Glentham Life Sciences, gegründet im Jahr 2013, ist ein führender Anbieter und Hersteller von Feinchemikalien, Rohstoffen, Reagenzien und biowissenschaftlichen Produkten.
ELZ vertreibt die Produktrange der Feinchemikalien von Glentham.
Glentham Life Sciences, gegründet im Jahr 2013, ist ein führender Anbieter und Hersteller von Feinchemikalien, Rohstoffen, Reagenzien und biowissenschaftlichen Produkten.
ELZ vertreibt die Produktrange der Feinchemikalien von Glentham.
| Artikelnummer | Name | CAS-Nummer | Packungsgröße |
|---|---|---|---|
| GL3628-1mg | (-)-Ageloxime D | 1219817-25-0 | 1mg |
| GL0766-100ml | (-)-alpha-Pinene | 7785-26-4 | 100ml |
| GL0766-500ml | (-)-alpha-Pinene | 7785-26-4 | 500ml |
| GL7074-1mg | (-)-Blebbistatin | 856925-71-8 | 1mg |
| GL7074-5mg | (-)-Blebbistatin | 856925-71-8 | 5mg |
| GL7074-10mg | (-)-Blebbistatin | 856925-71-8 | 10mg |
| GL9681-100g | (-)-Borneol, 97% | 464-45-9 | 100g |
| GL9681-500g | (-)-Borneol, 97% | 464-45-9 | 500g |
| GL9681-1kg | (-)-Borneol, 97% | 464-45-9 | 1kg |
| GK7856-5mg | (-)-Catechin | 18829-70-4 | 5mg |
| GK7856-25mg | (-)-Catechin | 18829-70-4 | 25mg |
| GK9244-5mg | (-)-Catechin gallate | 130405-40-2 | 5mg |
| GL3914-5mg | (-)-Gallocatechin gallate | 4233-96-9 | 5mg |
| GL3914-10mg | (-)-Gallocatechin gallate | 4233-96-9 | 10mg |
| GK8768-25mg | (-)-Huperzine A | 102518-79-6 | 25mg |
| GL4102-300ug | (-)-Indolactam V | 90365-57-4 | 300ug |
| GL4102-1mg | (-)-Indolactam V | 90365-57-4 | 1mg |
| GK0009-10g | (-)-Menthone | 14073-97-3 | 10g |
| GW4756-1mg | (-)-Mitorubrinic acid | 58958-07-9 | 1mg |
| GL6791-25ml | (-)-Nicotine hemisulfate salt, 40% aqueous solution | 65-30-5 | 25ml |
| GL6791-100ml | (-)-Nicotine hemisulfate salt, 40% aqueous solution | 65-30-5 | 100ml |
| GL6791-250ml | (-)-Nicotine hemisulfate salt, 40% aqueous solution | 65-30-5 | 250ml |
| GL6791-500ml | (-)-Nicotine hemisulfate salt, 40% aqueous solution | 65-30-5 | 500ml |
| GL6791-1l | (-)-Nicotine hemisulfate salt, 40% aqueous solution | 65-30-5 | 1l |
| GL9693-1g | (-)-Nicotine hydrogen tartrate salt | 65-31-6 | 1g |
| GL9693-5g | (-)-Nicotine hydrogen tartrate salt | 65-31-6 | 5g |
| GK5476-5g | (-)-Perillyl alcohol | 18457-55-1 | 5g |
| GK5476-25g | (-)-Perillyl alcohol | 18457-55-1 | 25g |
| GK5476-50g | (-)-Perillyl alcohol | 18457-55-1 | 50g |
| GL8537-1g | (-)-Scopolamine hydrobromide trihydrate | 6533-68-2 | 1g |
| GL8537-5g | (-)-Scopolamine hydrobromide trihydrate | 6533-68-2 | 5g |
| GL8537-10g | (-)-Scopolamine hydrobromide trihydrate | 6533-68-2 | 10g |
| GL8537-25g | (-)-Scopolamine hydrobromide trihydrate | 6533-68-2 | 25g |
| GK4380-25g | (-)-Terpinen-4-ol | 20126-76-5 | 25g |
| GL4922-100ml | (-)-trans-Caryophyllene | 87-44-5 | 100ml |
| GW9400-500ug | (-)-Viriditoxin | 1381782-08-6 | 500ug |
| GW9906-5g | (+)-(8,8-Dichlorocamphorylsulfonyl) oxaziridine | 127184-05-8 | 5g |
| GW9906-25g | (+)-(8,8-Dichlorocamphorylsulfonyl) oxaziridine | 127184-05-8 | 25g |
| GA3662-5mg | (+)-Abscisic acid | 21293-29-8 | 5mg |
| GA3662-25mg | (+)-Abscisic acid | 21293-29-8 | 25mg |
| GA3662-100mg | (+)-Abscisic acid | 21293-29-8 | 100mg |
| GL2550-100ml | (+)-alpha-Pinene | 7785-70-8 | 100ml |
| GL2550-500ml | (+)-alpha-Pinene | 7785-70-8 | 500ml |
| GL1672-25g | (+)-alpha-Tocopherol acetate | 58-95-7 | 25g |
| GL1672-100g | (+)-alpha-Tocopherol acetate | 58-95-7 | 100g |
| GE0805-25mg | (+)-Bicuculline | 485-49-4 | 25mg |
| GE0805-500mg | (+)-Bicuculline | 485-49-4 | 500mg |
| GE0805-5g | (+)-Bicuculline | 485-49-4 | 5g |
| GV8230-100mg | (+)-Biotin N-hydroxysuccinimide ester | 35013-72-0 | 100mg |
| GV8230-250mg | (+)-Biotin N-hydroxysuccinimide ester | 35013-72-0 | 250mg |
| GW3852-100mg | (+)-Biotin-PFP-ester | 120550-35-8 | 100mg |
| GW3852-250mg | (+)-Biotin-PFP-ester | 120550-35-8 | 250mg |
| GL5584-100mg | (+)-Borneol | 464-43-7 | 100mg |
| GK0455-10mg | (+)-Catechin | 154-23-4 | 10mg |
| GL6828-1g | (+)-Catechin hydrate | 225937-10-0 | 1g |
| GL6828-5g | (+)-Catechin hydrate | 225937-10-0 | 5g |
| GL6828-10g | (+)-Catechin hydrate | 225937-10-0 | 10g |
| GK6736-100mg | (+)-Dehydroabietic acid | 1231-75-0 | 100mg |
| GK6736-250mg | (+)-Dehydroabietic acid | 1231-75-0 | 250mg |
| GK6736-1g | (+)-Dehydroabietic acid | 1231-75-0 | 1g |
| GP8869-1g | (+)-Epinephrine (+)-bitartrate salt | 51-42-3 | 1g |
| GP8869-5g | (+)-Epinephrine (+)-bitartrate salt | 51-42-3 | 5g |
| GP8869-25g | (+)-Epinephrine (+)-bitartrate salt | 51-42-3 | 25g |
| GL0593-5mg | (+)-Etomoxir sodium salt hydrate | 828934-41-4 | 5mg |
| GL0593-25mg | (+)-Etomoxir sodium salt hydrate | 828934-41-4 | 25mg |
| GL0765-1mg | (+)-Flavipucine | 72597-14-9 | 1mg |
| GK1846-25mg | (+)-Isomenthol | 23283-97-8 | 25mg |
| GK1846-100mg | (+)-Isomenthol | 23283-97-8 | 100mg |
| GW0962-1mg | (+)-JQ1 | 1268524-70-4 | 1mg |
| GW0962-5mg | (+)-JQ1 | 1268524-70-4 | 5mg |
| GW0962-10mg | (+)-JQ1 | 1268524-70-4 | 10mg |
| GV8858-25g | (+)-Magnesium L-ascorbate | 15431-40-0 | 25g |
| GV8858-100g | (+)-Magnesium L-ascorbate | 15431-40-0 | 100g |
| GW3266-1mg | (+)-Rubiginone B2 | 130548-10-6 | 1mg |
| GW0417-100mg | (+)-Spartein Surrogate | 475301-86-1 | 100mg |
| GL7349-5g | (+)-Usnic acid | 7562-61-0 | 5g |
| GL7349-25g | (+)-Usnic acid | 7562-61-0 | 25g |
| GL7349-100g | (+)-Usnic acid | 7562-61-0 | 100g |
| GW6270-1mg | (+/-)-C75 | 191282-48-1 | 1mg |
| GW6270-5mg | (+/-)-C75 | 191282-48-1 | 5mg |
| GP0916-5mg | (+/-)-Cloprostenol sodium salt hydrate | 55028-72-3 | 5mg |
| GE9509-100mg | (+/-)-Jasmonic acid | 77026-92-7 | 100mg |
| GE9509-250mg | (+/-)-Jasmonic acid | 77026-92-7 | 250mg |
| GW8355-10mg | (+/-)-Lisofylline | 6493-06-7 | 10mg |
| GW8355-50mg | (+/-)-Lisofylline | 6493-06-7 | 50mg |
| GW5906-1g | (+/-)-Potassium citramalate monohydrate | 1030365-02-6 | 1g |
| GW5906-5g | (+/-)-Potassium citramalate monohydrate | 1030365-02-6 | 5g |
| GW5906-25g | (+/-)-Potassium citramalate monohydrate | 1030365-02-6 | 25g |
| GW1880-20mg | (+/-)-Sodium 2,3-dihydroxyisovalerate hydrate | 74294-97-6 | 20mg |
| GW1880-100mg | (+/-)-Sodium 2,3-dihydroxyisovalerate hydrate | 74294-97-6 | 100mg |
| GP3540-25mg | (+/-)-Taxifolin hydrate | 24198-97-8 | 25mg |
| GP3540-100mg | (+/-)-Taxifolin hydrate | 24198-97-8 | 100mg |
| GP3540-500mg | (+/-)-Taxifolin hydrate | 24198-97-8 | 500mg |
| GK1082-10mg | (±)-Dihydrokaempferol | 104486-98-8 | 10mg |
| GK1082-50mg | (±)-Dihydrokaempferol | 104486-98-8 | 50mg |
| GW6264-5g | (−)-(8,8-Dichlorocamphorylsulfonyl) oxaziridine | 139628-16-3 | 5g |
| GW6264-25g | (−)-(8,8-Dichlorocamphorylsulfonyl) oxaziridine | 139628-16-3 | 25g |
| GD0341-25g | (1-Hexadecyl)trimethylammonium bromide | 57-09-0 | 25g |
| GD0341-100g | (1-Hexadecyl)trimethylammonium bromide | 57-09-0 | 100g |
| GD0341-250g | (1-Hexadecyl)trimethylammonium bromide | 57-09-0 | 250g |
| GD0341-500g | (1-Hexadecyl)trimethylammonium bromide | 57-09-0 | 500g |
| GD0341-1kg | (1-Hexadecyl)trimethylammonium bromide | 57-09-0 | 1kg |
| GC4950-500mg | (1E)-2-Acetamido-3,4,6-tri-O-benzoyl-2-deoxy-D-glucose 1-oxime | 500mg | |
| GC4950-1g | (1E)-2-Acetamido-3,4,6-tri-O-benzoyl-2-deoxy-D-glucose 1-oxime | 1g | |
| GC4950-2g | (1E)-2-Acetamido-3,4,6-tri-O-benzoyl-2-deoxy-D-glucose 1-oxime | 2g | |
| GC4950-5g | (1E)-2-Acetamido-3,4,6-tri-O-benzoyl-2-deoxy-D-glucose 1-oxime | 5g | |
| GK6757-10g | (1R,2R)-(-)-2-Amino-1-nitrophenyl)-1,3-propanediol | 716-61-0 | 10g |
| GK6757-25g | (1R,2R)-(-)-2-Amino-1-nitrophenyl)-1,3-propanediol | 716-61-0 | 25g |
| GK6738-25g | (1R)-(-)-Camphor-10-sulfonic acid | 35963-20-3 | 25g |
| GK6738-100g | (1R)-(-)-Camphor-10-sulfonic acid | 35963-20-3 | 100g |
| GW5467-250mg | (1S)-(+)-3-Bromocamphor-10-sulfonic acid hydrate | 206860-46-0 | 250mg |
| GW5467-1g | (1S)-(+)-3-Bromocamphor-10-sulfonic acid hydrate | 206860-46-0 | 1g |
| GK7715-5g | (1S)-(+)-Camphor-10-sulfonic acid | 3144-16-9 | 5g |
| GK7715-25g | (1S)-(+)-Camphor-10-sulfonic acid | 3144-16-9 | 25g |
| GK4925-25g | (2-Bromoethyl)trimethylammonium bromide | 2758-06-7 | 25g |
| GX9244-5g | (2-Hydroxypropyl)-gamma-cyclodextrin | 128446-34-4 | 5g |
| GX9244-25g | (2-Hydroxypropyl)-gamma-cyclodextrin | 128446-34-4 | 25g |
| GV6226-1mg | (24R)-24,25-Dihydroxyvitamin D3 | 55721-11-4 | 1mg |
| GC5130-1mg | (2R)-2,3-Dihydroxypropyl-b-D-galactopyranoside | 16232-91-0 | 1mg |
| GC5130-5mg | (2R)-2,3-Dihydroxypropyl-b-D-galactopyranoside | 16232-91-0 | 5mg |
| GC5130-10mg | (2R)-2,3-Dihydroxypropyl-b-D-galactopyranoside | 16232-91-0 | 10mg |
| GC5130-25mg | (2R)-2,3-Dihydroxypropyl-b-D-galactopyranoside | 16232-91-0 | 25mg |
| GC5130-50mg | (2R)-2,3-Dihydroxypropyl-b-D-galactopyranoside | 16232-91-0 | 50mg |
| GC2774-100mg | (2R)-2,3-O-Isopropylidene-D-glyceric acid benzyl ester | 55032-17-2 | 100mg |
| GC2774-250mg | (2R)-2,3-O-Isopropylidene-D-glyceric acid benzyl ester | 55032-17-2 | 250mg |
| GC2774-500mg | (2R)-2,3-O-Isopropylidene-D-glyceric acid benzyl ester | 55032-17-2 | 500mg |
| GC2774-1g | (2R)-2,3-O-Isopropylidene-D-glyceric acid benzyl ester | 55032-17-2 | 1g |
| GW5424-10mg | (2R)-3-(1-Naphthalenyloxy)-1,2-propanediol | 61248-78-0 | 10mg |
| GW5424-25mg | (2R)-3-(1-Naphthalenyloxy)-1,2-propanediol | 61248-78-0 | 25mg |
| GL6358-1mg | (3S,6R)-Lateritin | 172721-98-1 | 1mg |
| GC4542-50mg | (4S)-2,2-Dimethyl-1,3-dioxane-4-methanol | 85287-64-5 | 50mg |
| GC4542-100mg | (4S)-2,2-Dimethyl-1,3-dioxane-4-methanol | 85287-64-5 | 100mg |
| GC4542-250mg | (4S)-2,2-Dimethyl-1,3-dioxane-4-methanol | 85287-64-5 | 250mg |
| GC4542-500mg | (4S)-2,2-Dimethyl-1,3-dioxane-4-methanol | 85287-64-5 | 500mg |
| GK9183-1g | (9,9-Dimethyl-9H-xanthene-4,5-diyl)bis(diphenylphosphine) | 161265-03-8 | 1g |
| GK9183-5g | (9,9-Dimethyl-9H-xanthene-4,5-diyl)bis(diphenylphosphine) | 161265-03-8 | 5g |
| GK9183-10g | (9,9-Dimethyl-9H-xanthene-4,5-diyl)bis(diphenylphosphine) | 161265-03-8 | 10g |
| GK9183-25g | (9,9-Dimethyl-9H-xanthene-4,5-diyl)bis(diphenylphosphine) | 161265-03-8 | 25g |
| GM1444-5g | (Boc-Cys-OH)2 | 10389-65-8 | 5g |
| GM1444-25g | (Boc-Cys-OH)2 | 10389-65-8 | 25g |
| GW1934-1g | (Difluoromethyl)trimethylsilane | 65864-64-4 | 1g |
| GW1934-2g | (Difluoromethyl)trimethylsilane | 65864-64-4 | 2g |
| GW1934-10g | (Difluoromethyl)trimethylsilane | 65864-64-4 | 10g |
| GW0272-500mg | (E)-8-Methyl-6-nonenoic acid | 59320-77-3 | 500mg |
| GW0272-1g | (E)-8-Methyl-6-nonenoic acid | 59320-77-3 | 1g |
| GW0815-1g | (R,R)-(+)-1,4-Dimethoxy-2,3-butanediol | 33507-82-3 | 1g |
| GW0815-5g | (R,R)-(+)-1,4-Dimethoxy-2,3-butanediol | 33507-82-3 | 5g |
| GC2211-1mg | (R,S)-Alvimopan O-β-D-glucuronide | 1mg | |
| GC2211-2mg | (R,S)-Alvimopan O-β-D-glucuronide | 2mg | |
| GC2211-5mg | (R,S)-Alvimopan O-β-D-glucuronide | 5mg | |
| GC3482-1mg | (R,S)-Ambrisentan acyl-β-D-glucuronide | 1106685-82-8 | 1mg |
| GC3482-2mg | (R,S)-Ambrisentan acyl-β-D-glucuronide | 1106685-82-8 | 2mg |
| GC3482-5mg | (R,S)-Ambrisentan acyl-β-D-glucuronide | 1106685-82-8 | 5mg |
| GC3482-10mg | (R,S)-Ambrisentan acyl-β-D-glucuronide | 1106685-82-8 | 10mg |
| GC4548-1mg | (R,S)-Carvedilol O-β-D-glucuronide | 114869-83-9 | 1mg |
| GC4548-2mg | (R,S)-Carvedilol O-β-D-glucuronide | 114869-83-9 | 2mg |
| GC4548-5mg | (R,S)-Carvedilol O-β-D-glucuronide | 114869-83-9 | 5mg |
| GC4548-10mg | (R,S)-Carvedilol O-β-D-glucuronide | 114869-83-9 | 10mg |
| GP9597-1g | (R,S)-Equol | 94105-90-5 | 1g |
| GC2517-1mg | (R,S)-Flurbiprofen acyl-β-D-glucuronide | 91683-37-3 | 1mg |
| GC2517-2mg | (R,S)-Flurbiprofen acyl-β-D-glucuronide | 91683-37-3 | 2mg |
| GC2517-5mg | (R,S)-Flurbiprofen acyl-β-D-glucuronide | 91683-37-3 | 5mg |
| GC2517-10mg | (R,S)-Flurbiprofen acyl-β-D-glucuronide | 91683-37-3 | 10mg |
| GC0405-1mg | (R,S)-Flurbiprofen-d8 | 1mg | |
| GC0405-2mg | (R,S)-Flurbiprofen-d8 | 2mg | |
| GC0405-5mg | (R,S)-Flurbiprofen-d8 | 5mg | |
| GC0405-10mg | (R,S)-Flurbiprofen-d8 | 10mg | |
| GC7744-1mg | (R,S)-Flurbiprofen-d8 acyl-β-D-glucuronide | 1mg | |
| GC7744-2mg | (R,S)-Flurbiprofen-d8 acyl-β-D-glucuronide | 2mg | |
| GC7744-5mg | (R,S)-Flurbiprofen-d8 acyl-β-D-glucuronide | 5mg | |
| GC3123-1mg | (R,S)-Ibuprofen-d4 acyl-β-D-glucuronide | 1mg | |
| GC3123-2mg | (R,S)-Ibuprofen-d4 acyl-β-D-glucuronide | 2mg | |
| GC3123-5mg | (R,S)-Ibuprofen-d4 acyl-β-D-glucuronide | 5mg | |
| GC8251-1mg | (R,S)-Methocarbamol O-β-D-glucuronide | 56305-74-9 | 1mg |
| GC8251-2mg | (R,S)-Methocarbamol O-β-D-glucuronide | 56305-74-9 | 2mg |
| GC8251-5mg | (R,S)-Methocarbamol O-β-D-glucuronide | 56305-74-9 | 5mg |
| GC8251-10mg | (R,S)-Methocarbamol O-β-D-glucuronide | 56305-74-9 | 10mg |
| GC5125-1mg | (R,S)-Naproxen acyl-β-D-glucuronide | 120143-21-7 | 1mg |
| GC5125-2mg | (R,S)-Naproxen acyl-β-D-glucuronide | 120143-21-7 | 2mg |
| GC5125-5mg | (R,S)-Naproxen acyl-β-D-glucuronide | 120143-21-7 | 5mg |
| GC5125-10mg | (R,S)-Naproxen acyl-β-D-glucuronide | 120143-21-7 | 10mg |
| GC3234-1mg | (R,S)-Naproxen-1,3,4,5,7,8-d6 | 958293-99-7 | 1mg |
| GC3234-2mg | (R,S)-Naproxen-1,3,4,5,7,8-d6 | 958293-99-7 | 2mg |
| GC3234-5mg | (R,S)-Naproxen-1,3,4,5,7,8-d6 | 958293-99-7 | 5mg |
| GC2700-1mg | (R,S)-Norfluoxetine N-β-D-glucuronide | 96735-72-7 | 1mg |
| GC2700-2mg | (R,S)-Norfluoxetine N-β-D-glucuronide | 96735-72-7 | 2mg |
| GC2700-5mg | (R,S)-Norfluoxetine N-β-D-glucuronide | 96735-72-7 | 5mg |
| GC2700-10mg | (R,S)-Norfluoxetine N-β-D-glucuronide | 96735-72-7 | 10mg |
| GC0368-1mg | (R,S)-Ramipril acyl-β-D-glucuronide | 1357570-21-8 | 1mg |
| GC0368-2mg | (R,S)-Ramipril acyl-β-D-glucuronide | 1357570-21-8 | 2mg |
| GC0368-5mg | (R,S)-Ramipril acyl-β-D-glucuronide | 1357570-21-8 | 5mg |
| GC0368-10mg | (R,S)-Ramipril acyl-β-D-glucuronide | 1357570-21-8 | 10mg |
| GK3923-1g | (R)-(-)-1,1''-Binaphthyl-2,2''-diyl hydrogenphosphate | 39648-67-4 | 1g |
| GK3923-5g | (R)-(-)-1,1''-Binaphthyl-2,2''-diyl hydrogenphosphate | 39648-67-4 | 5g |
| GP4315-50mg | (R)-(-)-2-Fluoro-alpha-methyl-4-biphenylacetic acid | 51543-40-9 | 50mg |
| GL3381-5g | (R)-(-)-Carvone | 6485-40-1 | 5g |
| GK4856-1g | (R)-(-)-Methyl 3-hydroxybutyrate | 3976-69-0 | 1g |
| GK4856-5g | (R)-(-)-Methyl 3-hydroxybutyrate | 3976-69-0 | 5g |
| GL9617-1g | (R)-(-)-Phenylephrine hydrochloride | 61-76-7 | 1g |
| GL9617-5g | (R)-(-)-Phenylephrine hydrochloride | 61-76-7 | 5g |
| GL9617-25g | (R)-(-)-Phenylephrine hydrochloride | 61-76-7 | 25g |
| GK0559-1g | (R)-(+)-1,1''-Bi-2-naphthol | 18531-94-7 | 1g |
| GK0559-5g | (R)-(+)-1,1''-Bi-2-naphthol | 18531-94-7 | 5g |
| GW9630-1g | (R)-(+)-2-Phenyl-1-propanol | 19141-40-3 | 1g |
| GK0418-5g | (R)-(+)-alpha-Lipoic acid | 1200-22-2 | 5g |
| GK0418-10g | (R)-(+)-alpha-Lipoic acid | 1200-22-2 | 10g |
| GK0418-25g | (R)-(+)-alpha-Lipoic acid | 1200-22-2 | 25g |
| GL0622-5g | (R)-(+)-Pulegone | 89-82-7 | 5g |
| GK7020-25mg | (R)-3-Hydroxybutyric acid | 625-72-9 | 25mg |
| GK7020-100mg | (R)-3-Hydroxybutyric acid | 625-72-9 | 100mg |
| GW3338-250mg | (R)-3-Hydroxymyristic acid | 28715-21-1 | 250mg |
| GW3338-1g | (R)-3-Hydroxymyristic acid | 28715-21-1 | 1g |
| GW0676-1mg | (R)-BI-2536 | 755038-02-9 | 1mg |
| GW0676-5mg | (R)-BI-2536 | 755038-02-9 | 5mg |
| GW0676-10mg | (R)-BI-2536 | 755038-02-9 | 10mg |
| GL2908-1mg | (R)-CR8 | 294646-77-8 | 1mg |
| GL2908-5mg | (R)-CR8 | 294646-77-8 | 5mg |
| GL4415-100ug | (R)-FSL-1 | 100ug | |
| GL2018-1mg | (R)-Perharidine 1 | 1133437-80-5 | 1mg |
| GL2018-5mg | (R)-Perharidine 1 | 1133437-80-5 | 5mg |
| GL2018-25mg | (R)-Perharidine 1 | 1133437-80-5 | 25mg |
| GM2918-25mg | (R)-Propionyl carnitine chloride | 119793-66-7 | 25mg |
| GM2918-100mg | (R)-Propionyl carnitine chloride | 119793-66-7 | 100mg |
| GM2918-500mg | (R)-Propionyl carnitine chloride | 119793-66-7 | 500mg |
| GC5485-1mg | (R)-Propranolol O-β-D-glucuronide | 58657-79-7 | 1mg |
| GC5485-2mg | (R)-Propranolol O-β-D-glucuronide | 58657-79-7 | 2mg |
| GC5485-5mg | (R)-Propranolol O-β-D-glucuronide | 58657-79-7 | 5mg |
| GC5485-10mg | (R)-Propranolol O-β-D-glucuronide | 58657-79-7 | 10mg |
| GA0013-500ug | (R)-Semivioxanthin | 70477-26-8 | 500ug |
| GA0013-1mg | (R)-Semivioxanthin | 70477-26-8 | 1mg |
| GL1233-500ug | (R)-Semixanthomegnin | 500ug | |
| GL1233-1mg | (R)-Semixanthomegnin | 1mg | |
| GC3952-1mg | (rac)-N-Desmethyl-Ecopipam O-β-D-glucuronide | 1mg | |
| GC3952-2mg | (rac)-N-Desmethyl-Ecopipam O-β-D-glucuronide | 2mg | |
| GC3952-5mg | (rac)-N-Desmethyl-Ecopipam O-β-D-glucuronide | 5mg | |
| GC3952-10mg | (rac)-N-Desmethyl-Ecopipam O-β-D-glucuronide | 10mg | |
| GC3887-1mg | (rac)-N-Desmethyl-Ecopipam-d6 O-β-D-glucuronide | 1mg | |
| GC3887-2mg | (rac)-N-Desmethyl-Ecopipam-d6 O-β-D-glucuronide | 2mg | |
| GW0124-1g | (RS)-1-Methyl-2-propynyl-p-toluenesulfonate | 53487-52-8 | 1g |
| GW0124-5g | (RS)-1-Methyl-2-propynyl-p-toluenesulfonate | 53487-52-8 | 5g |
| GW6265-250mg | (S,S)-(-)-1,4-Dimethoxy-2,3-butanediol | 50622-10-1 | 250mg |
| GW6265-1g | (S,S)-(-)-1,4-Dimethoxy-2,3-butanediol | 50622-10-1 | 1g |
| GW6265-5g | (S,S)-(-)-1,4-Dimethoxy-2,3-butanediol | 50622-10-1 | 5g |
| GW0880-25g | (S,S)-Ethylenediamine-N,N''-disuccinic acid | 20846-91-7 | 25g |
| GW0880-100g | (S,S)-Ethylenediamine-N,N''-disuccinic acid | 20846-91-7 | 100g |
| GW0455-100ml | (S,S)-Ethylenediamine-N,N''-disuccinic acid trisodium salt solution | 178949-82-1 | 100ml |
| GM0237-1g | (S)-(-)-2-Amino-4-pentenoic acid | 16338-48-0 | 1g |
| GM0237-5g | (S)-(-)-2-Amino-4-pentenoic acid | 16338-48-0 | 5g |
| GL6848-250mg | (S)-(+)-1-Aminoindan | 61341-86-4 | 250mg |
| GL6848-5g | (S)-(+)-1-Aminoindan | 61341-86-4 | 5g |
| GL6848-25g | (S)-(+)-1-Aminoindan | 61341-86-4 | 25g |
| GM6081-10g | (S)-(+)-4-Nitrophenylalanine methyl ester hydrochloride | 17193-40-7 | 10g |
| GK1601-25g | (S)-(+)-4-Phenyl-2-oxazolidinone | 99395-88-7 | 25g |
| GK1601-100g | (S)-(+)-4-Phenyl-2-oxazolidinone | 99395-88-7 | 100g |
| GA6393-1mg | (S)-(+)-Ascochin | 935699-58-4 | 1mg |
| GA6393-5mg | (S)-(+)-Ascochin | 935699-58-4 | 5mg |
| GA9966-25mg | (S)-(+)-Camptothecin | 7689-03-4 | 25mg |
| GA9966-100mg | (S)-(+)-Camptothecin | 7689-03-4 | 100mg |
| GA9966-250mg | (S)-(+)-Camptothecin | 7689-03-4 | 250mg |
| GL7238-5g | (S)-(+)-Carvone | 2244-16-8 | 5g |
| GK4784-1g | (S)-(+)-Clopidogrel hydrogen sulfate | 120202-66-6 | 1g |
| GP9058-1g | (S)-(+)-Ibuprofen | 51146-56-6 | 1g |
| GP9058-5g | (S)-(+)-Ibuprofen | 51146-56-6 | 5g |
| GP6062-1g | (S)-(+)-Ketoprofen | 22161-81-5 | 1g |
| GP6062-5g | (S)-(+)-Ketoprofen | 22161-81-5 | 5g |
| GP6062-25g | (S)-(+)-Ketoprofen | 22161-81-5 | 25g |
| GK9869-25mg | (S)-3-Hydroxybutyric acid | 6168-83-8 | 25mg |
| GK9869-100mg | (S)-3-Hydroxybutyric acid | 6168-83-8 | 100mg |
| GM6729-250mg | (S)-5-Azido-2-(Fmoc-amino)pentanoic acid | 1097192-04-5 | 250mg |
| GW2431-100mg | (S)-alpha-Methoxy-2-naphthylacetic acid | 157134-51-5 | 100mg |
| GW2431-500mg | (S)-alpha-Methoxy-2-naphthylacetic acid | 157134-51-5 | 500mg |
| GL4189-1mg | (S)-CR8 | 1084893-56-0 | 1mg |
| GL4189-5mg | (S)-CR8 | 1084893-56-0 | 5mg |
| GL4189-10mg | (S)-CR8 | 1084893-56-0 | 10mg |
| GC3999-1mg | (S)-Flurbiprofen acyl-β-D-glucuronide | 162992-66-7 | 1mg |
| GC3999-2mg | (S)-Flurbiprofen acyl-β-D-glucuronide | 162992-66-7 | 2mg |
| GC3999-5mg | (S)-Flurbiprofen acyl-β-D-glucuronide | 162992-66-7 | 5mg |
| GC3999-10mg | (S)-Flurbiprofen acyl-β-D-glucuronide | 162992-66-7 | 10mg |
| GC3957-1mg | (S)-Naproxen acyl-b-D-glucuronide | 41945-43-1 | 1mg |
| GC3957-2mg | (S)-Naproxen acyl-b-D-glucuronide | 41945-43-1 | 2mg |
| GC3957-5mg | (S)-Naproxen acyl-b-D-glucuronide | 41945-43-1 | 5mg |
| GL9968-1mg | (S)-Perharidine 1 | 1133437-81-6 | 1mg |
| GL9968-5mg | (S)-Perharidine 1 | 1133437-81-6 | 5mg |
| GL9968-25mg | (S)-Perharidine 1 | 1133437-81-6 | 25mg |
| GC7121-1mg | (S)-Propranolol O-β-D-glucuronide | 58657-78-6 | 1mg |
| GC7121-2mg | (S)-Propranolol O-β-D-glucuronide | 58657-78-6 | 2mg |
| GC7121-5mg | (S)-Propranolol O-β-D-glucuronide | 58657-78-6 | 5mg |
| GC7121-10mg | (S)-Propranolol O-β-D-glucuronide | 58657-78-6 | 10mg |
| GL1360-5mg | (S)-Roscovitine | 186692-45-5 | 5mg |
| GL1360-25mg | (S)-Roscovitine | 186692-45-5 | 25mg |
| GL0840-5mg | [10]-Gingerol | 23513-15-7 | 5mg |
| GP8612-20mg | [6]-Gingerol | 23513-14-6 | 20mg |
| GL9488-5mg | [8]-Gingerol | 23513-08-8 | 5mg |
| GK3718-1mg | [D-Ala2, N-Me-Phe4, Gly5-ol]-Enkephalin acetate salt | 100929-53-1 | 1mg |
| GK3718-5mg | [D-Ala2, N-Me-Phe4, Gly5-ol]-Enkephalin acetate salt | 100929-53-1 | 5mg |
| GW2513-10mg | [Ru(bpy)2(5-chloroacetamido-1,10-phenanthroline)](PF6)2 | 204273-42-7 | 10mg |
| GW2513-100mg | [Ru(bpy)2(5-chloroacetamido-1,10-phenanthroline)](PF6)2 | 204273-42-7 | 100mg |
| GW1890-10mg | [Ru(bpy)2(5-iodoacetamido-1,10-phenanthroline)](PF6)2 | 204273-39-2 | 10mg |
| GW1890-100mg | [Ru(bpy)2(5-iodoacetamido-1,10-phenanthroline)](PF6)2 | 204273-39-2 | 100mg |
| GW5936-5mg | 1-(2-Isothiocyanatoethyl)-4-[2-(3,4-dihydro-2H-1-benzopyranyl-6-yl)-5-oxazolyl]pyridinium bromide | 155863-02-8 | 5mg |
| GW5936-50mg | 1-(2-Isothiocyanatoethyl)-4-[2-(3,4-dihydro-2H-1-benzopyranyl-6-yl)-5-oxazolyl]pyridinium bromide | 155863-02-8 | 50mg |
| GW5936-250mg | 1-(2-Isothiocyanatoethyl)-4-[2-(3,4-dihydro-2H-1-benzopyranyl-6-yl)-5-oxazolyl]pyridinium bromide | 155863-02-8 | 250mg |
| GW2652-25mg | 1-(2-Isothiocyanatoethyl)-4-[5-(4-methoxyphenyl)-2-oxazolyl]pyridinium bromide | 155862-91-2 | 25mg |
| GW2652-50mg | 1-(2-Isothiocyanatoethyl)-4-[5-(4-methoxyphenyl)-2-oxazolyl]pyridinium bromide | 155862-91-2 | 50mg |
| GW2652-250mg | 1-(2-Isothiocyanatoethyl)-4-[5-(4-methoxyphenyl)-2-oxazolyl]pyridinium bromide | 155862-91-2 | 250mg |
| GT6232-1g | 1-(2-Pyridylazo)-2-naphthol | 85-85-8 | 1g |
| GT6232-5g | 1-(2-Pyridylazo)-2-naphthol | 85-85-8 | 5g |
| GT6232-10g | 1-(2-Pyridylazo)-2-naphthol | 85-85-8 | 10g |
| GT6232-25g | 1-(2-Pyridylazo)-2-naphthol | 85-85-8 | 25g |
| GC4876-100mg | 1-(2,2,2-Trifluoro-N-phenylethanimidate)-D-glucopyranuronic acid methyl ester 2,3,4-triacetate | 869996-05-4 | 100mg |
| GC4876-250mg | 1-(2,2,2-Trifluoro-N-phenylethanimidate)-D-glucopyranuronic acid methyl ester 2,3,4-triacetate | 869996-05-4 | 250mg |
| GC4876-500mg | 1-(2,2,2-Trifluoro-N-phenylethanimidate)-D-glucopyranuronic acid methyl ester 2,3,4-triacetate | 869996-05-4 | 500mg |
| GC4876-1g | 1-(2,2,2-Trifluoro-N-phenylethanimidate)-D-glucopyranuronic acid methyl ester 2,3,4-triacetate | 869996-05-4 | 1g |
| GW9017-1g | 1-(2,5-Dichloro-3,6-dimethylphenyl ethanone | 164165-77-9 | 1g |
| GW9017-5g | 1-(2,5-Dichloro-3,6-dimethylphenyl ethanone | 164165-77-9 | 5g |
| GW0830-25mg | 1-(3-Isothiocyanatobenzyl)-4-[2-(3,4-dihydro-2H-1-benzopyran-6-yl)-5-oxazolyl] pyridinium bromide | 155863-01-7 | 25mg |
| GW0830-50mg | 1-(3-Isothiocyanatobenzyl)-4-[2-(3,4-dihydro-2H-1-benzopyran-6-yl)-5-oxazolyl] pyridinium bromide | 155863-01-7 | 50mg |
| GW0830-250mg | 1-(3-Isothiocyanatobenzyl)-4-[2-(3,4-dihydro-2H-1-benzopyran-6-yl)-5-oxazolyl] pyridinium bromide | 155863-01-7 | 250mg |
| GW4246-10mg | 1-(3''-Carboxypropyl)-3,7-dimethylxanthine | 6493-07-8 | 10mg |
| GW4246-50mg | 1-(3''-Carboxypropyl)-3,7-dimethylxanthine | 6493-07-8 | 50mg |
| GW3012-50mg | 1-(4-Dimethylamino-phenyl)-2-phenanthridin-6-yl-ethanone | 938155-11-4 | 50mg |
| GW3012-250mg | 1-(4-Dimethylamino-phenyl)-2-phenanthridin-6-yl-ethanone | 938155-11-4 | 250mg |
| GE9805-1g | 1-(4-Nitrophenyl)glycerol | 2207-68-3 | 1g |
| GW9713-10mg | 1-(4''-Carboxybutyl)-3,7-dimethylxanthine | 38975-44-9 | 10mg |
| GW9713-25mg | 1-(4''-Carboxybutyl)-3,7-dimethylxanthine | 38975-44-9 | 25mg |
| GX8752-10g | 1-(cis-3-Chloroallyl)-3,5,7-triaza-1-azoniaadamantane chloride | 51229-78-8 | 10g |
| GK3194-200mg | 1-(Ethoxycarbonylmethyl)-6-methoxyquinolinium bromide | 162558-52-3 | 200mg |
| GK3194-1g | 1-(Ethoxycarbonylmethyl)-6-methoxyquinolinium bromide | 162558-52-3 | 1g |
| GW2166-25mg | 1-[2-(4-Isothiocyanatophenoxy)ethyl]-4-[5-(4-methoxyphenyl)-2-oxazolyl] pyridinium tosylate | 155862-93-4 | 25mg |
| GW2166-50mg | 1-[2-(4-Isothiocyanatophenoxy)ethyl]-4-[5-(4-methoxyphenyl)-2-oxazolyl] pyridinium tosylate | 155862-93-4 | 50mg |
| GW2166-250mg | 1-[2-(4-Isothiocyanatophenoxy)ethyl]-4-[5-(4-methoxyphenyl)-2-oxazolyl] pyridinium tosylate | 155862-93-4 | 250mg |
| GW1502-20mg | 1-[2-(6-Methoxy-3-oxo-3H-xanthen-9-yl)-benzoyl]-piperidine-4-carboxylic acid | 442151-56-6 | 20mg |
| GW1502-125mg | 1-[2-(6-Methoxy-3-oxo-3H-xanthen-9-yl)-benzoyl]-piperidine-4-carboxylic acid | 442151-56-6 | 125mg |
| GW9698-5mg | 1-[2-(Maleimido)ethyl]-4-[5-(4-methoxyphenyl)-2-oxazolyl] pyridinium triflate | 155862-98-9 | 5mg |
| GW9698-50mg | 1-[2-(Maleimido)ethyl]-4-[5-(4-methoxyphenyl)-2-oxazolyl] pyridinium triflate | 155862-98-9 | 50mg |
| GW9698-250mg | 1-[2-(Maleimido)ethyl]-4-[5-(4-methoxyphenyl)-2-oxazolyl] pyridinium triflate | 155862-98-9 | 250mg |
| GK6663-25g | 1-Acetyl-2-phenylhydrazine | 114-83-0 | 25g |
| GK6663-100g | 1-Acetyl-2-phenylhydrazine | 114-83-0 | 100g |
| GK6663-250g | 1-Acetyl-2-phenylhydrazine | 114-83-0 | 250g |
| GC2506-1mg | 1-Amino-1-deoxy-scyllo-inositol | 16051-25-5 | 1mg |
| GC2506-2mg | 1-Amino-1-deoxy-scyllo-inositol | 16051-25-5 | 2mg |
| GC2506-5mg | 1-Amino-1-deoxy-scyllo-inositol | 16051-25-5 | 5mg |
| GC2506-10mg | 1-Amino-1-deoxy-scyllo-inositol | 16051-25-5 | 10mg |
| GC2506-25mg | 1-Amino-1-deoxy-scyllo-inositol | 16051-25-5 | 25mg |
| GC3462-1mg | 1-Amino-1-deoxy-scyllo-inositol hydrochloride | 4933-84-0 | 1mg |
| GC3462-2mg | 1-Amino-1-deoxy-scyllo-inositol hydrochloride | 4933-84-0 | 2mg |
| GC3462-5mg | 1-Amino-1-deoxy-scyllo-inositol hydrochloride | 4933-84-0 | 5mg |
| GC3462-10mg | 1-Amino-1-deoxy-scyllo-inositol hydrochloride | 4933-84-0 | 10mg |
| GC3462-25mg | 1-Amino-1-deoxy-scyllo-inositol hydrochloride | 4933-84-0 | 25mg |
| GC3995-2mg | 1-Amino-1,2-dideoxy-scyllo-inositol | 75419-36-2 | 2mg |
| GC3995-5mg | 1-Amino-1,2-dideoxy-scyllo-inositol | 75419-36-2 | 5mg |
| GC3995-10mg | 1-Amino-1,2-dideoxy-scyllo-inositol | 75419-36-2 | 10mg |
| GC3995-25mg | 1-Amino-1,2-dideoxy-scyllo-inositol | 75419-36-2 | 25mg |
| GM9665-100mg | 1-Aminocyclopropanecarboxylic acid | 22059-21-8 | 100mg |
| GM9665-250mg | 1-Aminocyclopropanecarboxylic acid | 22059-21-8 | 250mg |
| GM9665-1g | 1-Aminocyclopropanecarboxylic acid | 22059-21-8 | 1g |
| GL5815-1mg | 1-Azakenpaullone | 676596-65-9 | 1mg |
| GL5815-5mg | 1-Azakenpaullone | 676596-65-9 | 5mg |
| GC9520-100mg | 1-Azido-1-deoxy-b-D-lactopyranoside | 69266-16-6 | 100mg |
| GC9520-250mg | 1-Azido-1-deoxy-b-D-lactopyranoside | 69266-16-6 | 250mg |
| GC9520-500mg | 1-Azido-1-deoxy-b-D-lactopyranoside | 69266-16-6 | 500mg |
| GC9520-1g | 1-Azido-1-deoxy-b-D-lactopyranoside | 69266-16-6 | 1g |
| GX4295-100g | 1-Benzyl-2-methylimidazole | 13750-62-4 | 100g |
| GX4295-250g | 1-Benzyl-2-methylimidazole | 13750-62-4 | 250g |
| GK0901-5g | 1-Benzylimidazole | 4238-71-5 | 5g |
| GK0901-25g | 1-Benzylimidazole | 4238-71-5 | 25g |
| GX2173-5g | 1-Bromo-3-methylbutane | 107-82-4 | 5g |
| GK3043-25g | 1-Bromoadamantane | 768-90-1 | 25g |
| GW7570-50g | 1-Bromoundecane | 693-67-4 | 50g |
| GW7570-250g | 1-Bromoundecane | 693-67-4 | 250g |
| GK2430-25g | 1-Butanesulfonic acid sodium salt, HPLC grade | 2386-54-1 | 25g |
| GK2430-50g | 1-Butanesulfonic acid sodium salt, HPLC grade | 2386-54-1 | 50g |
| GK2430-100g | 1-Butanesulfonic acid sodium salt, HPLC grade | 2386-54-1 | 100g |
| GK8249-100ml | 1-Butanol | 71-36-3 | 100ml |
| GX8686-25g | 1-Butyl-3-methylimidazolium chloride | 79917-90-1 | 25g |
| GX8686-100g | 1-Butyl-3-methylimidazolium chloride | 79917-90-1 | 100g |
| GX4050-25g | 1-Butyl-3-methylimidazolium hexafluorophosphate | 174501-64-5 | 25g |
| GX4050-50g | 1-Butyl-3-methylimidazolium hexafluorophosphate | 174501-64-5 | 50g |
| GX4050-100g | 1-Butyl-3-methylimidazolium hexafluorophosphate | 174501-64-5 | 100g |
| GW9456-100mg | 1-Chloro-1,2-benziodoxol-3-one | 59457-26-0 | 100mg |
| GW9456-500mg | 1-Chloro-1,2-benziodoxol-3-one | 59457-26-0 | 500mg |
| GW0990-100mg | 1-Chloro-1,3-dihydro-3,3-dimethyl-1,2-benziodoxole | 69352-04-1 | 100mg |
| GW0990-500mg | 1-Chloro-1,3-dihydro-3,3-dimethyl-1,2-benziodoxole | 69352-04-1 | 500mg |
| GK8344-100ml | 1-Chlorobutane | 109-69-3 | 100ml |
| GS9086-100ml | 1-Chlorobutane, GlenDry™, anhydrous | 109-69-3 | 100ml |
| GS9086-500ml | 1-Chlorobutane, GlenDry™, anhydrous | 109-69-3 | 500ml |
| GS9086-1l | 1-Chlorobutane, GlenDry™, anhydrous | 109-69-3 | 1l |
| GS9086-2500ml | 1-Chlorobutane, GlenDry™, anhydrous | 109-69-3 | 2500ml |
| GS8301-500ml | 1-Chlorobutane, GlenPure™, analytical grade | 109-69-3 | 500ml |
| GS8301-1l | 1-Chlorobutane, GlenPure™, analytical grade | 109-69-3 | 1l |
| GS8301-2500ml | 1-Chlorobutane, GlenPure™, analytical grade | 109-69-3 | 2500ml |
| GL4378-25g | 1-Chloronaphthalene | 90-13-1 | 25g |
| GL4378-100g | 1-Chloronaphthalene | 90-13-1 | 100g |
| GW0069-100mg | 1-Cyano-4-dimethylaminopyridinium tetrafluoroborate | 59016-56-7 | 100mg |
| GW0069-500mg | 1-Cyano-4-dimethylaminopyridinium tetrafluoroborate | 59016-56-7 | 500mg |
| GK1505-25g | 1-Decanesulfonic acid sodium salt | 13419-61-9 | 25g |
| GK1505-50g | 1-Decanesulfonic acid sodium salt | 13419-61-9 | 50g |
| GK1505-100g | 1-Decanesulfonic acid sodium salt | 13419-61-9 | 100g |
| GK2994-25ml | 1-Decanol | 112-30-1 | 25ml |
| GK2994-500ml | 1-Decanol | 112-30-1 | 500ml |
| GC9238-100mg | 1-Deoxy-1-iodo-2,3:4,5-di-O-isopropylidene-β-D-fructopyranose | 38084-03-6 | 100mg |
| GC9238-250mg | 1-Deoxy-1-iodo-2,3:4,5-di-O-isopropylidene-β-D-fructopyranose | 38084-03-6 | 250mg |
| GC9238-500mg | 1-Deoxy-1-iodo-2,3:4,5-di-O-isopropylidene-β-D-fructopyranose | 38084-03-6 | 500mg |
| GC9238-1g | 1-Deoxy-1-iodo-2,3:4,5-di-O-isopropylidene-β-D-fructopyranose | 38084-03-6 | 1g |
| GC0354-25mg | 1-Deoxy-3-O-tert-butyldimethylsilyl-4,5-O-isopropylidene-D-fructopyranose | 942194-07-2 | 25mg |
| GC0354-50mg | 1-Deoxy-3-O-tert-butyldimethylsilyl-4,5-O-isopropylidene-D-fructopyranose | 942194-07-2 | 50mg |
| GC0354-100mg | 1-Deoxy-3-O-tert-butyldimethylsilyl-4,5-O-isopropylidene-D-fructopyranose | 942194-07-2 | 100mg |
| GC0354-250mg | 1-Deoxy-3-O-tert-butyldimethylsilyl-4,5-O-isopropylidene-D-fructopyranose | 942194-07-2 | 250mg |
| GC8278-10mg | 1-Deoxy-D-fructose | 32785-92-5 | 10mg |
| GC8278-25mg | 1-Deoxy-D-fructose | 32785-92-5 | 25mg |
| GC8278-50mg | 1-Deoxy-D-fructose | 32785-92-5 | 50mg |
| GC8278-100mg | 1-Deoxy-D-fructose | 32785-92-5 | 100mg |
| GC6644-5mg | 1-Deoxygalactonojirimycin hydrochoride | 75172-81-5 | 5mg |
| GC6644-10mg | 1-Deoxygalactonojirimycin hydrochoride | 75172-81-5 | 10mg |
| GC6644-25mg | 1-Deoxygalactonojirimycin hydrochoride | 75172-81-5 | 25mg |
| GC6644-50mg | 1-Deoxygalactonojirimycin hydrochoride | 75172-81-5 | 50mg |
| GC6644-100mg | 1-Deoxygalactonojirimycin hydrochoride | 75172-81-5 | 100mg |
| GC2683-1mg | 1-Deoxynojirimycin | 19130-96-2 | 1mg |
| GC2683-5mg | 1-Deoxynojirimycin | 19130-96-2 | 5mg |
| GK1715-25g | 1-Dodecanesulfonic acid sodium salt | 2386-53-0 | 25g |
| GK1715-50g | 1-Dodecanesulfonic acid sodium salt | 2386-53-0 | 50g |
| GK1715-100g | 1-Dodecanesulfonic acid sodium salt | 2386-53-0 | 100g |
| GX8668-5g | 1-Ethyl-3-methylimidazolium chloride | 65039-09-0 | 5g |
| GK4340-25g | 1-Ethylimidazole | 7098-07-9 | 25g |
| GK4340-100g | 1-Ethylimidazole | 7098-07-9 | 100g |
| GK5173-100g | 1-Fluoro-4-nitrobenzene | 350-46-9 | 100g |
| GK4196-25g | 1-Heptanesulfonic acid sodium salt monohydrate | 207300-90-1 | 25g |
| GK4196-50g | 1-Heptanesulfonic acid sodium salt monohydrate | 207300-90-1 | 50g |
| GK4196-100g | 1-Heptanesulfonic acid sodium salt monohydrate | 207300-90-1 | 100g |
| GK4832-25g | 1-Heptanesulfonic acid sodium salt, HPLC grade | 22767-50-6 | 25g |
| GK4832-50g | 1-Heptanesulfonic acid sodium salt, HPLC grade | 22767-50-6 | 50g |
| GK4832-100g | 1-Heptanesulfonic acid sodium salt, HPLC grade | 22767-50-6 | 100g |
| GL8492-100mg | 1-Hexacosanol, 95% | 506-52-5 | 100mg |
| GL8492-1g | 1-Hexacosanol, 95% | 506-52-5 | 1g |
| GK8194-5g | 1-Hexadecanesulfonic acid sodium salt | 15015-81-3 | 5g |
| GK8194-25g | 1-Hexadecanesulfonic acid sodium salt | 15015-81-3 | 25g |
| GK8194-100g | 1-Hexadecanesulfonic acid sodium salt | 15015-81-3 | 100g |
| GX1637-25g | 1-Hexadecanol | 36653-82-4 | 25g |
| GK8349-25g | 1-Hexanesulfonic acid sodium salt monohydrate, HPLC grade | 207300-91-2 | 25g |
| GK8349-50g | 1-Hexanesulfonic acid sodium salt monohydrate, HPLC grade | 207300-91-2 | 50g |
| GK8349-100g | 1-Hexanesulfonic acid sodium salt monohydrate, HPLC grade | 207300-91-2 | 100g |
| GK0100-25g | 1-Hexanesulfonic acid sodium salt, HPLC grade | 2832-45-3 | 25g |
| GK0100-50g | 1-Hexanesulfonic acid sodium salt, HPLC grade | 2832-45-3 | 50g |
| GK0100-100g | 1-Hexanesulfonic acid sodium salt, HPLC grade | 2832-45-3 | 100g |
| GW9359-100mg | 1-Hydroxy-1,2-benziodoxol-3-one | 131-62-4 | 100mg |
| GW9359-500mg | 1-Hydroxy-1,2-benziodoxol-3-one | 131-62-4 | 500mg |
| GW4641-1g | 1-Hydroxy-1,2-benziodoxol-3-one 1-oxide pyridinium complex | 1380548-11-7 | 1g |
| GW4641-5g | 1-Hydroxy-1,2-benziodoxol-3-one 1-oxide pyridinium complex | 1380548-11-7 | 5g |
| GX2582-25g | 1-Hydroxypyridine-2-thione zinc salt | 13463-41-7 | 25g |
| GX2582-100g | 1-Hydroxypyridine-2-thione zinc salt | 13463-41-7 | 100g |
| GK7440-1g | 1-Indanol | 6351-10-6 | 1g |
| GC0415-100mg | 1-Kestose | 470-69-9 | 100mg |
| GW6305-1g | 1-Methoxy-1,3-butadiene | 3036-66-6 | 1g |
| GW6305-5g | 1-Methoxy-1,3-butadiene | 3036-66-6 | 5g |
| GT7110-25mg | 1-Methoxy-5-methylphenazinium methyl sulfate | 65162-13-2 | 25mg |
| GT7110-100mg | 1-Methoxy-5-methylphenazinium methyl sulfate | 65162-13-2 | 100mg |
| GK1345-100ml | 1-Methyl-2-pyrrolidinone | 872-50-4 | 100ml |
| GK1345-250ml | 1-Methyl-2-pyrrolidinone | 872-50-4 | 250ml |
| GK1345-500ml | 1-Methyl-2-pyrrolidinone | 872-50-4 | 500ml |
| GK6677-25g | 1-Methylnaphthalene | 90-12-0 | 25g |
| GW7718-200mg | 1-Methyltryptamine | 7518-21-0 | 200mg |
| GW7718-1g | 1-Methyltryptamine | 7518-21-0 | 1g |
| GK2088-25g | 1-Naphthaleneacetic acid potassium salt | 15165-79-4 | 25g |
| GK2088-100g | 1-Naphthaleneacetic acid potassium salt | 15165-79-4 | 100g |
| GK2088-250g | 1-Naphthaleneacetic acid potassium salt | 15165-79-4 | 250g |
| GL5209-25mg | 1-Naphthohydroxamic acid | 6953-61-3 | 25mg |
| GL5209-100mg | 1-Naphthohydroxamic acid | 6953-61-3 | 100mg |
| GK9874-25g | 1-Naphthol | 90-15-3 | 25g |
| GK9874-100g | 1-Naphthol | 90-15-3 | 100g |
| GK9874-250g | 1-Naphthol | 90-15-3 | 250g |
| GC6475-100mg | 1-Naphthyl 2-acetamido-2-deoxy-b-D-glucopyranoside | 10329-98-3 | 100mg |
| GK8442-25g | 1-Naphthyl acetate | 830-81-9 | 25g |
| GC7868-1g | 1-Naphthyl b-D-glucopyranoside | 19939-82-3 | 1g |
| GE8832-1g | 1-Naphthyl phosphate disodium salt hydrate | 2183-17-7 | 1g |
| GE8832-5g | 1-Naphthyl phosphate disodium salt hydrate | 2183-17-7 | 5g |
| GE8832-25g | 1-Naphthyl phosphate disodium salt hydrate | 2183-17-7 | 25g |
| GE3933-1g | 1-Naphthyl phosphate monosodium salt hydrate | 81012-89-7 | 1g |
| GE3933-5g | 1-Naphthyl phosphate monosodium salt hydrate | 81012-89-7 | 5g |
| GE3933-10g | 1-Naphthyl phosphate monosodium salt hydrate | 81012-89-7 | 10g |
| GE3933-25g | 1-Naphthyl phosphate monosodium salt hydrate | 81012-89-7 | 25g |
| GK7756-25g | 1-Naphthylamine | 134-32-7 | 25g |
| GK7756-100g | 1-Naphthylamine | 134-32-7 | 100g |
| GK1538-10g | 1-Nitroso-2-naphthol | 131-91-9 | 10g |
| GK1538-25g | 1-Nitroso-2-naphthol | 131-91-9 | 25g |
| GK1538-100g | 1-Nitroso-2-naphthol | 131-91-9 | 100g |
| GX1362-5g | 1-Nonanesulfonic acid sodium salt | 35192-74-6 | 5g |
| GX1362-10g | 1-Nonanesulfonic acid sodium salt | 35192-74-6 | 10g |
| GK9226-100ml | 1-Nonanol | 143-08-8 | 100ml |
| GC6024-500mg | 1-O-(3,4,5-Tri-O-benzyl)-galloyl β-D-glucopyranoside tetraacetate | 79815-03-5 | 500mg |
| GC6024-1g | 1-O-(3,4,5-Tri-O-benzyl)-galloyl β-D-glucopyranoside tetraacetate | 79815-03-5 | 1g |
| GC6024-2g | 1-O-(3,4,5-Tri-O-benzyl)-galloyl β-D-glucopyranoside tetraacetate | 79815-03-5 | 2g |
| GC6024-5g | 1-O-(3,4,5-Tri-O-benzyl)-galloyl β-D-glucopyranoside tetraacetate | 79815-03-5 | 5g |
| GC3100-5mg | 1-O-(E)-Feruloyl-β-D-glucopyranose | 64625-37-2 | 5mg |
| GC3100-10mg | 1-O-(E)-Feruloyl-β-D-glucopyranose | 64625-37-2 | 10mg |
| GC3100-25mg | 1-O-(E)-Feruloyl-β-D-glucopyranose | 64625-37-2 | 25mg |
| GC3100-50mg | 1-O-(E)-Feruloyl-β-D-glucopyranose | 64625-37-2 | 50mg |
| GC3288-250mg | 1-O-Acetyl-2,3,5-tri-O-benzyl-D-ribofuranose | 58381-23-0 | 250mg |
| GC3288-500mg | 1-O-Acetyl-2,3,5-tri-O-benzyl-D-ribofuranose | 58381-23-0 | 500mg |
| GC3288-1g | 1-O-Acetyl-2,3,5-tri-O-benzyl-D-ribofuranose | 58381-23-0 | 1g |
| GC3288-2g | 1-O-Acetyl-2,3,5-tri-O-benzyl-D-ribofuranose | 58381-23-0 | 2g |
| GC3288-5g | 1-O-Acetyl-2,3,5-tri-O-benzyl-D-ribofuranose | 58381-23-0 | 5g |
| GC5374-500mg | 1-O-Acetyl-3,5-bis(4-chlorobenzoyl)-2-deoxy-D-ribose | 1207459-15-1 | 500mg |
| GC5374-1g | 1-O-Acetyl-3,5-bis(4-chlorobenzoyl)-2-deoxy-D-ribose | 1207459-15-1 | 1g |
| GC5374-2g | 1-O-Acetyl-3,5-bis(4-chlorobenzoyl)-2-deoxy-D-ribose | 1207459-15-1 | 2g |
| GC5374-5g | 1-O-Acetyl-3,5-bis(4-chlorobenzoyl)-2-deoxy-D-ribose | 1207459-15-1 | 5g |
| GC5374-10g | 1-O-Acetyl-3,5-bis(4-chlorobenzoyl)-2-deoxy-D-ribose | 1207459-15-1 | 10g |
| GC1016-100mg | 1-O-Acetyl-4-azido-2,3,6-tri-O-benzoyl-4-deoxy-D-glucopyranose | 1206451-91-3 | 100mg |
| GC1016-250mg | 1-O-Acetyl-4-azido-2,3,6-tri-O-benzoyl-4-deoxy-D-glucopyranose | 1206451-91-3 | 250mg |
| GC1016-500mg | 1-O-Acetyl-4-azido-2,3,6-tri-O-benzoyl-4-deoxy-D-glucopyranose | 1206451-91-3 | 500mg |
| GC1016-1g | 1-O-Acetyl-4-azido-2,3,6-tri-O-benzoyl-4-deoxy-D-glucopyranose | 1206451-91-3 | 1g |
| GC2553-50mg | 1-O-Galloyl-b-D-glucose | 13405-60-2 | 50mg |
| GC2553-100mg | 1-O-Galloyl-b-D-glucose | 13405-60-2 | 100mg |
| GC2553-250mg | 1-O-Galloyl-b-D-glucose | 13405-60-2 | 250mg |
| GC2553-500mg | 1-O-Galloyl-b-D-glucose | 13405-60-2 | 500mg |
| GC8374-1mg | 1-O-p-Coumaroyl β-D-glucopyranose | 7139-64-2 | 1mg |
| GC8374-2mg | 1-O-p-Coumaroyl β-D-glucopyranose | 7139-64-2 | 2mg |
| GC8374-5mg | 1-O-p-Coumaroyl β-D-glucopyranose | 7139-64-2 | 5mg |
| GC8374-10mg | 1-O-p-Coumaroyl β-D-glucopyranose | 7139-64-2 | 10mg |
| GC1018-1g | 1-O-tert-Butyldimethylsilyl-2,3-O-isopropylidene-α-D-mannofuranose | 111000-75-0 | 1g |
| GC1018-2g | 1-O-tert-Butyldimethylsilyl-2,3-O-isopropylidene-α-D-mannofuranose | 111000-75-0 | 2g |
| GC1018-5g | 1-O-tert-Butyldimethylsilyl-2,3-O-isopropylidene-α-D-mannofuranose | 111000-75-0 | 5g |
| GC1018-10g | 1-O-tert-Butyldimethylsilyl-2,3-O-isopropylidene-α-D-mannofuranose | 111000-75-0 | 10g |
| GC7962-1g | 1-O-tert-Butyldimethylsilyl-2,3:5,6-di-O-isopropylidene-α-D-mannofuranose | 108678-46-2 | 1g |
| GC7962-2g | 1-O-tert-Butyldimethylsilyl-2,3:5,6-di-O-isopropylidene-α-D-mannofuranose | 108678-46-2 | 2g |
| GC7962-5g | 1-O-tert-Butyldimethylsilyl-2,3:5,6-di-O-isopropylidene-α-D-mannofuranose | 108678-46-2 | 5g |
| GC7962-10g | 1-O-tert-Butyldimethylsilyl-2,3:5,6-di-O-isopropylidene-α-D-mannofuranose | 108678-46-2 | 10g |
| GK2715-10g | 1-Octadecanethiol | 2885-00-9 | 10g |
| GK7991-25g | 1-Octadecanol | 112-92-5 | 25g |
| GK7991-100g | 1-Octadecanol | 112-92-5 | 100g |
| GK7376-25g | 1-Octanesulfonic acid sodium salt monohydrate | 207596-29-0 | 25g |
| GK7376-50g | 1-Octanesulfonic acid sodium salt monohydrate | 207596-29-0 | 50g |
| GK7376-100g | 1-Octanesulfonic acid sodium salt monohydrate | 207596-29-0 | 100g |
| GK3339-25g | 1-Octanesulfonic acid sodium salt, HPLC grade | 5324-84-5 | 25g |
| GK3339-50g | 1-Octanesulfonic acid sodium salt, HPLC grade | 5324-84-5 | 50g |
| GK3339-100g | 1-Octanesulfonic acid sodium salt, HPLC grade | 5324-84-5 | 100g |
| GM6151-25ml | 1-Octanol | 111-87-5 | 25ml |
| GM6151-100ml | 1-Octanol | 111-87-5 | 100ml |
| GM6151-250ml | 1-Octanol | 111-87-5 | 250ml |
| GM6151-500ml | 1-Octanol | 111-87-5 | 500ml |
| GC1184-1g | 1-Octylamino-1-deoxy-D-glucitol | 23323-37-7 | 1g |
| GK0438-25g | 1-Pentanesulfonic acid sodium salt monohydrate | 207605-40-1 | 25g |
| GK0438-50g | 1-Pentanesulfonic acid sodium salt monohydrate | 207605-40-1 | 50g |
| GK0438-100g | 1-Pentanesulfonic acid sodium salt monohydrate | 207605-40-1 | 100g |
| GK8163-25g | 1-Pentanesulfonic acid sodium salt, HPLC grade | 22767-49-3 | 25g |
| GK8163-50g | 1-Pentanesulfonic acid sodium salt, HPLC grade | 22767-49-3 | 50g |
| GK8163-100g | 1-Pentanesulfonic acid sodium salt, HPLC grade | 22767-49-3 | 100g |
| GL6339-100ml | 1-Pentanol | 71-41-0 | 100ml |
| GK4574-25g | 1-Phenyl-3-pyrazolidinone | 92-43-3 | 25g |
| GK4574-100g | 1-Phenyl-3-pyrazolidinone | 92-43-3 | 100g |
| GK6491-25g | 1-Propanesulfonic acid sodium salt | 14533-63-2 | 25g |
| GK6491-50g | 1-Propanesulfonic acid sodium salt | 14533-63-2 | 50g |
| GK6491-100g | 1-Propanesulfonic acid sodium salt | 14533-63-2 | 100g |
| GL9076-25ml | 1-Propanol, 99% | 71-23-8 | 25ml |
| GL9076-100ml | 1-Propanol, 99% | 71-23-8 | 100ml |
| GW9349-20g | 1-Pyrenecarboxaldehyde | 3029-19-4 | 20g |
| GW9349-100g | 1-Pyrenecarboxaldehyde | 3029-19-4 | 100g |
| GK4046-100g | 1-Tetradecanol | 112-72-1 | 100g |
| GC2938-25ml | 1-Thioglycerol | 96-27-5 | 25ml |
| GC2938-100ml | 1-Thioglycerol | 96-27-5 | 100ml |
| GL6030-100mg | 1-Triacontanol | 593-50-0 | 100mg |
| GK0090-1g | 1-Tridecanol | 112-70-9 | 1g |
| GK8862-25g | 1,1-Bis(methylthio)-2-nitroethylene | 13623-94-4 | 25g |
| GW3640-1g | 1,1-Bis(phenylsulfonyl)ethylene | 39082-53-6 | 1g |
| GW3640-5g | 1,1-Bis(phenylsulfonyl)ethylene | 39082-53-6 | 5g |
| GK4690-5g | 1,1,1,3,3,3-Hexafluoro-2-propanol | 920-66-1 | 5g |
| GK4690-25g | 1,1,1,3,3,3-Hexafluoro-2-propanol | 920-66-1 | 25g |
| GK4690-100g | 1,1,1,3,3,3-Hexafluoro-2-propanol | 920-66-1 | 100g |
| GK4690-250g | 1,1,1,3,3,3-Hexafluoro-2-propanol | 920-66-1 | 250g |
| GK4690-500g | 1,1,1,3,3,3-Hexafluoro-2-propanol | 920-66-1 | 500g |
| GW2823-500mg | 1,1,2-Trimethyl-3-(4-sulfobutyl)benz[e]benzindolium, inner salt | 63149-24-6 | 500mg |
| GW2823-2500mg | 1,1,2-Trimethyl-3-(4-sulfobutyl)benz[e]benzindolium, inner salt | 63149-24-6 | 2500mg |
| GK1393-250ml | 1,1,4,7,7-Pentamethyldiethylenetriamine | 3030-47-5 | 250ml |
| GK1393-500ml | 1,1,4,7,7-Pentamethyldiethylenetriamine | 3030-47-5 | 500ml |
| GK1393-1l | 1,1,4,7,7-Pentamethyldiethylenetriamine | 3030-47-5 | 1l |
| GW6694-100mg | 1,1''-(1,2-Ethanediyl)bis-1H-1,2,4-triazole | 116476-98-3 | 100mg |
| GW6694-1g | 1,1''-(1,2-Ethanediyl)bis-1H-1,2,4-triazole | 116476-98-3 | 1g |
| GW0163-25g | 1,1''-Carbonyldipyrrolidine | 81759-25-3 | 25g |
| GW0163-50g | 1,1''-Carbonyldipyrrolidine | 81759-25-3 | 50g |
| GW7092-1g | 1,1''-Dibutyl-3,3,3'',3''-tetramethylindotricarbocyanine hexafluorophosphate | 134339-08-5 | 1g |
| GW7092-5g | 1,1''-Dibutyl-3,3,3'',3''-tetramethylindotricarbocyanine hexafluorophosphate | 134339-08-5 | 5g |
| GW3985-100mg | 1,1′-Dioctadecyl-3,3,3′,3′-tetramethylindocarbocyanine perchlorate | 41085-99-8 | 100mg |
| GW3985-1g | 1,1′-Dioctadecyl-3,3,3′,3′-tetramethylindocarbocyanine perchlorate | 41085-99-8 | 1g |
| GA0090-5g | 1,10-Phenanthroline hydrochloride monohydrate | 18851-33-7 | 5g |
| GA0090-25g | 1,10-Phenanthroline hydrochloride monohydrate | 18851-33-7 | 25g |
| GA0090-100g | 1,10-Phenanthroline hydrochloride monohydrate | 18851-33-7 | 100g |
| GE7007-1g | 1,10-Phenanthroline monohydrate | 5144-89-8 | 1g |
| GE7007-5g | 1,10-Phenanthroline monohydrate | 5144-89-8 | 5g |
| GE7007-25g | 1,10-Phenanthroline monohydrate | 5144-89-8 | 25g |
| GE7007-100g | 1,10-Phenanthroline monohydrate | 5144-89-8 | 100g |
| GE1327-5g | 1,10-Phenanthroline, anhydrous | 66-71-7 | 5g |
| GE1327-25g | 1,10-Phenanthroline, anhydrous | 66-71-7 | 25g |
| GE1327-100g | 1,10-Phenanthroline, anhydrous | 66-71-7 | 100g |
| GK0328-1g | 1,2-Bis(2-aminophenoxy)ethane-N,N,N'',N''-tetraacetic acid | 85233-19-8 | 1g |
| GK0328-5g | 1,2-Bis(2-aminophenoxy)ethane-N,N,N'',N''-tetraacetic acid | 85233-19-8 | 5g |
| GK6651-10g | 1,2-Bis(diphenylphosphino)ethane | 1663-45-2 | 10g |
| GK6651-25g | 1,2-Bis(diphenylphosphino)ethane | 1663-45-2 | 25g |
| GC4187-100mg | 1,2-Di-O-acetyl-3,5-di-O-benzoyl-β-D-ribofuranose | 71080-18-7 | 100mg |
| GC4187-250mg | 1,2-Di-O-acetyl-3,5-di-O-benzoyl-β-D-ribofuranose | 71080-18-7 | 250mg |
| GS4126-100ml | 1,2-Dichlorobenzene, GlenDry™, anhydrous | 95-50-1 | 100ml |
| GS4126-500ml | 1,2-Dichlorobenzene, GlenDry™, anhydrous | 95-50-1 | 500ml |
| GS4126-1l | 1,2-Dichlorobenzene, GlenDry™, anhydrous | 95-50-1 | 1l |
| GS4126-2500ml | 1,2-Dichlorobenzene, GlenDry™, anhydrous | 95-50-1 | 2500ml |
| GS3093-500ml | 1,2-Dichlorobenzene, GlenPure™, analytical grade | 95-50-1 | 500ml |
| GS3093-1l | 1,2-Dichlorobenzene, GlenPure™, analytical grade | 95-50-1 | 1l |
| GS3093-2500ml | 1,2-Dichlorobenzene, GlenPure™, analytical grade | 95-50-1 | 2500ml |
| GK1801-25g | 1,2-Dihydroxybenzene | 120-80-9 | 25g |
| GK1801-100g | 1,2-Dihydroxybenzene | 120-80-9 | 100g |
| GK1801-250g | 1,2-Dihydroxybenzene | 120-80-9 | 250g |
| GK1801-500g | 1,2-Dihydroxybenzene | 120-80-9 | 500g |
| GS5227-100ml | 1,2-Dimethoxyethane, GlenDry, anhydrous over molecular sieve | 110-71-4 | 100ml |
| GS5227-500ml | 1,2-Dimethoxyethane, GlenDry, anhydrous over molecular sieve | 110-71-4 | 500ml |
| GS5227-1l | 1,2-Dimethoxyethane, GlenDry, anhydrous over molecular sieve | 110-71-4 | 1l |
| GS5227-2500ml | 1,2-Dimethoxyethane, GlenDry, anhydrous over molecular sieve | 110-71-4 | 2500ml |
| GS7642-500ml | 1,2-Dimethoxyethane, GlenDry™, anhydrous | 110-71-4 | 500ml |
| GS7642-1l | 1,2-Dimethoxyethane, GlenDry™, anhydrous | 110-71-4 | 1l |
| GS7642-2500ml | 1,2-Dimethoxyethane, GlenDry™, anhydrous | 110-71-4 | 2500ml |
| GS6752-500ml | 1,2-Dimethoxyethane, GlenPure™, analytical grade | 110-71-4 | 500ml |
| GS6752-1l | 1,2-Dimethoxyethane, GlenPure™, analytical grade | 110-71-4 | 1l |
| GS6752-2500ml | 1,2-Dimethoxyethane, GlenPure™, analytical grade | 110-71-4 | 2500ml |
| GC7919-500mg | 1,2-O-Isopropylidene-6-O-tert-butyldimethylsilyl-α-D-glucofuranose | 85951-10-6 | 500mg |
| GC7919-1g | 1,2-O-Isopropylidene-6-O-tert-butyldimethylsilyl-α-D-glucofuranose | 85951-10-6 | 1g |
| GC7919-2g | 1,2-O-Isopropylidene-6-O-tert-butyldimethylsilyl-α-D-glucofuranose | 85951-10-6 | 2g |
| GC7919-5g | 1,2-O-Isopropylidene-6-O-tert-butyldimethylsilyl-α-D-glucofuranose | 85951-10-6 | 5g |
| GC9080-1g | 1,2-O-Isopropylidene-6-O-trityl-α-D-glucofuranose | 33737-08-5 | 1g |
| GC9080-2g | 1,2-O-Isopropylidene-6-O-trityl-α-D-glucofuranose | 33737-08-5 | 2g |
| GC9080-5g | 1,2-O-Isopropylidene-6-O-trityl-α-D-glucofuranose | 33737-08-5 | 5g |
| GC9080-10g | 1,2-O-Isopropylidene-6-O-trityl-α-D-glucofuranose | 33737-08-5 | 10g |
| GC9080-25g | 1,2-O-Isopropylidene-6-O-trityl-α-D-glucofuranose | 33737-08-5 | 25g |
| GC7780-250mg | 1,2-O-Isopropylidene-b-L-idofuranosylurono-6,3-lactone | 29514-28-1 | 250mg |
| GC7780-500mg | 1,2-O-Isopropylidene-b-L-idofuranosylurono-6,3-lactone | 29514-28-1 | 500mg |
| GC7780-1g | 1,2-O-Isopropylidene-b-L-idofuranosylurono-6,3-lactone | 29514-28-1 | 1g |
| GC7780-2g | 1,2-O-Isopropylidene-b-L-idofuranosylurono-6,3-lactone | 29514-28-1 | 2g |
| GC7780-5g | 1,2-O-Isopropylidene-b-L-idofuranosylurono-6,3-lactone | 29514-28-1 | 5g |
| GC4252-500mg | 1,2-O-Isopropylidene-D-mannitol | 4306-35-8 | 500mg |
| GC4252-1g | 1,2-O-Isopropylidene-D-mannitol | 4306-35-8 | 1g |
| GC4252-2g | 1,2-O-Isopropylidene-D-mannitol | 4306-35-8 | 2g |
| GC4252-5g | 1,2-O-Isopropylidene-D-mannitol | 4306-35-8 | 5g |
| GC4252-10g | 1,2-O-Isopropylidene-D-mannitol | 4306-35-8 | 10g |
| GC7659-250mg | 1,2-O-Isopropylidene-DL-myo-inositol | 26276-97-1 | 250mg |
| GC7659-500mg | 1,2-O-Isopropylidene-DL-myo-inositol | 26276-97-1 | 500mg |
| GC7659-1g | 1,2-O-Isopropylidene-DL-myo-inositol | 26276-97-1 | 1g |
| GC7659-2g | 1,2-O-Isopropylidene-DL-myo-inositol | 26276-97-1 | 2g |
| GC8090-10g | 1,2-O-Isopropylidene-α-D-glucofuranose | 18549-40-1 | 10g |
| GC8090-25g | 1,2-O-Isopropylidene-α-D-glucofuranose | 18549-40-1 | 25g |
| GC8090-50g | 1,2-O-Isopropylidene-α-D-glucofuranose | 18549-40-1 | 50g |
| GC8090-100g | 1,2-O-Isopropylidene-α-D-glucofuranose | 18549-40-1 | 100g |
| GC8090-250g | 1,2-O-Isopropylidene-α-D-glucofuranose | 18549-40-1 | 250g |
| GC6546-5g | 1,2-O-Isopropylidene-α-D-glucofuranosidurono-6,3-lactone | 20513-98-8 | 5g |
| GC6546-10g | 1,2-O-Isopropylidene-α-D-glucofuranosidurono-6,3-lactone | 20513-98-8 | 10g |
| GC6546-25g | 1,2-O-Isopropylidene-α-D-glucofuranosidurono-6,3-lactone | 20513-98-8 | 25g |
| GC6546-50g | 1,2-O-Isopropylidene-α-D-glucofuranosidurono-6,3-lactone | 20513-98-8 | 50g |
| GC9804-100mg | 1,2-O-Isopropylidene-α-D-glucofuranuronic-6-13C acid, γ-lactone | 40010-66-0 | 100mg |
| GC9804-250mg | 1,2-O-Isopropylidene-α-D-glucofuranuronic-6-13C acid, γ-lactone | 40010-66-0 | 250mg |
| GC9804-500mg | 1,2-O-Isopropylidene-α-D-glucofuranuronic-6-13C acid, γ-lactone | 40010-66-0 | 500mg |
| GC9804-1g | 1,2-O-Isopropylidene-α-D-glucofuranuronic-6-13C acid, γ-lactone | 40010-66-0 | 1g |
| GC2230-250mg | 1,2-O-Isopropylidene-β-D-fructofuranose | 76549-76-3 | 250mg |
| GC2230-500mg | 1,2-O-Isopropylidene-β-D-fructofuranose | 76549-76-3 | 500mg |
| GC2230-1g | 1,2-O-Isopropylidene-β-D-fructofuranose | 76549-76-3 | 1g |
| GC2230-2g | 1,2-O-Isopropylidene-β-D-fructofuranose | 76549-76-3 | 2g |
| GC5848-100mg | 1,2-O-Isopropylidene-β-L-idofuranuronic-1,6-13C2 acid γ-lactone | 100mg | |
| GC5848-250mg | 1,2-O-Isopropylidene-β-L-idofuranuronic-1,6-13C2 acid γ-lactone | 250mg | |
| GC5848-500mg | 1,2-O-Isopropylidene-β-L-idofuranuronic-1,6-13C2 acid γ-lactone | 500mg | |
| GC5848-1g | 1,2-O-Isopropylidene-β-L-idofuranuronic-1,6-13C2 acid γ-lactone | 1g | |
| GC2040-250mg | 1,2-O-Isopropylidene-β-L-idofuranuronic-6-13C acid γ-lactone | 40010-58-0 | 250mg |
| GC2040-500mg | 1,2-O-Isopropylidene-β-L-idofuranuronic-6-13C acid γ-lactone | 40010-58-0 | 500mg |
| GC2040-1g | 1,2-O-Isopropylidene-β-L-idofuranuronic-6-13C acid γ-lactone | 40010-58-0 | 1g |
| GC2040-2g | 1,2-O-Isopropylidene-β-L-idofuranuronic-6-13C acid γ-lactone | 40010-58-0 | 2g |
| GC7732-25mg | 1,2,2'',3,3'',6-Hexa-O-acetyl-4'',6''-O-benzylidene-D-cellobiose | 25mg | |
| GC7732-50mg | 1,2,2'',3,3'',6-Hexa-O-acetyl-4'',6''-O-benzylidene-D-cellobiose | 50mg | |
| GC7732-100mg | 1,2,2'',3,3'',6-Hexa-O-acetyl-4'',6''-O-benzylidene-D-cellobiose | 100mg | |
| GC7732-250mg | 1,2,2'',3,3'',6-Hexa-O-acetyl-4'',6''-O-benzylidene-D-cellobiose | 250mg | |
| GC9754-50mg | 1,2,3-Tri-O-acetyl-2,6-dideoxy-6-iodo-D-glucopyranose | 182014-19-3 | 50mg |
| GC9754-100mg | 1,2,3-Tri-O-acetyl-2,6-dideoxy-6-iodo-D-glucopyranose | 182014-19-3 | 100mg |
| GC9754-250mg | 1,2,3-Tri-O-acetyl-2,6-dideoxy-6-iodo-D-glucopyranose | 182014-19-3 | 250mg |
| GC9754-500mg | 1,2,3-Tri-O-acetyl-2,6-dideoxy-6-iodo-D-glucopyranose | 182014-19-3 | 500mg |
| GW1357-1g | 1,2,3-Tris(diethylamino)cyclopropenylium bis(trifluoromethanesulfonyl)imide | 1415962-25-2 | 1g |
| GW1357-5g | 1,2,3-Tris(diethylamino)cyclopropenylium bis(trifluoromethanesulfonyl)imide | 1415962-25-2 | 5g |
| GW2679-1g | 1,2,3-Tris(diethylamino)cyclopropenylium dicyanamide | 1415962-26-3 | 1g |
| GW2679-5g | 1,2,3-Tris(diethylamino)cyclopropenylium dicyanamide | 1415962-26-3 | 5g |
| GX0888-25g | 1,2,3,4-Butanetetracarboxylic acid | 1703-58-8 | 25g |
| GX0888-100g | 1,2,3,4-Butanetetracarboxylic acid | 1703-58-8 | 100g |
| GX0888-500g | 1,2,3,4-Butanetetracarboxylic acid | 1703-58-8 | 500g |
| GC0979-50mg | 1,2,3,4-Tetra-O-acetyl-6-azido-6-deoxy-D-galactopyranose | 629620-22-0 | 50mg |
| GC0979-100mg | 1,2,3,4-Tetra-O-acetyl-6-azido-6-deoxy-D-galactopyranose | 629620-22-0 | 100mg |
| GC0979-250mg | 1,2,3,4-Tetra-O-acetyl-6-azido-6-deoxy-D-galactopyranose | 629620-22-0 | 250mg |
| GC0979-500mg | 1,2,3,4-Tetra-O-acetyl-6-azido-6-deoxy-D-galactopyranose | 629620-22-0 | 500mg |
| GC1780-25mg | 1,2,3,4-Tetra-O-acetyl-6-azido-6-deoxy-α-D-galactopyranose | 73108-24-4 | 25mg |
| GC1780-50mg | 1,2,3,4-Tetra-O-acetyl-6-azido-6-deoxy-α-D-galactopyranose | 73108-24-4 | 50mg |
| GC1780-100mg | 1,2,3,4-Tetra-O-acetyl-6-azido-6-deoxy-α-D-galactopyranose | 73108-24-4 | 100mg |
| GC1780-250mg | 1,2,3,4-Tetra-O-acetyl-6-azido-6-deoxy-α-D-galactopyranose | 73108-24-4 | 250mg |
| GC0446-5mg | 1,2,3,4-Tetra-O-acetyl-6-azido-L-fucopyranose | 912478-17-2 | 5mg |
| GC0446-10mg | 1,2,3,4-Tetra-O-acetyl-6-azido-L-fucopyranose | 912478-17-2 | 10mg |
| GC0446-25mg | 1,2,3,4-Tetra-O-acetyl-6-azido-L-fucopyranose | 912478-17-2 | 25mg |
| GC0446-50mg | 1,2,3,4-Tetra-O-acetyl-6-azido-L-fucopyranose | 912478-17-2 | 50mg |
| GC3594-500mg | 1,2,3,4-Tetra-O-acetyl-6-deoxy-6-iodo-α-D-glucopyranose | 24871-54-3 | 500mg |
| GC3594-1g | 1,2,3,4-Tetra-O-acetyl-6-deoxy-6-iodo-α-D-glucopyranose | 24871-54-3 | 1g |
| GC3594-2g | 1,2,3,4-Tetra-O-acetyl-6-deoxy-6-iodo-α-D-glucopyranose | 24871-54-3 | 2g |
| GC3594-5g | 1,2,3,4-Tetra-O-acetyl-6-deoxy-6-iodo-α-D-glucopyranose | 24871-54-3 | 5g |
| GC4038-250mg | 1,2,3,4-Tetra-O-acetyl-6-diphenylphosphoryl-β-D-mannopyranose | 108321-48-8 | 250mg |
| GC4038-500mg | 1,2,3,4-Tetra-O-acetyl-6-diphenylphosphoryl-β-D-mannopyranose | 108321-48-8 | 500mg |
| GC4038-1g | 1,2,3,4-Tetra-O-acetyl-6-diphenylphosphoryl-β-D-mannopyranose | 108321-48-8 | 1g |
| GC4038-2g | 1,2,3,4-Tetra-O-acetyl-6-diphenylphosphoryl-β-D-mannopyranose | 108321-48-8 | 2g |
| GC1747-500mg | 1,2,3,4-Tetra-O-acetyl-6-O-trityl-b-D-glucopyranose | 37074-90-1 | 500mg |
| GC1747-1g | 1,2,3,4-Tetra-O-acetyl-6-O-trityl-b-D-glucopyranose | 37074-90-1 | 1g |
| GC1747-2g | 1,2,3,4-Tetra-O-acetyl-6-O-trityl-b-D-glucopyranose | 37074-90-1 | 2g |
| GC1747-5g | 1,2,3,4-Tetra-O-acetyl-6-O-trityl-b-D-glucopyranose | 37074-90-1 | 5g |
| GC1747-10g | 1,2,3,4-Tetra-O-acetyl-6-O-trityl-b-D-glucopyranose | 37074-90-1 | 10g |
| GC0346-1g | 1,2,3,4-Tetra-O-acetyl-6-O-trityl-β-D-mannopyranose | 92621-31-3 | 1g |
| GC0346-2g | 1,2,3,4-Tetra-O-acetyl-6-O-trityl-β-D-mannopyranose | 92621-31-3 | 2g |
| GC0346-5g | 1,2,3,4-Tetra-O-acetyl-6-O-trityl-β-D-mannopyranose | 92621-31-3 | 5g |
| GC0346-10g | 1,2,3,4-Tetra-O-acetyl-6-O-trityl-β-D-mannopyranose | 92621-31-3 | 10g |
| GC0953-1g | 1,2,3,4-Tetra-O-acetyl-a-L-fucopyranose | 64913-16-2 | 1g |
| GC0953-2g | 1,2,3,4-Tetra-O-acetyl-a-L-fucopyranose | 64913-16-2 | 2g |
| GC0953-5g | 1,2,3,4-Tetra-O-acetyl-a-L-fucopyranose | 64913-16-2 | 5g |
| GC0953-10g | 1,2,3,4-Tetra-O-acetyl-a-L-fucopyranose | 64913-16-2 | 10g |
| GC5900-1g | 1,2,3,4-Tetra-O-acetyl-b-D-glucopyranose | 13100-46-4 | 1g |
| GC5900-2g | 1,2,3,4-Tetra-O-acetyl-b-D-glucopyranose | 13100-46-4 | 2g |
| GC5900-5g | 1,2,3,4-Tetra-O-acetyl-b-D-glucopyranose | 13100-46-4 | 5g |
| GC5900-10g | 1,2,3,4-Tetra-O-acetyl-b-D-glucopyranose | 13100-46-4 | 10g |
| GC5906-100mg | 1,2,3,4-Tetra-O-acetyl-b-D-xylopyranose | 4049-33-6 | 100mg |
| GC5906-250mg | 1,2,3,4-Tetra-O-acetyl-b-D-xylopyranose | 4049-33-6 | 250mg |
| GC5906-1g | 1,2,3,4-Tetra-O-acetyl-b-D-xylopyranose | 4049-33-6 | 1g |
| GC1176-1g | 1,2,3,4-Tetra-O-acetyl-beta-D-glucuronic acid | 62133-77-1 | 1g |
| GC1176-2g | 1,2,3,4-Tetra-O-acetyl-beta-D-glucuronic acid | 62133-77-1 | 2g |
| GC1176-5g | 1,2,3,4-Tetra-O-acetyl-beta-D-glucuronic acid | 62133-77-1 | 5g |
| GC1176-10g | 1,2,3,4-Tetra-O-acetyl-beta-D-glucuronic acid | 62133-77-1 | 10g |
| GC4650-1g | 1,2,3,4-Tetra-O-acetyl-L-rhamnopyranose | 30021-94-4 | 1g |
| GC4650-2g | 1,2,3,4-Tetra-O-acetyl-L-rhamnopyranose | 30021-94-4 | 2g |
| GC4650-5g | 1,2,3,4-Tetra-O-acetyl-L-rhamnopyranose | 30021-94-4 | 5g |
| GC4650-10g | 1,2,3,4-Tetra-O-acetyl-L-rhamnopyranose | 30021-94-4 | 10g |
| GC0019-25mg | 1,2,3,4-Tetra-O-acetyl-α-D-galacturonic acid | 95722-13-7 | 25mg |
| GC0019-50mg | 1,2,3,4-Tetra-O-acetyl-α-D-galacturonic acid | 95722-13-7 | 50mg |
| GC0019-100mg | 1,2,3,4-Tetra-O-acetyl-α-D-galacturonic acid | 95722-13-7 | 100mg |
| GC0019-250mg | 1,2,3,4-Tetra-O-acetyl-α-D-galacturonic acid | 95722-13-7 | 250mg |
| GC7263-1g | 1,2,3,4-Tetra-O-acetyl-β-D-glucopyranuronic acid benzyl ester | 184874-53-1 | 1g |
| GC7263-2g | 1,2,3,4-Tetra-O-acetyl-β-D-glucopyranuronic acid benzyl ester | 184874-53-1 | 2g |
| GC7263-5g | 1,2,3,4-Tetra-O-acetyl-β-D-glucopyranuronic acid benzyl ester | 184874-53-1 | 5g |
| GC7263-10g | 1,2,3,4-Tetra-O-acetyl-β-D-glucopyranuronic acid benzyl ester | 184874-53-1 | 10g |
| GC8516-500mg | 1,2,3,4-Tetra-O-acetyl-β-D-mannopyranose | 28154-37-2 | 500mg |
| GC8516-1g | 1,2,3,4-Tetra-O-acetyl-β-D-mannopyranose | 28154-37-2 | 1g |
| GC8516-2g | 1,2,3,4-Tetra-O-acetyl-β-D-mannopyranose | 28154-37-2 | 2g |
| GC8516-5g | 1,2,3,4-Tetra-O-acetyl-β-D-mannopyranose | 28154-37-2 | 5g |
| GC9303-1g | 1,2,3,4-Tetra-O-benzyl-6-O-trityl-a-D-mannopyranose | 78561-22-5 | 1g |
| GC9303-2g | 1,2,3,4-Tetra-O-benzyl-6-O-trityl-a-D-mannopyranose | 78561-22-5 | 2g |
| GC9303-5g | 1,2,3,4-Tetra-O-benzyl-6-O-trityl-a-D-mannopyranose | 78561-22-5 | 5g |
| GC9303-10g | 1,2,3,4-Tetra-O-benzyl-6-O-trityl-a-D-mannopyranose | 78561-22-5 | 10g |
| GC5837-1g | 1,2,3,4-Tetra-O-isobutyryl-β-D-glucopyranuronic acid methyl ester | 150607-94-6 | 1g |
| GC5837-2g | 1,2,3,4-Tetra-O-isobutyryl-β-D-glucopyranuronic acid methyl ester | 150607-94-6 | 2g |
| GC5837-5g | 1,2,3,4-Tetra-O-isobutyryl-β-D-glucopyranuronic acid methyl ester | 150607-94-6 | 5g |
| GC5837-10g | 1,2,3,4-Tetra-O-isobutyryl-β-D-glucopyranuronic acid methyl ester | 150607-94-6 | 10g |
| GC7693-250mg | 1,2,3,4-Tetra-O-pivaloyl-β-D-glucopyranuronic acid methyl ester | 86448-91-1 | 250mg |
| GC7693-500mg | 1,2,3,4-Tetra-O-pivaloyl-β-D-glucopyranuronic acid methyl ester | 86448-91-1 | 500mg |
| GC7693-1g | 1,2,3,4-Tetra-O-pivaloyl-β-D-glucopyranuronic acid methyl ester | 86448-91-1 | 1g |
| GC7693-2g | 1,2,3,4-Tetra-O-pivaloyl-β-D-glucopyranuronic acid methyl ester | 86448-91-1 | 2g |
| GK8366-100g | 1,2,3,4-Tetrahydroquinoline | 635-46-1 | 100g |
| GK8366-250g | 1,2,3,4-Tetrahydroquinoline | 635-46-1 | 250g |
| GC6653-5g | 1,2,3,4,5-Penta-O-acetyl-b-D-fructose | 20764-61-8 | 5g |
| GC6653-10g | 1,2,3,4,5-Penta-O-acetyl-b-D-fructose | 20764-61-8 | 10g |
| GC6653-25g | 1,2,3,4,5-Penta-O-acetyl-b-D-fructose | 20764-61-8 | 25g |
| GC6653-50g | 1,2,3,4,5-Penta-O-acetyl-b-D-fructose | 20764-61-8 | 50g |
| GC8082-10g | 1,2,3,4,5,6-Hexa-O-acetyl-myo-inositol | 1254-38-2 | 10g |
| GC8082-25g | 1,2,3,4,5,6-Hexa-O-acetyl-myo-inositol | 1254-38-2 | 25g |
| GC8082-50g | 1,2,3,4,5,6-Hexa-O-acetyl-myo-inositol | 1254-38-2 | 50g |
| GC8082-100g | 1,2,3,4,5,6-Hexa-O-acetyl-myo-inositol | 1254-38-2 | 100g |
| GC6108-500mg | 1,2,3,4,6-Penta-O-acetyl-1-thio-β-D-galactopyranose | 6806-56-0 | 500mg |
| GC6108-1g | 1,2,3,4,6-Penta-O-acetyl-1-thio-β-D-galactopyranose | 6806-56-0 | 1g |
| GC6108-2g | 1,2,3,4,6-Penta-O-acetyl-1-thio-β-D-galactopyranose | 6806-56-0 | 2g |
| GC6108-5g | 1,2,3,4,6-Penta-O-acetyl-1-thio-β-D-galactopyranose | 6806-56-0 | 5g |
| GC6125-1g | 1,2,3,4,6-Penta-O-acetyl-1-thio-β-D-glucopyranose | 13639-50-4 | 1g |
| GC6125-2g | 1,2,3,4,6-Penta-O-acetyl-1-thio-β-D-glucopyranose | 13639-50-4 | 2g |
| GC6125-5g | 1,2,3,4,6-Penta-O-acetyl-1-thio-β-D-glucopyranose | 13639-50-4 | 5g |
| GC6125-10g | 1,2,3,4,6-Penta-O-acetyl-1-thio-β-D-glucopyranose | 13639-50-4 | 10g |
| GC3275-5g | 1,2,3,4,6-Penta-O-acetyl-b-D-galactopyranose | 4163-60-4 | 5g |
| GC3275-25g | 1,2,3,4,6-Penta-O-acetyl-b-D-galactopyranose | 4163-60-4 | 25g |
| GC3275-100g | 1,2,3,4,6-Penta-O-acetyl-b-D-galactopyranose | 4163-60-4 | 100g |
| GC3275-250g | 1,2,3,4,6-Penta-O-acetyl-b-D-galactopyranose | 4163-60-4 | 250g |
| GC3275-500g | 1,2,3,4,6-Penta-O-acetyl-b-D-galactopyranose | 4163-60-4 | 500g |
| GC7359-50g | 1,2,3,4,6-Penta-O-acetyl-b-D-glucopyranose | 604-69-3 | 50g |
| GC7359-100g | 1,2,3,4,6-Penta-O-acetyl-b-D-glucopyranose | 604-69-3 | 100g |
| GC7359-250g | 1,2,3,4,6-Penta-O-acetyl-b-D-glucopyranose | 604-69-3 | 250g |
| GC7359-500g | 1,2,3,4,6-Penta-O-acetyl-b-D-glucopyranose | 604-69-3 | 500g |
| GC7359-1kg | 1,2,3,4,6-Penta-O-acetyl-b-D-glucopyranose | 604-69-3 | 1kg |
| GC8999-100mg | 1,2,3,4,6-Penta-O-acetyl-L-idopyranose | 330974-67-9 | 100mg |
| GC8999-250mg | 1,2,3,4,6-Penta-O-acetyl-L-idopyranose | 330974-67-9 | 250mg |
| GC8999-500mg | 1,2,3,4,6-Penta-O-acetyl-L-idopyranose | 330974-67-9 | 500mg |
| GC8999-1g | 1,2,3,4,6-Penta-O-acetyl-L-idopyranose | 330974-67-9 | 1g |
| GC5395-250mg | 1,2,3,4,6-Penta-O-acetyl-β-D-glucopyranose-1,2,3,4,5,6-13C6 | 213020-65-6 | 250mg |
| GC5395-500mg | 1,2,3,4,6-Penta-O-acetyl-β-D-glucopyranose-1,2,3,4,5,6-13C6 | 213020-65-6 | 500mg |
| GC5395-1g | 1,2,3,4,6-Penta-O-acetyl-β-D-glucopyranose-1,2,3,4,5,6-13C6 | 213020-65-6 | 1g |
| GC5395-2g | 1,2,3,4,6-Penta-O-acetyl-β-D-glucopyranose-1,2,3,4,5,6-13C6 | 213020-65-6 | 2g |
| GC6402-100mg | 1,2,3,4,6-Penta-O-acetyl-β-D-glucopyranose-1,6-13C2 | 100mg | |
| GC6402-250mg | 1,2,3,4,6-Penta-O-acetyl-β-D-glucopyranose-1,6-13C2 | 250mg | |
| GC6402-500mg | 1,2,3,4,6-Penta-O-acetyl-β-D-glucopyranose-1,6-13C2 | 500mg | |
| GC6402-1g | 1,2,3,4,6-Penta-O-acetyl-β-D-glucopyranose-1,6-13C2 | 1g | |
| GC6402-2g | 1,2,3,4,6-Penta-O-acetyl-β-D-glucopyranose-1,6-13C2 | 2g | |
| GC5342-1g | 1,2,3,4,6-Penta-O-benzoyl-a-D-galactopyranose | 41545-55-5 | 1g |
| GC5342-2g | 1,2,3,4,6-Penta-O-benzoyl-a-D-galactopyranose | 41545-55-5 | 2g |
| GC5342-5g | 1,2,3,4,6-Penta-O-benzoyl-a-D-galactopyranose | 41545-55-5 | 5g |
| GC5342-10g | 1,2,3,4,6-Penta-O-benzoyl-a-D-galactopyranose | 41545-55-5 | 10g |
| GC5342-25g | 1,2,3,4,6-Penta-O-benzoyl-a-D-galactopyranose | 41545-55-5 | 25g |
| GC9382-1g | 1,2,3,4,6-Penta-O-benzoyl-a-D-glucopyranose | 22415-91-4 | 1g |
| GC9382-2g | 1,2,3,4,6-Penta-O-benzoyl-a-D-glucopyranose | 22415-91-4 | 2g |
| GC9382-5g | 1,2,3,4,6-Penta-O-benzoyl-a-D-glucopyranose | 22415-91-4 | 5g |
| GC9382-10g | 1,2,3,4,6-Penta-O-benzoyl-a-D-glucopyranose | 22415-91-4 | 10g |
| GC4585-10g | 1,2,3,4,6-Penta-O-benzoyl-α-D-mannopyranose | 41569-33-9 | 10g |
| GC4585-25g | 1,2,3,4,6-Penta-O-benzoyl-α-D-mannopyranose | 41569-33-9 | 25g |
| GC4585-50g | 1,2,3,4,6-Penta-O-benzoyl-α-D-mannopyranose | 41569-33-9 | 50g |
| GC4585-100g | 1,2,3,4,6-Penta-O-benzoyl-α-D-mannopyranose | 41569-33-9 | 100g |
| GC4585-250g | 1,2,3,4,6-Penta-O-benzoyl-α-D-mannopyranose | 41569-33-9 | 250g |
| GC7755-1g | 1,2,3,5,6-Penta-O-tert-butyldimethylsilyl-α-D-galactofuranose | 1130008-07-9 | 1g |
| GC7755-2g | 1,2,3,5,6-Penta-O-tert-butyldimethylsilyl-α-D-galactofuranose | 1130008-07-9 | 2g |
| GC7755-5g | 1,2,3,5,6-Penta-O-tert-butyldimethylsilyl-α-D-galactofuranose | 1130008-07-9 | 5g |
| GC7755-10g | 1,2,3,5,6-Penta-O-tert-butyldimethylsilyl-α-D-galactofuranose | 1130008-07-9 | 10g |
| GC0874-500mg | 1,2,3,6-Tetra-O-benzoyl-β-D-mannopyranose | 171482-60-3 | 500mg |
| GC0874-1g | 1,2,3,6-Tetra-O-benzoyl-β-D-mannopyranose | 171482-60-3 | 1g |
| GC0874-2g | 1,2,3,6-Tetra-O-benzoyl-β-D-mannopyranose | 171482-60-3 | 2g |
| GC0874-5g | 1,2,3,6-Tetra-O-benzoyl-β-D-mannopyranose | 171482-60-3 | 5g |
| GK6052-25g | 1,2,4-Butanetriol | 3068-00-6 | 25g |
| GK6052-100g | 1,2,4-Butanetriol | 3068-00-6 | 100g |
| GK8927-25g | 1,2,4-Triazole | 288-88-0 | 25g |
| GK8927-100g | 1,2,4-Triazole | 288-88-0 | 100g |
| GK8927-250g | 1,2,4-Triazole | 288-88-0 | 250g |
| GK8927-500g | 1,2,4-Triazole | 288-88-0 | 500g |
| GC5156-2g | 1,2,4,5-Di-O-isopropylidene-b-D-fructopyranose | 25018-67-1 | 2g |
| GC5156-5g | 1,2,4,5-Di-O-isopropylidene-b-D-fructopyranose | 25018-67-1 | 5g |
| GC5156-10g | 1,2,4,5-Di-O-isopropylidene-b-D-fructopyranose | 25018-67-1 | 10g |
| GC5156-25g | 1,2,4,5-Di-O-isopropylidene-b-D-fructopyranose | 25018-67-1 | 25g |
| GC3976-500mg | 1,2,4,6-Tetra-O-acetyl-3-azido-3-deoxy-D-glucopyranose | 185114-94-7 | 500mg |
| GC3976-1g | 1,2,4,6-Tetra-O-acetyl-3-azido-3-deoxy-D-glucopyranose | 185114-94-7 | 1g |
| GC3976-2g | 1,2,4,6-Tetra-O-acetyl-3-azido-3-deoxy-D-glucopyranose | 185114-94-7 | 2g |
| GC3976-5g | 1,2,4,6-Tetra-O-acetyl-3-azido-3-deoxy-D-glucopyranose | 185114-94-7 | 5g |
| GC9637-50mg | 1,2,4,6-Tetra-O-acetyl-3-deoxy-3-fluoro-D-glucopyranose | 83602-93-1 | 50mg |
| GC9637-100mg | 1,2,4,6-Tetra-O-acetyl-3-deoxy-3-fluoro-D-glucopyranose | 83602-93-1 | 100mg |
| GC9637-250mg | 1,2,4,6-Tetra-O-acetyl-3-deoxy-3-fluoro-D-glucopyranose | 83602-93-1 | 250mg |
| GC9637-500mg | 1,2,4,6-Tetra-O-acetyl-3-deoxy-3-fluoro-D-glucopyranose | 83602-93-1 | 500mg |
| GC3054-25mg | 1,2,4,6-Tetra-O-acetyl-3-deoxy-3-fluoro-β-D-allopyranose | 25mg | |
| GC3054-50mg | 1,2,4,6-Tetra-O-acetyl-3-deoxy-3-fluoro-β-D-allopyranose | 50mg | |
| GC3054-100mg | 1,2,4,6-Tetra-O-acetyl-3-deoxy-3-fluoro-β-D-allopyranose | 100mg | |
| GC3054-250mg | 1,2,4,6-Tetra-O-acetyl-3-deoxy-3-fluoro-β-D-allopyranose | 250mg | |
| GC9556-100mg | 1,2,4,6-Tetra-O-acetyl-3-O-(2,3,4-tri-O-acetyl-β-D-xylopyranosyl)-β-D-glucopyranose | 243454-98-0 | 100mg |
| GC9556-250mg | 1,2,4,6-Tetra-O-acetyl-3-O-(2,3,4-tri-O-acetyl-β-D-xylopyranosyl)-β-D-glucopyranose | 243454-98-0 | 250mg |
| GC9556-500mg | 1,2,4,6-Tetra-O-acetyl-3-O-(2,3,4-tri-O-acetyl-β-D-xylopyranosyl)-β-D-glucopyranose | 243454-98-0 | 500mg |
| GC9556-1g | 1,2,4,6-Tetra-O-acetyl-3-O-(2,3,4-tri-O-acetyl-β-D-xylopyranosyl)-β-D-glucopyranose | 243454-98-0 | 1g |
| GC0188-1g | 1,2,4,6-Tetra-O-acetyl-3-O-allyl-β-D-glucopyranose | 39698-00-5 | 1g |
| GC0188-2g | 1,2,4,6-Tetra-O-acetyl-3-O-allyl-β-D-glucopyranose | 39698-00-5 | 2g |
| GC0188-5g | 1,2,4,6-Tetra-O-acetyl-3-O-allyl-β-D-glucopyranose | 39698-00-5 | 5g |
| GC0188-10g | 1,2,4,6-Tetra-O-acetyl-3-O-allyl-β-D-glucopyranose | 39698-00-5 | 10g |
| GC2036-1g | 1,2,4,6-Tetra-O-acetyl-3-O-benzyl-b-D-glucopyranose | 39686-94-7 | 1g |
| GC2036-2g | 1,2,4,6-Tetra-O-acetyl-3-O-benzyl-b-D-glucopyranose | 39686-94-7 | 2g |
| GC2036-5g | 1,2,4,6-Tetra-O-acetyl-3-O-benzyl-b-D-glucopyranose | 39686-94-7 | 5g |
| GC2036-10g | 1,2,4,6-Tetra-O-acetyl-3-O-benzyl-b-D-glucopyranose | 39686-94-7 | 10g |
| GC2036-25g | 1,2,4,6-Tetra-O-acetyl-3-O-benzyl-b-D-glucopyranose | 39686-94-7 | 25g |
| GC8270-25mg | 1,2,4,6-Tetra-O-acetyl-3-O-carbamoyl-α-D-mannopyranose | 99748-11-5 | 25mg |
| GC8270-50mg | 1,2,4,6-Tetra-O-acetyl-3-O-carbamoyl-α-D-mannopyranose | 99748-11-5 | 50mg |
| GC8270-100mg | 1,2,4,6-Tetra-O-acetyl-3-O-carbamoyl-α-D-mannopyranose | 99748-11-5 | 100mg |
| GC8270-250mg | 1,2,4,6-Tetra-O-acetyl-3-O-carbamoyl-α-D-mannopyranose | 99748-11-5 | 250mg |
| GC5146-500mg | 1,2,4,6-Tetra-O-acetyl-β-D-glucopyranose | 27086-14-2 | 500mg |
| GC5146-1g | 1,2,4,6-Tetra-O-acetyl-β-D-glucopyranose | 27086-14-2 | 1g |
| GC5146-2g | 1,2,4,6-Tetra-O-acetyl-β-D-glucopyranose | 27086-14-2 | 2g |
| GC5146-5g | 1,2,4,6-Tetra-O-acetyl-β-D-glucopyranose | 27086-14-2 | 5g |
| GC1750-2g | 1,2:3,4-Di-O-isopropylidene-6-O-mesyl-α-D-galactopyranose | 4148-55-4 | 2g |
| GC1750-5g | 1,2:3,4-Di-O-isopropylidene-6-O-mesyl-α-D-galactopyranose | 4148-55-4 | 5g |
| GC1750-10g | 1,2:3,4-Di-O-isopropylidene-6-O-mesyl-α-D-galactopyranose | 4148-55-4 | 10g |
| GC1750-25g | 1,2:3,4-Di-O-isopropylidene-6-O-mesyl-α-D-galactopyranose | 4148-55-4 | 25g |
| GC3852-5g | 1,2:3,4-Di-O-isopropylidene-6-O-p-toluenesulfonyl-a-D-galactopyranose | 4478-43-7 | 5g |
| GC3852-10g | 1,2:3,4-Di-O-isopropylidene-6-O-p-toluenesulfonyl-a-D-galactopyranose | 4478-43-7 | 10g |
| GC3852-25g | 1,2:3,4-Di-O-isopropylidene-6-O-p-toluenesulfonyl-a-D-galactopyranose | 4478-43-7 | 25g |
| GC3852-50g | 1,2:3,4-Di-O-isopropylidene-6-O-p-toluenesulfonyl-a-D-galactopyranose | 4478-43-7 | 50g |
| GC2289-25g | 1,2:3,4-Di-O-isopropylidene-alpha-D-galactopyranose | 4064-06-6 | 25g |
| GC9085-1g | 1,2:3,4-Di-O-isopropylidene-α-D-galactopyranuronic acid methyl ester | 18524-41-9 | 1g |
| GC9085-2g | 1,2:3,4-Di-O-isopropylidene-α-D-galactopyranuronic acid methyl ester | 18524-41-9 | 2g |
| GC9085-5g | 1,2:3,4-Di-O-isopropylidene-α-D-galactopyranuronic acid methyl ester | 18524-41-9 | 5g |
| GC9085-10g | 1,2:3,4-Di-O-isopropylidene-α-D-galactopyranuronic acid methyl ester | 18524-41-9 | 10g |
| GC8025-250mg | 1,2:3,4-Di-O-isopropylidene-α-L-galactopyranose | 70932-37-5 | 250mg |
| GC8025-500mg | 1,2:3,4-Di-O-isopropylidene-α-L-galactopyranose | 70932-37-5 | 500mg |
| GC8025-1g | 1,2:3,4-Di-O-isopropylidene-α-L-galactopyranose | 70932-37-5 | 1g |
| GC8025-2g | 1,2:3,4-Di-O-isopropylidene-α-L-galactopyranose | 70932-37-5 | 2g |
| GC2245-5g | 1,2:3,5-Di-O-isopropylidene-a-D-xylofuranose | 20881-04-3 | 5g |
| GC2245-10g | 1,2:3,5-Di-O-isopropylidene-a-D-xylofuranose | 20881-04-3 | 10g |
| GC2245-25g | 1,2:3,5-Di-O-isopropylidene-a-D-xylofuranose | 20881-04-3 | 25g |
| GC2245-100g | 1,2:3,5-Di-O-isopropylidene-a-D-xylofuranose | 20881-04-3 | 100g |
| GC3064-1g | 1,2:5,6-Di-O-isopropylidene-3-O-tosyl-α-D-glucofuranose | 3253-75-6 | 1g |
| GC3064-2g | 1,2:5,6-Di-O-isopropylidene-3-O-tosyl-α-D-glucofuranose | 3253-75-6 | 2g |
| GC3064-5g | 1,2:5,6-Di-O-isopropylidene-3-O-tosyl-α-D-glucofuranose | 3253-75-6 | 5g |
| GC3064-10g | 1,2:5,6-Di-O-isopropylidene-3-O-tosyl-α-D-glucofuranose | 3253-75-6 | 10g |
| GC3745-100mg | 1,2:5,6-Di-O-isopropylidene-a-D-gulofuranose | 14686-89-6 | 100mg |
| GC3745-500mg | 1,2:5,6-Di-O-isopropylidene-a-D-gulofuranose | 14686-89-6 | 500mg |
| GC3745-1g | 1,2:5,6-Di-O-isopropylidene-a-D-gulofuranose | 14686-89-6 | 1g |
| GC2354-1g | 1,2:5,6-Di-O-isopropylidene-alpha-D-allofuranose | 2595-05-3 | 1g |
| GC2354-5g | 1,2:5,6-Di-O-isopropylidene-alpha-D-allofuranose | 2595-05-3 | 5g |
| GC2354-10g | 1,2:5,6-Di-O-isopropylidene-alpha-D-allofuranose | 2595-05-3 | 10g |
| GC2055-100g | 1,2:5,6-Di-O-isopropylidene-α-D-glucofuranose | 582-52-5 | 100g |
| GC2055-250g | 1,2:5,6-Di-O-isopropylidene-α-D-glucofuranose | 582-52-5 | 250g |
| GC2055-500g | 1,2:5,6-Di-O-isopropylidene-α-D-glucofuranose | 582-52-5 | 500g |
| GC2055-1kg | 1,2:5,6-Di-O-isopropylidene-α-D-glucofuranose | 582-52-5 | 1kg |
| GC6909-250mg | 1,2:5,6-Di-O-isopropylidene-α-D-glucofuranose-1,2,3,4,5,6-13C6 | 126590-65-6 | 250mg |
| GC6909-500mg | 1,2:5,6-Di-O-isopropylidene-α-D-glucofuranose-1,2,3,4,5,6-13C6 | 126590-65-6 | 500mg |
| GC6909-1g | 1,2:5,6-Di-O-isopropylidene-α-D-glucofuranose-1,2,3,4,5,6-13C6 | 126590-65-6 | 1g |
| GC6909-2g | 1,2:5,6-Di-O-isopropylidene-α-D-glucofuranose-1,2,3,4,5,6-13C6 | 126590-65-6 | 2g |
| GC6909-5g | 1,2:5,6-Di-O-isopropylidene-α-D-glucofuranose-1,2,3,4,5,6-13C6 | 126590-65-6 | 5g |
| GC5451-1g | 1,2:5,6-Di-O-isopropylidene-α-D-ribo-hexofuranose-3-ulose | 2847-00-9 | 1g |
| GC5451-2g | 1,2:5,6-Di-O-isopropylidene-α-D-ribo-hexofuranose-3-ulose | 2847-00-9 | 2g |
| GC5451-5g | 1,2:5,6-Di-O-isopropylidene-α-D-ribo-hexofuranose-3-ulose | 2847-00-9 | 5g |
| GC5451-10g | 1,2:5,6-Di-O-isopropylidene-α-D-ribo-hexofuranose-3-ulose | 2847-00-9 | 10g |
| GC5451-25g | 1,2:5,6-Di-O-isopropylidene-α-D-ribo-hexofuranose-3-ulose | 2847-00-9 | 25g |
| GK9001-50g | 1,3-Benzodioxole | 274-09-9 | 50g |
| GW3521-1g | 1,3-bis(Aminooxy)propan dihydrochloride | 104845-82-1 | 1g |
| GW3521-5g | 1,3-bis(Aminooxy)propan dihydrochloride | 104845-82-1 | 5g |
| GM0020-25g | 1,3-Bis(tert-butoxycarbonyl)-2-methyl-2-thiopseudourea | 107819-90-9 | 25g |
| GL1795-25g | 1,3-Diamino-2-propanol | 616-29-5 | 25g |
| GL1795-100g | 1,3-Diamino-2-propanol | 616-29-5 | 100g |
| GK6415-25g | 1,3-Dibromo-5,5-dimethylhydantoin | 77-48-5 | 25g |
| GK6415-100g | 1,3-Dibromo-5,5-dimethylhydantoin | 77-48-5 | 100g |
| GK6415-250g | 1,3-Dibromo-5,5-dimethylhydantoin | 77-48-5 | 250g |
| GK6415-500g | 1,3-Dibromo-5,5-dimethylhydantoin | 77-48-5 | 500g |
| GL5447-25g | 1,3-Diethyl-1,3-diphenylurea | 85-98-3 | 25g |
| GL5447-100g | 1,3-Diethyl-1,3-diphenylurea | 85-98-3 | 100g |
| GL5447-250g | 1,3-Diethyl-1,3-diphenylurea | 85-98-3 | 250g |
| GK7697-25g | 1,3-Diethyl-2-thiourea | 105-55-5 | 25g |
| GK7697-250g | 1,3-Diethyl-2-thiourea | 105-55-5 | 250g |
| GW5128-100mg | 1,3-Dihydro-1-hydroxy-3,3-dimethyl-1,2-benziodoxole | 69429-70-5 | 100mg |
| GW5128-1g | 1,3-Dihydro-1-hydroxy-3,3-dimethyl-1,2-benziodoxole | 69429-70-5 | 1g |
| GT2891-1g | 1,3-Dihydroxynaphthalene | 132-86-5 | 1g |
| GT2891-5g | 1,3-Dihydroxynaphthalene | 132-86-5 | 5g |
| GX7393-1g | 1,3-Dimethoxy-5-iodobenzene | 25245-27-6 | 1g |
| GK4775-100ml | 1,3-Dimethyl-2-imidazolidinone | 80-73-9 | 100ml |
| GK4775-500ml | 1,3-Dimethyl-2-imidazolidinone | 80-73-9 | 500ml |
| GK4775-1l | 1,3-Dimethyl-2-imidazolidinone | 80-73-9 | 1l |
| GK5288-25g | 1,3-Diphenylguanidine | 102-06-7 | 25g |
| GK1429-25g | 1,3-Diphenylurea | 102-07-8 | 25g |
| GK1429-100g | 1,3-Diphenylurea | 102-07-8 | 100g |
| GK1429-250g | 1,3-Diphenylurea | 102-07-8 | 250g |
| GK1429-500g | 1,3-Diphenylurea | 102-07-8 | 500g |
| GK6085-25g | 1,3-Indanedione | 606-23-5 | 25g |
| GC8272-5g | 1,3-O-Benzylidene-D-arabitol | 70831-50-4 | 5g |
| GC8272-10g | 1,3-O-Benzylidene-D-arabitol | 70831-50-4 | 10g |
| GC8272-25g | 1,3-O-Benzylidene-D-arabitol | 70831-50-4 | 25g |
| GC8272-50g | 1,3-O-Benzylidene-D-arabitol | 70831-50-4 | 50g |
| GE8945-25g | 1,3-Propanesultone | 1120-71-4 | 25g |
| GE8945-100g | 1,3-Propanesultone | 1120-71-4 | 100g |
| GC7605-1g | 1,3,4-Tri-O-acetyl-2-amino-2-deoxy-N-(4-methoxybenzylidene)-6-O-tosyl-β-D-glucopyranose | 6619-11-0 | 1g |
| GC7605-2g | 1,3,4-Tri-O-acetyl-2-amino-2-deoxy-N-(4-methoxybenzylidene)-6-O-tosyl-β-D-glucopyranose | 6619-11-0 | 2g |
| GC7605-5g | 1,3,4-Tri-O-acetyl-2-amino-2-deoxy-N-(4-methoxybenzylidene)-6-O-tosyl-β-D-glucopyranose | 6619-11-0 | 5g |
| GC7605-10g | 1,3,4-Tri-O-acetyl-2-amino-2-deoxy-N-(4-methoxybenzylidene)-6-O-tosyl-β-D-glucopyranose | 6619-11-0 | 10g |
| GC7605-25g | 1,3,4-Tri-O-acetyl-2-amino-2-deoxy-N-(4-methoxybenzylidene)-6-O-tosyl-β-D-glucopyranose | 6619-11-0 | 25g |
| GC2084-250mg | 1,3,4-Tri-O-acetyl-2-amino-2,6-dideoxy-6-iodo-N-(4-methoxybenzylidene)-β-D-glucopyranose | 113535-31-2 | 250mg |
| GC2084-500mg | 1,3,4-Tri-O-acetyl-2-amino-2,6-dideoxy-6-iodo-N-(4-methoxybenzylidene)-β-D-glucopyranose | 113535-31-2 | 500mg |
| GC2084-1g | 1,3,4-Tri-O-acetyl-2-amino-2,6-dideoxy-6-iodo-N-(4-methoxybenzylidene)-β-D-glucopyranose | 113535-31-2 | 1g |
| GC2084-2g | 1,3,4-Tri-O-acetyl-2-amino-2,6-dideoxy-6-iodo-N-(4-methoxybenzylidene)-β-D-glucopyranose | 113535-31-2 | 2g |
| GC9402-100mg | 1,3,4-Tri-O-acetyl-2-azido-2-deoxy-6-O-trityl-β-D-glucopyranose | 100mg | |
| GC9402-250mg | 1,3,4-Tri-O-acetyl-2-azido-2-deoxy-6-O-trityl-β-D-glucopyranose | 250mg | |
| GC9402-500mg | 1,3,4-Tri-O-acetyl-2-azido-2-deoxy-6-O-trityl-β-D-glucopyranose | 500mg | |
| GC9402-1g | 1,3,4-Tri-O-acetyl-2-azido-2-deoxy-6-O-trityl-β-D-glucopyranose | 1g | |
| GC9402-2g | 1,3,4-Tri-O-acetyl-2-azido-2-deoxy-6-O-trityl-β-D-glucopyranose | 2g | |
| GC5048-10mg | 1,3,4-Tri-O-acetyl-2-azido-2-deoxy-α-L-fucopyranose | 115435-17-1 | 10mg |
| GC5048-25mg | 1,3,4-Tri-O-acetyl-2-azido-2-deoxy-α-L-fucopyranose | 115435-17-1 | 25mg |
| GC5048-50mg | 1,3,4-Tri-O-acetyl-2-azido-2-deoxy-α-L-fucopyranose | 115435-17-1 | 50mg |
| GC5048-100mg | 1,3,4-Tri-O-acetyl-2-azido-2-deoxy-α-L-fucopyranose | 115435-17-1 | 100mg |
| GC3731-25mg | 1,3,4-Tri-O-acetyl-2-azido-2-deoxy-β-D-glucopyranuronic acid methyl ester | 25mg | |
| GC3731-50mg | 1,3,4-Tri-O-acetyl-2-azido-2-deoxy-β-D-glucopyranuronic acid methyl ester | 50mg | |
| GC3731-100mg | 1,3,4-Tri-O-acetyl-2-azido-2-deoxy-β-D-glucopyranuronic acid methyl ester | 100mg | |
| GC3731-250mg | 1,3,4-Tri-O-acetyl-2-azido-2-deoxy-β-D-glucopyranuronic acid methyl ester | 250mg | |
| GC2139-10mg | 1,3,4-Tri-O-acetyl-2-deoxy-2-fluoro-L-fucopyranose | 188783-78-0 | 10mg |
| GC2139-25mg | 1,3,4-Tri-O-acetyl-2-deoxy-2-fluoro-L-fucopyranose | 188783-78-0 | 25mg |
| GC2139-50mg | 1,3,4-Tri-O-acetyl-2-deoxy-2-fluoro-L-fucopyranose | 188783-78-0 | 50mg |
| GC2139-100mg | 1,3,4-Tri-O-acetyl-2-deoxy-2-fluoro-L-fucopyranose | 188783-78-0 | 100mg |
| GC3163-5mg | 1,3,4-Tri-O-acetyl-2-deoxy-2-fluoro-α-L-fucopyranose | 74554-12-4 | 5mg |
| GC3163-10mg | 1,3,4-Tri-O-acetyl-2-deoxy-2-fluoro-α-L-fucopyranose | 74554-12-4 | 10mg |
| GC3163-25mg | 1,3,4-Tri-O-acetyl-2-deoxy-2-fluoro-α-L-fucopyranose | 74554-12-4 | 25mg |
| GC3163-50mg | 1,3,4-Tri-O-acetyl-2-deoxy-2-fluoro-α-L-fucopyranose | 74554-12-4 | 50mg |
| GC8538-25mg | 1,3,4-Tri-O-acetyl-2-deoxy-D-glucopyranose | 221910-20-9 | 25mg |
| GC8538-50mg | 1,3,4-Tri-O-acetyl-2-deoxy-D-glucopyranose | 221910-20-9 | 50mg |
| GC8538-100mg | 1,3,4-Tri-O-acetyl-2-deoxy-D-glucopyranose | 221910-20-9 | 100mg |
| GC8538-250mg | 1,3,4-Tri-O-acetyl-2-deoxy-D-glucopyranose | 221910-20-9 | 250mg |
| GC3173-250mg | 1,3,4-Tri-O-acetyl-2-deoxy-D-xylopyranose | 101628-74-4 | 250mg |
| GC3173-500mg | 1,3,4-Tri-O-acetyl-2-deoxy-D-xylopyranose | 101628-74-4 | 500mg |
| GC3173-1g | 1,3,4-Tri-O-acetyl-2-deoxy-D-xylopyranose | 101628-74-4 | 1g |
| GC3173-2g | 1,3,4-Tri-O-acetyl-2-deoxy-D-xylopyranose | 101628-74-4 | 2g |
| GC3173-5g | 1,3,4-Tri-O-acetyl-2-deoxy-D-xylopyranose | 101628-74-4 | 5g |
| GC3675-10mg | 1,3,4-Tri-O-acetyl-2,6-dideoxy-D-glucopyranose | 89063-61-6 | 10mg |
| GC3675-25mg | 1,3,4-Tri-O-acetyl-2,6-dideoxy-D-glucopyranose | 89063-61-6 | 25mg |
| GC3675-50mg | 1,3,4-Tri-O-acetyl-2,6-dideoxy-D-glucopyranose | 89063-61-6 | 50mg |
| GC3675-100mg | 1,3,4-Tri-O-acetyl-2,6-dideoxy-D-glucopyranose | 89063-61-6 | 100mg |
| GC9503-25mg | 1,3,4,6-Tetra-O-acetyl-2-amino-2-deoxy-D-galactopyranose hydrochloride | 1355005-40-1 | 25mg |
| GC9503-50mg | 1,3,4,6-Tetra-O-acetyl-2-amino-2-deoxy-D-galactopyranose hydrochloride | 1355005-40-1 | 50mg |
| GC9503-100mg | 1,3,4,6-Tetra-O-acetyl-2-amino-2-deoxy-D-galactopyranose hydrochloride | 1355005-40-1 | 100mg |
| GC9503-250mg | 1,3,4,6-Tetra-O-acetyl-2-amino-2-deoxy-D-galactopyranose hydrochloride | 1355005-40-1 | 250mg |
| GC0435-250mg | 1,3,4,6-Tetra-O-acetyl-2-amino-2-deoxy-N-(4-methoxybenzylidene)-β-D-galactopyranose | 34948-61-3 | 250mg |
| GC0435-500mg | 1,3,4,6-Tetra-O-acetyl-2-amino-2-deoxy-N-(4-methoxybenzylidene)-β-D-galactopyranose | 34948-61-3 | 500mg |
| GC0435-1g | 1,3,4,6-Tetra-O-acetyl-2-amino-2-deoxy-N-(4-methoxybenzylidene)-β-D-galactopyranose | 34948-61-3 | 1g |
| GC0435-2g | 1,3,4,6-Tetra-O-acetyl-2-amino-2-deoxy-N-(4-methoxybenzylidene)-β-D-galactopyranose | 34948-61-3 | 2g |
| GC6829-100mg | 1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-a-D-glucopyranose | 56883-33-1 | 100mg |
| GC6829-250mg | 1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-a-D-glucopyranose | 56883-33-1 | 250mg |
| GC6829-500mg | 1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-a-D-glucopyranose | 56883-33-1 | 500mg |
| GC6829-1g | 1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-a-D-glucopyranose | 56883-33-1 | 1g |
| GC6829-2g | 1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-a-D-glucopyranose | 56883-33-1 | 2g |
| GC5410-1g | 1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-D-glucopyranose | 171032-74-9 | 1g |
| GC5410-2g | 1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-D-glucopyranose | 171032-74-9 | 2g |
| GC5410-5g | 1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-D-glucopyranose | 171032-74-9 | 5g |
| GC5410-10g | 1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-D-glucopyranose | 171032-74-9 | 10g |
| GC0260-1g | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-(2,2,2-trichloroethoxycarbonylamino)-D-glucopyranose | 114360-77-9 | 1g |
| GC0260-2g | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-(2,2,2-trichloroethoxycarbonylamino)-D-glucopyranose | 114360-77-9 | 2g |
| GC0260-5g | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-(2,2,2-trichloroethoxycarbonylamino)-D-glucopyranose | 114360-77-9 | 5g |
| GC0260-10g | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-(2,2,2-trichloroethoxycarbonylamino)-D-glucopyranose | 114360-77-9 | 10g |
| GC7722-50mg | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-fluoro-D-galactopyranose | 262607-48-7 | 50mg |
| GC7722-100mg | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-fluoro-D-galactopyranose | 262607-48-7 | 100mg |
| GC7722-250mg | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-fluoro-D-galactopyranose | 262607-48-7 | 250mg |
| GC7722-500mg | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-fluoro-D-galactopyranose | 262607-48-7 | 500mg |
| GC4769-250mg | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-iodo-a-D-glucopyranose | 95672-63-2 | 250mg |
| GC4769-500mg | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-iodo-a-D-glucopyranose | 95672-63-2 | 500mg |
| GC4769-1g | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-iodo-a-D-glucopyranose | 95672-63-2 | 1g |
| GC4769-2g | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-iodo-a-D-glucopyranose | 95672-63-2 | 2g |
| GC5256-100mg | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-iodo-D-galactopyranose | 1286737-83-4 | 100mg |
| GC5256-250mg | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-iodo-D-galactopyranose | 1286737-83-4 | 250mg |
| GC5256-500mg | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-iodo-D-galactopyranose | 1286737-83-4 | 500mg |
| GC5256-1g | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-iodo-D-galactopyranose | 1286737-83-4 | 1g |
| GC3729-100mg | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-iodo-β-D-galactopyranose | 141510-66-9 | 100mg |
| GC3729-250mg | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-iodo-β-D-galactopyranose | 141510-66-9 | 250mg |
| GC3729-500mg | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-iodo-β-D-galactopyranose | 141510-66-9 | 500mg |
| GC3729-1g | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-iodo-β-D-galactopyranose | 141510-66-9 | 1g |
| GC0802-1g | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-phthalimido-α-D-glucopyranose | 31505-44-9 | 1g |
| GC0802-2g | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-phthalimido-α-D-glucopyranose | 31505-44-9 | 2g |
| GC0802-5g | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-phthalimido-α-D-glucopyranose | 31505-44-9 | 5g |
| GC0802-10g | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-phthalimido-α-D-glucopyranose | 31505-44-9 | 10g |
| GC2974-1g | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-trichloroacetylamino-β-D-glucopyranose | 10353-00-1 | 1g |
| GC2974-2g | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-trichloroacetylamino-β-D-glucopyranose | 10353-00-1 | 2g |
| GC2974-5g | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-trichloroacetylamino-β-D-glucopyranose | 10353-00-1 | 5g |
| GC2974-10g | 1,3,4,6-Tetra-O-acetyl-2-deoxy-2-trichloroacetylamino-β-D-glucopyranose | 10353-00-1 | 10g |
| GC7946-5g | 1,3,4,6-Tetra-O-acetyl-b-D-glucosamine hydrochloride | 10034-20-5 | 5g |
| GC7946-10g | 1,3,4,6-Tetra-O-acetyl-b-D-glucosamine hydrochloride | 10034-20-5 | 10g |
| GC7946-25g | 1,3,4,6-Tetra-O-acetyl-b-D-glucosamine hydrochloride | 10034-20-5 | 25g |
| GC7946-50g | 1,3,4,6-Tetra-O-acetyl-b-D-glucosamine hydrochloride | 10034-20-5 | 50g |
| GC7946-100g | 1,3,4,6-Tetra-O-acetyl-b-D-glucosamine hydrochloride | 10034-20-5 | 100g |
| GC2618-500mg | 1,3,4,6-Tetra-O-acetyl-b-D-mannopyranose | 18968-05-3 | 500mg |
| GC2618-1g | 1,3,4,6-Tetra-O-acetyl-b-D-mannopyranose | 18968-05-3 | 1g |
| GC2618-2g | 1,3,4,6-Tetra-O-acetyl-b-D-mannopyranose | 18968-05-3 | 2g |
| GC2618-5g | 1,3,4,6-Tetra-O-acetyl-b-D-mannopyranose | 18968-05-3 | 5g |
| GC3318-100mg | 1,3,4,6-Tetra-O-acetyl-N-propanoyl-D-mannosamine | 379219-32-6 | 100mg |
| GC3318-250mg | 1,3,4,6-Tetra-O-acetyl-N-propanoyl-D-mannosamine | 379219-32-6 | 250mg |
| GC3318-500mg | 1,3,4,6-Tetra-O-acetyl-N-propanoyl-D-mannosamine | 379219-32-6 | 500mg |
| GC3318-1g | 1,3,4,6-Tetra-O-acetyl-N-propanoyl-D-mannosamine | 379219-32-6 | 1g |
| GK6321-25g | 1,3,5-Benzenetricarboxylic acid | 554-95-0 | 25g |
| GK6321-100g | 1,3,5-Benzenetricarboxylic acid | 554-95-0 | 100g |
| GK1486-10g | 1,3,5-Benzenetricarboxylic acid chloride | 4422-95-1 | 10g |
| GK1486-25g | 1,3,5-Benzenetricarboxylic acid chloride | 4422-95-1 | 25g |
| GC1101-1g | 1,3,5-O-Methylidyne-myo-inositol | 98510-20-4 | 1g |
| GC1101-2g | 1,3,5-O-Methylidyne-myo-inositol | 98510-20-4 | 2g |
| GC1101-5g | 1,3,5-O-Methylidyne-myo-inositol | 98510-20-4 | 5g |
| GC1101-10g | 1,3,5-O-Methylidyne-myo-inositol | 98510-20-4 | 10g |
| GC1101-25g | 1,3,5-O-Methylidyne-myo-inositol | 98510-20-4 | 25g |
| GC8131-250mg | 1,3,5-Tri-O-benzoyl-α-D-arabinofuranose | 314289-48-0 | 250mg |
| GC8131-500mg | 1,3,5-Tri-O-benzoyl-α-D-arabinofuranose | 314289-48-0 | 500mg |
| GC8131-1g | 1,3,5-Tri-O-benzoyl-α-D-arabinofuranose | 314289-48-0 | 1g |
| GC8131-2g | 1,3,5-Tri-O-benzoyl-α-D-arabinofuranose | 314289-48-0 | 2g |
| GC2888-1mg | 1,3,6-Tri-O-galloyl glucose | 18483-17-5 | 1mg |
| GC4459-1g | 1,3,6,7-Tetrahydroxyxanthone-C2-b-D-glucoside | 4773-96-0 | 1g |
| GW4466-2500mg | 1,3,6,8-Pyrenetetrasulfonic acid tetrasodium salt | 59572-10-0 | 2500mg |
| GW4466-10g | 1,3,6,8-Pyrenetetrasulfonic acid tetrasodium salt | 59572-10-0 | 10g |
| GC8478-25mg | 1,4-Anhydro-2-deoxy-2-iodo-β-D-galactopyranose | 161254-78-0 | 25mg |
| GC8478-50mg | 1,4-Anhydro-2-deoxy-2-iodo-β-D-galactopyranose | 161254-78-0 | 50mg |
| GC8478-100mg | 1,4-Anhydro-2-deoxy-2-iodo-β-D-galactopyranose | 161254-78-0 | 100mg |
| GC8478-250mg | 1,4-Anhydro-2-deoxy-2-iodo-β-D-galactopyranose | 161254-78-0 | 250mg |
| GC3619-10g | 1,4-Anhydro-D-erythritol | 4358-64-9 | 10g |
| GC3619-25g | 1,4-Anhydro-D-erythritol | 4358-64-9 | 25g |
| GC3619-50g | 1,4-Anhydro-D-erythritol | 4358-64-9 | 50g |
| GC3619-100g | 1,4-Anhydro-D-erythritol | 4358-64-9 | 100g |
| GC3216-100mg | 1,4-Anhydro-D-mannitol | 7726-97-8 | 100mg |
| GC3216-250mg | 1,4-Anhydro-D-mannitol | 7726-97-8 | 250mg |
| GC3216-500mg | 1,4-Anhydro-D-mannitol | 7726-97-8 | 500mg |
| GC3216-1g | 1,4-Anhydro-D-mannitol | 7726-97-8 | 1g |
| GX5730-10g | 1,4-Butanediol diglycidyl ether | 2425-79-8 | 10g |
| GX5730-25g | 1,4-Butanediol diglycidyl ether | 2425-79-8 | 25g |
| GX5730-100g | 1,4-Butanediol diglycidyl ether | 2425-79-8 | 100g |
| GW7558-25mg | 1,4-Cubanebis(dimethylamide) | 133180-93-5 | 25mg |
| GW7558-100mg | 1,4-Cubanebis(dimethylamide) | 133180-93-5 | 100mg |
| GW0129-250mg | 1,4-Cubanedicarboxylic acid | 32846-66-5 | 250mg |
| GW0129-1g | 1,4-Cubanedicarboxylic acid | 32846-66-5 | 1g |
| GW0910-25mg | 1,4-Cubanediol | 133393-43-8 | 25mg |
| GW0910-100mg | 1,4-Cubanediol | 133393-43-8 | 100mg |
| GK2466-25g | 1,4-Diazabicyclo(2.2.2)octane | 280-57-9 | 25g |
| GK2466-100g | 1,4-Diazabicyclo(2.2.2)octane | 280-57-9 | 100g |
| GK2466-250g | 1,4-Diazabicyclo(2.2.2)octane | 280-57-9 | 250g |
| GK2466-500g | 1,4-Diazabicyclo(2.2.2)octane | 280-57-9 | 500g |
| GS0901-100ml | 1,4-Dioxan, GlenDry™, anhydrous | 123-91-1 | 100ml |
| GS0901-500ml | 1,4-Dioxan, GlenDry™, anhydrous | 123-91-1 | 500ml |
| GS0901-1l | 1,4-Dioxan, GlenDry™, anhydrous | 123-91-1 | 1l |
| GS0901-2500ml | 1,4-Dioxan, GlenDry™, anhydrous | 123-91-1 | 2500ml |
| GS3872-100ml | 1,4-Dioxan, GlenDry™, anhydrous over molecular sieve | 123-91-1 | 100ml |
| GS3872-500ml | 1,4-Dioxan, GlenDry™, anhydrous over molecular sieve | 123-91-1 | 500ml |
| GS3872-1l | 1,4-Dioxan, GlenDry™, anhydrous over molecular sieve | 123-91-1 | 1l |
| GS3872-2500ml | 1,4-Dioxan, GlenDry™, anhydrous over molecular sieve | 123-91-1 | 2500ml |
| GS5840-500ml | 1,4-Dioxan, GlenPure™, analytical grade | 123-91-1 | 500ml |
| GS5840-1l | 1,4-Dioxan, GlenPure™, analytical grade | 123-91-1 | 1l |
| GS5840-2500ml | 1,4-Dioxan, GlenPure™, analytical grade | 123-91-1 | 2500ml |
| GK4038-100ml | 1,4-Dioxane | 123-91-1 | 100ml |
| GK4038-250ml | 1,4-Dioxane | 123-91-1 | 250ml |
| GK4038-500ml | 1,4-Dioxane | 123-91-1 | 500ml |
| GK4038-1l | 1,4-Dioxane | 123-91-1 | 1l |
| GE5960-1g | 1,4-Dithioerythritol | 6892-68-8 | 1g |
| GE5960-5g | 1,4-Dithioerythritol | 6892-68-8 | 5g |
| GE5960-10g | 1,4-Dithioerythritol | 6892-68-8 | 10g |
| GE5960-25g | 1,4-Dithioerythritol | 6892-68-8 | 25g |
| GK9026-500g | 1,4-Naphthoquinone | 130-15-4 | 500g |
| GC3468-50mg | 1,4,5,6-Tetra-O-acetyl-3-O-tosyl-myo-inositol | 4079-34-9 | 50mg |
| GC3468-100mg | 1,4,5,6-Tetra-O-acetyl-3-O-tosyl-myo-inositol | 4079-34-9 | 100mg |
| GC3468-250mg | 1,4,5,6-Tetra-O-acetyl-3-O-tosyl-myo-inositol | 4079-34-9 | 250mg |
| GC3468-500mg | 1,4,5,6-Tetra-O-acetyl-3-O-tosyl-myo-inositol | 4079-34-9 | 500mg |
| GC3468-1g | 1,4,5,6-Tetra-O-acetyl-3-O-tosyl-myo-inositol | 4079-34-9 | 1g |
| GC8879-100mg | 1,4,5,6-Tetra-O-benzyl-3-O-tosyl-DL-myo-inositol | 97371-75-0 | 100mg |
| GC8879-250mg | 1,4,5,6-Tetra-O-benzyl-3-O-tosyl-DL-myo-inositol | 97371-75-0 | 250mg |
| GC8879-500mg | 1,4,5,6-Tetra-O-benzyl-3-O-tosyl-DL-myo-inositol | 97371-75-0 | 500mg |
| GC8879-1g | 1,4,5,6-Tetra-O-benzyl-3-O-tosyl-DL-myo-inositol | 97371-75-0 | 1g |
| GC5709-100mg | 1,4,5,6-Tetra-O-benzyl-DL-myo-inositol | 26276-99-3 | 100mg |
| GC5709-250mg | 1,4,5,6-Tetra-O-benzyl-DL-myo-inositol | 26276-99-3 | 250mg |
| GC5709-500mg | 1,4,5,6-Tetra-O-benzyl-DL-myo-inositol | 26276-99-3 | 500mg |
| GC5709-1g | 1,4,5,6-Tetra-O-benzyl-DL-myo-inositol | 26276-99-3 | 1g |
| GC7939-25g | 1,4:3,6-Dianhydro-D-glucitol | 652-67-5 | 25g |
| GC7939-100g | 1,4:3,6-Dianhydro-D-glucitol | 652-67-5 | 100g |
| GC7939-250g | 1,4:3,6-Dianhydro-D-glucitol | 652-67-5 | 250g |
| GC3292-2mg | 1,4:3,6-Dianhydro-α-D-glucopyranose | 4451-30-3 | 2mg |
| GC3292-5mg | 1,4:3,6-Dianhydro-α-D-glucopyranose | 4451-30-3 | 5mg |
| GC3292-10mg | 1,4:3,6-Dianhydro-α-D-glucopyranose | 4451-30-3 | 10mg |
| GC3292-25mg | 1,4:3,6-Dianhydro-α-D-glucopyranose | 4451-30-3 | 25mg |
| GC9779-100mg | 1,5-Anhydro-D-mannitol | 492-93-3 | 100mg |
| GC9779-250mg | 1,5-Anhydro-D-mannitol | 492-93-3 | 250mg |
| GC9779-500mg | 1,5-Anhydro-D-mannitol | 492-93-3 | 500mg |
| GC9779-1g | 1,5-Anhydro-D-mannitol | 492-93-3 | 1g |
| GC8099-100mg | 1,5-Anhydro-D-sorbitol | 154-58-5 | 100mg |
| GC4721-10mg | 1,5-Anhydro-β-D-xylofuranose | 51246-91-4 | 10mg |
| GC4721-25mg | 1,5-Anhydro-β-D-xylofuranose | 51246-91-4 | 25mg |
| GC4721-50mg | 1,5-Anhydro-β-D-xylofuranose | 51246-91-4 | 50mg |
| GC4721-100mg | 1,5-Anhydro-β-D-xylofuranose | 51246-91-4 | 100mg |
| GK7051-5mg | 1,5-Isoquinolinediol | 5154-02-9 | 5mg |
| GK7051-25mg | 1,5-Isoquinolinediol | 5154-02-9 | 25mg |
| GK7051-100mg | 1,5-Isoquinolinediol | 5154-02-9 | 100mg |
| GX9598-500mg | 1,6-Anhydro-2-azido-2-deoxy-b-D-glucopyranose | 67546-20-7 | 500mg |
| GX9598-1g | 1,6-Anhydro-2-azido-2-deoxy-b-D-glucopyranose | 67546-20-7 | 1g |
| GX9598-2g | 1,6-Anhydro-2-azido-2-deoxy-b-D-glucopyranose | 67546-20-7 | 2g |
| GX9598-5g | 1,6-Anhydro-2-azido-2-deoxy-b-D-glucopyranose | 67546-20-7 | 5g |
| GX9598-10g | 1,6-Anhydro-2-azido-2-deoxy-b-D-glucopyranose | 67546-20-7 | 10g |
| GC7611-250mg | 1,6-Anhydro-2-azido-3-O-benzyl-2-deoxy-β-D-glucopyranose | 55682-57-0 | 250mg |
| GC7611-500mg | 1,6-Anhydro-2-azido-3-O-benzyl-2-deoxy-β-D-glucopyranose | 55682-57-0 | 500mg |
| GC7611-1g | 1,6-Anhydro-2-azido-3-O-benzyl-2-deoxy-β-D-glucopyranose | 55682-57-0 | 1g |
| GC7611-2g | 1,6-Anhydro-2-azido-3-O-benzyl-2-deoxy-β-D-glucopyranose | 55682-57-0 | 2g |
| GC9454-1g | 1,6-Anhydro-2-azido-3,4-di-O-benzyl-2-deoxy-β-D-glucopyranose | 55682-48-9 | 1g |
| GC9454-2g | 1,6-Anhydro-2-azido-3,4-di-O-benzyl-2-deoxy-β-D-glucopyranose | 55682-48-9 | 2g |
| GC9454-5g | 1,6-Anhydro-2-azido-3,4-di-O-benzyl-2-deoxy-β-D-glucopyranose | 55682-48-9 | 5g |
| GC9454-10g | 1,6-Anhydro-2-azido-3,4-di-O-benzyl-2-deoxy-β-D-glucopyranose | 55682-48-9 | 10g |
| GC7689-100mg | 1,6-Anhydro-2-azido-4-O-benzyl-2-deoxy-b-D-glucopyranose | 55682-47-8 | 100mg |
| GC7689-250mg | 1,6-Anhydro-2-azido-4-O-benzyl-2-deoxy-b-D-glucopyranose | 55682-47-8 | 250mg |
| GC7689-500mg | 1,6-Anhydro-2-azido-4-O-benzyl-2-deoxy-b-D-glucopyranose | 55682-47-8 | 500mg |
| GC7689-1g | 1,6-Anhydro-2-azido-4-O-benzyl-2-deoxy-b-D-glucopyranose | 55682-47-8 | 1g |
| GC4174-100mg | 1,6-Anhydro-2-deoxy-2-fluoro-β-D-glucopyranose | 23235-99-6 | 100mg |
| GC4174-250mg | 1,6-Anhydro-2-deoxy-2-fluoro-β-D-glucopyranose | 23235-99-6 | 250mg |
| GC4174-500mg | 1,6-Anhydro-2-deoxy-2-fluoro-β-D-glucopyranose | 23235-99-6 | 500mg |
| GC4174-1g | 1,6-Anhydro-2-deoxy-2-fluoro-β-D-glucopyranose | 23235-99-6 | 1g |
| GC0024-50mg | 1,6-Anhydro-2-deoxy-2-iodo-β-D-galactopyranose | 161254-77-9 | 50mg |
| GC0024-100mg | 1,6-Anhydro-2-deoxy-2-iodo-β-D-galactopyranose | 161254-77-9 | 100mg |
| GC0024-250mg | 1,6-Anhydro-2-deoxy-2-iodo-β-D-galactopyranose | 161254-77-9 | 250mg |
| GC0024-500mg | 1,6-Anhydro-2-deoxy-2-iodo-β-D-galactopyranose | 161254-77-9 | 500mg |
| GX1764-250mg | 1,6-Anhydro-2-iodo-2-deoxy-b-D-glucopyranose | 139437-39-1 | 250mg |
| GX1764-500mg | 1,6-Anhydro-2-iodo-2-deoxy-b-D-glucopyranose | 139437-39-1 | 500mg |
| GX1764-1g | 1,6-Anhydro-2-iodo-2-deoxy-b-D-glucopyranose | 139437-39-1 | 1g |
| GX1764-2g | 1,6-Anhydro-2-iodo-2-deoxy-b-D-glucopyranose | 139437-39-1 | 2g |
| GC0958-1mg | 1,6-Anhydro-2-O-α-D-glucopyranosyl-β-D-glucopyranose | 85357-26-2 | 1mg |
| GC0958-2mg | 1,6-Anhydro-2-O-α-D-glucopyranosyl-β-D-glucopyranose | 85357-26-2 | 2mg |
| GC0958-5mg | 1,6-Anhydro-2-O-α-D-glucopyranosyl-β-D-glucopyranose | 85357-26-2 | 5mg |
| GC0958-10mg | 1,6-Anhydro-2-O-α-D-glucopyranosyl-β-D-glucopyranose | 85357-26-2 | 10mg |
| GC8470-1mg | 1,6-Anhydro-2-O-β-D-glucopyranosyl-β-D-glucopyranose | 85357-25-1 | 1mg |
| GC8470-5mg | 1,6-Anhydro-2-O-β-D-glucopyranosyl-β-D-glucopyranose | 85357-25-1 | 5mg |
| GC8470-10mg | 1,6-Anhydro-2-O-β-D-glucopyranosyl-β-D-glucopyranose | 85357-25-1 | 10mg |
| GC8470-25mg | 1,6-Anhydro-2-O-β-D-glucopyranosyl-β-D-glucopyranose | 85357-25-1 | 25mg |
| GC8470-50mg | 1,6-Anhydro-2-O-β-D-glucopyranosyl-β-D-glucopyranose | 85357-25-1 | 50mg |
| GC7748-2g | 1,6-Anhydro-2,3,4-tri-O-benzyl-b-D-glucopyranose | 10548-46-6 | 2g |
| GC7748-5g | 1,6-Anhydro-2,3,4-tri-O-benzyl-b-D-glucopyranose | 10548-46-6 | 5g |
| GC7748-10g | 1,6-Anhydro-2,3,4-tri-O-benzyl-b-D-glucopyranose | 10548-46-6 | 10g |
| GC7748-25g | 1,6-Anhydro-2,3,4-tri-O-benzyl-b-D-glucopyranose | 10548-46-6 | 25g |
| GC2239-100mg | 1,6-Anhydro-2,3,4-tri-O-benzyl-β-L-idopyranose | 89157-97-1 | 100mg |
| GC2239-250mg | 1,6-Anhydro-2,3,4-tri-O-benzyl-β-L-idopyranose | 89157-97-1 | 250mg |
| GC2239-500mg | 1,6-Anhydro-2,3,4-tri-O-benzyl-β-L-idopyranose | 89157-97-1 | 500mg |
| GC2239-1g | 1,6-Anhydro-2,3,4-tri-O-benzyl-β-L-idopyranose | 89157-97-1 | 1g |
| GC3874-10mg | 1,6-Anhydro-2,4-dideoxy-4-fluoro-2-iodo-β-D-glucopyranose | 10mg | |
| GC3874-25mg | 1,6-Anhydro-2,4-dideoxy-4-fluoro-2-iodo-β-D-glucopyranose | 25mg | |
| GC3874-50mg | 1,6-Anhydro-2,4-dideoxy-4-fluoro-2-iodo-β-D-glucopyranose | 50mg | |
| GC3874-100mg | 1,6-Anhydro-2,4-dideoxy-4-fluoro-2-iodo-β-D-glucopyranose | 100mg | |
| GC6073-50mg | 1,6-Anhydro-3-O-benzoyl-2-deoxy-2-fluoro-β-D-glucopyranose | 50mg | |
| GC6073-100mg | 1,6-Anhydro-3-O-benzoyl-2-deoxy-2-fluoro-β-D-glucopyranose | 100mg | |
| GC6073-250mg | 1,6-Anhydro-3-O-benzoyl-2-deoxy-2-fluoro-β-D-glucopyranose | 250mg | |
| GC6073-500mg | 1,6-Anhydro-3-O-benzoyl-2-deoxy-2-fluoro-β-D-glucopyranose | 500mg | |
| GC7485-100mg | 1,6-Anhydro-3-O-benzyl-b-L-idopyranose | 42926-91-0 | 100mg |
| GC7485-250mg | 1,6-Anhydro-3-O-benzyl-b-L-idopyranose | 42926-91-0 | 250mg |
| GC7485-500mg | 1,6-Anhydro-3-O-benzyl-b-L-idopyranose | 42926-91-0 | 500mg |
| GC7485-1g | 1,6-Anhydro-3-O-benzyl-b-L-idopyranose | 42926-91-0 | 1g |
| GC0760-1mg | 1,6-Anhydro-3-O-α-D-glucopyranosyl-β-D-glucopyranose | 1mg | |
| GC0760-2mg | 1,6-Anhydro-3-O-α-D-glucopyranosyl-β-D-glucopyranose | 2mg | |
| GC0760-5mg | 1,6-Anhydro-3-O-α-D-glucopyranosyl-β-D-glucopyranose | 5mg | |
| GC0760-10mg | 1,6-Anhydro-3-O-α-D-glucopyranosyl-β-D-glucopyranose | 10mg | |
| GC1200-5mg | 1,6-Anhydro-3-O-β-D-glucopyranosyl-β-D-glucopyranose | 137334-33-9 | 5mg |
| GC1200-10mg | 1,6-Anhydro-3-O-β-D-glucopyranosyl-β-D-glucopyranose | 137334-33-9 | 10mg |
| GC1200-25mg | 1,6-Anhydro-3-O-β-D-glucopyranosyl-β-D-glucopyranose | 137334-33-9 | 25mg |
| GC1200-50mg | 1,6-Anhydro-3-O-β-D-glucopyranosyl-β-D-glucopyranose | 137334-33-9 | 50mg |
| GC4109-100mg | 1,6-Anhydro-3,4-dideoxy-2,2-(ethylenedioxy)-β-D-glycero-hex-3-enopyranose | 167629-13-2 | 100mg |
| GC4109-250mg | 1,6-Anhydro-3,4-dideoxy-2,2-(ethylenedioxy)-β-D-glycero-hex-3-enopyranose | 167629-13-2 | 250mg |
| GC4109-500mg | 1,6-Anhydro-3,4-dideoxy-2,2-(ethylenedioxy)-β-D-glycero-hex-3-enopyranose | 167629-13-2 | 500mg |
| GC4109-1g | 1,6-Anhydro-3,4-dideoxy-2,2-(ethylenedioxy)-β-D-glycero-hex-3-enopyranose | 167629-13-2 | 1g |
| GC1732-5mg | 1,6-Anhydro-3,4-O-isopropylidene-2-O-(2,3,4,6-tetra-O-acetyl-β-D-galactopyranosyl)-β-D-galactopyranose | 127527-87-1 | 5mg |
| GC1732-10mg | 1,6-Anhydro-3,4-O-isopropylidene-2-O-(2,3,4,6-tetra-O-acetyl-β-D-galactopyranosyl)-β-D-galactopyranose | 127527-87-1 | 10mg |
| GC1732-25mg | 1,6-Anhydro-3,4-O-isopropylidene-2-O-(2,3,4,6-tetra-O-acetyl-β-D-galactopyranosyl)-β-D-galactopyranose | 127527-87-1 | 25mg |
| GC1732-50mg | 1,6-Anhydro-3,4-O-isopropylidene-2-O-(2,3,4,6-tetra-O-acetyl-β-D-galactopyranosyl)-β-D-galactopyranose | 127527-87-1 | 50mg |
| GC2792-500mg | 1,6-Anhydro-3,4-O-isopropylidene-β-D-galactopyranose | 52579-97-2 | 500mg |
| GC2792-1g | 1,6-Anhydro-3,4-O-isopropylidene-β-D-galactopyranose | 52579-97-2 | 1g |
| GC2792-2g | 1,6-Anhydro-3,4-O-isopropylidene-β-D-galactopyranose | 52579-97-2 | 2g |
| GC2792-5g | 1,6-Anhydro-3,4-O-isopropylidene-β-D-galactopyranose | 52579-97-2 | 5g |
| GC9221-100mg | 1,6-Anhydro-4'',6''-O-benzylidene-β-D-maltose | 56838-36-9 | 100mg |
| GC9221-250mg | 1,6-Anhydro-4'',6''-O-benzylidene-β-D-maltose | 56838-36-9 | 250mg |
| GC9221-500mg | 1,6-Anhydro-4'',6''-O-benzylidene-β-D-maltose | 56838-36-9 | 500mg |
| GC9221-1g | 1,6-Anhydro-4'',6''-O-benzylidene-β-D-maltose | 56838-36-9 | 1g |
| GC1056-50mg | 1,6-Anhydro-b-D-cellobiose | 35405-71-1 | 50mg |
| GC1056-100mg | 1,6-Anhydro-b-D-cellobiose | 35405-71-1 | 100mg |
| GC1056-500mg | 1,6-Anhydro-b-D-cellobiose | 35405-71-1 | 500mg |
| GC1056-1g | 1,6-Anhydro-b-D-cellobiose | 35405-71-1 | 1g |
| GC3680-1mg | 1,6-Anhydro-α-D-galactofuranose | 33818-21-2 | 1mg |
| GC3680-2mg | 1,6-Anhydro-α-D-galactofuranose | 33818-21-2 | 2mg |
| GC3680-5mg | 1,6-Anhydro-α-D-galactofuranose | 33818-21-2 | 5mg |
| GC3680-10mg | 1,6-Anhydro-α-D-galactofuranose | 33818-21-2 | 10mg |
| GC3680-25mg | 1,6-Anhydro-α-D-galactofuranose | 33818-21-2 | 25mg |
| GC3386-1mg | 1,6-Anhydro-β-D-cellopentaose | 122274-98-0 | 1mg |
| GC3386-2mg | 1,6-Anhydro-β-D-cellopentaose | 122274-98-0 | 2mg |
| GC3386-5mg | 1,6-Anhydro-β-D-cellopentaose | 122274-98-0 | 5mg |
| GC3386-10mg | 1,6-Anhydro-β-D-cellopentaose | 122274-98-0 | 10mg |
| GC1313-2mg | 1,6-Anhydro-β-D-cellotetraose | 80325-59-3 | 2mg |
| GC1313-5mg | 1,6-Anhydro-β-D-cellotetraose | 80325-59-3 | 5mg |
| GC1313-10mg | 1,6-Anhydro-β-D-cellotetraose | 80325-59-3 | 10mg |
| GC1313-25mg | 1,6-Anhydro-β-D-cellotetraose | 80325-59-3 | 25mg |
| GC7678-5mg | 1,6-Anhydro-β-D-cellotriose | 78797-67-8 | 5mg |
| GC7678-10mg | 1,6-Anhydro-β-D-cellotriose | 78797-67-8 | 10mg |
| GC7678-25mg | 1,6-Anhydro-β-D-cellotriose | 78797-67-8 | 25mg |
| GC7678-50mg | 1,6-Anhydro-β-D-cellotriose | 78797-67-8 | 50mg |
| GC2336-5mg | 1,6-Anhydro-β-D-cellotriose nonaacetate | 78797-66-7 | 5mg |
| GC2336-10mg | 1,6-Anhydro-β-D-cellotriose nonaacetate | 78797-66-7 | 10mg |
| GC2336-25mg | 1,6-Anhydro-β-D-cellotriose nonaacetate | 78797-66-7 | 25mg |
| GC2336-50mg | 1,6-Anhydro-β-D-cellotriose nonaacetate | 78797-66-7 | 50mg |
| GC9846-1mg | 1,6-Anhydro-β-D-glucofuranose | 7425-74-3 | 1mg |
| GC9846-2mg | 1,6-Anhydro-β-D-glucofuranose | 7425-74-3 | 2mg |
| GC9846-5mg | 1,6-Anhydro-β-D-glucofuranose | 7425-74-3 | 5mg |
| GC9846-10mg | 1,6-Anhydro-β-D-glucofuranose | 7425-74-3 | 10mg |
| GC9846-25mg | 1,6-Anhydro-β-D-glucofuranose | 7425-74-3 | 25mg |
| GC5907-5g | 1,6-Anhydro-β-D-glucopyranose | 498-07-7 | 5g |
| GC5907-10g | 1,6-Anhydro-β-D-glucopyranose | 498-07-7 | 10g |
| GC5907-25g | 1,6-Anhydro-β-D-glucopyranose | 498-07-7 | 25g |
| GC5907-50g | 1,6-Anhydro-β-D-glucopyranose | 498-07-7 | 50g |
| GC5502-1g | 1,6-Anhydro-β-D-glucopyranose 2,3,4-triacetate | 13242-55-2 | 1g |
| GC5502-2g | 1,6-Anhydro-β-D-glucopyranose 2,3,4-triacetate | 13242-55-2 | 2g |
| GC5502-5g | 1,6-Anhydro-β-D-glucopyranose 2,3,4-triacetate | 13242-55-2 | 5g |
| GC5502-10g | 1,6-Anhydro-β-D-glucopyranose 2,3,4-triacetate | 13242-55-2 | 10g |
| GC2845-25mg | 1,6-Anhydro-β-D-lactose | 34395-01-2 | 25mg |
| GC2845-50mg | 1,6-Anhydro-β-D-lactose | 34395-01-2 | 50mg |
| GC2845-100mg | 1,6-Anhydro-β-D-lactose | 34395-01-2 | 100mg |
| GC2845-250mg | 1,6-Anhydro-β-D-lactose | 34395-01-2 | 250mg |
| GC9708-50mg | 1,6-Anhydro-β-D-lactose hexaacetate | 25878-57-3 | 50mg |
| GC9708-100mg | 1,6-Anhydro-β-D-lactose hexaacetate | 25878-57-3 | 100mg |
| GC9708-250mg | 1,6-Anhydro-β-D-lactose hexaacetate | 25878-57-3 | 250mg |
| GC9708-500mg | 1,6-Anhydro-β-D-lactose hexaacetate | 25878-57-3 | 500mg |
| GC4270-250mg | 1,6-Anhydro-β-D-maltose | 6983-27-3 | 250mg |
| GC4270-500mg | 1,6-Anhydro-β-D-maltose | 6983-27-3 | 500mg |
| GC4270-1g | 1,6-Anhydro-β-D-maltose | 6983-27-3 | 1g |
| GC4270-2g | 1,6-Anhydro-β-D-maltose | 6983-27-3 | 2g |
| GC7390-250mg | 1,6-Anhydro-β-D-maltose hexaacetate | 28868-67-9 | 250mg |
| GC7390-500mg | 1,6-Anhydro-β-D-maltose hexaacetate | 28868-67-9 | 500mg |
| GC7390-1g | 1,6-Anhydro-β-D-maltose hexaacetate | 28868-67-9 | 1g |
| GC7390-2g | 1,6-Anhydro-β-D-maltose hexaacetate | 28868-67-9 | 2g |
| GC1522-5mg | 1,6-Anhydro-β-D-maltotriose | 60575-03-3 | 5mg |
| GC1522-10mg | 1,6-Anhydro-β-D-maltotriose | 60575-03-3 | 10mg |
| GC1522-25mg | 1,6-Anhydro-β-D-maltotriose | 60575-03-3 | 25mg |
| GC1522-50mg | 1,6-Anhydro-β-D-maltotriose | 60575-03-3 | 50mg |
| GC1479-10mg | 1,6-Anhydro-β-D-maltotriose nonaacetate | 60347-81-1 | 10mg |
| GC1479-25mg | 1,6-Anhydro-β-D-maltotriose nonaacetate | 60347-81-1 | 25mg |
| GC1479-50mg | 1,6-Anhydro-β-D-maltotriose nonaacetate | 60347-81-1 | 50mg |
| GC1479-100mg | 1,6-Anhydro-β-D-maltotriose nonaacetate | 60347-81-1 | 100mg |
| GC2681-1mg | 1,6-Anhydro-β-D-mannofuranose | 31880-33-8 | 1mg |
| GC2681-2mg | 1,6-Anhydro-β-D-mannofuranose | 31880-33-8 | 2mg |
| GC2681-5mg | 1,6-Anhydro-β-D-mannofuranose | 31880-33-8 | 5mg |
| GC2681-10mg | 1,6-Anhydro-β-D-mannofuranose | 31880-33-8 | 10mg |
| GC2681-25mg | 1,6-Anhydro-β-D-mannofuranose | 31880-33-8 | 25mg |
| GC1511-250mg | 1,6-Di-O-acetyl-2-azido-3,4-di-O-benzyl-2-deoxy-α-D-glucopyranose | 55682-49-0 | 250mg |
| GC1511-500mg | 1,6-Di-O-acetyl-2-azido-3,4-di-O-benzyl-2-deoxy-α-D-glucopyranose | 55682-49-0 | 500mg |
| GC1511-1g | 1,6-Di-O-acetyl-2-azido-3,4-di-O-benzyl-2-deoxy-α-D-glucopyranose | 55682-49-0 | 1g |
| GC1511-2g | 1,6-Di-O-acetyl-2-azido-3,4-di-O-benzyl-2-deoxy-α-D-glucopyranose | 55682-49-0 | 2g |
| GK9174-25g | 1,6-Diaminohexane | 124-09-4 | 25g |
| GK9174-100g | 1,6-Diaminohexane | 124-09-4 | 100g |
| GC8010-50mg | 1,6:2,3-Dianhydro-4-O-(2,3-di-O-benzyl-4,6-O-benzylidene-β-D-glucopyranosyl)-β-D-mannopyranose | 99541-22-7 | 50mg |
| GC8010-100mg | 1,6:2,3-Dianhydro-4-O-(2,3-di-O-benzyl-4,6-O-benzylidene-β-D-glucopyranosyl)-β-D-mannopyranose | 99541-22-7 | 100mg |
| GC8010-250mg | 1,6:2,3-Dianhydro-4-O-(2,3-di-O-benzyl-4,6-O-benzylidene-β-D-glucopyranosyl)-β-D-mannopyranose | 99541-22-7 | 250mg |
| GC7404-50mg | 1,6:2,3-Dianhydro-4-O-(2,3-di-O-benzyl-β-D-glucopyranosyl)-β-D-mannopyranose | 50mg | |
| GC7404-100mg | 1,6:2,3-Dianhydro-4-O-(2,3-di-O-benzyl-β-D-glucopyranosyl)-β-D-mannopyranose | 100mg | |
| GC7404-250mg | 1,6:2,3-Dianhydro-4-O-(2,3-di-O-benzyl-β-D-glucopyranosyl)-β-D-mannopyranose | 250mg | |
| GC7404-500mg | 1,6:2,3-Dianhydro-4-O-(2,3-di-O-benzyl-β-D-glucopyranosyl)-β-D-mannopyranose | 500mg | |
| GC4821-100mg | 1,6:2,3-Dianhydro-4-O-(2,3,4,6-tetra-O-acetyl-β-D-glucopyranosyl)-β-D-mannopyranose | 103702-87-0 | 100mg |
| GC4821-250mg | 1,6:2,3-Dianhydro-4-O-(2,3,4,6-tetra-O-acetyl-β-D-glucopyranosyl)-β-D-mannopyranose | 103702-87-0 | 250mg |
| GC4821-500mg | 1,6:2,3-Dianhydro-4-O-(2,3,4,6-tetra-O-acetyl-β-D-glucopyranosyl)-β-D-mannopyranose | 103702-87-0 | 500mg |
| GC4821-1g | 1,6:2,3-Dianhydro-4-O-(2,3,4,6-tetra-O-acetyl-β-D-glucopyranosyl)-β-D-mannopyranose | 103702-87-0 | 1g |
| GC1272-50mg | 1,6:2,3-Dianhydro-4-O-(4,6-O-benzylidene-β-D-glucopyranosyl)-β-D-mannopyranose | 150126-09-3 | 50mg |
| GC1272-100mg | 1,6:2,3-Dianhydro-4-O-(4,6-O-benzylidene-β-D-glucopyranosyl)-β-D-mannopyranose | 150126-09-3 | 100mg |
| GC1272-250mg | 1,6:2,3-Dianhydro-4-O-(4,6-O-benzylidene-β-D-glucopyranosyl)-β-D-mannopyranose | 150126-09-3 | 250mg |
| GC1166-25mg | 1,6:2,3-Dianhydro-4-O-(6-methyl-2,3-di-O-benzyl-β-D-glucopyranuronosyl)-β-D-mannopyranose | 87907-24-2 | 25mg |
| GC1166-50mg | 1,6:2,3-Dianhydro-4-O-(6-methyl-2,3-di-O-benzyl-β-D-glucopyranuronosyl)-β-D-mannopyranose | 87907-24-2 | 50mg |
| GC1166-100mg | 1,6:2,3-Dianhydro-4-O-(6-methyl-2,3-di-O-benzyl-β-D-glucopyranuronosyl)-β-D-mannopyranose | 87907-24-2 | 100mg |
| GC1166-250mg | 1,6:2,3-Dianhydro-4-O-(6-methyl-2,3-di-O-benzyl-β-D-glucopyranuronosyl)-β-D-mannopyranose | 87907-24-2 | 250mg |
| GC1827-50mg | 1,6:2,3-Dianhydro-4-O-benzyl-β-D-mannopyranose | 33208-47-8 | 50mg |
| GC1827-100mg | 1,6:2,3-Dianhydro-4-O-benzyl-β-D-mannopyranose | 33208-47-8 | 100mg |
| GC1827-250mg | 1,6:2,3-Dianhydro-4-O-benzyl-β-D-mannopyranose | 33208-47-8 | 250mg |
| GC1827-500mg | 1,6:2,3-Dianhydro-4-O-benzyl-β-D-mannopyranose | 33208-47-8 | 500mg |
| GC2391-1g | 1,6:2,3-Dianhydro-b-D-mannopyranose | 3868-03-9 | 1g |
| GC2391-2g | 1,6:2,3-Dianhydro-b-D-mannopyranose | 3868-03-9 | 2g |
| GC2391-5g | 1,6:2,3-Dianhydro-b-D-mannopyranose | 3868-03-9 | 5g |
| GC2391-10g | 1,6:2,3-Dianhydro-b-D-mannopyranose | 3868-03-9 | 10g |
| GC7927-50mg | 1,6:2,3-Dianhydro-β-D-talopyranose | 6893-59-0 | 50mg |
| GC7927-100mg | 1,6:2,3-Dianhydro-β-D-talopyranose | 6893-59-0 | 100mg |
| GC7927-250mg | 1,6:2,3-Dianhydro-β-D-talopyranose | 6893-59-0 | 250mg |
| GC7927-500mg | 1,6:2,3-Dianhydro-β-D-talopyranose | 6893-59-0 | 500mg |
| GC1940-100mg | 1,6:3,4-Dianhydro-2-O-benzyl-β-D-altropyranose | 213594-43-5 | 100mg |
| GC1940-250mg | 1,6:3,4-Dianhydro-2-O-benzyl-β-D-altropyranose | 213594-43-5 | 250mg |
| GC1940-500mg | 1,6:3,4-Dianhydro-2-O-benzyl-β-D-altropyranose | 213594-43-5 | 500mg |
| GC1940-1g | 1,6:3,4-Dianhydro-2-O-benzyl-β-D-altropyranose | 213594-43-5 | 1g |
| GC0672-25mg | 1,6:3,4-Dianhydro-β-D-altropyranose | 3868-04-0 | 25mg |
| GC0672-50mg | 1,6:3,4-Dianhydro-β-D-altropyranose | 3868-04-0 | 50mg |
| GC0672-100mg | 1,6:3,4-Dianhydro-β-D-altropyranose | 3868-04-0 | 100mg |
| GC0672-250mg | 1,6:3,4-Dianhydro-β-D-altropyranose | 3868-04-0 | 250mg |
| GW2666-50mg | 1,7-Dimethyluric acid | 33868-03-0 | 50mg |
| GW2666-250mg | 1,7-Dimethyluric acid | 33868-03-0 | 250mg |
| GE9784-25ml | 1,8-Cineole | 470-82-6 | 25ml |
| GK8071-25g | 1,8-Diazabicyclo(5.4.0)undec-7-ene | 6674-22-2 | 25g |
| GK8071-100g | 1,8-Diazabicyclo(5.4.0)undec-7-ene | 6674-22-2 | 100g |
| GK8071-500g | 1,8-Diazabicyclo(5.4.0)undec-7-ene | 6674-22-2 | 500g |
| GK5792-250mg | 1,8-Diazafluoren-9-one | 54078-29-4 | 250mg |
| GK5792-1g | 1,8-Diazafluoren-9-one | 54078-29-4 | 1g |
| GW6285-1g | 1(E)-Iodo-hex-1-ene | 16644-98-7 | 1g |
| GW6285-5g | 1(E)-Iodo-hex-1-ene | 16644-98-7 | 5g |
| GW9956-1g | 1(E)-Iodo-oct-1-ene | 42599-17-7 | 1g |
| GW9956-5g | 1(E)-Iodo-oct-1-ene | 42599-17-7 | 5g |
| GW0590-5mg | 1(H)-Naphthotriazol | 269-12-5 | 5mg |
| GW0590-25mg | 1(H)-Naphthotriazol | 269-12-5 | 25mg |
| GL1949-25mg | 1(S);9(R)-(-)-Bicuculline methiodide | 40709-69-1 | 25mg |
| GL1949-100mg | 1(S);9(R)-(-)-Bicuculline methiodide | 40709-69-1 | 100mg |
| GY7900-10mg | 10-Deacetyltaxol | 78432-77-6 | 10mg |
| GW8626-20mg | 10-Dodecylacridine Orange Bromide | 41387-42-2 | 20mg |
| GP2894-250mg | 10-Hydroxycamptothecin | 64439-81-2 | 250mg |
| GP2894-1g | 10-Hydroxycamptothecin | 64439-81-2 | 1g |
| GK2383-1g | 10-Hydroxydecanoic acid | 1679-53-4 | 1g |
| GK2383-5g | 10-Hydroxydecanoic acid | 1679-53-4 | 5g |
| GK2383-10g | 10-Hydroxydecanoic acid | 1679-53-4 | 10g |
| GW6191-25mg | 10-Octadecylacridine orange bromide | 75168-16-0 | 25mg |
| GW6191-250mg | 10-Octadecylacridine orange bromide | 75168-16-0 | 250mg |
| GK3843-25g | 10-Undecenoic acid | 112-38-9 | 25g |
| GL1970-1mg | 10,11-Dehydrocurvularin | 1095588-70-7 | 1mg |
| GL1970-5mg | 10,11-Dehydrocurvularin | 1095588-70-7 | 5mg |
| GC3455-1mg | 10,11-Dihydro-10-hydroxycarbamazepine O-b-D-glucuronide | 144407-84-1 | 1mg |
| GC3455-2mg | 10,11-Dihydro-10-hydroxycarbamazepine O-b-D-glucuronide | 144407-84-1 | 2mg |
| GC3455-5mg | 10,11-Dihydro-10-hydroxycarbamazepine O-b-D-glucuronide | 144407-84-1 | 5mg |
| GC3455-10mg | 10,11-Dihydro-10-hydroxycarbamazepine O-b-D-glucuronide | 144407-84-1 | 10mg |
| GX2825-10g | 10% Pd/C Degussa Type E 106 NN/W (water wet) | 7440-05-3 | 10g |
| GX2825-50g | 10% Pd/C Degussa Type E 106 NN/W (water wet) | 7440-05-3 | 50g |
| GL1230-5mg | 10058-F4 | 403811-55-2 | 5mg |
| GL1230-25mg | 10058-F4 | 403811-55-2 | 25mg |
| GL2243-500ug | 10Z-Hymenialdisine | 82005-12-7 | 500ug |
| GL2243-1mg | 10Z-Hymenialdisine | 82005-12-7 | 1mg |
| GK8220-100mg | 11-alpha-Hydroxyprogesterone | 80-75-1 | 100mg |
| GL2214-250ug | 11-O-Methylpseurotin A | 956904-34-0 | 250ug |
| GL2214-1mg | 11-O-Methylpseurotin A | 956904-34-0 | 1mg |
| GW9547-5mg | 12-(1-Pyrenyl) dodecanoic acid | 69168-45-2 | 5mg |
| GW9547-50mg | 12-(1-Pyrenyl) dodecanoic acid | 69168-45-2 | 50mg |
| GK1795-25g | 12-Hydroxyoctadecanoic acid | 106-14-9 | 25g |
| GL9536-1mg | 12-Methoxycarnosic acid | 62201-71-2 | 1mg |
| GX6295-100g | 12-Molybdophosphoric acid hydrate p.A., ACS | 51429-74-4 | 100g |
| GX6295-500g | 12-Molybdophosphoric acid hydrate p.A., ACS | 51429-74-4 | 500g |
| GL0512-250ug | 1233B | 34668-61-6 | 250ug |
| GL0512-1mg | 1233B | 34668-61-6 | 1mg |
| GW3882-1mg | 13-cis-4-Oxoretinoic acid | 71748-58-8 | 1mg |
| GW3882-5mg | 13-cis-4-Oxoretinoic acid | 71748-58-8 | 5mg |
| GW3882-25mg | 13-cis-4-Oxoretinoic acid | 71748-58-8 | 25mg |
| GK6799-5mg | 1400W dihydrochloride | 214358-33-5 | 5mg |
| GK6799-25mg | 1400W dihydrochloride | 214358-33-5 | 25mg |
| GK6799-100mg | 1400W dihydrochloride | 214358-33-5 | 100mg |
| GL0386-100ug | 16-epi-Latrunculin B | 444911-05-1 | 100ug |
| GL4924-1mg | 16-keto-Aspergillimide | 199784-50-4 | 1mg |
| GL4924-5mg | 16-keto-Aspergillimide | 199784-50-4 | 5mg |
| GA4123-1mg | 17-Dimethylaminoethylamino-17-demethoxygeldanamycin | 467214-20-6 | 1mg |
| GA4123-5mg | 17-Dimethylaminoethylamino-17-demethoxygeldanamycin | 467214-20-6 | 5mg |
| GL0144-250ug | 17-Hydroxyventuricidin A | 113204-43-6 | 250ug |
| GL0144-1mg | 17-Hydroxyventuricidin A | 113204-43-6 | 1mg |
| GK1031-25g | 18-Crown-6 | 17455-13-9 | 25g |
| GK1031-100g | 18-Crown-6 | 17455-13-9 | 100g |
| GW6196-1mg | 19-O-Acetylchaetoglobosin A | 50939-69-0 | 1mg |
| GW6196-5mg | 19-O-Acetylchaetoglobosin A | 50939-69-0 | 5mg |
| GC3561-100mg | 1D-chiro-Inositol | 643-12-9 | 100mg |
| GC3561-1g | 1D-chiro-Inositol | 643-12-9 | 1g |
| GL1507-10mg | 1H-[1,2,4]Oxadiazolo[4,3-a]quinoxalin-1-one | 41443-28-1 | 10mg |
| GL1507-50mg | 1H-[1,2,4]Oxadiazolo[4,3-a]quinoxalin-1-one | 41443-28-1 | 50mg |
| GC7626-100mg | 1L-chiro-Inositol | 551-72-4 | 100mg |
| GC7626-1g | 1L-chiro-Inositol | 551-72-4 | 1g |
| GW0298-500mg | 2-(1,1-Dimethylpropyl)-6-(diphenylphosphino)pyridine | 947315-18-6 | 500mg |
| GW0298-2500mg | 2-(1,1-Dimethylpropyl)-6-(diphenylphosphino)pyridine | 947315-18-6 | 2500mg |
| GW9222-20mg | 2-(2-Benzofuranyl)-3-hydroxychromone | 67261-94-3 | 20mg |
| GW9222-250mg | 2-(2-Benzofuranyl)-3-hydroxychromone | 67261-94-3 | 250mg |
| GW1052-5mg | 2-(2-Naphthyl)-2-(phenylmethoxy)-ethanenitrile | 500372-25-8 | 5mg |
| GW1052-25mg | 2-(2-Naphthyl)-2-(phenylmethoxy)-ethanenitrile | 500372-25-8 | 25mg |
| GW1052-250mg | 2-(2-Naphthyl)-2-(phenylmethoxy)-ethanenitrile | 500372-25-8 | 250mg |
| GW8066-25mg | 2-(2-Naphthyl)-2-pentyloxyethanenitrile | 500372-26-9 | 25mg |
| GW8066-250mg | 2-(2-Naphthyl)-2-pentyloxyethanenitrile | 500372-26-9 | 250mg |
| GW9746-10g | 2-(4-Aminophenyl)-6-methylbenzothiazole-7-sulphonic acid | 130-17-6 | 10g |
| GW9746-100g | 2-(4-Aminophenyl)-6-methylbenzothiazole-7-sulphonic acid | 130-17-6 | 100g |
| GK8928-5g | 2-(4-Hydroxyphenyl)ethanol | 501-94-0 | 5g |
| GK8928-25g | 2-(4-Hydroxyphenyl)ethanol | 501-94-0 | 25g |
| GK8928-100g | 2-(4-Hydroxyphenyl)ethanol | 501-94-0 | 100g |
| GC3113-1g | 2-(4-Iodophenyl)-3-(4-nitrophenyl)-5-phenyltetrazolium chloride | 146-68-9 | 1g |
| GC3113-5g | 2-(4-Iodophenyl)-3-(4-nitrophenyl)-5-phenyltetrazolium chloride | 146-68-9 | 5g |
| GC8008-1g | 2-(4-Methoxybenzylidene)imino-2-deoxy-1,3,4,6-Tetra-O-acetyl-β-D-glucopyranose | 7597-81-1 | 1g |
| GC8008-2g | 2-(4-Methoxybenzylidene)imino-2-deoxy-1,3,4,6-Tetra-O-acetyl-β-D-glucopyranose | 7597-81-1 | 2g |
| GC8008-5g | 2-(4-Methoxybenzylidene)imino-2-deoxy-1,3,4,6-Tetra-O-acetyl-β-D-glucopyranose | 7597-81-1 | 5g |
| GC8008-10g | 2-(4-Methoxybenzylidene)imino-2-deoxy-1,3,4,6-Tetra-O-acetyl-β-D-glucopyranose | 7597-81-1 | 10g |
| GC8008-25g | 2-(4-Methoxybenzylidene)imino-2-deoxy-1,3,4,6-Tetra-O-acetyl-β-D-glucopyranose | 7597-81-1 | 25g |
| GC0682-1g | 2-(4-Methoxybenzylidene)imino-2-deoxy-D-glucopyranose | 51471-40-0 | 1g |
| GC0682-2g | 2-(4-Methoxybenzylidene)imino-2-deoxy-D-glucopyranose | 51471-40-0 | 2g |
| GC0682-5g | 2-(4-Methoxybenzylidene)imino-2-deoxy-D-glucopyranose | 51471-40-0 | 5g |
| GC0682-10g | 2-(4-Methoxybenzylidene)imino-2-deoxy-D-glucopyranose | 51471-40-0 | 10g |
| GC0682-25g | 2-(4-Methoxybenzylidene)imino-2-deoxy-D-glucopyranose | 51471-40-0 | 25g |
| GC0914-5mg | 2-(Acetylamino)phenyl β-D-glucopyranosiduronic acid, sodium salt | 5mg | |
| GC0914-10mg | 2-(Acetylamino)phenyl β-D-glucopyranosiduronic acid, sodium salt | 10mg | |
| GC0914-25mg | 2-(Acetylamino)phenyl β-D-glucopyranosiduronic acid, sodium salt | 25mg | |
| GC0914-50mg | 2-(Acetylamino)phenyl β-D-glucopyranosiduronic acid, sodium salt | 50mg | |
| GX3212-1g | 2-(Aminomethyl)-1,3-dioxolane | 4388-97-0 | 1g |
| GC1658-10mg | 2-(Biotinylamido)ethyl α-D-mannopyranoside | 952486-15-6 | 10mg |
| GC1658-25mg | 2-(Biotinylamido)ethyl α-D-mannopyranoside | 952486-15-6 | 25mg |
| GC1658-50mg | 2-(Biotinylamido)ethyl α-D-mannopyranoside | 952486-15-6 | 50mg |
| GC1658-100mg | 2-(Biotinylamido)ethyl α-D-mannopyranoside | 952486-15-6 | 100mg |
| GW5329-1g | 2-(Chloromethyl)benzoic acid | 85888-81-9 | 1g |
| GW5329-5g | 2-(Chloromethyl)benzoic acid | 85888-81-9 | 5g |
| GW5329-25g | 2-(Chloromethyl)benzoic acid | 85888-81-9 | 25g |
| GC5983-1mg | 2-(Dihydrogen phosphate) D-glucose | 67101-62-6 | 1mg |
| GC5983-2mg | 2-(Dihydrogen phosphate) D-glucose | 67101-62-6 | 2mg |
| GC5983-5mg | 2-(Dihydrogen phosphate) D-glucose | 67101-62-6 | 5mg |
| GC5983-10mg | 2-(Dihydrogen phosphate) D-glucose | 67101-62-6 | 10mg |
| GC0571-50mg | 2-(Dimethoxymethyl)-5-(methoxymethyl)furan | 110339-34-9 | 50mg |
| GC0571-100mg | 2-(Dimethoxymethyl)-5-(methoxymethyl)furan | 110339-34-9 | 100mg |
| GC0571-250mg | 2-(Dimethoxymethyl)-5-(methoxymethyl)furan | 110339-34-9 | 250mg |
| GC0571-500mg | 2-(Dimethoxymethyl)-5-(methoxymethyl)furan | 110339-34-9 | 500mg |
| GC0906-1g | 2-(Dimethoxymethyl)furan | 1453-62-9 | 1g |
| GC0906-2g | 2-(Dimethoxymethyl)furan | 1453-62-9 | 2g |
| GC0906-5g | 2-(Dimethoxymethyl)furan | 1453-62-9 | 5g |
| GC0906-10g | 2-(Dimethoxymethyl)furan | 1453-62-9 | 10g |
| GW7725-1g | 2-(Tosyloxy)cycloheptanone | 146040-84-8 | 1g |
| GW0746-1g | 2-(Tosyloxy)cyclohexanone | 81447-34-9 | 1g |
| GW0746-5g | 2-(Tosyloxy)cyclohexanone | 81447-34-9 | 5g |
| GW1095-50mg | 2-[2-(2-Aminophenoxy)ethoxy]-4-methyl-benzenamine | 96331-95-2 | 50mg |
| GX2631-5g | 2-[2-(2-Methoxyethoxy)ethoxy]acetic acid | 16024-58-1 | 5g |
| GC2376-1g | 2-Acetamido-1,3-di-O-acetyl-2-deoxy-4,6-O-isopropylidene-D-glucopyranose | 1g | |
| GC2376-2g | 2-Acetamido-1,3-di-O-acetyl-2-deoxy-4,6-O-isopropylidene-D-glucopyranose | 2g | |
| GC2376-5g | 2-Acetamido-1,3-di-O-acetyl-2-deoxy-4,6-O-isopropylidene-D-glucopyranose | 5g | |
| GC8022-5mg | 2-Acetamido-1,3,4-tri-O-acetyl-2-deoxy-α-L-fucopyranose | 115509-87-0 | 5mg |
| GC8022-10mg | 2-Acetamido-1,3,4-tri-O-acetyl-2-deoxy-α-L-fucopyranose | 115509-87-0 | 10mg |
| GC8022-25mg | 2-Acetamido-1,3,4-tri-O-acetyl-2-deoxy-α-L-fucopyranose | 115509-87-0 | 25mg |
| GC8022-50mg | 2-Acetamido-1,3,4-tri-O-acetyl-2-deoxy-α-L-fucopyranose | 115509-87-0 | 50mg |
| GC3993-50mg | 2-Acetamido-1,3,4-tri-O-acetyl-2-deoxy-β-D-quinovose | 13475-86-0 | 50mg |
| GC3993-100mg | 2-Acetamido-1,3,4-tri-O-acetyl-2-deoxy-β-D-quinovose | 13475-86-0 | 100mg |
| GC3993-250mg | 2-Acetamido-1,3,4-tri-O-acetyl-2-deoxy-β-D-quinovose | 13475-86-0 | 250mg |
| GC3993-500mg | 2-Acetamido-1,3,4-tri-O-acetyl-2-deoxy-β-D-quinovose | 13475-86-0 | 500mg |
| GC1882-25mg | 2-Acetamido-1,3,4-tri-O-acetyl-2,6-dideoxy-6-fluoro-D-glucopyranose | 1094213-88-3 | 25mg |
| GC1882-50mg | 2-Acetamido-1,3,4-tri-O-acetyl-2,6-dideoxy-6-fluoro-D-glucopyranose | 1094213-88-3 | 50mg |
| GC1882-100mg | 2-Acetamido-1,3,4-tri-O-acetyl-2,6-dideoxy-6-fluoro-D-glucopyranose | 1094213-88-3 | 100mg |
| GC1882-250mg | 2-Acetamido-1,3,4-tri-O-acetyl-2,6-dideoxy-6-fluoro-D-glucopyranose | 1094213-88-3 | 250mg |
| GC8421-50mg | 2-Acetamido-1,3,4-tri-O-butanoyl-2-deoxy-D-mannopyranose | 1020166-63-5 | 50mg |
| GC8421-100mg | 2-Acetamido-1,3,4-tri-O-butanoyl-2-deoxy-D-mannopyranose | 1020166-63-5 | 100mg |
| GC8421-250mg | 2-Acetamido-1,3,4-tri-O-butanoyl-2-deoxy-D-mannopyranose | 1020166-63-5 | 250mg |
| GC8421-500mg | 2-Acetamido-1,3,4-tri-O-butanoyl-2-deoxy-D-mannopyranose | 1020166-63-5 | 500mg |
| GC8421-1g | 2-Acetamido-1,3,4-tri-O-butanoyl-2-deoxy-D-mannopyranose | 1020166-63-5 | 1g |
| GC9132-10g | 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-a-D-glucopyranose | 14086-90-9 | 10g |
| GC9132-25g | 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-a-D-glucopyranose | 14086-90-9 | 25g |
| GC9132-50g | 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-a-D-glucopyranose | 14086-90-9 | 50g |
| GC9132-100g | 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-a-D-glucopyranose | 14086-90-9 | 100g |
| GC8824-2g | 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-b-D-galactopyranose | 3006-60-8 | 2g |
| GC8824-5g | 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-b-D-galactopyranose | 3006-60-8 | 5g |
| GC8824-10g | 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-b-D-galactopyranose | 3006-60-8 | 10g |
| GC8824-25g | 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-b-D-galactopyranose | 3006-60-8 | 25g |
| GC8824-50g | 2-Acetamido-1,3,4,6-tetra-O-acetyl-2-deoxy-b-D-galactopyranose | 3006-60-8 | 50g |
| GC0192-50mg | 2-Acetamido-2-deoxy-3,4,6-tri-O-acetyl-β-D-glucopyranosylamine | 4515-24-6 | 50mg |
| GC0192-100mg | 2-Acetamido-2-deoxy-3,4,6-tri-O-acetyl-β-D-glucopyranosylamine | 4515-24-6 | 100mg |
| GC0192-250mg | 2-Acetamido-2-deoxy-3,4,6-tri-O-acetyl-β-D-glucopyranosylamine | 4515-24-6 | 250mg |
| GC0192-500mg | 2-Acetamido-2-deoxy-3,4,6-tri-O-acetyl-β-D-glucopyranosylamine | 4515-24-6 | 500mg |
| GC2175-1mg | 2-Acetamido-2-deoxy-4-O-(2-acetamido-2-deoxy-b-D-galactopyranosyl)-D-glucose | 136198-41-9 | 1mg |
| GC2175-2mg | 2-Acetamido-2-deoxy-4-O-(2-acetamido-2-deoxy-b-D-galactopyranosyl)-D-glucose | 136198-41-9 | 2mg |
| GC2175-5mg | 2-Acetamido-2-deoxy-4-O-(2-acetamido-2-deoxy-b-D-galactopyranosyl)-D-glucose | 136198-41-9 | 5mg |
| GC7643-1mg | 2-Acetamido-2-deoxy-4-O-(b-D-galactopyranosyl)-D-galactopyranose | 82535-18-0 | 1mg |
| GC7643-2mg | 2-Acetamido-2-deoxy-4-O-(b-D-galactopyranosyl)-D-galactopyranose | 82535-18-0 | 2mg |
| GC7643-5mg | 2-Acetamido-2-deoxy-4-O-(b-D-galactopyranosyl)-D-galactopyranose | 82535-18-0 | 5mg |
| GC7643-10mg | 2-Acetamido-2-deoxy-4-O-(b-D-galactopyranosyl)-D-galactopyranose | 82535-18-0 | 10mg |
| GC9273-1mg | 2-Acetamido-2-deoxy-4-O-α-D-galactopyranosyl-D-glucose | 205380-69-4 | 1mg |
| GC9273-2mg | 2-Acetamido-2-deoxy-4-O-α-D-galactopyranosyl-D-glucose | 205380-69-4 | 2mg |
| GC9273-5mg | 2-Acetamido-2-deoxy-4-O-α-D-galactopyranosyl-D-glucose | 205380-69-4 | 5mg |
| GC9273-10mg | 2-Acetamido-2-deoxy-4-O-α-D-galactopyranosyl-D-glucose | 205380-69-4 | 10mg |
| GC7323-1g | 2-Acetamido-2-deoxy-4,6-O-isopropylidene-D-glucopyranose | 50605-09-9 | 1g |
| GC7323-2g | 2-Acetamido-2-deoxy-4,6-O-isopropylidene-D-glucopyranose | 50605-09-9 | 2g |
| GC7323-5g | 2-Acetamido-2-deoxy-4,6-O-isopropylidene-D-glucopyranose | 50605-09-9 | 5g |
| GC7323-10g | 2-Acetamido-2-deoxy-4,6-O-isopropylidene-D-glucopyranose | 50605-09-9 | 10g |
| GC3327-1mg | 2-Acetamido-2-deoxy-6-O-(b-D-galactopyranosyl)-D-glucopyranose | 50787-10-5 | 1mg |
| GC8334-1mg | 2-Acetamido-2-deoxy-N-(2-(2-aminoethoxy)ethoxy)acetylaminohexanoyl-β-D-glucopyranosylamine | 1mg | |
| GC8334-2mg | 2-Acetamido-2-deoxy-N-(2-(2-aminoethoxy)ethoxy)acetylaminohexanoyl-β-D-glucopyranosylamine | 2mg | |
| GC8334-5mg | 2-Acetamido-2-deoxy-N-(2-(2-aminoethoxy)ethoxy)acetylaminohexanoyl-β-D-glucopyranosylamine | 5mg | |
| GC0418-1g | 2-Acetamido-2-deoxy-β-D-glucopyranosyl azide | 29847-23-2 | 1g |
| GC0418-2g | 2-Acetamido-2-deoxy-β-D-glucopyranosyl azide | 29847-23-2 | 2g |
| GC0418-5g | 2-Acetamido-2-deoxy-β-D-glucopyranosyl azide | 29847-23-2 | 5g |
| GC0418-10g | 2-Acetamido-2-deoxy-β-D-glucopyranosyl azide | 29847-23-2 | 10g |
| GC0341-1mg | 2-Acetamido-2,6-dideoxy-L-galactose | 49694-69-1 | 1mg |
| GC0341-2mg | 2-Acetamido-2,6-dideoxy-L-galactose | 49694-69-1 | 2mg |
| GC0341-5mg | 2-Acetamido-2,6-dideoxy-L-galactose | 49694-69-1 | 5mg |
| GC0341-10mg | 2-Acetamido-2,6-dideoxy-L-galactose | 49694-69-1 | 10mg |
| GC0341-25mg | 2-Acetamido-2,6-dideoxy-L-galactose | 49694-69-1 | 25mg |
| GC9902-1mg | 2-Acetamido-3,4,6-tri-O-acetyl-2-deoxy-N-(2-(2-(fluorenylmethyloxycarbonylamino)ethoxy)ethoxy)acetylaminohexanoyl-β-D-glucopyranosylamine | 1mg | |
| GC9902-2mg | 2-Acetamido-3,4,6-tri-O-acetyl-2-deoxy-N-(2-(2-(fluorenylmethyloxycarbonylamino)ethoxy)ethoxy)acetylaminohexanoyl-β-D-glucopyranosylamine | 2mg | |
| GC9902-5mg | 2-Acetamido-3,4,6-tri-O-acetyl-2-deoxy-N-(2-(2-(fluorenylmethyloxycarbonylamino)ethoxy)ethoxy)acetylaminohexanoyl-β-D-glucopyranosylamine | 5mg | |
| GC9902-10mg | 2-Acetamido-3,4,6-tri-O-acetyl-2-deoxy-N-(2-(2-(fluorenylmethyloxycarbonylamino)ethoxy)ethoxy)acetylaminohexanoyl-β-D-glucopyranosylamine | 10mg | |
| GC6071-25mg | 2-Acetamido-3,4,6-tri-O-acetyl-N-(N-Cbz-ε-aminocaproyl)-2-deoxy-β-D-glucopyranosylamine | 56146-88-4 | 25mg |
| GC6071-50mg | 2-Acetamido-3,4,6-tri-O-acetyl-N-(N-Cbz-ε-aminocaproyl)-2-deoxy-β-D-glucopyranosylamine | 56146-88-4 | 50mg |
| GC6071-100mg | 2-Acetamido-3,4,6-tri-O-acetyl-N-(N-Cbz-ε-aminocaproyl)-2-deoxy-β-D-glucopyranosylamine | 56146-88-4 | 100mg |
| GC6071-250mg | 2-Acetamido-3,4,6-tri-O-acetyl-N-(N-Cbz-ε-aminocaproyl)-2-deoxy-β-D-glucopyranosylamine | 56146-88-4 | 250mg |
| GC1733-5mg | 2-Acetamido-4-fluoro-1,3,6-tri-O-acetyl-2,4-dideoxy-D-glucopyranose | 116049-57-1 | 5mg |
| GC1733-10mg | 2-Acetamido-4-fluoro-1,3,6-tri-O-acetyl-2,4-dideoxy-D-glucopyranose | 116049-57-1 | 10mg |
| GC1733-25mg | 2-Acetamido-4-fluoro-1,3,6-tri-O-acetyl-2,4-dideoxy-D-glucopyranose | 116049-57-1 | 25mg |
| GC1733-50mg | 2-Acetamido-4-fluoro-1,3,6-tri-O-acetyl-2,4-dideoxy-D-glucopyranose | 116049-57-1 | 50mg |
| GC2532-1g | 2-Acetamido-4,6-O-benzylidene-2-deoxy-D-glucopyranose | 29776-43-0 | 1g |
| GC2532-5g | 2-Acetamido-4,6-O-benzylidene-2-deoxy-D-glucopyranose | 29776-43-0 | 5g |
| GC2532-10g | 2-Acetamido-4,6-O-benzylidene-2-deoxy-D-glucopyranose | 29776-43-0 | 10g |
| GC2532-25g | 2-Acetamido-4,6-O-benzylidene-2-deoxy-D-glucopyranose | 29776-43-0 | 25g |
| GN8510-100mg | 2-Acetamido-6-chloro-9-(2'',3'',5''-tri-O-acetyl-b-D-ribofuranosyl)purine | 137896-02-7 | 100mg |
| GN8510-250mg | 2-Acetamido-6-chloro-9-(2'',3'',5''-tri-O-acetyl-b-D-ribofuranosyl)purine | 137896-02-7 | 250mg |
| GN8510-500mg | 2-Acetamido-6-chloro-9-(2'',3'',5''-tri-O-acetyl-b-D-ribofuranosyl)purine | 137896-02-7 | 500mg |
| GN8510-1g | 2-Acetamido-6-chloro-9-(2'',3'',5''-tri-O-acetyl-b-D-ribofuranosyl)purine | 137896-02-7 | 1g |
| GN8510-2g | 2-Acetamido-6-chloro-9-(2'',3'',5''-tri-O-acetyl-b-D-ribofuranosyl)purine | 137896-02-7 | 2g |
| GK4219-5g | 2-Acetyl-6-methoxynaphthalene | 3900-45-6 | 5g |
| GC1108-1mg | 2-Acetylsalicylic acid acyl-b-D-glucuronide | 24719-72-0 | 1mg |
| GC1108-2mg | 2-Acetylsalicylic acid acyl-b-D-glucuronide | 24719-72-0 | 2mg |
| GC1108-5mg | 2-Acetylsalicylic acid acyl-b-D-glucuronide | 24719-72-0 | 5mg |
| GC1108-10mg | 2-Acetylsalicylic acid acyl-b-D-glucuronide | 24719-72-0 | 10mg |
| GC3189-5mg | 2-Amino-2-deoxy-D-ribopyranose, hydrochloride (min. 95% α-anomer) | 5mg | |
| GC3189-10mg | 2-Amino-2-deoxy-D-ribopyranose, hydrochloride (min. 95% α-anomer) | 10mg | |
| GC3189-25mg | 2-Amino-2-deoxy-D-ribopyranose, hydrochloride (min. 95% α-anomer) | 25mg | |
| GC3189-50mg | 2-Amino-2-deoxy-D-ribopyranose, hydrochloride (min. 95% α-anomer) | 50mg | |
| GC3189-100mg | 2-Amino-2-deoxy-D-ribopyranose, hydrochloride (min. 95% α-anomer) | 100mg | |
| GC0129-500mg | 2-Amino-2-deoxy-N-(4-methoxybenzylidene)-β-D-galactopyranose | 233595-32-9 | 500mg |
| GC0129-1g | 2-Amino-2-deoxy-N-(4-methoxybenzylidene)-β-D-galactopyranose | 233595-32-9 | 1g |
| GC0129-2g | 2-Amino-2-deoxy-N-(4-methoxybenzylidene)-β-D-galactopyranose | 233595-32-9 | 2g |
| GC0129-5g | 2-Amino-2-deoxy-N-(4-methoxybenzylidene)-β-D-galactopyranose | 233595-32-9 | 5g |
| GK0508-50g | 2-Amino-2-methyl-1-propanol hydrochloride | 3207-12-3 | 50g |
| GK0508-100g | 2-Amino-2-methyl-1-propanol hydrochloride | 3207-12-3 | 100g |
| GK9117-25ml | 2-Amino-2-methyl-1-propanol, 95% | 124-68-5 | 25ml |
| GK9117-100ml | 2-Amino-2-methyl-1-propanol, 95% | 124-68-5 | 100ml |
| GN7302-5mg | 2-Amino-4-methoxy-7-(2-deoxy-b-D-ribofuranosyl)-pyrrolo[2,3-d]pyrimidine | 150206-15-8 | 5mg |
| GN7302-25mg | 2-Amino-4-methoxy-7-(2-deoxy-b-D-ribofuranosyl)-pyrrolo[2,3-d]pyrimidine | 150206-15-8 | 25mg |
| GN7302-100mg | 2-Amino-4-methoxy-7-(2-deoxy-b-D-ribofuranosyl)-pyrrolo[2,3-d]pyrimidine | 150206-15-8 | 100mg |
| GK1489-5g | 2-Amino-4-methylbenzamide | 39549-79-6 | 5g |
| GK3964-1g | 2-Amino-5-chloro-2''-fluorobenzophenone | 784-38-3 | 1g |
| GK3964-5g | 2-Amino-5-chloro-2''-fluorobenzophenone | 784-38-3 | 5g |
| GK3964-25g | 2-Amino-5-chloro-2''-fluorobenzophenone | 784-38-3 | 25g |
| GK3964-100g | 2-Amino-5-chloro-2''-fluorobenzophenone | 784-38-3 | 100g |
| GM8338-5g | 2-Amino-5-chlorobenzoic acid | 635-21-2 | 5g |
| GM8338-10g | 2-Amino-5-chlorobenzoic acid | 635-21-2 | 10g |
| GM8338-50g | 2-Amino-5-chlorobenzoic acid | 635-21-2 | 50g |
| GK7993-25g | 2-Amino-5-chlorobenzophenone | 719-59-5 | 25g |
| GK8739-100g | 2-Amino-5-chloropyridine | 1072-98-6 | 100g |
| GK1804-100g | 2-Amino-5-mercapto-1,3,4-thiadiazole | 2349-67-9 | 100g |
| GK1804-500g | 2-Amino-5-mercapto-1,3,4-thiadiazole | 2349-67-9 | 500g |
| GK5047-25g | 2-Amino-5-nitrothiazole | 121-66-4 | 25g |
| GE6104-1g | 2-Amino-6-chloropurine riboside | 2004-07-1 | 1g |
| GK1021-1g | 2-Aminobenzenesulfonamide | 3306-62-5 | 1g |
| GC6285-1mg | 2-Aminoethyl 2-acetamido-2-deoxy-3-O-β-D-galactopyranosyl-β-D-glucopyranoside | 894075-84-4 | 1mg |
| GC6285-2mg | 2-Aminoethyl 2-acetamido-2-deoxy-3-O-β-D-galactopyranosyl-β-D-glucopyranoside | 894075-84-4 | 2mg |
| GC6285-5mg | 2-Aminoethyl 2-acetamido-2-deoxy-3-O-β-D-galactopyranosyl-β-D-glucopyranoside | 894075-84-4 | 5mg |
| GC6285-10mg | 2-Aminoethyl 2-acetamido-2-deoxy-3-O-β-D-galactopyranosyl-β-D-glucopyranoside | 894075-84-4 | 10mg |
| GC6285-25mg | 2-Aminoethyl 2-acetamido-2-deoxy-3-O-β-D-galactopyranosyl-β-D-glucopyranoside | 894075-84-4 | 25mg |
| GC0673-10mg | 2-Aminoethyl 2-O-sulfo-α-L-fucopyranoside sodium salt | 10mg | |
| GC0673-25mg | 2-Aminoethyl 2-O-sulfo-α-L-fucopyranoside sodium salt | 25mg | |
| GC0673-50mg | 2-Aminoethyl 2-O-sulfo-α-L-fucopyranoside sodium salt | 50mg | |
| GC0673-100mg | 2-Aminoethyl 2-O-sulfo-α-L-fucopyranoside sodium salt | 100mg | |
| GC6268-100mg | 2-Aminoethyl 2,3,4,6-tetra-O-acetyl-α-D-mannopyranoside hydrochloride | 1438262-33-9 | 100mg |
| GC6268-250mg | 2-Aminoethyl 2,3,4,6-tetra-O-acetyl-α-D-mannopyranoside hydrochloride | 1438262-33-9 | 250mg |
| GC6268-500mg | 2-Aminoethyl 2,3,4,6-tetra-O-acetyl-α-D-mannopyranoside hydrochloride | 1438262-33-9 | 500mg |
| GC6268-1g | 2-Aminoethyl 2,3,4,6-tetra-O-acetyl-α-D-mannopyranoside hydrochloride | 1438262-33-9 | 1g |
| GC4975-1mg | 2-Aminoethyl 3-O-α-D-galactopyranosyl-β-D-galactopyranoside | 2460713-67-9 | 1mg |
| GC4975-2mg | 2-Aminoethyl 3-O-α-D-galactopyranosyl-β-D-galactopyranoside | 2460713-67-9 | 2mg |
| GC4975-5mg | 2-Aminoethyl 3-O-α-D-galactopyranosyl-β-D-galactopyranoside | 2460713-67-9 | 5mg |
| GC4975-10mg | 2-Aminoethyl 3-O-α-D-galactopyranosyl-β-D-galactopyranoside | 2460713-67-9 | 10mg |
| GC6645-5mg | 2-Aminoethyl 6-deoxy-α-D-galactopyranoside | 5mg | |
| GC6645-10mg | 2-Aminoethyl 6-deoxy-α-D-galactopyranoside | 10mg | |
| GC6645-25mg | 2-Aminoethyl 6-deoxy-α-D-galactopyranoside | 25mg | |
| GC6645-50mg | 2-Aminoethyl 6-deoxy-α-D-galactopyranoside | 50mg | |
| GC2707-10mg | 2-Aminoethyl α-L-fucopyranoside | 153252-87-0 | 10mg |
| GC2707-25mg | 2-Aminoethyl α-L-fucopyranoside | 153252-87-0 | 25mg |
| GC2707-50mg | 2-Aminoethyl α-L-fucopyranoside | 153252-87-0 | 50mg |
| GC2707-100mg | 2-Aminoethyl α-L-fucopyranoside | 153252-87-0 | 100mg |
| GC2707-250mg | 2-Aminoethyl α-L-fucopyranoside | 153252-87-0 | 250mg |
| GC4850-1mg | 2-Aminoethyl β-D-anthropyranoside | 1042430-66-9 | 1mg |
| GC4850-2mg | 2-Aminoethyl β-D-anthropyranoside | 1042430-66-9 | 2mg |
| GM4865-25g | 2-Aminoisobutyric acid | 62-57-7 | 25g |
| GM4865-100g | 2-Aminoisobutyric acid | 62-57-7 | 100g |
| GK2991-100g | 2-Aminophenol | 95-55-6 | 100g |
| GK2991-500g | 2-Aminophenol | 95-55-6 | 500g |
| GC6815-100mg | 2-Aminophenyl 2,3,4-tri-O-acetyl-β-D-glucopyranosiduronic acid methyl ester | 2243924-11-8 | 100mg |
| GC6815-250mg | 2-Aminophenyl 2,3,4-tri-O-acetyl-β-D-glucopyranosiduronic acid methyl ester | 2243924-11-8 | 250mg |
| GC6815-500mg | 2-Aminophenyl 2,3,4-tri-O-acetyl-β-D-glucopyranosiduronic acid methyl ester | 2243924-11-8 | 500mg |
| GC6815-1g | 2-Aminophenyl 2,3,4-tri-O-acetyl-β-D-glucopyranosiduronic acid methyl ester | 2243924-11-8 | 1g |
| GE6905-100mg | 2-Aminopurine | 452-06-2 | 100mg |
| GE6905-250mg | 2-Aminopurine | 452-06-2 | 250mg |
| GM2720-25g | 2-Aminoterephthalic acid | 10312-55-7 | 25g |
| GW1198-100mg | 2-Anthracenylsulfonyl chloride | 17407-98-6 | 100mg |
| GW1198-1g | 2-Anthracenylsulfonyl chloride | 17407-98-6 | 1g |
| GC9044-50mg | 2-Azido-2-deoxy-1-O-(thexyldimethylsilyl)-β-L-fucopyranose | 1653990-08-9 | 50mg |
| GC9044-100mg | 2-Azido-2-deoxy-1-O-(thexyldimethylsilyl)-β-L-fucopyranose | 1653990-08-9 | 100mg |
| GC9044-250mg | 2-Azido-2-deoxy-1-O-(thexyldimethylsilyl)-β-L-fucopyranose | 1653990-08-9 | 250mg |
| GC9044-500mg | 2-Azido-2-deoxy-1-O-(thexyldimethylsilyl)-β-L-fucopyranose | 1653990-08-9 | 500mg |
| GC9044-1g | 2-Azido-2-deoxy-1-O-(thexyldimethylsilyl)-β-L-fucopyranose | 1653990-08-9 | 1g |
| GC6213-250mg | 2-Azido-2-deoxy-1,3,4,6-tetra-O-acetyl-D-galactopyranose | 84278-00-2 | 250mg |
| GC6213-500mg | 2-Azido-2-deoxy-1,3,4,6-tetra-O-acetyl-D-galactopyranose | 84278-00-2 | 500mg |
| GC6213-1g | 2-Azido-2-deoxy-1,3,4,6-tetra-O-acetyl-D-galactopyranose | 84278-00-2 | 1g |
| GC6213-2g | 2-Azido-2-deoxy-1,3,4,6-tetra-O-acetyl-D-galactopyranose | 84278-00-2 | 2g |
| GC5275-50mg | 2-Azido-2-deoxy-D-galactose | 68733-26-6 | 50mg |
| GC5275-100mg | 2-Azido-2-deoxy-D-galactose | 68733-26-6 | 100mg |
| GC5275-250mg | 2-Azido-2-deoxy-D-galactose | 68733-26-6 | 250mg |
| GC5275-500mg | 2-Azido-2-deoxy-D-galactose | 68733-26-6 | 500mg |
| GC5099-10mg | 2-Azido-2-deoxy-D-glucofuranurono-6,3-lactone | 81997-89-9 | 10mg |
| GC5099-25mg | 2-Azido-2-deoxy-D-glucofuranurono-6,3-lactone | 81997-89-9 | 25mg |
| GC5099-50mg | 2-Azido-2-deoxy-D-glucofuranurono-6,3-lactone | 81997-89-9 | 50mg |
| GC5099-100mg | 2-Azido-2-deoxy-D-glucofuranurono-6,3-lactone | 81997-89-9 | 100mg |
| GC8902-500mg | 2-Azido-2-deoxy-D-glucose | 56883-39-7 | 500mg |
| GC8902-1g | 2-Azido-2-deoxy-D-glucose | 56883-39-7 | 1g |
| GC8902-2g | 2-Azido-2-deoxy-D-glucose | 56883-39-7 | 2g |
| GC8902-5g | 2-Azido-2-deoxy-D-glucose | 56883-39-7 | 5g |
| GC6789-5mg | 2-Azido-2-deoxy-L-fucopyranose | 5mg | |
| GC6789-10mg | 2-Azido-2-deoxy-L-fucopyranose | 10mg | |
| GC6789-25mg | 2-Azido-2-deoxy-L-fucopyranose | 25mg | |
| GC6789-50mg | 2-Azido-2-deoxy-L-fucopyranose | 50mg | |
| GC5554-1mg | 2-Azidoethyl 2-acetamido-2-deoxy-3-O-β-D-galactopyranosyl-β-D-glucopyranoside | 639459-69-1 | 1mg |
| GC5554-2mg | 2-Azidoethyl 2-acetamido-2-deoxy-3-O-β-D-galactopyranosyl-β-D-glucopyranoside | 639459-69-1 | 2mg |
| GC5554-5mg | 2-Azidoethyl 2-acetamido-2-deoxy-3-O-β-D-galactopyranosyl-β-D-glucopyranoside | 639459-69-1 | 5mg |
| GC5554-10mg | 2-Azidoethyl 2-acetamido-2-deoxy-3-O-β-D-galactopyranosyl-β-D-glucopyranoside | 639459-69-1 | 10mg |
| GC5554-25mg | 2-Azidoethyl 2-acetamido-2-deoxy-3-O-β-D-galactopyranosyl-β-D-glucopyranoside | 639459-69-1 | 25mg |
| GC6784-1mg | 2-Azidoethyl 2-acetamido-2-deoxy-4-O-β-D-galactopyranosyl-β-D-glucopyranoside | 338971-38-3 | 1mg |
| GC6784-2mg | 2-Azidoethyl 2-acetamido-2-deoxy-4-O-β-D-galactopyranosyl-β-D-glucopyranoside | 338971-38-3 | 2mg |
| GC6784-5mg | 2-Azidoethyl 2-acetamido-2-deoxy-4-O-β-D-galactopyranosyl-β-D-glucopyranoside | 338971-38-3 | 5mg |
| GC6784-10mg | 2-Azidoethyl 2-acetamido-2-deoxy-4-O-β-D-galactopyranosyl-β-D-glucopyranoside | 338971-38-3 | 10mg |
| GC7544-50mg | 2-Azidoethyl 2-acetamido-2-deoxy-β-D-glucopyranoside | 142072-12-6 | 50mg |
| GC7544-100mg | 2-Azidoethyl 2-acetamido-2-deoxy-β-D-glucopyranoside | 142072-12-6 | 100mg |
| GC7544-250mg | 2-Azidoethyl 2-acetamido-2-deoxy-β-D-glucopyranoside | 142072-12-6 | 250mg |
| GC7544-500mg | 2-Azidoethyl 2-acetamido-2-deoxy-β-D-glucopyranoside | 142072-12-6 | 500mg |
| GC7544-1g | 2-Azidoethyl 2-acetamido-2-deoxy-β-D-glucopyranoside | 142072-12-6 | 1g |
| GC4249-100mg | 2-Azidoethyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-galactopyranoside | 142072-14-8 | 100mg |
| GC4249-250mg | 2-Azidoethyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-galactopyranoside | 142072-14-8 | 250mg |
| GC4249-500mg | 2-Azidoethyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-galactopyranoside | 142072-14-8 | 500mg |
| GC4249-1g | 2-Azidoethyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-galactopyranoside | 142072-14-8 | 1g |
| GC2840-100mg | 2-Azidoethyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-glucopyranoside | 142072-11-5 | 100mg |
| GC2840-250mg | 2-Azidoethyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-glucopyranoside | 142072-11-5 | 250mg |
| GC2840-500mg | 2-Azidoethyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-glucopyranoside | 142072-11-5 | 500mg |
| GC2840-1g | 2-Azidoethyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-glucopyranoside | 142072-11-5 | 1g |
| GC5686-10mg | 2-Azidoethyl 2,3,4-tri-O-acetyl-6-deoxy-α-D-galactopyranoside | 10mg | |
| GC5686-25mg | 2-Azidoethyl 2,3,4-tri-O-acetyl-6-deoxy-α-D-galactopyranoside | 25mg | |
| GC5686-50mg | 2-Azidoethyl 2,3,4-tri-O-acetyl-6-deoxy-α-D-galactopyranoside | 50mg | |
| GC5686-100mg | 2-Azidoethyl 2,3,4-tri-O-acetyl-6-deoxy-α-D-galactopyranoside | 100mg | |
| GC2992-50mg | 2-Azidoethyl 2,3,4-tri-O-acetyl-α-L-fucopyranoside | 167015-91-0 | 50mg |
| GC2992-100mg | 2-Azidoethyl 2,3,4-tri-O-acetyl-α-L-fucopyranoside | 167015-91-0 | 100mg |
| GC2992-250mg | 2-Azidoethyl 2,3,4-tri-O-acetyl-α-L-fucopyranoside | 167015-91-0 | 250mg |
| GC2992-500mg | 2-Azidoethyl 2,3,4-tri-O-acetyl-α-L-fucopyranoside | 167015-91-0 | 500mg |
| GC2992-1g | 2-Azidoethyl 2,3,4-tri-O-acetyl-α-L-fucopyranoside | 167015-91-0 | 1g |
| GC4178-50mg | 2-Azidoethyl 2,3,4-tri-O-acetyl-β-D-glucopyranosiduronic acid methyl ester | 128095-62-5 | 50mg |
| GC4178-100mg | 2-Azidoethyl 2,3,4-tri-O-acetyl-β-D-glucopyranosiduronic acid methyl ester | 128095-62-5 | 100mg |
| GC4178-250mg | 2-Azidoethyl 2,3,4-tri-O-acetyl-β-D-glucopyranosiduronic acid methyl ester | 128095-62-5 | 250mg |
| GC4178-500mg | 2-Azidoethyl 2,3,4-tri-O-acetyl-β-D-glucopyranosiduronic acid methyl ester | 128095-62-5 | 500mg |
| GC0060-100mg | 2-Azidoethyl 2,3,4-tri-O-acetyl-β-D-xylopyranoside | 72718-01-5 | 100mg |
| GC0060-250mg | 2-Azidoethyl 2,3,4-tri-O-acetyl-β-D-xylopyranoside | 72718-01-5 | 250mg |
| GC0060-500mg | 2-Azidoethyl 2,3,4-tri-O-acetyl-β-D-xylopyranoside | 72718-01-5 | 500mg |
| GC0060-1g | 2-Azidoethyl 2,3,4-tri-O-acetyl-β-D-xylopyranoside | 72718-01-5 | 1g |
| GC3573-500mg | 2-Azidoethyl 2,3,4,6-tetra-O-acetyl-α-D-mannopyranoside | 140428-83-7 | 500mg |
| GC3573-1g | 2-Azidoethyl 2,3,4,6-tetra-O-acetyl-α-D-mannopyranoside | 140428-83-7 | 1g |
| GC3573-2g | 2-Azidoethyl 2,3,4,6-tetra-O-acetyl-α-D-mannopyranoside | 140428-83-7 | 2g |
| GC3573-5g | 2-Azidoethyl 2,3,4,6-tetra-O-acetyl-α-D-mannopyranoside | 140428-83-7 | 5g |
| GC0578-500mg | 2-Azidoethyl 2,3,4,6-tetra-O-acetyl-β-D-galactopyranoside | 139888-80-5 | 500mg |
| GC0578-1g | 2-Azidoethyl 2,3,4,6-tetra-O-acetyl-β-D-galactopyranoside | 139888-80-5 | 1g |
| GC0578-2g | 2-Azidoethyl 2,3,4,6-tetra-O-acetyl-β-D-galactopyranoside | 139888-80-5 | 2g |
| GC0578-5g | 2-Azidoethyl 2,3,4,6-tetra-O-acetyl-β-D-galactopyranoside | 139888-80-5 | 5g |
| GC4291-500mg | 2-Azidoethyl 2,3,4,6-tetra-O-acetyl-β-D-glucopyranoside | 140428-81-5 | 500mg |
| GC4291-1g | 2-Azidoethyl 2,3,4,6-tetra-O-acetyl-β-D-glucopyranoside | 140428-81-5 | 1g |
| GC4291-2g | 2-Azidoethyl 2,3,4,6-tetra-O-acetyl-β-D-glucopyranoside | 140428-81-5 | 2g |
| GC4291-5g | 2-Azidoethyl 2,3,4,6-tetra-O-acetyl-β-D-glucopyranoside | 140428-81-5 | 5g |
| GC9458-25mg | 2-Azidoethyl 2,4-di-O-benzoyl-α-D-mannopyranoside | 872100-81-7 | 25mg |
| GC9458-50mg | 2-Azidoethyl 2,4-di-O-benzoyl-α-D-mannopyranoside | 872100-81-7 | 50mg |
| GC9458-100mg | 2-Azidoethyl 2,4-di-O-benzoyl-α-D-mannopyranoside | 872100-81-7 | 100mg |
| GC9458-250mg | 2-Azidoethyl 2,4-di-O-benzoyl-α-D-mannopyranoside | 872100-81-7 | 250mg |
| GC5237-100mg | 2-Azidoethyl 3-O-acetyl-4,6-O-benzylidene-2-deoxy-2-phthalimido-β-D-glucopyranoside | 1194397-89-1 | 100mg |
| GC5237-250mg | 2-Azidoethyl 3-O-acetyl-4,6-O-benzylidene-2-deoxy-2-phthalimido-β-D-glucopyranoside | 1194397-89-1 | 250mg |
| GC5237-500mg | 2-Azidoethyl 3-O-acetyl-4,6-O-benzylidene-2-deoxy-2-phthalimido-β-D-glucopyranoside | 1194397-89-1 | 500mg |
| GC5237-1g | 2-Azidoethyl 3-O-acetyl-4,6-O-benzylidene-2-deoxy-2-phthalimido-β-D-glucopyranoside | 1194397-89-1 | 1g |
| GC6746-50mg | 2-Azidoethyl 3,4-O-isopropylidene-α-L-fucopyranoside | 1220051-58-0 | 50mg |
| GC6746-100mg | 2-Azidoethyl 3,4-O-isopropylidene-α-L-fucopyranoside | 1220051-58-0 | 100mg |
| GC6746-250mg | 2-Azidoethyl 3,4-O-isopropylidene-α-L-fucopyranoside | 1220051-58-0 | 250mg |
| GC6746-500mg | 2-Azidoethyl 3,4-O-isopropylidene-α-L-fucopyranoside | 1220051-58-0 | 500mg |
| GC2770-1mg | 2-Azidoethyl 3,6-di-O-(α-D-mannopyranosyl)-α-D-mannopyranoside | 1238337-27-3 | 1mg |
| GC2770-2mg | 2-Azidoethyl 3,6-di-O-(α-D-mannopyranosyl)-α-D-mannopyranoside | 1238337-27-3 | 2mg |
| GC2770-5mg | 2-Azidoethyl 3,6-di-O-(α-D-mannopyranosyl)-α-D-mannopyranoside | 1238337-27-3 | 5mg |
| GC2770-10mg | 2-Azidoethyl 3,6-di-O-(α-D-mannopyranosyl)-α-D-mannopyranoside | 1238337-27-3 | 10mg |
| GC6983-50mg | 2-Azidoethyl α-D-mannopyranoside | 155196-97-7 | 50mg |
| GC6983-100mg | 2-Azidoethyl α-D-mannopyranoside | 155196-97-7 | 100mg |
| GC6983-250mg | 2-Azidoethyl α-D-mannopyranoside | 155196-97-7 | 250mg |
| GC6983-500mg | 2-Azidoethyl α-D-mannopyranoside | 155196-97-7 | 500mg |
| GC6983-1g | 2-Azidoethyl α-D-mannopyranoside | 155196-97-7 | 1g |
| GC9084-25mg | 2-Azidoethyl α-L-fucopyranoside | 153252-86-9 | 25mg |
| GC9084-50mg | 2-Azidoethyl α-L-fucopyranoside | 153252-86-9 | 50mg |
| GC9084-100mg | 2-Azidoethyl α-L-fucopyranoside | 153252-86-9 | 100mg |
| GC9084-250mg | 2-Azidoethyl α-L-fucopyranoside | 153252-86-9 | 250mg |
| GC6933-100mg | 2-Azidoethyl β-D-galactopyranoside | 151651-54-6 | 100mg |
| GC6933-250mg | 2-Azidoethyl β-D-galactopyranoside | 151651-54-6 | 250mg |
| GC6933-500mg | 2-Azidoethyl β-D-galactopyranoside | 151651-54-6 | 500mg |
| GC6933-1g | 2-Azidoethyl β-D-galactopyranoside | 151651-54-6 | 1g |
| GC6933-2g | 2-Azidoethyl β-D-galactopyranoside | 151651-54-6 | 2g |
| GC5576-100mg | 2-Azidoethyl β-D-glucopyranoside | 165331-08-8 | 100mg |
| GC5576-250mg | 2-Azidoethyl β-D-glucopyranoside | 165331-08-8 | 250mg |
| GC5576-500mg | 2-Azidoethyl β-D-glucopyranoside | 165331-08-8 | 500mg |
| GC5576-1g | 2-Azidoethyl β-D-glucopyranoside | 165331-08-8 | 1g |
| GC5504-1mg | 2-Azidoethyl β-D-glucopyranosiduronic acid | 128095-64-7 | 1mg |
| GC5504-2mg | 2-Azidoethyl β-D-glucopyranosiduronic acid | 128095-64-7 | 2mg |
| GC5504-5mg | 2-Azidoethyl β-D-glucopyranosiduronic acid | 128095-64-7 | 5mg |
| GC9441-25mg | 2-Azidoethyl β-D-lactoside | 230286-11-0 | 25mg |
| GC9441-50mg | 2-Azidoethyl β-D-lactoside | 230286-11-0 | 50mg |
| GC9441-100mg | 2-Azidoethyl β-D-lactoside | 230286-11-0 | 100mg |
| GC9441-250mg | 2-Azidoethyl β-D-lactoside | 230286-11-0 | 250mg |
| GC3441-50mg | 2-Azidoethyl β-D-lactoside heptaacetate | 230286-10-9 | 50mg |
| GC3441-100mg | 2-Azidoethyl β-D-lactoside heptaacetate | 230286-10-9 | 100mg |
| GC3441-250mg | 2-Azidoethyl β-D-lactoside heptaacetate | 230286-10-9 | 250mg |
| GC3441-500mg | 2-Azidoethyl β-D-lactoside heptaacetate | 230286-10-9 | 500mg |
| GC6031-500mg | 2-Benzyl-lactyl lactate | 70022-27-4 | 500mg |
| GC6031-1g | 2-Benzyl-lactyl lactate | 70022-27-4 | 1g |
| GC6031-2g | 2-Benzyl-lactyl lactate | 70022-27-4 | 2g |
| GC6031-5g | 2-Benzyl-lactyl lactate | 70022-27-4 | 5g |
| GX0684-1g | 2-Bromo-1-(4-fluorophenyl)-2-phenylethanone | 88675-31-4 | 1g |
| GP7889-25g | 2-Bromo-2-nitro-1,3-propanediol | 52-51-7 | 25g |
| GP7889-100g | 2-Bromo-2-nitro-1,3-propanediol | 52-51-7 | 100g |
| GP7889-250g | 2-Bromo-2-nitro-1,3-propanediol | 52-51-7 | 250g |
| GK5453-5g | 2-Bromo-5-methoxybenzoic acid | 22921-68-2 | 5g |
| GW4551-500mg | 2-Bromoacrolein | 14925-39-4 | 500mg |
| GW4551-2g | 2-Bromoacrolein | 14925-39-4 | 2g |
| GK1337-5g | 2-Bromobiphenyl | 2052-07-5 | 5g |
| GK1337-25g | 2-Bromobiphenyl | 2052-07-5 | 25g |
| GW0228-500mg | 2-Bromocycloheptanone | 766-65-4 | 500mg |
| GW0228-1g | 2-Bromocycloheptanone | 766-65-4 | 1g |
| GK9684-25g | 2-Bromoethanesulfonic acid sodium salt | 4263-52-9 | 25g |
| GK0232-25g | 2-Bromoethylamine hydrobromide | 2576-47-8 | 25g |
| GK0232-100g | 2-Bromoethylamine hydrobromide | 2576-47-8 | 100g |
| GK0232-250g | 2-Bromoethylamine hydrobromide | 2576-47-8 | 250g |
| GK0232-500g | 2-Bromoethylamine hydrobromide | 2576-47-8 | 500g |
| GW5217-5g | 2-Bromophenethylamine | 65185-58-2 | 5g |
| GW5217-10g | 2-Bromophenethylamine | 65185-58-2 | 10g |
| GL0826-25ml | 2-Butanol | 78-92-2 | 25ml |
| GL0826-100ml | 2-Butanol | 78-92-2 | 100ml |
| GK2748-100ml | 2-Butanone | 78-93-3 | 100ml |
| GK1873-25g | 2-Carbethoxycyclopentanone | 611-10-9 | 25g |
| GK1873-100g | 2-Carbethoxycyclopentanone | 611-10-9 | 100g |
| GK3806-5g | 2-Chloro-2'',4''-difluoroacetophenone | 51336-94-8 | 5g |
| GP2706-5g | 2-Chloro-4-fluorobenzaldehyde | 84194-36-5 | 5g |
| GK8367-25g | 2-Chloro-4-fluorobenzoic acid | 2252-51-9 | 25g |
| GW3462-1g | 2-Chloro-4-methoxyresorcinol | 81742-06-5 | 1g |
| GK1821-5g | 2-Chloro-4-methylphenol | 6640-27-3 | 5g |
| GC0463-5mg | 2-Chloro-4-nitrophenyl 2-azido-2-deoxy-β-D-galactopyranoside | 5mg | |
| GC0463-10mg | 2-Chloro-4-nitrophenyl 2-azido-2-deoxy-β-D-galactopyranoside | 10mg | |
| GC0463-25mg | 2-Chloro-4-nitrophenyl 2-azido-2-deoxy-β-D-galactopyranoside | 25mg | |
| GC0463-50mg | 2-Chloro-4-nitrophenyl 2-azido-2-deoxy-β-D-galactopyranoside | 50mg | |
| GC0463-100mg | 2-Chloro-4-nitrophenyl 2-azido-2-deoxy-β-D-galactopyranoside | 100mg | |
| GC2222-25mg | 2-Chloro-4-nitrophenyl a-D-maltotrioside | 118291-90-0 | 25mg |
| GC2222-100mg | 2-Chloro-4-nitrophenyl a-D-maltotrioside | 118291-90-0 | 100mg |
| GC9138-10mg | 2-Chloro-4-nitrophenyl b-D-cellobioside | 135743-28-1 | 10mg |
| GC9138-25mg | 2-Chloro-4-nitrophenyl b-D-cellobioside | 135743-28-1 | 25mg |
| GC9138-50mg | 2-Chloro-4-nitrophenyl b-D-cellobioside | 135743-28-1 | 50mg |
| GC9138-100mg | 2-Chloro-4-nitrophenyl b-D-cellobioside | 135743-28-1 | 100mg |
| GC5397-100mg | 2-Chloro-4-nitrophenyl b-D-maltotrioside | 165522-16-7 | 100mg |
| GC0413-50mg | 2-Chloro-4-nitrophenyl-α-D-glucopyranoside | 119047-14-2 | 50mg |
| GC0413-100mg | 2-Chloro-4-nitrophenyl-α-D-glucopyranoside | 119047-14-2 | 100mg |
| GC0413-250mg | 2-Chloro-4-nitrophenyl-α-D-glucopyranoside | 119047-14-2 | 250mg |
| GC0413-500mg | 2-Chloro-4-nitrophenyl-α-D-glucopyranoside | 119047-14-2 | 500mg |
| GC0413-1g | 2-Chloro-4-nitrophenyl-α-D-glucopyranoside | 119047-14-2 | 1g |
| GK9320-5g | 2-Chloro-4,6-dimethoxy-1,3,5-triazine | 3140-73-6 | 5g |
| GK9320-25g | 2-Chloro-4,6-dimethoxy-1,3,5-triazine | 3140-73-6 | 25g |
| GK9320-100g | 2-Chloro-4,6-dimethoxy-1,3,5-triazine | 3140-73-6 | 100g |
| GK8517-1g | 2-Chloro-5-chloromethylthiazole | 105827-91-6 | 1g |
| GK8517-5g | 2-Chloro-5-chloromethylthiazole | 105827-91-6 | 5g |
| GK4024-25g | 2-Chloro-5-nitrobenzaldehyde | 6361-21-3 | 25g |
| GK4024-100g | 2-Chloro-5-nitrobenzaldehyde | 6361-21-3 | 100g |
| GK3965-25g | 2-Chloro-5-nitrobenzoic acid | 2516-96-3 | 25g |
| GK4951-1g | 2-Chloro-6-trichloromethylpyridine | 1929-82-4 | 1g |
| GK4951-5g | 2-Chloro-6-trichloromethylpyridine | 1929-82-4 | 5g |
| GK4392-5g | 2-Chloro-6-trifluoromethylpyridine | 39890-95-4 | 5g |
| GE9219-1g | 2-Chloroadenosine | 146-77-0 | 1g |
| GK8903-25ml | 2-Chloroaniline | 95-51-2 | 25ml |
| GK8903-100ml | 2-Chloroaniline | 95-51-2 | 100ml |
| GX3919-100g | 2-Chlorobenzaldehyde | 89-98-5 | 100g |
| GW2613-1g | 2-Chlorocyclohepta-2,4,6-trienone | 3839-48-3 | 1g |
| GW2613-2g | 2-Chlorocyclohepta-2,4,6-trienone | 3839-48-3 | 2g |
| GW2613-10g | 2-Chlorocyclohepta-2,4,6-trienone | 3839-48-3 | 10g |
| GC2627-100mg | 2-Chloroethyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-glucopyranoside | 887641-02-3 | 100mg |
| GC2627-250mg | 2-Chloroethyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-glucopyranoside | 887641-02-3 | 250mg |
| GC2627-500mg | 2-Chloroethyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-glucopyranoside | 887641-02-3 | 500mg |
| GC2627-1g | 2-Chloroethyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-glucopyranoside | 887641-02-3 | 1g |
| GC7015-100mg | 2-Chloroethyl 2,3,4-tri-O-acetyl-β-D-glucopyranosiduronic acid methyl ester | 6386-29-4 | 100mg |
| GC7015-250mg | 2-Chloroethyl 2,3,4-tri-O-acetyl-β-D-glucopyranosiduronic acid methyl ester | 6386-29-4 | 250mg |
| GC7015-500mg | 2-Chloroethyl 2,3,4-tri-O-acetyl-β-D-glucopyranosiduronic acid methyl ester | 6386-29-4 | 500mg |
| GC7015-1g | 2-Chloroethyl 2,3,4-tri-O-acetyl-β-D-glucopyranosiduronic acid methyl ester | 6386-29-4 | 1g |
| GC3955-1g | 2-Chloroethyl 2,3,4-tri-O-acetyl-β-D-xylopyranoside | 18404-86-9 | 1g |
| GC3955-2g | 2-Chloroethyl 2,3,4-tri-O-acetyl-β-D-xylopyranoside | 18404-86-9 | 2g |
| GC3955-5g | 2-Chloroethyl 2,3,4-tri-O-acetyl-β-D-xylopyranoside | 18404-86-9 | 5g |
| GC3955-10g | 2-Chloroethyl 2,3,4-tri-O-acetyl-β-D-xylopyranoside | 18404-86-9 | 10g |
| GC3265-500mg | 2-Chloroethyl 2,3,4,6-tetra-O-acetyl-β-D-galactopyranoside | 140428-85-9 | 500mg |
| GC3265-1g | 2-Chloroethyl 2,3,4,6-tetra-O-acetyl-β-D-galactopyranoside | 140428-85-9 | 1g |
| GC3265-2g | 2-Chloroethyl 2,3,4,6-tetra-O-acetyl-β-D-galactopyranoside | 140428-85-9 | 2g |
| GC3265-5g | 2-Chloroethyl 2,3,4,6-tetra-O-acetyl-β-D-galactopyranoside | 140428-85-9 | 5g |
| GC1334-1g | 2-Chloroethyl 2,3,4,6-tetra-O-acetyl-β-D-glucopyranoside | 16977-77-8 | 1g |
| GC1334-2g | 2-Chloroethyl 2,3,4,6-tetra-O-acetyl-β-D-glucopyranoside | 16977-77-8 | 2g |
| GC1334-5g | 2-Chloroethyl 2,3,4,6-tetra-O-acetyl-β-D-glucopyranoside | 16977-77-8 | 5g |
| GC1334-10g | 2-Chloroethyl 2,3,4,6-tetra-O-acetyl-β-D-glucopyranoside | 16977-77-8 | 10g |
| GC2640-100mg | 2-Chloroethyl 3-O-acetyl-4,6-O-benzylidene-2-deoxy-2-phthalimido-β-D-glucopyranoside | 100mg | |
| GC2640-250mg | 2-Chloroethyl 3-O-acetyl-4,6-O-benzylidene-2-deoxy-2-phthalimido-β-D-glucopyranoside | 250mg | |
| GC2640-500mg | 2-Chloroethyl 3-O-acetyl-4,6-O-benzylidene-2-deoxy-2-phthalimido-β-D-glucopyranoside | 500mg | |
| GC2640-1g | 2-Chloroethyl 3-O-acetyl-4,6-O-benzylidene-2-deoxy-2-phthalimido-β-D-glucopyranoside | 1g | |
| GC0171-50mg | 2-Chloroethyl α-L-fucopyranoside | 491593-36-3 | 50mg |
| GC0171-100mg | 2-Chloroethyl α-L-fucopyranoside | 491593-36-3 | 100mg |
| GC0171-250mg | 2-Chloroethyl α-L-fucopyranoside | 491593-36-3 | 250mg |
| GC0171-500mg | 2-Chloroethyl α-L-fucopyranoside | 491593-36-3 | 500mg |
| GC5174-100mg | 2-Chloroethyl β-D-lactoside | 111501-79-2 | 100mg |
| GC5174-250mg | 2-Chloroethyl β-D-lactoside | 111501-79-2 | 250mg |
| GC5174-500mg | 2-Chloroethyl β-D-lactoside | 111501-79-2 | 500mg |
| GC5174-1g | 2-Chloroethyl β-D-lactoside | 111501-79-2 | 1g |
| GC8520-100mg | 2-Chloroethyl β-D-lactoside heptaacetate | 120232-83-9 | 100mg |
| GC8520-250mg | 2-Chloroethyl β-D-lactoside heptaacetate | 120232-83-9 | 250mg |
| GC8520-500mg | 2-Chloroethyl β-D-lactoside heptaacetate | 120232-83-9 | 500mg |
| GC8520-1g | 2-Chloroethyl β-D-lactoside heptaacetate | 120232-83-9 | 1g |
| GC0442-500mg | 2-Chloroethyl-2,3,4,6-tetra-O-acetyl-a-D-mannopyranoside | 849420-02-6 | 500mg |
| GC0442-1g | 2-Chloroethyl-2,3,4,6-tetra-O-acetyl-a-D-mannopyranoside | 849420-02-6 | 1g |
| GC0442-2g | 2-Chloroethyl-2,3,4,6-tetra-O-acetyl-a-D-mannopyranoside | 849420-02-6 | 2g |
| GC0442-5g | 2-Chloroethyl-2,3,4,6-tetra-O-acetyl-a-D-mannopyranoside | 849420-02-6 | 5g |
| GK5986-25g | 2-Chloromethylpyridine hydrochloride | 6959-47-3 | 25g |
| GK5986-100g | 2-Chloromethylpyridine hydrochloride | 6959-47-3 | 100g |
| GK8595-25g | 2-Chloropyridine-4-carboxylic acid | 6313-54-8 | 25g |
| GK2810-5g | 2-Coumaranone | 553-86-6 | 5g |
| GK2810-25g | 2-Coumaranone | 553-86-6 | 25g |
| GW4194-2g | 2-Cyclopropyl-propylamine -p-toluenesulfonate salt | 172947-14-7 | 2g |
| GW4194-10g | 2-Cyclopropyl-propylamine -p-toluenesulfonate salt | 172947-14-7 | 10g |
| GC7979-100mg | 2-Decyltetradecyl D-xylopyranoside | 446264-02-4 | 100mg |
| GC7979-250mg | 2-Decyltetradecyl D-xylopyranoside | 446264-02-4 | 250mg |
| GC7979-500mg | 2-Decyltetradecyl D-xylopyranoside | 446264-02-4 | 500mg |
| GC7979-1g | 2-Decyltetradecyl D-xylopyranoside | 446264-02-4 | 1g |
| GC7411-25mg | 2-Deoxy-2-fluoro-D-glucose | 29702-43-0 | 25mg |
| GC7411-50mg | 2-Deoxy-2-fluoro-D-glucose | 29702-43-0 | 50mg |
| GC7411-100mg | 2-Deoxy-2-fluoro-D-glucose | 29702-43-0 | 100mg |
| GC7411-250mg | 2-Deoxy-2-fluoro-D-glucose | 29702-43-0 | 250mg |
| GC7411-500mg | 2-Deoxy-2-fluoro-D-glucose | 29702-43-0 | 500mg |
| GC8449-1mg | 2-Deoxy-2-fluoro-D-lactose | 1mg | |
| GC8449-2mg | 2-Deoxy-2-fluoro-D-lactose | 2mg | |
| GC8449-5mg | 2-Deoxy-2-fluoro-D-lactose | 5mg | |
| GC8449-10mg | 2-Deoxy-2-fluoro-D-lactose | 10mg | |
| GC4574-10mg | 2-Deoxy-2-fluoro-D-ribofuranose | 10mg | |
| GC4574-25mg | 2-Deoxy-2-fluoro-D-ribofuranose | 25mg | |
| GC4574-50mg | 2-Deoxy-2-fluoro-D-ribofuranose | 50mg | |
| GC4574-100mg | 2-Deoxy-2-fluoro-D-ribofuranose | 100mg | |
| GC8836-5mg | 2-Deoxy-2-fluoro-L-fucose | 70763-62-1 | 5mg |
| GC8836-10mg | 2-Deoxy-2-fluoro-L-fucose | 70763-62-1 | 10mg |
| GC8836-25mg | 2-Deoxy-2-fluoro-L-fucose | 70763-62-1 | 25mg |
| GC8836-50mg | 2-Deoxy-2-fluoro-L-fucose | 70763-62-1 | 50mg |
| GC8836-100mg | 2-Deoxy-2-fluoro-L-fucose | 70763-62-1 | 100mg |
| GC3912-25mg | 2-Deoxy-2-fluoro-β-D-glucopyranosyl azide | 1159265-95-8 | 25mg |
| GC3912-50mg | 2-Deoxy-2-fluoro-β-D-glucopyranosyl azide | 1159265-95-8 | 50mg |
| GC3912-100mg | 2-Deoxy-2-fluoro-β-D-glucopyranosyl azide | 1159265-95-8 | 100mg |
| GC3912-250mg | 2-Deoxy-2-fluoro-β-D-glucopyranosyl azide | 1159265-95-8 | 250mg |
| GC6121-50mg | 2-Deoxy-2-iodo-D-glucose | 53008-75-6 | 50mg |
| GC6121-100mg | 2-Deoxy-2-iodo-D-glucose | 53008-75-6 | 100mg |
| GC6121-250mg | 2-Deoxy-2-iodo-D-glucose | 53008-75-6 | 250mg |
| GC6121-500mg | 2-Deoxy-2-iodo-D-glucose | 53008-75-6 | 500mg |
| GC8127-2g | 2-Deoxy-2-N-phthalimido-1,3,4,6-tetra-O-acetyl-D-glucopyranose | 79733-86-1 | 2g |
| GC8127-5g | 2-Deoxy-2-N-phthalimido-1,3,4,6-tetra-O-acetyl-D-glucopyranose | 79733-86-1 | 5g |
| GC8127-10g | 2-Deoxy-2-N-phthalimido-1,3,4,6-tetra-O-acetyl-D-glucopyranose | 79733-86-1 | 10g |
| GC8127-25g | 2-Deoxy-2-N-phthalimido-1,3,4,6-tetra-O-acetyl-D-glucopyranose | 79733-86-1 | 25g |
| GC2414-10mg | 2-Deoxy-D-arabino-Hexonic acid, calcium salt | 74516-89-5 | 10mg |
| GC2414-25mg | 2-Deoxy-D-arabino-Hexonic acid, calcium salt | 74516-89-5 | 25mg |
| GC2414-50mg | 2-Deoxy-D-arabino-Hexonic acid, calcium salt | 74516-89-5 | 50mg |
| GC2414-100mg | 2-Deoxy-D-arabino-Hexonic acid, calcium salt | 74516-89-5 | 100mg |
| GC5572-1g | 2-Deoxy-D-galactose | 1949-89-9 | 1g |
| GC5572-2g | 2-Deoxy-D-galactose | 1949-89-9 | 2g |
| GC5572-5g | 2-Deoxy-D-galactose | 1949-89-9 | 5g |
| GC5572-10g | 2-Deoxy-D-galactose | 1949-89-9 | 10g |
| GC6248-1g | 2-Deoxy-D-glucose | 154-17-6 | 1g |
| GC6248-5g | 2-Deoxy-D-glucose | 154-17-6 | 5g |
| GC6248-25g | 2-Deoxy-D-glucose | 154-17-6 | 25g |
| GC6248-100g | 2-Deoxy-D-glucose | 154-17-6 | 100g |
| GC2000-25mg | 2-Deoxy-D-glucose 6-phosphate sodium salt | 33068-19-8 | 25mg |
| GC7273-1g | 2-Deoxy-D-ribose | 533-67-5 | 1g |
| GC7273-5g | 2-Deoxy-D-ribose | 533-67-5 | 5g |
| GC7273-25g | 2-Deoxy-D-ribose | 533-67-5 | 25g |
| GC7273-100g | 2-Deoxy-D-ribose | 533-67-5 | 100g |
| GC9858-50mg | 2-Deoxy-D-xylose | 5284-18-4 | 50mg |
| GC9858-100mg | 2-Deoxy-D-xylose | 5284-18-4 | 100mg |
| GC9858-250mg | 2-Deoxy-D-xylose | 5284-18-4 | 250mg |
| GC9858-500mg | 2-Deoxy-D-xylose | 5284-18-4 | 500mg |
| GC5334-1g | 2-Deoxy-L-ribose | 18546-37-7 | 1g |
| GC5334-5g | 2-Deoxy-L-ribose | 18546-37-7 | 5g |
| GC5334-10g | 2-Deoxy-L-ribose | 18546-37-7 | 10g |
| GC3703-1mg | 2-Deoxy-scyllo-inosose | 78963-40-3 | 1mg |
| GC3703-5mg | 2-Deoxy-scyllo-inosose | 78963-40-3 | 5mg |
| GC3703-10mg | 2-Deoxy-scyllo-inosose | 78963-40-3 | 10mg |
| GC3703-25mg | 2-Deoxy-scyllo-inosose | 78963-40-3 | 25mg |
| GM1876-25g | 2-Dimethylaminoethanol (+)-bitartrate salt | 5988-51-2 | 25g |
| GC7173-100mg | 2-Dodecylhexadecyl D-xylopyranoside | 446264-03-5 | 100mg |
| GC7173-250mg | 2-Dodecylhexadecyl D-xylopyranoside | 446264-03-5 | 250mg |
| GC7173-500mg | 2-Dodecylhexadecyl D-xylopyranoside | 446264-03-5 | 500mg |
| GC7173-1g | 2-Dodecylhexadecyl D-xylopyranoside | 446264-03-5 | 1g |
| GM0340-25g | 2-Ethoxy-1-ethoxycarbonyl-1,2-dihydroquinoline | 16357-59-8 | 25g |
| GM0340-100g | 2-Ethoxy-1-ethoxycarbonyl-1,2-dihydroquinoline | 16357-59-8 | 100g |
| GW8859-50mg | 2-Ethoxy-2-(2-naphthyl)-acetonitrile | 33224-80-5 | 50mg |
| GW8859-250mg | 2-Ethoxy-2-(2-naphthyl)-acetonitrile | 33224-80-5 | 250mg |
| GX2445-25ml | 2-Ethoxyethanol | 110-80-5 | 25ml |
| GX2445-100ml | 2-Ethoxyethanol | 110-80-5 | 100ml |
| GC2764-100mg | 2-Ethylhexyl D-xylopyranoside | 185699-11-0 | 100mg |
| GC2764-250mg | 2-Ethylhexyl D-xylopyranoside | 185699-11-0 | 250mg |
| GC2764-500mg | 2-Ethylhexyl D-xylopyranoside | 185699-11-0 | 500mg |
| GC2764-1g | 2-Ethylhexyl D-xylopyranoside | 185699-11-0 | 1g |
| GK6026-100ml | 2-Ethylhexyl nitrate | 27247-96-7 | 100ml |
| GK6026-500ml | 2-Ethylhexyl nitrate | 27247-96-7 | 500ml |
| GK6026-1l | 2-Ethylhexyl nitrate | 27247-96-7 | 1l |
| GC6081-10mg | 2-Fluoro-4-nitrophenyl 2-azido-2-deoxy-β-D-galactopyranoside | 10mg | |
| GC6081-25mg | 2-Fluoro-4-nitrophenyl 2-azido-2-deoxy-β-D-galactopyranoside | 25mg | |
| GC6081-50mg | 2-Fluoro-4-nitrophenyl 2-azido-2-deoxy-β-D-galactopyranoside | 50mg | |
| GC6081-100mg | 2-Fluoro-4-nitrophenyl 2-azido-2-deoxy-β-D-galactopyranoside | 100mg | |
| GK0223-10g | 2-Fluorobenzaldehyde | 446-52-6 | 10g |
| GK0223-25g | 2-Fluorobenzaldehyde | 446-52-6 | 25g |
| GC2819-5mg | 2-Fluoroethyl α-L-fucopyranoside | 5mg | |
| GC2819-10mg | 2-Fluoroethyl α-L-fucopyranoside | 10mg | |
| GC2819-25mg | 2-Fluoroethyl α-L-fucopyranoside | 25mg | |
| GC2819-50mg | 2-Fluoroethyl α-L-fucopyranoside | 50mg | |
| GC1395-1g | 2-Formylphenyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside | 14581-83-0 | 1g |
| GC1395-2g | 2-Formylphenyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside | 14581-83-0 | 2g |
| GC1395-5g | 2-Formylphenyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside | 14581-83-0 | 5g |
| GC1395-10g | 2-Formylphenyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside | 14581-83-0 | 10g |
| GW9659-25mg | 2-Heptyl-3-hydroxyl-4-quinolone | 108985-27-9 | 25mg |
| GW9659-250mg | 2-Heptyl-3-hydroxyl-4-quinolone | 108985-27-9 | 250mg |
| GK5842-5g | 2-Hydrazinopyridine | 4930-98-7 | 5g |
| GK0834-5g | 2-Hydroxy-3-nitropyridine | 6332-56-5 | 5g |
| GK0834-25g | 2-Hydroxy-3-nitropyridine | 6332-56-5 | 25g |
| GK3659-5g | 2-Hydroxy-4-methoxybenzaldehyde | 673-22-3 | 5g |
| GK2691-10g | 2-Hydroxy-4-methoxybenzophenone-5-sulfonic acid | 4065-45-6 | 10g |
| GK2691-25g | 2-Hydroxy-4-methoxybenzophenone-5-sulfonic acid | 4065-45-6 | 25g |
| GK2691-100g | 2-Hydroxy-4-methoxybenzophenone-5-sulfonic acid | 4065-45-6 | 100g |
| GK2691-250g | 2-Hydroxy-4-methoxybenzophenone-5-sulfonic acid | 4065-45-6 | 250g |
| GK2521-5g | 2-Hydroxyacetophenone | 582-24-1 | 5g |
| GK9908-25g | 2-Hydroxybenzyl alcohol | 90-01-7 | 25g |
| GK9908-50g | 2-Hydroxybenzyl alcohol | 90-01-7 | 50g |
| GK9908-100g | 2-Hydroxybenzyl alcohol | 90-01-7 | 100g |
| GK9908-250g | 2-Hydroxybenzyl alcohol | 90-01-7 | 250g |
| GK9328-25g | 2-Hydroxybiphenyl | 90-43-7 | 25g |
| GK7095-25g | 2-Hydroxyethyl methacrylate | 868-77-9 | 25g |
| GK7095-100g | 2-Hydroxyethyl methacrylate | 868-77-9 | 100g |
| GX7571-100ml | 2-Hydroxyethyl methacrylate phosphate | 52628-03-2 | 100ml |
| GE5756-5g | 2-Hydroxypropyl-beta-cyclodextrin | 128446-35-5 | 5g |
| GE5756-25g | 2-Hydroxypropyl-beta-cyclodextrin | 128446-35-5 | 25g |
| GE5756-100g | 2-Hydroxypropyl-beta-cyclodextrin | 128446-35-5 | 100g |
| GE5877-25g | 2-Hydroxypropyl-beta-cyclodextrin, EP, USP grade | 128446-35-5 | 25g |
| GE3201-25g | 2-Hydroxypropyl-beta-cyclodextrin, USP grade | 128446-35-5 | 25g |
| GK4072-5g | 2-Hydroxypyridine-N-oxide | 13161-30-3 | 5g |
| GK4072-25g | 2-Hydroxypyridine-N-oxide | 13161-30-3 | 25g |
| GK4072-100g | 2-Hydroxypyridine-N-oxide | 13161-30-3 | 100g |
| GK4272-500g | 2-Imidazolidone | 120-93-4 | 500g |
| GX3703-1g | 2-Iodobenzenesulfonic acid sodium salt | 62973-69-7 | 1g |
| GX3703-5g | 2-Iodobenzenesulfonic acid sodium salt | 62973-69-7 | 5g |
| GK1884-100g | 2-Iodobenzoic acid | 88-67-5 | 100g |
| GC6472-100mg | 2-Iodoethyl 2,3,4-tri-O-acetyl-α-L-fucopyranoside | 100mg | |
| GC6472-250mg | 2-Iodoethyl 2,3,4-tri-O-acetyl-α-L-fucopyranoside | 250mg | |
| GC6472-500mg | 2-Iodoethyl 2,3,4-tri-O-acetyl-α-L-fucopyranoside | 500mg | |
| GC6472-1g | 2-Iodoethyl 2,3,4-tri-O-acetyl-α-L-fucopyranoside | 1g | |
| GC1017-50mg | 2-Iodoethyl α-L-fucopyranoside | 1932573-19-7 | 50mg |
| GC1017-100mg | 2-Iodoethyl α-L-fucopyranoside | 1932573-19-7 | 100mg |
| GC1017-250mg | 2-Iodoethyl α-L-fucopyranoside | 1932573-19-7 | 250mg |
| GC1017-500mg | 2-Iodoethyl α-L-fucopyranoside | 1932573-19-7 | 500mg |
| GK4274-5g | 2-Iodophenol | 533-58-4 | 5g |
| GK4274-25g | 2-Iodophenol | 533-58-4 | 25g |
| GW7450-1g | 2-Iodoso-3,4,5,6-tetrafluorobenzoic acid | 954373-94-5 | 1g |
| GW7450-5g | 2-Iodoso-3,4,5,6-tetrafluorobenzoic acid | 954373-94-5 | 5g |
| GW8496-500mg | 2-Iodoxy-3,4,5,6-tetrafluorobenzoic acid | 954373-95-6 | 500mg |
| GW8496-2500mg | 2-Iodoxy-3,4,5,6-tetrafluorobenzoic acid | 954373-95-6 | 2500mg |
| GP9006-100g | 2-Ketoglutaric acid | 328-50-7 | 100g |
| GP9006-250g | 2-Ketoglutaric acid | 328-50-7 | 250g |
| GP9006-500g | 2-Ketoglutaric acid | 328-50-7 | 500g |
| GP9006-1kg | 2-Ketoglutaric acid | 328-50-7 | 1kg |
| GE6119-25g | 2-Ketoglutaric acid disodium salt dihydrate | 305-72-6 | 25g |
| GE6119-100g | 2-Ketoglutaric acid disodium salt dihydrate | 305-72-6 | 100g |
| GE8113-5g | 2-Ketoglutaric acid monopotassium salt | 997-43-3 | 5g |
| GE8113-25g | 2-Ketoglutaric acid monopotassium salt | 997-43-3 | 25g |
| GE8113-100g | 2-Ketoglutaric acid monopotassium salt | 997-43-3 | 100g |
| GE8113-250g | 2-Ketoglutaric acid monopotassium salt | 997-43-3 | 250g |
| GW6904-2500mg | 2-Maleinimidoethyl mesylate | 155863-36-8 | 2500mg |
| GW6904-1g | 2-Maleinimidoethyl mesylate | 155863-36-8 | 1g |
| GW6904-10g | 2-Maleinimidoethyl mesylate | 155863-36-8 | 10g |
| GK2967-25g | 2-Mercaptobenzimidazole | 583-39-1 | 25g |
| GK2967-100g | 2-Mercaptobenzimidazole | 583-39-1 | 100g |
| GK2967-250g | 2-Mercaptobenzimidazole | 583-39-1 | 250g |
| GK2967-500g | 2-Mercaptobenzimidazole | 583-39-1 | 500g |
| GK4221-100g | 2-Mercaptobenzothiazole | 149-30-4 | 100g |
| GC3766-1mg | 2-Mercaptoethyl 3-O-α-D-galactopyranosyl-β-D-galactopyranoside | 1mg | |
| GC3766-2mg | 2-Mercaptoethyl 3-O-α-D-galactopyranosyl-β-D-galactopyranoside | 2mg | |
| GC3766-5mg | 2-Mercaptoethyl 3-O-α-D-galactopyranosyl-β-D-galactopyranoside | 5mg | |
| GW3426-50mg | 2-Methoxy-2-(2-naphthyl)ethanenitrile | 118736-08-6 | 50mg |
| GW3426-250mg | 2-Methoxy-2-(2-naphthyl)ethanenitrile | 118736-08-6 | 250mg |
| GK1548-5g | 2-Methoxyphenacyl bromide | 31949-21-0 | 5g |
| GK8378-5g | 2-Methoxyphenylacetic acid | 93-25-4 | 5g |
| GK8378-25g | 2-Methoxyphenylacetic acid | 93-25-4 | 25g |
| GK8378-100g | 2-Methoxyphenylacetic acid | 93-25-4 | 100g |
| GK8346-100ml | 2-Methyl-1-butanol | 137-32-6 | 100ml |
| GK2141-100ml | 2-Methyl-1-propanol | 78-83-1 | 100ml |
| GC1739-50mg | 2-Methyl-4,5-(2-deoxy-α-D-glucopyrano)-∆2-oxazoline | 22854-00-8 | 50mg |
| GC1739-100mg | 2-Methyl-4,5-(2-deoxy-α-D-glucopyrano)-∆2-oxazoline | 22854-00-8 | 100mg |
| GC1739-250mg | 2-Methyl-4,5-(2-deoxy-α-D-glucopyrano)-∆2-oxazoline | 22854-00-8 | 250mg |
| GC1739-500mg | 2-Methyl-4,5-(2-deoxy-α-D-glucopyrano)-∆2-oxazoline | 22854-00-8 | 500mg |
| GC4116-100mg | 2-Methyl-4,5-(3,4,6-tri-O-acetyl-2-deoxy-α-D-glucopyrano)-Δ2-oxazoline | 35954-65-5 | 100mg |
| GC4116-250mg | 2-Methyl-4,5-(3,4,6-tri-O-acetyl-2-deoxy-α-D-glucopyrano)-Δ2-oxazoline | 35954-65-5 | 250mg |
| GC4116-500mg | 2-Methyl-4,5-(3,4,6-tri-O-acetyl-2-deoxy-α-D-glucopyrano)-Δ2-oxazoline | 35954-65-5 | 500mg |
| GC4116-1g | 2-Methyl-4,5-(3,4,6-tri-O-acetyl-2-deoxy-α-D-glucopyrano)-Δ2-oxazoline | 35954-65-5 | 1g |
| GW8818-100mg | 2-Methyl-5-nitroimidazole-1-acetic acid | 1010-93-1 | 100mg |
| GW8818-1g | 2-Methyl-5-nitroimidazole-1-acetic acid | 1010-93-1 | 1g |
| GK4791-25g | 2-Methyl-6-nitroaniline | 570-24-1 | 25g |
| GK4791-100g | 2-Methyl-6-nitroaniline | 570-24-1 | 100g |
| GC0254-1mg | 2-Methylbutyl D-glucuronide | 1mg | |
| GC0254-2mg | 2-Methylbutyl D-glucuronide | 2mg | |
| GC0254-5mg | 2-Methylbutyl D-glucuronide | 5mg | |
| GC0254-10mg | 2-Methylbutyl D-glucuronide | 10mg | |
| GK6407-100g | 2-Methylimidazole | 693-98-1 | 100g |
| GK6407-500g | 2-Methylimidazole | 693-98-1 | 500g |
| GK3342-25g | 2-Methylindole | 95-20-5 | 25g |
| GK3342-100g | 2-Methylindole | 95-20-5 | 100g |
| GS4207-100ml | 2-Methylpropan-1-ol, GlenDry™, anhydrous | 78-83-1 | 100ml |
| GS4207-500ml | 2-Methylpropan-1-ol, GlenDry™, anhydrous | 78-83-1 | 500ml |
| GS4207-1l | 2-Methylpropan-1-ol, GlenDry™, anhydrous | 78-83-1 | 1l |
| GS4207-2500ml | 2-Methylpropan-1-ol, GlenDry™, anhydrous | 78-83-1 | 2500ml |
| GS6963-100ml | 2-Methyltetrahydrofuran, GlenDry™, anhydrous | 96-47-9 | 100ml |
| GS6963-500ml | 2-Methyltetrahydrofuran, GlenDry™, anhydrous | 96-47-9 | 500ml |
| GS6963-1l | 2-Methyltetrahydrofuran, GlenDry™, anhydrous | 96-47-9 | 1l |
| GS6963-2500ml | 2-Methyltetrahydrofuran, GlenDry™, anhydrous | 96-47-9 | 2500ml |
| GS5892-100ml | 2-Methyltetrahydrofuran, GlenDry™, anhydrous stabilised with BHT | 96-47-9 | 100ml |
| GS5892-500ml | 2-Methyltetrahydrofuran, GlenDry™, anhydrous stabilised with BHT | 96-47-9 | 500ml |
| GS5892-1l | 2-Methyltetrahydrofuran, GlenDry™, anhydrous stabilised with BHT | 96-47-9 | 1l |
| GS5892-2500ml | 2-Methyltetrahydrofuran, GlenDry™, anhydrous stabilised with BHT | 96-47-9 | 2500ml |
| GS0371-500ml | 2-Methyltetrahydrofuran, GlenPure™, analytical grade | 96-47-9 | 500ml |
| GS0371-1l | 2-Methyltetrahydrofuran, GlenPure™, analytical grade | 96-47-9 | 1l |
| GS0371-2500ml | 2-Methyltetrahydrofuran, GlenPure™, analytical grade | 96-47-9 | 2500ml |
| GS6995-500ml | 2-Methyltetrahydrofuran, GlenPure™, analytical grade stabilised with BHT | 96-47-9 | 500ml |
| GS6995-1l | 2-Methyltetrahydrofuran, GlenPure™, analytical grade stabilised with BHT | 96-47-9 | 1l |
| GS6995-2500ml | 2-Methyltetrahydrofuran, GlenPure™, analytical grade stabilised with BHT | 96-47-9 | 2500ml |
| GC7707-25mg | 2-Naphthalenyl β-D-glucopyranosiduronic acid, sodium salt | 20838-64-6 | 25mg |
| GC7707-50mg | 2-Naphthalenyl β-D-glucopyranosiduronic acid, sodium salt | 20838-64-6 | 50mg |
| GC7707-100mg | 2-Naphthalenyl β-D-glucopyranosiduronic acid, sodium salt | 20838-64-6 | 100mg |
| GC7707-250mg | 2-Naphthalenyl β-D-glucopyranosiduronic acid, sodium salt | 20838-64-6 | 250mg |
| GK1330-25g | 2-Naphthol | 135-19-3 | 25g |
| GX6293-25g | 2-Naphthoxyacetic acid | 120-23-0 | 25g |
| GX6293-100g | 2-Naphthoxyacetic acid | 120-23-0 | 100g |
| GC6509-5mg | 2-NBDG | 186689-07-6 | 5mg |
| GC6509-10mg | 2-NBDG | 186689-07-6 | 10mg |
| GC6509-25mg | 2-NBDG | 186689-07-6 | 25mg |
| GK9508-25g | 2-Nitrobenzaldehyde | 552-89-6 | 25g |
| GK9508-100g | 2-Nitrobenzaldehyde | 552-89-6 | 100g |
| GC0206-100mg | 2-Nitrophenyl b-D-cellobioside heptaacetate | 70867-22-0 | 100mg |
| GC0206-250mg | 2-Nitrophenyl b-D-cellobioside heptaacetate | 70867-22-0 | 250mg |
| GC0206-500mg | 2-Nitrophenyl b-D-cellobioside heptaacetate | 70867-22-0 | 500mg |
| GC0206-1g | 2-Nitrophenyl b-D-cellobioside heptaacetate | 70867-22-0 | 1g |
| GC0605-500mg | 2-Nitrophenyl b-D-galactopyranoside | 369-07-3 | 500mg |
| GC0605-1g | 2-Nitrophenyl b-D-galactopyranoside | 369-07-3 | 1g |
| GC0605-5g | 2-Nitrophenyl b-D-galactopyranoside | 369-07-3 | 5g |
| GC0605-25g | 2-Nitrophenyl b-D-galactopyranoside | 369-07-3 | 25g |
| GC5922-250mg | 2-Nitrophenyl b-D-glucopyranoside | 2816-24-2 | 250mg |
| GC5922-1g | 2-Nitrophenyl b-D-glucopyranoside | 2816-24-2 | 1g |
| GC5922-5g | 2-Nitrophenyl b-D-glucopyranoside | 2816-24-2 | 5g |
| GW8426-5ml | 2-Nitrophenyl dodecyl ether | 83027-71-8 | 5ml |
| GC5682-100mg | 2-Nitrophenyl α-D-galactopyranoside | 19887-85-5 | 100mg |
| GC5682-250mg | 2-Nitrophenyl α-D-galactopyranoside | 19887-85-5 | 250mg |
| GC5682-500mg | 2-Nitrophenyl α-D-galactopyranoside | 19887-85-5 | 500mg |
| GC5682-1g | 2-Nitrophenyl α-D-galactopyranoside | 19887-85-5 | 1g |
| GC0123-100mg | 2-Nitrophenyl α-D-glucopyranoside | 56193-44-3 | 100mg |
| GC0123-250mg | 2-Nitrophenyl α-D-glucopyranoside | 56193-44-3 | 250mg |
| GC0123-500mg | 2-Nitrophenyl α-D-glucopyranoside | 56193-44-3 | 500mg |
| GC0123-1g | 2-Nitrophenyl α-D-glucopyranoside | 56193-44-3 | 1g |
| GC5464-100mg | 2-Nitrophenyl β-D-Glucuronide | 137629-36-8 | 100mg |
| GC5464-250mg | 2-Nitrophenyl β-D-Glucuronide | 137629-36-8 | 250mg |
| GC5464-500mg | 2-Nitrophenyl β-D-Glucuronide | 137629-36-8 | 500mg |
| GC5464-1g | 2-Nitrophenyl β-D-Glucuronide | 137629-36-8 | 1g |
| GK0697-25g | 2-Nonanol | 628-99-9 | 25g |
| GC0557-1mg | 2-O-(2-Acetamido-2-deoxy-α-D-galactopyranosyl)-D-galactose | 503551-82-4 | 1mg |
| GC0557-2mg | 2-O-(2-Acetamido-2-deoxy-α-D-galactopyranosyl)-D-galactose | 503551-82-4 | 2mg |
| GC0557-5mg | 2-O-(2-Acetamido-2-deoxy-α-D-galactopyranosyl)-D-galactose | 503551-82-4 | 5mg |
| GC9937-1mg | 2-O-(2-Acetamido-2-deoxy-β-D-galactopyranosyl)-D-galactose | 1mg | |
| GC9937-2mg | 2-O-(2-Acetamido-2-deoxy-β-D-galactopyranosyl)-D-galactose | 2mg | |
| GC9937-5mg | 2-O-(2-Acetamido-2-deoxy-β-D-galactopyranosyl)-D-galactose | 5mg | |
| GC5377-1mg | 2-O-(a-L-Fucopyranosyl)-D-galactopyranose | 24656-24-4 | 1mg |
| GC5377-2mg | 2-O-(a-L-Fucopyranosyl)-D-galactopyranose | 24656-24-4 | 2mg |
| GC5377-5mg | 2-O-(a-L-Fucopyranosyl)-D-galactopyranose | 24656-24-4 | 5mg |
| GC5377-10mg | 2-O-(a-L-Fucopyranosyl)-D-galactopyranose | 24656-24-4 | 10mg |
| GC5377-25mg | 2-O-(a-L-Fucopyranosyl)-D-galactopyranose | 24656-24-4 | 25mg |
| GC6431-1mg | 2-O-(Carboxymethyl)-D-glucose | 95350-40-6 | 1mg |
| GC6431-2mg | 2-O-(Carboxymethyl)-D-glucose | 95350-40-6 | 2mg |
| GC6431-5mg | 2-O-(Carboxymethyl)-D-glucose | 95350-40-6 | 5mg |
| GC6431-10mg | 2-O-(Carboxymethyl)-D-glucose | 95350-40-6 | 10mg |
| GC3628-1g | 2-O-a-D-Glucopyranosyl-L-ascorbic acid | 129499-78-1 | 1g |
| GC3628-5g | 2-O-a-D-Glucopyranosyl-L-ascorbic acid | 129499-78-1 | 5g |
| GC8450-100mg | 2-O-Acetyl-1,6-anhydro-3,4-O-isopropylidene-β-D-galactopyranose | 20787-28-4 | 100mg |
| GC8450-250mg | 2-O-Acetyl-1,6-anhydro-3,4-O-isopropylidene-β-D-galactopyranose | 20787-28-4 | 250mg |
| GC8450-500mg | 2-O-Acetyl-1,6-anhydro-3,4-O-isopropylidene-β-D-galactopyranose | 20787-28-4 | 500mg |
| GC8450-1g | 2-O-Acetyl-1,6-anhydro-3,4-O-isopropylidene-β-D-galactopyranose | 20787-28-4 | 1g |
| GC3534-50mg | 2-O-Acetyl-3,4-di-O-benzyl-L-fucopyranose | 50mg | |
| GC3534-100mg | 2-O-Acetyl-3,4-di-O-benzyl-L-fucopyranose | 100mg | |
| GC3534-250mg | 2-O-Acetyl-3,4-di-O-benzyl-L-fucopyranose | 250mg | |
| GC3534-500mg | 2-O-Acetyl-3,4-di-O-benzyl-L-fucopyranose | 500mg | |
| GC7337-25mg | 2-O-Methyl-D-glucopyranose | 2140-41-2 | 25mg |
| GC7337-50mg | 2-O-Methyl-D-glucopyranose | 2140-41-2 | 50mg |
| GC7337-100mg | 2-O-Methyl-D-glucopyranose | 2140-41-2 | 100mg |
| GC7337-250mg | 2-O-Methyl-D-glucopyranose | 2140-41-2 | 250mg |
| GC5974-1g | 2-O-Tert-butyldimethylsilyl-3,4-O-isopropylidene-D-arabinonic acid δ-lactone | 1g | |
| GC5974-2g | 2-O-Tert-butyldimethylsilyl-3,4-O-isopropylidene-D-arabinonic acid δ-lactone | 2g | |
| GC5974-5g | 2-O-Tert-butyldimethylsilyl-3,4-O-isopropylidene-D-arabinonic acid δ-lactone | 5g | |
| GC5974-10g | 2-O-Tert-butyldimethylsilyl-3,4-O-isopropylidene-D-arabinonic acid δ-lactone | 10g | |
| GC8727-1mg | 2-O-β-D-Galactopyranosyl-D-galactose | 72244-38-3 | 1mg |
| GC8727-2mg | 2-O-β-D-Galactopyranosyl-D-galactose | 72244-38-3 | 2mg |
| GC8727-5mg | 2-O-β-D-Galactopyranosyl-D-galactose | 72244-38-3 | 5mg |
| GC8727-10mg | 2-O-β-D-Galactopyranosyl-D-galactose | 72244-38-3 | 10mg |
| GC5135-100mg | 2-Octyldodecyl D-xylopyranoside | 423772-95-6 | 100mg |
| GC5135-250mg | 2-Octyldodecyl D-xylopyranoside | 423772-95-6 | 250mg |
| GC5135-500mg | 2-Octyldodecyl D-xylopyranoside | 423772-95-6 | 500mg |
| GC5135-1g | 2-Octyldodecyl D-xylopyranoside | 423772-95-6 | 1g |
| GK6163-1g | 2-Oxobutyric acid | 600-18-0 | 1g |
| GK4735-25g | 2-Phenoxyaniline | 2688-84-8 | 25g |
| GK4735-100g | 2-Phenoxyaniline | 2688-84-8 | 100g |
| GK9546-1l | 2-Phenoxyethanol | 122-99-6 | 1l |
| GK9546-5l | 2-Phenoxyethanol | 122-99-6 | 5l |
| GK6984-25g | 2-Phenylbutyric acid | 90-27-7 | 25g |
| GK6245-250g | 2-Phenylethanol | 60-12-8 | 250g |
| GK6245-1kg | 2-Phenylethanol | 60-12-8 | 1kg |
| GK6245-5kg | 2-Phenylethanol | 60-12-8 | 5kg |
| GM3708-25g | 2-Phenylglycine | 2835-06-5 | 25g |
| GM3708-100g | 2-Phenylglycine | 2835-06-5 | 100g |
| GM3708-250g | 2-Phenylglycine | 2835-06-5 | 250g |
| GM3708-500g | 2-Phenylglycine | 2835-06-5 | 500g |
| GW4893-1g | 2-Phenylpropionyl chloride | 22414-26-2 | 1g |
| GW4893-5g | 2-Phenylpropionyl chloride | 22414-26-2 | 5g |
| GV3345-10g | 2-Phospho-L-ascorbic acid trisodium salt | 66170-10-3 | 10g |
| GV3345-25g | 2-Phospho-L-ascorbic acid trisodium salt | 66170-10-3 | 25g |
| GV3345-100g | 2-Phospho-L-ascorbic acid trisodium salt | 66170-10-3 | 100g |
| GX4575-100g | 2-Phosphonobutane-1,2,4-tricarboxylic acid solution | 37971-36-1 | 100g |
| GX4575-500g | 2-Phosphonobutane-1,2,4-tricarboxylic acid solution | 37971-36-1 | 500g |
| GW1004-25mg | 2-Propyl-2-pentenoic acid | 60218-41-9 | 25mg |
| GW1004-50mg | 2-Propyl-2-pentenoic acid | 60218-41-9 | 50mg |
| GK6992-25g | 2-Pyrrolidinone | 616-45-5 | 25g |
| GK6992-500g | 2-Pyrrolidinone | 616-45-5 | 500g |
| GK3183-25g | 2-Thiouracil | 141-90-2 | 25g |
| GK3183-100g | 2-Thiouracil | 141-90-2 | 100g |
| GK3183-250g | 2-Thiouracil | 141-90-2 | 250g |
| GN9592-100mg | 2-Thiouridine | 20235-78-3 | 100mg |
| GW1654-2500mg | 2-Tosyloxytropone | 38768-08-0 | 2500mg |
| GW1654-25g | 2-Tosyloxytropone | 38768-08-0 | 25g |
| GK3424-5g | 2-Vanillylamine hydrochloride | 7149-10-2 | 5g |
| GK3424-25g | 2-Vanillylamine hydrochloride | 7149-10-2 | 25g |
| GC2922-1mg | 2-β-D-Glucopyranosyloxy-1,4-benzoxazin-3-one | 285134-43-2 | 1mg |
| GC2922-2mg | 2-β-D-Glucopyranosyloxy-1,4-benzoxazin-3-one | 285134-43-2 | 2mg |
| GC2922-5mg | 2-β-D-Glucopyranosyloxy-1,4-benzoxazin-3-one | 285134-43-2 | 5mg |
| GC2922-10mg | 2-β-D-Glucopyranosyloxy-1,4-benzoxazin-3-one | 285134-43-2 | 10mg |
| GC2922-25mg | 2-β-D-Glucopyranosyloxy-1,4-benzoxazin-3-one | 285134-43-2 | 25mg |
| GC4214-1mg | 2-β-D-Glucuronopyranosyloxy-1,4-benzoxazin-3-one | 1613271-29-6 | 1mg |
| GC4214-2mg | 2-β-D-Glucuronopyranosyloxy-1,4-benzoxazin-3-one | 1613271-29-6 | 2mg |
| GC4214-5mg | 2-β-D-Glucuronopyranosyloxy-1,4-benzoxazin-3-one | 1613271-29-6 | 5mg |
| GC4214-10mg | 2-β-D-Glucuronopyranosyloxy-1,4-benzoxazin-3-one | 1613271-29-6 | 10mg |
| GL3296-25g | 2,2-Dimethoxy-2-phenylacetophenone | 24650-42-8 | 25g |
| GL3296-100g | 2,2-Dimethoxy-2-phenylacetophenone | 24650-42-8 | 100g |
| GL3296-250g | 2,2-Dimethoxy-2-phenylacetophenone | 24650-42-8 | 250g |
| GE8961-100g | 2,2-Dimethyl-1,3-dioxane-4,6-dione | 2033-24-1 | 100g |
| GE8961-250g | 2,2-Dimethyl-1,3-dioxane-4,6-dione | 2033-24-1 | 250g |
| GE8961-500g | 2,2-Dimethyl-1,3-dioxane-4,6-dione | 2033-24-1 | 500g |
| GL7180-5g | 2,2-Dimethyl-1,3-propanediamine | 7328-91-8 | 5g |
| GX8890-1g | 2,2-Dimethyl-3-(3-methylphenyl)propanol | 103694-68-4 | 1g |
| GX8890-5g | 2,2-Dimethyl-3-(3-methylphenyl)propanol | 103694-68-4 | 5g |
| GK8315-1g | 2,2-Dimethylcyclopentanone | 4541-32-6 | 1g |
| GK8315-5g | 2,2-Dimethylcyclopentanone | 4541-32-6 | 5g |
| GK8315-50g | 2,2-Dimethylcyclopentanone | 4541-32-6 | 50g |
| GX8745-1g | 2,2-Diphenyl-1-picrylhydrazyl | 1898-66-4 | 1g |
| GM1388-5g | 2,2-Diphenylglycine | 3060-50-2 | 5g |
| GS2953-100ml | 2,2,2-Trifluoroethanol, GlenPure™, analytical grade | 75-89-8 | 100ml |
| GS2953-500ml | 2,2,2-Trifluoroethanol, GlenPure™, analytical grade | 75-89-8 | 500ml |
| GS9378-100ml | 2,2,4-Trimethylpentane, GlenDry™, anhydrous | 540-84-1 | 100ml |
| GS9378-500ml | 2,2,4-Trimethylpentane, GlenDry™, anhydrous | 540-84-1 | 500ml |
| GS9378-1l | 2,2,4-Trimethylpentane, GlenDry™, anhydrous | 540-84-1 | 1l |
| GS9378-2500ml | 2,2,4-Trimethylpentane, GlenDry™, anhydrous | 540-84-1 | 2500ml |
| GS9928-100ml | 2,2,4-Trimethylpentane, GlenDry™, anhydrous over molecular sieve | 540-84-1 | 100ml |
| GS9928-500ml | 2,2,4-Trimethylpentane, GlenDry™, anhydrous over molecular sieve | 540-84-1 | 500ml |
| GS9928-1l | 2,2,4-Trimethylpentane, GlenDry™, anhydrous over molecular sieve | 540-84-1 | 1l |
| GS9928-2500ml | 2,2,4-Trimethylpentane, GlenDry™, anhydrous over molecular sieve | 540-84-1 | 2500ml |
| GS9997-500ml | 2,2,4-Trimethylpentane, GlenPure™, analytical grade | 540-84-1 | 500ml |
| GS9997-1l | 2,2,4-Trimethylpentane, GlenPure™, analytical grade | 540-84-1 | 1l |
| GS9997-2500ml | 2,2,4-Trimethylpentane, GlenPure™, analytical grade | 540-84-1 | 2500ml |
| GS5342-2500ml | 2,2,4-Trimethylpentane, GlenUltra™, analytical grade, for GC | 540-84-1 | 2500ml |
| GX6792-25g | 2,2''-Azobis(2-(2-imidazolin-2-yl)propane) dihydrochloride | 27776-21-2 | 25g |
| GK3418-5g | 2,2''-Dipyridyl | 366-18-7 | 5g |
| GK3418-25g | 2,2''-Dipyridyl | 366-18-7 | 25g |
| GK3418-100g | 2,2''-Dipyridyl | 366-18-7 | 100g |
| GK5006-25g | 2,2''-Dithiodipyridine | 2127-03-9 | 25g |
| GK5006-100g | 2,2''-Dithiodipyridine | 2127-03-9 | 100g |
| GC4251-100mg | 2,2'',3,3''-Tetra-O-acetyl-4'',6''-O-benzylidene-1,6-anhydro-β-D-cellobiose | 97415-74-2 | 100mg |
| GC4251-250mg | 2,2'',3,3''-Tetra-O-acetyl-4'',6''-O-benzylidene-1,6-anhydro-β-D-cellobiose | 97415-74-2 | 250mg |
| GC4251-500mg | 2,2'',3,3''-Tetra-O-acetyl-4'',6''-O-benzylidene-1,6-anhydro-β-D-cellobiose | 97415-74-2 | 500mg |
| GC4251-1g | 2,2'',3,3''-Tetra-O-acetyl-4'',6''-O-benzylidene-1,6-anhydro-β-D-cellobiose | 97415-74-2 | 1g |
| GC4128-1g | 2,2'',3,3'',4'',6,6''-Hepta-O-acetyl-α-D-lactosyl bromide | 4753-07-5 | 1g |
| GC4128-2g | 2,2'',3,3'',4'',6,6''-Hepta-O-acetyl-α-D-lactosyl bromide | 4753-07-5 | 2g |
| GC4128-5g | 2,2'',3,3'',4'',6,6''-Hepta-O-acetyl-α-D-lactosyl bromide | 4753-07-5 | 5g |
| GC4128-10g | 2,2'',3,3'',4'',6,6''-Hepta-O-acetyl-α-D-lactosyl bromide | 4753-07-5 | 10g |
| GC4128-25g | 2,2'',3,3'',4'',6,6''-Hepta-O-acetyl-α-D-lactosyl bromide | 4753-07-5 | 25g |
| GC8971-1g | 2,2'',3,3'',4'',6,6''-Hepta-O-benzoyl-D-lactosyl trichloroacetimidate | 473449-32-0 | 1g |
| GC8971-2g | 2,2'',3,3'',4'',6,6''-Hepta-O-benzoyl-D-lactosyl trichloroacetimidate | 473449-32-0 | 2g |
| GC8971-5g | 2,2'',3,3'',4'',6,6''-Hepta-O-benzoyl-D-lactosyl trichloroacetimidate | 473449-32-0 | 5g |
| GC8971-10g | 2,2'',3,3'',4'',6,6''-Hepta-O-benzoyl-D-lactosyl trichloroacetimidate | 473449-32-0 | 10g |
| GC2542-50mg | 2,2'',3,3'',6''-Penta-O-acetyl-1,6-anhydro-β-D-cellobiose | 20581-86-6 | 50mg |
| GC2542-100mg | 2,2'',3,3'',6''-Penta-O-acetyl-1,6-anhydro-β-D-cellobiose | 20581-86-6 | 100mg |
| GC2542-250mg | 2,2'',3,3'',6''-Penta-O-acetyl-1,6-anhydro-β-D-cellobiose | 20581-86-6 | 250mg |
| GC2542-500mg | 2,2'',3,3'',6''-Penta-O-acetyl-1,6-anhydro-β-D-cellobiose | 20581-86-6 | 500mg |
| GE8310-100ml | 2,2′-Azobis(2-methylpropionitrile) solution, 0.2M in toluene | 78-67-1 | 100ml |
| GL3348-25g | 2,3-Butanedione monoxime | 57-71-6 | 25g |
| GL3348-100g | 2,3-Butanedione monoxime | 57-71-6 | 100g |
| GL3348-250g | 2,3-Butanedione monoxime | 57-71-6 | 250g |
| GL3348-500g | 2,3-Butanedione monoxime | 57-71-6 | 500g |
| GC5114-1mg | 2,3-Di-O-(carboxymethyl)-D-glucose | 95350-41-7 | 1mg |
| GC5114-2mg | 2,3-Di-O-(carboxymethyl)-D-glucose | 95350-41-7 | 2mg |
| GC5114-5mg | 2,3-Di-O-(carboxymethyl)-D-glucose | 95350-41-7 | 5mg |
| GC5114-10mg | 2,3-Di-O-(carboxymethyl)-D-glucose | 95350-41-7 | 10mg |
| GK7665-1g | 2,3-Diaminonaphthalene | 771-97-1 | 1g |
| GK7665-5g | 2,3-Diaminonaphthalene | 771-97-1 | 5g |
| GK7665-10g | 2,3-Diaminonaphthalene | 771-97-1 | 10g |
| GW1075-25mg | 2,3-Diaminopropane-1-thiol dihydrobromide | 70548-07-1 | 25mg |
| GW1075-100mg | 2,3-Diaminopropane-1-thiol dihydrobromide | 70548-07-1 | 100mg |
| GW1075-250mg | 2,3-Diaminopropane-1-thiol dihydrobromide | 70548-07-1 | 250mg |
| GK4311-5g | 2,3-Dichloro-1,4-naphthoquinone | 117-80-6 | 5g |
| GK7795-5g | 2,3-Dihydroxybenzaldehyde, 97% | 24677-78-9 | 5g |
| GK9055-25g | 2,3-Dihydroxynaphthalene | 92-44-4 | 25g |
| GC0421-100mg | 2,3-Diketo-L-gulonic acid | 3445-22-5 | 100mg |
| GC0421-250mg | 2,3-Diketo-L-gulonic acid | 3445-22-5 | 250mg |
| GC0421-500mg | 2,3-Diketo-L-gulonic acid | 3445-22-5 | 500mg |
| GC4551-100mg | 2,3-O-Carbonyl-α-D-mannopyranose | 76548-27-1 | 100mg |
| GC4551-250mg | 2,3-O-Carbonyl-α-D-mannopyranose | 76548-27-1 | 250mg |
| GC4551-500mg | 2,3-O-Carbonyl-α-D-mannopyranose | 76548-27-1 | 500mg |
| GC4551-1g | 2,3-O-Carbonyl-α-D-mannopyranose | 76548-27-1 | 1g |
| GC4551-2g | 2,3-O-Carbonyl-α-D-mannopyranose | 76548-27-1 | 2g |
| GC3038-1g | 2,3-O-Isopropylidene-1,1,4,4-tetraphenyl-L-threitol | 93379-48-7 | 1g |
| GC8613-250mg | 2,3-O-Isopropylidene-D-erythrofuranose | 189996-60-9 | 250mg |
| GC8613-500mg | 2,3-O-Isopropylidene-D-erythrofuranose | 189996-60-9 | 500mg |
| GC8613-1g | 2,3-O-Isopropylidene-D-erythrofuranose | 189996-60-9 | 1g |
| GC8613-2g | 2,3-O-Isopropylidene-D-erythrofuranose | 189996-60-9 | 2g |
| GC8613-5g | 2,3-O-Isopropylidene-D-erythrofuranose | 189996-60-9 | 5g |
| GC4888-1g | 2,3-O-Isopropylidene-L-gulonic acid-1,4-lactone | 94840-08-1 | 1g |
| GC4888-2g | 2,3-O-Isopropylidene-L-gulonic acid-1,4-lactone | 94840-08-1 | 2g |
| GC4888-5g | 2,3-O-Isopropylidene-L-gulonic acid-1,4-lactone | 94840-08-1 | 5g |
| GC4888-10g | 2,3-O-Isopropylidene-L-gulonic acid-1,4-lactone | 94840-08-1 | 10g |
| GC0119-1g | 2,3,2'',3'',4'',6''-Hexa-O-acetyl-1,6-anhydro-b-D-cellobiose | 38631-27-5 | 1g |
| GC0119-2g | 2,3,2'',3'',4'',6''-Hexa-O-acetyl-1,6-anhydro-b-D-cellobiose | 38631-27-5 | 2g |
| GC0119-5g | 2,3,2'',3'',4'',6''-Hexa-O-acetyl-1,6-anhydro-b-D-cellobiose | 38631-27-5 | 5g |
| GC0119-10g | 2,3,2'',3'',4'',6''-Hexa-O-acetyl-1,6-anhydro-b-D-cellobiose | 38631-27-5 | 10g |
| GC0119-25g | 2,3,2'',3'',4'',6''-Hexa-O-acetyl-1,6-anhydro-b-D-cellobiose | 38631-27-5 | 25g |
| GW1039-100mg | 2,3,3-Trimethyl-1-(4-sulfobutyl)-indolium, inner salt | 54136-26-4 | 100mg |
| GW1039-500mg | 2,3,3-Trimethyl-1-(4-sulfobutyl)-indolium, inner salt | 54136-26-4 | 500mg |
| GW1039-5g | 2,3,3-Trimethyl-1-(4-sulfobutyl)-indolium, inner salt | 54136-26-4 | 5g |
| GK6260-5g | 2,3,3-Trimethylindolenine | 1640-39-7 | 5g |
| GK6260-50g | 2,3,3-Trimethylindolenine | 1640-39-7 | 50g |
| GC9530-100mg | 2,3,3'',4,4''-Penta-O-isovaleryl-sucrose | 498552-73-1 | 100mg |
| GC9530-250mg | 2,3,3'',4,4''-Penta-O-isovaleryl-sucrose | 498552-73-1 | 250mg |
| GC9530-500mg | 2,3,3'',4,4''-Penta-O-isovaleryl-sucrose | 498552-73-1 | 500mg |
| GC9530-1g | 2,3,3'',4,4''-Penta-O-isovaleryl-sucrose | 498552-73-1 | 1g |
| GC4075-250mg | 2,3,3'',4,4'',6,6''-Hepta-O-benzoyl-D-sucrose | 309261-83-4 | 250mg |
| GC4075-500mg | 2,3,3'',4,4'',6,6''-Hepta-O-benzoyl-D-sucrose | 309261-83-4 | 500mg |
| GC4075-1g | 2,3,3'',4,4'',6,6''-Hepta-O-benzoyl-D-sucrose | 309261-83-4 | 1g |
| GC4075-2g | 2,3,3'',4,4'',6,6''-Hepta-O-benzoyl-D-sucrose | 309261-83-4 | 2g |
| GC2218-100mg | 2,3,4-Tri-O-acetyl-6-azido-6-deoxy-β-D-glucopyranosyl azide | 106192-56-7 | 100mg |
| GC2218-250mg | 2,3,4-Tri-O-acetyl-6-azido-6-deoxy-β-D-glucopyranosyl azide | 106192-56-7 | 250mg |
| GC2218-500mg | 2,3,4-Tri-O-acetyl-6-azido-6-deoxy-β-D-glucopyranosyl azide | 106192-56-7 | 500mg |
| GC2218-1g | 2,3,4-Tri-O-acetyl-6-azido-6-deoxy-β-D-glucopyranosyl azide | 106192-56-7 | 1g |
| GC1325-10mg | 2,3,4-Tri-O-acetyl-6-azido-6-deoxy-β-D-glucopyranosylamine | 565226-14-4 | 10mg |
| GC1325-25mg | 2,3,4-Tri-O-acetyl-6-azido-6-deoxy-β-D-glucopyranosylamine | 565226-14-4 | 25mg |
| GC1325-50mg | 2,3,4-Tri-O-acetyl-6-azido-6-deoxy-β-D-glucopyranosylamine | 565226-14-4 | 50mg |
| GC1325-100mg | 2,3,4-Tri-O-acetyl-6-azido-6-deoxy-β-D-glucopyranosylamine | 565226-14-4 | 100mg |
| GC6675-500mg | 2,3,4-Tri-O-acetyl-6-O-tosyl-β-D-glucopyranosyl azide | 106192-41-0 | 500mg |
| GC6675-1g | 2,3,4-Tri-O-acetyl-6-O-tosyl-β-D-glucopyranosyl azide | 106192-41-0 | 1g |
| GC6675-2g | 2,3,4-Tri-O-acetyl-6-O-tosyl-β-D-glucopyranosyl azide | 106192-41-0 | 2g |
| GC6675-5g | 2,3,4-Tri-O-acetyl-6-O-tosyl-β-D-glucopyranosyl azide | 106192-41-0 | 5g |
| GC3919-250mg | 2,3,4-Tri-O-acetyl-6-O-trityl-D-galactopyranose | 250mg | |
| GC3919-500mg | 2,3,4-Tri-O-acetyl-6-O-trityl-D-galactopyranose | 500mg | |
| GC3919-1g | 2,3,4-Tri-O-acetyl-6-O-trityl-D-galactopyranose | 1g | |
| GC3919-2g | 2,3,4-Tri-O-acetyl-6-O-trityl-D-galactopyranose | 2g | |
| GC8293-250mg | 2,3,4-Tri-O-acetyl-a-D-xylopyranosyl trichloroacetimidate | 128376-91-0 | 250mg |
| GC8293-500mg | 2,3,4-Tri-O-acetyl-a-D-xylopyranosyl trichloroacetimidate | 128376-91-0 | 500mg |
| GC8293-1g | 2,3,4-Tri-O-acetyl-a-D-xylopyranosyl trichloroacetimidate | 128376-91-0 | 1g |
| GC8293-2g | 2,3,4-Tri-O-acetyl-a-D-xylopyranosyl trichloroacetimidate | 128376-91-0 | 2g |
| GC8293-5g | 2,3,4-Tri-O-acetyl-a-D-xylopyranosyl trichloroacetimidate | 128376-91-0 | 5g |
| GC4447-1g | 2,3,4-Tri-O-acetyl-b-D-xylopyranosyl azide | 53784-33-1 | 1g |
| GC4447-2g | 2,3,4-Tri-O-acetyl-b-D-xylopyranosyl azide | 53784-33-1 | 2g |
| GC4447-5g | 2,3,4-Tri-O-acetyl-b-D-xylopyranosyl azide | 53784-33-1 | 5g |
| GC4447-10g | 2,3,4-Tri-O-acetyl-b-D-xylopyranosyl azide | 53784-33-1 | 10g |
| GC2056-250mg | 2,3,4-Tri-O-acetyl-b-L-fucopyranosyl azide | 95581-07-0 | 250mg |
| GC2056-500mg | 2,3,4-Tri-O-acetyl-b-L-fucopyranosyl azide | 95581-07-0 | 500mg |
| GC2056-1g | 2,3,4-Tri-O-acetyl-b-L-fucopyranosyl azide | 95581-07-0 | 1g |
| GC2056-2g | 2,3,4-Tri-O-acetyl-b-L-fucopyranosyl azide | 95581-07-0 | 2g |
| GC1572-1g | 2,3,4-Tri-O-acetyl-D-glucopyranuronic acid methyl ester | 3082-95-9 | 1g |
| GC1572-2g | 2,3,4-Tri-O-acetyl-D-glucopyranuronic acid methyl ester | 3082-95-9 | 2g |
| GC1572-5g | 2,3,4-Tri-O-acetyl-D-glucopyranuronic acid methyl ester | 3082-95-9 | 5g |
| GC1572-10g | 2,3,4-Tri-O-acetyl-D-glucopyranuronic acid methyl ester | 3082-95-9 | 10g |
| GC6305-100mg | 2,3,4-Tri-O-acetyl-D-xylopyranosyl trichloroacetimidate | 197144-02-8 | 100mg |
| GC6305-250mg | 2,3,4-Tri-O-acetyl-D-xylopyranosyl trichloroacetimidate | 197144-02-8 | 250mg |
| GC6305-500mg | 2,3,4-Tri-O-acetyl-D-xylopyranosyl trichloroacetimidate | 197144-02-8 | 500mg |
| GC6305-1g | 2,3,4-Tri-O-acetyl-D-xylopyranosyl trichloroacetimidate | 197144-02-8 | 1g |
| GC6305-2g | 2,3,4-Tri-O-acetyl-D-xylopyranosyl trichloroacetimidate | 197144-02-8 | 2g |
| GC1151-250mg | 2,3,4-Tri-O-acetyl-L-fucose | 141607-28-5 | 250mg |
| GC1151-500mg | 2,3,4-Tri-O-acetyl-L-fucose | 141607-28-5 | 500mg |
| GC1151-1g | 2,3,4-Tri-O-acetyl-L-fucose | 141607-28-5 | 1g |
| GC1151-2g | 2,3,4-Tri-O-acetyl-L-fucose | 141607-28-5 | 2g |
| GC5477-50mg | 2,3,4-Tri-O-acetyl-α-D-glucopyranuronic acid 4-methoxybenzyl ester trichloroacetimidate | 50mg | |
| GC5477-100mg | 2,3,4-Tri-O-acetyl-α-D-glucopyranuronic acid 4-methoxybenzyl ester trichloroacetimidate | 100mg | |
| GC5477-250mg | 2,3,4-Tri-O-acetyl-α-D-glucopyranuronic acid 4-methoxybenzyl ester trichloroacetimidate | 250mg | |
| GC5477-500mg | 2,3,4-Tri-O-acetyl-α-D-glucopyranuronic acid 4-methoxybenzyl ester trichloroacetimidate | 500mg | |
| GC5477-1g | 2,3,4-Tri-O-acetyl-α-D-glucopyranuronic acid 4-methoxybenzyl ester trichloroacetimidate | 1g | |
| GC0455-100mg | 2,3,4-Tri-O-acetyl-α-D-glucuronide methyl ester trichloroacetimidate | 92420-89-8 | 100mg |
| GC0455-250mg | 2,3,4-Tri-O-acetyl-α-D-glucuronide methyl ester trichloroacetimidate | 92420-89-8 | 250mg |
| GC0455-500mg | 2,3,4-Tri-O-acetyl-α-D-glucuronide methyl ester trichloroacetimidate | 92420-89-8 | 500mg |
| GC0455-1g | 2,3,4-Tri-O-acetyl-α-D-glucuronide methyl ester trichloroacetimidate | 92420-89-8 | 1g |
| GC0455-2g | 2,3,4-Tri-O-acetyl-α-D-glucuronide methyl ester trichloroacetimidate | 92420-89-8 | 2g |
| GC4810-1g | 2,3,4-Tri-O-acetyl-α-L-arabinopyranosyl bromide | 75247-31-3 | 1g |
| GC4810-2g | 2,3,4-Tri-O-acetyl-α-L-arabinopyranosyl bromide | 75247-31-3 | 2g |
| GC4810-5g | 2,3,4-Tri-O-acetyl-α-L-arabinopyranosyl bromide | 75247-31-3 | 5g |
| GC4810-10g | 2,3,4-Tri-O-acetyl-α-L-arabinopyranosyl bromide | 75247-31-3 | 10g |
| GC3560-100mg | 2,3,4-Tri-O-acetyl-α-L-fucopyranosyl fluoride | 129864-97-7 | 100mg |
| GC3560-250mg | 2,3,4-Tri-O-acetyl-α-L-fucopyranosyl fluoride | 129864-97-7 | 250mg |
| GC3560-500mg | 2,3,4-Tri-O-acetyl-α-L-fucopyranosyl fluoride | 129864-97-7 | 500mg |
| GC3560-1g | 2,3,4-Tri-O-acetyl-α-L-fucopyranosyl fluoride | 129864-97-7 | 1g |
| GC7672-50mg | 2,3,4-Tri-O-acetyl-α-L-fucopyranosyl trichloroacetimidate | 128571-86-8 | 50mg |
| GC7672-100mg | 2,3,4-Tri-O-acetyl-α-L-fucopyranosyl trichloroacetimidate | 128571-86-8 | 100mg |
| GC7672-250mg | 2,3,4-Tri-O-acetyl-α-L-fucopyranosyl trichloroacetimidate | 128571-86-8 | 250mg |
| GC7672-500mg | 2,3,4-Tri-O-acetyl-α-L-fucopyranosyl trichloroacetimidate | 128571-86-8 | 500mg |
| GC0144-100mg | 2,3,4-Tri-O-acetyl-α-L-rhamnopyranosyl bromide | 5158-64-5 | 100mg |
| GC0144-250mg | 2,3,4-Tri-O-acetyl-α-L-rhamnopyranosyl bromide | 5158-64-5 | 250mg |
| GC0144-500mg | 2,3,4-Tri-O-acetyl-α-L-rhamnopyranosyl bromide | 5158-64-5 | 500mg |
| GC0144-1g | 2,3,4-Tri-O-acetyl-α-L-rhamnopyranosyl bromide | 5158-64-5 | 1g |
| GC5795-100mg | 2,3,4-Tri-O-acetyl-β-D-xylopyranosyl trichloroacetimidate | 128377-34-4 | 100mg |
| GC5795-250mg | 2,3,4-Tri-O-acetyl-β-D-xylopyranosyl trichloroacetimidate | 128377-34-4 | 250mg |
| GC5795-500mg | 2,3,4-Tri-O-acetyl-β-D-xylopyranosyl trichloroacetimidate | 128377-34-4 | 500mg |
| GC5795-1g | 2,3,4-Tri-O-acetyl-β-D-xylopyranosyl trichloroacetimidate | 128377-34-4 | 1g |
| GC5795-2g | 2,3,4-Tri-O-acetyl-β-D-xylopyranosyl trichloroacetimidate | 128377-34-4 | 2g |
| GC1761-100mg | 2,3,4-Tri-O-acetyl-β-L-fucopyranosyl fluoride | 106488-07-7 | 100mg |
| GC1761-250mg | 2,3,4-Tri-O-acetyl-β-L-fucopyranosyl fluoride | 106488-07-7 | 250mg |
| GC1761-500mg | 2,3,4-Tri-O-acetyl-β-L-fucopyranosyl fluoride | 106488-07-7 | 500mg |
| GC1761-1g | 2,3,4-Tri-O-acetyl-β-L-fucopyranosyl fluoride | 106488-07-7 | 1g |
| GC7116-25mg | 2,3,4-Tri-O-benzyl-a-D-glucuronide benzyl ester trichloroacetimidate | 184698-69-9 | 25mg |
| GC7116-50mg | 2,3,4-Tri-O-benzyl-a-D-glucuronide benzyl ester trichloroacetimidate | 184698-69-9 | 50mg |
| GC7116-100mg | 2,3,4-Tri-O-benzyl-a-D-glucuronide benzyl ester trichloroacetimidate | 184698-69-9 | 100mg |
| GC7116-250mg | 2,3,4-Tri-O-benzyl-a-D-glucuronide benzyl ester trichloroacetimidate | 184698-69-9 | 250mg |
| GC2697-500mg | 2,3,4-Tri-O-benzyl-D-glucopyranose | 47727-93-5 | 500mg |
| GC2697-1g | 2,3,4-Tri-O-benzyl-D-glucopyranose | 47727-93-5 | 1g |
| GC2697-2g | 2,3,4-Tri-O-benzyl-D-glucopyranose | 47727-93-5 | 2g |
| GC2697-5g | 2,3,4-Tri-O-benzyl-D-glucopyranose | 47727-93-5 | 5g |
| GC9135-25mg | 2,3,4-Tri-O-benzyl-D-glucopyranuronic acid benzyl ester | 4539-78-0 | 25mg |
| GC9135-50mg | 2,3,4-Tri-O-benzyl-D-glucopyranuronic acid benzyl ester | 4539-78-0 | 50mg |
| GC9135-100mg | 2,3,4-Tri-O-benzyl-D-glucopyranuronic acid benzyl ester | 4539-78-0 | 100mg |
| GC9135-250mg | 2,3,4-Tri-O-benzyl-D-glucopyranuronic acid benzyl ester | 4539-78-0 | 250mg |
| GC9135-500mg | 2,3,4-Tri-O-benzyl-D-glucopyranuronic acid benzyl ester | 4539-78-0 | 500mg |
| GC6114-250mg | 2,3,4-Tri-O-benzyl-D-xylopyranose | 2249922-12-9 | 250mg |
| GC6114-500mg | 2,3,4-Tri-O-benzyl-D-xylopyranose | 2249922-12-9 | 500mg |
| GC6114-1g | 2,3,4-Tri-O-benzyl-D-xylopyranose | 2249922-12-9 | 1g |
| GC6114-2g | 2,3,4-Tri-O-benzyl-D-xylopyranose | 2249922-12-9 | 2g |
| GC7661-50mg | 2,3,4-Tri-O-benzyl-D-xylopyranosyl trichloroacetimidate | 200059-37-6 | 50mg |
| GC7661-100mg | 2,3,4-Tri-O-benzyl-D-xylopyranosyl trichloroacetimidate | 200059-37-6 | 100mg |
| GC7661-250mg | 2,3,4-Tri-O-benzyl-D-xylopyranosyl trichloroacetimidate | 200059-37-6 | 250mg |
| GC7661-500mg | 2,3,4-Tri-O-benzyl-D-xylopyranosyl trichloroacetimidate | 200059-37-6 | 500mg |
| GC7661-1g | 2,3,4-Tri-O-benzyl-D-xylopyranosyl trichloroacetimidate | 200059-37-6 | 1g |
| GC0315-100mg | 2,3,4-Tri-O-isobutyryl-D-glucopyranuronic acid methyl ester | 1190403-86-1 | 100mg |
| GC0315-250mg | 2,3,4-Tri-O-isobutyryl-D-glucopyranuronic acid methyl ester | 1190403-86-1 | 250mg |
| GC0315-500mg | 2,3,4-Tri-O-isobutyryl-D-glucopyranuronic acid methyl ester | 1190403-86-1 | 500mg |
| GC0315-1g | 2,3,4-Tri-O-isobutyryl-D-glucopyranuronic acid methyl ester | 1190403-86-1 | 1g |
| GC4023-50mg | 2,3,4-Tri-O-pivaloyl-α-D-glucopyranuronic acid methyl ester trichloroacetimidate | 201789-50-6 | 50mg |
| GC4023-100mg | 2,3,4-Tri-O-pivaloyl-α-D-glucopyranuronic acid methyl ester trichloroacetimidate | 201789-50-6 | 100mg |
| GC4023-250mg | 2,3,4-Tri-O-pivaloyl-α-D-glucopyranuronic acid methyl ester trichloroacetimidate | 201789-50-6 | 250mg |
| GC4023-500mg | 2,3,4-Tri-O-pivaloyl-α-D-glucopyranuronic acid methyl ester trichloroacetimidate | 201789-50-6 | 500mg |
| GC4023-1g | 2,3,4-Tri-O-pivaloyl-α-D-glucopyranuronic acid methyl ester trichloroacetimidate | 201789-50-6 | 1g |
| GC9895-100mg | 2,3,4-Tri-O-pivaloyl-β-D-glucopyranuronic acid methyl ester | 86448-98-8 | 100mg |
| GC9895-250mg | 2,3,4-Tri-O-pivaloyl-β-D-glucopyranuronic acid methyl ester | 86448-98-8 | 250mg |
| GC9895-500mg | 2,3,4-Tri-O-pivaloyl-β-D-glucopyranuronic acid methyl ester | 86448-98-8 | 500mg |
| GC9895-1g | 2,3,4-Tri-O-pivaloyl-β-D-glucopyranuronic acid methyl ester | 86448-98-8 | 1g |
| GK5123-5g | 2,3,4-Trifluorobenzoic acid | 61079-72-9 | 5g |
| GK5123-25g | 2,3,4-Trifluorobenzoic acid | 61079-72-9 | 25g |
| GK3797-5g | 2,3,4-Trihydroxybenzaldehyde | 2144-08-3 | 5g |
| GK3797-25g | 2,3,4-Trihydroxybenzaldehyde | 2144-08-3 | 25g |
| GC1828-500mg | 2,3,4,6-Tetra-O-acetyl-1-deoxy-D-arabino-hex-1-enopyranose | 3366-47-0 | 500mg |
| GC1828-1g | 2,3,4,6-Tetra-O-acetyl-1-deoxy-D-arabino-hex-1-enopyranose | 3366-47-0 | 1g |
| GC1828-2g | 2,3,4,6-Tetra-O-acetyl-1-deoxy-D-arabino-hex-1-enopyranose | 3366-47-0 | 2g |
| GC1828-5g | 2,3,4,6-Tetra-O-acetyl-1-deoxy-D-arabino-hex-1-enopyranose | 3366-47-0 | 5g |
| GC5969-1g | 2,3,4,6-Tetra-O-acetyl-a-D-galactopyranosyl trichloroacetimidate | 86520-63-0 | 1g |
| GC5969-2g | 2,3,4,6-Tetra-O-acetyl-a-D-galactopyranosyl trichloroacetimidate | 86520-63-0 | 2g |
| GC5969-5g | 2,3,4,6-Tetra-O-acetyl-a-D-galactopyranosyl trichloroacetimidate | 86520-63-0 | 5g |
| GC5969-10g | 2,3,4,6-Tetra-O-acetyl-a-D-galactopyranosyl trichloroacetimidate | 86520-63-0 | 10g |
| GC2702-500mg | 2,3,4,6-Tetra-O-acetyl-alpha-D-mannopyranosyl trichloroacetimidate | 121238-27-5 | 500mg |
| GC2702-1g | 2,3,4,6-Tetra-O-acetyl-alpha-D-mannopyranosyl trichloroacetimidate | 121238-27-5 | 1g |
| GC2702-2g | 2,3,4,6-Tetra-O-acetyl-alpha-D-mannopyranosyl trichloroacetimidate | 121238-27-5 | 2g |
| GC2702-5g | 2,3,4,6-Tetra-O-acetyl-alpha-D-mannopyranosyl trichloroacetimidate | 121238-27-5 | 5g |
| GC2562-250mg | 2,3,4,6-Tetra-O-acetyl-b-D-galactopyranosyl azide | 13992-26-2 | 250mg |
| GC2562-1g | 2,3,4,6-Tetra-O-acetyl-b-D-galactopyranosyl azide | 13992-26-2 | 1g |
| GC1823-1g | 2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl azide | 13992-25-1 | 1g |
| GC1823-2g | 2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl azide | 13992-25-1 | 2g |
| GC1823-5g | 2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl azide | 13992-25-1 | 5g |
| GC1823-10g | 2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl azide | 13992-25-1 | 10g |
| GC4363-250mg | 2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl fluoride | 2823-46-3 | 250mg |
| GC4363-500mg | 2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl fluoride | 2823-46-3 | 500mg |
| GC4363-1g | 2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl fluoride | 2823-46-3 | 1g |
| GC4363-2g | 2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl fluoride | 2823-46-3 | 2g |
| GC2324-1g | 2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl salicylate | 32748-59-7 | 1g |
| GC2324-2g | 2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl salicylate | 32748-59-7 | 2g |
| GC2324-5g | 2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl salicylate | 32748-59-7 | 5g |
| GC2324-10g | 2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl salicylate | 32748-59-7 | 10g |
| GC9112-1g | 2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl trichloroacetimidate | 92052-29-4 | 1g |
| GC9112-2g | 2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl trichloroacetimidate | 92052-29-4 | 2g |
| GC9112-5g | 2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl trichloroacetimidate | 92052-29-4 | 5g |
| GC9112-10g | 2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl trichloroacetimidate | 92052-29-4 | 10g |
| GC6496-2g | 2,3,4,6-Tetra-O-acetyl-D-galactopyranosyl trichloroacetimidate | 2g | |
| GC6496-5g | 2,3,4,6-Tetra-O-acetyl-D-galactopyranosyl trichloroacetimidate | 5g | |
| GC6496-10g | 2,3,4,6-Tetra-O-acetyl-D-galactopyranosyl trichloroacetimidate | 10g | |
| GC6496-25g | 2,3,4,6-Tetra-O-acetyl-D-galactopyranosyl trichloroacetimidate | 25g | |
| GC2556-1g | 2,3,4,6-Tetra-O-acetyl-D-glucopyranosyl trichloroacetimidate | 142831-80-9 | 1g |
| GC2556-2g | 2,3,4,6-Tetra-O-acetyl-D-glucopyranosyl trichloroacetimidate | 142831-80-9 | 2g |
| GC2556-5g | 2,3,4,6-Tetra-O-acetyl-D-glucopyranosyl trichloroacetimidate | 142831-80-9 | 5g |
| GC2556-10g | 2,3,4,6-Tetra-O-acetyl-D-glucopyranosyl trichloroacetimidate | 142831-80-9 | 10g |
| GC1085-500mg | 2,3,4,6-Tetra-O-acetyl-α-D-mannopyranosyl azide | 53784-29-5 | 500mg |
| GC1085-1g | 2,3,4,6-Tetra-O-acetyl-α-D-mannopyranosyl azide | 53784-29-5 | 1g |
| GC1085-2g | 2,3,4,6-Tetra-O-acetyl-α-D-mannopyranosyl azide | 53784-29-5 | 2g |
| GC1085-5g | 2,3,4,6-Tetra-O-acetyl-α-D-mannopyranosyl azide | 53784-29-5 | 5g |
| GC1085-10g | 2,3,4,6-Tetra-O-acetyl-α-D-mannopyranosyl azide | 53784-29-5 | 10g |
| GC9539-500mg | 2,3,4,6-Tetra-O-benzoyl-α-D-mannopyranosyl trichloroacetimidate | 183901-63-5 | 500mg |
| GC9539-1g | 2,3,4,6-Tetra-O-benzoyl-α-D-mannopyranosyl trichloroacetimidate | 183901-63-5 | 1g |
| GC9539-2g | 2,3,4,6-Tetra-O-benzoyl-α-D-mannopyranosyl trichloroacetimidate | 183901-63-5 | 2g |
| GC9539-5g | 2,3,4,6-Tetra-O-benzoyl-α-D-mannopyranosyl trichloroacetimidate | 183901-63-5 | 5g |
| GC2006-50mg | 2,3,4,6-Tetra-O-benzoyl-β-D-glucopyranosyl fluoride | 4163-40-0 | 50mg |
| GC2006-100mg | 2,3,4,6-Tetra-O-benzoyl-β-D-glucopyranosyl fluoride | 4163-40-0 | 100mg |
| GC2006-250mg | 2,3,4,6-Tetra-O-benzoyl-β-D-glucopyranosyl fluoride | 4163-40-0 | 250mg |
| GC2006-500mg | 2,3,4,6-Tetra-O-benzoyl-β-D-glucopyranosyl fluoride | 4163-40-0 | 500mg |
| GC9056-1g | 2,3,4,6-Tetra-O-benzyl-D-galactopyranose | 6386-24-9 | 1g |
| GC9056-2g | 2,3,4,6-Tetra-O-benzyl-D-galactopyranose | 6386-24-9 | 2g |
| GC9056-5g | 2,3,4,6-Tetra-O-benzyl-D-galactopyranose | 6386-24-9 | 5g |
| GC9056-10g | 2,3,4,6-Tetra-O-benzyl-D-galactopyranose | 6386-24-9 | 10g |
| GC7184-10g | 2,3,4,6-Tetra-O-benzyl-D-glucopyranose | 4132-28-9 | 10g |
| GC7184-25g | 2,3,4,6-Tetra-O-benzyl-D-glucopyranose | 4132-28-9 | 25g |
| GC7184-50g | 2,3,4,6-Tetra-O-benzyl-D-glucopyranose | 4132-28-9 | 50g |
| GC7184-100g | 2,3,4,6-Tetra-O-benzyl-D-glucopyranose | 4132-28-9 | 100g |
| GC1557-1g | 2,3,4,6-Tetra-O-benzyl-D-mannopyranose | 61330-61-8 | 1g |
| GC1557-2g | 2,3,4,6-Tetra-O-benzyl-D-mannopyranose | 61330-61-8 | 2g |
| GC1557-5g | 2,3,4,6-Tetra-O-benzyl-D-mannopyranose | 61330-61-8 | 5g |
| GC1557-10g | 2,3,4,6-Tetra-O-benzyl-D-mannopyranose | 61330-61-8 | 10g |
| GC6470-250mg | 2,3,4,6-Tetra-O-benzyl-D-mannopyranosyl fluoride | 94898-42-7 | 250mg |
| GC6470-500mg | 2,3,4,6-Tetra-O-benzyl-D-mannopyranosyl fluoride | 94898-42-7 | 500mg |
| GC6470-1g | 2,3,4,6-Tetra-O-benzyl-D-mannopyranosyl fluoride | 94898-42-7 | 1g |
| GC6470-2g | 2,3,4,6-Tetra-O-benzyl-D-mannopyranosyl fluoride | 94898-42-7 | 2g |
| GC6047-250mg | 2,3,4,6-Tetra-O-benzyl-β-D-galactopyranosyl trichloroacetimidate | 114743-70-3 | 250mg |
| GC6047-500mg | 2,3,4,6-Tetra-O-benzyl-β-D-galactopyranosyl trichloroacetimidate | 114743-70-3 | 500mg |
| GC6047-1g | 2,3,4,6-Tetra-O-benzyl-β-D-galactopyranosyl trichloroacetimidate | 114743-70-3 | 1g |
| GC6047-2g | 2,3,4,6-Tetra-O-benzyl-β-D-galactopyranosyl trichloroacetimidate | 114743-70-3 | 2g |
| GE0337-100mg | 2,3,4,6-Tetramethyl-D-glucose | 7506-68-5 | 100mg |
| GE0337-250mg | 2,3,4,6-Tetramethyl-D-glucose | 7506-68-5 | 250mg |
| GE0337-500mg | 2,3,4,6-Tetramethyl-D-glucose | 7506-68-5 | 500mg |
| GE0337-1g | 2,3,4,6-Tetramethyl-D-glucose | 7506-68-5 | 1g |
| GC0772-1g | 2,3,5-Tri-O-acetyl-D-arabinonic acid, γ-lactone | 16751-37-4 | 1g |
| GC0772-2g | 2,3,5-Tri-O-acetyl-D-arabinonic acid, γ-lactone | 16751-37-4 | 2g |
| GC0772-5g | 2,3,5-Tri-O-acetyl-D-arabinonic acid, γ-lactone | 16751-37-4 | 5g |
| GC0772-10g | 2,3,5-Tri-O-acetyl-D-arabinonic acid, γ-lactone | 16751-37-4 | 10g |
| GC5277-1g | 2,3,5-Tri-O-acetyl-D-xylonic acid, γ-lactone | 79580-60-2 | 1g |
| GC5277-2g | 2,3,5-Tri-O-acetyl-D-xylonic acid, γ-lactone | 79580-60-2 | 2g |
| GC5277-5g | 2,3,5-Tri-O-acetyl-D-xylonic acid, γ-lactone | 79580-60-2 | 5g |
| GC5277-10g | 2,3,5-Tri-O-acetyl-D-xylonic acid, γ-lactone | 79580-60-2 | 10g |
| GC7875-100mg | 2,3,5-Tri-O-benzoyl-β-D-arabinofuranosyl fluoride | 6301-48-0 | 100mg |
| GC7875-250mg | 2,3,5-Tri-O-benzoyl-β-D-arabinofuranosyl fluoride | 6301-48-0 | 250mg |
| GC7875-500mg | 2,3,5-Tri-O-benzoyl-β-D-arabinofuranosyl fluoride | 6301-48-0 | 500mg |
| GC7875-1g | 2,3,5-Tri-O-benzoyl-β-D-arabinofuranosyl fluoride | 6301-48-0 | 1g |
| GC7875-2g | 2,3,5-Tri-O-benzoyl-β-D-arabinofuranosyl fluoride | 6301-48-0 | 2g |
| GC0836-5g | 2,3,5-Tri-O-benzyl-b-D-arabinofuranose | 60933-68-8 | 5g |
| GC5276-1g | 2,3,5-Tri-O-benzyl-D-ribofuranose | 16838-89-4 | 1g |
| GC5276-2g | 2,3,5-Tri-O-benzyl-D-ribofuranose | 16838-89-4 | 2g |
| GC5276-5g | 2,3,5-Tri-O-benzyl-D-ribofuranose | 16838-89-4 | 5g |
| GC5276-10g | 2,3,5-Tri-O-benzyl-D-ribofuranose | 16838-89-4 | 10g |
| GC9514-5g | 2,3,5-Triphenyltetrazolium chloride, 99% | 298-96-4 | 5g |
| GC9514-25g | 2,3,5-Triphenyltetrazolium chloride, 99% | 298-96-4 | 25g |
| GC9514-50g | 2,3,5-Triphenyltetrazolium chloride, 99% | 298-96-4 | 50g |
| GC9514-100g | 2,3,5-Triphenyltetrazolium chloride, 99% | 298-96-4 | 100g |
| GC9514-250g | 2,3,5-Triphenyltetrazolium chloride, 99% | 298-96-4 | 250g |
| GE2454-5g | 2,3,5-Triphenyltetrazolium chloride, 99%, for analysis | 298-96-4 | 5g |
| GE2454-25g | 2,3,5-Triphenyltetrazolium chloride, 99%, for analysis | 298-96-4 | 25g |
| GC5452-1mg | 2,3,6-Tri-O-(carboxymethyl)-D-glucose | 108844-55-9 | 1mg |
| GC5452-2mg | 2,3,6-Tri-O-(carboxymethyl)-D-glucose | 108844-55-9 | 2mg |
| GC5452-5mg | 2,3,6-Tri-O-(carboxymethyl)-D-glucose | 108844-55-9 | 5mg |
| GC8269-100mg | 2,3,6-Tri-O-benzyl-1-O-(thexyldimethylsilyl)-β-D-galactopyranose | 1887760-18-0 | 100mg |
| GC8269-250mg | 2,3,6-Tri-O-benzyl-1-O-(thexyldimethylsilyl)-β-D-galactopyranose | 1887760-18-0 | 250mg |
| GC8269-500mg | 2,3,6-Tri-O-benzyl-1-O-(thexyldimethylsilyl)-β-D-galactopyranose | 1887760-18-0 | 500mg |
| GC8269-1g | 2,3,6-Tri-O-benzyl-1-O-(thexyldimethylsilyl)-β-D-galactopyranose | 1887760-18-0 | 1g |
| GC7711-1g | 2,3,6,2'',3'',4'',6''-Hepta-O-acetyl-1-thio-β-D-lactose 1-(dimethylcarbamodithioate) | 19200-34-1 | 1g |
| GC7711-2g | 2,3,6,2'',3'',4'',6''-Hepta-O-acetyl-1-thio-β-D-lactose 1-(dimethylcarbamodithioate) | 19200-34-1 | 2g |
| GC7711-5g | 2,3,6,2'',3'',4'',6''-Hepta-O-acetyl-1-thio-β-D-lactose 1-(dimethylcarbamodithioate) | 19200-34-1 | 5g |
| GC7711-10g | 2,3,6,2'',3'',4'',6''-Hepta-O-acetyl-1-thio-β-D-lactose 1-(dimethylcarbamodithioate) | 19200-34-1 | 10g |
| GC4713-1g | 2,3,6,2'',3'',4'',6''-Hepta-O-acetyl-a-D-cellobiosyl bromide | 14227-66-8 | 1g |
| GC4713-2g | 2,3,6,2'',3'',4'',6''-Hepta-O-acetyl-a-D-cellobiosyl bromide | 14227-66-8 | 2g |
| GC4713-5g | 2,3,6,2'',3'',4'',6''-Hepta-O-acetyl-a-D-cellobiosyl bromide | 14227-66-8 | 5g |
| GC4713-10g | 2,3,6,2'',3'',4'',6''-Hepta-O-acetyl-a-D-cellobiosyl bromide | 14227-66-8 | 10g |
| GC0193-100mg | 2,3,6,2'',3'',6''-Hepta-O-acetyl-b-maltosyl azide | 33012-49-6 | 100mg |
| GC0193-250mg | 2,3,6,2'',3'',6''-Hepta-O-acetyl-b-maltosyl azide | 33012-49-6 | 250mg |
| GC0193-500mg | 2,3,6,2'',3'',6''-Hepta-O-acetyl-b-maltosyl azide | 33012-49-6 | 500mg |
| GC0193-1g | 2,3,6,2'',3'',6''-Hepta-O-acetyl-b-maltosyl azide | 33012-49-6 | 1g |
| GT1501-1g | 2,3,6,7-Tetrahydro-8-hydroxy-1H,5H-benzo[ij]quinolizine-9-carboxaldehyde | 63149-33-7 | 1g |
| GC0061-500mg | 2,3:4,5-Di-O-isopropylidene-1-O-propargyl-β-D-fructopyranose | 364733-08-4 | 500mg |
| GC0061-1g | 2,3:4,5-Di-O-isopropylidene-1-O-propargyl-β-D-fructopyranose | 364733-08-4 | 1g |
| GC0061-2g | 2,3:4,5-Di-O-isopropylidene-1-O-propargyl-β-D-fructopyranose | 364733-08-4 | 2g |
| GC0061-5g | 2,3:4,5-Di-O-isopropylidene-1-O-propargyl-β-D-fructopyranose | 364733-08-4 | 5g |
| GC1595-500mg | 2,3:4,5-Di-O-isopropylidene-D-arabinose | 13039-93-5 | 500mg |
| GC1595-1g | 2,3:4,5-Di-O-isopropylidene-D-arabinose | 13039-93-5 | 1g |
| GC1595-2g | 2,3:4,5-Di-O-isopropylidene-D-arabinose | 13039-93-5 | 2g |
| GC1595-5g | 2,3:4,5-Di-O-isopropylidene-D-arabinose | 13039-93-5 | 5g |
| GC0195-1g | 2,3:4,5-Di-O-isopropylidene-D-arabitol | 19139-74-3 | 1g |
| GC0195-2g | 2,3:4,5-Di-O-isopropylidene-D-arabitol | 19139-74-3 | 2g |
| GC0195-5g | 2,3:4,5-Di-O-isopropylidene-D-arabitol | 19139-74-3 | 5g |
| GC0195-10g | 2,3:4,5-Di-O-isopropylidene-D-arabitol | 19139-74-3 | 10g |
| GC6033-5g | 2,3:4,5-Di-O-isopropylidene-β-D-fructopyranose | 20880-92-6 | 5g |
| GC6033-10g | 2,3:4,5-Di-O-isopropylidene-β-D-fructopyranose | 20880-92-6 | 10g |
| GC6033-25g | 2,3:4,5-Di-O-isopropylidene-β-D-fructopyranose | 20880-92-6 | 25g |
| GC6033-50g | 2,3:4,5-Di-O-isopropylidene-β-D-fructopyranose | 20880-92-6 | 50g |
| GC0575-2g | 2,3:4,6-Di-O-isopropylidene-a-L-sorbofuranose | 17682-70-1 | 2g |
| GC0575-5g | 2,3:4,6-Di-O-isopropylidene-a-L-sorbofuranose | 17682-70-1 | 5g |
| GC0575-10g | 2,3:4,6-Di-O-isopropylidene-a-L-sorbofuranose | 17682-70-1 | 10g |
| GC0575-25g | 2,3:4,6-Di-O-isopropylidene-a-L-sorbofuranose | 17682-70-1 | 25g |
| GC6507-100mg | 2,3:5,6-Di-O-isopropylidene-D-gluconic acid methyl ester | 134639-65-9 | 100mg |
| GC6507-250mg | 2,3:5,6-Di-O-isopropylidene-D-gluconic acid methyl ester | 134639-65-9 | 250mg |
| GC6507-500mg | 2,3:5,6-Di-O-isopropylidene-D-gluconic acid methyl ester | 134639-65-9 | 500mg |
| GC6507-1g | 2,3:5,6-Di-O-isopropylidene-D-gluconic acid methyl ester | 134639-65-9 | 1g |
| GC2026-25g | 2,3:5,6-Di-O-isopropylidene-α-D-mannofuranose | 14131-84-1 | 25g |
| GC2026-50g | 2,3:5,6-Di-O-isopropylidene-α-D-mannofuranose | 14131-84-1 | 50g |
| GC2026-100g | 2,3:5,6-Di-O-isopropylidene-α-D-mannofuranose | 14131-84-1 | 100g |
| GC3818-100mg | 2,4-Di-O-acetyl-1,6-anhydro-3-O-benzyl-β-L-idopyranose | 61237-60-3 | 100mg |
| GC3818-250mg | 2,4-Di-O-acetyl-1,6-anhydro-3-O-benzyl-β-L-idopyranose | 61237-60-3 | 250mg |
| GC3818-500mg | 2,4-Di-O-acetyl-1,6-anhydro-3-O-benzyl-β-L-idopyranose | 61237-60-3 | 500mg |
| GC3818-1g | 2,4-Di-O-acetyl-1,6-anhydro-3-O-benzyl-β-L-idopyranose | 61237-60-3 | 1g |
| GT1388-1g | 2,4-Dichlorobenzenediazonium 1,5-naphthalenedisulfonate hydrate | 123333-91-5 | 1g |
| GK6386-25g | 2,4-Dichlorophenoxyacetic acid | 94-75-7 | 25g |
| GK6386-100g | 2,4-Dichlorophenoxyacetic acid | 94-75-7 | 100g |
| GK6386-250g | 2,4-Dichlorophenoxyacetic acid | 94-75-7 | 250g |
| GK6386-500g | 2,4-Dichlorophenoxyacetic acid | 94-75-7 | 500g |
| GK6386-1kg | 2,4-Dichlorophenoxyacetic acid | 94-75-7 | 1kg |
| GW3317-10g | 2,4-Dichlororesorcinol | 16606-61-4 | 10g |
| GW3317-50g | 2,4-Dichlororesorcinol | 16606-61-4 | 50g |
| GK0030-25g | 2,4-Difluoroaniline | 367-25-9 | 25g |
| GW6353-500mg | 2,4-Difluororesorcinol | 195136-71-1 | 500mg |
| GW6353-1g | 2,4-Difluororesorcinol | 195136-71-1 | 1g |
| GW6353-5g | 2,4-Difluororesorcinol | 195136-71-1 | 5g |
| GK2365-25g | 2,4-Dihydroxybenzaldehyde | 95-01-2 | 25g |
| GK2365-100g | 2,4-Dihydroxybenzaldehyde | 95-01-2 | 100g |
| GK8522-25ml | 2,4-Dimethylaniline | 95-68-1 | 25ml |
| GK5333-25g | 2,4-Dinitrofluorobenzene | 70-34-8 | 25g |
| GK5333-100g | 2,4-Dinitrofluorobenzene | 70-34-8 | 100g |
| GC7368-2mg | 2,4-Dinitrophenyl 2-deoxy-2-fluoro-b-D-glucopyranoside | 111495-86-4 | 2mg |
| GC7368-5mg | 2,4-Dinitrophenyl 2-deoxy-2-fluoro-b-D-glucopyranoside | 111495-86-4 | 5mg |
| GC7368-10mg | 2,4-Dinitrophenyl 2-deoxy-2-fluoro-b-D-glucopyranoside | 111495-86-4 | 10mg |
| GC7368-25mg | 2,4-Dinitrophenyl 2-deoxy-2-fluoro-b-D-glucopyranoside | 111495-86-4 | 25mg |
| GC1845-1mg | 2,4-Dinitrophenyl 2-deoxy-2-fluoro-β-D-xylopyranoside | 172218-63-2 | 1mg |
| GC1845-2mg | 2,4-Dinitrophenyl 2-deoxy-2-fluoro-β-D-xylopyranoside | 172218-63-2 | 2mg |
| GC1845-5mg | 2,4-Dinitrophenyl 2-deoxy-2-fluoro-β-D-xylopyranoside | 172218-63-2 | 5mg |
| GC1845-10mg | 2,4-Dinitrophenyl 2-deoxy-2-fluoro-β-D-xylopyranoside | 172218-63-2 | 10mg |
| GC9590-250mg | 2,4-Dinitrophenyl 2,3,4,6-tetra-O-acetyl-α-D-glucopyranoside | 77516-86-0 | 250mg |
| GC9590-500mg | 2,4-Dinitrophenyl 2,3,4,6-tetra-O-acetyl-α-D-glucopyranoside | 77516-86-0 | 500mg |
| GC9590-1g | 2,4-Dinitrophenyl 2,3,4,6-tetra-O-acetyl-α-D-glucopyranoside | 77516-86-0 | 1g |
| GC9590-2g | 2,4-Dinitrophenyl 2,3,4,6-tetra-O-acetyl-α-D-glucopyranoside | 77516-86-0 | 2g |
| GC6346-250mg | 2,4-Dinitrophenyl 2,3,4,6-tetra-O-acetyl-β-D-glucopyranoside | 17042-32-9 | 250mg |
| GC6346-500mg | 2,4-Dinitrophenyl 2,3,4,6-tetra-O-acetyl-β-D-glucopyranoside | 17042-32-9 | 500mg |
| GC6346-1g | 2,4-Dinitrophenyl 2,3,4,6-tetra-O-acetyl-β-D-glucopyranoside | 17042-32-9 | 1g |
| GC6346-2g | 2,4-Dinitrophenyl 2,3,4,6-tetra-O-acetyl-β-D-glucopyranoside | 17042-32-9 | 2g |
| GC9571-5mg | 2,4-Dinitrophenyl 3,4-di-O-acetyl-2-deoxy-2-fluoro-α-D-lyxopyranoside | 5mg | |
| GC9571-10mg | 2,4-Dinitrophenyl 3,4-di-O-acetyl-2-deoxy-2-fluoro-α-D-lyxopyranoside | 10mg | |
| GC9571-25mg | 2,4-Dinitrophenyl 3,4-di-O-acetyl-2-deoxy-2-fluoro-α-D-lyxopyranoside | 25mg | |
| GC9571-50mg | 2,4-Dinitrophenyl 3,4-di-O-acetyl-2-deoxy-2-fluoro-α-D-lyxopyranoside | 50mg | |
| GC9478-10mg | 2,4-Dinitrophenyl β-D-glucopyranoside | 25775-97-7 | 10mg |
| GC9478-25mg | 2,4-Dinitrophenyl β-D-glucopyranoside | 25775-97-7 | 25mg |
| GC9478-50mg | 2,4-Dinitrophenyl β-D-glucopyranoside | 25775-97-7 | 50mg |
| GC9478-100mg | 2,4-Dinitrophenyl β-D-glucopyranoside | 25775-97-7 | 100mg |
| GW8640-5g | 2,4-Pentadienoic acid | 626-99-3 | 5g |
| GW8640-25g | 2,4-Pentadienoic acid | 626-99-3 | 25g |
| GW9999-25g | 2,4,5-Trichlorophenol | 95-95-4 | 25g |
| GW9999-100g | 2,4,5-Trichlorophenol | 95-95-4 | 100g |
| GC2544-1g | 2,4,6-Tri-O-acetyl-1,3,5-O-methylidyne-myo-inositol | 98510-21-5 | 1g |
| GC2544-2g | 2,4,6-Tri-O-acetyl-1,3,5-O-methylidyne-myo-inositol | 98510-21-5 | 2g |
| GC2544-5g | 2,4,6-Tri-O-acetyl-1,3,5-O-methylidyne-myo-inositol | 98510-21-5 | 5g |
| GC2544-10g | 2,4,6-Tri-O-acetyl-1,3,5-O-methylidyne-myo-inositol | 98510-21-5 | 10g |
| GC2544-25g | 2,4,6-Tri-O-acetyl-1,3,5-O-methylidyne-myo-inositol | 98510-21-5 | 25g |
| GC3129-100mg | 2,4,6-Tri-O-acetyl-3-O-allyl-D-glucopyranosyl trichloroacetimidate | 905714-81-0 | 100mg |
| GC3129-250mg | 2,4,6-Tri-O-acetyl-3-O-allyl-D-glucopyranosyl trichloroacetimidate | 905714-81-0 | 250mg |
| GC3129-500mg | 2,4,6-Tri-O-acetyl-3-O-allyl-D-glucopyranosyl trichloroacetimidate | 905714-81-0 | 500mg |
| GC3129-1g | 2,4,6-Tri-O-acetyl-3-O-allyl-D-glucopyranosyl trichloroacetimidate | 905714-81-0 | 1g |
| GC3129-2g | 2,4,6-Tri-O-acetyl-3-O-allyl-D-glucopyranosyl trichloroacetimidate | 905714-81-0 | 2g |
| GC7134-50mg | 2,4,6-Tri-O-acetyl-3-O-allyl-α-D-glucopyranosyl trichloroacetimidate | 147589-16-0 | 50mg |
| GC7134-100mg | 2,4,6-Tri-O-acetyl-3-O-allyl-α-D-glucopyranosyl trichloroacetimidate | 147589-16-0 | 100mg |
| GC7134-250mg | 2,4,6-Tri-O-acetyl-3-O-allyl-α-D-glucopyranosyl trichloroacetimidate | 147589-16-0 | 250mg |
| GC7134-500mg | 2,4,6-Tri-O-acetyl-3-O-allyl-α-D-glucopyranosyl trichloroacetimidate | 147589-16-0 | 500mg |
| GC7134-1g | 2,4,6-Tri-O-acetyl-3-O-allyl-α-D-glucopyranosyl trichloroacetimidate | 147589-16-0 | 1g |
| GC7774-250mg | 2,4,6-Tri-O-acetyl-3-O-benzyl-α-D-glucopyranosyl trichloroacetimidate | 142130-42-5 | 250mg |
| GC7774-500mg | 2,4,6-Tri-O-acetyl-3-O-benzyl-α-D-glucopyranosyl trichloroacetimidate | 142130-42-5 | 500mg |
| GC7774-1g | 2,4,6-Tri-O-acetyl-3-O-benzyl-α-D-glucopyranosyl trichloroacetimidate | 142130-42-5 | 1g |
| GC7774-2g | 2,4,6-Tri-O-acetyl-3-O-benzyl-α-D-glucopyranosyl trichloroacetimidate | 142130-42-5 | 2g |
| GC9832-100mg | 2,4,6-Tri-O-acetyl-3-O-benzyl-β-D-glucopyranosyl trichloroacetimidate | 314038-30-7 | 100mg |
| GC9832-250mg | 2,4,6-Tri-O-acetyl-3-O-benzyl-β-D-glucopyranosyl trichloroacetimidate | 314038-30-7 | 250mg |
| GC9832-500mg | 2,4,6-Tri-O-acetyl-3-O-benzyl-β-D-glucopyranosyl trichloroacetimidate | 314038-30-7 | 500mg |
| GC9832-1g | 2,4,6-Tri-O-acetyl-3-O-benzyl-β-D-glucopyranosyl trichloroacetimidate | 314038-30-7 | 1g |
| GK6656-5g | 2,4,6-Tri(2-pyridyl)-s-triazine | 3682-35-7 | 5g |
| GK6656-10g | 2,4,6-Tri(2-pyridyl)-s-triazine | 3682-35-7 | 10g |
| GK6656-25g | 2,4,6-Tri(2-pyridyl)-s-triazine | 3682-35-7 | 25g |
| GW0465-100mg | 2,4,6-Triiodobenzoic acid | 2012-31-9 | 100mg |
| GW0465-500mg | 2,4,6-Triiodobenzoic acid | 2012-31-9 | 500mg |
| GW5495-1g | 2,4,6-Tris(trifluoromethyl)-1,3,5-triazine | 368-66-1 | 1g |
| GW5495-5g | 2,4,6-Tris(trifluoromethyl)-1,3,5-triazine | 368-66-1 | 5g |
| GC5558-10mg | 2,4,7,8-Tetra-O-acetyl-9-azido-9-deoxy-N-acetylneuraminic acid methyl ester | 219814-64-9 | 10mg |
| GC5558-25mg | 2,4,7,8-Tetra-O-acetyl-9-azido-9-deoxy-N-acetylneuraminic acid methyl ester | 219814-64-9 | 25mg |
| GC5558-50mg | 2,4,7,8-Tetra-O-acetyl-9-azido-9-deoxy-N-acetylneuraminic acid methyl ester | 219814-64-9 | 50mg |
| GC5558-100mg | 2,4,7,8-Tetra-O-acetyl-9-azido-9-deoxy-N-acetylneuraminic acid methyl ester | 219814-64-9 | 100mg |
| GC1218-250mg | 2,4,7,8,9-Penta-O-acetyl-a-D-neuraminic acid methyl ester | 73208-82-9 | 250mg |
| GC1218-500mg | 2,4,7,8,9-Penta-O-acetyl-a-D-neuraminic acid methyl ester | 73208-82-9 | 500mg |
| GC1218-1g | 2,4,7,8,9-Penta-O-acetyl-a-D-neuraminic acid methyl ester | 73208-82-9 | 1g |
| GC1218-2g | 2,4,7,8,9-Penta-O-acetyl-a-D-neuraminic acid methyl ester | 73208-82-9 | 2g |
| GC7893-10mg | 2,5-Anhydro-1-O-trityl-D-mannitol | 68774-48-1 | 10mg |
| GC7893-25mg | 2,5-Anhydro-1-O-trityl-D-mannitol | 68774-48-1 | 25mg |
| GC7893-50mg | 2,5-Anhydro-1-O-trityl-D-mannitol | 68774-48-1 | 50mg |
| GC7893-100mg | 2,5-Anhydro-1-O-trityl-D-mannitol | 68774-48-1 | 100mg |
| GC0241-100mg | 2,5-Anhydro-D-mannitol | 41107-82-8 | 100mg |
| GC0241-250mg | 2,5-Anhydro-D-mannitol | 41107-82-8 | 250mg |
| GC0241-500mg | 2,5-Anhydro-D-mannitol | 41107-82-8 | 500mg |
| GC0241-1g | 2,5-Anhydro-D-mannitol | 41107-82-8 | 1g |
| GC4910-5mg | 2,5-Anhydro-L-iditol | 28218-55-5 | 5mg |
| GC4910-10mg | 2,5-Anhydro-L-iditol | 28218-55-5 | 10mg |
| GC4910-25mg | 2,5-Anhydro-L-iditol | 28218-55-5 | 25mg |
| GC4910-50mg | 2,5-Anhydro-L-iditol | 28218-55-5 | 50mg |
| GK4865-5g | 2,5-Bis-trifluoromethylaniline | 328-93-8 | 5g |
| GK4865-25g | 2,5-Bis-trifluoromethylaniline | 328-93-8 | 25g |
| GW2517-20mg | 2,5-Bis(4-aminophenyl)-1,3,4-oxadiazole | 2425-95-8 | 20mg |
| GW2517-250mg | 2,5-Bis(4-aminophenyl)-1,3,4-oxadiazole | 2425-95-8 | 250mg |
| GW3033-100g | 2,5-Dichloro-p-xylene | 1124-05-6 | 100g |
| GW3033-500g | 2,5-Dichloro-p-xylene | 1124-05-6 | 500g |
| GK8629-50g | 2,5-Dichloroaniline | 95-82-9 | 50g |
| GK9654-100g | 2,5-Dihydroxy-1,4-dithiane | 40018-26-6 | 100g |
| GL7510-5mg | 2,5-Dimethyl-celecoxib | 457639-26-8 | 5mg |
| GL7510-25mg | 2,5-Dimethyl-celecoxib | 457639-26-8 | 25mg |
| GW1803-250mg | 2,5-Dioxopyrrolidin-1-yl propanoate | 30364-55-7 | 250mg |
| GW1803-500mg | 2,5-Dioxopyrrolidin-1-yl propanoate | 30364-55-7 | 500mg |
| GE1342-25g | 2,5-Diphenyloxazole | 92-71-7 | 25g |
| GE1342-100g | 2,5-Diphenyloxazole | 92-71-7 | 100g |
| GC9225-1mg | 2,6-Anhydro-3-deoxy-D-glycero-D-galacto-non-2-enoic-acid | 188854-96-8 | 1mg |
| GC9225-2mg | 2,6-Anhydro-3-deoxy-D-glycero-D-galacto-non-2-enoic-acid | 188854-96-8 | 2mg |
| GC9225-5mg | 2,6-Anhydro-3-deoxy-D-glycero-D-galacto-non-2-enoic-acid | 188854-96-8 | 5mg |
| GC9225-10mg | 2,6-Anhydro-3-deoxy-D-glycero-D-galacto-non-2-enoic-acid | 188854-96-8 | 10mg |
| GC5552-1mg | 2,6-Di-O-(carboxymethyl)-D-glucose | 95350-37-1 | 1mg |
| GC5552-2mg | 2,6-Di-O-(carboxymethyl)-D-glucose | 95350-37-1 | 2mg |
| GC5552-5mg | 2,6-Di-O-(carboxymethyl)-D-glucose | 95350-37-1 | 5mg |
| GM5205-1g | 2,6-Diaminopimelic acid | 583-93-7 | 1g |
| GK0378-25g | 2,6-Dichloro-4-nitroaniline | 99-30-9 | 25g |
| GT5955-1g | 2,6-Dichloroindophenol sodium salt | 620-45-1 | 1g |
| GT5955-5g | 2,6-Dichloroindophenol sodium salt | 620-45-1 | 5g |
| GT5955-10g | 2,6-Dichloroindophenol sodium salt | 620-45-1 | 10g |
| GT5955-25g | 2,6-Dichloroindophenol sodium salt | 620-45-1 | 25g |
| GT0602-1g | 2,6-Dichloroquinone-4-chloroimide | 101-38-2 | 1g |
| GT0602-5g | 2,6-Dichloroquinone-4-chloroimide | 101-38-2 | 5g |
| GC5575-5mg | 2,6-Dideoxy-D-glucose | 6988-55-2 | 5mg |
| GC5575-10mg | 2,6-Dideoxy-D-glucose | 6988-55-2 | 10mg |
| GC5575-25mg | 2,6-Dideoxy-D-glucose | 6988-55-2 | 25mg |
| GC5575-50mg | 2,6-Dideoxy-D-glucose | 6988-55-2 | 50mg |
| GK9208-5g | 2,6-Difluoropyridine | 1513-65-1 | 5g |
| GK9208-10g | 2,6-Difluoropyridine | 1513-65-1 | 10g |
| GK9208-25g | 2,6-Difluoropyridine | 1513-65-1 | 25g |
| GK9246-1g | 2,6-Dihydroxyanthraquinone | 84-60-6 | 1g |
| GK9246-5g | 2,6-Dihydroxyanthraquinone | 84-60-6 | 5g |
| GK8250-25g | 2,6-Dihydroxybenzoic acid | 303-07-1 | 25g |
| GK8250-100g | 2,6-Dihydroxybenzoic acid | 303-07-1 | 100g |
| GK9060-1g | 2,6-Dimethyl-4-hydroxypyridine | 13603-44-6 | 1g |
| GK9060-5g | 2,6-Dimethyl-4-hydroxypyridine | 13603-44-6 | 5g |
| GL6190-25g | 2,6-Dimethylphenol | 576-26-1 | 25g |
| GK3868-500ml | 2,6-Lutidine | 108-48-5 | 500ml |
| GK0816-25g | 2,6-Pyridinedicarboxylic acid | 499-83-2 | 25g |
| GK6114-5g | 2,7-Dihydroxynaphthalene | 582-17-2 | 5g |
| GL7240-250mg | 2'-Deoxyguanosine monohydrate | 312693-72-4 | 250mg |
| GL7240-1g | 2'-Deoxyguanosine monohydrate | 312693-72-4 | 1g |
| GK7080-25g | 2''-Aminoacetophenone | 551-93-9 | 25g |
| GN5326-5mg | 2''-C-Methylcytidine | 20724-73-6 | 5mg |
| GN5326-10mg | 2''-C-Methylcytidine | 20724-73-6 | 10mg |
| GN5326-25mg | 2''-C-Methylcytidine | 20724-73-6 | 25mg |
| GN2276-5mg | 2''-Deoxy-2'',2''-difluorouridine | 114248-23-6 | 5mg |
| GN2276-10mg | 2''-Deoxy-2'',2''-difluorouridine | 114248-23-6 | 10mg |
| GW1127-1mg | 2''-Deoxy-5-formylcytidine | 137017-45-9 | 1mg |
| GW1127-5mg | 2''-Deoxy-5-formylcytidine | 137017-45-9 | 5mg |
| GN8981-1g | 2''-Deoxy-5''-O-DMT-N2-isobutyrylguanosine | 68892-41-1 | 1g |
| GN9770-10mg | 2''-Deoxy-L-cytidine | 40093-94-5 | 10mg |
| GN1250-25mg | 2''-Deoxy-N6-methyladenosine | 2002-35-9 | 25mg |
| GN1250-100mg | 2''-Deoxy-N6-methyladenosine | 2002-35-9 | 100mg |
| GN7468-1g | 2''-Deoxyadenosine monohydrate | 16373-93-6 | 1g |
| GN7468-5g | 2''-Deoxyadenosine monohydrate | 16373-93-6 | 5g |
| GE5892-1g | 2''-Deoxyadenosine-5''-monophosphate disodium salt | 2922-74-9 | 1g |
| GK4440-250mg | 2''-Deoxycytidine | 951-77-9 | 250mg |
| GK4440-1g | 2''-Deoxycytidine | 951-77-9 | 1g |
| GK4440-5g | 2''-Deoxycytidine | 951-77-9 | 5g |
| GE7787-1g | 2''-Deoxycytidine hydrochloride | 3992-42-5 | 1g |
| GE7787-5g | 2''-Deoxycytidine hydrochloride | 3992-42-5 | 5g |
| GE7787-25g | 2''-Deoxycytidine hydrochloride | 3992-42-5 | 25g |
| GE3235-25g | 2''-Deoxyuridine | 951-78-0 | 25g |
| GE3235-100g | 2''-Deoxyuridine | 951-78-0 | 100g |
| GE3411-100mg | 2''-Deoxyuridine-5''-monophosphate disodium salt | 42155-08-8 | 100mg |
| GE3411-1g | 2''-Deoxyuridine-5''-monophosphate disodium salt | 42155-08-8 | 1g |
| GK0150-5g | 2''-Nitrophenacyl bromide | 6851-99-6 | 5g |
| GC3937-1g | 2''-O-Methyl guanosine | 2140-71-8 | 1g |
| GC3937-5g | 2''-O-Methyl guanosine | 2140-71-8 | 5g |
| GE2863-25mg | 2'',3''-Dideoxyadenosine | 4097-22-7 | 25mg |
| GN2393-1g | 2'',3'',5''-Tri-O-acetyl-6-chloro-6-deoxyguanosine | 16321-99-6 | 1g |
| GN2393-2g | 2'',3'',5''-Tri-O-acetyl-6-chloro-6-deoxyguanosine | 16321-99-6 | 2g |
| GN2393-5g | 2'',3'',5''-Tri-O-acetyl-6-chloro-6-deoxyguanosine | 16321-99-6 | 5g |
| GN2393-10g | 2'',3'',5''-Tri-O-acetyl-6-chloro-6-deoxyguanosine | 16321-99-6 | 10g |
| GE4701-5g | 2'',3'',5''-Triacetyluridine | 4105-38-8 | 5g |
| GE4701-10g | 2'',3'',5''-Triacetyluridine | 4105-38-8 | 10g |
| GE4701-25g | 2'',3'',5''-Triacetyluridine | 4105-38-8 | 25g |
| GT2638-1mg | 2'',7''-bis(2-Carboxyethyl)-5(6)-carboxyfluorescein | 85138-49-4 | 1mg |
| GT2638-5mg | 2'',7''-bis(2-Carboxyethyl)-5(6)-carboxyfluorescein | 85138-49-4 | 5mg |
| GT2638-25mg | 2'',7''-bis(2-Carboxyethyl)-5(6)-carboxyfluorescein | 85138-49-4 | 25mg |
| GT8033-1g | 2'',7''-Dichlorofluorescein | 76-54-0 | 1g |
| GW2593-50mg | 2'',7''-Dichlorofluorescin diacetate | 4091-99-0 | 50mg |
| GW2593-250mg | 2'',7''-Dichlorofluorescin diacetate | 4091-99-0 | 250mg |
| GW2593-1g | 2'',7''-Dichlorofluorescin diacetate | 4091-99-0 | 1g |
| GW1362-100mg | 2'',7''-Difluorofluorescein | 195136-58-4 | 100mg |
| GW1362-1g | 2'',7''-Difluorofluorescein | 195136-58-4 | 1g |
| GW1829-100mg | 2'',7''-Difluorofluorescein diacetate | 1027558-93-5 | 100mg |
| GC5734-250mg | 2'''',3'''',4'''',5,6''''-Penta-O-acetyl-4''-O-tert-butyldimethylsilyl-genistin | 250mg | |
| GC5734-500mg | 2'''',3'''',4'''',5,6''''-Penta-O-acetyl-4''-O-tert-butyldimethylsilyl-genistin | 500mg | |
| GC5734-1g | 2'''',3'''',4'''',5,6''''-Penta-O-acetyl-4''-O-tert-butyldimethylsilyl-genistin | 1g | |
| GC5734-2g | 2'''',3'''',4'''',5,6''''-Penta-O-acetyl-4''-O-tert-butyldimethylsilyl-genistin | 2g | |
| GC5734-5g | 2'''',3'''',4'''',5,6''''-Penta-O-acetyl-4''-O-tert-butyldimethylsilyl-genistin | 5g | |
| GM3282-100mg | 2(S)-Amino-4-azido-butanoic acid | 120042-14-0 | 100mg |
| GK5583-1mg | 2′,7′-bis(2-Carboxyethyl)-5(6)-carboxyfluorescein acetoxymethyl ester | 117464-70-7 | 1mg |
| GK5583-5mg | 2′,7′-bis(2-Carboxyethyl)-5(6)-carboxyfluorescein acetoxymethyl ester | 117464-70-7 | 5mg |
| GP0436-250mg | 20-Hydroxyecdysone, 90% | 5289-74-7 | 250mg |
| GP0436-1g | 20-Hydroxyecdysone, 90% | 5289-74-7 | 1g |
| GP9112-25mg | 20-Hydroxyecdysone, 97% | 5289-74-7 | 25mg |
| GP9112-100mg | 20-Hydroxyecdysone, 97% | 5289-74-7 | 100mg |
| GC1836-10mg | 20(s)-Ginsenoside Rh2 | 78214-33-2 | 10mg |
| GW9823-1mg | 22-NHC . hydrochloride | 360068-87-7 | 1mg |
| GW9823-5mg | 22-NHC . hydrochloride | 360068-87-7 | 5mg |
| GL1954-1mg | 22-NHC (inactive isomer) | 40521-33-3 | 1mg |
| GL1954-5mg | 22-NHC (inactive isomer) | 40521-33-3 | 5mg |
| GL2658-1mg | 22-NHC hydrochloride | 360068-87-7 (base) | 1mg |
| GL2658-5mg | 22-NHC hydrochloride | 360068-87-7 (base) | 5mg |
| GK9955-10mg | 25-Hydroxycholesterol | 2140-46-7 | 10mg |
| GK9955-25mg | 25-Hydroxycholesterol | 2140-46-7 | 25mg |
| GV7732-1mg | 25-Hydroxyvitamin D3 | 19356-17-3 | 1mg |
| GV7732-5mg | 25-Hydroxyvitamin D3 | 19356-17-3 | 5mg |
| GV7349-1mg | 25-Hydroxyvitamin D3 monohydrate | 63283-36-3 | 1mg |
| GV7349-5mg | 25-Hydroxyvitamin D3 monohydrate | 63283-36-3 | 5mg |
| GC9490-25mg | 2α-Mannobiose octaacetate | 49587-30-6 | 25mg |
| GC9490-50mg | 2α-Mannobiose octaacetate | 49587-30-6 | 50mg |
| GC9490-100mg | 2α-Mannobiose octaacetate | 49587-30-6 | 100mg |
| GC9490-250mg | 2α-Mannobiose octaacetate | 49587-30-6 | 250mg |
| GK3590-25g | 3-(1-Pyridinio)-1-propanesulfonate | 15471-17-7 | 25g |
| GM1275-10mg | 3-(1,2,4-Triazol-1-yl)-L-alanine | 4819-36-7 | 10mg |
| GK6405-25ml | 3-(2-Aminoethylamino)propyltrimethoxysilane | 1760-24-3 | 25ml |
| GK6405-100ml | 3-(2-Aminoethylamino)propyltrimethoxysilane | 1760-24-3 | 100ml |
| GW8865-10mg | 3-(2-Furoyl)quinoline-2-carboxaldehyde | 126769-01-5 | 10mg |
| GW8865-50mg | 3-(2-Furoyl)quinoline-2-carboxaldehyde | 126769-01-5 | 50mg |
| GK6800-1g | 3-(2-Pyridyl)-5,6-diphenyl-1,2,4-triazine | 1046-56-6 | 1g |
| GK6800-5g | 3-(2-Pyridyl)-5,6-diphenyl-1,2,4-triazine | 1046-56-6 | 5g |
| GX8894-1g | 3-(4-Chlorobutyl)-1H-indole-5-carbonitrile | 143612-79-7 | 1g |
| GX8894-5g | 3-(4-Chlorobutyl)-1H-indole-5-carbonitrile | 143612-79-7 | 5g |
| GL9990-1g | 3-(4-tert-Butyl-1-pyridinio)-1-propanesulfonate | 570412-84-9 | 1g |
| GL9990-3g | 3-(4-tert-Butyl-1-pyridinio)-1-propanesulfonate | 570412-84-9 | 3g |
| GX3305-25g | 3-(Methacryloyloxy)propyltris(trimethylsiloxy)silane | 17096-07-0 | 25g |
| GX3305-100g | 3-(Methacryloyloxy)propyltris(trimethylsiloxy)silane | 17096-07-0 | 100g |
| GE2828-1g | 3-(N-Ethyl-3-methylanilino)-2-hydroxypropanesulfonic acid sodium salt | 82692-93-1 | 1g |
| GE2828-5g | 3-(N-Ethyl-3-methylanilino)-2-hydroxypropanesulfonic acid sodium salt | 82692-93-1 | 5g |
| GD9579-5g | 3-(N,N-Dimethylmyristylammonio)propanesulfonate | 14933-09-6 | 5g |
| GD9579-25g | 3-(N,N-Dimethylmyristylammonio)propanesulfonate | 14933-09-6 | 25g |
| GC0671-1mg | 3-[2-[2-(Aminooxy)acetyl]hydrazinocarbonyl]propyl 2α-mannobioside | 1mg | |
| GC0671-2mg | 3-[2-[2-(Aminooxy)acetyl]hydrazinocarbonyl]propyl 2α-mannobioside | 2mg | |
| GC0671-5mg | 3-[2-[2-(Aminooxy)acetyl]hydrazinocarbonyl]propyl 2α-mannobioside | 5mg | |
| GC0671-10mg | 3-[2-[2-(Aminooxy)acetyl]hydrazinocarbonyl]propyl 2α-mannobioside | 10mg | |
| GC6383-1mg | 3-Acetamido-3,6-dideoxy-D-galactose | 4277-45-6 | 1mg |
| GC6383-2mg | 3-Acetamido-3,6-dideoxy-D-galactose | 4277-45-6 | 2mg |
| GC6383-5mg | 3-Acetamido-3,6-dideoxy-D-galactose | 4277-45-6 | 5mg |
| GC6383-10mg | 3-Acetamido-3,6-dideoxy-D-galactose | 4277-45-6 | 10mg |
| GW1063-250mg | 3-Acetamido-4-nitrophthalic anhydride | 209324-66-3 | 250mg |
| GW1063-1g | 3-Acetamido-4-nitrophthalic anhydride | 209324-66-3 | 1g |
| GK7482-5g | 3-Acetylcoumarin | 3949-36-8 | 5g |
| GC6979-5mg | 3-Acetylumbelliferyl b-D-glucopyranoside | 20943-16-2 | 5mg |
| GC6979-10mg | 3-Acetylumbelliferyl b-D-glucopyranoside | 20943-16-2 | 10mg |
| GC6979-25mg | 3-Acetylumbelliferyl b-D-glucopyranoside | 20943-16-2 | 25mg |
| GC6979-50mg | 3-Acetylumbelliferyl b-D-glucopyranoside | 20943-16-2 | 50mg |
| GL4935-1g | 3-Amino-1-propanesulfonic acid sodium salt | 81028-90-2 | 1g |
| GK4820-25g | 3-Amino-1,2-propanediol | 616-30-8 | 25g |
| GK4820-100g | 3-Amino-1,2-propanediol | 616-30-8 | 100g |
| GK0366-25g | 3-Amino-1,2,4-triazole | 61-82-5 | 25g |
| GK0366-100g | 3-Amino-1,2,4-triazole | 61-82-5 | 100g |
| GC8196-50mg | 3-Amino-3-deoxy-D-ribose, hydrochloride | 20590-58-3 | 50mg |
| GC8196-100mg | 3-Amino-3-deoxy-D-ribose, hydrochloride | 20590-58-3 | 100mg |
| GC8196-250mg | 3-Amino-3-deoxy-D-ribose, hydrochloride | 20590-58-3 | 250mg |
| GC8196-500mg | 3-Amino-3-deoxy-D-ribose, hydrochloride | 20590-58-3 | 500mg |
| GK4976-1g | 3-Amino-4-iodopyridine | 105752-11-2 | 1g |
| GM0393-25g | 3-Amino-5-bromobenzoic acid | 42237-85-4 | 25g |
| GX9435-5g | 3-Amino-6-chloropyridazine | 5469-69-2 | 5g |
| GK6824-1g | 3-Amino-9-ethylcarbazole | 132-32-1 | 1g |
| GK6824-5g | 3-Amino-9-ethylcarbazole | 132-32-1 | 5g |
| GK1994-5g | 3-Aminobenzonitrile | 2237-30-1 | 5g |
| GK1994-25g | 3-Aminobenzonitrile | 2237-30-1 | 25g |
| GK5470-25g | 3-Aminobenzotrifluoride | 98-16-8 | 25g |
| GK5470-100g | 3-Aminobenzotrifluoride | 98-16-8 | 100g |
| GW1262-250mg | 3-Aminoisobutyric acid [BAIBA] | 1214139-20-5 | 250mg |
| GW1262-1g | 3-Aminoisobutyric acid [BAIBA] | 1214139-20-5 | 1g |
| GE9420-25g | 3-Aminophenyl sulfone | 599-61-1 | 25g |
| GE9420-100g | 3-Aminophenyl sulfone | 599-61-1 | 100g |
| GE9420-500g | 3-Aminophenyl sulfone | 599-61-1 | 500g |
| GK3705-1g | 3-Aminophenylboronic acid | 30418-59-8 | 1g |
| GK3705-5g | 3-Aminophenylboronic acid | 30418-59-8 | 5g |
| GK6749-25g | 3-Aminopropyltriethoxysilane | 919-30-2 | 25g |
| GK6749-100g | 3-Aminopropyltriethoxysilane | 919-30-2 | 100g |
| GK5847-25g | 3-Aminopyrazole | 1820-80-0 | 25g |
| GK5847-100g | 3-Aminopyrazole | 1820-80-0 | 100g |
| GX2840-1g | 3-Aminopyridine-4-carboxylic acid | 7579-20-6 | 1g |
| GC4602-500mg | 3-Azido-3-deoxy-1,2-O-isopropylidene-α-D-allofuranose | 35085-25-7 | 500mg |
| GC4602-1g | 3-Azido-3-deoxy-1,2-O-isopropylidene-α-D-allofuranose | 35085-25-7 | 1g |
| GC4602-2g | 3-Azido-3-deoxy-1,2-O-isopropylidene-α-D-allofuranose | 35085-25-7 | 2g |
| GC4602-5g | 3-Azido-3-deoxy-1,2-O-isopropylidene-α-D-allofuranose | 35085-25-7 | 5g |
| GX3105-1g | 3-Azido-3-deoxy-1,2:5,6-di-O-isopropylidene-α-D-allofuranose | 21870-78-0 | 1g |
| GX3105-2g | 3-Azido-3-deoxy-1,2:5,6-di-O-isopropylidene-α-D-allofuranose | 21870-78-0 | 2g |
| GX3105-5g | 3-Azido-3-deoxy-1,2:5,6-di-O-isopropylidene-α-D-allofuranose | 21870-78-0 | 5g |
| GX3105-10g | 3-Azido-3-deoxy-1,2:5,6-di-O-isopropylidene-α-D-allofuranose | 21870-78-0 | 10g |
| GC2997-250mg | 3-Azido-3-deoxy-1,2:5,6-di-O-isopropylidene-α-D-glucofuranose | 13964-23-3 | 250mg |
| GC2997-500mg | 3-Azido-3-deoxy-1,2:5,6-di-O-isopropylidene-α-D-glucofuranose | 13964-23-3 | 500mg |
| GC2997-1g | 3-Azido-3-deoxy-1,2:5,6-di-O-isopropylidene-α-D-glucofuranose | 13964-23-3 | 1g |
| GC2997-2g | 3-Azido-3-deoxy-1,2:5,6-di-O-isopropylidene-α-D-glucofuranose | 13964-23-3 | 2g |
| GC3433-100mg | 3-Azido-3-deoxy-4-hydroxy-methyl-1,2-O-isopropylidene-a-D-ribofuranose | 247025-10-1 | 100mg |
| GC3433-250mg | 3-Azido-3-deoxy-4-hydroxy-methyl-1,2-O-isopropylidene-a-D-ribofuranose | 247025-10-1 | 250mg |
| GC3433-500mg | 3-Azido-3-deoxy-4-hydroxy-methyl-1,2-O-isopropylidene-a-D-ribofuranose | 247025-10-1 | 500mg |
| GC3433-1g | 3-Azido-3-deoxy-4-hydroxy-methyl-1,2-O-isopropylidene-a-D-ribofuranose | 247025-10-1 | 1g |
| GC9380-10mg | 3-Azido-3-deoxy-D-galactose | 2250404-17-0 | 10mg |
| GC9380-25mg | 3-Azido-3-deoxy-D-galactose | 2250404-17-0 | 25mg |
| GC9380-50mg | 3-Azido-3-deoxy-D-galactose | 2250404-17-0 | 50mg |
| GC9380-100mg | 3-Azido-3-deoxy-D-galactose | 2250404-17-0 | 100mg |
| GC3469-100mg | 3-Azido-3-deoxy-D-glucopyranose | 104875-44-7 | 100mg |
| GC3469-250mg | 3-Azido-3-deoxy-D-glucopyranose | 104875-44-7 | 250mg |
| GC3469-500mg | 3-Azido-3-deoxy-D-glucopyranose | 104875-44-7 | 500mg |
| GC3469-1g | 3-Azido-3-deoxy-D-glucopyranose | 104875-44-7 | 1g |
| GC3469-2g | 3-Azido-3-deoxy-D-glucopyranose | 104875-44-7 | 2g |
| GW5837-1g | 3-Bromo-1-butyne | 18668-72-9 | 1g |
| GW5837-5g | 3-Bromo-1-butyne | 18668-72-9 | 5g |
| GW5837-25g | 3-Bromo-1-butyne | 18668-72-9 | 25g |
| GK2668-5g | 3-Bromo-4-methoxybenzoic acid | 99-58-1 | 5g |
| GK5829-5g | 3-Bromo-o-xylene | 576-23-8 | 5g |
| GK5829-25g | 3-Bromo-o-xylene | 576-23-8 | 25g |
| GK0949-1g | 3-Bromopyruvic acid | 1113-59-3 | 1g |
| GK0949-5g | 3-Bromopyruvic acid | 1113-59-3 | 5g |
| GW2598-50g | 3-Butyn-2-ol | 2028-63-9 | 50g |
| GW2598-100g | 3-Butyn-2-ol | 2028-63-9 | 100g |
| GW0184-25mg | 3-Carboxy-6,8-difluoro-7-hydroxycoumarin N-succinimidyl ester | 215868-33-0 | 25mg |
| GW0184-100mg | 3-Carboxy-6,8-difluoro-7-hydroxycoumarin N-succinimidyl ester | 215868-33-0 | 100mg |
| GK9936-25g | 3-Chloro-4-fluoroaniline | 367-21-5 | 25g |
| GK9936-100g | 3-Chloro-4-fluoroaniline | 367-21-5 | 100g |
| GK9936-250g | 3-Chloro-4-fluoroaniline | 367-21-5 | 250g |
| GK9936-500g | 3-Chloro-4-fluoroaniline | 367-21-5 | 500g |
| GW8092-1g | 3-Chloro-4-methyl-7-hydroxycoumarin | 6174-86-3 | 1g |
| GW8092-5g | 3-Chloro-4-methyl-7-hydroxycoumarin | 6174-86-3 | 5g |
| GM4001-1g | 3-Chloro-L-tyrosine | 7423-93-0 | 1g |
| GM4001-5g | 3-Chloro-L-tyrosine | 7423-93-0 | 5g |
| GW7155-1mg | 3-cis-Hydroxyglibenclamide | 23074-02-4 | 1mg |
| GW7155-5mg | 3-cis-Hydroxyglibenclamide | 23074-02-4 | 5mg |
| GW9413-20mg | 3-Cyano-7-ethoxycoumarin | 117620-77-6 | 20mg |
| GW9413-100mg | 3-Cyano-7-ethoxycoumarin | 117620-77-6 | 100mg |
| GK9086-100mg | 3-Cyanoumbelliferone | 19088-73-4 | 100mg |
| GK9086-1g | 3-Cyanoumbelliferone | 19088-73-4 | 1g |
| GK9086-5g | 3-Cyanoumbelliferone | 19088-73-4 | 5g |
| GC9415-500mg | 3-Deoxy-1,2:4,5-di-O-isopropylidene-β-D-fructopyranose | 67104-35-2 | 500mg |
| GC9415-1g | 3-Deoxy-1,2:4,5-di-O-isopropylidene-β-D-fructopyranose | 67104-35-2 | 1g |
| GC9415-2g | 3-Deoxy-1,2:4,5-di-O-isopropylidene-β-D-fructopyranose | 67104-35-2 | 2g |
| GC9415-5g | 3-Deoxy-1,2:4,5-di-O-isopropylidene-β-D-fructopyranose | 67104-35-2 | 5g |
| GC5764-500mg | 3-Deoxy-1,2:5,6-di-O-isopropylidene-α-D-erythro-hex-3,4-enofuranose | 2774-28-9 | 500mg |
| GC5764-1g | 3-Deoxy-1,2:5,6-di-O-isopropylidene-α-D-erythro-hex-3,4-enofuranose | 2774-28-9 | 1g |
| GC5764-2g | 3-Deoxy-1,2:5,6-di-O-isopropylidene-α-D-erythro-hex-3,4-enofuranose | 2774-28-9 | 2g |
| GC5764-5g | 3-Deoxy-1,2:5,6-di-O-isopropylidene-α-D-erythro-hex-3,4-enofuranose | 2774-28-9 | 5g |
| GC3228-250mg | 3-Deoxy-1,2:5,6-di-O-isopropylidene-α-D-glucofuranose | 2774-29-0 | 250mg |
| GC3228-500mg | 3-Deoxy-1,2:5,6-di-O-isopropylidene-α-D-glucofuranose | 2774-29-0 | 500mg |
| GC3228-1g | 3-Deoxy-1,2:5,6-di-O-isopropylidene-α-D-glucofuranose | 2774-29-0 | 1g |
| GC3228-2g | 3-Deoxy-1,2:5,6-di-O-isopropylidene-α-D-glucofuranose | 2774-29-0 | 2g |
| GC7539-50mg | 3-Deoxy-2-C-(hydroxymethyl)-D-erythro-pentonic acid, calcium salt | 16835-77-1 | 50mg |
| GC7539-100mg | 3-Deoxy-2-C-(hydroxymethyl)-D-erythro-pentonic acid, calcium salt | 16835-77-1 | 100mg |
| GC7539-250mg | 3-Deoxy-2-C-(hydroxymethyl)-D-erythro-pentonic acid, calcium salt | 16835-77-1 | 250mg |
| GC7539-500mg | 3-Deoxy-2-C-(hydroxymethyl)-D-erythro-pentonic acid, calcium salt | 16835-77-1 | 500mg |
| GC9136-5mg | 3-Deoxy-2-C-(hydroxymethyl)-D-threo-pentonic acid, calcium salt | 5mg | |
| GC9136-10mg | 3-Deoxy-2-C-(hydroxymethyl)-D-threo-pentonic acid, calcium salt | 10mg | |
| GC9136-25mg | 3-Deoxy-2-C-(hydroxymethyl)-D-threo-pentonic acid, calcium salt | 25mg | |
| GC9136-50mg | 3-Deoxy-2-C-(hydroxymethyl)-D-threo-pentonic acid, calcium salt | 50mg | |
| GC6525-10mg | 3-Deoxy-3-fluoro-D-allose | 99605-33-1 | 10mg |
| GC6525-25mg | 3-Deoxy-3-fluoro-D-allose | 99605-33-1 | 25mg |
| GC6525-50mg | 3-Deoxy-3-fluoro-D-allose | 99605-33-1 | 50mg |
| GC6525-100mg | 3-Deoxy-3-fluoro-D-allose | 99605-33-1 | 100mg |
| GC0271-25mg | 3-Deoxy-3-fluoro-D-glucopyranose | 7226-70-2 | 25mg |
| GC0271-50mg | 3-Deoxy-3-fluoro-D-glucopyranose | 7226-70-2 | 50mg |
| GC0271-100mg | 3-Deoxy-3-fluoro-D-glucopyranose | 7226-70-2 | 100mg |
| GC0271-250mg | 3-Deoxy-3-fluoro-D-glucopyranose | 7226-70-2 | 250mg |
| GC8304-2mg | 3-Deoxy-3-fluoro-D-mannose | 87764-46-3 | 2mg |
| GC8304-5mg | 3-Deoxy-3-fluoro-D-mannose | 87764-46-3 | 5mg |
| GC8304-10mg | 3-Deoxy-3-fluoro-D-mannose | 87764-46-3 | 10mg |
| GC8304-25mg | 3-Deoxy-3-fluoro-D-mannose | 87764-46-3 | 25mg |
| GC8304-50mg | 3-Deoxy-3-fluoro-D-mannose | 87764-46-3 | 50mg |
| GC9690-100mg | 3-Deoxy-5,6-O-isopropylidene-D-arabino-hexonic acid, γ-lactone | 110995-49-8 | 100mg |
| GC9690-250mg | 3-Deoxy-5,6-O-isopropylidene-D-arabino-hexonic acid, γ-lactone | 110995-49-8 | 250mg |
| GC9690-500mg | 3-Deoxy-5,6-O-isopropylidene-D-arabino-hexonic acid, γ-lactone | 110995-49-8 | 500mg |
| GC9690-1g | 3-Deoxy-5,6-O-isopropylidene-D-arabino-hexonic acid, γ-lactone | 110995-49-8 | 1g |
| GC8404-5mg | 3-Deoxy-D-arabino-hexonic acid, calcium salt | 79580-64-6 | 5mg |
| GC8404-10mg | 3-Deoxy-D-arabino-hexonic acid, calcium salt | 79580-64-6 | 10mg |
| GC8404-25mg | 3-Deoxy-D-arabino-hexonic acid, calcium salt | 79580-64-6 | 25mg |
| GC8404-50mg | 3-Deoxy-D-arabino-hexonic acid, calcium salt | 79580-64-6 | 50mg |
| GC8404-100mg | 3-Deoxy-D-arabino-hexonic acid, calcium salt | 79580-64-6 | 100mg |
| GC6222-10mg | 3-Deoxy-D-fructose | 6196-57-2 | 10mg |
| GC6222-25mg | 3-Deoxy-D-fructose | 6196-57-2 | 25mg |
| GC6222-50mg | 3-Deoxy-D-fructose | 6196-57-2 | 50mg |
| GC6222-100mg | 3-Deoxy-D-fructose | 6196-57-2 | 100mg |
| GC4920-5mg | 3-Deoxy-D-ribo-hexonic acid, calcium salt | 96154-36-8 | 5mg |
| GC4920-10mg | 3-Deoxy-D-ribo-hexonic acid, calcium salt | 96154-36-8 | 10mg |
| GC4920-25mg | 3-Deoxy-D-ribo-hexonic acid, calcium salt | 96154-36-8 | 25mg |
| GC4920-50mg | 3-Deoxy-D-ribo-hexonic acid, calcium salt | 96154-36-8 | 50mg |
| GC2009-1mg | 3-Deoxy-D-ribo-hexonic acid, γ-lactone | 499-87-6 | 1mg |
| GC2009-2mg | 3-Deoxy-D-ribo-hexonic acid, γ-lactone | 499-87-6 | 2mg |
| GC2009-5mg | 3-Deoxy-D-ribo-hexonic acid, γ-lactone | 499-87-6 | 5mg |
| GC2009-10mg | 3-Deoxy-D-ribo-hexonic acid, γ-lactone | 499-87-6 | 10mg |
| GC2009-25mg | 3-Deoxy-D-ribo-hexonic acid, γ-lactone | 499-87-6 | 25mg |
| GC2330-5mg | 3-Deoxy-galactosone | 4134-97-8 | 5mg |
| GC2330-10mg | 3-Deoxy-galactosone | 4134-97-8 | 10mg |
| GC2330-25mg | 3-Deoxy-galactosone | 4134-97-8 | 25mg |
| GC2330-50mg | 3-Deoxy-galactosone | 4134-97-8 | 50mg |
| GL9152-250ug | 3-Deoxyaphidicolin | 85483-00-7 | 250ug |
| GL9152-1mg | 3-Deoxyaphidicolin | 85483-00-7 | 1mg |
| GC0945-1mg | 3-Deoxyglucosone | 4084-27-9 | 1mg |
| GC0945-5mg | 3-Deoxyglucosone | 4084-27-9 | 5mg |
| GC0945-10mg | 3-Deoxyglucosone | 4084-27-9 | 10mg |
| GC0945-25mg | 3-Deoxyglucosone | 4084-27-9 | 25mg |
| GC0945-50mg | 3-Deoxyglucosone | 4084-27-9 | 50mg |
| GK1051-25g | 3-Diethylaminophenol | 91-68-9 | 25g |
| GK0817-5g | 3-Dimethylaminobenzoic acid | 99-64-9 | 5g |
| GK8569-25g | 3-Fluorobenzaldehyde | 456-48-4 | 25g |
| GW6838-5g | 3-Fluorophthalic anhydride | 652-39-1 | 5g |
| GW6838-25g | 3-Fluorophthalic anhydride | 652-39-1 | 25g |
| GC7369-1mg | 3-Fucosyl-D-lactose | 41312-47-4 | 1mg |
| GC7369-5mg | 3-Fucosyl-D-lactose | 41312-47-4 | 5mg |
| GM2009-500mg | 3-Guanidinopropionic acid | 353-09-3 | 500mg |
| GM2009-1g | 3-Guanidinopropionic acid | 353-09-3 | 1g |
| GK1049-25g | 3-Hexanol | 623-37-0 | 25g |
| GK4205-1g | 3-Hydroxy-2,4,6-tribromobenzoic acid | 14348-40-4 | 1g |
| GK4205-5g | 3-Hydroxy-2,4,6-tribromobenzoic acid | 14348-40-4 | 5g |
| GK7523-100mg | 3-Hydroxy-3-methylglutaric acid | 503-49-1 | 100mg |
| GW3842-5mg | 3-Hydroxy-butanoyl-DL-homoserine lactone | 912545-51-8 | 5mg |
| GW3842-10mg | 3-Hydroxy-butanoyl-DL-homoserine lactone | 912545-51-8 | 10mg |
| GW7571-5mg | 3-Hydroxy-butanoyl-L-homoserine lactone | 1325550-06-8 | 5mg |
| GW7571-25mg | 3-Hydroxy-butanoyl-L-homoserine lactone | 1325550-06-8 | 25mg |
| GW3769-5mg | 3-Hydroxy-hexanoyl-DL-homoserine lactone | 161234-45-3 | 5mg |
| GW3769-25mg | 3-Hydroxy-hexanoyl-DL-homoserine lactone | 161234-45-3 | 25mg |
| GW6190-5mg | 3-Hydroxy-hexanoyl-L-homoserine lactone | 192883-16-2 | 5mg |
| GW6190-25mg | 3-Hydroxy-hexanoyl-L-homoserine lactone | 192883-16-2 | 25mg |
| GW9838-10mg | 3-Hydroxy-pentanoyl-DL-homoserine lactone | 148433-24-3 | 10mg |
| GW9838-50mg | 3-Hydroxy-pentanoyl-DL-homoserine lactone | 148433-24-3 | 50mg |
| GL8795-500g | 3-Hydroxybenzoic acid | 99-06-9 | 500g |
| GK2157-25mg | 3-Hydroxytyrosol | 10597-60-1 | 25mg |
| GK2157-100mg | 3-Hydroxytyrosol | 10597-60-1 | 100mg |
| GT2044-5g | 3-Indoleacetic acid | 87-51-4 | 5g |
| GT2044-25g | 3-Indoleacetic acid | 87-51-4 | 25g |
| GT2044-100g | 3-Indoleacetic acid | 87-51-4 | 100g |
| GC7681-1mg | 3-Indolyl β-D-cellotrioside | 1mg | |
| GC7681-2mg | 3-Indolyl β-D-cellotrioside | 2mg | |
| GC7681-5mg | 3-Indolyl β-D-cellotrioside | 5mg | |
| GC7681-10mg | 3-Indolyl β-D-cellotrioside | 10mg | |
| GK2261-1g | 3-Indoxyl acetate | 608-08-2 | 1g |
| GL2425-100mg | 3-Isobutyl-1-methylxanthine | 28822-58-4 | 100mg |
| GL2425-500mg | 3-Isobutyl-1-methylxanthine | 28822-58-4 | 500mg |
| GL2425-1g | 3-Isobutyl-1-methylxanthine | 28822-58-4 | 1g |
| GM5666-25g | 3-Mercaptopropionic acid | 107-96-0 | 25g |
| GK8188-100ml | 3-Methyl-1-butanol | 123-51-3 | 100ml |
| GK8188-500ml | 3-Methyl-1-butanol | 123-51-3 | 500ml |
| GK8188-1l | 3-Methyl-1-butanol | 123-51-3 | 1l |
| GL5578-1kg | 3-Methyl-2-buten-1-ol | 556-82-1 | 1kg |
| GL3599-25mg | 3-Methyladenine autophagy inhibitor | 5142-23-4 | 25mg |
| GL3599-100mg | 3-Methyladenine autophagy inhibitor | 5142-23-4 | 100mg |
| GL3599-250mg | 3-Methyladenine autophagy inhibitor | 5142-23-4 | 250mg |
| GS6015-100ml | 3-Methylbutan-1-ol, GlenBiol™, suitable for molecular biology | 123-51-3 | 100ml |
| GS6015-500ml | 3-Methylbutan-1-ol, GlenBiol™, suitable for molecular biology | 123-51-3 | 500ml |
| GW6110-1mg | 3-Morpholinobenzanthrone | 299927-47-2 | 1mg |
| GW6110-5mg | 3-Morpholinobenzanthrone | 299927-47-2 | 5mg |
| GK4946-10mg | 3-Morpholinosydnonimine hydrochloride | 16142-27-1 | 10mg |
| GK4946-50mg | 3-Morpholinosydnonimine hydrochloride | 16142-27-1 | 50mg |
| GK4162-25g | 3-Nitroaniline | 99-09-2 | 25g |
| GK2298-25g | 3-Nitrobenzaldehyde | 99-61-6 | 25g |
| GK0858-100g | 3-Nitrobenzyl alcohol | 619-25-0 | 100g |
| GK3336-5g | 3-Nitrobenzyl chloride | 619-23-8 | 5g |
| GC2835-100mg | 3-Nitrophenyl α-D-galactopyranoside | 52571-71-8 | 100mg |
| GC2835-250mg | 3-Nitrophenyl α-D-galactopyranoside | 52571-71-8 | 250mg |
| GC2835-500mg | 3-Nitrophenyl α-D-galactopyranoside | 52571-71-8 | 500mg |
| GC2835-1g | 3-Nitrophenyl α-D-galactopyranoside | 52571-71-8 | 1g |
| GK0653-10g | 3-Nitrophthalic anhydride | 641-70-3 | 10g |
| GK0653-25g | 3-Nitrophthalic anhydride | 641-70-3 | 25g |
| GK0653-100g | 3-Nitrophthalic anhydride | 641-70-3 | 100g |
| GT0573-5g | 3-Nitrophthalonitrile | 51762-67-5 | 5g |
| GT0573-10g | 3-Nitrophthalonitrile | 51762-67-5 | 10g |
| GT0573-25g | 3-Nitrophthalonitrile | 51762-67-5 | 25g |
| GC2377-1mg | 3-O-(2-Acetamido-2-deoxy-α-D-glucopyranosyl)-D-galactose | 97096-73-6 | 1mg |
| GC2377-2mg | 3-O-(2-Acetamido-2-deoxy-α-D-glucopyranosyl)-D-galactose | 97096-73-6 | 2mg |
| GC2377-5mg | 3-O-(2-Acetamido-2-deoxy-α-D-glucopyranosyl)-D-galactose | 97096-73-6 | 5mg |
| GC2377-10mg | 3-O-(2-Acetamido-2-deoxy-α-D-glucopyranosyl)-D-galactose | 97096-73-6 | 10mg |
| GC4506-1mg | 3-O-(2-Acetamido-2-deoxy-β-D-glucopyranosyl)-D-galactose | 67006-44-4 | 1mg |
| GC4506-2mg | 3-O-(2-Acetamido-2-deoxy-β-D-glucopyranosyl)-D-galactose | 67006-44-4 | 2mg |
| GC4506-5mg | 3-O-(2-Acetamido-2-deoxy-β-D-glucopyranosyl)-D-galactose | 67006-44-4 | 5mg |
| GC4506-10mg | 3-O-(2-Acetamido-2-deoxy-β-D-glucopyranosyl)-D-galactose | 67006-44-4 | 10mg |
| GC1801-1mg | 3-O-(Carboxymethyl)-D-glucose | 95350-39-3 | 1mg |
| GC1801-2mg | 3-O-(Carboxymethyl)-D-glucose | 95350-39-3 | 2mg |
| GC1801-5mg | 3-O-(Carboxymethyl)-D-glucose | 95350-39-3 | 5mg |
| GC1801-10mg | 3-O-(Carboxymethyl)-D-glucose | 95350-39-3 | 10mg |
| GC1801-25mg | 3-O-(Carboxymethyl)-D-glucose | 95350-39-3 | 25mg |
| GC2891-250mg | 3-O-Acetyl-1,2:5,6-di-O-isopropylidene-α-D-erythrohexofuranen-(3)-ose | 14686-88-5 | 250mg |
| GC2891-500mg | 3-O-Acetyl-1,2:5,6-di-O-isopropylidene-α-D-erythrohexofuranen-(3)-ose | 14686-88-5 | 500mg |
| GC2891-1g | 3-O-Acetyl-1,2:5,6-di-O-isopropylidene-α-D-erythrohexofuranen-(3)-ose | 14686-88-5 | 1g |
| GC2891-2g | 3-O-Acetyl-1,2:5,6-di-O-isopropylidene-α-D-erythrohexofuranen-(3)-ose | 14686-88-5 | 2g |
| GC0032-500mg | 3-O-Acetyl-1,2:5,6-di-O-isopropylidene-α-D-gulofuranose | 26775-14-4 | 500mg |
| GC0032-1g | 3-O-Acetyl-1,2:5,6-di-O-isopropylidene-α-D-gulofuranose | 26775-14-4 | 1g |
| GC0032-2g | 3-O-Acetyl-1,2:5,6-di-O-isopropylidene-α-D-gulofuranose | 26775-14-4 | 2g |
| GC0032-5g | 3-O-Acetyl-1,2:5,6-di-O-isopropylidene-α-D-gulofuranose | 26775-14-4 | 5g |
| GC0912-100mg | 3-O-Acetyl-1,6-anhydro-2-azido-2'',3''-di-O-benzyl-4'',6''-O-benzylidene-2-deoxy-β-D-cellobiose | 99541-23-8 | 100mg |
| GC0912-250mg | 3-O-Acetyl-1,6-anhydro-2-azido-2'',3''-di-O-benzyl-4'',6''-O-benzylidene-2-deoxy-β-D-cellobiose | 99541-23-8 | 250mg |
| GC0912-500mg | 3-O-Acetyl-1,6-anhydro-2-azido-2'',3''-di-O-benzyl-4'',6''-O-benzylidene-2-deoxy-β-D-cellobiose | 99541-23-8 | 500mg |
| GC0912-1g | 3-O-Acetyl-1,6-anhydro-2-azido-2'',3''-di-O-benzyl-4'',6''-O-benzylidene-2-deoxy-β-D-cellobiose | 99541-23-8 | 1g |
| GL3831-5mg | 3-O-Acetyl-11-keto-beta-boswellic acid | 67416-61-9 | 5mg |
| GC4442-5mg | 3-O-Acetyl-4-O-methyl-D-glucuronic acid | 5mg | |
| GC4442-10mg | 3-O-Acetyl-4-O-methyl-D-glucuronic acid | 10mg | |
| GC4442-25mg | 3-O-Acetyl-4-O-methyl-D-glucuronic acid | 25mg | |
| GC4442-50mg | 3-O-Acetyl-4-O-methyl-D-glucuronic acid | 50mg | |
| GC6375-10g | 3-O-Allyl-1,2:5,6-di-O-isopropylidene-α-D-glucofuranose | 20316-77-2 | 10g |
| GC6375-25g | 3-O-Allyl-1,2:5,6-di-O-isopropylidene-α-D-glucofuranose | 20316-77-2 | 25g |
| GC6375-50g | 3-O-Allyl-1,2:5,6-di-O-isopropylidene-α-D-glucofuranose | 20316-77-2 | 50g |
| GC6375-100g | 3-O-Allyl-1,2:5,6-di-O-isopropylidene-α-D-glucofuranose | 20316-77-2 | 100g |
| GC4003-5g | 3-O-Allyl-β-D-glucopyranose | 77388-91-1 | 5g |
| GC4003-10g | 3-O-Allyl-β-D-glucopyranose | 77388-91-1 | 10g |
| GC4003-25g | 3-O-Allyl-β-D-glucopyranose | 77388-91-1 | 25g |
| GC4003-50g | 3-O-Allyl-β-D-glucopyranose | 77388-91-1 | 50g |
| GC6797-1g | 3-O-Benzyl 4-C-(methanesulfonyloxymethyl)-5-O-methanesulfonyl-1,2-O-isopropylidene-a-D-ribofuranose | 293751-01-6 | 1g |
| GC0759-500mg | 3-O-Benzyl-1,2-O-isopropylidene-a-D-xylopentodialdo-1,4-furanose | 23558-05-6 | 500mg |
| GC0759-1g | 3-O-Benzyl-1,2-O-isopropylidene-a-D-xylopentodialdo-1,4-furanose | 23558-05-6 | 1g |
| GC0759-2g | 3-O-Benzyl-1,2-O-isopropylidene-a-D-xylopentodialdo-1,4-furanose | 23558-05-6 | 2g |
| GC0759-5g | 3-O-Benzyl-1,2-O-isopropylidene-a-D-xylopentodialdo-1,4-furanose | 23558-05-6 | 5g |
| GC5473-500mg | 3-O-Benzyl-1,2-O-isopropylidene-β-D-fructopyranose | 70551-32-5 | 500mg |
| GC5473-1g | 3-O-Benzyl-1,2-O-isopropylidene-β-D-fructopyranose | 70551-32-5 | 1g |
| GC5473-2g | 3-O-Benzyl-1,2-O-isopropylidene-β-D-fructopyranose | 70551-32-5 | 2g |
| GC5473-5g | 3-O-Benzyl-1,2-O-isopropylidene-β-D-fructopyranose | 70551-32-5 | 5g |
| GC5890-250mg | 3-O-Benzyl-1,2,4,6-tetra-O-acetyl-α-D-mannopyranose | 65827-58-9 | 250mg |
| GC5890-500mg | 3-O-Benzyl-1,2,4,6-tetra-O-acetyl-α-D-mannopyranose | 65827-58-9 | 500mg |
| GC5890-1g | 3-O-Benzyl-1,2,4,6-tetra-O-acetyl-α-D-mannopyranose | 65827-58-9 | 1g |
| GC5890-2g | 3-O-Benzyl-1,2,4,6-tetra-O-acetyl-α-D-mannopyranose | 65827-58-9 | 2g |
| GC7108-10g | 3-O-Benzyl-1,2:5,6-di-O-isopropylidene-a-D-allofuranose | 22331-21-1 | 10g |
| GC7108-25g | 3-O-Benzyl-1,2:5,6-di-O-isopropylidene-a-D-allofuranose | 22331-21-1 | 25g |
| GC7108-50g | 3-O-Benzyl-1,2:5,6-di-O-isopropylidene-a-D-allofuranose | 22331-21-1 | 50g |
| GC7108-100g | 3-O-Benzyl-1,2:5,6-di-O-isopropylidene-a-D-allofuranose | 22331-21-1 | 100g |
| GC2593-5g | 3-O-Benzyl-1,2:5,6-Di-O-isopropylidene-α-D-glucofuranose | 18685-18-2 | 5g |
| GC2593-10g | 3-O-Benzyl-1,2:5,6-Di-O-isopropylidene-α-D-glucofuranose | 18685-18-2 | 10g |
| GC2593-25g | 3-O-Benzyl-1,2:5,6-Di-O-isopropylidene-α-D-glucofuranose | 18685-18-2 | 25g |
| GC2593-50g | 3-O-Benzyl-1,2:5,6-Di-O-isopropylidene-α-D-glucofuranose | 18685-18-2 | 50g |
| GC0720-1g | 3-O-Benzyl-D-glucopyranose | 10230-17-8 | 1g |
| GC0720-2g | 3-O-Benzyl-D-glucopyranose | 10230-17-8 | 2g |
| GC0720-5g | 3-O-Benzyl-D-glucopyranose | 10230-17-8 | 5g |
| GC0720-10g | 3-O-Benzyl-D-glucopyranose | 10230-17-8 | 10g |
| GL8113-1mg | 3-O-Caffeoyl-betulin | 89130-86-9 | 1mg |
| GL8113-5mg | 3-O-Caffeoyl-betulin | 89130-86-9 | 5mg |
| GX7688-10mg | 3-O-Methylfluorescein | 65144-30-1 | 10mg |
| GX7688-25mg | 3-O-Methylfluorescein | 65144-30-1 | 25mg |
| GC5713-1mg | 3-O-α-L-Fucopyranosyl-D-galactose | 24667-49-0 | 1mg |
| GC5713-2mg | 3-O-α-L-Fucopyranosyl-D-galactose | 24667-49-0 | 2mg |
| GC5713-5mg | 3-O-α-L-Fucopyranosyl-D-galactose | 24667-49-0 | 5mg |
| GC0399-1mg | 3-O-α-L-Fucopyranosyl-D-glucose | 56822-52-7 | 1mg |
| GC0399-2mg | 3-O-α-L-Fucopyranosyl-D-glucose | 56822-52-7 | 2mg |
| GC0399-5mg | 3-O-α-L-Fucopyranosyl-D-glucose | 56822-52-7 | 5mg |
| GC0399-10mg | 3-O-α-L-Fucopyranosyl-D-glucose | 56822-52-7 | 10mg |
| GC7159-1mg | 3-O-β-D-Galactopyranosyl-D-galactose | 1mg | |
| GC7159-2mg | 3-O-β-D-Galactopyranosyl-D-galactose | 2mg | |
| GC7159-5mg | 3-O-β-D-Galactopyranosyl-D-galactose | 5mg | |
| GC7159-10mg | 3-O-β-D-Galactopyranosyl-D-galactose | 10mg | |
| GC2827-1mg | 3-O-β-D-Glucopyranuronosyl-D-xylose | 475598-94-8 | 1mg |
| GC2827-2mg | 3-O-β-D-Glucopyranuronosyl-D-xylose | 475598-94-8 | 2mg |
| GC2827-5mg | 3-O-β-D-Glucopyranuronosyl-D-xylose | 475598-94-8 | 5mg |
| GC2827-10mg | 3-O-β-D-Glucopyranuronosyl-D-xylose | 475598-94-8 | 10mg |
| GC1110-1mg | 3-O-β-D-Xylopyranosyl-D-glucuronic acid | 1mg | |
| GC1110-2mg | 3-O-β-D-Xylopyranosyl-D-glucuronic acid | 2mg | |
| GC1110-5mg | 3-O-β-D-Xylopyranosyl-D-glucuronic acid | 5mg | |
| GC1110-10mg | 3-O-β-D-Xylopyranosyl-D-glucuronic acid | 10mg | |
| GC1110-25mg | 3-O-β-D-Xylopyranosyl-D-glucuronic acid | 25mg | |
| GW5237-25mg | 3-Oxo-dodecan-(2-aminocyclohexanone) | 596104-55-1 | 25mg |
| GX4577-100ml | 3-Pentanone | 96-22-0 | 100ml |
| GK9047-5mg | 3-Phenanthrol | 605-87-8 | 5mg |
| GW4341-1g | 3-Phenyl-2-propynenitrile | 935-02-4 | 1g |
| GW4341-5g | 3-Phenyl-2-propynenitrile | 935-02-4 | 5g |
| GE2115-1g | 3-Phenylazo-2,6-diaminopyridine hydrochloride | 136-40-3 | 1g |
| GK0782-5g | 3-Quinuclidone hydrochloride | 1193-65-3 | 5g |
| GK0782-25g | 3-Quinuclidone hydrochloride | 1193-65-3 | 25g |
| GK0782-100g | 3-Quinuclidone hydrochloride | 1193-65-3 | 100g |
| GK2226-1g | 3-Trifluoromethylpyridine | 3796-23-4 | 1g |
| GK2226-5g | 3-Trifluoromethylpyridine | 3796-23-4 | 5g |
| GL3346-1mg | 3,28-Di-O-(3,3-dimethylglutaryl)betulin | 1mg | |
| GL3346-5mg | 3,28-Di-O-(3,3-dimethylglutaryl)betulin | 5mg | |
| GW9541-1g | 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-1-octanethiol | 34451-26-8 | 1g |
| GW9541-5g | 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-1-octanethiol | 34451-26-8 | 5g |
| GK6069-1g | 3,3''-[Oxybis(methylene)]bis(3-ethyloxetane) | 18934-00-4 | 1g |
| GE0505-5g | 3,3''-Diaminobenzidine | 91-95-2 | 5g |
| GE0505-25g | 3,3''-Diaminobenzidine | 91-95-2 | 25g |
| GE4032-1g | 3,3''-Diaminobenzidine tetrahydrochloride hydrate | 868272-85-9 | 1g |
| GE4032-5g | 3,3''-Diaminobenzidine tetrahydrochloride hydrate | 868272-85-9 | 5g |
| GE4032-25g | 3,3''-Diaminobenzidine tetrahydrochloride hydrate | 868272-85-9 | 25g |
| GW3021-250mg | 3,3''-Diethylthiacarbocyanine iodide | 905-97-5 | 250mg |
| GW3021-1g | 3,3''-Diethylthiacarbocyanine iodide | 905-97-5 | 1g |
| GW9950-250mg | 3,3''-Dipropylthiacarbocyanine iodide | 53336-12-2 | 250mg |
| GW9950-500mg | 3,3''-Dipropylthiacarbocyanine iodide | 53336-12-2 | 500mg |
| GW2803-100mg | 3,3''-Dipropylthiadicarbocyanine iodide | 53213-94-8 | 100mg |
| GW2803-1g | 3,3''-Dipropylthiadicarbocyanine iodide | 53213-94-8 | 1g |
| GE2741-100mg | 3,3'',5-Triiodo-L-thyronine | 6893-02-3 | 100mg |
| GE2741-1g | 3,3'',5-Triiodo-L-thyronine | 6893-02-3 | 1g |
| GE6369-100mg | 3,3'',5-Triiodo-L-thyronine sodium salt | 55-06-1 | 100mg |
| GE6369-250mg | 3,3'',5-Triiodo-L-thyronine sodium salt | 55-06-1 | 250mg |
| GE6369-500mg | 3,3'',5-Triiodo-L-thyronine sodium salt | 55-06-1 | 500mg |
| GE8825-1g | 3,3'',5,5''-Tetramethylbenzidine | 54827-17-7 | 1g |
| GE8825-5g | 3,3'',5,5''-Tetramethylbenzidine | 54827-17-7 | 5g |
| GE8825-25g | 3,3'',5,5''-Tetramethylbenzidine | 54827-17-7 | 25g |
| GX7677-100ml | 3,3'',5,5''-Tetramethylbenzidine (TMB) Liquid Substrate, for ELISA | - | 100ml |
| GE6063-1g | 3,3'',5,5''-Tetramethylbenzidine dihydrochloride hydrate | 64285-73-0 | 1g |
| GE6063-5g | 3,3'',5,5''-Tetramethylbenzidine dihydrochloride hydrate | 64285-73-0 | 5g |
| GC8123-250mg | 3,4-Di-O-acetyl-1,6-anhydro-2-azido-2-deoxy-β-D-glucopyranose | 119005-80-0 | 250mg |
| GC8123-500mg | 3,4-Di-O-acetyl-1,6-anhydro-2-azido-2-deoxy-β-D-glucopyranose | 119005-80-0 | 500mg |
| GC8123-1g | 3,4-Di-O-acetyl-1,6-anhydro-2-azido-2-deoxy-β-D-glucopyranose | 119005-80-0 | 1g |
| GC8123-2g | 3,4-Di-O-acetyl-1,6-anhydro-2-azido-2-deoxy-β-D-glucopyranose | 119005-80-0 | 2g |
| GC6663-100mg | 3,4-Di-O-acetyl-1,6-anhydro-2-deoxy-2-fluoro-β-D-glucopyranose | 23236-00-2 | 100mg |
| GC6663-250mg | 3,4-Di-O-acetyl-1,6-anhydro-2-deoxy-2-fluoro-β-D-glucopyranose | 23236-00-2 | 250mg |
| GC6663-500mg | 3,4-Di-O-acetyl-1,6-anhydro-2-deoxy-2-fluoro-β-D-glucopyranose | 23236-00-2 | 500mg |
| GC6663-1g | 3,4-Di-O-acetyl-1,6-anhydro-2-deoxy-2-fluoro-β-D-glucopyranose | 23236-00-2 | 1g |
| GC3547-500mg | 3,4-Di-O-acetyl-1,6-anhydro-2-deoxy-2-iodo-β-D-glucopyranose | 136573-62-1 | 500mg |
| GC3547-1g | 3,4-Di-O-acetyl-1,6-anhydro-2-deoxy-2-iodo-β-D-glucopyranose | 136573-62-1 | 1g |
| GC3547-2g | 3,4-Di-O-acetyl-1,6-anhydro-2-deoxy-2-iodo-β-D-glucopyranose | 136573-62-1 | 2g |
| GC2610-50mg | 3,4-Di-O-acetyl-2-azido-2-deoxy-D-glucopyranose | 50mg | |
| GC2610-100mg | 3,4-Di-O-acetyl-2-azido-2-deoxy-D-glucopyranose | 100mg | |
| GC2610-250mg | 3,4-Di-O-acetyl-2-azido-2-deoxy-D-glucopyranose | 250mg | |
| GC2610-500mg | 3,4-Di-O-acetyl-2-azido-2-deoxy-D-glucopyranose | 500mg | |
| GC7937-10mg | 3,4-Di-O-acetyl-2-deoxy-2-fluoro-L-fucopyranose | 249566-79-8 | 10mg |
| GC7937-25mg | 3,4-Di-O-acetyl-2-deoxy-2-fluoro-L-fucopyranose | 249566-79-8 | 25mg |
| GC7937-50mg | 3,4-Di-O-acetyl-2-deoxy-2-fluoro-L-fucopyranose | 249566-79-8 | 50mg |
| GC7937-100mg | 3,4-Di-O-acetyl-2-deoxy-2-fluoro-L-fucopyranose | 249566-79-8 | 100mg |
| GC6112-500mg | 3,4-Di-O-acetyl-D-xylal | 3152-43-0 | 500mg |
| GC6112-1g | 3,4-Di-O-acetyl-D-xylal | 3152-43-0 | 1g |
| GC6112-2g | 3,4-Di-O-acetyl-D-xylal | 3152-43-0 | 2g |
| GC6112-5g | 3,4-Di-O-acetyl-D-xylal | 3152-43-0 | 5g |
| GC9295-500mg | 3,4-Di-O-acetyl-L-fucal | 54621-94-2 | 500mg |
| GC9295-1g | 3,4-Di-O-acetyl-L-fucal | 54621-94-2 | 1g |
| GC9295-2g | 3,4-Di-O-acetyl-L-fucal | 54621-94-2 | 2g |
| GC9295-5g | 3,4-Di-O-acetyl-L-fucal | 54621-94-2 | 5g |
| GY6814-5mg | 3,4-Dicaffeoylquinic acid | 14534-61-3 | 5mg |
| GC1951-1mg | 3,4-Dideoxyglucosone-3-ene | 252006-38-5 | 1mg |
| GC1951-2mg | 3,4-Dideoxyglucosone-3-ene | 252006-38-5 | 2mg |
| GC1951-5mg | 3,4-Dideoxyglucosone-3-ene | 252006-38-5 | 5mg |
| GC1951-10mg | 3,4-Dideoxyglucosone-3-ene | 252006-38-5 | 10mg |
| GP5740-5g | 3,4-Difluorobenzaldehyde | 34036-07-2 | 5g |
| GL1038-1g | 3,4-Dihydroxy-DL-phenylalanine | 63-84-3 | 1g |
| GM9724-5g | 3,4-Dihydroxy-L-phenylalanine | 59-92-7 | 5g |
| GM9724-25g | 3,4-Dihydroxy-L-phenylalanine | 59-92-7 | 25g |
| GM9724-100g | 3,4-Dihydroxy-L-phenylalanine | 59-92-7 | 100g |
| GK7288-10g | 3,4-Dihydroxybenzoic acid | 99-50-3 | 10g |
| GK7288-100g | 3,4-Dihydroxybenzoic acid | 99-50-3 | 100g |
| GK5224-1g | 3,4-Dihydroxyphenylacetic acid | 102-32-9 | 1g |
| GK5224-5g | 3,4-Dihydroxyphenylacetic acid | 102-32-9 | 5g |
| GK5000-25g | 3,4-Dimethoxybenzoic acid | 93-07-2 | 25g |
| GK5000-100g | 3,4-Dimethoxybenzoic acid | 93-07-2 | 100g |
| GK4901-25g | 3,4-Dimethoxybenzonitrile | 2024-83-1 | 25g |
| GW3024-10mg | 3,4-Dimethoxychalcone | 5416-71-7 | 10mg |
| GW3024-50mg | 3,4-Dimethoxychalcone | 5416-71-7 | 50mg |
| GW3024-250mg | 3,4-Dimethoxychalcone | 5416-71-7 | 250mg |
| GK7280-5g | 3,4-Dimethylbenzaldehyde | 5973-71-7 | 5g |
| GK7280-10g | 3,4-Dimethylbenzaldehyde | 5973-71-7 | 10g |
| GK7280-25g | 3,4-Dimethylbenzaldehyde | 5973-71-7 | 25g |
| GW5808-1g | 3,4-Epoxycyclohex-1-en | 6705-51-7 | 1g |
| GW5808-5g | 3,4-Epoxycyclohex-1-en | 6705-51-7 | 5g |
| GC4495-500mg | 3,4-O-[(1R,2R)-1,2-Dimethoxy-1,2-dimethyl-1,2-ethanediyl]-1,6-O-[(1S,2S)-1,2-dimethoxy-1,2-dimethyl-1,2-ethanediyl]-D-myo-inositol | 176798-27-9 | 500mg |
| GC4495-1g | 3,4-O-[(1R,2R)-1,2-Dimethoxy-1,2-dimethyl-1,2-ethanediyl]-1,6-O-[(1S,2S)-1,2-dimethoxy-1,2-dimethyl-1,2-ethanediyl]-D-myo-inositol | 176798-27-9 | 1g |
| GC4495-2g | 3,4-O-[(1R,2R)-1,2-Dimethoxy-1,2-dimethyl-1,2-ethanediyl]-1,6-O-[(1S,2S)-1,2-dimethoxy-1,2-dimethyl-1,2-ethanediyl]-D-myo-inositol | 176798-27-9 | 2g |
| GC4495-5g | 3,4-O-[(1R,2R)-1,2-Dimethoxy-1,2-dimethyl-1,2-ethanediyl]-1,6-O-[(1S,2S)-1,2-dimethoxy-1,2-dimethyl-1,2-ethanediyl]-D-myo-inositol | 176798-27-9 | 5g |
| GC5144-1g | 3,4-O-Isopropylidene-D-arabinonic acid δ-lactone | 84772-89-4 | 1g |
| GC5144-2g | 3,4-O-Isopropylidene-D-arabinonic acid δ-lactone | 84772-89-4 | 2g |
| GC5144-5g | 3,4-O-Isopropylidene-D-arabinonic acid δ-lactone | 84772-89-4 | 5g |
| GC5144-10g | 3,4-O-Isopropylidene-D-arabinonic acid δ-lactone | 84772-89-4 | 10g |
| GK0381-1g | 3,4,5-Trihydroxybenzaldehyde | 13677-79-7 | 1g |
| GW5520-500mg | 3,4,5,6-Tetramethylpyridazin | 22868-72-0 | 500mg |
| GW5520-2500mg | 3,4,5,6-Tetramethylpyridazin | 22868-72-0 | 2500mg |
| GC3915-1g | 3,4,6-Tri-O-acetyl-1,2-O-(1-alloxyethylidene)-β-D-mannopyranose | 136944-74-6 | 1g |
| GC3915-2g | 3,4,6-Tri-O-acetyl-1,2-O-(1-alloxyethylidene)-β-D-mannopyranose | 136944-74-6 | 2g |
| GC3915-5g | 3,4,6-Tri-O-acetyl-1,2-O-(1-alloxyethylidene)-β-D-mannopyranose | 136944-74-6 | 5g |
| GC3915-10g | 3,4,6-Tri-O-acetyl-1,2-O-(1-alloxyethylidene)-β-D-mannopyranose | 136944-74-6 | 10g |
| GC7073-1g | 3,4,6-Tri-O-acetyl-1,2-O-ethoxyethylidene-b-D-mannopyranose | 28140-37-6 | 1g |
| GC7073-2g | 3,4,6-Tri-O-acetyl-1,2-O-ethoxyethylidene-b-D-mannopyranose | 28140-37-6 | 2g |
| GC7073-5g | 3,4,6-Tri-O-acetyl-1,2-O-ethoxyethylidene-b-D-mannopyranose | 28140-37-6 | 5g |
| GC7073-10g | 3,4,6-Tri-O-acetyl-1,2-O-ethoxyethylidene-b-D-mannopyranose | 28140-37-6 | 10g |
| GC7073-25g | 3,4,6-Tri-O-acetyl-1,2-O-ethoxyethylidene-b-D-mannopyranose | 28140-37-6 | 25g |
| GC7266-500mg | 3,4,6-Tri-O-acetyl-1,2-O-isopropylidene-β-D-fructofuranose | 76512-89-5 | 500mg |
| GC7266-1g | 3,4,6-Tri-O-acetyl-1,2-O-isopropylidene-β-D-fructofuranose | 76512-89-5 | 1g |
| GC7266-2g | 3,4,6-Tri-O-acetyl-1,2-O-isopropylidene-β-D-fructofuranose | 76512-89-5 | 2g |
| GC7266-5g | 3,4,6-Tri-O-acetyl-1,2-O-isopropylidene-β-D-fructofuranose | 76512-89-5 | 5g |
| GC7811-250mg | 3,4,6-Tri-O-acetyl-2-azido-2-deoxy-D-glucopyranosyl trichloroacetimidate | 145840-43-3 | 250mg |
| GC7811-500mg | 3,4,6-Tri-O-acetyl-2-azido-2-deoxy-D-glucopyranosyl trichloroacetimidate | 145840-43-3 | 500mg |
| GC7811-1g | 3,4,6-Tri-O-acetyl-2-azido-2-deoxy-D-glucopyranosyl trichloroacetimidate | 145840-43-3 | 1g |
| GC7811-2g | 3,4,6-Tri-O-acetyl-2-azido-2-deoxy-D-glucopyranosyl trichloroacetimidate | 145840-43-3 | 2g |
| GC7860-100mg | 3,4,6-Tri-O-acetyl-2-azido-2-deoxy-β-D-glucopyranosyl trichloroacetimidate | 94715-57-8 | 100mg |
| GC7860-250mg | 3,4,6-Tri-O-acetyl-2-azido-2-deoxy-β-D-glucopyranosyl trichloroacetimidate | 94715-57-8 | 250mg |
| GC7860-500mg | 3,4,6-Tri-O-acetyl-2-azido-2-deoxy-β-D-glucopyranosyl trichloroacetimidate | 94715-57-8 | 500mg |
| GC7860-1g | 3,4,6-Tri-O-acetyl-2-azido-2-deoxy-β-D-glucopyranosyl trichloroacetimidate | 94715-57-8 | 1g |
| GC7798-50mg | 3,4,6-Tri-O-acetyl-2-deoxy-2-fluoro-β-D-glucopyranosyl azide | 249566-73-2 | 50mg |
| GC7798-100mg | 3,4,6-Tri-O-acetyl-2-deoxy-2-fluoro-β-D-glucopyranosyl azide | 249566-73-2 | 100mg |
| GC7798-250mg | 3,4,6-Tri-O-acetyl-2-deoxy-2-fluoro-β-D-glucopyranosyl azide | 249566-73-2 | 250mg |
| GC7798-500mg | 3,4,6-Tri-O-acetyl-2-deoxy-2-fluoro-β-D-glucopyranosyl azide | 249566-73-2 | 500mg |
| GC5681-100mg | 3,4,6-Tri-O-acetyl-2-deoxy-2-fluoro-β-D-glucopyranosyl fluoride | 29069-93-0 | 100mg |
| GC5681-250mg | 3,4,6-Tri-O-acetyl-2-deoxy-2-fluoro-β-D-glucopyranosyl fluoride | 29069-93-0 | 250mg |
| GC5681-500mg | 3,4,6-Tri-O-acetyl-2-deoxy-2-fluoro-β-D-glucopyranosyl fluoride | 29069-93-0 | 500mg |
| GC5681-1g | 3,4,6-Tri-O-acetyl-2-deoxy-2-fluoro-β-D-glucopyranosyl fluoride | 29069-93-0 | 1g |
| GC1208-500mg | 3,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-D-glucopyranose | 87190-66-7 | 500mg |
| GC1208-1g | 3,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-D-glucopyranose | 87190-66-7 | 1g |
| GC1208-2g | 3,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-D-glucopyranose | 87190-66-7 | 2g |
| GC1208-5g | 3,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-D-glucopyranose | 87190-66-7 | 5g |
| GC1854-500mg | 3,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-β-D-glucopyranose | 72858-55-0 | 500mg |
| GC1854-1g | 3,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-β-D-glucopyranose | 72858-55-0 | 1g |
| GC1854-2g | 3,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-β-D-glucopyranose | 72858-55-0 | 2g |
| GC1854-5g | 3,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-β-D-glucopyranose | 72858-55-0 | 5g |
| GC6922-100mg | 3,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-β-D-glucopyranosyl trichloroacetimidate | 87190-67-8 | 100mg |
| GC6922-250mg | 3,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-β-D-glucopyranosyl trichloroacetimidate | 87190-67-8 | 250mg |
| GC6922-500mg | 3,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-β-D-glucopyranosyl trichloroacetimidate | 87190-67-8 | 500mg |
| GC6922-1g | 3,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-β-D-glucopyranosyl trichloroacetimidate | 87190-67-8 | 1g |
| GC6922-2g | 3,4,6-Tri-O-acetyl-2-deoxy-2-phthalimido-β-D-glucopyranosyl trichloroacetimidate | 87190-67-8 | 2g |
| GC7986-100mg | 3,4,6-Tri-O-acetyl-2-deoxy-D-glucopyranose | 69503-94-2 | 100mg |
| GC1068-5mg | 3,4,6-Tri-O-acetyl-2-O-trifluoromethanesulfonyl-β-D-mannopyranosyl azide | 1159265-99-2 | 5mg |
| GC1068-10mg | 3,4,6-Tri-O-acetyl-2-O-trifluoromethanesulfonyl-β-D-mannopyranosyl azide | 1159265-99-2 | 10mg |
| GC1068-25mg | 3,4,6-Tri-O-acetyl-2-O-trifluoromethanesulfonyl-β-D-mannopyranosyl azide | 1159265-99-2 | 25mg |
| GC1068-50mg | 3,4,6-Tri-O-acetyl-2-O-trifluoromethanesulfonyl-β-D-mannopyranosyl azide | 1159265-99-2 | 50mg |
| GC6886-10g | 3,4,6-Tri-O-acetyl-D-galactal | 4098-06-0 | 10g |
| GC6886-25g | 3,4,6-Tri-O-acetyl-D-galactal | 4098-06-0 | 25g |
| GC6886-50g | 3,4,6-Tri-O-acetyl-D-galactal | 4098-06-0 | 50g |
| GC6886-100g | 3,4,6-Tri-O-acetyl-D-galactal | 4098-06-0 | 100g |
| GC8639-1g | 3,4,6-Tri-O-acetyl-β-D-mannopyranose 1,2-(methyl orthoacetate) | 4435-05-6 | 1g |
| GC8639-2g | 3,4,6-Tri-O-acetyl-β-D-mannopyranose 1,2-(methyl orthoacetate) | 4435-05-6 | 2g |
| GC8639-5g | 3,4,6-Tri-O-acetyl-β-D-mannopyranose 1,2-(methyl orthoacetate) | 4435-05-6 | 5g |
| GC8639-10g | 3,4,6-Tri-O-acetyl-β-D-mannopyranose 1,2-(methyl orthoacetate) | 4435-05-6 | 10g |
| GC5169-500mg | 3,4,6-Tri-O-benzyl-b-D-mannopyranose 1,2-(methyl orthoacetate) | 16697-49-7 | 500mg |
| GC5169-1g | 3,4,6-Tri-O-benzyl-b-D-mannopyranose 1,2-(methyl orthoacetate) | 16697-49-7 | 1g |
| GC5169-2g | 3,4,6-Tri-O-benzyl-b-D-mannopyranose 1,2-(methyl orthoacetate) | 16697-49-7 | 2g |
| GC5169-5g | 3,4,6-Tri-O-benzyl-b-D-mannopyranose 1,2-(methyl orthoacetate) | 16697-49-7 | 5g |
| GC5169-10g | 3,4,6-Tri-O-benzyl-b-D-mannopyranose 1,2-(methyl orthoacetate) | 16697-49-7 | 10g |
| GC2644-500mg | 3,4,6-Tri-O-tert-butyldimethylsilyl-1,2-O-isopropylidene-β-D-fructofuranose | 500mg | |
| GC2644-1g | 3,4,6-Tri-O-tert-butyldimethylsilyl-1,2-O-isopropylidene-β-D-fructofuranose | 1g | |
| GC2644-2g | 3,4,6-Tri-O-tert-butyldimethylsilyl-1,2-O-isopropylidene-β-D-fructofuranose | 2g | |
| GC2644-5g | 3,4,6-Tri-O-tert-butyldimethylsilyl-1,2-O-isopropylidene-β-D-fructofuranose | 5g | |
| GC5145-1g | 3,4:5,6-Di-O-isopropylidene-D-glucitol | 58846-25-6 | 1g |
| GC5145-2g | 3,4:5,6-Di-O-isopropylidene-D-glucitol | 58846-25-6 | 2g |
| GC5145-5g | 3,4:5,6-Di-O-isopropylidene-D-glucitol | 58846-25-6 | 5g |
| GC5145-10g | 3,4:5,6-Di-O-isopropylidene-D-glucitol | 58846-25-6 | 10g |
| GC3320-1g | 3,4'',5-Trihydroxystilbene-3-b-D-glucopyranoside | 65914-17-2 | 1g |
| GC1075-100mg | 3,5-Di-O-benzoyl-1,2-O-isopropylidene-α-D-ribofuranose | 80244-95-7 | 100mg |
| GC1075-250mg | 3,5-Di-O-benzoyl-1,2-O-isopropylidene-α-D-ribofuranose | 80244-95-7 | 250mg |
| GC1075-500mg | 3,5-Di-O-benzoyl-1,2-O-isopropylidene-α-D-ribofuranose | 80244-95-7 | 500mg |
| GC1075-1g | 3,5-Di-O-benzoyl-1,2-O-isopropylidene-α-D-ribofuranose | 80244-95-7 | 1g |
| GC4112-500mg | 3,5-Di-O-benzoyl-2-deoxy-2-fluoro-α-D-arabinofuranosyl bromide | 97614-44-3 | 500mg |
| GC4112-1g | 3,5-Di-O-benzoyl-2-deoxy-2-fluoro-α-D-arabinofuranosyl bromide | 97614-44-3 | 1g |
| GC4112-2g | 3,5-Di-O-benzoyl-2-deoxy-2-fluoro-α-D-arabinofuranosyl bromide | 97614-44-3 | 2g |
| GC4112-5g | 3,5-Di-O-benzoyl-2-deoxy-2-fluoro-α-D-arabinofuranosyl bromide | 97614-44-3 | 5g |
| GW3782-1g | 3,5-Di-tert-butylbenzaldehyde | 17610-00-3 | 1g |
| GW3782-5g | 3,5-Di-tert-butylbenzaldehyde | 17610-00-3 | 5g |
| GL2424-5mg | 3,5-Dicaffeoylquinic acid | 2450-53-5 | 5mg |
| GK1672-5g | 3,5-Dichloro-2-hydroxybenzenesulfonic acid sodium salt | 54970-72-8 | 5g |
| GK1672-10g | 3,5-Dichloro-2-hydroxybenzenesulfonic acid sodium salt | 54970-72-8 | 10g |
| GK1672-25g | 3,5-Dichloro-2-hydroxybenzenesulfonic acid sodium salt | 54970-72-8 | 25g |
| GW7251-250mg | 3,5-Difluoro-2,4-dihydroxybenzaldehyde | 209541-27-5 | 250mg |
| GW7251-1g | 3,5-Difluoro-2,4-dihydroxybenzaldehyde | 209541-27-5 | 1g |
| GM6754-1g | 3,5-Diiodo-L-thyronine | 1041-01-6 | 1g |
| GK9835-10g | 3,5-Diiodo-L-tyrosine dihydrate | 300-39-0 | 10g |
| GM1454-5g | 3,5-Diiodo-L-tyrosine hydrate | 18835-59-1 | 5g |
| GK8169-5g | 3,5-Dimethoxybenzaldehyde | 7311-34-4 | 5g |
| GK8169-25g | 3,5-Dimethoxybenzaldehyde | 7311-34-4 | 25g |
| GK1802-1g | 3,5-Dimethoxyphenylacetic acid | 4670-10-4 | 1g |
| GK1802-5g | 3,5-Dimethoxyphenylacetic acid | 4670-10-4 | 5g |
| GW8849-10mg | 3,5-Dimethyl-NAPQI | 74827-85-3 | 10mg |
| GW8849-25mg | 3,5-Dimethyl-NAPQI | 74827-85-3 | 25mg |
| GK2398-100g | 3,5-Dimethylpyrazole | 67-51-6 | 100g |
| GK2398-500g | 3,5-Dimethylpyrazole | 67-51-6 | 500g |
| GT6720-25g | 3,5-Dinitrosalicylic acid | 609-99-4 | 25g |
| GT6720-100g | 3,5-Dinitrosalicylic acid | 609-99-4 | 100g |
| GC9650-100mg | 3,5-O-Benzylidene-1,2-O-isopropylidene-6-O-propargyl-α-D-glucofuranose | 100mg | |
| GC9650-250mg | 3,5-O-Benzylidene-1,2-O-isopropylidene-6-O-propargyl-α-D-glucofuranose | 250mg | |
| GC9650-500mg | 3,5-O-Benzylidene-1,2-O-isopropylidene-6-O-propargyl-α-D-glucofuranose | 500mg | |
| GC9650-1g | 3,5-O-Benzylidene-1,2-O-isopropylidene-6-O-propargyl-α-D-glucofuranose | 1g | |
| GC4984-250mg | 3,5-O-Benzylidene-1,2-O-isopropylidene-α-D-glucofuranose | 22164-09-6 | 250mg |
| GC4984-500mg | 3,5-O-Benzylidene-1,2-O-isopropylidene-α-D-glucofuranose | 22164-09-6 | 500mg |
| GC4984-1g | 3,5-O-Benzylidene-1,2-O-isopropylidene-α-D-glucofuranose | 22164-09-6 | 1g |
| GC4984-2g | 3,5-O-Benzylidene-1,2-O-isopropylidene-α-D-glucofuranose | 22164-09-6 | 2g |
| GC0247-1g | 3,5,6-Tri-O-benzoyl-1,2-O-isopropylidene-α-D-glucofuranose | 6339-03-3 | 1g |
| GC0247-2g | 3,5,6-Tri-O-benzoyl-1,2-O-isopropylidene-α-D-glucofuranose | 6339-03-3 | 2g |
| GC0247-5g | 3,5,6-Tri-O-benzoyl-1,2-O-isopropylidene-α-D-glucofuranose | 6339-03-3 | 5g |
| GC0247-10g | 3,5,6-Tri-O-benzoyl-1,2-O-isopropylidene-α-D-glucofuranose | 6339-03-3 | 10g |
| GC6678-2mg | 3,5,6-Trichloro-2-pyridinol b-D-glucuronide | 58997-12-9 | 2mg |
| GC6678-5mg | 3,5,6-Trichloro-2-pyridinol b-D-glucuronide | 58997-12-9 | 5mg |
| GC6678-10mg | 3,5,6-Trichloro-2-pyridinol b-D-glucuronide | 58997-12-9 | 10mg |
| GC6678-25mg | 3,5,6-Trichloro-2-pyridinol b-D-glucuronide | 58997-12-9 | 25mg |
| GC7226-1mg | 3,6-Di-O-(carboxymethyl)-D-glucose | 122569-71-5 | 1mg |
| GC7226-2mg | 3,6-Di-O-(carboxymethyl)-D-glucose | 122569-71-5 | 2mg |
| GC7226-5mg | 3,6-Di-O-(carboxymethyl)-D-glucose | 122569-71-5 | 5mg |
| GC7226-10mg | 3,6-Di-O-(carboxymethyl)-D-glucose | 122569-71-5 | 10mg |
| GC3769-100mg | 3,6-Di-O-acetyl-2-azido-2-deoxy-α-D-glucopyranose | 100mg | |
| GC3769-250mg | 3,6-Di-O-acetyl-2-azido-2-deoxy-α-D-glucopyranose | 250mg | |
| GC3769-500mg | 3,6-Di-O-acetyl-2-azido-2-deoxy-α-D-glucopyranose | 500mg | |
| GC3769-1g | 3,6-Di-O-acetyl-2-azido-2-deoxy-α-D-glucopyranose | 1g | |
| GC3689-100mg | 3,6-Di-O-benzoyl-D-galactal | 130323-36-3 | 100mg |
| GC3689-250mg | 3,6-Di-O-benzoyl-D-galactal | 130323-36-3 | 250mg |
| GC3689-500mg | 3,6-Di-O-benzoyl-D-galactal | 130323-36-3 | 500mg |
| GC3689-1g | 3,6-Di-O-benzoyl-D-galactal | 130323-36-3 | 1g |
| GC4699-500mg | 3,6-Di-O-benzoyl-D-glucal | 58871-06-0 | 500mg |
| GC4699-1g | 3,6-Di-O-benzoyl-D-glucal | 58871-06-0 | 1g |
| GC4699-2g | 3,6-Di-O-benzoyl-D-glucal | 58871-06-0 | 2g |
| GC4699-5g | 3,6-Di-O-benzoyl-D-glucal | 58871-06-0 | 5g |
| GC1099-100mg | 3,6-Di-O-benzyl-D-glucal | 145852-76-2 | 100mg |
| GC1099-250mg | 3,6-Di-O-benzyl-D-glucal | 145852-76-2 | 250mg |
| GC1099-500mg | 3,6-Di-O-benzyl-D-glucal | 145852-76-2 | 500mg |
| GC1099-1g | 3,6-Di-O-benzyl-D-glucal | 145852-76-2 | 1g |
| GT4417-1g | 3,6-Dichloro-1,2-benzenedithiol | 87314-49-6 | 1g |
| GW4063-250mg | 3,6-Dichlorotrimellitic acid | 137071-78-4 | 250mg |
| GW4063-1g | 3,6-Dichlorotrimellitic acid | 137071-78-4 | 1g |
| GK3538-25ml | 3,7-Dimethyl-1,6-octadien-3-yl acetate | 115-95-7 | 25ml |
| GK7393-1g | 3,8-Diamino-6-phenylphenanthridine | 52009-64-0 | 1g |
| GK7393-5g | 3,8-Diamino-6-phenylphenanthridine | 52009-64-0 | 5g |
| GC6091-50mg | 3,u200b6-u200bAnhydro-u200bD-u200bglucose | 7625-23-2 | 50mg |
| GC6091-100mg | 3,u200b6-u200bAnhydro-u200bD-u200bglucose | 7625-23-2 | 100mg |
| GC6091-250mg | 3,u200b6-u200bAnhydro-u200bD-u200bglucose | 7625-23-2 | 250mg |
| GC6091-500mg | 3,u200b6-u200bAnhydro-u200bD-u200bglucose | 7625-23-2 | 500mg |
| GN2140-250mg | 3''-Azido-3''-deoxythymidine | 30516-87-1 | 250mg |
| GN2140-1g | 3''-Azido-3''-deoxythymidine | 30516-87-1 | 1g |
| GN2140-5g | 3''-Azido-3''-deoxythymidine | 30516-87-1 | 5g |
| GX9281-25g | 3''-Chloropropiophenone | 34841-35-5 | 25g |
| GX9281-100g | 3''-Chloropropiophenone | 34841-35-5 | 100g |
| GX9281-250g | 3''-Chloropropiophenone | 34841-35-5 | 250g |
| GX9281-500g | 3''-Chloropropiophenone | 34841-35-5 | 500g |
| GW2740-5mg | 3''-O-Methylfluorescein | 70672-05-8 | 5mg |
| GW2740-10mg | 3''-O-Methylfluorescein | 70672-05-8 | 10mg |
| GW2740-50mg | 3''-O-Methylfluorescein | 70672-05-8 | 50mg |
| GN3227-10mg | 3''-O-Methylguanosine | 10300-27-3 | 10mg |
| GN3227-50mg | 3''-O-Methylguanosine | 10300-27-3 | 50mg |
| GN3227-100mg | 3''-O-Methylguanosine | 10300-27-3 | 100mg |
| GT9232-1g | 3'',3'''',5'',5''''-Tetrabromophenolphthalein ethyl ester potassium salt | 62637-91-6 | 1g |
| GT9232-5g | 3'',3'''',5'',5''''-Tetrabromophenolphthalein ethyl ester potassium salt | 62637-91-6 | 5g |
| GK1618-5g | 3'',4'',5''-Trimethoxyacetophenone | 1136-86-3 | 5g |
| GK1618-25g | 3'',4'',5''-Trimethoxyacetophenone | 1136-86-3 | 25g |
| GK4078-1g | 3'',5-Dimethoxy-4''-hydroxyacetophenone | 2478-38-8 | 1g |
| GK4078-5g | 3'',5-Dimethoxy-4''-hydroxyacetophenone | 2478-38-8 | 5g |
| GW1351-25mg | 4-((4-(Dimethylamino)phenyl)azo)benzoic acid N-succinimidyl ester | 146998-31-4 | 25mg |
| GW1351-100mg | 4-((4-(Dimethylamino)phenyl)azo)benzoic acid N-succinimidyl ester | 146998-31-4 | 100mg |
| GW1351-1g | 4-((4-(Dimethylamino)phenyl)azo)benzoic acid N-succinimidyl ester | 146998-31-4 | 1g |
| GK6761-250mg | 4-(3-(4-Iodophenyl)-2-(2,4-dinitrophenyl)-2H-5-tetrazolio)-1,3-benzene | 161617-45-4 | 250mg |
| GK6761-1g | 4-(3-(4-Iodophenyl)-2-(2,4-dinitrophenyl)-2H-5-tetrazolio)-1,3-benzene | 161617-45-4 | 1g |
| GL0430-100mg | 4-(3-Butoxy-4-methoxybenzyl)imidazolidin-2-one | 29925-17-5 | 100mg |
| GT9017-25g | 4-(4-Nitrophenylazo)resorcinol | 74-39-5 | 25g |
| GT9017-100g | 4-(4-Nitrophenylazo)resorcinol | 74-39-5 | 100g |
| GX6763-5g | 4-(4,6-Dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholinium chloride | 3945-69-5 | 5g |
| GX6763-10g | 4-(4,6-Dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholinium chloride | 3945-69-5 | 10g |
| GX6763-25g | 4-(4,6-Dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholinium chloride | 3945-69-5 | 25g |
| GW7938-5g | 4-(6-Methylbenzothiazol-2-yl)-aniline | 92-36-4 | 5g |
| GW7938-25g | 4-(6-Methylbenzothiazol-2-yl)-aniline | 92-36-4 | 25g |
| GM6072-5g | 4-(Aminomethyl)benzoic acid | 56-91-7 | 5g |
| GM6072-25g | 4-(Aminomethyl)benzoic acid | 56-91-7 | 25g |
| GM6072-100g | 4-(Aminomethyl)benzoic acid | 56-91-7 | 100g |
| GP9986-25g | 4-(Benzyloxy)phenol | 103-16-2 | 25g |
| GP9986-100g | 4-(Benzyloxy)phenol | 103-16-2 | 100g |
| GP9986-250g | 4-(Benzyloxy)phenol | 103-16-2 | 250g |
| GX5018-5g | 4-(Bromomethyl)benzoic acid | 6232-88-8 | 5g |
| GX5018-10g | 4-(Bromomethyl)benzoic acid | 6232-88-8 | 10g |
| GX5018-25g | 4-(Bromomethyl)benzoic acid | 6232-88-8 | 25g |
| GW6268-25mg | 4-(Bromomethyl)phenyl isothiocyanate | 155863-32-4 | 25mg |
| GW6268-100mg | 4-(Bromomethyl)phenyl isothiocyanate | 155863-32-4 | 100mg |
| GT3284-25g | 4-(Dimethylamino)benzaldehyde | 100-10-7 | 25g |
| GT3284-100g | 4-(Dimethylamino)benzaldehyde | 100-10-7 | 100g |
| GT3284-250g | 4-(Dimethylamino)benzaldehyde | 100-10-7 | 250g |
| GT3284-500g | 4-(Dimethylamino)benzaldehyde | 100-10-7 | 500g |
| GT3284-1kg | 4-(Dimethylamino)benzaldehyde | 100-10-7 | 1kg |
| GT3524-250g | 4-(Dimethylamino)benzaldehyde, 98% | 100-10-7 | 250g |
| GT3524-1kg | 4-(Dimethylamino)benzaldehyde, 98% | 100-10-7 | 1kg |
| GT5394-5g | 4-(Dimethylamino)cinnamaldehyde | 6203-18-5 | 5g |
| GT5394-25g | 4-(Dimethylamino)cinnamaldehyde | 6203-18-5 | 25g |
| GX9847-1g | 4-(Imidazol-1-yl)phenol | 10041-02-8 | 1g |
| GW9250-50mg | 4-(N,N-Diethylaminomethyl)-7-methoxy-coumarin | 152584-35-5 | 50mg |
| GW9250-500mg | 4-(N,N-Diethylaminomethyl)-7-methoxy-coumarin | 152584-35-5 | 500mg |
| GW6432-50mg | 4-(N,N-Diethylaminomethyl)-7-propoxycoumarin | 351194-25-7 | 50mg |
| GW6432-500mg | 4-(N,N-Diethylaminomethyl)-7-propoxycoumarin | 351194-25-7 | 500mg |
| GW0297-50mg | 4-(N,N-Dimethylaminomethyl)-7-propoxycoumarin | 351194-17-7 | 50mg |
| GW0297-500mg | 4-(N,N-Dimethylaminomethyl)-7-propoxycoumarin | 351194-17-7 | 500mg |
| GW0017-1g | 4-(Trifluoroacetyl)benzoyl chloride | 58808-60-9 | 1g |
| GW0017-5g | 4-(Trifluoroacetyl)benzoyl chloride | 58808-60-9 | 5g |
| GK1347-5g | 4-(Trifluoromethyl)benzaldehyde | 455-19-6 | 5g |
| GK7826-5g | 4-(Trifluoromethyl)phenyl isothiocyanate | 1645-65-4 | 5g |
| GW9595-100mg | 4-(Trifluoromethyl)umbelliferyl phosphate | 352525-17-8 | 100mg |
| GW9595-500mg | 4-(Trifluoromethyl)umbelliferyl phosphate | 352525-17-8 | 500mg |
| GC8144-1mg | 4-(Trifluoromethyl)umbelliferyl-b-D-cellotrioside | 116981-90-9 | 1mg |
| GC8144-2mg | 4-(Trifluoromethyl)umbelliferyl-b-D-cellotrioside | 116981-90-9 | 2mg |
| GC8144-5mg | 4-(Trifluoromethyl)umbelliferyl-b-D-cellotrioside | 116981-90-9 | 5mg |
| GC8144-10mg | 4-(Trifluoromethyl)umbelliferyl-b-D-cellotrioside | 116981-90-9 | 10mg |
| GW9237-50mg | 4-[4''-(2''-Methyl)thiazolyl]phenol | 30686-73-8 | 50mg |
| GW9237-500mg | 4-[4''-(2''-Methyl)thiazolyl]phenol | 30686-73-8 | 500mg |
| GC3246-1mg | 4-Acetamido-4-deoxy-D-glucopyranose | 93060-86-7 | 1mg |
| GC3246-2mg | 4-Acetamido-4-deoxy-D-glucopyranose | 93060-86-7 | 2mg |
| GC3246-5mg | 4-Acetamido-4-deoxy-D-glucopyranose | 93060-86-7 | 5mg |
| GC3246-10mg | 4-Acetamido-4-deoxy-D-glucopyranose | 93060-86-7 | 10mg |
| GW7710-250mg | 4-Acetamido-5-nitrophthalic anhydride | 209324-72-1 | 250mg |
| GW7710-1g | 4-Acetamido-5-nitrophthalic anhydride | 209324-72-1 | 1g |
| GM0898-100g | 4-Acetamidobenzoic acid | 556-08-1 | 100g |
| GM0898-500g | 4-Acetamidobenzoic acid | 556-08-1 | 500g |
| GK4314-100g | 4-Acetamidophenol | 103-90-2 | 100g |
| GK4314-250g | 4-Acetamidophenol | 103-90-2 | 250g |
| GK4314-500g | 4-Acetamidophenol | 103-90-2 | 500g |
| GK4314-1kg | 4-Acetamidophenol | 103-90-2 | 1kg |
| GW2107-25g | 4-Acetoxystyrene (Stabilized with MEHQ) | 2628-16-2 | 25g |
| GK6464-25g | 4-Allylanisole | 140-67-0 | 25g |
| GK6464-100g | 4-Allylanisole | 140-67-0 | 100g |
| GK9259-1g | 4-Amino-2-chlorophenol | 3964-52-1 | 1g |
| GK9259-5g | 4-Amino-2-chlorophenol | 3964-52-1 | 5g |
| GW5931-25g | 4-Amino-3-hydroxy-1-naphthalenesulfonic acid | 116-63-2 | 25g |
| GW5931-100g | 4-Amino-3-hydroxy-1-naphthalenesulfonic acid | 116-63-2 | 100g |
| GW5511-25g | 4-Amino-3-hydroxy-1-naphthalenesulfonic acid, ACS grade | 116-63-2 | 25g |
| GK1140-25g | 4-Amino-3-nitrobenzotrifluoride | 400-98-6 | 25g |
| GK1140-100g | 4-Amino-3-nitrobenzotrifluoride | 400-98-6 | 100g |
| GT6946-25g | 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid monosodium salt hydrate | 312693-54-2 | 25g |
| GT6946-100g | 4-Amino-5-hydroxy-2,7-naphthalenedisulfonic acid monosodium salt hydrate | 312693-54-2 | 100g |
| GK3497-25g | 4-Aminoantipyrine | 83-07-8 | 25g |
| GK3497-100g | 4-Aminoantipyrine | 83-07-8 | 100g |
| GK3497-250g | 4-Aminoantipyrine | 83-07-8 | 250g |
| GL6173-25g | 4-Aminoazobenzene | 60-09-3 | 25g |
| GL6173-100g | 4-Aminoazobenzene | 60-09-3 | 100g |
| GM6679-25g | 4-Aminobenzoic acid | 150-13-0 | 25g |
| GM6679-100g | 4-Aminobenzoic acid | 150-13-0 | 100g |
| GM6679-250g | 4-Aminobenzoic acid | 150-13-0 | 250g |
| GM6679-500g | 4-Aminobenzoic acid | 150-13-0 | 500g |
| GM6679-1kg | 4-Aminobenzoic acid | 150-13-0 | 1kg |
| GM2145-1kg | 4-Aminobenzoic acid, USP grade | 150-13-0 | 1kg |
| GK0362-10g | 4-Aminobutyric acid | 56-12-2 | 10g |
| GK0362-25g | 4-Aminobutyric acid | 56-12-2 | 25g |
| GK0362-100g | 4-Aminobutyric acid | 56-12-2 | 100g |
| GK0362-250g | 4-Aminobutyric acid | 56-12-2 | 250g |
| GK0362-500g | 4-Aminobutyric acid | 56-12-2 | 500g |
| GK0362-1kg | 4-Aminobutyric acid | 56-12-2 | 1kg |
| GK8970-25g | 4-Aminophenol | 123-30-8 | 25g |
| GK8970-100g | 4-Aminophenol | 123-30-8 | 100g |
| GK8970-250g | 4-Aminophenol | 123-30-8 | 250g |
| GK8970-500g | 4-Aminophenol | 123-30-8 | 500g |
| GK8970-1kg | 4-Aminophenol | 123-30-8 | 1kg |
| GL2746-25g | 4-Aminophenol hydrochloride | 51-78-5 | 25g |
| GL2746-100g | 4-Aminophenol hydrochloride | 51-78-5 | 100g |
| GC1550-1mg | 4-Aminophenyl 3,6-di-O-(α-D-mannopyranosyl)-α-D-mannopyranoside | 1mg | |
| GC1550-2mg | 4-Aminophenyl 3,6-di-O-(α-D-mannopyranosyl)-α-D-mannopyranoside | 2mg | |
| GC1550-5mg | 4-Aminophenyl 3,6-di-O-(α-D-mannopyranosyl)-α-D-mannopyranoside | 5mg | |
| GC1550-10mg | 4-Aminophenyl 3,6-di-O-(α-D-mannopyranosyl)-α-D-mannopyranoside | 10mg | |
| GC1550-25mg | 4-Aminophenyl 3,6-di-O-(α-D-mannopyranosyl)-α-D-mannopyranoside | 25mg | |
| GC3719-100mg | 4-Aminophenyl b-D-lactopyranoside | 17691-02-0 | 100mg |
| GC3719-250mg | 4-Aminophenyl b-D-lactopyranoside | 17691-02-0 | 250mg |
| GC3719-500mg | 4-Aminophenyl b-D-lactopyranoside | 17691-02-0 | 500mg |
| GC3719-1g | 4-Aminophenyl b-D-lactopyranoside | 17691-02-0 | 1g |
| GC6601-25mg | 4-Aminophenyl b-D-thiogalactopyranoside | 29558-05-2 | 25mg |
| GC6601-50mg | 4-Aminophenyl b-D-thiogalactopyranoside | 29558-05-2 | 50mg |
| GC6601-100mg | 4-Aminophenyl b-D-thiogalactopyranoside | 29558-05-2 | 100mg |
| GC6601-250mg | 4-Aminophenyl b-D-thiogalactopyranoside | 29558-05-2 | 250mg |
| GC5729-5mg | 4-Aminophenyl b-D-thioglucopyranoside | 58737-22-7 | 5mg |
| GC5729-10mg | 4-Aminophenyl b-D-thioglucopyranoside | 58737-22-7 | 10mg |
| GC5729-25mg | 4-Aminophenyl b-D-thioglucopyranoside | 58737-22-7 | 25mg |
| GC5729-50mg | 4-Aminophenyl b-D-thioglucopyranoside | 58737-22-7 | 50mg |
| GC0512-100mg | 4-Aminophenyl b-L-fucopyranoside | 69936-58-9 | 100mg |
| GC0512-250mg | 4-Aminophenyl b-L-fucopyranoside | 69936-58-9 | 250mg |
| GC0512-500mg | 4-Aminophenyl b-L-fucopyranoside | 69936-58-9 | 500mg |
| GC0512-1g | 4-Aminophenyl b-L-fucopyranoside | 69936-58-9 | 1g |
| GX5844-5g | 4-Aminophenyl disulfide | 722-27-0 | 5g |
| GX5844-25g | 4-Aminophenyl disulfide | 722-27-0 | 25g |
| GC3242-100mg | 4-Aminophenyl α-D-mannopyranoside | 34213-86-0 | 100mg |
| GC3242-250mg | 4-Aminophenyl α-D-mannopyranoside | 34213-86-0 | 250mg |
| GC3242-500mg | 4-Aminophenyl α-D-mannopyranoside | 34213-86-0 | 500mg |
| GC3242-1g | 4-Aminophenyl α-D-mannopyranoside | 34213-86-0 | 1g |
| GC0889-10mg | 4-Aminophenyl β-D-xylopyranoside | 17306-95-5 | 10mg |
| GC0889-25mg | 4-Aminophenyl β-D-xylopyranoside | 17306-95-5 | 25mg |
| GC0889-50mg | 4-Aminophenyl β-D-xylopyranoside | 17306-95-5 | 50mg |
| GC0889-100mg | 4-Aminophenyl β-D-xylopyranoside | 17306-95-5 | 100mg |
| GK6823-1g | 4-Aminophenylboronic acid hydrochloride | 80460-73-7 | 1g |
| GL6836-10mg | 4-Aminophenylphosphate sodium salt | 108084-47-5 | 10mg |
| GL6836-50mg | 4-Aminophenylphosphate sodium salt | 108084-47-5 | 50mg |
| GL6836-100mg | 4-Aminophenylphosphate sodium salt | 108084-47-5 | 100mg |
| GT7777-5g | 4-Aminophthalonitrile | 56765-79-8 | 5g |
| GM8827-100g | 4-Aminosalicylic acid | 65-49-6 | 100g |
| GM8827-500g | 4-Aminosalicylic acid | 65-49-6 | 500g |
| GK1726-5g | 4-Aminothiophenol | 1193-02-8 | 5g |
| GC0898-50mg | 4-Azido-4-deoxy-D-galactose | 94885-19-5 | 50mg |
| GC0898-100mg | 4-Azido-4-deoxy-D-galactose | 94885-19-5 | 100mg |
| GC0898-250mg | 4-Azido-4-deoxy-D-galactose | 94885-19-5 | 250mg |
| GC0898-500mg | 4-Azido-4-deoxy-D-galactose | 94885-19-5 | 500mg |
| GC9076-50mg | 4-Azido-4-deoxy-D-glucose | 74593-35-4 | 50mg |
| GC9076-100mg | 4-Azido-4-deoxy-D-glucose | 74593-35-4 | 100mg |
| GC9076-250mg | 4-Azido-4-deoxy-D-glucose | 74593-35-4 | 250mg |
| GC9076-1g | 4-Azido-4-deoxy-D-glucose | 74593-35-4 | 1g |
| GC9076-500mg | 4-Azido-4-deoxy-D-glucose | 74593-35-4 | 500mg |
| GW9407-100mg | 4-Azido-4-nitro-2,1,3-benzoxadiazole | 10199-90-3 | 100mg |
| GW9407-500mg | 4-Azido-4-nitro-2,1,3-benzoxadiazole | 10199-90-3 | 500mg |
| GW6973-250mg | 4-Benzylamino-7-nitrobenzofurazan | 18378-20-6 | 250mg |
| GW6973-1g | 4-Benzylamino-7-nitrobenzofurazan | 18378-20-6 | 1g |
| GK8159-25g | 4-Biphenylacetic acid | 5728-52-9 | 25g |
| GK8159-100g | 4-Biphenylacetic acid | 5728-52-9 | 100g |
| GW4949-5g | 4-Bromo-1,8-naphthalic anhydride | 81-86-7 | 5g |
| GE8435-1g | 4-Bromo-2-(trifluoromethyl)benzenol | 50824-04-9 | 1g |
| GE8435-5g | 4-Bromo-2-(trifluoromethyl)benzenol | 50824-04-9 | 5g |
| GE8435-25g | 4-Bromo-2-(trifluoromethyl)benzenol | 50824-04-9 | 25g |
| GK7136-25g | 4-Bromo-2-fluoroaniline | 367-24-8 | 25g |
| GK8323-10g | 4-Bromobenzaldehyde | 1122-91-4 | 10g |
| GK8323-25g | 4-Bromobenzaldehyde | 1122-91-4 | 25g |
| GW4304-5g | 4-Bromobenzenediazonium tetrafluoroborate | 673-40-5 | 5g |
| GK4692-10g | 4-Bromobiphenyl | 92-66-0 | 10g |
| GK4692-25g | 4-Bromobiphenyl | 92-66-0 | 25g |
| GT0455-1g | 4-Bromomethyl-7-methoxycoumarin | 35231-44-8 | 1g |
| GT0455-5g | 4-Bromomethyl-7-methoxycoumarin | 35231-44-8 | 5g |
| GK1485-25g | 4-Carboxybenzaldehyde | 619-66-9 | 25g |
| GE8221-5g | 4-Chloro-1-naphthol | 604-44-4 | 5g |
| GE8221-25g | 4-Chloro-1-naphthol | 604-44-4 | 25g |
| GE8221-100g | 4-Chloro-1-naphthol | 604-44-4 | 100g |
| GW4182-5g | 4-Chloro-2,1,3-benzoxadiazole | 7116-16-7 | 5g |
| GW4182-10g | 4-Chloro-2,1,3-benzoxadiazole | 7116-16-7 | 10g |
| GK6955-1g | 4-Chloro-3-fluorobenzaldehyde | 5527-95-7 | 1g |
| GK6955-5g | 4-Chloro-3-fluorobenzaldehyde | 5527-95-7 | 5g |
| GK3346-25g | 4-Chloro-3-methylphenol | 59-50-7 | 25g |
| GK3346-100g | 4-Chloro-3-methylphenol | 59-50-7 | 100g |
| GK3346-250g | 4-Chloro-3-methylphenol | 59-50-7 | 250g |
| GK3346-500g | 4-Chloro-3-methylphenol | 59-50-7 | 500g |
| GK8861-500g | 4-Chloro-3-methylphenol, BP, EP grade | 59-50-7 | 500g |
| GK8861-1kg | 4-Chloro-3-methylphenol, BP, EP grade | 59-50-7 | 1kg |
| GK9303-500g | 4-Chloro-3-methylphenol, BP, Ph. Eur., USP grade | 59-50-7 | 500g |
| GK9303-1kg | 4-Chloro-3-methylphenol, BP, Ph. Eur., USP grade | 59-50-7 | 1kg |
| GK4354-1g | 4-Chloro-4''-hydroxybenzophenone | 42019-78-3 | 1g |
| GK5353-5g | 4-Chloroaniline | 106-47-8 | 5g |
| GK5353-25g | 4-Chloroaniline | 106-47-8 | 25g |
| GK2625-5g | 4-Chlorobenzophenone | 134-85-0 | 5g |
| GW0503-500mg | 4-Chloromethylbenzonitrile | 874-86-2 | 500mg |
| GW0503-10g | 4-Chloromethylbenzonitrile | 874-86-2 | 10g |
| GK7849-25g | 4-Chlorophenol | 106-48-9 | 25g |
| GK7849-100g | 4-Chlorophenol | 106-48-9 | 100g |
| GK7849-500g | 4-Chlorophenol | 106-48-9 | 500g |
| GL2685-25g | 4-Cumylphenol | 599-64-4 | 25g |
| GL2685-100g | 4-Cumylphenol | 599-64-4 | 100g |
| GL2685-250g | 4-Cumylphenol | 599-64-4 | 250g |
| GL2685-500g | 4-Cumylphenol | 599-64-4 | 500g |
| GK5664-1g | 4-Cyanobenzaldehyde | 105-07-7 | 1g |
| GK5664-5g | 4-Cyanobenzaldehyde | 105-07-7 | 5g |
| GK5664-25g | 4-Cyanobenzaldehyde | 105-07-7 | 25g |
| GK5664-100g | 4-Cyanobenzaldehyde | 105-07-7 | 100g |
| GC6964-250mg | 4-Cyclohexylbutyl β-D-glucopyranoside | 869542-54-1 | 250mg |
| GC6964-500mg | 4-Cyclohexylbutyl β-D-glucopyranoside | 869542-54-1 | 500mg |
| GC6964-1g | 4-Cyclohexylbutyl β-D-glucopyranoside | 869542-54-1 | 1g |
| GC6964-2g | 4-Cyclohexylbutyl β-D-glucopyranoside | 869542-54-1 | 2g |
| GC6964-5g | 4-Cyclohexylbutyl β-D-glucopyranoside | 869542-54-1 | 5g |
| GC7335-5mg | 4-Deoxy-4-fluoro-D-galactose | 40010-20-6 | 5mg |
| GC7335-10mg | 4-Deoxy-4-fluoro-D-galactose | 40010-20-6 | 10mg |
| GC7335-25mg | 4-Deoxy-4-fluoro-D-galactose | 40010-20-6 | 25mg |
| GC7335-50mg | 4-Deoxy-4-fluoro-D-galactose | 40010-20-6 | 50mg |
| GC9628-25mg | 4-Deoxy-4-fluoro-D-glucopyranose | 30694-44-1 | 25mg |
| GC9628-50mg | 4-Deoxy-4-fluoro-D-glucopyranose | 30694-44-1 | 50mg |
| GC9628-100mg | 4-Deoxy-4-fluoro-D-glucopyranose | 30694-44-1 | 100mg |
| GC6508-5mg | 4-Deoxy-4-fluoro-D-mannose | 87764-47-4 | 5mg |
| GC6508-10mg | 4-Deoxy-4-fluoro-D-mannose | 87764-47-4 | 10mg |
| GC6508-25mg | 4-Deoxy-4-fluoro-D-mannose | 87764-47-4 | 25mg |
| GC6508-50mg | 4-Deoxy-4-fluoro-D-mannose | 87764-47-4 | 50mg |
| GX8186-100mg | 4-Deoxypyridoxine hydrochloride | 148-51-6 | 100mg |
| GX8186-1g | 4-Deoxypyridoxine hydrochloride | 148-51-6 | 1g |
| GW1929-1g | 4-Di-2-ASP | 105802-46-8 | 1g |
| GW1929-5g | 4-Di-2-ASP | 105802-46-8 | 5g |
| GE4595-5g | 4-Dimethylaminopyridine | 1122-58-3 | 5g |
| GE4595-25g | 4-Dimethylaminopyridine | 1122-58-3 | 25g |
| GE4595-100g | 4-Dimethylaminopyridine | 1122-58-3 | 100g |
| GE4595-250g | 4-Dimethylaminopyridine | 1122-58-3 | 250g |
| GE4595-500g | 4-Dimethylaminopyridine | 1122-58-3 | 500g |
| GX2537-5g | 4-Ethoxy-3-methoxybenzaldehyde | 120-25-2 | 5g |
| GX9509-1g | 4-Ethynylbenzaldehyde | 63697-96-1 | 1g |
| GW9969-3g | 4-Fluoro-2,1,3-benzoxadiazol | 29270-55-1 | 3g |
| GW9969-10g | 4-Fluoro-2,1,3-benzoxadiazol | 29270-55-1 | 10g |
| GK8959-10g | 4-Fluorobenzaldehyde | 459-57-4 | 10g |
| GK3478-25g | 4-Fluorobenzoyl chloride | 403-43-0 | 25g |
| GK3478-100g | 4-Fluorobenzoyl chloride | 403-43-0 | 100g |
| GK7183-5g | 4-Fluorophenacyl bromide | 403-29-2 | 5g |
| GK7183-10g | 4-Fluorophenacyl bromide | 403-29-2 | 10g |
| GK7183-25g | 4-Fluorophenacyl bromide | 403-29-2 | 25g |
| GK2089-25g | 4-Fluorophenol | 371-41-5 | 25g |
| GW9408-500mg | 4-Fluororesorcinol | 103068-41-3 | 500mg |
| GW9408-1g | 4-Fluororesorcinol | 103068-41-3 | 1g |
| GW9408-10g | 4-Fluororesorcinol | 103068-41-3 | 10g |
| GC4513-10g | 4-Formylphenyl b-D-allopyranoside | 80154-34-3 | 10g |
| GK1506-1g | 4-Formylphenylboronic acid | 87199-17-5 | 1g |
| GK1506-5g | 4-Formylphenylboronic acid | 87199-17-5 | 5g |
| GK9325-25g | 4-Hexylresorcinol | 136-77-6 | 25g |
| GK9325-100g | 4-Hexylresorcinol | 136-77-6 | 100g |
| GK9325-250g | 4-Hexylresorcinol | 136-77-6 | 250g |
| GW2291-25mg | 4-Hydrazino-7-nitro-2,1,3-benzoxadiazol | 90421-78-6 | 25mg |
| GW2291-100mg | 4-Hydrazino-7-nitro-2,1,3-benzoxadiazol | 90421-78-6 | 100mg |
| GE0239-5g | 4-Hydroxy TEMPO, free radical | 2226-96-2 | 5g |
| GE0239-25g | 4-Hydroxy TEMPO, free radical | 2226-96-2 | 25g |
| GK7543-25g | 4-Hydroxybenzaldehyde | 123-08-0 | 25g |
| GK3185-25g | 4-Hydroxybenzhydrazide | 5351-23-5 | 25g |
| GK3185-100g | 4-Hydroxybenzhydrazide | 5351-23-5 | 100g |
| GX4620-100g | 4-Hydroxybenzoic acid | 99-96-7 | 100g |
| GK8868-25g | 4-Hydroxybiphenyl | 92-69-3 | 25g |
| GK1602-5g | 4-Hydroxycinnamic acid | 501-98-4 | 5g |
| GK1602-25g | 4-Hydroxycinnamic acid | 501-98-4 | 25g |
| GK1602-50g | 4-Hydroxycinnamic acid | 501-98-4 | 50g |
| GK1602-100g | 4-Hydroxycinnamic acid | 501-98-4 | 100g |
| GL1043-1mg | 4-Hydroxyestradiol | 5976-61-4 | 1mg |
| GP1978-1g | 4-Hydroxyindole | 2380-94-1 | 1g |
| GK5318-5g | 4-Hydroxyisophthalic acid | 636-46-4 | 5g |
| GL4484-5mg | 4-Hydroxymephenytoin | 61837-65-8 | 5mg |
| GK3530-25g | 4-Hydroxymethyl-4-methyl-1-phenyl-3-pyrazolidone | 13047-13-7 | 25g |
| GA3752-10mg | 4-Hydroxytamoxifen | 68392-35-8 | 10mg |
| GA3752-25mg | 4-Hydroxytamoxifen | 68392-35-8 | 25mg |
| GL7772-10mg | 4-Hydroxytolbutamide | 5719-85-7 | 10mg |
| GK0166-1g | 4-Imidazoleacetic acid hydrochloride | 3251-69-2 | 1g |
| GK0166-5g | 4-Imidazoleacetic acid hydrochloride | 3251-69-2 | 5g |
| GC1132-5mg | 4-Isothiocyanatophenyl 6-O-[(di-O-tert-butyl)phosphoryl]-α-D-mannopyranoside | 5mg | |
| GC1132-10mg | 4-Isothiocyanatophenyl 6-O-[(di-O-tert-butyl)phosphoryl]-α-D-mannopyranoside | 10mg | |
| GC1132-25mg | 4-Isothiocyanatophenyl 6-O-[(di-O-tert-butyl)phosphoryl]-α-D-mannopyranoside | 25mg | |
| GC1132-50mg | 4-Isothiocyanatophenyl 6-O-[(di-O-tert-butyl)phosphoryl]-α-D-mannopyranoside | 50mg | |
| GC6661-10mg | 4-Isothiocyanatophenyl α-D-galactopyranoside | 146194-63-0 | 10mg |
| GC6661-25mg | 4-Isothiocyanatophenyl α-D-galactopyranoside | 146194-63-0 | 25mg |
| GC6661-50mg | 4-Isothiocyanatophenyl α-D-galactopyranoside | 146194-63-0 | 50mg |
| GC6661-100mg | 4-Isothiocyanatophenyl α-D-galactopyranoside | 146194-63-0 | 100mg |
| GW9881-250mg | 4-Methoxy-7-nitro-2,1,3-benzoxadiazole | 18333-73-8 | 250mg |
| GW9881-1g | 4-Methoxy-7-nitro-2,1,3-benzoxadiazole | 18333-73-8 | 1g |
| GK5518-25g | 4-Methoxyphenol | 150-76-5 | 25g |
| GK5518-100g | 4-Methoxyphenol | 150-76-5 | 100g |
| GK5518-500g | 4-Methoxyphenol | 150-76-5 | 500g |
| GK5518-1kg | 4-Methoxyphenol | 150-76-5 | 1kg |
| GC3394-1g | 4-Methoxyphenyl 2,2'',3,3'',4'',6,6''-hepta-O-acetyl-β-D-maltoside | 848863-34-3 | 1g |
| GC3394-2g | 4-Methoxyphenyl 2,2'',3,3'',4'',6,6''-hepta-O-acetyl-β-D-maltoside | 848863-34-3 | 2g |
| GC3394-5g | 4-Methoxyphenyl 2,2'',3,3'',4'',6,6''-hepta-O-acetyl-β-D-maltoside | 848863-34-3 | 5g |
| GC3394-10g | 4-Methoxyphenyl 2,2'',3,3'',4'',6,6''-hepta-O-acetyl-β-D-maltoside | 848863-34-3 | 10g |
| GC4670-1g | 4-Methoxyphenyl 2,3-di-O-acetyl-4,6-O-benzylidene-β-D-galactopyranoside | 899433-75-1 | 1g |
| GC4670-2g | 4-Methoxyphenyl 2,3-di-O-acetyl-4,6-O-benzylidene-β-D-galactopyranoside | 899433-75-1 | 2g |
| GC4670-5g | 4-Methoxyphenyl 2,3-di-O-acetyl-4,6-O-benzylidene-β-D-galactopyranoside | 899433-75-1 | 5g |
| GC4670-10g | 4-Methoxyphenyl 2,3-di-O-acetyl-4,6-O-benzylidene-β-D-galactopyranoside | 899433-75-1 | 10g |
| GC5063-5g | 4-Methoxyphenyl 2,3-di-O-benzyl-4,6-O-benzylidene-β-D-glucopyranoside | 1884592-53-3 | 5g |
| GC5063-10g | 4-Methoxyphenyl 2,3-di-O-benzyl-4,6-O-benzylidene-β-D-glucopyranoside | 1884592-53-3 | 10g |
| GC5063-25g | 4-Methoxyphenyl 2,3-di-O-benzyl-4,6-O-benzylidene-β-D-glucopyranoside | 1884592-53-3 | 25g |
| GC5063-50g | 4-Methoxyphenyl 2,3-di-O-benzyl-4,6-O-benzylidene-β-D-glucopyranoside | 1884592-53-3 | 50g |
| GC9837-1g | 4-Methoxyphenyl 2,3,4-tri-O-benzyl-β-D-glucopyranoside | 1055325-21-7 | 1g |
| GC9837-2g | 4-Methoxyphenyl 2,3,4-tri-O-benzyl-β-D-glucopyranoside | 1055325-21-7 | 2g |
| GC9837-5g | 4-Methoxyphenyl 2,3,4-tri-O-benzyl-β-D-glucopyranoside | 1055325-21-7 | 5g |
| GC9837-10g | 4-Methoxyphenyl 2,3,4-tri-O-benzyl-β-D-glucopyranoside | 1055325-21-7 | 10g |
| GC7500-5g | 4-Methoxyphenyl 2,3,4,6-tetra-O-acetyl-b-D-galactopyranoside | 2872-65-3 | 5g |
| GC7500-10g | 4-Methoxyphenyl 2,3,4,6-tetra-O-acetyl-b-D-galactopyranoside | 2872-65-3 | 10g |
| GC7500-25g | 4-Methoxyphenyl 2,3,4,6-tetra-O-acetyl-b-D-galactopyranoside | 2872-65-3 | 25g |
| GC7500-50g | 4-Methoxyphenyl 2,3,4,6-tetra-O-acetyl-b-D-galactopyranoside | 2872-65-3 | 50g |
| GC6291-5g | 4-Methoxyphenyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside | 14581-81-8 | 5g |
| GC6291-10g | 4-Methoxyphenyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside | 14581-81-8 | 10g |
| GC6291-25g | 4-Methoxyphenyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside | 14581-81-8 | 25g |
| GC6291-50g | 4-Methoxyphenyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside | 14581-81-8 | 50g |
| GC3377-500mg | 4-Methoxyphenyl 2,3,6-tri-O-acetyl-β-D-galactopyranoside | 500mg | |
| GC3377-1g | 4-Methoxyphenyl 2,3,6-tri-O-acetyl-β-D-galactopyranoside | 1g | |
| GC3377-2g | 4-Methoxyphenyl 2,3,6-tri-O-acetyl-β-D-galactopyranoside | 2g | |
| GC3377-5g | 4-Methoxyphenyl 2,3,6-tri-O-acetyl-β-D-galactopyranoside | 5g | |
| GC4045-250mg | 4-Methoxyphenyl 2,3,6-tri-O-acetyl-β-D-glucopyranoside | 250mg | |
| GC4045-500mg | 4-Methoxyphenyl 2,3,6-tri-O-acetyl-β-D-glucopyranoside | 500mg | |
| GC4045-1g | 4-Methoxyphenyl 2,3,6-tri-O-acetyl-β-D-glucopyranoside | 1g | |
| GC2277-500mg | 4-Methoxyphenyl 2,3,6-tri-O-benzoyl-β-D-glucopyranoside | 578007-30-4 | 500mg |
| GC2277-1g | 4-Methoxyphenyl 2,3,6-tri-O-benzoyl-β-D-glucopyranoside | 578007-30-4 | 1g |
| GC2277-2g | 4-Methoxyphenyl 2,3,6-tri-O-benzoyl-β-D-glucopyranoside | 578007-30-4 | 2g |
| GC2277-5g | 4-Methoxyphenyl 2,3,6-tri-O-benzoyl-β-D-glucopyranoside | 578007-30-4 | 5g |
| GC8189-500mg | 4-Methoxyphenyl 2,4,6-tri-O-acetyl-3-O-allyl-β-D-galactopyranoside | 343254-39-7 | 500mg |
| GC8189-1g | 4-Methoxyphenyl 2,4,6-tri-O-acetyl-3-O-allyl-β-D-galactopyranoside | 343254-39-7 | 1g |
| GC8189-2g | 4-Methoxyphenyl 2,4,6-tri-O-acetyl-3-O-allyl-β-D-galactopyranoside | 343254-39-7 | 2g |
| GC8189-5g | 4-Methoxyphenyl 2,4,6-tri-O-acetyl-3-O-allyl-β-D-galactopyranoside | 343254-39-7 | 5g |
| GC5303-50mg | 4-Methoxyphenyl 2,4,6-tri-O-acetyl-3-O-benzyl-α-D-glucopyranoside | 50mg | |
| GC5303-100mg | 4-Methoxyphenyl 2,4,6-tri-O-acetyl-3-O-benzyl-α-D-glucopyranoside | 100mg | |
| GC5303-250mg | 4-Methoxyphenyl 2,4,6-tri-O-acetyl-3-O-benzyl-α-D-glucopyranoside | 250mg | |
| GC5303-500mg | 4-Methoxyphenyl 2,4,6-tri-O-acetyl-3-O-benzyl-α-D-glucopyranoside | 500mg | |
| GC6302-500mg | 4-Methoxyphenyl 2,4,6-tri-O-benzyl-b-D-galactopyranoside | 247027-79-8 | 500mg |
| GC6302-1g | 4-Methoxyphenyl 2,4,6-tri-O-benzyl-b-D-galactopyranoside | 247027-79-8 | 1g |
| GC6302-2g | 4-Methoxyphenyl 2,4,6-tri-O-benzyl-b-D-galactopyranoside | 247027-79-8 | 2g |
| GC6302-5g | 4-Methoxyphenyl 2,4,6-tri-O-benzyl-b-D-galactopyranoside | 247027-79-8 | 5g |
| GC6302-10g | 4-Methoxyphenyl 2,4,6-tri-O-benzyl-b-D-galactopyranoside | 247027-79-8 | 10g |
| GC7468-1g | 4-Methoxyphenyl 2,6-di-O-acetyl-3,4-O-isopropylidene-β-D-galactopyranoside | 1201011-97-3 | 1g |
| GC7468-2g | 4-Methoxyphenyl 2,6-di-O-acetyl-3,4-O-isopropylidene-β-D-galactopyranoside | 1201011-97-3 | 2g |
| GC7468-5g | 4-Methoxyphenyl 2,6-di-O-acetyl-3,4-O-isopropylidene-β-D-galactopyranoside | 1201011-97-3 | 5g |
| GC7468-10g | 4-Methoxyphenyl 2,6-di-O-acetyl-3,4-O-isopropylidene-β-D-galactopyranoside | 1201011-97-3 | 10g |
| GC5211-1g | 4-Methoxyphenyl 2,6-di-O-acetyl-β-D-galactopyranoside | 1201011-99-5 | 1g |
| GC5211-5g | 4-Methoxyphenyl 2,6-di-O-acetyl-β-D-galactopyranoside | 1201011-99-5 | 5g |
| GC5211-10g | 4-Methoxyphenyl 2,6-di-O-acetyl-β-D-galactopyranoside | 1201011-99-5 | 10g |
| GC5211-25g | 4-Methoxyphenyl 2,6-di-O-acetyl-β-D-galactopyranoside | 1201011-99-5 | 25g |
| GC9269-1g | 4-Methoxyphenyl 2,6-di-O-benzyl-b-D-galactopyranoside | 159922-50-6 | 1g |
| GC9269-2g | 4-Methoxyphenyl 2,6-di-O-benzyl-b-D-galactopyranoside | 159922-50-6 | 2g |
| GC9269-5g | 4-Methoxyphenyl 2,6-di-O-benzyl-b-D-galactopyranoside | 159922-50-6 | 5g |
| GC9269-10g | 4-Methoxyphenyl 2,6-di-O-benzyl-b-D-galactopyranoside | 159922-50-6 | 10g |
| GC0539-1g | 4-Methoxyphenyl 3-O-allyl-2,4,6-tri-O-benzyl-β-D-galactopyranoside | 247027-78-7 | 1g |
| GC0539-2g | 4-Methoxyphenyl 3-O-allyl-2,4,6-tri-O-benzyl-β-D-galactopyranoside | 247027-78-7 | 2g |
| GC0539-5g | 4-Methoxyphenyl 3-O-allyl-2,4,6-tri-O-benzyl-β-D-galactopyranoside | 247027-78-7 | 5g |
| GC0539-10g | 4-Methoxyphenyl 3-O-allyl-2,4,6-tri-O-benzyl-β-D-galactopyranoside | 247027-78-7 | 10g |
| GC8202-1g | 4-Methoxyphenyl 3-O-allyl-b-D-galactopyranoside | 144985-19-3 | 1g |
| GC8202-2g | 4-Methoxyphenyl 3-O-allyl-b-D-galactopyranoside | 144985-19-3 | 2g |
| GC8202-5g | 4-Methoxyphenyl 3-O-allyl-b-D-galactopyranoside | 144985-19-3 | 5g |
| GC8202-10g | 4-Methoxyphenyl 3-O-allyl-b-D-galactopyranoside | 144985-19-3 | 10g |
| GC8943-1g | 4-Methoxyphenyl 3,4-O-isopropylidene-b-D-galactopyranoside | 159922-67-5 | 1g |
| GC8943-2g | 4-Methoxyphenyl 3,4-O-isopropylidene-b-D-galactopyranoside | 159922-67-5 | 2g |
| GC8943-5g | 4-Methoxyphenyl 3,4-O-isopropylidene-b-D-galactopyranoside | 159922-67-5 | 5g |
| GC8943-10g | 4-Methoxyphenyl 3,4-O-isopropylidene-b-D-galactopyranoside | 159922-67-5 | 10g |
| GC9881-1g | 4-Methoxyphenyl 4,6-O-benzylidene-β-D-galactopyranoside | 176299-96-0 | 1g |
| GC9881-2g | 4-Methoxyphenyl 4,6-O-benzylidene-β-D-galactopyranoside | 176299-96-0 | 2g |
| GC9881-5g | 4-Methoxyphenyl 4,6-O-benzylidene-β-D-galactopyranoside | 176299-96-0 | 5g |
| GC9881-10g | 4-Methoxyphenyl 4,6-O-benzylidene-β-D-galactopyranoside | 176299-96-0 | 10g |
| GC5591-500mg | 4-Methoxyphenyl 4,6-O-benzylidene-β-D-glucopyranoside | 158252-19-8 | 500mg |
| GC5591-1g | 4-Methoxyphenyl 4,6-O-benzylidene-β-D-glucopyranoside | 158252-19-8 | 1g |
| GC5591-2g | 4-Methoxyphenyl 4,6-O-benzylidene-β-D-glucopyranoside | 158252-19-8 | 2g |
| GC5591-5g | 4-Methoxyphenyl 4,6-O-benzylidene-β-D-glucopyranoside | 158252-19-8 | 5g |
| GC7760-250mg | 4-Methoxyphenyl 6-O-tert-butyldiphenylsilyl-3,4-O-isopropylidene-β-D-galactopyranoside | 503303-07-9 | 250mg |
| GC7760-500mg | 4-Methoxyphenyl 6-O-tert-butyldiphenylsilyl-3,4-O-isopropylidene-β-D-galactopyranoside | 503303-07-9 | 500mg |
| GC7760-1g | 4-Methoxyphenyl 6-O-tert-butyldiphenylsilyl-3,4-O-isopropylidene-β-D-galactopyranoside | 503303-07-9 | 1g |
| GC7760-2g | 4-Methoxyphenyl 6-O-tert-butyldiphenylsilyl-3,4-O-isopropylidene-β-D-galactopyranoside | 503303-07-9 | 2g |
| GC0428-5g | 4-Methoxyphenyl b-D-galactopyranoside | 3150-20-7 | 5g |
| GC0428-10g | 4-Methoxyphenyl b-D-galactopyranoside | 3150-20-7 | 10g |
| GC0428-25g | 4-Methoxyphenyl b-D-galactopyranoside | 3150-20-7 | 25g |
| GC0428-50g | 4-Methoxyphenyl b-D-galactopyranoside | 3150-20-7 | 50g |
| GC5744-1g | 4-Methoxyphenyl b-D-glucopyranoside | 6032-32-2 | 1g |
| GC5744-2g | 4-Methoxyphenyl b-D-glucopyranoside | 6032-32-2 | 2g |
| GC5744-5g | 4-Methoxyphenyl b-D-glucopyranoside | 6032-32-2 | 5g |
| GC5744-10g | 4-Methoxyphenyl b-D-glucopyranoside | 6032-32-2 | 10g |
| GC5744-25g | 4-Methoxyphenyl b-D-glucopyranoside | 6032-32-2 | 25g |
| GK6323-100ml | 4-Methyl-2-pentanone | 108-10-1 | 100ml |
| GK6220-25g | 4-Methyl-3-nitroaniline | 119-32-4 | 25g |
| GK6220-100g | 4-Methyl-3-nitroaniline | 119-32-4 | 100g |
| GX4883-1g | 4-Methyl-5-imidazolecarboxaldehyde | 68282-53-1 | 1g |
| GX4883-5g | 4-Methyl-5-imidazolecarboxaldehyde | 68282-53-1 | 5g |
| GK4728-25g | 4-Methylaminophenol sulfate | 55-55-0 | 25g |
| GK4728-100g | 4-Methylaminophenol sulfate | 55-55-0 | 100g |
| GK4728-250g | 4-Methylaminophenol sulfate | 55-55-0 | 250g |
| GK4728-500g | 4-Methylaminophenol sulfate | 55-55-0 | 500g |
| GK4728-1kg | 4-Methylaminophenol sulfate | 55-55-0 | 1kg |
| GK8875-100g | 4-Methylbenzenesulfinic acid sodium salt | 824-79-3 | 100g |
| GK8875-250g | 4-Methylbenzenesulfinic acid sodium salt | 824-79-3 | 250g |
| GK8875-500g | 4-Methylbenzenesulfinic acid sodium salt | 824-79-3 | 500g |
| GC6564-500mg | 4-Methylphenyl 1-thio-6-O-tosyl-β-D-glucopyranoside | 2230883-55-1 | 500mg |
| GC6564-1g | 4-Methylphenyl 1-thio-6-O-tosyl-β-D-glucopyranoside | 2230883-55-1 | 1g |
| GC6564-2g | 4-Methylphenyl 1-thio-6-O-tosyl-β-D-glucopyranoside | 2230883-55-1 | 2g |
| GC6564-5g | 4-Methylphenyl 1-thio-6-O-tosyl-β-D-glucopyranoside | 2230883-55-1 | 5g |
| GC3283-250mg | 4-Methylphenyl 1-thio-α-D-mannopyranoside | 457931-46-3 | 250mg |
| GC3283-500mg | 4-Methylphenyl 1-thio-α-D-mannopyranoside | 457931-46-3 | 500mg |
| GC3283-1g | 4-Methylphenyl 1-thio-α-D-mannopyranoside | 457931-46-3 | 1g |
| GC3283-2g | 4-Methylphenyl 1-thio-α-D-mannopyranoside | 457931-46-3 | 2g |
| GC4423-50mg | 4-Methylphenyl 1-thio-β-D-glucopyranosiduronic acid | 50mg | |
| GC4423-100mg | 4-Methylphenyl 1-thio-β-D-glucopyranosiduronic acid | 100mg | |
| GC4423-250mg | 4-Methylphenyl 1-thio-β-D-glucopyranosiduronic acid | 250mg | |
| GC4423-500mg | 4-Methylphenyl 1-thio-β-D-glucopyranosiduronic acid | 500mg | |
| GC7577-100mg | 4-Methylphenyl 1-thio-β-D-glucopyranosiduronic acid sodium salt | 100mg | |
| GC7577-250mg | 4-Methylphenyl 1-thio-β-D-glucopyranosiduronic acid sodium salt | 250mg | |
| GC7577-500mg | 4-Methylphenyl 1-thio-β-D-glucopyranosiduronic acid sodium salt | 500mg | |
| GC7577-1g | 4-Methylphenyl 1-thio-β-D-glucopyranosiduronic acid sodium salt | 1g | |
| GC7237-500mg | 4-Methylphenyl 1-thio-β-D-xylopyranoside | 67803-94-5 | 500mg |
| GC7237-1g | 4-Methylphenyl 1-thio-β-D-xylopyranoside | 67803-94-5 | 1g |
| GC7237-2g | 4-Methylphenyl 1-thio-β-D-xylopyranoside | 67803-94-5 | 2g |
| GC7237-5g | 4-Methylphenyl 1-thio-β-D-xylopyranoside | 67803-94-5 | 5g |
| GC0904-250mg | 4-Methylphenyl 2-O-acetyl-3-O-benzyl-1-thio-β-D-glucopyranoside | 250mg | |
| GC0904-500mg | 4-Methylphenyl 2-O-acetyl-3-O-benzyl-1-thio-β-D-glucopyranoside | 500mg | |
| GC0904-1g | 4-Methylphenyl 2-O-acetyl-3-O-benzyl-1-thio-β-D-glucopyranoside | 1g | |
| GC0904-2g | 4-Methylphenyl 2-O-acetyl-3-O-benzyl-1-thio-β-D-glucopyranoside | 2g | |
| GC6048-500mg | 4-Methylphenyl 2-O-acetyl-3-O-benzyl-4,6-O-benzylidene-1-thio-β-D-galactopyranoside | 2170345-73-8 | 500mg |
| GC6048-1g | 4-Methylphenyl 2-O-acetyl-3-O-benzyl-4,6-O-benzylidene-1-thio-β-D-galactopyranoside | 2170345-73-8 | 1g |
| GC6048-2g | 4-Methylphenyl 2-O-acetyl-3-O-benzyl-4,6-O-benzylidene-1-thio-β-D-galactopyranoside | 2170345-73-8 | 2g |
| GC6048-5g | 4-Methylphenyl 2-O-acetyl-3-O-benzyl-4,6-O-benzylidene-1-thio-β-D-galactopyranoside | 2170345-73-8 | 5g |
| GC9074-50mg | 4-Methylphenyl 2-O-benzyl-1-thio-β-D-galactopyranoside | 50mg | |
| GC9074-100mg | 4-Methylphenyl 2-O-benzyl-1-thio-β-D-galactopyranoside | 100mg | |
| GC9074-250mg | 4-Methylphenyl 2-O-benzyl-1-thio-β-D-galactopyranoside | 250mg | |
| GC9074-500mg | 4-Methylphenyl 2-O-benzyl-1-thio-β-D-galactopyranoside | 500mg | |
| GC0088-1g | 4-Methylphenyl 2,2'',3,3'',4'',6,6''-hepta-O-acetyl-1-thio-β-D-maltoside | 27894-92-4 | 1g |
| GC0088-2g | 4-Methylphenyl 2,2'',3,3'',4'',6,6''-hepta-O-acetyl-1-thio-β-D-maltoside | 27894-92-4 | 2g |
| GC0088-5g | 4-Methylphenyl 2,2'',3,3'',4'',6,6''-hepta-O-acetyl-1-thio-β-D-maltoside | 27894-92-4 | 5g |
| GC0088-10g | 4-Methylphenyl 2,2'',3,3'',4'',6,6''-hepta-O-acetyl-1-thio-β-D-maltoside | 27894-92-4 | 10g |
| GC4879-100mg | 4-Methylphenyl 2,3-di-O-acetyl-1-thio-D-glucopyranosiduronic acid methyl ester | 100mg | |
| GC4879-250mg | 4-Methylphenyl 2,3-di-O-acetyl-1-thio-D-glucopyranosiduronic acid methyl ester | 250mg | |
| GC4879-500mg | 4-Methylphenyl 2,3-di-O-acetyl-1-thio-D-glucopyranosiduronic acid methyl ester | 500mg | |
| GC4879-1g | 4-Methylphenyl 2,3-di-O-acetyl-1-thio-D-glucopyranosiduronic acid methyl ester | 1g | |
| GC7497-250mg | 4-Methylphenyl 2,3-di-O-acetyl-1-thio-β-D-glucopyranoside | 849834-73-7 | 250mg |
| GC7497-500mg | 4-Methylphenyl 2,3-di-O-acetyl-1-thio-β-D-glucopyranoside | 849834-73-7 | 500mg |
| GC7497-1g | 4-Methylphenyl 2,3-di-O-acetyl-1-thio-β-D-glucopyranoside | 849834-73-7 | 1g |
| GC7497-2g | 4-Methylphenyl 2,3-di-O-acetyl-1-thio-β-D-glucopyranoside | 849834-73-7 | 2g |
| GC3415-1g | 4-Methylphenyl 2,3-di-O-acetyl-4,6-O-benzylidene-1-thio-β-D-galactopyranoside | 258333-93-6 | 1g |
| GC3415-2g | 4-Methylphenyl 2,3-di-O-acetyl-4,6-O-benzylidene-1-thio-β-D-galactopyranoside | 258333-93-6 | 2g |
| GC3415-5g | 4-Methylphenyl 2,3-di-O-acetyl-4,6-O-benzylidene-1-thio-β-D-galactopyranoside | 258333-93-6 | 5g |
| GC3415-10g | 4-Methylphenyl 2,3-di-O-acetyl-4,6-O-benzylidene-1-thio-β-D-galactopyranoside | 258333-93-6 | 10g |
| GC7154-1g | 4-Methylphenyl 2,3-di-O-acetyl-4,6-O-benzylidene-1-thio-β-D-glucopyranoside | 219518-20-4 | 1g |
| GC7154-2g | 4-Methylphenyl 2,3-di-O-acetyl-4,6-O-benzylidene-1-thio-β-D-glucopyranoside | 219518-20-4 | 2g |
| GC7154-5g | 4-Methylphenyl 2,3-di-O-acetyl-4,6-O-benzylidene-1-thio-β-D-glucopyranoside | 219518-20-4 | 5g |
| GC7154-10g | 4-Methylphenyl 2,3-di-O-acetyl-4,6-O-benzylidene-1-thio-β-D-glucopyranoside | 219518-20-4 | 10g |
| GC3490-1g | 4-Methylphenyl 2,3-di-O-acetyl-4,6-O-isopropylidene-1-thio-β-D-glucopyranoside | 1157902-68-5 | 1g |
| GC3490-2g | 4-Methylphenyl 2,3-di-O-acetyl-4,6-O-isopropylidene-1-thio-β-D-glucopyranoside | 1157902-68-5 | 2g |
| GC3490-5g | 4-Methylphenyl 2,3-di-O-acetyl-4,6-O-isopropylidene-1-thio-β-D-glucopyranoside | 1157902-68-5 | 5g |
| GC3490-10g | 4-Methylphenyl 2,3-di-O-acetyl-4,6-O-isopropylidene-1-thio-β-D-glucopyranoside | 1157902-68-5 | 10g |
| GC5892-1g | 4-Methylphenyl 2,3-di-O-benzoyl-4,6-O-benzylidene-1-thio-β-D-glucopyranoside | 1326804-93-6 | 1g |
| GC5892-2g | 4-Methylphenyl 2,3-di-O-benzoyl-4,6-O-benzylidene-1-thio-β-D-glucopyranoside | 1326804-93-6 | 2g |
| GC5892-5g | 4-Methylphenyl 2,3-di-O-benzoyl-4,6-O-benzylidene-1-thio-β-D-glucopyranoside | 1326804-93-6 | 5g |
| GC5892-10g | 4-Methylphenyl 2,3-di-O-benzoyl-4,6-O-benzylidene-1-thio-β-D-glucopyranoside | 1326804-93-6 | 10g |
| GC0429-500mg | 4-Methylphenyl 2,3-di-O-benzyl-1-thio-α-D-mannopyranoside | 922523-13-5 | 500mg |
| GC0429-1g | 4-Methylphenyl 2,3-di-O-benzyl-1-thio-α-D-mannopyranoside | 922523-13-5 | 1g |
| GC0429-2g | 4-Methylphenyl 2,3-di-O-benzyl-1-thio-α-D-mannopyranoside | 922523-13-5 | 2g |
| GC0429-5g | 4-Methylphenyl 2,3-di-O-benzyl-1-thio-α-D-mannopyranoside | 922523-13-5 | 5g |
| GC6736-1g | 4-Methylphenyl 2,3-di-O-benzyl-1-thio-β-D-glucopyranoside | 596087-18-2 | 1g |
| GC6736-2g | 4-Methylphenyl 2,3-di-O-benzyl-1-thio-β-D-glucopyranoside | 596087-18-2 | 2g |
| GC6736-5g | 4-Methylphenyl 2,3-di-O-benzyl-1-thio-β-D-glucopyranoside | 596087-18-2 | 5g |
| GC6736-10g | 4-Methylphenyl 2,3-di-O-benzyl-1-thio-β-D-glucopyranoside | 596087-18-2 | 10g |
| GC5500-250mg | 4-Methylphenyl 2,3-di-O-benzyl-4,6-O-benzylidene-1-thio-α-D-mannopyranoside | 922523-12-4 | 250mg |
| GC5500-500mg | 4-Methylphenyl 2,3-di-O-benzyl-4,6-O-benzylidene-1-thio-α-D-mannopyranoside | 922523-12-4 | 500mg |
| GC5500-1g | 4-Methylphenyl 2,3-di-O-benzyl-4,6-O-benzylidene-1-thio-α-D-mannopyranoside | 922523-12-4 | 1g |
| GC5500-2g | 4-Methylphenyl 2,3-di-O-benzyl-4,6-O-benzylidene-1-thio-α-D-mannopyranoside | 922523-12-4 | 2g |
| GC1691-1g | 4-Methylphenyl 2,3-di-O-benzyl-4,6-O-benzylidene-1-thio-β-D-glucopyranoside | 850416-39-6 | 1g |
| GC1691-2g | 4-Methylphenyl 2,3-di-O-benzyl-4,6-O-benzylidene-1-thio-β-D-glucopyranoside | 850416-39-6 | 2g |
| GC1691-5g | 4-Methylphenyl 2,3-di-O-benzyl-4,6-O-benzylidene-1-thio-β-D-glucopyranoside | 850416-39-6 | 5g |
| GC1691-10g | 4-Methylphenyl 2,3-di-O-benzyl-4,6-O-benzylidene-1-thio-β-D-glucopyranoside | 850416-39-6 | 10g |
| GC8918-250mg | 4-Methylphenyl 2,3-O-isopropylidene-1-thio-α-L-rhamnopyranoside | 903906-55-8 | 250mg |
| GC8918-500mg | 4-Methylphenyl 2,3-O-isopropylidene-1-thio-α-L-rhamnopyranoside | 903906-55-8 | 500mg |
| GC8918-1g | 4-Methylphenyl 2,3-O-isopropylidene-1-thio-α-L-rhamnopyranoside | 903906-55-8 | 1g |
| GC8918-2g | 4-Methylphenyl 2,3-O-isopropylidene-1-thio-α-L-rhamnopyranoside | 903906-55-8 | 2g |
| GC3603-100mg | 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-α-L-fucopyranoside | 100mg | |
| GC3603-250mg | 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-α-L-fucopyranoside | 250mg | |
| GC3603-500mg | 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-α-L-fucopyranoside | 500mg | |
| GC3603-1g | 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-α-L-fucopyranoside | 1g | |
| GC9943-1g | 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-α-L-rhamnopyranoside | 620951-70-4 | 1g |
| GC9943-2g | 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-α-L-rhamnopyranoside | 620951-70-4 | 2g |
| GC9943-5g | 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-α-L-rhamnopyranoside | 620951-70-4 | 5g |
| GC9943-10g | 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-α-L-rhamnopyranoside | 620951-70-4 | 10g |
| GC4788-250mg | 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-β-D-glucopyranosiduronic acid methyl ester | 61025-09-0 | 250mg |
| GC4788-500mg | 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-β-D-glucopyranosiduronic acid methyl ester | 61025-09-0 | 500mg |
| GC4788-1g | 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-β-D-glucopyranosiduronic acid methyl ester | 61025-09-0 | 1g |
| GC4788-2g | 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-β-D-glucopyranosiduronic acid methyl ester | 61025-09-0 | 2g |
| GC5737-1g | 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-β-D-xylopyranoside | 61025-08-9 | 1g |
| GC5737-2g | 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-β-D-xylopyranoside | 61025-08-9 | 2g |
| GC5737-5g | 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-β-D-xylopyranoside | 61025-08-9 | 5g |
| GC5737-10g | 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-β-D-xylopyranoside | 61025-08-9 | 10g |
| GC9917-250mg | 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-β-L-fucopyranoside | 153658-86-7 | 250mg |
| GC9917-500mg | 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-β-L-fucopyranoside | 153658-86-7 | 500mg |
| GC9917-1g | 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-β-L-fucopyranoside | 153658-86-7 | 1g |
| GC9917-2g | 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-β-L-fucopyranoside | 153658-86-7 | 2g |
| GC9915-500mg | 4-Methylphenyl 2,3,4-tri-O-acetyl-6-O-tert-butyldiphenylsilyl-1-thio-β-D-glucopyranoside | 959793-42-1 | 500mg |
| GC9915-1g | 4-Methylphenyl 2,3,4-tri-O-acetyl-6-O-tert-butyldiphenylsilyl-1-thio-β-D-glucopyranoside | 959793-42-1 | 1g |
| GC9915-2g | 4-Methylphenyl 2,3,4-tri-O-acetyl-6-O-tert-butyldiphenylsilyl-1-thio-β-D-glucopyranoside | 959793-42-1 | 2g |
| GC9915-5g | 4-Methylphenyl 2,3,4-tri-O-acetyl-6-O-tert-butyldiphenylsilyl-1-thio-β-D-glucopyranoside | 959793-42-1 | 5g |
| GC8690-1g | 4-Methylphenyl 2,3,4-tri-O-allyl-1-thio-β-D-xylopyranoside | 1g | |
| GC8690-2g | 4-Methylphenyl 2,3,4-tri-O-allyl-1-thio-β-D-xylopyranoside | 2g | |
| GC8690-5g | 4-Methylphenyl 2,3,4-tri-O-allyl-1-thio-β-D-xylopyranoside | 5g | |
| GC8690-10g | 4-Methylphenyl 2,3,4-tri-O-allyl-1-thio-β-D-xylopyranoside | 10g | |
| GC4332-250mg | 4-Methylphenyl 2,3,4-tri-O-benzyl-1-thio-β-D-glucopyranoside | 479252-05-6 | 250mg |
| GC4332-500mg | 4-Methylphenyl 2,3,4-tri-O-benzyl-1-thio-β-D-glucopyranoside | 479252-05-6 | 500mg |
| GC4332-1g | 4-Methylphenyl 2,3,4-tri-O-benzyl-1-thio-β-D-glucopyranoside | 479252-05-6 | 1g |
| GC4332-2g | 4-Methylphenyl 2,3,4-tri-O-benzyl-1-thio-β-D-glucopyranoside | 479252-05-6 | 2g |
| GC4119-100mg | 4-Methylphenyl 2,3,4-tri-O-benzyl-1-thio-β-D-glucopyranosiduronic acid | 1400906-88-8 | 100mg |
| GC4119-250mg | 4-Methylphenyl 2,3,4-tri-O-benzyl-1-thio-β-D-glucopyranosiduronic acid | 1400906-88-8 | 250mg |
| GC4119-500mg | 4-Methylphenyl 2,3,4-tri-O-benzyl-1-thio-β-D-glucopyranosiduronic acid | 1400906-88-8 | 500mg |
| GC4119-1g | 4-Methylphenyl 2,3,4-tri-O-benzyl-1-thio-β-D-glucopyranosiduronic acid | 1400906-88-8 | 1g |
| GC0500-500mg | 4-Methylphenyl 2,3,4-tri-O-benzyl-1-thio-β-D-xylopyranoside | 145079-53-4 | 500mg |
| GC0500-1g | 4-Methylphenyl 2,3,4-tri-O-benzyl-1-thio-β-D-xylopyranoside | 145079-53-4 | 1g |
| GC0500-2g | 4-Methylphenyl 2,3,4-tri-O-benzyl-1-thio-β-D-xylopyranoside | 145079-53-4 | 2g |
| GC0500-5g | 4-Methylphenyl 2,3,4-tri-O-benzyl-1-thio-β-D-xylopyranoside | 145079-53-4 | 5g |
| GC0500-10g | 4-Methylphenyl 2,3,4-tri-O-benzyl-1-thio-β-D-xylopyranoside | 145079-53-4 | 10g |
| GC7908-250mg | 4-Methylphenyl 2,3,4-tri-O-benzyl-1-thio-β-L-fucopyranoside | 211801-54-6 | 250mg |
| GC7908-500mg | 4-Methylphenyl 2,3,4-tri-O-benzyl-1-thio-β-L-fucopyranoside | 211801-54-6 | 500mg |
| GC7908-1g | 4-Methylphenyl 2,3,4-tri-O-benzyl-1-thio-β-L-fucopyranoside | 211801-54-6 | 1g |
| GC7908-2g | 4-Methylphenyl 2,3,4-tri-O-benzyl-1-thio-β-L-fucopyranoside | 211801-54-6 | 2g |
| GC5024-500mg | 4-Methylphenyl 2,3,4,6-tetra-O-acetyl-1-thio-α-D-mannopyranoside | 211801-79-5 | 500mg |
| GC5024-1g | 4-Methylphenyl 2,3,4,6-tetra-O-acetyl-1-thio-α-D-mannopyranoside | 211801-79-5 | 1g |
| GC5024-2g | 4-Methylphenyl 2,3,4,6-tetra-O-acetyl-1-thio-α-D-mannopyranoside | 211801-79-5 | 2g |
| GC5024-5g | 4-Methylphenyl 2,3,4,6-tetra-O-acetyl-1-thio-α-D-mannopyranoside | 211801-79-5 | 5g |
| GC9493-100mg | 4-Methylphenyl 2,3,4,6-tetra-O-acetyl-1-thio-β-D-glucopyranoside-1,2,3,4,5,6-13C6 | 100mg | |
| GC9493-250mg | 4-Methylphenyl 2,3,4,6-tetra-O-acetyl-1-thio-β-D-glucopyranoside-1,2,3,4,5,6-13C6 | 250mg | |
| GC9493-500mg | 4-Methylphenyl 2,3,4,6-tetra-O-acetyl-1-thio-β-D-glucopyranoside-1,2,3,4,5,6-13C6 | 500mg | |
| GC9493-1g | 4-Methylphenyl 2,3,4,6-tetra-O-acetyl-1-thio-β-D-glucopyranoside-1,2,3,4,5,6-13C6 | 1g | |
| GC2857-1g | 4-Methylphenyl 2,3,4,6-tetra-O-acetyl-b-D-thiogalactopyranoside | 28244-99-7 | 1g |
| GC2857-2g | 4-Methylphenyl 2,3,4,6-tetra-O-acetyl-b-D-thiogalactopyranoside | 28244-99-7 | 2g |
| GC2857-5g | 4-Methylphenyl 2,3,4,6-tetra-O-acetyl-b-D-thiogalactopyranoside | 28244-99-7 | 5g |
| GC2857-10g | 4-Methylphenyl 2,3,4,6-tetra-O-acetyl-b-D-thiogalactopyranoside | 28244-99-7 | 10g |
| GC2857-25g | 4-Methylphenyl 2,3,4,6-tetra-O-acetyl-b-D-thiogalactopyranoside | 28244-99-7 | 25g |
| GC5807-2g | 4-Methylphenyl 2,3,4,6-tetra-O-acetyl-b-D-thioglucopyranoside | 28244-94-2 | 2g |
| GC5807-5g | 4-Methylphenyl 2,3,4,6-tetra-O-acetyl-b-D-thioglucopyranoside | 28244-94-2 | 5g |
| GC5807-10g | 4-Methylphenyl 2,3,4,6-tetra-O-acetyl-b-D-thioglucopyranoside | 28244-94-2 | 10g |
| GC5807-25g | 4-Methylphenyl 2,3,4,6-tetra-O-acetyl-b-D-thioglucopyranoside | 28244-94-2 | 25g |
| GC3037-1g | 4-Methylphenyl 2,3,4,6-tetra-O-benzyl-1-thio-β-D-galactopyranoside | 211678-08-9 | 1g |
| GC3037-2g | 4-Methylphenyl 2,3,4,6-tetra-O-benzyl-1-thio-β-D-galactopyranoside | 211678-08-9 | 2g |
| GC3037-5g | 4-Methylphenyl 2,3,4,6-tetra-O-benzyl-1-thio-β-D-galactopyranoside | 211678-08-9 | 5g |
| GC3037-10g | 4-Methylphenyl 2,3,4,6-tetra-O-benzyl-1-thio-β-D-galactopyranoside | 211678-08-9 | 10g |
| GC5938-500mg | 4-Methylphenyl 2,3,6-tri-O-acetyl-1-thio-β-D-glucopyranoside | 2281774-76-1 | 500mg |
| GC5938-1g | 4-Methylphenyl 2,3,6-tri-O-acetyl-1-thio-β-D-glucopyranoside | 2281774-76-1 | 1g |
| GC5938-2g | 4-Methylphenyl 2,3,6-tri-O-acetyl-1-thio-β-D-glucopyranoside | 2281774-76-1 | 2g |
| GC5938-5g | 4-Methylphenyl 2,3,6-tri-O-acetyl-1-thio-β-D-glucopyranoside | 2281774-76-1 | 5g |
| GC0498-100mg | 4-Methylphenyl 2,4-di-O-acetyl-1-thio-β-D-glucopyranosylurono-6,3-lactone | 100mg | |
| GC0498-250mg | 4-Methylphenyl 2,4-di-O-acetyl-1-thio-β-D-glucopyranosylurono-6,3-lactone | 250mg | |
| GC0498-500mg | 4-Methylphenyl 2,4-di-O-acetyl-1-thio-β-D-glucopyranosylurono-6,3-lactone | 500mg | |
| GC0498-1g | 4-Methylphenyl 2,4-di-O-acetyl-1-thio-β-D-glucopyranosylurono-6,3-lactone | 1g | |
| GC2275-100mg | 4-Methylphenyl 2,4-di-O-acetyl-3-O-benzyl-1-thio-β-D-glucopyranosiduronic acid methyl ester | 100mg | |
| GC2275-250mg | 4-Methylphenyl 2,4-di-O-acetyl-3-O-benzyl-1-thio-β-D-glucopyranosiduronic acid methyl ester | 250mg | |
| GC2275-500mg | 4-Methylphenyl 2,4-di-O-acetyl-3-O-benzyl-1-thio-β-D-glucopyranosiduronic acid methyl ester | 500mg | |
| GC2275-1g | 4-Methylphenyl 2,4-di-O-acetyl-3-O-benzyl-1-thio-β-D-glucopyranosiduronic acid methyl ester | 1g | |
| GC5490-250mg | 4-Methylphenyl 2,4,6-tri-O-acetyl-1-thio-β-D-galactopyranoside | 211676-47-0 | 250mg |
| GC5490-500mg | 4-Methylphenyl 2,4,6-tri-O-acetyl-1-thio-β-D-galactopyranoside | 211676-47-0 | 500mg |
| GC5490-1g | 4-Methylphenyl 2,4,6-tri-O-acetyl-1-thio-β-D-galactopyranoside | 211676-47-0 | 1g |
| GC5490-2g | 4-Methylphenyl 2,4,6-tri-O-acetyl-1-thio-β-D-galactopyranoside | 211676-47-0 | 2g |
| GC1791-1g | 4-Methylphenyl 2,4,6-tri-O-acetyl-3-O-benzyl-1-thio-β-D-glucopyranoside | 959153-39-0 | 1g |
| GC1791-2g | 4-Methylphenyl 2,4,6-tri-O-acetyl-3-O-benzyl-1-thio-β-D-glucopyranoside | 959153-39-0 | 2g |
| GC1791-5g | 4-Methylphenyl 2,4,6-tri-O-acetyl-3-O-benzyl-1-thio-β-D-glucopyranoside | 959153-39-0 | 5g |
| GC1791-10g | 4-Methylphenyl 2,4,6-tri-O-acetyl-3-O-benzyl-1-thio-β-D-glucopyranoside | 959153-39-0 | 10g |
| GC9156-100mg | 4-Methylphenyl 3-O-benzoyl-4,6-O-benzylidene-1-thio-α-D-mannopyranoside | 100mg | |
| GC9156-250mg | 4-Methylphenyl 3-O-benzoyl-4,6-O-benzylidene-1-thio-α-D-mannopyranoside | 250mg | |
| GC9156-500mg | 4-Methylphenyl 3-O-benzoyl-4,6-O-benzylidene-1-thio-α-D-mannopyranoside | 500mg | |
| GC9328-500mg | 4-Methylphenyl 3-O-benzyl-4,6-O-benzylidene-1-thio-β-D-galactopyranoside | 1042430-51-2 | 500mg |
| GC9328-1g | 4-Methylphenyl 3-O-benzyl-4,6-O-benzylidene-1-thio-β-D-galactopyranoside | 1042430-51-2 | 1g |
| GC9328-2g | 4-Methylphenyl 3-O-benzyl-4,6-O-benzylidene-1-thio-β-D-galactopyranoside | 1042430-51-2 | 2g |
| GC9328-5g | 4-Methylphenyl 3-O-benzyl-4,6-O-benzylidene-1-thio-β-D-galactopyranoside | 1042430-51-2 | 5g |
| GC7960-100mg | 4-Methylphenyl 3,4,6-tri-O-acetyl-2-O-benzyl-1-thio-β-D-galactopyranoside | 189744-09-0 | 100mg |
| GC7960-250mg | 4-Methylphenyl 3,4,6-tri-O-acetyl-2-O-benzyl-1-thio-β-D-galactopyranoside | 189744-09-0 | 250mg |
| GC7960-500mg | 4-Methylphenyl 3,4,6-tri-O-acetyl-2-O-benzyl-1-thio-β-D-galactopyranoside | 189744-09-0 | 500mg |
| GC7960-1g | 4-Methylphenyl 3,4,6-tri-O-acetyl-2-O-benzyl-1-thio-β-D-galactopyranoside | 189744-09-0 | 1g |
| GC0536-500mg | 4-Methylphenyl 4-O-benzyl-1-thio-α-L-rhamnopyranoside | 1053179-22-8 | 500mg |
| GC0536-1g | 4-Methylphenyl 4-O-benzyl-1-thio-α-L-rhamnopyranoside | 1053179-22-8 | 1g |
| GC0536-2g | 4-Methylphenyl 4-O-benzyl-1-thio-α-L-rhamnopyranoside | 1053179-22-8 | 2g |
| GC0536-5g | 4-Methylphenyl 4-O-benzyl-1-thio-α-L-rhamnopyranoside | 1053179-22-8 | 5g |
| GC2287-500mg | 4-Methylphenyl 4,6-O-benzylidene-1-thio-α-D-mannopyranoside | 2173297-55-5 | 500mg |
| GC2287-1g | 4-Methylphenyl 4,6-O-benzylidene-1-thio-α-D-mannopyranoside | 2173297-55-5 | 1g |
| GC2287-2g | 4-Methylphenyl 4,6-O-benzylidene-1-thio-α-D-mannopyranoside | 2173297-55-5 | 2g |
| GC2287-5g | 4-Methylphenyl 4,6-O-benzylidene-1-thio-α-D-mannopyranoside | 2173297-55-5 | 5g |
| GC0654-1g | 4-Methylphenyl 4,6-O-benzylidene-b-D-thioglucopyranoside | 868241-49-0 | 1g |
| GC0654-2g | 4-Methylphenyl 4,6-O-benzylidene-b-D-thioglucopyranoside | 868241-49-0 | 2g |
| GC0654-5g | 4-Methylphenyl 4,6-O-benzylidene-b-D-thioglucopyranoside | 868241-49-0 | 5g |
| GC0654-10g | 4-Methylphenyl 4,6-O-benzylidene-b-D-thioglucopyranoside | 868241-49-0 | 10g |
| GC5071-1g | 4-Methylphenyl 4,6-O-Benzylidene-β-D-thiogalactopyranoside | 161007-96-1 | 1g |
| GC5071-2g | 4-Methylphenyl 4,6-O-Benzylidene-β-D-thiogalactopyranoside | 161007-96-1 | 2g |
| GC5071-5g | 4-Methylphenyl 4,6-O-Benzylidene-β-D-thiogalactopyranoside | 161007-96-1 | 5g |
| GC5071-10g | 4-Methylphenyl 4,6-O-Benzylidene-β-D-thiogalactopyranoside | 161007-96-1 | 10g |
| GC4505-1g | 4-Methylphenyl 4,6-O-isopropylidene-1-thio-β-D-glucopyranoside | 905716-02-1 | 1g |
| GC4505-2g | 4-Methylphenyl 4,6-O-isopropylidene-1-thio-β-D-glucopyranoside | 905716-02-1 | 2g |
| GC4505-5g | 4-Methylphenyl 4,6-O-isopropylidene-1-thio-β-D-glucopyranoside | 905716-02-1 | 5g |
| GC4505-10g | 4-Methylphenyl 4,6-O-isopropylidene-1-thio-β-D-glucopyranoside | 905716-02-1 | 10g |
| GC4801-250mg | 4-Methylphenyl 6-O-acetyl-2,3-di-O-benzyl-1-thio-β-D-glucopyranoside | 637316-98-4 | 250mg |
| GC4801-500mg | 4-Methylphenyl 6-O-acetyl-2,3-di-O-benzyl-1-thio-β-D-glucopyranoside | 637316-98-4 | 500mg |
| GC4801-1g | 4-Methylphenyl 6-O-acetyl-2,3-di-O-benzyl-1-thio-β-D-glucopyranoside | 637316-98-4 | 1g |
| GC4801-2g | 4-Methylphenyl 6-O-acetyl-2,3-di-O-benzyl-1-thio-β-D-glucopyranoside | 637316-98-4 | 2g |
| GC4274-100mg | 4-Methylphenyl 6-O-acetyl-2,3,4-tri-O-benzyl-1-thio-D-glucopyranoside | 100mg | |
| GC4274-250mg | 4-Methylphenyl 6-O-acetyl-2,3,4-tri-O-benzyl-1-thio-D-glucopyranoside | 250mg | |
| GC4274-500mg | 4-Methylphenyl 6-O-acetyl-2,3,4-tri-O-benzyl-1-thio-D-glucopyranoside | 500mg | |
| GC4274-1g | 4-Methylphenyl 6-O-acetyl-2,3,4-tri-O-benzyl-1-thio-D-glucopyranoside | 1g | |
| GC4274-2g | 4-Methylphenyl 6-O-acetyl-2,3,4-tri-O-benzyl-1-thio-D-glucopyranoside | 2g | |
| GC0990-500mg | 4-Methylphenyl 6-O-acetyl-2,3,4-tri-O-benzyl-1-thio-α-D-glucopyranoside | 1941225-54-2 | 500mg |
| GC0990-1g | 4-Methylphenyl 6-O-acetyl-2,3,4-tri-O-benzyl-1-thio-α-D-glucopyranoside | 1941225-54-2 | 1g |
| GC0990-2g | 4-Methylphenyl 6-O-acetyl-2,3,4-tri-O-benzyl-1-thio-α-D-glucopyranoside | 1941225-54-2 | 2g |
| GC0990-5g | 4-Methylphenyl 6-O-acetyl-2,3,4-tri-O-benzyl-1-thio-α-D-glucopyranoside | 1941225-54-2 | 5g |
| GC0402-1g | 4-Methylphenyl b-D-thioglucopyranoside | 1152-39-2 | 1g |
| GC0402-2g | 4-Methylphenyl b-D-thioglucopyranoside | 1152-39-2 | 2g |
| GC0402-5g | 4-Methylphenyl b-D-thioglucopyranoside | 1152-39-2 | 5g |
| GC0402-10g | 4-Methylphenyl b-D-thioglucopyranoside | 1152-39-2 | 10g |
| GC6589-2g | 4-Methylphenylthio-β-D-galactopyranoside | 28244-98-6 | 2g |
| GC6589-5g | 4-Methylphenylthio-β-D-galactopyranoside | 28244-98-6 | 5g |
| GC6589-10g | 4-Methylphenylthio-β-D-galactopyranoside | 28244-98-6 | 10g |
| GC6589-25g | 4-Methylphenylthio-β-D-galactopyranoside | 28244-98-6 | 25g |
| GE8143-25g | 4-Methylumbelliferone | 90-33-5 | 25g |
| GE8143-100g | 4-Methylumbelliferone | 90-33-5 | 100g |
| GE8143-250g | 4-Methylumbelliferone | 90-33-5 | 250g |
| GE8143-500g | 4-Methylumbelliferone | 90-33-5 | 500g |
| GE8143-1kg | 4-Methylumbelliferone | 90-33-5 | 1kg |
| GC7128-250mg | 4-Methylumbelliferyl 2-acetamido-2-deoxy-b-D-glucopyranoside | 37067-30-4 | 250mg |
| GC6703-1mg | 4-Methylumbelliferyl 3-O-α-D-xylopyranosyl-β-D-glucopyranoside | 1mg | |
| GC6703-2mg | 4-Methylumbelliferyl 3-O-α-D-xylopyranosyl-β-D-glucopyranoside | 2mg | |
| GC6703-5mg | 4-Methylumbelliferyl 3-O-α-D-xylopyranosyl-β-D-glucopyranoside | 5mg | |
| GC6703-10mg | 4-Methylumbelliferyl 3-O-α-D-xylopyranosyl-β-D-glucopyranoside | 10mg | |
| GC5401-25mg | 4-Methylumbelliferyl a-D-galactopyranoside | 38597-12-5 | 25mg |
| GC5401-100mg | 4-Methylumbelliferyl a-D-galactopyranoside | 38597-12-5 | 100mg |
| GC5401-250mg | 4-Methylumbelliferyl a-D-galactopyranoside | 38597-12-5 | 250mg |
| GC1434-100mg | 4-Methylumbelliferyl a-D-glucopyranoside | 17833-43-1 | 100mg |
| GC1434-250mg | 4-Methylumbelliferyl a-D-glucopyranoside | 17833-43-1 | 250mg |
| GC3812-2mg | 4-Methylumbelliferyl a-L-idopyranosiduronic acid | 66966-09-4 | 2mg |
| GC5543-1mg | 4-Methylumbelliferyl a-L-idopyranosiduronic acid sodium salt | 89157-94-8 | 1mg |
| GC5543-2mg | 4-Methylumbelliferyl a-L-idopyranosiduronic acid sodium salt | 89157-94-8 | 2mg |
| GC5543-5mg | 4-Methylumbelliferyl a-L-idopyranosiduronic acid sodium salt | 89157-94-8 | 5mg |
| GC5543-10mg | 4-Methylumbelliferyl a-L-idopyranosiduronic acid sodium salt | 89157-94-8 | 10mg |
| GC5543-25mg | 4-Methylumbelliferyl a-L-idopyranosiduronic acid sodium salt | 89157-94-8 | 25mg |
| GC1749-20g | 4-Methylumbelliferyl acetate | 2747-05-9 | 20g |
| GC1749-100g | 4-Methylumbelliferyl acetate | 2747-05-9 | 100g |
| GC6773-250mg | 4-Methylumbelliferyl b-D-cellobioside | 72626-61-0 | 250mg |
| GC6773-500mg | 4-Methylumbelliferyl b-D-cellobioside | 72626-61-0 | 500mg |
| GC6773-1g | 4-Methylumbelliferyl b-D-cellobioside | 72626-61-0 | 1g |
| GC6773-2g | 4-Methylumbelliferyl b-D-cellobioside | 72626-61-0 | 2g |
| GC7534-1mg | 4-Methylumbelliferyl b-D-cellohexoside | 84325-21-3 | 1mg |
| GC7534-2mg | 4-Methylumbelliferyl b-D-cellohexoside | 84325-21-3 | 2mg |
| GC7534-5mg | 4-Methylumbelliferyl b-D-cellohexoside | 84325-21-3 | 5mg |
| GC6850-1mg | 4-Methylumbelliferyl b-D-cellopentoside | 84325-20-2 | 1mg |
| GC6850-2mg | 4-Methylumbelliferyl b-D-cellopentoside | 84325-20-2 | 2mg |
| GC6850-5mg | 4-Methylumbelliferyl b-D-cellopentoside | 84325-20-2 | 5mg |
| GC6850-10mg | 4-Methylumbelliferyl b-D-cellopentoside | 84325-20-2 | 10mg |
| GC9821-1mg | 4-Methylumbelliferyl b-D-cellotetroside | 84325-19-9 | 1mg |
| GC9821-2mg | 4-Methylumbelliferyl b-D-cellotetroside | 84325-19-9 | 2mg |
| GC9821-5mg | 4-Methylumbelliferyl b-D-cellotetroside | 84325-19-9 | 5mg |
| GC9821-10mg | 4-Methylumbelliferyl b-D-cellotetroside | 84325-19-9 | 10mg |
| GC7245-1mg | 4-Methylumbelliferyl b-D-cellotrioside | 84325-18-8 | 1mg |
| GC7245-2mg | 4-Methylumbelliferyl b-D-cellotrioside | 84325-18-8 | 2mg |
| GC7245-5mg | 4-Methylumbelliferyl b-D-cellotrioside | 84325-18-8 | 5mg |
| GC7245-10mg | 4-Methylumbelliferyl b-D-cellotrioside | 84325-18-8 | 10mg |
| GC6034-250mg | 4-Methylumbelliferyl b-D-galactopyranoside | 6160-78-7 | 250mg |
| GC6034-1g | 4-Methylumbelliferyl b-D-galactopyranoside | 6160-78-7 | 1g |
| GC6034-5g | 4-Methylumbelliferyl b-D-galactopyranoside | 6160-78-7 | 5g |
| GC0596-100mg | 4-Methylumbelliferyl b-D-glucopyranoside | 18997-57-4 | 100mg |
| GC0596-250mg | 4-Methylumbelliferyl b-D-glucopyranoside | 18997-57-4 | 250mg |
| GC0596-500mg | 4-Methylumbelliferyl b-D-glucopyranoside | 18997-57-4 | 500mg |
| GC0596-1g | 4-Methylumbelliferyl b-D-glucopyranoside | 18997-57-4 | 1g |
| GC5027-250mg | 4-Methylumbelliferyl b-D-glucuronide hydrate | 6160-80-1 | 250mg |
| GC5027-1g | 4-Methylumbelliferyl b-D-glucuronide hydrate | 6160-80-1 | 1g |
| GC5027-5g | 4-Methylumbelliferyl b-D-glucuronide hydrate | 6160-80-1 | 5g |
| GC0151-250mg | 4-Methylumbelliferyl b-D-glucuronide trihydrate | 199329-67-4 | 250mg |
| GC0151-1g | 4-Methylumbelliferyl b-D-glucuronide trihydrate | 199329-67-4 | 1g |
| GC0151-5g | 4-Methylumbelliferyl b-D-glucuronide trihydrate | 199329-67-4 | 5g |
| GW3653-1g | 4-Methylumbelliferyl beta-D-glucuronide dihydrate | 881005-91-0 | 1g |
| GC0011-5g | 4-Methylumbelliferyl butyrate | 17695-46-4 | 5g |
| GC0011-20g | 4-Methylumbelliferyl butyrate | 17695-46-4 | 20g |
| GC0011-125g | 4-Methylumbelliferyl butyrate | 17695-46-4 | 125g |
| GC0745-5g | 4-Methylumbelliferyl caprylate | 20671-66-3 | 5g |
| GC0745-25g | 4-Methylumbelliferyl caprylate | 20671-66-3 | 25g |
| GW1688-100mg | 4-Methylumbelliferyl heptanoate | 18319-92-1 | 100mg |
| GW1688-500mg | 4-Methylumbelliferyl heptanoate | 18319-92-1 | 500mg |
| GE8516-5g | 4-Methylumbelliferyl nonanoate | 18319-93-2 | 5g |
| GE8516-25g | 4-Methylumbelliferyl nonanoate | 18319-93-2 | 25g |
| GC3615-25mg | 4-Methylumbelliferyl oleate | 18323-58-5 | 25mg |
| GC3615-250mg | 4-Methylumbelliferyl oleate | 18323-58-5 | 250mg |
| GC3615-2500mg | 4-Methylumbelliferyl oleate | 18323-58-5 | 2500mg |
| GC1583-250mg | 4-Methylumbelliferyl phosphate | 3368-04-5 | 250mg |
| GC1583-1g | 4-Methylumbelliferyl phosphate | 3368-04-5 | 1g |
| GC5745-250mg | 4-Methylumbelliferyl phosphate disodium salt | 22919-26-2 | 250mg |
| GC5745-1g | 4-Methylumbelliferyl phosphate disodium salt | 22919-26-2 | 1g |
| GC5001-1g | 4-Methylumbelliferyl sulfate potassium salt | 15220-11-8 | 1g |
| GC6550-25mg | 4-Methylumbelliferyl α-L-rhamnopyranoside | 106488-05-5 | 25mg |
| GC6550-50mg | 4-Methylumbelliferyl α-L-rhamnopyranoside | 106488-05-5 | 50mg |
| GC6550-100mg | 4-Methylumbelliferyl α-L-rhamnopyranoside | 106488-05-5 | 100mg |
| GC6550-250mg | 4-Methylumbelliferyl α-L-rhamnopyranoside | 106488-05-5 | 250mg |
| GC7203-25mg | 4-Methylumbelliferyl β-D-xylopyranoside | 6734-33-4 | 25mg |
| GC7203-100mg | 4-Methylumbelliferyl β-D-xylopyranoside | 6734-33-4 | 100mg |
| GC7203-250mg | 4-Methylumbelliferyl β-D-xylopyranoside | 6734-33-4 | 250mg |
| GC7144-100mg | 4-Methyphenyl 4,7,8,9-tetra-O-acetyl-2-thio-β-N-acetylneuraminic acid methyl ester | 358681-51-3 | 100mg |
| GC7144-250mg | 4-Methyphenyl 4,7,8,9-tetra-O-acetyl-2-thio-β-N-acetylneuraminic acid methyl ester | 358681-51-3 | 250mg |
| GC7144-500mg | 4-Methyphenyl 4,7,8,9-tetra-O-acetyl-2-thio-β-N-acetylneuraminic acid methyl ester | 358681-51-3 | 500mg |
| GC7144-1g | 4-Methyphenyl 4,7,8,9-tetra-O-acetyl-2-thio-β-N-acetylneuraminic acid methyl ester | 358681-51-3 | 1g |
| GK3210-25g | 4-Nitrobenzaldehyde | 555-16-8 | 25g |
| GK5397-25g | 4-Nitrobenzoic acid | 62-23-7 | 25g |
| GK9069-25g | 4-Nitrobenzyl bromide | 100-11-8 | 25g |
| GK1498-25g | 4-Nitrobenzyl chloride | 100-14-1 | 25g |
| GK1498-100g | 4-Nitrobenzyl chloride | 100-14-1 | 100g |
| GK7618-5g | 4-Nitrobenzyl chloroformate | 4457-32-3 | 5g |
| GK7618-10g | 4-Nitrobenzyl chloroformate | 4457-32-3 | 10g |
| GK7618-25g | 4-Nitrobenzyl chloroformate | 4457-32-3 | 25g |
| GE4873-5g | 4-Nitroimidazole | 3034-38-6 | 5g |
| GK3547-25g | 4-Nitrophenol | 100-02-7 | 25g |
| GC5753-100mg | 4-Nitrophenoxycarbonyl 2,3,4-tri-O-acetyl-β-D-glucopyranuronic acid methyl ester | 228412-71-3 | 100mg |
| GC5753-250mg | 4-Nitrophenoxycarbonyl 2,3,4-tri-O-acetyl-β-D-glucopyranuronic acid methyl ester | 228412-71-3 | 250mg |
| GC5753-500mg | 4-Nitrophenoxycarbonyl 2,3,4-tri-O-acetyl-β-D-glucopyranuronic acid methyl ester | 228412-71-3 | 500mg |
| GC9252-25mg | 4-Nitrophenoxycarbonyl 2,3,4-tri-O-benzyl-β-D-glucopyranuronic acid benzyl ester | 1311144-66-7 | 25mg |
| GC9252-50mg | 4-Nitrophenoxycarbonyl 2,3,4-tri-O-benzyl-β-D-glucopyranuronic acid benzyl ester | 1311144-66-7 | 50mg |
| GC9252-100mg | 4-Nitrophenoxycarbonyl 2,3,4-tri-O-benzyl-β-D-glucopyranuronic acid benzyl ester | 1311144-66-7 | 100mg |
| GC9252-250mg | 4-Nitrophenoxycarbonyl 2,3,4-tri-O-benzyl-β-D-glucopyranuronic acid benzyl ester | 1311144-66-7 | 250mg |
| GC9252-500mg | 4-Nitrophenoxycarbonyl 2,3,4-tri-O-benzyl-β-D-glucopyranuronic acid benzyl ester | 1311144-66-7 | 500mg |
| GC1726-1mg | 4-Nitrophenyl 2-acetamido-2-deoxy-3-O-(b-D-galactopyranosyl)-b-D-glucopyranoside | 57467-13-7 | 1mg |
| GC1726-2mg | 4-Nitrophenyl 2-acetamido-2-deoxy-3-O-(b-D-galactopyranosyl)-b-D-glucopyranoside | 57467-13-7 | 2mg |
| GC1726-5mg | 4-Nitrophenyl 2-acetamido-2-deoxy-3-O-(b-D-galactopyranosyl)-b-D-glucopyranoside | 57467-13-7 | 5mg |
| GC1726-10mg | 4-Nitrophenyl 2-acetamido-2-deoxy-3-O-(b-D-galactopyranosyl)-b-D-glucopyranoside | 57467-13-7 | 10mg |
| GC1726-25mg | 4-Nitrophenyl 2-acetamido-2-deoxy-3-O-(b-D-galactopyranosyl)-b-D-glucopyranoside | 57467-13-7 | 25mg |
| GC8698-100mg | 4-Nitrophenyl 2-acetamido-2-deoxy-b-D-glucopyranoside | 3459-18-5 | 100mg |
| GC8698-250mg | 4-Nitrophenyl 2-acetamido-2-deoxy-b-D-glucopyranoside | 3459-18-5 | 250mg |
| GC8698-500mg | 4-Nitrophenyl 2-acetamido-2-deoxy-b-D-glucopyranoside | 3459-18-5 | 500mg |
| GC8698-1g | 4-Nitrophenyl 2-acetamido-2-deoxy-b-D-glucopyranoside | 3459-18-5 | 1g |
| GC9827-500mg | 4-Nitrophenyl 2,3,4-tri-O-acetyl-β-L-fucopyranoside | 24332-99-8 | 500mg |
| GC9827-1g | 4-Nitrophenyl 2,3,4-tri-O-acetyl-β-L-fucopyranoside | 24332-99-8 | 1g |
| GC9827-2g | 4-Nitrophenyl 2,3,4-tri-O-acetyl-β-L-fucopyranoside | 24332-99-8 | 2g |
| GC9827-5g | 4-Nitrophenyl 2,3,4-tri-O-acetyl-β-L-fucopyranoside | 24332-99-8 | 5g |
| GC8979-250mg | 4-Nitrophenyl 2,3,4,6-Tri-O-acetyl-α-D-mannopyranoside | 13242-51-8 | 250mg |
| GC8979-500mg | 4-Nitrophenyl 2,3,4,6-Tri-O-acetyl-α-D-mannopyranoside | 13242-51-8 | 500mg |
| GC8979-1g | 4-Nitrophenyl 2,3,4,6-Tri-O-acetyl-α-D-mannopyranoside | 13242-51-8 | 1g |
| GC8979-2g | 4-Nitrophenyl 2,3,4,6-Tri-O-acetyl-α-D-mannopyranoside | 13242-51-8 | 2g |
| GC8979-5g | 4-Nitrophenyl 2,3,4,6-Tri-O-acetyl-α-D-mannopyranoside | 13242-51-8 | 5g |
| GC1104-25mg | 4-Nitrophenyl 2,4-di-O-acetyl-3-O-allyl-6-O-trityl-α-D-mannopyranoside | 25mg | |
| GC1104-50mg | 4-Nitrophenyl 2,4-di-O-acetyl-3-O-allyl-6-O-trityl-α-D-mannopyranoside | 50mg | |
| GC1104-100mg | 4-Nitrophenyl 2,4-di-O-acetyl-3-O-allyl-6-O-trityl-α-D-mannopyranoside | 100mg | |
| GC1104-250mg | 4-Nitrophenyl 2,4-di-O-acetyl-3-O-allyl-6-O-trityl-α-D-mannopyranoside | 250mg | |
| GC1104-500mg | 4-Nitrophenyl 2,4-di-O-acetyl-3-O-allyl-6-O-trityl-α-D-mannopyranoside | 500mg | |
| GC6978-2mg | 4-Nitrophenyl 3,6-di-O-(α-D-mannopyranosyl)-α-D-mannopyranoside | 443346-78-9 | 2mg |
| GC6978-5mg | 4-Nitrophenyl 3,6-di-O-(α-D-mannopyranosyl)-α-D-mannopyranoside | 443346-78-9 | 5mg |
| GC6978-10mg | 4-Nitrophenyl 3,6-di-O-(α-D-mannopyranosyl)-α-D-mannopyranoside | 443346-78-9 | 10mg |
| GC6978-25mg | 4-Nitrophenyl 3,6-di-O-(α-D-mannopyranosyl)-α-D-mannopyranoside | 443346-78-9 | 25mg |
| GC5779-25mg | 4-Nitrophenyl 6-O-diphenylphosphoryl-α-D-mannopyranoside | 25mg | |
| GC5779-50mg | 4-Nitrophenyl 6-O-diphenylphosphoryl-α-D-mannopyranoside | 50mg | |
| GC5779-100mg | 4-Nitrophenyl 6-O-diphenylphosphoryl-α-D-mannopyranoside | 100mg | |
| GC5779-250mg | 4-Nitrophenyl 6-O-diphenylphosphoryl-α-D-mannopyranoside | 250mg | |
| GC8292-100mg | 4-Nitrophenyl a-D-galactopyranoside | 7493-95-0 | 100mg |
| GC8292-250mg | 4-Nitrophenyl a-D-galactopyranoside | 7493-95-0 | 250mg |
| GC8292-500mg | 4-Nitrophenyl a-D-galactopyranoside | 7493-95-0 | 500mg |
| GC8292-1g | 4-Nitrophenyl a-D-galactopyranoside | 7493-95-0 | 1g |
| GC8292-5g | 4-Nitrophenyl a-D-galactopyranoside | 7493-95-0 | 5g |
| GC9732-1g | 4-Nitrophenyl a-D-glucopyranoside | 3767-28-0 | 1g |
| GC9732-5g | 4-Nitrophenyl a-D-glucopyranoside | 3767-28-0 | 5g |
| GC9732-10g | 4-Nitrophenyl a-D-glucopyranoside | 3767-28-0 | 10g |
| GC9732-25g | 4-Nitrophenyl a-D-glucopyranoside | 3767-28-0 | 25g |
| GC4497-25mg | 4-Nitrophenyl a-L-fucopyranoside | 10231-84-2 | 25mg |
| GC4497-100mg | 4-Nitrophenyl a-L-fucopyranoside | 10231-84-2 | 100mg |
| GC4497-250mg | 4-Nitrophenyl a-L-fucopyranoside | 10231-84-2 | 250mg |
| GC1109-100mg | 4-Nitrophenyl b-D-cellobioside | 3482-57-3 | 100mg |
| GC1109-500mg | 4-Nitrophenyl b-D-cellobioside | 3482-57-3 | 500mg |
| GC3225-250mg | 4-Nitrophenyl b-D-galactopyranoside | 3150-24-1 | 250mg |
| GC3225-500mg | 4-Nitrophenyl b-D-galactopyranoside | 3150-24-1 | 500mg |
| GC3225-1g | 4-Nitrophenyl b-D-galactopyranoside | 3150-24-1 | 1g |
| GC3225-5g | 4-Nitrophenyl b-D-galactopyranoside | 3150-24-1 | 5g |
| GC3225-10g | 4-Nitrophenyl b-D-galactopyranoside | 3150-24-1 | 10g |
| GC1754-500mg | 4-Nitrophenyl b-D-glucopyranoside | 2492-87-7 | 500mg |
| GC1754-1g | 4-Nitrophenyl b-D-glucopyranoside | 2492-87-7 | 1g |
| GC1754-5g | 4-Nitrophenyl b-D-glucopyranoside | 2492-87-7 | 5g |
| GC1754-25g | 4-Nitrophenyl b-D-glucopyranoside | 2492-87-7 | 25g |
| GC6761-1g | 4-Nitrophenyl b-D-glucuronide | 10344-94-2 | 1g |
| GC2716-50mg | 4-Nitrophenyl b-D-thioglucopyranoside | 2788-56-9 | 50mg |
| GC2716-100mg | 4-Nitrophenyl b-D-thioglucopyranoside | 2788-56-9 | 100mg |
| GC2716-250mg | 4-Nitrophenyl b-D-thioglucopyranoside | 2788-56-9 | 250mg |
| GC2716-500mg | 4-Nitrophenyl b-D-thioglucopyranoside | 2788-56-9 | 500mg |
| GC2716-1g | 4-Nitrophenyl b-D-thioglucopyranoside | 2788-56-9 | 1g |
| GC8126-100mg | 4-Nitrophenyl b-D-xylopyranoside | 2001-96-9 | 100mg |
| GC8126-500mg | 4-Nitrophenyl b-D-xylopyranoside | 2001-96-9 | 500mg |
| GC2204-250mg | 4-Nitrophenyl b-L-fucopyranoside | 22153-71-5 | 250mg |
| GC2204-500mg | 4-Nitrophenyl b-L-fucopyranoside | 22153-71-5 | 500mg |
| GC2204-1g | 4-Nitrophenyl b-L-fucopyranoside | 22153-71-5 | 1g |
| GC2204-2g | 4-Nitrophenyl b-L-fucopyranoside | 22153-71-5 | 2g |
| GC0487-250mg | 4-Nitrophenyl hepta-O-acetyl-b-lactoside | 84034-75-3 | 250mg |
| GC0487-500mg | 4-Nitrophenyl hepta-O-acetyl-b-lactoside | 84034-75-3 | 500mg |
| GC0487-1g | 4-Nitrophenyl hepta-O-acetyl-b-lactoside | 84034-75-3 | 1g |
| GC0487-2g | 4-Nitrophenyl hepta-O-acetyl-b-lactoside | 84034-75-3 | 2g |
| GK3996-5g | 4-Nitrophenyl palmitate | 1492-30-4 | 5g |
| GX6852-1g | 4-Nitrophenyl phosphate | 330-13-2 | 1g |
| GX6852-5g | 4-Nitrophenyl phosphate | 330-13-2 | 5g |
| GC6147-5g | 4-Nitrophenyl phosphate bis(tris(hydroxymethyl)amino methane) | 68189-42-4 | 5g |
| GC6147-25g | 4-Nitrophenyl phosphate bis(tris(hydroxymethyl)amino methane) | 68189-42-4 | 25g |
| GC2733-5g | 4-Nitrophenyl phosphate disodium salt hexahydrate | 4264-83-9 | 5g |
| GC2733-25g | 4-Nitrophenyl phosphate disodium salt hexahydrate | 4264-83-9 | 25g |
| GC1051-1g | 4-Nitrophenyl α-D-mannopyranoside | 10357-27-4 | 1g |
| GC1051-2g | 4-Nitrophenyl α-D-mannopyranoside | 10357-27-4 | 2g |
| GC1051-5g | 4-Nitrophenyl α-D-mannopyranoside | 10357-27-4 | 5g |
| GC1051-10g | 4-Nitrophenyl α-D-mannopyranoside | 10357-27-4 | 10g |
| GC0414-100mg | 4-Nitrophenyl β-D-lactopyranoside | 4419-94-7 | 100mg |
| GK7452-25g | 4-Nitrophthalic anhydride | 5466-84-2 | 25g |
| GT7803-1g | 4-Nitrophthalonitrile | 31643-49-9 | 1g |
| GT7803-5g | 4-Nitrophthalonitrile | 31643-49-9 | 5g |
| GT7803-25g | 4-Nitrophthalonitrile | 31643-49-9 | 25g |
| GT7803-100g | 4-Nitrophthalonitrile | 31643-49-9 | 100g |
| GC7889-5mg | 4-O-(6-Azido-6-deoxy-β-D-glucopyranosyl)-D-glucose | 1499187-31-3 | 5mg |
| GC7889-10mg | 4-O-(6-Azido-6-deoxy-β-D-glucopyranosyl)-D-glucose | 1499187-31-3 | 10mg |
| GC7889-25mg | 4-O-(6-Azido-6-deoxy-β-D-glucopyranosyl)-D-glucose | 1499187-31-3 | 25mg |
| GC7889-50mg | 4-O-(6-Azido-6-deoxy-β-D-glucopyranosyl)-D-glucose | 1499187-31-3 | 50mg |
| GL8371-10mg | 4-O-Caffeoylquinic acid | 905-99-7 | 10mg |
| GC0892-25mg | 4-O-Methyl-D-glucose | 4132-38-1 | 25mg |
| GC0892-50mg | 4-O-Methyl-D-glucose | 4132-38-1 | 50mg |
| GC0892-100mg | 4-O-Methyl-D-glucose | 4132-38-1 | 100mg |
| GC0892-250mg | 4-O-Methyl-D-glucose | 4132-38-1 | 250mg |
| GC4328-10mg | 4-O-Methyl-D-glucuronic acid | 4120-73-4 | 10mg |
| GC4328-25mg | 4-O-Methyl-D-glucuronic acid | 4120-73-4 | 25mg |
| GC4328-50mg | 4-O-Methyl-D-glucuronic acid | 4120-73-4 | 50mg |
| GC4328-100mg | 4-O-Methyl-D-glucuronic acid | 4120-73-4 | 100mg |
| GC4328-250mg | 4-O-Methyl-D-glucuronic acid | 4120-73-4 | 250mg |
| GC8905-5mg | 4-O-α-D-Galactopyranosyl-D-glucose | 56907-30-3 | 5mg |
| GC8905-10mg | 4-O-α-D-Galactopyranosyl-D-glucose | 56907-30-3 | 10mg |
| GC8905-25mg | 4-O-α-D-Galactopyranosyl-D-glucose | 56907-30-3 | 25mg |
| GC8905-50mg | 4-O-α-D-Galactopyranosyl-D-glucose | 56907-30-3 | 50mg |
| GC4091-1mg | 4-O-α-D-Galactopyranosyl-D-sucrose | 155154-22-6 | 1mg |
| GC4091-2mg | 4-O-α-D-Galactopyranosyl-D-sucrose | 155154-22-6 | 2mg |
| GC4091-5mg | 4-O-α-D-Galactopyranosyl-D-sucrose | 155154-22-6 | 5mg |
| GC4091-10mg | 4-O-α-D-Galactopyranosyl-D-sucrose | 155154-22-6 | 10mg |
| GC4091-25mg | 4-O-α-D-Galactopyranosyl-D-sucrose | 155154-22-6 | 25mg |
| GC5625-1mg | 4-O-β-D-Galactopyranosyl-D-sucrose | 87419-56-5 | 1mg |
| GC5625-2mg | 4-O-β-D-Galactopyranosyl-D-sucrose | 87419-56-5 | 2mg |
| GC5625-5mg | 4-O-β-D-Galactopyranosyl-D-sucrose | 87419-56-5 | 5mg |
| GC5625-10mg | 4-O-β-D-Galactopyranosyl-D-sucrose | 87419-56-5 | 10mg |
| GC5625-25mg | 4-O-β-D-Galactopyranosyl-D-sucrose | 87419-56-5 | 25mg |
| GK3710-25g | 4-tert-Octylphenol | 140-66-9 | 25g |
| GN0818-10mg | 4-Thiothymidine | 7236-57-9 | 10mg |
| GN6085-5mg | 4-Thiouridine | 13957-31-8 | 5mg |
| GN6085-25mg | 4-Thiouridine | 13957-31-8 | 25mg |
| GN6085-100mg | 4-Thiouridine | 13957-31-8 | 100mg |
| GN6085-250mg | 4-Thiouridine | 13957-31-8 | 250mg |
| GW4968-1mg | 4-trans-Hydroxyglibenclamide | 23155-00-2 | 1mg |
| GW4968-5mg | 4-trans-Hydroxyglibenclamide | 23155-00-2 | 5mg |
| GW3023-1g | 4,4''-Bis(bromomethyl)biphenyl | 20248-86-6 | 1g |
| GW3023-5g | 4,4''-Bis(bromomethyl)biphenyl | 20248-86-6 | 5g |
| GW3023-25g | 4,4''-Bis(bromomethyl)biphenyl | 20248-86-6 | 25g |
| GX2406-100g | 4,4''-Bis(diethylamino)benzophenone | 90-93-7 | 100g |
| GK1534-1g | 4,4''-Bis(dimethylamino)benzhydrol | 119-58-4 | 1g |
| GK4774-5g | 4,4''-Dihydroxybenzophenone | 611-99-4 | 5g |
| GL5989-25g | 4,4''-Dihydroxybiphenyl | 92-88-6 | 25g |
| GL5989-100g | 4,4''-Dihydroxybiphenyl | 92-88-6 | 100g |
| GL5989-500g | 4,4''-Dihydroxybiphenyl | 92-88-6 | 500g |
| GE3209-5g | 4,4''-Dimethoxytritylchloride | 40615-36-9 | 5g |
| GE3209-25g | 4,4''-Dimethoxytritylchloride | 40615-36-9 | 25g |
| GK1576-5g | 4,4''-Dimethyl-2,2''-dipyridyl | 1134-35-6 | 5g |
| GK1576-25g | 4,4''-Dimethyl-2,2''-dipyridyl | 1134-35-6 | 25g |
| GK1003-5g | 4,4''-Dipyridyl | 553-26-4 | 5g |
| GK1003-25g | 4,4''-Dipyridyl | 553-26-4 | 25g |
| GW9195-10g | 4,4′-Diazido-2,2′-stilbenedisulfonic acid disodium salt tetrahydrate | 2718-90-3 | 10g |
| GW9195-50g | 4,4′-Diazido-2,2′-stilbenedisulfonic acid disodium salt tetrahydrate | 2718-90-3 | 50g |
| GW9195-250g | 4,4′-Diazido-2,2′-stilbenedisulfonic acid disodium salt tetrahydrate | 2718-90-3 | 250g |
| GY3789-5mg | 4,5-Dicaffeoylquinic acid | 57378-72-0 | 5mg |
| GT3175-10mg | 4,5-Methylenedioxy-1,2-phenylenediamine dihydrochloride | 81864-15-5 | 10mg |
| GT3175-50mg | 4,5-Methylenedioxy-1,2-phenylenediamine dihydrochloride | 81864-15-5 | 50mg |
| GK1943-10g | 4,6-Dihydroxy-2-methylpyrimidine | 40497-30-1 | 10g |
| GK1943-25g | 4,6-Dihydroxy-2-methylpyrimidine | 40497-30-1 | 25g |
| GC9369-500mg | 4,6-O-Benzylidene-D-maltose | 93417-41-5 | 500mg |
| GC9369-1g | 4,6-O-Benzylidene-D-maltose | 93417-41-5 | 1g |
| GC9369-2g | 4,6-O-Benzylidene-D-maltose | 93417-41-5 | 2g |
| GC9369-5g | 4,6-O-Benzylidene-D-maltose | 93417-41-5 | 5g |
| GC9369-10g | 4,6-O-Benzylidene-D-maltose | 93417-41-5 | 10g |
| GW8878-50mg | 4''-Diethylamino-3-hydroxyflavone | 146680-78-6 | 50mg |
| GW8878-100mg | 4''-Diethylamino-3-hydroxyflavone | 146680-78-6 | 100mg |
| GL1668-100ug | 4''-Hydroxydiclofenac | 64118-84-9 | 100ug |
| GL1668-5mg | 4''-Hydroxydiclofenac | 64118-84-9 | 5mg |
| GK6743-25g | 4''-Isobutylacetophenone | 38861-78-8 | 25g |
| GK6399-25g | 4''-Methoxyacetophenone | 100-06-1 | 25g |
| GT2414-5mg | 4'',6-Diamidino-2-phenylindole dihydrochloride | 28718-90-3 | 5mg |
| GT2414-10mg | 4'',6-Diamidino-2-phenylindole dihydrochloride | 28718-90-3 | 10mg |
| GT2414-25mg | 4'',6-Diamidino-2-phenylindole dihydrochloride | 28718-90-3 | 25mg |
| GT2414-50mg | 4'',6-Diamidino-2-phenylindole dihydrochloride | 28718-90-3 | 50mg |
| GT8978-5g | 4′,5′-Dibromofluorescein (C.I. 45370:1) | 596-03-2 | 5g |
| GL2665-1mg | 4alpha-Phorbol 12-myristate 13-acetate | 63597-44-4 | 1mg |
| GK9754-1g | 5-(4-Dimethylaminobenzylidene)rhodanine | 536-17-4 | 1g |
| GK9754-5g | 5-(4-Dimethylaminobenzylidene)rhodanine | 536-17-4 | 5g |
| GK9754-10g | 5-(4-Dimethylaminobenzylidene)rhodanine | 536-17-4 | 10g |
| GK9754-25g | 5-(4-Dimethylaminobenzylidene)rhodanine | 536-17-4 | 25g |
| GN2626-50mg | 5-(E)-(2-Bromovinyl)-2''-deoxyuridine | 69304-47-8 | 50mg |
| GW7259-5mg | 5-[(4-Propyloxyphenyl)methylene] 2,4-thiazolidinedione | 587852-28-6 | 5mg |
| GW7259-10mg | 5-[(4-Propyloxyphenyl)methylene] 2,4-thiazolidinedione | 587852-28-6 | 10mg |
| GW7259-50mg | 5-[(4-Propyloxyphenyl)methylene] 2,4-thiazolidinedione | 587852-28-6 | 50mg |
| GC6856-1mg | 5-Acetamidofluorescein-di-(b-D-galactopyranoside) | 216299-45-5 | 1mg |
| GC6856-2mg | 5-Acetamidofluorescein-di-(b-D-galactopyranoside) | 216299-45-5 | 2mg |
| GC6856-5mg | 5-Acetamidofluorescein-di-(b-D-galactopyranoside) | 216299-45-5 | 5mg |
| GC6856-10mg | 5-Acetamidofluorescein-di-(b-D-galactopyranoside) | 216299-45-5 | 10mg |
| GC6856-25mg | 5-Acetamidofluorescein-di-(b-D-galactopyranoside) | 216299-45-5 | 25mg |
| GC1250-1g | 5-Aldo-1,2-O-isopropylidene-a-D-xylofuranose | 53167-11-6 | 1g |
| GC1250-2g | 5-Aldo-1,2-O-isopropylidene-a-D-xylofuranose | 53167-11-6 | 2g |
| GC1250-5g | 5-Aldo-1,2-O-isopropylidene-a-D-xylofuranose | 53167-11-6 | 5g |
| GC1250-10g | 5-Aldo-1,2-O-isopropylidene-a-D-xylofuranose | 53167-11-6 | 10g |
| GW5733-10mg | 5-Amino TAMRA | 167095-10-5 | 10mg |
| GK3683-25g | 5-Amino-1(H)-tetrazole hydrate | 4418-61-5 | 25g |
| GK3683-100g | 5-Amino-1(H)-tetrazole hydrate | 4418-61-5 | 100g |
| GK3683-250g | 5-Amino-1(H)-tetrazole hydrate | 4418-61-5 | 250g |
| GK3683-500g | 5-Amino-1(H)-tetrazole hydrate | 4418-61-5 | 500g |
| GE8160-5g | 5-Amino-2,3-dihydro-1,4- phthalazinedione sodium salt (Sodium Luminol) | 20666-12-0 | 5g |
| GE8160-25g | 5-Amino-2,3-dihydro-1,4- phthalazinedione sodium salt (Sodium Luminol) | 20666-12-0 | 25g |
| GW4015-10mg | 5-Aminoeosin | 75900-75-3 | 10mg |
| GW4015-25mg | 5-Aminoeosin | 75900-75-3 | 25mg |
| GW7444-250mg | 5-Aminofluorescein diacetate | 195977-46-9 | 250mg |
| GW7444-1g | 5-Aminofluorescein diacetate | 195977-46-9 | 1g |
| GW7444-10g | 5-Aminofluorescein diacetate | 195977-46-9 | 10g |
| GM8475-250mg | 5-Aminolevulinic acid hydrochloride | 5451-09-2 | 250mg |
| GM8475-500mg | 5-Aminolevulinic acid hydrochloride | 5451-09-2 | 500mg |
| GM8475-1g | 5-Aminolevulinic acid hydrochloride | 5451-09-2 | 1g |
| GM8475-5g | 5-Aminolevulinic acid hydrochloride | 5451-09-2 | 5g |
| GK4042-1g | 5-Aminonicotinic acid | 24242-19-1 | 1g |
| GK4042-5g | 5-Aminonicotinic acid | 24242-19-1 | 5g |
| GM5644-5g | 5-Aminosalicylic acid | 89-57-6 | 5g |
| GP1241-5mg | 5-Aza-2''-deoxycytidine | 2353-33-5 | 5mg |
| GP1241-25mg | 5-Aza-2''-deoxycytidine | 2353-33-5 | 25mg |
| GP1241-100mg | 5-Aza-2''-deoxycytidine | 2353-33-5 | 100mg |
| GA4671-250mg | 5-Azacytidine | 320-67-2 | 250mg |
| GA4671-1g | 5-Azacytidine | 320-67-2 | 1g |
| GA4671-5g | 5-Azacytidine | 320-67-2 | 5g |
| GE1043-5g | 5-Benzylthio-1H-tetrazole | 21871-47-6 | 5g |
| GE3595-100mg | 5-Bromo-2''-deoxyuridine | 59-14-3 | 100mg |
| GE3595-250mg | 5-Bromo-2''-deoxyuridine | 59-14-3 | 250mg |
| GE3595-1g | 5-Bromo-2''-deoxyuridine | 59-14-3 | 1g |
| GC1105-100mg | 5-Bromo-3-indolyl-b-D-galactopyranoside | 97753-82-7 | 100mg |
| GC1105-500mg | 5-Bromo-3-indolyl-b-D-galactopyranoside | 97753-82-7 | 500mg |
| GC1105-1g | 5-Bromo-3-indolyl-b-D-galactopyranoside | 97753-82-7 | 1g |
| GC1105-5g | 5-Bromo-3-indolyl-b-D-galactopyranoside | 97753-82-7 | 5g |
| GC8338-500mg | 5-Bromo-4-chloro-3-indolyl 2-acetamido-2-deoxy-b-D-glucopyranoside | 4264-82-8 | 500mg |
| GC8338-1g | 5-Bromo-4-chloro-3-indolyl 2-acetamido-2-deoxy-b-D-glucopyranoside | 4264-82-8 | 1g |
| GC5824-25mg | 5-Bromo-4-chloro-3-indolyl a-D-galactopyranoside | 107021-38-5 | 25mg |
| GC5824-100mg | 5-Bromo-4-chloro-3-indolyl a-D-galactopyranoside | 107021-38-5 | 100mg |
| GC5824-250mg | 5-Bromo-4-chloro-3-indolyl a-D-galactopyranoside | 107021-38-5 | 250mg |
| GC5824-1g | 5-Bromo-4-chloro-3-indolyl a-D-galactopyranoside | 107021-38-5 | 1g |
| GC1995-25mg | 5-Bromo-4-chloro-3-indolyl a-D-glucopyranoside | 108789-36-2 | 25mg |
| GC1995-100mg | 5-Bromo-4-chloro-3-indolyl a-D-glucopyranoside | 108789-36-2 | 100mg |
| GE8805-100mg | 5-Bromo-4-chloro-3-indolyl a-L-arabinopyranoside | 100mg | |
| GE9068-25mg | 5-Bromo-4-chloro-3-indolyl acetate | 3252-36-6 | 25mg |
| GE9068-100mg | 5-Bromo-4-chloro-3-indolyl acetate | 3252-36-6 | 100mg |
| GC3237-50mg | 5-Bromo-4-chloro-3-indolyl b-D-galactopyranoside | 7240-90-6 | 50mg |
| GC3237-100mg | 5-Bromo-4-chloro-3-indolyl b-D-galactopyranoside | 7240-90-6 | 100mg |
| GC3237-500mg | 5-Bromo-4-chloro-3-indolyl b-D-galactopyranoside | 7240-90-6 | 500mg |
| GC3237-1g | 5-Bromo-4-chloro-3-indolyl b-D-galactopyranoside | 7240-90-6 | 1g |
| GC3237-5g | 5-Bromo-4-chloro-3-indolyl b-D-galactopyranoside | 7240-90-6 | 5g |
| GC5699-5mg | 5-Bromo-4-chloro-3-indolyl b-D-glucopyranoside | 15548-60-4 | 5mg |
| GC5699-25mg | 5-Bromo-4-chloro-3-indolyl b-D-glucopyranoside | 15548-60-4 | 25mg |
| GC5699-100mg | 5-Bromo-4-chloro-3-indolyl b-D-glucopyranoside | 15548-60-4 | 100mg |
| GC5699-500mg | 5-Bromo-4-chloro-3-indolyl b-D-glucopyranoside | 15548-60-4 | 500mg |
| GC5699-1g | 5-Bromo-4-chloro-3-indolyl b-D-glucopyranoside | 15548-60-4 | 1g |
| GC8906-250mg | 5-Bromo-4-chloro-3-indolyl b-D-glucuronide cyclohexylammonium salt | 114162-64-0 | 250mg |
| GC8906-1g | 5-Bromo-4-chloro-3-indolyl b-D-glucuronide cyclohexylammonium salt | 114162-64-0 | 1g |
| GC1526-50mg | 5-Bromo-4-chloro-3-indolyl b-D-xylopyranoside | 207606-55-1 | 50mg |
| GC2869-500mg | 5-Bromo-4-chloro-3-indolyl phosphate disodium salt | 102185-33-1 | 500mg |
| GC2869-1g | 5-Bromo-4-chloro-3-indolyl phosphate disodium salt | 102185-33-1 | 1g |
| GC5463-1g | 5-Bromo-4-chloro-3-indolyl phosphate p-toluidine-salt | 6578-06-9 | 1g |
| GC5463-5g | 5-Bromo-4-chloro-3-indolyl phosphate p-toluidine-salt | 6578-06-9 | 5g |
| GC7540-1mg | 5-Bromo-4-chloro-3-indolyl β-D-cellotetraoside | 1mg | |
| GC7540-2mg | 5-Bromo-4-chloro-3-indolyl β-D-cellotetraoside | 2mg | |
| GC7540-5mg | 5-Bromo-4-chloro-3-indolyl β-D-cellotetraoside | 5mg | |
| GC9954-1mg | 5-Bromo-4-chloro-3-indolyl β-D-cellotrioside | 1mg | |
| GC9954-2mg | 5-Bromo-4-chloro-3-indolyl β-D-cellotrioside | 2mg | |
| GC9954-5mg | 5-Bromo-4-chloro-3-indolyl β-D-cellotrioside | 5mg | |
| GC9954-10mg | 5-Bromo-4-chloro-3-indolyl β-D-cellotrioside | 10mg | |
| GA6057-5g | 5-Bromo-5-nitro-1,3-dioxane | 30007-47-7 | 5g |
| GA6057-25g | 5-Bromo-5-nitro-1,3-dioxane | 30007-47-7 | 25g |
| GC6247-100mg | 5-Bromo-6-chloro-3-indolyl b-D-galactopyranoside | 93863-88-8 | 100mg |
| GC6120-25mg | 5-Bromo-6-chloro-3-indolyl b-D-glucuronide cyclohexylammonium salt | 144110-43-0 | 25mg |
| GC6120-100mg | 5-Bromo-6-chloro-3-indolyl b-D-glucuronide cyclohexylammonium salt | 144110-43-0 | 100mg |
| GC4671-100mg | 5-Bromo-6-chloro-3-indolyl phosphate p-toluidine salt | 6769-80-8 | 100mg |
| GC4671-500mg | 5-Bromo-6-chloro-3-indolyl phosphate p-toluidine salt | 6769-80-8 | 500mg |
| GC4671-1g | 5-Bromo-6-chloro-3-indolyl phosphate p-toluidine salt | 6769-80-8 | 1g |
| GK6698-10g | 5-Bromonicotinic acid | 20826-04-4 | 10g |
| GK6698-50g | 5-Bromonicotinic acid | 20826-04-4 | 50g |
| GN9949-250mg | 5-Bromouridine | 957-75-5 | 250mg |
| GN9949-1g | 5-Bromouridine | 957-75-5 | 1g |
| GW5240-100mg | 5-Carboxy-2'',7''-dichlorofluorescein DA | 144489-09-8 | 100mg |
| GW5240-250mg | 5-Carboxy-2'',7''-dichlorofluorescein DA | 144489-09-8 | 250mg |
| GT3783-100mg | 5-Carboxyfluorescein | 76823-03-5 | 100mg |
| GT3783-250mg | 5-Carboxyfluorescein | 76823-03-5 | 250mg |
| GT3783-1g | 5-Carboxyfluorescein | 76823-03-5 | 1g |
| GL8762-25mg | 5-Carboxyfluorescein diacetate | 79955-27-4 | 25mg |
| GL8762-100mg | 5-Carboxyfluorescein diacetate | 79955-27-4 | 100mg |
| GL8762-1g | 5-Carboxyfluorescein diacetate | 79955-27-4 | 1g |
| GK4616-10mg | 5-Carboxyfluorescein,succinimidyl ester | 92557-80-7 | 10mg |
| GK4616-25mg | 5-Carboxyfluorescein,succinimidyl ester | 92557-80-7 | 25mg |
| GK4616-100mg | 5-Carboxyfluorescein,succinimidyl ester | 92557-80-7 | 100mg |
| GT5624-25mg | 5-Carboxytetramethylrhodamine | 91809-66-4 | 25mg |
| GT5624-250mg | 5-Carboxytetramethylrhodamine | 91809-66-4 | 250mg |
| GW3686-10mg | 5-CFDA ethanedioic-S-phenylmethyl ester | 690958-19-1 | 10mg |
| GW3686-50mg | 5-CFDA ethanedioic-S-phenylmethyl ester | 690958-19-1 | 50mg |
| GW3017-5mg | 5-CFDA N-succinimidyl ester | 150206-05-6 | 5mg |
| GW3017-25mg | 5-CFDA N-succinimidyl ester | 150206-05-6 | 25mg |
| GW3017-100mg | 5-CFDA N-succinimidyl ester | 150206-05-6 | 100mg |
| GK7497-5g | 5-Chloro-1-phenyltetrazole | 14210-25-4 | 5g |
| GK5171-10g | 5-Chloro-2-methyl-4-isothiazolin-3-one | 26172-55-4 | 10g |
| GK7391-25g | 5-Chloro-8-hydroxyquinoline | 130-16-5 | 25g |
| GC7949-5mg | 5-Chloro-8-hydroxyquinoline sulfate | 15164-40-6 | 5mg |
| GC7949-10mg | 5-Chloro-8-hydroxyquinoline sulfate | 15164-40-6 | 10mg |
| GC7949-25mg | 5-Chloro-8-hydroxyquinoline sulfate | 15164-40-6 | 25mg |
| GC7949-50mg | 5-Chloro-8-hydroxyquinoline sulfate | 15164-40-6 | 50mg |
| GC4825-5mg | 5-Chloro-8-hydroxyquinoline β-D-glucuronide | 65851-39-0 | 5mg |
| GC4825-10mg | 5-Chloro-8-hydroxyquinoline β-D-glucuronide | 65851-39-0 | 10mg |
| GC4825-25mg | 5-Chloro-8-hydroxyquinoline β-D-glucuronide | 65851-39-0 | 25mg |
| GC4825-50mg | 5-Chloro-8-hydroxyquinoline β-D-glucuronide | 65851-39-0 | 50mg |
| GC8838-100mg | 5-Deoxy-1,2-O-isopropylidene-α-D-xylofuranose | 4152-79-8 | 100mg |
| GC8838-250mg | 5-Deoxy-1,2-O-isopropylidene-α-D-xylofuranose | 4152-79-8 | 250mg |
| GC8838-500mg | 5-Deoxy-1,2-O-isopropylidene-α-D-xylofuranose | 4152-79-8 | 500mg |
| GC8838-1g | 5-Deoxy-1,2-O-isopropylidene-α-D-xylofuranose | 4152-79-8 | 1g |
| GC8954-500mg | 5-Deoxy-5-iodo-1,2-O-isopropylidene-α-D-xylofuranose | 50600-39-0 | 500mg |
| GC8954-1g | 5-Deoxy-5-iodo-1,2-O-isopropylidene-α-D-xylofuranose | 50600-39-0 | 1g |
| GC8954-2g | 5-Deoxy-5-iodo-1,2-O-isopropylidene-α-D-xylofuranose | 50600-39-0 | 2g |
| GC8954-5g | 5-Deoxy-5-iodo-1,2-O-isopropylidene-α-D-xylofuranose | 50600-39-0 | 5g |
| GE3047-100mg | 5-Deoxy-D-ribose | 13039-75-3 | 100mg |
| GE3047-250mg | 5-Deoxy-D-ribose | 13039-75-3 | 250mg |
| GC1634-5mg | 5-Dodecanoylaminoflorescein di-b-D-galactopyranoside | 138777-25-0 | 5mg |
| GW7056-50mg | 5-Dodecanoylaminofluorescein | 107827-77-0 | 50mg |
| GW7056-250mg | 5-Dodecanoylaminofluorescein | 107827-77-0 | 250mg |
| GW5346-500mg | 5-DTAF hydrochloride | 21811-74-5 | 500mg |
| GW5346-2500mg | 5-DTAF hydrochloride | 21811-74-5 | 2500mg |
| GE7013-1g | 5-Ethylthio-1(H)-tetrazole | 89797-68-2 | 1g |
| GE7013-5g | 5-Ethylthio-1(H)-tetrazole | 89797-68-2 | 5g |
| GE7013-25g | 5-Ethylthio-1(H)-tetrazole | 89797-68-2 | 25g |
| GW8985-50mg | 5-FITC DA | 118378-76-0 | 50mg |
| GW8985-250mg | 5-FITC DA | 118378-76-0 | 250mg |
| GE9614-1g | 5-Fluoro-2-methylbenzoic acid | 33184-16-6 | 1g |
| GE9614-5g | 5-Fluoro-2-methylbenzoic acid | 33184-16-6 | 5g |
| GP7931-100mg | 5-Fluoro-5''-deoxyuridine | 3094-09-5 | 100mg |
| GA6771-250mg | 5-Fluorocytosine | 2022-85-7 | 250mg |
| GA6771-1g | 5-Fluorocytosine | 2022-85-7 | 1g |
| GA6771-5g | 5-Fluorocytosine | 2022-85-7 | 5g |
| GA6771-25g | 5-Fluorocytosine | 2022-85-7 | 25g |
| GA6771-100g | 5-Fluorocytosine | 2022-85-7 | 100g |
| GK0555-1g | 5-Fluoroindole | 399-52-0 | 1g |
| GK4345-5g | 5-Fluoroisatin | 443-69-6 | 5g |
| GK4345-25g | 5-Fluoroisatin | 443-69-6 | 25g |
| GK4291-1g | 5-Fluoroorotic acid | 207291-81-4 | 1g |
| GP6168-5g | 5-Fluorouracil | 51-21-8 | 5g |
| GP6168-25g | 5-Fluorouracil | 51-21-8 | 25g |
| GP6168-100g | 5-Fluorouracil | 51-21-8 | 100g |
| GW5609-1mg | 5-Geranyloxy-7-methoxycoumarin | 7380-39-4 | 1mg |
| GW8797-50mg | 5-Hexadecanoylaminofluorescein | 73024-80-3 | 50mg |
| GW8797-250mg | 5-Hexadecanoylaminofluorescein | 73024-80-3 | 250mg |
| GL5192-500ug | 5-Hydroxy-2-methyl-4-chromanone | 14153-17-4 | 500ug |
| GL5192-1mg | 5-Hydroxy-2-methyl-4-chromanone | 14153-17-4 | 1mg |
| GM9337-1g | 5-Hydroxy-L-tryptophan | 4350-09-8 | 1g |
| GM9337-5g | 5-Hydroxy-L-tryptophan | 4350-09-8 | 5g |
| GM9337-25g | 5-Hydroxy-L-tryptophan | 4350-09-8 | 25g |
| GM9337-100g | 5-Hydroxy-L-tryptophan | 4350-09-8 | 100g |
| GM9337-250g | 5-Hydroxy-L-tryptophan | 4350-09-8 | 250g |
| GW5578-1mg | 5-Hydroxydiclofenac | 69002-84-2 | 1mg |
| GW5578-5mg | 5-Hydroxydiclofenac | 69002-84-2 | 5mg |
| GW9123-10mg | 5-Hydroxyferulic acid | 1782-55-4 | 10mg |
| GW9123-50mg | 5-Hydroxyferulic acid | 1782-55-4 | 50mg |
| GW9123-100mg | 5-Hydroxyferulic acid | 1782-55-4 | 100mg |
| GN9819-1mg | 5-Hydroxymethyl-2''-deoxycytidine | 7226-77-9 | 1mg |
| GN9819-5mg | 5-Hydroxymethyl-2''-deoxycytidine | 7226-77-9 | 5mg |
| GW0468-1mg | 5-Hydroxymethylfluorescein diacetate | 143106-56-3 | 1mg |
| GW0468-5mg | 5-Hydroxymethylfluorescein diacetate | 143106-56-3 | 5mg |
| GK9725-1g | 5-Hydroxynicotinic acid | 27828-71-3 | 1g |
| GK9725-5g | 5-Hydroxynicotinic acid | 27828-71-3 | 5g |
| GK9725-25g | 5-Hydroxynicotinic acid | 27828-71-3 | 25g |
| GP1769-1g | 5-Iodo-2''-deoxyuridine | 54-42-2 | 1g |
| GP1769-5g | 5-Iodo-2''-deoxyuridine | 54-42-2 | 5g |
| GC3607-1g | 5-Keto-D-gluconic acid potassium salt | 91446-96-7 | 1g |
| GW6174-10mg | 5-Maleimido-eosin | 150322-02-4 | 10mg |
| GW6174-100mg | 5-Maleimido-eosin | 150322-02-4 | 100mg |
| GK5733-5g | 5-Mercapto-1-methyltetrazole | 13183-79-4 | 5g |
| GK5733-25g | 5-Mercapto-1-methyltetrazole | 13183-79-4 | 25g |
| GW9728-500mg | 5-Methoxy-2,3,3-trimethyl-1-(4-sulfobutyl)-indolium, inner salt | 54136-27-5 | 500mg |
| GW9728-2500mg | 5-Methoxy-2,3,3-trimethyl-1-(4-sulfobutyl)-indolium, inner salt | 54136-27-5 | 2500mg |
| GL5991-250mg | 5-Methoxypsoralen | 484-20-8 | 250mg |
| GL5991-1g | 5-Methoxypsoralen | 484-20-8 | 1g |
| GL4839-1mg | 5-Methoxysterigmatocystin | 22897-08-1 | 1mg |
| GL4839-5mg | 5-Methoxysterigmatocystin | 22897-08-1 | 5mg |
| GX2343-25g | 5-Methoxyuracil | 6623-81-0 | 25g |
| GE5158-50mg | 5-Methyl-2''-deoxycytidine | 838-07-3 | 50mg |
| GE4109-25mg | 5-Methylcytidine | 2140-61-6 | 25mg |
| GE4109-100mg | 5-Methylcytidine | 2140-61-6 | 100mg |
| GL1986-1mg | 5-Methylmellein | 7734-92-1 | 1mg |
| GL1986-5mg | 5-Methylmellein | 7734-92-1 | 5mg |
| GK4297-5g | 5-Nitro-2-furaldehyde | 698-63-5 | 5g |
| GK4297-25g | 5-Nitro-2-furaldehyde | 698-63-5 | 25g |
| GK3255-25g | 5-Nitro-2-furaldehyde semicarbazone | 59-87-0 | 25g |
| GK3255-100g | 5-Nitro-2-furaldehyde semicarbazone | 59-87-0 | 100g |
| GK3255-500g | 5-Nitro-2-furaldehyde semicarbazone | 59-87-0 | 500g |
| GK3359-5g | 5-Nitrosalicylaldehyde | 97-51-8 | 5g |
| GK3359-25g | 5-Nitrosalicylaldehyde | 97-51-8 | 25g |
| GW3720-50ml | 5-Nonanol | 623-93-8 | 50ml |
| GW3720-250ml | 5-Nonanol | 623-93-8 | 250ml |
| GC0465-100mg | 5-O-Acetyl-4''-O-tert-butyldimethylsilyl-genistein | 1330249-25-6 | 100mg |
| GC0465-250mg | 5-O-Acetyl-4''-O-tert-butyldimethylsilyl-genistein | 1330249-25-6 | 250mg |
| GC0465-500mg | 5-O-Acetyl-4''-O-tert-butyldimethylsilyl-genistein | 1330249-25-6 | 500mg |
| GC0465-1g | 5-O-Acetyl-4''-O-tert-butyldimethylsilyl-genistein | 1330249-25-6 | 1g |
| GC2624-500mg | 5-O-Benzyl-1,2-O-isopropylidene-α-D-glucofuranuronic acid, γ-lactone | 5111-13-7 | 500mg |
| GC2624-1g | 5-O-Benzyl-1,2-O-isopropylidene-α-D-glucofuranuronic acid, γ-lactone | 5111-13-7 | 1g |
| GC2624-2g | 5-O-Benzyl-1,2-O-isopropylidene-α-D-glucofuranuronic acid, γ-lactone | 5111-13-7 | 2g |
| GC2624-5g | 5-O-Benzyl-1,2-O-isopropylidene-α-D-glucofuranuronic acid, γ-lactone | 5111-13-7 | 5g |
| GW2330-20mg | 5-ROX | 216699-35-3 | 20mg |
| GW2330-200mg | 5-ROX | 216699-35-3 | 200mg |
| GK1236-100g | 5-Sulfosalicylic acid dihydrate | 5965-83-3 | 100g |
| GK1236-250g | 5-Sulfosalicylic acid dihydrate | 5965-83-3 | 250g |
| GK1236-500g | 5-Sulfosalicylic acid dihydrate | 5965-83-3 | 500g |
| GK1236-1kg | 5-Sulfosalicylic acid dihydrate | 5965-83-3 | 1kg |
| GW5614-1mg | 5-TAMRA N-succinimidyl ester | 150810-68-7 | 1mg |
| GW5614-10mg | 5-TAMRA N-succinimidyl ester | 150810-68-7 | 10mg |
| GW0175-10mg | 5,5''-Difluoro BAPTA-AM | 128255-42-5 | 10mg |
| GW0175-50mg | 5,5''-Difluoro BAPTA-AM | 128255-42-5 | 50mg |
| GK9458-1g | 5,5''-Dithio-bis(2-nitrobenzoic acid) | 69-78-3 | 1g |
| GK9458-5g | 5,5''-Dithio-bis(2-nitrobenzoic acid) | 69-78-3 | 5g |
| GK9458-25g | 5,5''-Dithio-bis(2-nitrobenzoic acid) | 69-78-3 | 25g |
| GK3851-25g | 5,6-Dimethylbenzimidazole | 582-60-5 | 25g |
| GK3851-100g | 5,6-Dimethylbenzimidazole | 582-60-5 | 100g |
| GA6096-10g | 5,7-Dichloro-8-hydroxy-2-methylquinoline | 72-80-0 | 10g |
| GC7270-5mg | 5,7-Dichloro-8-hydroxyquinoline sulfate, sodium salt | 58698-96-7 | 5mg |
| GC7270-10mg | 5,7-Dichloro-8-hydroxyquinoline sulfate, sodium salt | 58698-96-7 | 10mg |
| GC7270-25mg | 5,7-Dichloro-8-hydroxyquinoline sulfate, sodium salt | 58698-96-7 | 25mg |
| GC5825-2mg | 5,7-Dichloro-8-hydroxyquinoline β-D-glucuronide | 40951-47-1 | 2mg |
| GC5825-5mg | 5,7-Dichloro-8-hydroxyquinoline β-D-glucuronide | 40951-47-1 | 5mg |
| GC5825-10mg | 5,7-Dichloro-8-hydroxyquinoline β-D-glucuronide | 40951-47-1 | 10mg |
| GC5825-25mg | 5,7-Dichloro-8-hydroxyquinoline β-D-glucuronide | 40951-47-1 | 25mg |
| GW2645-10mg | 5,7-Dihydroxytryptamine hydrobromide | 31363-74-3 | 10mg |
| GW2645-25mg | 5,7-Dihydroxytryptamine hydrobromide | 31363-74-3 | 25mg |
| GW2645-250mg | 5,7-Dihydroxytryptamine hydrobromide | 31363-74-3 | 250mg |
| GX5299-100mg | 5,7-Dinitro-8-quinolinol | 1084-32-8 | 100mg |
| GN0695-1mg | 5''-Amino-5''-deoxyadenosine | 14365-44-7 | 1mg |
| GN0695-5mg | 5''-Amino-5''-deoxyadenosine | 14365-44-7 | 5mg |
| GN5056-100mg | 5''-Chloro-5''-deoxyadenosine | 892-48-8 | 100mg |
| GN5056-250mg | 5''-Chloro-5''-deoxyadenosine | 892-48-8 | 250mg |
| GN1624-50mg | 5''-Deoxyuridine | 15958-99-3 | 50mg |
| GN3343-1g | 5''-DMT-2''-O-TBDMS-N2-acetyl-guanosine phosphoramidite | 944138-03-8 | 1g |
| GN5170-250mg | 5''-Ethynyl-2''-deoxyuridine | 61135-33-9 | 250mg |
| GN5170-1g | 5''-Ethynyl-2''-deoxyuridine | 61135-33-9 | 1g |
| GW5634-10mg | 5(6)-Amino-TAMRA | 123379-86-2 | 10mg |
| GW5634-100mg | 5(6)-Amino-TAMRA | 123379-86-2 | 100mg |
| GW3634-2g | 5(6)-Aminofluorescein (Mixture of isomers) | 27599-63-9 | 2g |
| GW3634-10g | 5(6)-Aminofluorescein (Mixture of isomers) | 27599-63-9 | 10g |
| GE4671-1g | 5(6)-Carboxyfluorescein | 72088-94-9 | 1g |
| GE4671-5g | 5(6)-Carboxyfluorescein | 72088-94-9 | 5g |
| GE4671-50g | 5(6)-Carboxyfluorescein | 72088-94-9 | 50g |
| GT5678-50mg | 5(6)-Carboxyfluorescein diacetate N-succinimidyl ester | 150347-59-4 | 50mg |
| GT5678-500mg | 5(6)-Carboxyfluorescein diacetate N-succinimidyl ester | 150347-59-4 | 500mg |
| GT9499-100mg | 5(6)-Carboxyfluorescein N-hydroxysuccinimide ester | 117548-22-8 | 100mg |
| GW3794-25mg | 5(6)-CFDA | 124387-19-5 | 25mg |
| GW3794-100mg | 5(6)-CFDA | 124387-19-5 | 100mg |
| GW3794-1g | 5(6)-CFDA | 124387-19-5 | 1g |
| GW3793-10mg | 5(6)-FITC DA | 871487-69-3 | 10mg |
| GW3793-100mg | 5(6)-FITC DA | 871487-69-3 | 100mg |
| GW9624-25mg | 5(6)-ROX | 198978-94-8 | 25mg |
| GW9624-100mg | 5(6)-ROX | 198978-94-8 | 100mg |
| GW9624-1g | 5(6)-ROX | 198978-94-8 | 1g |
| GW4789-10mg | 5(6)-ROX N-succinimidyl ester | 114616-32-9 | 10mg |
| GW4789-25mg | 5(6)-ROX N-succinimidyl ester | 114616-32-9 | 25mg |
| GW4789-500mg | 5(6)-ROX N-succinimidyl ester | 114616-32-9 | 500mg |
| GW9780-100mg | 5(6)-TAMRA | 98181-63-6 | 100mg |
| GW0444-25mg | 5(6)-TAMRA N-succinimidyl ester | 150408-83-6 | 25mg |
| GX3697-10g | 5% Pd/C Degussa Type E 101 O/W (water wet) | 7440-05-3 | 10g |
| GX3697-50g | 5% Pd/C Degussa Type E 101 O/W (water wet) | 7440-05-3 | 50g |
| GX3445-10g | 5% Pd/C Degussa Type E 101 R/W (water wet) | 7440-05-3 | 10g |
| GX3445-50g | 5% Pd/C Degussa Type E 101 R/W (water wet) | 7440-05-3 | 50g |
| GX7836-10g | 5% Pd/C Degussa Type E 105 CA/W (water wet) | 7440-05-3 | 10g |
| GX7836-50g | 5% Pd/C Degussa Type E 105 CA/W (water wet) | 7440-05-3 | 50g |
| GX3188-10g | 5% Pt/Al2O3 Degussa Type F 214 SP/D | 7440-06-4 | 10g |
| GX3188-50g | 5% Pt/Al2O3 Degussa Type F 214 SP/D | 7440-06-4 | 50g |
| GX6125-10g | 5% Ru/C Degussa Type H 105 XBA/W (water wet) | 7440-18-8 | 10g |
| GX6125-50g | 5% Ru/C Degussa Type H 105 XBA/W (water wet) | 7440-18-8 | 50g |
| GW2839-10mg | 6-(4-Acetamido-1,8-naphthalamido) hexanoic acid | 172227-59-7 | 10mg |
| GW2839-50mg | 6-(4-Acetamido-1,8-naphthalamido) hexanoic acid | 172227-59-7 | 50mg |
| GL5650-250mg | 6-(Dimethylamino)purine | 938-55-6 | 250mg |
| GL5650-1g | 6-(Dimethylamino)purine | 938-55-6 | 1g |
| GW3669-10mg | 6-(Fluorescein-5-carboxamido)hexanoic acid | 194661-60-4 | 10mg |
| GW3669-50mg | 6-(Fluorescein-5-carboxamido)hexanoic acid | 194661-60-4 | 50mg |
| GW9800-10mg | 6-(Fluorescein-5-carboxamido)hexanoic acid N-succinimidyl ester | 148356-00-7 | 10mg |
| GW9800-25mg | 6-(Fluorescein-5-carboxamido)hexanoic acid N-succinimidyl ester | 148356-00-7 | 25mg |
| GW5042-25mg | 6-(Fluorescein-5(6)-carboxamido)hexanoic acid | 265981-56-4 | 25mg |
| GW5042-50mg | 6-(Fluorescein-5(6)-carboxamido)hexanoic acid | 265981-56-4 | 50mg |
| GW4127-10mg | 6-(Fluorescein-6-carboxamido)hexanoic acid | 323196-16-3 | 10mg |
| GW4127-50mg | 6-(Fluorescein-6-carboxamido)hexanoic acid | 323196-16-3 | 50mg |
| GW1403-10mg | 6-(Fluorescein-6-carboxamido)hexanoic acid N-succinimidyl ester | 148356-01-8 | 10mg |
| GW1403-25mg | 6-(Fluorescein-6-carboxamido)hexanoic acid N-succinimidyl ester | 148356-01-8 | 25mg |
| GL5083-10mg | 6-[4-(2-Piperidin-1-ylethoxy)phenyl]-3-pyridin-4-ylpyrazolo[1,5-a]pyrimidine | 866405-64-3 | 10mg |
| GT7214-5mg | 6-[Fluorescein-5(6)-carboxamido]hexanoic acid N-hydroxysuccinimide ester | 114616-31-8 | 5mg |
| GT7214-25mg | 6-[Fluorescein-5(6)-carboxamido]hexanoic acid N-hydroxysuccinimide ester | 114616-31-8 | 25mg |
| GW9877-10mg | 6-Amino TAMRA | 159435-10-6 | 10mg |
| GC4758-25mg | 6-Amino-6-deoxy-D-glucopyranose, hydrochloride | 4460-60-0 | 25mg |
| GC4758-50mg | 6-Amino-6-deoxy-D-glucopyranose, hydrochloride | 4460-60-0 | 50mg |
| GC4758-100mg | 6-Amino-6-deoxy-D-glucopyranose, hydrochloride | 4460-60-0 | 100mg |
| GC4758-250mg | 6-Amino-6-deoxy-D-glucopyranose, hydrochloride | 4460-60-0 | 250mg |
| GL4478-1mg | 6-Amino-8-trifluoromethylphenanthridine | 651055-83-3 | 1mg |
| GL4478-5mg | 6-Amino-8-trifluoromethylphenanthridine | 651055-83-3 | 5mg |
| GL4478-25mg | 6-Amino-8-trifluoromethylphenanthridine | 651055-83-3 | 25mg |
| GX0537-1mg | 6-Amino-D-luciferin | 161055-47-6 | 1mg |
| GX0537-5mg | 6-Amino-D-luciferin | 161055-47-6 | 5mg |
| GT0384-250mg | 6-Aminofluorescein | 51649-83-3 | 250mg |
| GT0384-2g | 6-Aminofluorescein | 51649-83-3 | 2g |
| GT0384-10g | 6-Aminofluorescein | 51649-83-3 | 10g |
| GM8394-100g | 6-Aminohexanoic acid | 60-32-2 | 100g |
| GM8394-250g | 6-Aminohexanoic acid | 60-32-2 | 250g |
| GM8394-500g | 6-Aminohexanoic acid | 60-32-2 | 500g |
| GM8394-1kg | 6-Aminohexanoic acid | 60-32-2 | 1kg |
| GM9885-25g | 6-Aminohexanoic acid, USP grade | 60-32-2 | 25g |
| GM9885-100g | 6-Aminohexanoic acid, USP grade | 60-32-2 | 100g |
| GM9885-250g | 6-Aminohexanoic acid, USP grade | 60-32-2 | 250g |
| GM9885-500g | 6-Aminohexanoic acid, USP grade | 60-32-2 | 500g |
| GM9885-1kg | 6-Aminohexanoic acid, USP grade | 60-32-2 | 1kg |
| GA3817-10g | 6-Aminopenicillanic acid | 551-16-6 | 10g |
| GA3817-25g | 6-Aminopenicillanic acid | 551-16-6 | 25g |
| GA3817-50g | 6-Aminopenicillanic acid | 551-16-6 | 50g |
| GL4332-1mg | 6-Aminophenanthridine | 832-68-8 | 1mg |
| GL4332-5mg | 6-Aminophenanthridine | 832-68-8 | 5mg |
| GL4332-25mg | 6-Aminophenanthridine | 832-68-8 | 25mg |
| GE4170-50mg | 6-Aminoquinoline N-succinimidyl ester | 148757-94-2 | 50mg |
| GE4170-250mg | 6-Aminoquinoline N-succinimidyl ester | 148757-94-2 | 250mg |
| GW0943-1mg | 6-Aminoseleno-D-luciferin | 1375964-28-5 | 1mg |
| GW0943-5mg | 6-Aminoseleno-D-luciferin | 1375964-28-5 | 5mg |
| GC6916-100mg | 6-Azido-6-deoxy-1,2-O-isopropylidene-α-D-glucofuranose | 65371-16-6 | 100mg |
| GC6916-250mg | 6-Azido-6-deoxy-1,2-O-isopropylidene-α-D-glucofuranose | 65371-16-6 | 250mg |
| GC6916-500mg | 6-Azido-6-deoxy-1,2-O-isopropylidene-α-D-glucofuranose | 65371-16-6 | 500mg |
| GC6916-1g | 6-Azido-6-deoxy-1,2-O-isopropylidene-α-D-glucofuranose | 65371-16-6 | 1g |
| GC3605-1g | 6-Azido-6-deoxy-2,3-O-isopropylidene-α-L-sorbofuranose | 126210-25-1 | 1g |
| GC3605-2g | 6-Azido-6-deoxy-2,3-O-isopropylidene-α-L-sorbofuranose | 126210-25-1 | 2g |
| GC3605-5g | 6-Azido-6-deoxy-2,3-O-isopropylidene-α-L-sorbofuranose | 126210-25-1 | 5g |
| GC3605-10g | 6-Azido-6-deoxy-2,3-O-isopropylidene-α-L-sorbofuranose | 126210-25-1 | 10g |
| GC5096-250mg | 6-Azido-6-deoxy-D-galactose | 66927-03-5 | 250mg |
| GC5096-500mg | 6-Azido-6-deoxy-D-galactose | 66927-03-5 | 500mg |
| GC5096-1g | 6-Azido-6-deoxy-D-galactose | 66927-03-5 | 1g |
| GC5096-2g | 6-Azido-6-deoxy-D-galactose | 66927-03-5 | 2g |
| GC7385-50mg | 6-Azido-6-deoxy-D-glucopyranose | 20847-05-6 | 50mg |
| GC7385-100mg | 6-Azido-6-deoxy-D-glucopyranose | 20847-05-6 | 100mg |
| GC7385-250mg | 6-Azido-6-deoxy-D-glucopyranose | 20847-05-6 | 250mg |
| GC7385-500mg | 6-Azido-6-deoxy-D-glucopyranose | 20847-05-6 | 500mg |
| GC3815-5mg | 6-Azido-L-fucose | 70932-63-7 | 5mg |
| GC3815-10mg | 6-Azido-L-fucose | 70932-63-7 | 10mg |
| GC3815-25mg | 6-Azido-L-fucose | 70932-63-7 | 25mg |
| GC3815-50mg | 6-Azido-L-fucose | 70932-63-7 | 50mg |
| GE8289-1g | 6-Benzylaminopurine | 1214-39-7 | 1g |
| GE8289-5g | 6-Benzylaminopurine | 1214-39-7 | 5g |
| GE8289-10g | 6-Benzylaminopurine | 1214-39-7 | 10g |
| GE8289-25g | 6-Benzylaminopurine | 1214-39-7 | 25g |
| GK9444-5g | 6-Bromo-1-hexanol | 4286-55-9 | 5g |
| GX2922-5g | 6-Bromonicotinic acid | 6311-35-9 | 5g |
| GX2922-10g | 6-Bromonicotinic acid | 6311-35-9 | 10g |
| GX2922-25g | 6-Bromonicotinic acid | 6311-35-9 | 25g |
| GW0085-100mg | 6-Carboxy-2'',7''-dichlorofluorescein DA | 144489-10-1 | 100mg |
| GW0085-250mg | 6-Carboxy-2'',7''-dichlorofluorescein DA | 144489-10-1 | 250mg |
| GT3614-25mg | 6-Carboxy-X-rhodamine | 194785-18-7 | 25mg |
| GT3614-125mg | 6-Carboxy-X-rhodamine | 194785-18-7 | 125mg |
| GT6690-50mg | 6-Carboxyfluorescein | 3301-79-9 | 50mg |
| GT6690-200mg | 6-Carboxyfluorescein | 3301-79-9 | 200mg |
| GT6690-1g | 6-Carboxyfluorescein | 3301-79-9 | 1g |
| GK5482-25mg | 6-Carboxyfluorescein diacetate | 3348-03-6 | 25mg |
| GK5482-100mg | 6-Carboxyfluorescein diacetate | 3348-03-6 | 100mg |
| GK5482-1g | 6-Carboxyfluorescein diacetate | 3348-03-6 | 1g |
| GT3778-10mg | 6-Carboxyfluorescein N-hydroxysuccinimide ester | 92557-81-8 | 10mg |
| GT3778-25mg | 6-Carboxyfluorescein N-hydroxysuccinimide ester | 92557-81-8 | 25mg |
| GT3778-100mg | 6-Carboxyfluorescein N-hydroxysuccinimide ester | 92557-81-8 | 100mg |
| GT0256-25mg | 6-Carboxytetramethylrhodamine | 91809-67-5 | 25mg |
| GT0256-250mg | 6-Carboxytetramethylrhodamine | 91809-67-5 | 250mg |
| GW2572-1g | 6-Chloro-2-methoxy-9-phenoxyacridine | 7478-26-4 | 1g |
| GW2572-2g | 6-Chloro-2-methoxy-9-phenoxyacridine | 7478-26-4 | 2g |
| GW2572-10g | 6-Chloro-2-methoxy-9-phenoxyacridine | 7478-26-4 | 10g |
| GC0743-100mg | 6-Chloro-3-indolyl b-D-galactopyranoside | 138182-21-5 | 100mg |
| GC0743-500mg | 6-Chloro-3-indolyl b-D-galactopyranoside | 138182-21-5 | 500mg |
| GC3677-25mg | 6-Chloro-3-indolyl b-D-glucopyranoside | 159954-28-6 | 25mg |
| GC3677-250mg | 6-Chloro-3-indolyl b-D-glucopyranoside | 159954-28-6 | 250mg |
| GC3677-500mg | 6-Chloro-3-indolyl b-D-glucopyranoside | 159954-28-6 | 500mg |
| GC3677-1g | 6-Chloro-3-indolyl b-D-glucopyranoside | 159954-28-6 | 1g |
| GN7678-1g | 6-Chloro-9-(b-D-ribofuranosyl)purine | 5399-87-1 | 1g |
| GN7678-5g | 6-Chloro-9-(b-D-ribofuranosyl)purine | 5399-87-1 | 5g |
| GN7678-25g | 6-Chloro-9-(b-D-ribofuranosyl)purine | 5399-87-1 | 25g |
| GK1105-5g | 6-Chloropurine | 87-42-3 | 5g |
| GK1105-25g | 6-Chloropurine | 87-42-3 | 25g |
| GC8489-1g | 6-Deoxy-1,2:3,4-di-O-isopropylidene-6-iodo-a-D-galactopyranose | 4026-28-2 | 1g |
| GC8489-2g | 6-Deoxy-1,2:3,4-di-O-isopropylidene-6-iodo-a-D-galactopyranose | 4026-28-2 | 2g |
| GC8489-5g | 6-Deoxy-1,2:3,4-di-O-isopropylidene-6-iodo-a-D-galactopyranose | 4026-28-2 | 5g |
| GC8489-10g | 6-Deoxy-1,2:3,4-di-O-isopropylidene-6-iodo-a-D-galactopyranose | 4026-28-2 | 10g |
| GC7702-100mg | 6-Deoxy-6-fluoro-D-galactopyranose | 18961-68-7 | 100mg |
| GC7702-1g | 6-Deoxy-6-fluoro-D-galactopyranose | 18961-68-7 | 1g |
| GC7702-250mg | 6-Deoxy-6-fluoro-D-galactopyranose | 18961-68-7 | 250mg |
| GC7702-500mg | 6-Deoxy-6-fluoro-D-galactopyranose | 18961-68-7 | 500mg |
| GC9802-1mg | 6-Deoxy-6-fluoro-D-lactose | 1mg | |
| GC9802-2mg | 6-Deoxy-6-fluoro-D-lactose | 2mg | |
| GC9802-5mg | 6-Deoxy-6-fluoro-D-lactose | 5mg | |
| GC9802-10mg | 6-Deoxy-6-fluoro-D-lactose | 10mg | |
| GC0781-250mg | 6-Deoxy-6-iodo-D-glucopyranose | 6304-86-5 | 250mg |
| GC0781-500mg | 6-Deoxy-6-iodo-D-glucopyranose | 6304-86-5 | 500mg |
| GC0781-1g | 6-Deoxy-6-iodo-D-glucopyranose | 6304-86-5 | 1g |
| GC0781-2g | 6-Deoxy-6-iodo-D-glucopyranose | 6304-86-5 | 2g |
| GC0781-5g | 6-Deoxy-6-iodo-D-glucopyranose | 6304-86-5 | 5g |
| GK7261-1mg | 6-Deoxy-8-O-methylrabelomycin | 117620-87-8 | 1mg |
| GK7261-5mg | 6-Deoxy-8-O-methylrabelomycin | 117620-87-8 | 5mg |
| GC4641-100mg | 6-Deoxy-D-glucose | 7658-08-4 | 100mg |
| GC4641-250mg | 6-Deoxy-D-glucose | 7658-08-4 | 250mg |
| GL0816-5mg | 6-ECDCA | 459789-99-2 | 5mg |
| GL0816-25mg | 6-ECDCA | 459789-99-2 | 25mg |
| GL5586-25mg | 6-Ethylmercaptopurine | 5417-84-5 | 25mg |
| GW5145-100mg | 6-FITC | 18861-78-4 | 100mg |
| GW5145-250mg | 6-FITC | 18861-78-4 | 250mg |
| GW0761-50mg | 6-FITC DA | 890090-49-0 | 50mg |
| GW0761-250mg | 6-FITC DA | 890090-49-0 | 250mg |
| GC7639-1mg | 6-Fluoro-L-fucose | 68539-73-1 | 1mg |
| GC7639-2mg | 6-Fluoro-L-fucose | 68539-73-1 | 2mg |
| GC7639-5mg | 6-Fluoro-L-fucose | 68539-73-1 | 5mg |
| GC7639-10mg | 6-Fluoro-L-fucose | 68539-73-1 | 10mg |
| GC7639-25mg | 6-Fluoro-L-fucose | 68539-73-1 | 25mg |
| GW9265-25mg | 6-HEX dipivaloate | 1166837-63-3 | 25mg |
| GW9265-1g | 6-HEX dipivaloate | 1166837-63-3 | 1g |
| GL3045-100mg | 6-Hydroxy-2,5,7,8-tetramethylchroman-2-carboxylic acid | 53188-07-1 | 100mg |
| GL3045-1g | 6-Hydroxy-2,5,7,8-tetramethylchroman-2-carboxylic acid | 53188-07-1 | 1g |
| GX1011-1g | 6-Hydroxybenzothiazole-2-carbonitrile | 939-69-5 | 1g |
| GX1011-2500mg | 6-Hydroxybenzothiazole-2-carbonitrile | 939-69-5 | 2500mg |
| GW0392-50mg | 6-IAF | 73264-12-7 | 50mg |
| GW0392-250mg | 6-IAF | 73264-12-7 | 250mg |
| GY5625-1mg | 6-Iodo Diosmin | 1431536-92-3 | 1mg |
| GY5625-2mg | 6-Iodo Diosmin | 1431536-92-3 | 2mg |
| GY5625-5mg | 6-Iodo Diosmin | 1431536-92-3 | 5mg |
| GY5625-10mg | 6-Iodo Diosmin | 1431536-92-3 | 10mg |
| GT3645-5mg | 6-JOE SE | 113394-23-3 | 5mg |
| GM7814-1g | 6-Mercapto-1-hexanol | 1633-78-9 | 1g |
| GW5580-250mg | 6-Methoxy-N-(3-sulfopropyl)quinolinium | 83907-40-8 | 250mg |
| GW5580-1g | 6-Methoxy-N-(3-sulfopropyl)quinolinium | 83907-40-8 | 1g |
| GK0812-5g | 6-Methoxyquinoline | 5263-87-6 | 5g |
| GC4415-1mg | 6-O-(2-Acetamido-2-deoxy-β-D-glucopyranosyl)-D-galactose | 20212-77-5 | 1mg |
| GC4415-2mg | 6-O-(2-Acetamido-2-deoxy-β-D-glucopyranosyl)-D-galactose | 20212-77-5 | 2mg |
| GC4415-5mg | 6-O-(2-Acetamido-2-deoxy-β-D-glucopyranosyl)-D-galactose | 20212-77-5 | 5mg |
| GC4415-10mg | 6-O-(2-Acetamido-2-deoxy-β-D-glucopyranosyl)-D-galactose | 20212-77-5 | 10mg |
| GC4163-1mg | 6-O-(Carboxymethyl)-D-glucose | 95350-38-2 | 1mg |
| GC4163-2mg | 6-O-(Carboxymethyl)-D-glucose | 95350-38-2 | 2mg |
| GC4163-5mg | 6-O-(Carboxymethyl)-D-glucose | 95350-38-2 | 5mg |
| GC4163-10mg | 6-O-(Carboxymethyl)-D-glucose | 95350-38-2 | 10mg |
| GC4163-25mg | 6-O-(Carboxymethyl)-D-glucose | 95350-38-2 | 25mg |
| GC1190-10mg | 6-O-(E)-Feruloyl-D-glucose | 252207-50-4 | 10mg |
| GC1190-25mg | 6-O-(E)-Feruloyl-D-glucose | 252207-50-4 | 25mg |
| GC1190-50mg | 6-O-(E)-Feruloyl-D-glucose | 252207-50-4 | 50mg |
| GC1190-100mg | 6-O-(E)-Feruloyl-D-glucose | 252207-50-4 | 100mg |
| GC4494-100mg | 6-O-Acetyl-2-azido-3,4-di-O-benzyl-2-deoxy-D-glucopyranose | 211237-94-4 | 100mg |
| GC4494-250mg | 6-O-Acetyl-2-azido-3,4-di-O-benzyl-2-deoxy-D-glucopyranose | 211237-94-4 | 250mg |
| GC4494-500mg | 6-O-Acetyl-2-azido-3,4-di-O-benzyl-2-deoxy-D-glucopyranose | 211237-94-4 | 500mg |
| GC4494-1g | 6-O-Acetyl-2-azido-3,4-di-O-benzyl-2-deoxy-D-glucopyranose | 211237-94-4 | 1g |
| GC4494-2g | 6-O-Acetyl-2-azido-3,4-di-O-benzyl-2-deoxy-D-glucopyranose | 211237-94-4 | 2g |
| GC6687-100mg | 6-O-Acetyl-D-glucopyranose | 118759-70-9 | 100mg |
| GC6687-250mg | 6-O-Acetyl-D-glucopyranose | 118759-70-9 | 250mg |
| GC6687-500mg | 6-O-Acetyl-D-glucopyranose | 118759-70-9 | 500mg |
| GC6687-1g | 6-O-Acetyl-D-glucopyranose | 118759-70-9 | 1g |
| GC5322-5mg | 6-O-b-D-Galactopyranosyl-D-glucopyranose | 28447-39-4 | 5mg |
| GC9405-1g | 6-O-Benzoyl-3-O-benzyl-1,2-O-isopropylidene-5-O-mesyl-α-D-glucofuranose | 134198-40-6 | 1g |
| GC9405-2g | 6-O-Benzoyl-3-O-benzyl-1,2-O-isopropylidene-5-O-mesyl-α-D-glucofuranose | 134198-40-6 | 2g |
| GC9405-5g | 6-O-Benzoyl-3-O-benzyl-1,2-O-isopropylidene-5-O-mesyl-α-D-glucofuranose | 134198-40-6 | 5g |
| GC3271-1mg | 6-O-beta-D-Galactopyranosyl-D-galactose | 5077-31-6 | 1mg |
| GC3271-5mg | 6-O-beta-D-Galactopyranosyl-D-galactose | 5077-31-6 | 5mg |
| GC5599-10mg | 6-O-Methyl-D-glucose | 2461-70-3 | 10mg |
| GC5599-25mg | 6-O-Methyl-D-glucose | 2461-70-3 | 25mg |
| GC5599-50mg | 6-O-Methyl-D-glucose | 2461-70-3 | 50mg |
| GC5599-100mg | 6-O-Methyl-D-glucose | 2461-70-3 | 100mg |
| GC5599-250mg | 6-O-Methyl-D-glucose | 2461-70-3 | 250mg |
| GV2243-25g | 6-O-Palmitoyl-L-ascorbic acid | 137-66-6 | 25g |
| GV2243-100g | 6-O-Palmitoyl-L-ascorbic acid | 137-66-6 | 100g |
| GV2243-250g | 6-O-Palmitoyl-L-ascorbic acid | 137-66-6 | 250g |
| GV2243-500g | 6-O-Palmitoyl-L-ascorbic acid | 137-66-6 | 500g |
| GC3025-50mg | 6-O-Propargyl-D-glucose | 50mg | |
| GC3025-100mg | 6-O-Propargyl-D-glucose | 100mg | |
| GC3025-250mg | 6-O-Propargyl-D-glucose | 250mg | |
| GC3025-500mg | 6-O-Propargyl-D-glucose | 500mg | |
| GC4702-500mg | 6-O-Tosyl-β-D-glucopyranosyl azide | 2276663-59-1 | 500mg |
| GC4702-1g | 6-O-Tosyl-β-D-glucopyranosyl azide | 2276663-59-1 | 1g |
| GC4702-2g | 6-O-Tosyl-β-D-glucopyranosyl azide | 2276663-59-1 | 2g |
| GC4702-5g | 6-O-Tosyl-β-D-glucopyranosyl azide | 2276663-59-1 | 5g |
| GC3835-500mg | 6-O-Trityl-D-galactopyranose | 2442545-84-6 | 500mg |
| GC3835-1g | 6-O-Trityl-D-galactopyranose | 2442545-84-6 | 1g |
| GC3835-2g | 6-O-Trityl-D-galactopyranose | 2442545-84-6 | 2g |
| GC3835-5g | 6-O-Trityl-D-galactopyranose | 2442545-84-6 | 5g |
| GC0998-250mg | 6-O-Trityl-D-glucose | 67919-34-0 | 250mg |
| GC0998-500mg | 6-O-Trityl-D-glucose | 67919-34-0 | 500mg |
| GC0998-1g | 6-O-Trityl-D-glucose | 67919-34-0 | 1g |
| GC0998-2g | 6-O-Trityl-D-glucose | 67919-34-0 | 2g |
| GC1417-500mg | 6-O-Trityl-D-mannopyranose | 160712-27-6 | 500mg |
| GC1417-1g | 6-O-Trityl-D-mannopyranose | 160712-27-6 | 1g |
| GC1417-2g | 6-O-Trityl-D-mannopyranose | 160712-27-6 | 2g |
| GC1417-5g | 6-O-Trityl-D-mannopyranose | 160712-27-6 | 5g |
| GC1417-10g | 6-O-Trityl-D-mannopyranose | 160712-27-6 | 10g |
| GC6442-10mg | 6-O-α-D-Galactopyranosyl-D-galactopyranose | 902-54-5 | 10mg |
| GC6442-25mg | 6-O-α-D-Galactopyranosyl-D-galactopyranose | 902-54-5 | 25mg |
| GC6442-50mg | 6-O-α-D-Galactopyranosyl-D-galactopyranose | 902-54-5 | 50mg |
| GC6442-100mg | 6-O-α-D-Galactopyranosyl-D-galactopyranose | 902-54-5 | 100mg |
| GC5909-1g | 6-Phosphogluconic acid trisodium salt | 57775-17-4 | 1g |
| GK3084-10g | 6-Propyl-2-thiouracil | 51-52-5 | 10g |
| GK3084-25g | 6-Propyl-2-thiouracil | 51-52-5 | 25g |
| GY8937-10mg | 6-Shogaol | 555-66-8 | 10mg |
| GY8937-50mg | 6-Shogaol | 555-66-8 | 50mg |
| GW0891-5mg | 6-TAMRA N-succinimidyl ester | 150810-69-8 | 5mg |
| GW0891-25mg | 6-TAMRA N-succinimidyl ester | 150810-69-8 | 25mg |
| GW4639-500mg | 6-TET dipivaloate | 314734-87-7 | 500mg |
| GW4639-2500mg | 6-TET dipivaloate | 314734-87-7 | 2500mg |
| GP0033-250mg | 6-Thioguanine | 154-42-7 | 250mg |
| GP0033-1g | 6-Thioguanine | 154-42-7 | 1g |
| GP0033-5g | 6-Thioguanine | 154-42-7 | 5g |
| GW5465-10mg | 6-TRITC | 80724-20-5 | 10mg |
| GW5465-100mg | 6-TRITC | 80724-20-5 | 100mg |
| GX9409-1g | 6,13-Di(ethoxycarbonyl)-7,12-dimethyldibenzo[b,i]-1,4,8,11-tetraaza[14]-annulenato(2-)cobalt(II); 99+% | 1g | |
| GX9409-5g | 6,13-Di(ethoxycarbonyl)-7,12-dimethyldibenzo[b,i]-1,4,8,11-tetraaza[14]-annulenato(2-)cobalt(II); 99+% | 5g | |
| GC2126-100mg | 6,6''-Diazido-6,6''-dideoxy-α,α-D-trehalose | 18933-88-5 | 100mg |
| GC2126-250mg | 6,6''-Diazido-6,6''-dideoxy-α,α-D-trehalose | 18933-88-5 | 250mg |
| GC2126-500mg | 6,6''-Diazido-6,6''-dideoxy-α,α-D-trehalose | 18933-88-5 | 500mg |
| GC2126-1g | 6,6''-Diazido-6,6''-dideoxy-α,α-D-trehalose | 18933-88-5 | 1g |
| GC0817-100mg | 6,6''-Diazido-6,6''-dideoxy-α,α-D-trehalose hexaacetate | 23103-34-6 | 100mg |
| GC0817-250mg | 6,6''-Diazido-6,6''-dideoxy-α,α-D-trehalose hexaacetate | 23103-34-6 | 250mg |
| GC0817-500mg | 6,6''-Diazido-6,6''-dideoxy-α,α-D-trehalose hexaacetate | 23103-34-6 | 500mg |
| GC0817-1g | 6,6''-Diazido-6,6''-dideoxy-α,α-D-trehalose hexaacetate | 23103-34-6 | 1g |
| GW4567-100mg | 6,7-Diethoxy-4-(trifluoromethyl) coumarin | 351002-66-9 | 100mg |
| GW4567-1g | 6,7-Diethoxy-4-(trifluoromethyl) coumarin | 351002-66-9 | 1g |
| GW3873-100mg | 6,7-Diethoxy-4-methylcoumarin | 314744-06-4 | 100mg |
| GW3873-1g | 6,7-Diethoxy-4-methylcoumarin | 314744-06-4 | 1g |
| GW9414-100mg | 6,7-Dihydroxy-4-coumarinylacetic acid | 88404-14-2 | 100mg |
| GW9414-1g | 6,7-Dihydroxy-4-coumarinylacetic acid | 88404-14-2 | 1g |
| GW2028-100mg | 6,7-Dimethoxy-4-(trifluoromethyl) coumarin | 151625-32-0 | 100mg |
| GW2028-1g | 6,7-Dimethoxy-4-(trifluoromethyl) coumarin | 151625-32-0 | 1g |
| GW6907-100mg | 6,7-Dimethoxy-4-coumarinylacetic acid | 88404-26-6 | 100mg |
| GW6907-1g | 6,7-Dimethoxy-4-coumarinylacetic acid | 88404-26-6 | 1g |
| GC9598-1mg | 6,8-Difluoro-4-methylumbelliferyl β-D-cellotrioside | 1mg | |
| GC9598-2mg | 6,8-Difluoro-4-methylumbelliferyl β-D-cellotrioside | 2mg | |
| GC9598-5mg | 6,8-Difluoro-4-methylumbelliferyl β-D-cellotrioside | 5mg | |
| GC9598-10mg | 6,8-Difluoro-4-methylumbelliferyl β-D-cellotrioside | 10mg | |
| GC9951-10mg | 6,8-Difluoro-4-methylumbelliferyl β-D-glucuronide | 215868-36-3 | 10mg |
| GC9951-25mg | 6,8-Difluoro-4-methylumbelliferyl β-D-glucuronide | 215868-36-3 | 25mg |
| GC9951-50mg | 6,8-Difluoro-4-methylumbelliferyl β-D-glucuronide | 215868-36-3 | 50mg |
| GC9951-100mg | 6,8-Difluoro-4-methylumbelliferyl β-D-glucuronide | 215868-36-3 | 100mg |
| GC0090-1mg | 6,8-Difluoro-4-methylumbelliferyl-b-D-glucopyranoside | 351009-26-2 | 1mg |
| GC0090-2mg | 6,8-Difluoro-4-methylumbelliferyl-b-D-glucopyranoside | 351009-26-2 | 2mg |
| GC0090-5mg | 6,8-Difluoro-4-methylumbelliferyl-b-D-glucopyranoside | 351009-26-2 | 5mg |
| GC0090-10mg | 6,8-Difluoro-4-methylumbelliferyl-b-D-glucopyranoside | 351009-26-2 | 10mg |
| GC0090-25mg | 6,8-Difluoro-4-methylumbelliferyl-b-D-glucopyranoside | 351009-26-2 | 25mg |
| GW9110-25mg | 6,8-Difluoro-7-ethoxy-4-methylcoumarin | 215868-24-9 | 25mg |
| GW9110-50mg | 6,8-Difluoro-7-ethoxy-4-methylcoumarin | 215868-24-9 | 50mg |
| GW1517-10mg | 6,8-Difluoro-7-hydroxy-2-oxo-2H-1-benzopyran-3-carboxylic acid | 215868-31-8 | 10mg |
| GW1517-50mg | 6,8-Difluoro-7-hydroxy-2-oxo-2H-1-benzopyran-3-carboxylic acid | 215868-31-8 | 50mg |
| GW5785-25mg | 6,8-Difluoro-7-hydroxy-4-methylcumarin | 215868-23-8 | 25mg |
| GW5785-50mg | 6,8-Difluoro-7-hydroxy-4-methylcumarin | 215868-23-8 | 50mg |
| GC6734-10mg | 6''-Deoxy-6''-iodo-β-D-cellobiose | 10mg | |
| GC6734-25mg | 6''-Deoxy-6''-iodo-β-D-cellobiose | 25mg | |
| GC6734-50mg | 6''-Deoxy-6''-iodo-β-D-cellobiose | 50mg | |
| GC6734-100mg | 6''-Deoxy-6''-iodo-β-D-cellobiose | 100mg | |
| GC6827-1mg | 6''''-O-(α-D-Galactopyranosyl)-D-maltotriose | 226923-86-0 | 1mg |
| GC6827-2mg | 6''''-O-(α-D-Galactopyranosyl)-D-maltotriose | 226923-86-0 | 2mg |
| GC6827-5mg | 6''''-O-(α-D-Galactopyranosyl)-D-maltotriose | 226923-86-0 | 5mg |
| GC6827-10mg | 6''''-O-(α-D-Galactopyranosyl)-D-maltotriose | 226923-86-0 | 10mg |
| GC6827-25mg | 6''''-O-(α-D-Galactopyranosyl)-D-maltotriose | 226923-86-0 | 25mg |
| GC7743-1mg | 6''''-O-(α-D-Glucopyranosyl)-D-maltotriose | 35175-16-7 | 1mg |
| GC7743-2mg | 6''''-O-(α-D-Glucopyranosyl)-D-maltotriose | 35175-16-7 | 2mg |
| GC7743-5mg | 6''''-O-(α-D-Glucopyranosyl)-D-maltotriose | 35175-16-7 | 5mg |
| GC7743-10mg | 6''''-O-(α-D-Glucopyranosyl)-D-maltotriose | 35175-16-7 | 10mg |
| GC7743-25mg | 6''''-O-(α-D-Glucopyranosyl)-D-maltotriose | 35175-16-7 | 25mg |
| GC5806-1mg | 6''''-O-Acetyldaidzin | 71385-83-6 | 1mg |
| GC5806-2mg | 6''''-O-Acetyldaidzin | 71385-83-6 | 2mg |
| GC5806-5mg | 6''''-O-Acetyldaidzin | 71385-83-6 | 5mg |
| GC5806-10mg | 6''''-O-Acetyldaidzin | 71385-83-6 | 10mg |
| GC7592-1mg | 6''''-O-Acetylgenistin | 73566-30-0 | 1mg |
| GC7592-2mg | 6''''-O-Acetylgenistin | 73566-30-0 | 2mg |
| GC7592-5mg | 6''''-O-Acetylgenistin | 73566-30-0 | 5mg |
| GC7592-10mg | 6''''-O-Acetylgenistin | 73566-30-0 | 10mg |
| GC5251-1mg | 6''''-O-Malonyldaidzin | 124590-31-4 | 1mg |
| GC5251-2mg | 6''''-O-Malonyldaidzin | 124590-31-4 | 2mg |
| GC5251-5mg | 6''''-O-Malonyldaidzin | 124590-31-4 | 5mg |
| GC5251-10mg | 6''''-O-Malonyldaidzin | 124590-31-4 | 10mg |
| GC3342-1mg | 6''''-O-Malonylgenistin | 51011-05-3 | 1mg |
| GC3342-2mg | 6''''-O-Malonylgenistin | 51011-05-3 | 2mg |
| GC3342-5mg | 6''''-O-Malonylgenistin | 51011-05-3 | 5mg |
| GC3342-10mg | 6''''-O-Malonylgenistin | 51011-05-3 | 10mg |
| GC3367-25mg | 6α-Mannobiose octaacetate | 69685-27-4 | 25mg |
| GC3367-50mg | 6α-Mannobiose octaacetate | 69685-27-4 | 50mg |
| GC3367-100mg | 6α-Mannobiose octaacetate | 69685-27-4 | 100mg |
| GC3367-250mg | 6α-Mannobiose octaacetate | 69685-27-4 | 250mg |
| GC7777-1mg | 6β-Naltrexol-1,2,5,6,7,7-d6 | 1mg | |
| GC7777-2mg | 6β-Naltrexol-1,2,5,6,7,7-d6 | 2mg | |
| GC7777-5mg | 6β-Naltrexol-1,2,5,6,7,7-d6 | 5mg | |
| GW0193-10mg | 7-(2-Oxiranylethoxy)-2H-1-benzopyran-2-one | 381689-75-4 | 10mg |
| GW0193-100mg | 7-(2-Oxiranylethoxy)-2H-1-benzopyran-2-one | 381689-75-4 | 100mg |
| GW2024-100mg | 7-(Diethylamino)-3-(imidazol-1-ylcarbonyl)-1-benzopyran-2-one | 261943-47-9 | 100mg |
| GW2024-1g | 7-(Diethylamino)-3-(imidazol-1-ylcarbonyl)-1-benzopyran-2-one | 261943-47-9 | 1g |
| GT7462-1g | 7-(Diethylamino)-3-phenylcoumarin | 84865-19-0 | 1g |
| GT7462-5g | 7-(Diethylamino)-3-phenylcoumarin | 84865-19-0 | 5g |
| GT7462-10g | 7-(Diethylamino)-3-phenylcoumarin | 84865-19-0 | 10g |
| GW5613-50mg | 7-(Diethylamino)coumarin-3-carbohydrazide | 100343-98-4 | 50mg |
| GW5613-250mg | 7-(Diethylamino)coumarin-3-carbohydrazide | 100343-98-4 | 250mg |
| GT5363-5g | 7-(Dimethylamino)-4-methylcoumarin | 87-01-4 | 5g |
| GT5363-25g | 7-(Dimethylamino)-4-methylcoumarin | 87-01-4 | 25g |
| GT7967-1g | 7-(p-Methoxybenzylamino)-4-nitrobenz-2-oxa-1,3-diazole | 33984-50-8 | 1g |
| GT7967-5g | 7-(p-Methoxybenzylamino)-4-nitrobenz-2-oxa-1,3-diazole | 33984-50-8 | 5g |
| GW3070-10mg | 7-[(2-Oxocyclopentyl)oxy]-2H-1-benzopyran-2-one | 877774-65-7 | 10mg |
| GW3070-100mg | 7-[(2-Oxocyclopentyl)oxy]-2H-1-benzopyran-2-one | 877774-65-7 | 100mg |
| GN8466-5mg | 7-Allyl-7,8-dihydro-8-oxoguanosine | 121288-39-9 | 5mg |
| GN8466-25mg | 7-Allyl-7,8-dihydro-8-oxoguanosine | 121288-39-9 | 25mg |
| GT4475-250mg | 7-Amino-4-methylcoumarin | 26093-31-2 | 250mg |
| GT4475-10g | 7-Amino-4-methylcoumarin | 26093-31-2 | 10g |
| GW3701-100mg | 7-Amino-4-nitro-2,1,3-benzoxadiazole | 10199-91-4 | 100mg |
| GW3701-500mg | 7-Amino-4-nitro-2,1,3-benzoxadiazole | 10199-91-4 | 500mg |
| GT0896-100ug | 7-Amino-4-trifluoromethylcoumarin | 53518-15-3 | 100ug |
| GA3296-5mg | 7-Aminoactinomycin D | 7240-37-1 | 5mg |
| GA9837-1g | 7-Aminodesacetoxycephalosporanic acid | 22252-43-3 | 1g |
| GK7272-1g | 7-Azaindole | 271-63-6 | 1g |
| GK7272-5g | 7-Azaindole | 271-63-6 | 5g |
| GK7272-25g | 7-Azaindole | 271-63-6 | 25g |
| GL6932-1mg | 7-Azido-4-methylcoumarin | 95633-27-5 | 1mg |
| GL6932-5mg | 7-Azido-4-methylcoumarin | 95633-27-5 | 5mg |
| GK8132-50mg | 7-Benzyloxy-4-trifluoromethylcoumarin | 220001-53-6 | 50mg |
| GK8132-250mg | 7-Benzyloxy-4-trifluoromethylcoumarin | 220001-53-6 | 250mg |
| GK0634-5mg | 7-Benzyloxyquinoline | 131802-60-3 | 5mg |
| GL3845-5mg | 7-beta-Hydroxycholesterol | 566-27-8 | 5mg |
| GL3845-10mg | 7-beta-Hydroxycholesterol | 566-27-8 | 10mg |
| GL3845-100mg | 7-beta-Hydroxycholesterol | 566-27-8 | 100mg |
| GL8522-5g | 7-Dehydrocholesterol | 434-16-2 | 5g |
| GT9922-50mg | 7-Diethylamino-3-(4-maleimidophenyl)-4-methylcoumarin | 76877-33-3 | 50mg |
| GW0385-1mg | 7-Diethylamino-3-[N-(4-maleimidoethyl)carbamoyl]coumarin | 156571-46-9 | 1mg |
| GW0385-20mg | 7-Diethylamino-3-[N-(4-maleimidoethyl)carbamoyl]coumarin | 156571-46-9 | 20mg |
| GW0385-250mg | 7-Diethylamino-3-[N-(4-maleimidoethyl)carbamoyl]coumarin | 156571-46-9 | 250mg |
| GW2688-1mg | 7-Diethylamino-3-[N-(4-maleimidopropyl)carbamoyl]coumarin | 160291-54-3 | 1mg |
| GW2688-10mg | 7-Diethylamino-3-[N-(4-maleimidopropyl)carbamoyl]coumarin | 160291-54-3 | 10mg |
| GW2688-100mg | 7-Diethylamino-3-[N-(4-maleimidopropyl)carbamoyl]coumarin | 160291-54-3 | 100mg |
| GT1222-100g | 7-Diethylamino-4-methylcoumarin | 91-44-1 | 100g |
| GT1222-250g | 7-Diethylamino-4-methylcoumarin | 91-44-1 | 250g |
| GT1222-500g | 7-Diethylamino-4-methylcoumarin | 91-44-1 | 500g |
| GW8483-100mg | 7-Diethylaminocoumarin-3-carboxylic acid | 50995-74-9 | 100mg |
| GW8483-200mg | 7-Diethylaminocoumarin-3-carboxylic acid | 50995-74-9 | 200mg |
| GW8483-1g | 7-Diethylaminocoumarin-3-carboxylic acid | 50995-74-9 | 1g |
| GW9735-1g | 7-Diethylaminocoumarin-3-carboxylic acid ethyl ester | 28705-46-6 | 1g |
| GW9735-5g | 7-Diethylaminocoumarin-3-carboxylic acid ethyl ester | 28705-46-6 | 5g |
| GW0529-100mg | 7-Diethylaminocoumarin-3-carboxylic acid N-succinimidyl ester | 139346-57-9 | 100mg |
| GW0529-1g | 7-Diethylaminocoumarin-3-carboxylic acid N-succinimidyl ester | 139346-57-9 | 1g |
| GW2126-100mg | 7-Diethylaminocoumarin-3,4-dicarboxylic acid | 75240-77-6 | 100mg |
| GW2126-1g | 7-Diethylaminocoumarin-3,4-dicarboxylic acid | 75240-77-6 | 1g |
| GW8372-100mg | 7-Ethoxy-4-methylcoumarin | 87-05-8 | 100mg |
| GW8372-200mg | 7-Ethoxy-4-methylcoumarin | 87-05-8 | 200mg |
| GW8372-1g | 7-Ethoxy-4-methylcoumarin | 87-05-8 | 1g |
| GW8855-50mg | 7-Ethoxy-4-trifluoromethylcoumarin | 115453-82-2 | 50mg |
| GW8855-250mg | 7-Ethoxy-4-trifluoromethylcoumarin | 115453-82-2 | 250mg |
| GP6652-100mg | 7-Ethyl-10-hydroxycamptothecin | 86639-52-3 | 100mg |
| GP6652-250mg | 7-Ethyl-10-hydroxycamptothecin | 86639-52-3 | 250mg |
| GX5733-5g | 7-Fluoroisatin | 317-20-4 | 5g |
| GK3240-100mg | 7-Hydroxy-1-tetralone | 22009-38-7 | 100mg |
| GK3240-500mg | 7-Hydroxy-1-tetralone | 22009-38-7 | 500mg |
| GK3240-1g | 7-Hydroxy-1-tetralone | 22009-38-7 | 1g |
| GE5358-10mg | 7-Hydroxy-4-aminomethylcoumarin | 10mg | |
| GW7328-200mg | 7-Hydroxy-4-methyl-2(1H)-quinolone | 20513-71-7 | 200mg |
| GW7328-1g | 7-Hydroxy-4-methyl-2(1H)-quinolone | 20513-71-7 | 1g |
| GT6413-100mg | 7-Hydroxycoumarin-3-carboxylic acid | 779-27-1 | 100mg |
| GT6413-1g | 7-Hydroxycoumarin-3-carboxylic acid | 779-27-1 | 1g |
| GK2679-5g | 7-Hydroxycoumarin-4-acetic acid | 6950-82-9 | 5g |
| GW0885-50mg | 7-Methoxy-4-(trifluoromethyl)coumarin | 575-04-2 | 50mg |
| GW0885-250mg | 7-Methoxy-4-(trifluoromethyl)coumarin | 575-04-2 | 250mg |
| GE1869-10mg | 7-Methoxy-4-aminomethylcoumarin | 239136-56-2 | 10mg |
| GE1869-25mg | 7-Methoxy-4-aminomethylcoumarin | 239136-56-2 | 25mg |
| GW6921-100mg | 7-Methoxy-4-methylcoumarin | 2555-28-4 | 100mg |
| GW6921-5g | 7-Methoxy-4-methylcoumarin | 2555-28-4 | 5g |
| GW7439-100mg | 7-Methoxycoumarin-3-carbonyl azide | 97632-67-2 | 100mg |
| GW7439-500mg | 7-Methoxycoumarin-3-carbonyl azide | 97632-67-2 | 500mg |
| GW7439-1g | 7-Methoxycoumarin-3-carbonyl azide | 97632-67-2 | 1g |
| GW4028-500mg | 7-Methoxycoumarin-3-carboxylic acid | 20300-59-8 | 500mg |
| GW4028-5g | 7-Methoxycoumarin-3-carboxylic acid | 20300-59-8 | 5g |
| GW7575-25mg | 7-Methoxycoumarin-3-carboxylic acid N-succinimidyl ester | 150321-92-9 | 25mg |
| GW7575-125mg | 7-Methoxycoumarin-3-carboxylic acid N-succinimidyl ester | 150321-92-9 | 125mg |
| GK6412-500mg | 7-Methoxycoumarin-4-acetic acid | 62935-72-2 | 500mg |
| GK6412-1g | 7-Methoxycoumarin-4-acetic acid | 62935-72-2 | 1g |
| GT4414-50mg | 7-Methoxycoumarin-4-acetic Acid N-Succinimidyl Ester | 359436-89-8 | 50mg |
| GT4414-250mg | 7-Methoxycoumarin-4-acetic Acid N-Succinimidyl Ester | 359436-89-8 | 250mg |
| GW0899-250mg | 7-Methylguanine | 578-76-7 | 250mg |
| GW0899-500mg | 7-Methylguanine | 578-76-7 | 500mg |
| GW0899-1g | 7-Methylguanine | 578-76-7 | 1g |
| GW3952-10mg | 7beta-Hydroxy-cholesteryl-bishemisuccinate-diethanolamine salt | 105449-93-2 | 10mg |
| GW3952-50mg | 7beta-Hydroxy-cholesteryl-bishemisuccinate-diethanolamine salt | 105449-93-2 | 50mg |
| GW3952-250mg | 7beta-Hydroxy-cholesteryl-bishemisuccinate-diethanolamine salt | 105449-93-2 | 250mg |
| GL0006-10mg | 7BIO | 916440-85-2 | 10mg |
| GL0006-50mg | 7BIO | 916440-85-2 | 50mg |
| GW6816-200mg | 8-Acetoxypyrene-1,3,6-trisulfonic acid trisodium salt | 115787-83-2 | 200mg |
| GW6816-1g | 8-Acetoxypyrene-1,3,6-trisulfonic acid trisodium salt | 115787-83-2 | 1g |
| GW9424-25g | 8-Amino-2-naphthol | 118-46-7 | 25g |
| GW9424-100g | 8-Amino-2-naphthol | 118-46-7 | 100g |
| GK7810-100g | 8-Aminonaphthalene-1,6-disulfonic acid | 129-91-9 | 100g |
| GT2378-5g | 8-Anilino-1-naphthalenesulfonic acid | 82-76-8 | 5g |
| GT2378-25g | 8-Anilino-1-naphthalenesulfonic acid | 82-76-8 | 25g |
| GN5443-10mg | 8-Bromoguanosine 3'',5''-cyclic monophosphate sodium salt | 51116-01-9 | 10mg |
| GN5443-100mg | 8-Bromoguanosine 3'',5''-cyclic monophosphate sodium salt | 51116-01-9 | 100mg |
| GW8980-50mg | 8-Butyryloxy-pyren-1,3,6-trisulfonic acid | 115787-82-1 | 50mg |
| GW8980-250mg | 8-Butyryloxy-pyren-1,3,6-trisulfonic acid | 115787-82-1 | 250mg |
| GK4030-100g | 8-Chlorotheophylline | 85-18-7 | 100g |
| GY5383-5mg | 8-Geranopsoralen | 7437-55-0 | 5mg |
| GK6104-1g | 8-Hydroxy-1,3,6-pyrenetrisulfonic acid, trisodium salt | 6358-69-6 | 1g |
| GK6104-5g | 8-Hydroxy-1,3,6-pyrenetrisulfonic acid, trisodium salt | 6358-69-6 | 5g |
| GK6104-10g | 8-Hydroxy-1,3,6-pyrenetrisulfonic acid, trisodium salt | 6358-69-6 | 10g |
| GK4132-1g | 8-Hydroxy-5-nitroquinoline | 4008-48-4 | 1g |
| GW8063-10mg | 8-Hydroxy-N,N,N'',N'',N'''',N''''-hexamethyl-pyrene-1,3,6-trisulfonamide | 127044-59-1 | 10mg |
| GW8063-50mg | 8-Hydroxy-N,N,N'',N'',N'''',N''''-hexamethyl-pyrene-1,3,6-trisulfonamide | 127044-59-1 | 50mg |
| GT8956-1g | 8-Hydroxyjulolidine | 41175-50-2 | 1g |
| GT8956-5g | 8-Hydroxyjulolidine | 41175-50-2 | 5g |
| GT8956-25g | 8-Hydroxyjulolidine | 41175-50-2 | 25g |
| GA0472-25g | 8-Hydroxyquinoline | 148-24-3 | 25g |
| GA0472-100g | 8-Hydroxyquinoline | 148-24-3 | 100g |
| GA0472-250g | 8-Hydroxyquinoline | 148-24-3 | 250g |
| GA0472-500g | 8-Hydroxyquinoline | 148-24-3 | 500g |
| GA0472-1kg | 8-Hydroxyquinoline | 148-24-3 | 1kg |
| GK7141-10g | 8-Hydroxyquinoline citrate | 134-30-5 | 10g |
| GK7141-25g | 8-Hydroxyquinoline citrate | 134-30-5 | 25g |
| GK7141-50g | 8-Hydroxyquinoline citrate | 134-30-5 | 50g |
| GC9186-1g | 8-Hydroxyquinoline-b-D-galactopyranoside | 113079-84-8 | 1g |
| GT5671-100mg | 8-Methoxypyrene-1,3,6-trisulfonic acid trisodium salt | 82962-86-5 | 100mg |
| GT5671-250mg | 8-Methoxypyrene-1,3,6-trisulfonic acid trisodium salt | 82962-86-5 | 250mg |
| GT5671-1g | 8-Methoxypyrene-1,3,6-trisulfonic acid trisodium salt | 82962-86-5 | 1g |
| GW0644-1g | 8-Phenyl-1-octanol | 10472-97-6 | 1g |
| GW0644-5g | 8-Phenyl-1-octanol | 10472-97-6 | 5g |
| GY1353-1mg | 8-Prenylnaringenin | 53846-50-7 | 1mg |
| GY1353-5mg | 8-Prenylnaringenin | 53846-50-7 | 5mg |
| GA3030-500g | 8-Quinolinol hemisulfate salt | 134-31-6 | 500g |
| GA3030-1kg | 8-Quinolinol hemisulfate salt | 134-31-6 | 1kg |
| GT6060-10mg | 9-(2-Carboxy-2-cyanovinyl)julolidine | 142978-18-5 | 10mg |
| GT6060-125mg | 9-(2-Carboxy-2-cyanovinyl)julolidine | 142978-18-5 | 125mg |
| GN2070-100mg | 9-(b-D-Arabinofuranosyl)guanine | 38819-10-2 | 100mg |
| GN2070-1g | 9-(b-D-Arabinofuranosyl)guanine | 38819-10-2 | 1g |
| GN6878-500ug | 9-(b-D-Ribofuranosyl)purine | 550-33-4 | 500ug |
| GN6878-1mg | 9-(b-D-Ribofuranosyl)purine | 550-33-4 | 1mg |
| GW5286-10mg | 9-(Hydroxymethyl)-10-carbamoylacridan | 68011-71-2 | 10mg |
| GW5286-25mg | 9-(Hydroxymethyl)-10-carbamoylacridan | 68011-71-2 | 25mg |
| GP6992-5g | 9-Aminoacridine hydrochloride monohydrate | 52417-22-8 | 5g |
| GP6992-25g | 9-Aminoacridine hydrochloride monohydrate | 52417-22-8 | 25g |
| GP6992-100g | 9-Aminoacridine hydrochloride monohydrate | 52417-22-8 | 100g |
| GK0832-5g | 9-Anthracenecarboxylic acid | 723-62-6 | 5g |
| GK0832-25g | 9-Anthracenecarboxylic acid | 723-62-6 | 25g |
| GK0832-100g | 9-Anthracenecarboxylic acid | 723-62-6 | 100g |
| GK5039-5g | 9-Anthraldehyde | 642-31-9 | 5g |
| GK5039-500g | 9-Anthraldehyde | 642-31-9 | 500g |
| GK9920-5g | 9-Chloromethylanthracene | 24463-19-2 | 5g |
| GK9920-10g | 9-Chloromethylanthracene | 24463-19-2 | 10g |
| GK9920-25g | 9-Chloromethylanthracene | 24463-19-2 | 25g |
| GW8077-100mg | 9-Methylguanine | 5502-78-3 | 100mg |
| GW8077-250mg | 9-Methylguanine | 5502-78-3 | 250mg |
| GW8077-1g | 9-Methylguanine | 5502-78-3 | 1g |
| GW3436-100mg | 9,10-Anthracenedipropanoic acid | 71367-28-7 | 100mg |
| GW3436-250mg | 9,10-Anthracenedipropanoic acid | 71367-28-7 | 250mg |
| GW3436-1g | 9,10-Anthracenedipropanoic acid | 71367-28-7 | 1g |
| GW0020-50mg | 9,10-Anthracenediyl-bis(methylene)dimalonic acid | 307554-62-7 | 50mg |
| GW0020-200mg | 9,10-Anthracenediyl-bis(methylene)dimalonic acid | 307554-62-7 | 200mg |
| GW0020-1g | 9,10-Anthracenediyl-bis(methylene)dimalonic acid | 307554-62-7 | 1g |
| GX4434-5g | 9,10-Bis(chloromethyl)anthracene | 10387-13-0 | 5g |
| GX4434-25g | 9,10-Bis(chloromethyl)anthracene | 10387-13-0 | 25g |
| GW8813-1mg | A-443654 | 552325-16-3 | 1mg |
| GW8813-5mg | A-443654 | 552325-16-3 | 5mg |
| GW8742-1mg | A-674563 (free base) | 552325-73-2 | 1mg |
| GW8742-5mg | A-674563 (free base) | 552325-73-2 | 5mg |
| GW8742-10mg | A-674563 (free base) | 552325-73-2 | 10mg |
| GE5380-10mg | A-769662 | 844499-71-4 | 10mg |
| GC5340-10mg | a-D-Galactose-1-phosphate dipotassium salt pentahydrate | 19046-60-7 | 10mg |
| GC5340-25mg | a-D-Galactose-1-phosphate dipotassium salt pentahydrate | 19046-60-7 | 25mg |
| GC5340-100mg | a-D-Galactose-1-phosphate dipotassium salt pentahydrate | 19046-60-7 | 100mg |
| GC5340-250mg | a-D-Galactose-1-phosphate dipotassium salt pentahydrate | 19046-60-7 | 250mg |
| GC5340-500mg | a-D-Galactose-1-phosphate dipotassium salt pentahydrate | 19046-60-7 | 500mg |
| GC3160-5g | a-D-Mannose pentaacetate | 4163-65-9 | 5g |
| GC3160-10g | a-D-Mannose pentaacetate | 4163-65-9 | 10g |
| GC7225-5mg | a-Solanine | 20562-02-1 | 5mg |
| GW9828-25mg | A2B2-Ionophore | 1253421-84-9 | 25mg |
| GW9828-250mg | A2B2-Ionophore | 1253421-84-9 | 250mg |
| GP1173-1g | Abacavir | 136470-78-5 | 1g |
| GP1173-5g | Abacavir | 136470-78-5 | 5g |
| GC2122-1mg | Abacavir 5''-b-D-glucuronide | 384329-76-4 | 1mg |
| GC2122-2mg | Abacavir 5''-b-D-glucuronide | 384329-76-4 | 2mg |
| GC2122-5mg | Abacavir 5''-b-D-glucuronide | 384329-76-4 | 5mg |
| GC2122-10mg | Abacavir 5''-b-D-glucuronide | 384329-76-4 | 10mg |
| GP9949-250mg | Abacavir sulfate | 188062-50-2 | 250mg |
| GP9949-1g | Abacavir sulfate | 188062-50-2 | 1g |
| GC3099-1g | Abamectin | 71751-41-2 | 1g |
| GC3099-5g | Abamectin | 71751-41-2 | 5g |
| GT6137-10mg | ABD-F | 91366-65-3 | 10mg |
| GP8507-25mg | Abiraterone | 154229-19-3 | 25mg |
| GP8507-100mg | Abiraterone | 154229-19-3 | 100mg |
| GP3228-100mg | Abiraterone acetate | 154229-18-2 | 100mg |
| GP3228-250mg | Abiraterone acetate | 154229-18-2 | 250mg |
| GC6132-1mg | Abiraterone O-β-D-glucuronide | 2307194-33-6 | 1mg |
| GC6132-2mg | Abiraterone O-β-D-glucuronide | 2307194-33-6 | 2mg |
| GC6132-5mg | Abiraterone O-β-D-glucuronide | 2307194-33-6 | 5mg |
| GC6132-10mg | Abiraterone O-β-D-glucuronide | 2307194-33-6 | 10mg |
| GY7768-100mg | Abscisic acid | 14375-45-2 | 100mg |
| GY7768-500mg | Abscisic acid | 14375-45-2 | 500mg |
| GW8845-1mg | ABT-737 | 852808-04-9 | 1mg |
| GW8845-5mg | ABT-737 | 852808-04-9 | 5mg |
| GW8845-10mg | ABT-737 | 852808-04-9 | 10mg |
| GE7230-1g | ABTS | 30931-67-0 | 1g |
| GE7230-5g | ABTS | 30931-67-0 | 5g |
| GW6725-1mg | Ac-Ala-Asn-Trp-AMC | 2357123-49-8 | 1mg |
| GW6725-5mg | Ac-Ala-Asn-Trp-AMC | 2357123-49-8 | 5mg |
| GW6725-25mg | Ac-Ala-Asn-Trp-AMC | 2357123-49-8 | 25mg |
| GL7574-1mg | Ac-Arg-Leu-Arg-AMC | 929903-87-7 | 1mg |
| GL7574-5mg | Ac-Arg-Leu-Arg-AMC | 929903-87-7 | 5mg |
| GW0179-1mg | Ac-Pro-Ala-Leu-AMC | 1431362-79-6 | 1mg |
| GW0179-5mg | Ac-Pro-Ala-Leu-AMC | 1431362-79-6 | 5mg |
| GW0179-25mg | Ac-Pro-Ala-Leu-AMC | 1431362-79-6 | 25mg |
| GW3560-1mg | Ac-Trp-Leu-Ala-AMC | 1104011-59-7 | 1mg |
| GW3560-5mg | Ac-Trp-Leu-Ala-AMC | 1104011-59-7 | 5mg |
| GL4467-25mg | Acacetin | 480-44-4 | 25mg |
| GP6637-10mg | Acadesine | 2627-69-2 | 10mg |
| GP6637-50mg | Acadesine | 2627-69-2 | 50mg |
| GP6637-100mg | Acadesine | 2627-69-2 | 100mg |
| GC8557-250mg | Acarbose | 56180-94-0 | 250mg |
| GC8557-1g | Acarbose | 56180-94-0 | 1g |
| GC8557-5g | Acarbose | 56180-94-0 | 5g |
| GP9829-5g | Aceclofenac | 89796-99-6 | 5g |
| GP9829-25g | Aceclofenac | 89796-99-6 | 25g |
| GC3947-5mg | Acedoben acyl-β-D-glucuronide | 34220-56-9 | 5mg |
| GC3947-10mg | Acedoben acyl-β-D-glucuronide | 34220-56-9 | 10mg |
| GC3947-25mg | Acedoben acyl-β-D-glucuronide | 34220-56-9 | 25mg |
| GC3947-50mg | Acedoben acyl-β-D-glucuronide | 34220-56-9 | 50mg |
| GC6232-1mg | Acemetacin acyl-β-D-glucuronide | 1260603-31-3 | 1mg |
| GC6232-2mg | Acemetacin acyl-β-D-glucuronide | 1260603-31-3 | 2mg |
| GC6232-5mg | Acemetacin acyl-β-D-glucuronide | 1260603-31-3 | 5mg |
| GC6232-10mg | Acemetacin acyl-β-D-glucuronide | 1260603-31-3 | 10mg |
| GK1639-5g | Acenaphthene | 83-32-9 | 5g |
| GK1639-25g | Acenaphthene | 83-32-9 | 25g |
| GP6873-10mg | Acepromazine maleate | 3598-37-6 | 10mg |
| GP6873-50mg | Acepromazine maleate | 3598-37-6 | 50mg |
| GP6873-100mg | Acepromazine maleate | 3598-37-6 | 100mg |
| GB7796-25g | ACES | 7365-82-4 | 25g |
| GB7796-100g | ACES | 7365-82-4 | 100g |
| GB7796-250g | ACES | 7365-82-4 | 250g |
| GB7796-500g | ACES | 7365-82-4 | 500g |
| GB7796-1kg | ACES | 7365-82-4 | 1kg |
| GW2990-25g | Acesulfame K | 55589-62-3 | 25g |
| GW2990-100g | Acesulfame K | 55589-62-3 | 100g |
| GW2990-250g | Acesulfame K | 55589-62-3 | 250g |
| GL9642-100g | Acetamide | 60-35-5 | 100g |
| GL9642-250g | Acetamide | 60-35-5 | 250g |
| GL9642-500g | Acetamide | 60-35-5 | 500g |
| GL9642-1kg | Acetamide | 60-35-5 | 1kg |
| GL1221-250g | Acetamide, pure | 60-35-5 | 250g |
| GL1221-1kg | Acetamide, pure | 60-35-5 | 1kg |
| GL1221-5kg | Acetamide, pure | 60-35-5 | 5kg |
| GC6170-10mg | Acetaminophen D-glucuronide | 16110-10-4 | 10mg |
| GC6170-25mg | Acetaminophen D-glucuronide | 16110-10-4 | 25mg |
| GC6170-50mg | Acetaminophen D-glucuronide | 16110-10-4 | 50mg |
| GC6170-100mg | Acetaminophen D-glucuronide | 16110-10-4 | 100mg |
| GK4448-100mg | Acetamiprid | 135410-20-7 | 100mg |
| GK4448-1g | Acetamiprid | 135410-20-7 | 1g |
| GK9995-100g | Acetanilide | 103-84-4 | 100g |
| GK9995-250g | Acetanilide | 103-84-4 | 250g |
| GK9995-500g | Acetanilide | 103-84-4 | 500g |
| GK9995-1kg | Acetanilide | 103-84-4 | 1kg |
| GV2353-100ml | Acetic acid | 64-19-7 | 100ml |
| GV2353-500ml | Acetic acid | 64-19-7 | 500ml |
| GV2353-1l | Acetic acid | 64-19-7 | 1l |
| GV2353-2500ml | Acetic acid | 64-19-7 | 2500ml |
| GV2353-5l | Acetic acid | 64-19-7 | 5l |
| GV9212-1l | Acetic acid, glacial, Ph. Eur. grade | 64-19-7 | 1l |
| GV9212-2500ml | Acetic acid, glacial, Ph. Eur. grade | 64-19-7 | 2500ml |
| GV9212-5l | Acetic acid, glacial, Ph. Eur. grade | 64-19-7 | 5l |
| GS5817-100ml | Acetic Acid, GlenDry™, anhydrous | 64-19-7 | 100ml |
| GS5817-500ml | Acetic Acid, GlenDry™, anhydrous | 64-19-7 | 500ml |
| GS5817-1l | Acetic Acid, GlenDry™, anhydrous | 64-19-7 | 1l |
| GS5817-2500ml | Acetic Acid, GlenDry™, anhydrous | 64-19-7 | 2500ml |
| GS0690-500ml | Acetic acid, GlenPure™, analytical grade | 64-19-7 | 500ml |
| GS0690-1l | Acetic acid, GlenPure™, analytical grade | 64-19-7 | 1l |
| GS0690-2500ml | Acetic acid, GlenPure™, analytical grade | 64-19-7 | 2500ml |
| GX7648-10g | Acetoacetamide | 5977-14-0 | 10g |
| GC3316-1g | Acetobromo-a-D-glucuronic acid methyl ester | 21085-72-3 | 1g |
| GC7520-10g | Acetobromo-alpha-D-glucose | 572-09-8 | 10g |
| GC7520-25g | Acetobromo-alpha-D-glucose | 572-09-8 | 25g |
| GC7520-50g | Acetobromo-alpha-D-glucose | 572-09-8 | 50g |
| GC7520-100g | Acetobromo-alpha-D-glucose | 572-09-8 | 100g |
| GC2695-5g | Acetobromo-α-D-galactose | 3068-32-4 | 5g |
| GC2695-10g | Acetobromo-α-D-galactose | 3068-32-4 | 10g |
| GC2695-25g | Acetobromo-α-D-galactose | 3068-32-4 | 25g |
| GC7417-250mg | Acetobromofucose | 16741-27-8 | 250mg |
| GC7417-500mg | Acetobromofucose | 16741-27-8 | 500mg |
| GC7417-1g | Acetobromofucose | 16741-27-8 | 1g |
| GC7417-2g | Acetobromofucose | 16741-27-8 | 2g |
| GL0905-25g | Acetoin | 513-86-0 | 25g |
| GL0905-100g | Acetoin | 513-86-0 | 100g |
| GA3561-1mg | Acetomycin | 510-18-9 | 1mg |
| GA3561-5mg | Acetomycin | 510-18-9 | 5mg |
| GK3021-1l | Acetone | 67-64-1 | 1l |
| GK3021-2500ml | Acetone | 67-64-1 | 2500ml |
| GK3021-5l | Acetone | 67-64-1 | 5l |
| GK5043-500g | Acetone oxime | 127-06-0 | 500g |
| GK3913-500ml | Acetone, 99.8%, for analysis | 67-64-1 | 500ml |
| GK3913-1l | Acetone, 99.8%, for analysis | 67-64-1 | 1l |
| GK3913-2500ml | Acetone, 99.8%, for analysis | 67-64-1 | 2500ml |
| GS2410-100ml | Acetone, GlenDry™, anhydrous | 67-64-1 | 100ml |
| GS2410-500ml | Acetone, GlenDry™, anhydrous | 67-64-1 | 500ml |
| GS2410-1l | Acetone, GlenDry™, anhydrous | 67-64-1 | 1l |
| GS2410-2500ml | Acetone, GlenDry™, anhydrous | 67-64-1 | 2500ml |
| GS1428-500ml | Acetone, GlenPure™, analytical grade | 67-64-1 | 500ml |
| GS1428-1l | Acetone, GlenPure™, analytical grade | 67-64-1 | 1l |
| GS1428-2500ml | Acetone, GlenPure™, analytical grade | 67-64-1 | 2500ml |
| GS5770-2500ml | Acetone, GlenPure™, analytical grade low in methanol | 67-64-1 | 2500ml |
| GS9563-2500ml | Acetone, GlenUltra™, analytical grade, for GC | 67-64-1 | 2500ml |
| GK1492-100ml | Acetonitrile | 75-05-8 | 100ml |
| GK1492-500ml | Acetonitrile | 75-05-8 | 500ml |
| GK1492-1l | Acetonitrile | 75-05-8 | 1l |
| GK1492-2500ml | Acetonitrile | 75-05-8 | 2500ml |
| GS0969-1l | Acetonitrile 10, GlenBiol™, suitable for molecular biology | 75-05-8 | 1l |
| GS0969-2500ml | Acetonitrile 10, GlenBiol™, suitable for molecular biology | 75-05-8 | 2500ml |
| GS1866-500ml | Acetonitrile 190, GlenPure™, analytical grade far UV/gradient quality | 75-05-8 | 500ml |
| GS1866-1l | Acetonitrile 190, GlenPure™, analytical grade far UV/gradient quality | 75-05-8 | 1l |
| GS1866-2500ml | Acetonitrile 190, GlenPure™, analytical grade far UV/gradient quality | 75-05-8 | 2500ml |
| GS0853-500ml | Acetonitrile 200, GlenPure™, analytical grade far UV | 75-05-8 | 500ml |
| GS0853-1l | Acetonitrile 200, GlenPure™, analytical grade far UV | 75-05-8 | 1l |
| GS0853-2500ml | Acetonitrile 200, GlenPure™, analytical grade far UV | 75-05-8 | 2500ml |
| GS8649-1l | Acetonitrile 30, GlenBiol™, suitable for molecular biology | 75-05-8 | 1l |
| GS8649-2500ml | Acetonitrile 30, GlenBiol™, suitable for molecular biology | 75-05-8 | 2500ml |
| GS0247-1l | Acetonitrile 50, GlenBiol™, suitable for molecular biology | 75-05-8 | 1l |
| GS0247-2500ml | Acetonitrile 50, GlenBiol™, suitable for molecular biology | 75-05-8 | 2500ml |
| GS0493-100ml | Acetonitrile, GlenDry™, anhydrous | 75-05-8 | 100ml |
| GS0493-500ml | Acetonitrile, GlenDry™, anhydrous | 75-05-8 | 500ml |
| GS0493-1l | Acetonitrile, GlenDry™, anhydrous | 75-05-8 | 1l |
| GS0493-2500ml | Acetonitrile, GlenDry™, anhydrous | 75-05-8 | 2500ml |
| GS0555-100ml | Acetonitrile, GlenDry™, anhydrous over molecular sieve | 75-05-8 | 100ml |
| GS0555-500ml | Acetonitrile, GlenDry™, anhydrous over molecular sieve | 75-05-8 | 500ml |
| GS0555-1l | Acetonitrile, GlenDry™, anhydrous over molecular sieve | 75-05-8 | 1l |
| GS0555-2500ml | Acetonitrile, GlenDry™, anhydrous over molecular sieve | 75-05-8 | 2500ml |
| GS7079-2500ml | Acetonitrile, GlenUltra™, analytical grade, for GC | 75-05-8 | 2500ml |
| GS6636-1l | Acetonitrile, GlenUltra™, analytical grade, for LC | 75-05-8 | 1l |
| GS6636-2500ml | Acetonitrile, GlenUltra™, analytical grade, for LC | 75-05-8 | 2500ml |
| GX7956-100g | Acetophenone | 98-86-2 | 100g |
| GY4252-25g | Acetovanillone | 498-02-2 | 25g |
| GY4252-100g | Acetovanillone | 498-02-2 | 100g |
| GL8669-5mg | Acetyl coenzyme A lithium salt | 32140-51-5 | 5mg |
| GL8669-10mg | Acetyl coenzyme A lithium salt | 32140-51-5 | 10mg |
| GL8669-25mg | Acetyl coenzyme A lithium salt | 32140-51-5 | 25mg |
| GK4759-5mg | Acetyl coenzyme A sodium salt | 102029-73-2 | 5mg |
| GK4759-25mg | Acetyl coenzyme A sodium salt | 102029-73-2 | 25mg |
| GK4759-100mg | Acetyl coenzyme A sodium salt | 102029-73-2 | 100mg |
| GW1345-500mg | Acetyl-L-alanyl-L-glutamine | 121574-43-4 | 500mg |
| GW1345-5g | Acetyl-L-alanyl-L-glutamine | 121574-43-4 | 5g |
| GK5992-5g | Acetyl-L-carnitine hydrochloride | 5080-50-2 | 5g |
| GK5992-25g | Acetyl-L-carnitine hydrochloride | 5080-50-2 | 25g |
| GK4207-100ml | Acetylacetone | 123-54-6 | 100ml |
| GL2912-25g | Acetylsalicylic acid | 50-78-2 | 25g |
| GL2912-100g | Acetylsalicylic acid | 50-78-2 | 100g |
| GL2912-250g | Acetylsalicylic acid | 50-78-2 | 250g |
| GL2912-500g | Acetylsalicylic acid | 50-78-2 | 500g |
| GL2912-1kg | Acetylsalicylic acid | 50-78-2 | 1kg |
| GL0865-25g | Acetylsalicylic acid, USP grade | 50-78-2 | 25g |
| GL0865-100g | Acetylsalicylic acid, USP grade | 50-78-2 | 100g |
| GL0865-250g | Acetylsalicylic acid, USP grade | 50-78-2 | 250g |
| GL0865-500g | Acetylsalicylic acid, USP grade | 50-78-2 | 500g |
| GE4789-1g | Acetylthiocholine iodide | 1866-15-5 | 1g |
| GE4789-5g | Acetylthiocholine iodide | 1866-15-5 | 5g |
| GE4789-25g | Acetylthiocholine iodide | 1866-15-5 | 25g |
| GT2925-25g | Acid Blue 29 | 5850-35-1 | 25g |
| GT2925-100g | Acid Blue 29 | 5850-35-1 | 100g |
| GT2925-250g | Acid Blue 29 | 5850-35-1 | 250g |
| GT4451-25g | Acid Blue 40 (C.I. 62125) | 6424-85-7 | 25g |
| GT4451-100g | Acid Blue 40 (C.I. 62125) | 6424-85-7 | 100g |
| GT9286-25g | Acid Blue 80 | 4474-24-2 | 25g |
| GT9286-100g | Acid Blue 80 | 4474-24-2 | 100g |
| GT8266-25g | Acid Fuchsin (C.I. 42685) | 3244-88-0 | 25g |
| GT8266-50g | Acid Fuchsin (C.I. 42685) | 3244-88-0 | 50g |
| GT8266-100g | Acid Fuchsin (C.I. 42685) | 3244-88-0 | 100g |
| GT7822-25g | Acid Fuchsin calcium salt | 123334-10-1 | 25g |
| GT7822-100g | Acid Fuchsin calcium salt | 123334-10-1 | 100g |
| GT1171-25g | Acid Green 50 | 3087-16-9 | 25g |
| GT1171-100g | Acid Green 50 | 3087-16-9 | 100g |
| GT1171-500g | Acid Green 50 | 3087-16-9 | 500g |
| GT6503-25g | Acid Red 1 (C.I. 18050) | 3734-67-6 | 25g |
| GT6503-100g | Acid Red 1 (C.I. 18050) | 3734-67-6 | 100g |
| GT6503-250g | Acid Red 1 (C.I. 18050) | 3734-67-6 | 250g |
| GT6503-500g | Acid Red 1 (C.I. 18050) | 3734-67-6 | 500g |
| GT4801-50g | Acid Violet 17 (C.I. 42650) | 4129-84-4 | 50g |
| GK7831-25g | Acid Violet 43 | 4430-18-6 | 25g |
| GT0748-10g | Acid Yellow 99 (C.I. 13900) | 10343-58-5 | 10g |
| GT0748-25g | Acid Yellow 99 (C.I. 13900) | 10343-58-5 | 25g |
| GT0748-100g | Acid Yellow 99 (C.I. 13900) | 10343-58-5 | 100g |
| GP9248-100mg | Acitretin | 55079-83-9 | 100mg |
| GP9248-1g | Acitretin | 55079-83-9 | 1g |
| GK1633-100mg | Aconitine | 302-27-2 | 100mg |
| GT5850-100mg | Acridine Orange 10-nonyl bromide | 75168-11-5 | 100mg |
| GT9731-5g | Acridine Orange base | 494-38-2 | 5g |
| GT9731-25g | Acridine Orange base | 494-38-2 | 25g |
| GT9224-5g | Acridine Orange hemi(zinc chloride) salt (C.I. 46005) | 10127-02-3 | 5g |
| GT9224-10g | Acridine Orange hemi(zinc chloride) salt (C.I. 46005) | 10127-02-3 | 10g |
| GT9224-25g | Acridine Orange hemi(zinc chloride) salt (C.I. 46005) | 10127-02-3 | 25g |
| GL1836-1g | Acridine Orange hydrochloride hydrate | 65-61-2 | 1g |
| GL1836-5g | Acridine Orange hydrochloride hydrate | 65-61-2 | 5g |
| GT5724-25g | Acridine Yellow G (C.I. 46025) | 135-49-9 | 25g |
| GT5724-100g | Acridine Yellow G (C.I. 46025) | 135-49-9 | 100g |
| GT3998-10g | Acriflavine hydrochloride (C.I. 46000) | 69235-50-3 | 10g |
| GT3998-25g | Acriflavine hydrochloride (C.I. 46000) | 69235-50-3 | 25g |
| GT3998-100g | Acriflavine hydrochloride (C.I. 46000) | 69235-50-3 | 100g |
| GT4120-25g | Acriflavine neutral | 8048-52-0 | 25g |
| GT4120-100g | Acriflavine neutral | 8048-52-0 | 100g |
| GP6436-10mg | Acrivastin | 87848-99-5 | 10mg |
| GP6436-50mg | Acrivastin | 87848-99-5 | 50mg |
| GE3215-250ml | Acrylamide 4X solution | 79-06-1 | 250ml |
| GE3215-1l | Acrylamide 4X solution | 79-06-1 | 1l |
| GK0096-100g | Acrylamide, 98% | 79-06-1 | 100g |
| GK0096-250g | Acrylamide, 98% | 79-06-1 | 250g |
| GK0096-500g | Acrylamide, 98% | 79-06-1 | 500g |
| GK0096-1kg | Acrylamide, 98% | 79-06-1 | 1kg |
| GK5651-100g | Acrylamide, suitable for electrophoresis | 79-06-1 | 100g |
| GE5044-100ml | Acrylamide/Bis-acrylamide, 19:1, 30% solution | - | 100ml |
| GE5044-500ml | Acrylamide/Bis-acrylamide, 19:1, 30% solution | - | 500ml |
| GE5044-1l | Acrylamide/Bis-acrylamide, 19:1, 30% solution | - | 1l |
| GE0418-100ml | Acrylamide/Bis-acrylamide, 19:1, 40% solution | 100ml | |
| GE0418-500ml | Acrylamide/Bis-acrylamide, 19:1, 40% solution | 500ml | |
| GE0418-1l | Acrylamide/Bis-acrylamide, 19:1, 40% solution | 1l | |
| GE4227-100ml | Acrylamide/Bis-acrylamide, 29:1, 30% solution | - | 100ml |
| GE4227-500ml | Acrylamide/Bis-acrylamide, 29:1, 30% solution | - | 500ml |
| GE4227-1l | Acrylamide/Bis-acrylamide, 29:1, 30% solution | - | 1l |
| GE0513-100ml | Acrylamide/Bis-acrylamide, 29:1, 40% solution | - | 100ml |
| GE0513-500ml | Acrylamide/Bis-acrylamide, 29:1, 40% solution | - | 500ml |
| GE0513-1l | Acrylamide/Bis-acrylamide, 29:1, 40% solution | - | 1l |
| GE4329-100ml | Acrylamide/Bis-acrylamide, 37.5:1, 30% solution | - | 100ml |
| GE4329-500ml | Acrylamide/Bis-acrylamide, 37.5:1, 30% solution | - | 500ml |
| GE4329-1l | Acrylamide/Bis-acrylamide, 37.5:1, 30% solution | - | 1l |
| GE2988-100ml | Acrylamide/Bis-acrylamide, 37.5:1, 40% solution | - | 100ml |
| GE2988-500ml | Acrylamide/Bis-acrylamide, 37.5:1, 40% solution | - | 500ml |
| GE2988-1l | Acrylamide/Bis-acrylamide, 37.5:1, 40% solution | - | 1l |
| GW1963-1mg | Actagardin | 59165-34-3 | 1mg |
| GW1963-5mg | Actagardin | 59165-34-3 | 5mg |
| GW1963-25mg | Actagardin | 59165-34-3 | 25mg |
| GA0481-2mg | Actinomycin D | 50-76-0 | 2mg |
| GA0481-5mg | Actinomycin D | 50-76-0 | 5mg |
| GA0481-10mg | Actinomycin D | 50-76-0 | 10mg |
| GA0481-25mg | Actinomycin D | 50-76-0 | 25mg |
| GA0481-50mg | Actinomycin D | 50-76-0 | 50mg |
| GA7901-25mg | Actinomycin D, GlenCell™, suitable for cell culture, USP grade | 50-76-0 | 25mg |
| GL3366-1mg | Actinomycin X2 | 18865-48-0 | 1mg |
| GL3366-5mg | Actinomycin X2 | 18865-48-0 | 5mg |
| GA8851-5mg | Actinonin | 13434-13-4 | 5mg |
| GA8851-25mg | Actinonin | 13434-13-4 | 25mg |
| GX9755-1kg | Activated carbon, granules 2.5 mm | 7440-44-0 | 1kg |
| GX1528-250g | Activated carbon, powder 300-500 micron | 7440-44-0 | 250g |
| GX1528-1kg | Activated carbon, powder 300-500 micron | 7440-44-0 | 1kg |
| GX2452-250g | Activated carbon, powder, max. 100 micron | 7440-44-0 | 250g |
| GX2452-1kg | Activated carbon, powder, max. 100 micron | 7440-44-0 | 1kg |
| GX1921-100g | Activated charcoal, powder, EP grade | 7440-44-0 | 100g |
| GX1921-250g | Activated charcoal, powder, EP grade | 7440-44-0 | 250g |
| GX1921-500g | Activated charcoal, powder, EP grade | 7440-44-0 | 500g |
| GW3239-1mg | ACY-775 | 1375466-18-4 | 1mg |
| GW3239-5mg | ACY-775 | 1375466-18-4 | 5mg |
| GA7641-1g | Acyclovir | 59277-89-3 | 1g |
| GA7641-5g | Acyclovir | 59277-89-3 | 5g |
| GA7641-25g | Acyclovir | 59277-89-3 | 25g |
| GM7835-25g | ADA | 26239-55-4 | 25g |
| GM7835-100g | ADA | 26239-55-4 | 100g |
| GM7835-250g | ADA | 26239-55-4 | 250g |
| GM7835-500g | ADA | 26239-55-4 | 500g |
| GB0256-100g | ADA disodium salt | 41689-31-0 | 100g |
| GB0256-500g | ADA disodium salt | 41689-31-0 | 500g |
| GP9483-100mg | Adapalene | 106685-40-9 | 100mg |
| GP9483-250mg | Adapalene | 106685-40-9 | 250mg |
| GP9483-500mg | Adapalene | 106685-40-9 | 500mg |
| GP9483-1g | Adapalene | 106685-40-9 | 1g |
| GP5887-100mg | Adefovir | 106941-25-7 | 100mg |
| GP5887-1g | Adefovir | 106941-25-7 | 1g |
| GP5823-250mg | Adefovir dipivoxil | 142340-99-6 | 250mg |
| GP5823-1g | Adefovir dipivoxil | 142340-99-6 | 1g |
| GE7863-5g | Adenine | 73-24-5 | 5g |
| GE7863-25g | Adenine | 73-24-5 | 25g |
| GE7863-100g | Adenine | 73-24-5 | 100g |
| GA0167-1g | Adenine 9-beta-D-arabinofuranoside | 5536-17-4 | 1g |
| GA0167-5g | Adenine 9-beta-D-arabinofuranoside | 5536-17-4 | 5g |
| GA0167-25g | Adenine 9-beta-D-arabinofuranoside | 5536-17-4 | 25g |
| GE9458-1g | Adenine monohydrochloride | 2922-28-3 | 1g |
| GE9458-5g | Adenine monohydrochloride | 2922-28-3 | 5g |
| GE9458-25g | Adenine monohydrochloride | 2922-28-3 | 25g |
| GE9458-100g | Adenine monohydrochloride | 2922-28-3 | 100g |
| GE5051-5g | Adenine sulfate | 321-30-2 | 5g |
| GE5051-25g | Adenine sulfate | 321-30-2 | 25g |
| GE5051-100g | Adenine sulfate | 321-30-2 | 100g |
| GE2110-5g | Adenine sulfate dihydrate | 6509-19-9 | 5g |
| GE2110-25g | Adenine sulfate dihydrate | 6509-19-9 | 25g |
| GE2110-100g | Adenine sulfate dihydrate | 6509-19-9 | 100g |
| GE1212-25g | Adenosine | 58-61-7 | 25g |
| GE1212-100g | Adenosine | 58-61-7 | 100g |
| GE1212-250g | Adenosine | 58-61-7 | 250g |
| GL9725-1g | Adenosine 5''-triphosphate disodium salt hydrate | 34369-07-8 | 1g |
| GL9725-5g | Adenosine 5''-triphosphate disodium salt hydrate | 34369-07-8 | 5g |
| GL9725-10g | Adenosine 5''-triphosphate disodium salt hydrate | 34369-07-8 | 10g |
| GE3544-1g | Adenosine 3''-,5''-cyclic monophosphate | 60-92-4 | 1g |
| GE3544-5g | Adenosine 3''-,5''-cyclic monophosphate | 60-92-4 | 5g |
| GN9482-100mg | Adenosine 5''-diphosphate | 58-64-0 | 100mg |
| GN9482-250mg | Adenosine 5''-diphosphate | 58-64-0 | 250mg |
| GN9482-1g | Adenosine 5''-diphosphate | 58-64-0 | 1g |
| GE3988-250mg | Adenosine 5''-diphosphate disodium salt | 16178-48-6 | 250mg |
| GE3988-1g | Adenosine 5''-diphosphate disodium salt | 16178-48-6 | 1g |
| GN8647-1g | Adenosine 5''-diphosphate potassium salt hydrate | 72696-48-1 | 1g |
| GN8647-5g | Adenosine 5''-diphosphate potassium salt hydrate | 72696-48-1 | 5g |
| GK3475-100mg | Adenosine 5''-diphosphate sodium salt | 20398-34-9 | 100mg |
| GK3475-500mg | Adenosine 5''-diphosphate sodium salt | 20398-34-9 | 500mg |
| GK3475-1g | Adenosine 5''-diphosphate sodium salt | 20398-34-9 | 1g |
| GK3475-5g | Adenosine 5''-diphosphate sodium salt | 20398-34-9 | 5g |
| GV7058-5g | Adenosine 5''-monophosphate | 61-19-8 | 5g |
| GV7058-25g | Adenosine 5''-monophosphate | 61-19-8 | 25g |
| GN7778-1g | Adenosine 5''-monophosphate disodium salt | 4578-31-8 | 1g |
| GN7778-5g | Adenosine 5''-monophosphate disodium salt | 4578-31-8 | 5g |
| GN7778-10g | Adenosine 5''-monophosphate disodium salt | 4578-31-8 | 10g |
| GN7778-25g | Adenosine 5''-monophosphate disodium salt | 4578-31-8 | 25g |
| GE4953-5g | Adenosine 5''-monophosphate monohydrate | 18422-05-4 | 5g |
| GE4953-10g | Adenosine 5''-monophosphate monohydrate | 18422-05-4 | 10g |
| GE4953-25g | Adenosine 5''-monophosphate monohydrate | 18422-05-4 | 25g |
| GE4953-100g | Adenosine 5''-monophosphate monohydrate | 18422-05-4 | 100g |
| GN1040-1g | Adenosine 5''-monophosphate sodium salt | 149022-20-8 | 1g |
| GN1040-5g | Adenosine 5''-monophosphate sodium salt | 149022-20-8 | 5g |
| GN1040-10g | Adenosine 5''-monophosphate sodium salt | 149022-20-8 | 10g |
| GN1040-25g | Adenosine 5''-monophosphate sodium salt | 149022-20-8 | 25g |
| GL3641-1mg | Adenosine 5''-O-thiomonophosphate dilithium salt | 93839-85-1 | 1mg |
| GL3641-5mg | Adenosine 5''-O-thiomonophosphate dilithium salt | 93839-85-1 | 5mg |
| GK2348-100g | Adipic acid | 124-04-9 | 100g |
| GK2348-500g | Adipic acid | 124-04-9 | 500g |
| GK2348-1kg | Adipic acid | 124-04-9 | 1kg |
| GK2348-5kg | Adipic acid | 124-04-9 | 5kg |
| GM8712-250g | Adipic acid dihydrazide | 1071-93-8 | 250g |
| GM8712-1kg | Adipic acid dihydrazide | 1071-93-8 | 1kg |
| GL6438-10mg | AdipoRon | 924416-43-3 | 10mg |
| GL6438-50mg | AdipoRon | 924416-43-3 | 50mg |
| GL0874-10mg | AdipoRon hydrochloride | 924416-43-3 (base) | 10mg |
| GL0874-50mg | AdipoRon hydrochloride | 924416-43-3 (base) | 50mg |
| GE4678-50mg | AEBSF hydrochloride | 30827-99-7 | 50mg |
| GE4678-250mg | AEBSF hydrochloride | 30827-99-7 | 250mg |
| GE4678-1g | AEBSF hydrochloride | 30827-99-7 | 1g |
| GA7949-1mg | Aerothionin | 28714-26-3 | 1mg |
| GW6150-1mg | Afatinib | 439081-18-2 | 1mg |
| GW6150-5mg | Afatinib | 439081-18-2 | 5mg |
| GW6150-10mg | Afatinib | 439081-18-2 | 10mg |
| GL4073-1mg | Aftin-4 | 866893-90-5 | 1mg |
| GL4073-5mg | Aftin-4 | 866893-90-5 | 5mg |
| GL4073-25mg | Aftin-4 | 866893-90-5 | 25mg |
| GL5855-1mg | Aftin-5 | 1mg | |
| GL5855-5mg | Aftin-5 | 5mg | |
| GW6755-1mg | AG-13958 | 319460-94-1 | 1mg |
| GW6755-5mg | AG-13958 | 319460-94-1 | 5mg |
| GW6755-10mg | AG-13958 | 319460-94-1 | 10mg |
| GK9085-100g | Agar, high gel strength | 9002-18-0 | 100g |
| GK9085-250g | Agar, high gel strength | 9002-18-0 | 250g |
| GK9085-500g | Agar, high gel strength | 9002-18-0 | 500g |
| GK9085-1kg | Agar, high gel strength | 9002-18-0 | 1kg |
| GK2227-100g | Agar, low gel strength | 9002-18-0 | 100g |
| GK2227-250g | Agar, low gel strength | 9002-18-0 | 250g |
| GK2227-500g | Agar, low gel strength | 9002-18-0 | 500g |
| GK2227-1kg | Agar, low gel strength | 9002-18-0 | 1kg |
| GC6234-100g | Agar, low gel strength, suitable for microbiology | 9002-18-0 | 100g |
| GC6234-250g | Agar, low gel strength, suitable for microbiology | 9002-18-0 | 250g |
| GC6234-500g | Agar, low gel strength, suitable for microbiology | 9002-18-0 | 500g |
| GC6234-1kg | Agar, low gel strength, suitable for microbiology | 9002-18-0 | 1kg |
| GE7747-250g | Agarose, high EEO | 9012-36-6 | 250g |
| GE7747-1kg | Agarose, high EEO | 9012-36-6 | 1kg |
| GE0001-5g | Agarose, low EEO | 9012-36-6 | 5g |
| GE0001-25g | Agarose, low EEO | 9012-36-6 | 25g |
| GE0001-100g | Agarose, low EEO | 9012-36-6 | 100g |
| GE0001-250g | Agarose, low EEO | 9012-36-6 | 250g |
| GE0001-500g | Agarose, low EEO | 9012-36-6 | 500g |
| GE0001-1kg | Agarose, low EEO | 9012-36-6 | 1kg |
| GE6258-25g | Agarose, low EEO, GlenBiol™, suitable for molecular biology | 9012-36-6 | 25g |
| GE6258-100g | Agarose, low EEO, GlenBiol™, suitable for molecular biology | 9012-36-6 | 100g |
| GE4750-25g | Agarose, medium EEO | 9012-36-6 | 25g |
| GE4750-100g | Agarose, medium EEO | 9012-36-6 | 100g |
| GE4750-500g | Agarose, medium EEO | 9012-36-6 | 500g |
| GW0219-100mg | AGD | 1456890-74-6 | 100mg |
| GW0219-250mg | AGD | 1456890-74-6 | 250mg |
| GL9007-200ug | Ageladine A TFA | 950766-21-9 | 200ug |
| GW1673-5mg | AGI-5198 | 1355326-35-0 | 5mg |
| GW1673-25mg | AGI-5198 | 1355326-35-0 | 25mg |
| GL9494-1mg | Agistatin B | 144096-46-8 | 1mg |
| GL9494-5mg | Agistatin B | 144096-46-8 | 5mg |
| GL7855-1mg | Agistatin D | 144096-47-9 | 1mg |
| GL7855-5mg | Agistatin D | 144096-47-9 | 5mg |
| GL8855-1mg | Agistatin E | 144096-48-0 | 1mg |
| GL8855-5mg | Agistatin E | 144096-48-0 | 5mg |
| GP5692-1g | Agmatine sulfate | 2482-00-0 | 1g |
| GP5692-5g | Agmatine sulfate | 2482-00-0 | 5g |
| GP5210-10mg | Ajmalicine | 483-04-5 | 10mg |
| GP5210-100mg | Ajmalicine | 483-04-5 | 100mg |
| GP5210-250mg | Ajmalicine | 483-04-5 | 250mg |
| GY4956-100mg | Ajmaline | 4360-12-7 | 100mg |
| GY4956-500mg | Ajmaline | 4360-12-7 | 500mg |
| GL8955-5mg | AK-7 | 420831-40-9 | 5mg |
| GL8955-25mg | AK-7 | 420831-40-9 | 25mg |
| GW4346-1mg | Akt-I-1 | 473382-39-7 | 1mg |
| GW4346-5mg | Akt-I-1 | 473382-39-7 | 5mg |
| GW4346-10mg | Akt-I-1 | 473382-39-7 | 10mg |
| GW0863-1mg | Akt-I-2 hydrochloride | 473382-48-8 | 1mg |
| GW0863-5mg | Akt-I-2 hydrochloride | 473382-48-8 | 5mg |
| GW0863-10mg | Akt-I-2 hydrochloride | 473382-48-8 | 10mg |
| GM2362-1g | Ala-Gly | 687-69-4 | 1g |
| GL9912-1g | Ala-Tyr | 3061-88-9 | 1g |
| GA6884-10g | Albendazole | 54965-21-8 | 10g |
| GA6884-25g | Albendazole | 54965-21-8 | 25g |
| GA6884-50g | Albendazole | 54965-21-8 | 50g |
| GL9307-1mg | Albocycline | 25129-91-3 | 1mg |
| GL9307-5mg | Albocycline | 25129-91-3 | 5mg |
| GT8542-5g | Alcian Blue 8 GX (C.I. 74240) | 75881-23-1 | 5g |
| GT8542-10g | Alcian Blue 8 GX (C.I. 74240) | 75881-23-1 | 10g |
| GT8542-25g | Alcian Blue 8 GX (C.I. 74240) | 75881-23-1 | 25g |
| GE7998-500ml | Alcian Blue, 1% solution in 3% acetic acid, pH 2.5 | 75881-23-1 | 500ml |
| GE7998-1l | Alcian Blue, 1% solution in 3% acetic acid, pH 2.5 | 75881-23-1 | 1l |
| GT4246-1g | Alcian Yellow (C.I. 12840) | 61968-76-1 | 1g |
| GT4246-5g | Alcian Yellow (C.I. 12840) | 61968-76-1 | 5g |
| GP9293-100mg | Alclometasone dipropionate | 66734-13-2 | 100mg |
| GP9293-500mg | Alclometasone dipropionate | 66734-13-2 | 500mg |
| GW6765-100mg | Aldicarb | 116-06-3 | 100mg |
| GP1402-5g | Alendronate sodium salt trihydrate | 121268-17-5 | 5g |
| GP9489-5mg | Alfacalcidol | 41294-56-8 | 5mg |
| GP9489-25mg | Alfacalcidol | 41294-56-8 | 25mg |
| GC9046-100g | Alginic acid | 9005-32-7 | 100g |
| GC9046-500g | Alginic acid | 9005-32-7 | 500g |
| GC9046-1kg | Alginic acid | 9005-32-7 | 1kg |
| GE7494-100g | Alginic acid sodium salt | 9005-38-3 | 100g |
| GE7494-250g | Alginic acid sodium salt | 9005-38-3 | 250g |
| GE7494-500g | Alginic acid sodium salt | 9005-38-3 | 500g |
| GE7494-1kg | Alginic acid sodium salt | 9005-38-3 | 1kg |
| GC4932-1kg | Alginic acid sodium salt, high viscosity | 9005-38-3 | 1kg |
| GT5801-100g | Alizarin (C.I. 58000) | 72-48-0 | 100g |
| GT5801-250g | Alizarin (C.I. 58000) | 72-48-0 | 250g |
| GT5801-500g | Alizarin (C.I. 58000) | 72-48-0 | 500g |
| GT6797-1g | Alizarin Complexone | 3952-78-1 | 1g |
| GT6797-5g | Alizarin Complexone | 3952-78-1 | 5g |
| GT6797-10g | Alizarin Complexone | 3952-78-1 | 10g |
| GT6383-5g | Alizarin Red S (C.I. 58005) | 130-22-3 | 5g |
| GT6383-25g | Alizarin Red S (C.I. 58005) | 130-22-3 | 25g |
| GT6383-100g | Alizarin Red S (C.I. 58005) | 130-22-3 | 100g |
| GT5959-5g | Alizarin Yellow GG (C.I. 14025) | 584-42-9 | 5g |
| GT5959-25g | Alizarin Yellow GG (C.I. 14025) | 584-42-9 | 25g |
| GT5959-100g | Alizarin Yellow GG (C.I. 14025) | 584-42-9 | 100g |
| GT3658-10g | Alkali Blue 6B (C.I. 42765) | 1324-76-1 | 10g |
| GT3658-25g | Alkali Blue 6B (C.I. 42765) | 1324-76-1 | 25g |
| GT3658-50g | Alkali Blue 6B (C.I. 42765) | 1324-76-1 | 50g |
| GP0435-25g | Allantoin | 97-59-6 | 25g |
| GP0435-100g | Allantoin | 97-59-6 | 100g |
| GP0435-250g | Allantoin | 97-59-6 | 250g |
| GP0435-500g | Allantoin | 97-59-6 | 500g |
| GP0435-1kg | Allantoin | 97-59-6 | 1kg |
| GP7860-1g | Allopregnanolone | 516-55-2 | 1g |
| GP4954-5g | Allopurinol | 315-30-0 | 5g |
| GP4954-25g | Allopurinol | 315-30-0 | 25g |
| GP1499-5g | Alloxan monohydrate | 2244-11-3 | 5g |
| GP1499-25g | Alloxan monohydrate | 2244-11-3 | 25g |
| GT7523-25g | Allura Red AC (C.I. 16035) | 25956-17-6 | 25g |
| GT7523-100g | Allura Red AC (C.I. 16035) | 25956-17-6 | 100g |
| GT7523-250g | Allura Red AC (C.I. 16035) | 25956-17-6 | 250g |
| GT7523-500g | Allura Red AC (C.I. 16035) | 25956-17-6 | 500g |
| GC1574-1g | Allyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside | 10343-15-4 | 1g |
| GC1574-2g | Allyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside | 10343-15-4 | 2g |
| GC1574-5g | Allyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside | 10343-15-4 | 5g |
| GC1574-10g | Allyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside | 10343-15-4 | 10g |
| GC1574-25g | Allyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside | 10343-15-4 | 25g |
| GD8934-500g | Allylsulfonic acid sodium salt | 2495-39-8 | 500g |
| GL5648-50mg | Aloe-emodin | 481-72-1 | 50mg |
| GL5632-500ug | Aloeresin A | 74545-79-2 | 500ug |
| GL7079-500ug | Aloesin | 30861-27-9 | 500ug |
| GC9451-25g | Aloin | 1415-73-2 | 25g |
| GC9451-100g | Aloin | 1415-73-2 | 100g |
| GC6065-25mg | Aloin A, 97% | 1415-73-2 | 25mg |
| GC6065-100mg | Aloin A, 97% | 1415-73-2 | 100mg |
| GC6065-250mg | Aloin A, 97% | 1415-73-2 | 250mg |
| GW0189-1mg | Alpelisib | 1217486-61-7 | 1mg |
| GW0189-5mg | Alpelisib | 1217486-61-7 | 5mg |
| GW0189-10mg | Alpelisib | 1217486-61-7 | 10mg |
| GX9354-25g | alpha Iron(III) oxide Nanopowder, (Haematite); 99.5%, red [APS 10 - 100 nm] | 1309-37-1 | 25g |
| GX9354-100g | alpha Iron(III) oxide Nanopowder, (Haematite); 99.5%, red [APS 10 - 100 nm] | 1309-37-1 | 100g |
| GK5589-25g | alpha-(2,4-Dichlorophenyl)-(1H)-imidazole-1-ethanol | 24155-42-8 | 25g |
| GX4775-50g | alpha-Aluminium oxide Nanopowder, 99,5 % | 1344-28-1 | 50g |
| GX4775-100g | alpha-Aluminium oxide Nanopowder, 99,5 % | 1344-28-1 | 100g |
| GX1021-50g | alpha-Aluminium oxide Nanopowder, 99,85 % | 1344-28-1 | 50g |
| GX1021-250g | alpha-Aluminium oxide Nanopowder, 99,85 % | 1344-28-1 | 250g |
| GX1021-1kg | alpha-Aluminium oxide Nanopowder, 99,85 % | 1344-28-1 | 1kg |
| GX2399-50g | alpha-Aluminium oxide nanopowder, 99.9% | 1344-28-1 | 50g |
| GX2399-250g | alpha-Aluminium oxide nanopowder, 99.9% | 1344-28-1 | 250g |
| GX2399-1kg | alpha-Aluminium oxide nanopowder, 99.9% | 1344-28-1 | 1kg |
| GX2901-1kg | alpha-Aluminium oxide Nanopowder, 99+ % | 1344-28-1 | 1kg |
| GE7409-25g | alpha-Amylase (with starch) | 9000-90-2 | 25g |
| GE7409-100g | alpha-Amylase (with starch) | 9000-90-2 | 100g |
| GK2343-25ml | alpha-Amylase, liquid | 9000-85-5 | 25ml |
| GC6524-10g | alpha-Arbutin | 84380-01-8 | 10g |
| GC6524-25g | alpha-Arbutin | 84380-01-8 | 25g |
| GC6524-100g | alpha-Arbutin | 84380-01-8 | 100g |
| GC6524-250g | alpha-Arbutin | 84380-01-8 | 250g |
| GK5749-10g | alpha-Bisabolol | 515-69-5 | 10g |
| GK5749-25g | alpha-Bisabolol | 515-69-5 | 25g |
| GL0668-1g | alpha-Cyano-4-hydroxycinnamic acid | 28166-41-8 | 1g |
| GL0668-10g | alpha-Cyano-4-hydroxycinnamic acid | 28166-41-8 | 10g |
| GC6443-5g | alpha-Cyclodextrin | 10016-20-3 | 5g |
| GC6443-25g | alpha-Cyclodextrin | 10016-20-3 | 25g |
| GC6443-100g | alpha-Cyclodextrin | 10016-20-3 | 100g |
| GC6443-250g | alpha-Cyclodextrin | 10016-20-3 | 250g |
| GC6443-500g | alpha-Cyclodextrin | 10016-20-3 | 500g |
| GC4753-25g | alpha-D-Glucose Pentaacetate | 604-68-2 | 25g |
| GC4753-50g | alpha-D-Glucose Pentaacetate | 604-68-2 | 50g |
| GC4753-100g | alpha-D-Glucose Pentaacetate | 604-68-2 | 100g |
| GC4753-250g | alpha-D-Glucose Pentaacetate | 604-68-2 | 250g |
| GC8391-50mg | alpha-D-Mannopyranosyl azide | 51970-29-7 | 50mg |
| GC8391-100mg | alpha-D-Mannopyranosyl azide | 51970-29-7 | 100mg |
| GC8391-250mg | alpha-D-Mannopyranosyl azide | 51970-29-7 | 250mg |
| GC8391-500mg | alpha-D-Mannopyranosyl azide | 51970-29-7 | 500mg |
| GC8391-1g | alpha-D-Mannopyranosyl azide | 51970-29-7 | 1g |
| GC9989-25mg | alpha-D-Mannopyranosylphenyl isothiocyanate | 96345-79-8 | 25mg |
| GC9989-50mg | alpha-D-Mannopyranosylphenyl isothiocyanate | 96345-79-8 | 50mg |
| GC9989-100mg | alpha-D-Mannopyranosylphenyl isothiocyanate | 96345-79-8 | 100mg |
| GC9989-250mg | alpha-D-Mannopyranosylphenyl isothiocyanate | 96345-79-8 | 250mg |
| GC9989-500mg | alpha-D-Mannopyranosylphenyl isothiocyanate | 96345-79-8 | 500mg |
| GL2083-1mg | alpha-Ecdysone | 3604-87-3 | 1mg |
| GL2083-5mg | alpha-Ecdysone | 3604-87-3 | 5mg |
| GL2083-10mg | alpha-Ecdysone | 3604-87-3 | 10mg |
| GL2066-250ug | Alpha-Galactosylceramide | 158021-47-7 | 250ug |
| GL2066-1mg | Alpha-Galactosylceramide | 158021-47-7 | 1mg |
| GW9375-500ug | alpha-Galactosylceramide Analog 8 | 922727-14-8 | 500ug |
| GZ1265-1KU | alpha-Glucosidase | 9001-42-7 | 1KU |
| GX7168-100g | alpha-Iron(III) oxide Nanopowder (Haematite); 99.5% | 1309-37-1 | 100g |
| GX9549-25g | alpha-Iron(III) oxide-Nano Powder, 98+% | 1309-37-1 | 25g |
| GK6899-5g | alpha-Ketobutyric acid sodium salt | 2013-26-5 | 5g |
| GK4316-10mg | alpha-Mangostin | 6147-11-1 | 10mg |
| GK4316-25mg | alpha-Mangostin | 6147-11-1 | 25mg |
| GK4316-50mg | alpha-Mangostin | 6147-11-1 | 50mg |
| GL1199-250ug | alpha-Mannosylceramide | 320610-63-7 | 250ug |
| GL1199-1mg | alpha-Mannosylceramide | 320610-63-7 | 1mg |
| GT1431-10g | alpha-Naphtholbenzein | 145-50-6 | 10g |
| GT1431-25g | alpha-Naphtholbenzein | 145-50-6 | 25g |
| GT9609-1g | alpha-Naphtholphthalein | 596-01-0 | 1g |
| GT9609-5g | alpha-Naphtholphthalein | 596-01-0 | 5g |
| GT9609-10g | alpha-Naphtholphthalein | 596-01-0 | 10g |
| GT9609-25g | alpha-Naphtholphthalein | 596-01-0 | 25g |
| GL7078-5mg | alpha-NETA | 31059-54-8 | 5mg |
| GL7078-25mg | alpha-NETA | 31059-54-8 | 25mg |
| GK3356-5ml | alpha-Pinene | 80-56-8 | 5ml |
| GL0054-25g | alpha-Terpineol, natural | 98-55-5 | 25g |
| GL0054-100g | alpha-Terpineol, natural | 98-55-5 | 100g |
| GT7468-25g | Alphazurine A | 3486-30-4 | 25g |
| GT7468-100g | Alphazurine A | 3486-30-4 | 100g |
| GP1537-5mg | Alprostadil | 745-65-3 | 5mg |
| GP1537-10mg | Alprostadil | 745-65-3 | 10mg |
| GL8214-1mg | Alsterpaullone | 237430-03-4 | 1mg |
| GL8214-5mg | Alsterpaullone | 237430-03-4 | 5mg |
| GA5056-1mg | Altenusin | 31186-12-6 | 1mg |
| GA5056-5mg | Altenusin | 31186-12-6 | 5mg |
| GW2387-1mg | Alternariol | 641-38-3 | 1mg |
| GW2387-5mg | Alternariol | 641-38-3 | 5mg |
| GA2124-500ug | Alternariol monomethyl ether | 26894-49-5 | 500ug |
| GA2124-1mg | Alternariol monomethyl ether | 26894-49-5 | 1mg |
| GA2124-5mg | Alternariol monomethyl ether | 26894-49-5 | 5mg |
| GA8400-1mg | Altersolanol A | 22268-16-2 | 1mg |
| GP4646-1g | Altrenogest | 850-52-2 | 1g |
| GX8900-250g | Aluminium acetate, basic | 142-03-0 | 250g |
| GX8900-1kg | Aluminium acetate, basic | 142-03-0 | 1kg |
| GK4077-100g | Aluminium ammonium sulfate dodecahydrate | 7784-26-1 | 100g |
| GK4077-250g | Aluminium ammonium sulfate dodecahydrate | 7784-26-1 | 250g |
| GK4077-500g | Aluminium ammonium sulfate dodecahydrate | 7784-26-1 | 500g |
| GK4077-1kg | Aluminium ammonium sulfate dodecahydrate | 7784-26-1 | 1kg |
| GX6532-25g | Aluminium boride | 12041-50-8 | 25g |
| GX0222-50g | Aluminium carbide, 98% | 1299-86-1 | 50g |
| GX0222-250g | Aluminium carbide, 98% | 1299-86-1 | 250g |
| GK1055-500g | Aluminium chloride hexahydrate | 7784-13-6 | 500g |
| GK1055-1kg | Aluminium chloride hexahydrate | 7784-13-6 | 1kg |
| GK1055-5kg | Aluminium chloride hexahydrate | 7784-13-6 | 5kg |
| GX1271-1kg | Aluminium chloride hexahydrate, BP, Ph. Eur. grade | 7784-13-6 | 1kg |
| GX5192-100g | Aluminium chloride, anhydrous, 99.9+% | 7446-70-0 | 100g |
| GX0139-50g | Aluminium chloride, anhydrous, 99.99+% | 7446-70-0 | 50g |
| GK6958-100g | Aluminium chloride, anhydrous, granular, 98% | 7446-70-0 | 100g |
| GX2534-25g | Aluminium ethoxide, 97% | 555-75-9 | 25g |
| GX0876-100g | Aluminium fluoride hydrate | 15098-87-0 | 100g |
| GX0876-500g | Aluminium fluoride hydrate | 15098-87-0 | 500g |
| GX0876-1kg | Aluminium fluoride hydrate | 15098-87-0 | 1kg |
| GX7045-5g | Aluminium fluoride hydrate, 99.99% | 32287-65-3 | 5g |
| GK1147-500g | Aluminium fluoride trihydrate | 15098-87-0 | 500g |
| GX1880-100x100mm | Aluminium Foil 0.008 mm, annealed, 99+% | 7429-90-5 | 100x100mm |
| GX4505-50x50mm | Aluminium Foil 0.012 mm, annealed, 99+% | 7429-90-5 | 50x50mm |
| GX4505-100x100mm | Aluminium Foil 0.012 mm, annealed, 99+% | 7429-90-5 | 100x100mm |
| GX4505-150x150mm | Aluminium Foil 0.012 mm, annealed, 99+% | 7429-90-5 | 150x150mm |
| GX9180-50x50mm | Aluminium Foil 0.02 mm, annealed, 99+% | 7429-90-5 | 50x50mm |
| GX9180-150x150mm | Aluminium Foil 0.02 mm, annealed, 99+% | 7429-90-5 | 150x150mm |
| GX9180-100x100mm | Aluminium Foil 0.02 mm, annealed, 99+% | 7429-90-5 | 100x100mm |
| GX8209-50x50mm | Aluminium Foil 0.025 mm, annealed, 99+% | 7429-90-5 | 50x50mm |
| GX8209-100x100mm | Aluminium Foil 0.025 mm, annealed, 99+% | 7429-90-5 | 100x100mm |
| GX8209-150x150mm | Aluminium Foil 0.025 mm, annealed, 99+% | 7429-90-5 | 150x150mm |
| GX9255-100x100mm | Aluminium Foil 0.035 mm, annealed, 99+% | 7429-90-5 | 100x100mm |
| GX3493-25x25mm | Aluminium Foil 0.05 mm, 99.99+% | 7429-90-5 | 25x25mm |
| GX3493-50x50mm | Aluminium Foil 0.05 mm, 99.99+% | 7429-90-5 | 50x50mm |
| GX3493-100x100mm | Aluminium Foil 0.05 mm, 99.99+% | 7429-90-5 | 100x100mm |
| GX1641-50x50mm | Aluminium Foil 0.05 mm, 99.999% | 7429-90-5 | 50x50mm |
| GX1641-100x100mm | Aluminium Foil 0.05 mm, 99.999% | 7429-90-5 | 100x100mm |
| GX7144-50x50mm | Aluminium Foil 0.1 mm, 99.5+% | 7429-90-5 | 50x50mm |
| GX3348-50x50mm | Aluminium Foil 0.1 mm, 99.99+% | 7429-90-5 | 50x50mm |
| GX3348-100x100mm | Aluminium Foil 0.1 mm, 99.99+% | 7429-90-5 | 100x100mm |
| GX1008-50x50mm | Aluminium Foil 0.1 mm, 99.9999% | 7429-90-5 | 50x50mm |
| GX1008-100x100mm | Aluminium Foil 0.1 mm, 99.9999% | 7429-90-5 | 100x100mm |
| GX1008-100x200mm | Aluminium Foil 0.1 mm, 99.9999% | 7429-90-5 | 100x200mm |
| GX0335-100x100mm | Aluminium Foil 0.125 mm, 99.999% | 7429-90-5 | 100x100mm |
| GX0335-100x200mm | Aluminium Foil 0.125 mm, 99.999% | 7429-90-5 | 100x200mm |
| GX1520-100x100mm | Aluminium Foil 0.125 mm, annealed, 99.5% | 7429-90-5 | 100x100mm |
| GX8531-100x100mm | Aluminium Foil 0.125 mm, hard, 99.0% | 7429-90-5 | 100x100mm |
| GX4728-100x100mm | Aluminium Foil 0.2 mm, hard, 99.5% | 7429-90-5 | 100x100mm |
| GX4728-150x150mm | Aluminium Foil 0.2 mm, hard, 99.5% | 7429-90-5 | 150x150mm |
| GX4728-300x300mm | Aluminium Foil 0.2 mm, hard, 99.5% | 7429-90-5 | 300x300mm |
| GX6415-100x100mm | Aluminium Foil 0.25 mm, 99.5% | 7429-90-5 | 100x100mm |
| GX6415-150x150mm | Aluminium Foil 0.25 mm, 99.5% | 7429-90-5 | 150x150mm |
| GX6415-300x300mm | Aluminium Foil 0.25 mm, 99.5% | 7429-90-5 | 300x300mm |
| GX4952-100x100mm | Aluminium Foil 0.25 mm, 99.999% | 7429-90-5 | 100x100mm |
| GX1496-100x100mm | Aluminium Foil 0.5 mm, 99.5% | 7429-90-5 | 100x100mm |
| GX1496-150x150mm | Aluminium Foil 0.5 mm, 99.5% | 7429-90-5 | 150x150mm |
| GX1496-300x300mm | Aluminium Foil 0.5 mm, 99.5% | 7429-90-5 | 300x300mm |
| GX7260-50x50mm | Aluminium Foil 0.5 mm, 99.99+% | 7429-90-5 | 50x50mm |
| GX9340-50x50mm | Aluminium Foil 0.8 mm, 99.5% | 7429-90-5 | 50x50mm |
| GX9340-100x100mm | Aluminium Foil 0.8 mm, 99.5% | 7429-90-5 | 100x100mm |
| GX9340-150x150mm | Aluminium Foil 0.8 mm, 99.5% | 7429-90-5 | 150x150mm |
| GX3335-50x50mm | Aluminium Foil 1.0 mm, 99.5% | 7429-90-5 | 50x50mm |
| GX3335-100x100mm | Aluminium Foil 1.0 mm, 99.5% | 7429-90-5 | 100x100mm |
| GX3335-300x300mm | Aluminium Foil 1.0 mm, 99.5% | 7429-90-5 | 300x300mm |
| GX3854-50x50mm | Aluminium Foil 1.0 mm, 99.999% | 7429-90-5 | 50x50mm |
| GX3854-100x100mm | Aluminium Foil 1.0 mm, 99.999% | 7429-90-5 | 100x100mm |
| GX6842-50x50mm | Aluminium Foil 1.5 mm, 99.5% | 7429-90-5 | 50x50mm |
| GX6842-100x100mm | Aluminium Foil 1.5 mm, 99.5% | 7429-90-5 | 100x100mm |
| GX1759-50x50mm | Aluminium Foil 2.0 mm, 99.5% | 7429-90-5 | 50x50mm |
| GX1759-100x100mm | Aluminium Foil 2.0 mm, 99.5% | 7429-90-5 | 100x100mm |
| GX1759-150x150mm | Aluminium Foil 2.0 mm, 99.5% | 7429-90-5 | 150x150mm |
| GX1307-25x25mm | Aluminium Foil 2.0 mm, 99.999% | 7429-90-5 | 25x25mm |
| GX1307-50x50mm | Aluminium Foil 2.0 mm, 99.999% | 7429-90-5 | 50x50mm |
| GX0235-50x50mm | Aluminium Foil 3.0 mm, 99.5% | 7429-90-5 | 50x50mm |
| GX0235-100x100mm | Aluminium Foil 3.0 mm, 99.5% | 7429-90-5 | 100x100mm |
| GX0235-150x150mm | Aluminium Foil 3.0 mm, 99.5% | 7429-90-5 | 150x150mm |
| GX8966-50x50mm | Aluminium Foil 5.0 mm, 99.5% | 7429-90-5 | 50x50mm |
| GX8966-100x100mm | Aluminium Foil 5.0 mm, 99.5% | 7429-90-5 | 100x100mm |
| GX8966-150x150mm | Aluminium Foil 5.0 mm, 99.5% | 7429-90-5 | 150x150mm |
| GX8270-1kg | Aluminium Granules 0.6-1.2 mm, 99.8% | 7429-90-5 | 1kg |
| GX0187-250g | Aluminium Granules 2-10 mm, 99.9% | 7429-90-5 | 250g |
| GX0187-1kg | Aluminium Granules 2-10 mm, 99.9% | 7429-90-5 | 1kg |
| GX7495-250g | Aluminium Granules 2-10 mm, 99.99% | 7429-90-5 | 250g |
| GX3374-1kg | Aluminium Granules 2-5 mm, 99.5+% | 7429-90-5 | 1kg |
| GX5607-100g | Aluminium Granules max. 12 mm, 99.99% | 7429-90-5 | 100g |
| GX5607-250g | Aluminium Granules max. 12 mm, 99.99% | 7429-90-5 | 250g |
| GX3489-500g | Aluminium hydroxide hydrate | 1330-44-5 | 500g |
| GX3489-1kg | Aluminium hydroxide hydrate | 1330-44-5 | 1kg |
| GX7438-100g | Aluminium hydroxide, technical | 21645-51-2 | 100g |
| GX7438-500g | Aluminium hydroxide, technical | 21645-51-2 | 500g |
| GX7438-1kg | Aluminium hydroxide, technical | 21645-51-2 | 1kg |
| GX6650-100g | Aluminium Ingot, 99.999% | 7429-90-5 | 100g |
| GK9569-100g | Aluminium isopropoxide | 555-31-7 | 100g |
| GX6777-25g | Aluminium magnesium isopropoxide, 99.95% | 24992-44-7 | 25g |
| GX0595-1kg | Aluminium metaphosphate | 32823-06-6 | 1kg |
| GX0595-5kg | Aluminium metaphosphate | 32823-06-6 | 5kg |
| GX3628-25g | Aluminium molybdate, 99+% | 15123-80-5 | 25g |
| GX3628-100g | Aluminium molybdate, 99+% | 15123-80-5 | 100g |
| GX4607-25g | Aluminium nitrate hydrate, 98% | 7784-27-2 | 25g |
| GX4607-1kg | Aluminium nitrate hydrate, 98% | 7784-27-2 | 1kg |
| GX1335-25g | Aluminium nitrate hydrate, 99.998% | 7784-27-2 | 25g |
| GX7841-100g | Aluminium nitride, 99% | 24304-00-5 | 100g |
| GX5326-50cm | Aluminium oxide Rod 10 mm diameter, 99.5% | 1344-28-1 | 50cm |
| GX5326-1m | Aluminium oxide Rod 10 mm diameter, 99.5% | 1344-28-1 | 1m |
| GX5526-50g | Aluminium oxide-Nano Powder, 99.5% | 1344-28-1 | 50g |
| GX5526-250g | Aluminium oxide-Nano Powder, 99.5% | 1344-28-1 | 250g |
| GX8819-50g | Aluminium oxide-Nano Powder, 99.97% | 1344-28-1 | 50g |
| GX1565-50g | Aluminium oxide-Nano Powder, 99.97% | 1344-28-1 | 50g |
| GX5889-50g | Aluminium oxide-Nano Powder, 99% | 1344-28-1 | 50g |
| GX0712-1kg | Aluminium oxide, 98+% | 1344-28-1 | 1kg |
| GX0283-100g | Aluminium oxide, 99.99% | 1344-28-1 | 100g |
| GX2525-100g | Aluminium oxide, 99.99% | 1344-28-1 | 100g |
| GX0283-250g | Aluminium oxide, 99.99% | 1344-28-1 | 250g |
| GX6914-25g | Aluminium oxide, 99.999% | 1344-28-1 | 25g |
| GX6914-100g | Aluminium oxide, 99.999% | 1344-28-1 | 100g |
| GX0767-100g | Aluminium oxide, activated, acidic for chromatography | 1344-28-1 | 100g |
| GX0767-500g | Aluminium oxide, activated, acidic for chromatography | 1344-28-1 | 500g |
| GX0767-1kg | Aluminium oxide, activated, acidic for chromatography | 1344-28-1 | 1kg |
| GX0767-5kg | Aluminium oxide, activated, acidic for chromatography | 1344-28-1 | 5kg |
| GX6654-100g | Aluminium oxide, activated, basic for chromatography | 1344-28-1 | 100g |
| GX6654-250g | Aluminium oxide, activated, basic for chromatography | 1344-28-1 | 250g |
| GX6654-500g | Aluminium oxide, activated, basic for chromatography | 1344-28-1 | 500g |
| GX6654-1kg | Aluminium oxide, activated, basic for chromatography | 1344-28-1 | 1kg |
| GX6654-5kg | Aluminium oxide, activated, basic for chromatography | 1344-28-1 | 5kg |
| GK0599-100g | Aluminium oxide, activated, neutral for chromatography | 1344-28-1 | 100g |
| GK0599-250g | Aluminium oxide, activated, neutral for chromatography | 1344-28-1 | 250g |
| GK0599-500g | Aluminium oxide, activated, neutral for chromatography | 1344-28-1 | 500g |
| GK0599-1kg | Aluminium oxide, activated, neutral for chromatography | 1344-28-1 | 1kg |
| GK0599-5kg | Aluminium oxide, activated, neutral for chromatography | 1344-28-1 | 5kg |
| GX4562-25g | Aluminium Pellets 1.6 x 0.5 mm, 99.999% | 7429-90-5 | 25g |
| GX5129-10g | Aluminium Pellets 3.9 x 2.5 mm, 99.999% | 7429-90-5 | 10g |
| GX5129-50g | Aluminium Pellets 3.9 x 2.5 mm, 99.999% | 7429-90-5 | 50g |
| GX0821-25g | Aluminium Pellets 6 x 6 mm, 99.999% | 7429-90-5 | 25g |
| GX0821-100g | Aluminium Pellets 6 x 6 mm, 99.999% | 7429-90-5 | 100g |
| GX5270-25g | Aluminium Pellets 9.5 x 3.2 mm, 99.999% | 7429-90-5 | 25g |
| GX5147-10g | Aluminium phosphate, 99.99% | 7784-30-7 | 10g |
| GX0196-100g | Aluminium potassium sulfate dodecahydrate, 99% | 7784-24-9 | 100g |
| GX0196-250g | Aluminium potassium sulfate dodecahydrate, 99% | 7784-24-9 | 250g |
| GX0196-500g | Aluminium potassium sulfate dodecahydrate, 99% | 7784-24-9 | 500g |
| GX0196-1kg | Aluminium potassium sulfate dodecahydrate, 99% | 7784-24-9 | 1kg |
| GX6483-100g | Aluminium Powder -100 mesh, 99.7% | 7429-90-5 | 100g |
| GX8511-25g | Aluminium Powder -100, +325 mesh, 99.97% | 7429-90-5 | 25g |
| GX8511-50g | Aluminium Powder -100, +325 mesh, 99.97% | 7429-90-5 | 50g |
| GX8511-250g | Aluminium Powder -100, +325 mesh, 99.97% | 7429-90-5 | 250g |
| GX7099-1kg | Aluminium Powder max. 1000 micron, 98.5% | 7429-90-5 | 1kg |
| GX0409-1kg | Aluminium Powder max. 250 micron, 98.5% | 7429-90-5 | 1kg |
| GX5638-25mm | Aluminium Rod 10 mm diameter, 99.9999% | 7429-90-5 | 25mm |
| GX5638-100mm | Aluminium Rod 10 mm diameter, 99.9999% | 7429-90-5 | 100mm |
| GX6039-50cm | Aluminium Rod 25 mm diameter, 99.5% | 7429-90-5 | 50cm |
| GX2804-100g | Aluminium Rod 25 mm diameter, 99.99% | 7429-90-5 | 100g |
| GX6410-25mm | Aluminium Rod 5.0 mm diameter, 99.9999% | 7429-90-5 | 25mm |
| GX6410-100mm | Aluminium Rod 5.0 mm diameter, 99.9999% | 7429-90-5 | 100mm |
| GX4558-50mm | Aluminium Rod 6.0 mm diameter, 99.999% | 7429-90-5 | 50mm |
| GX4558-150mm | Aluminium Rod 6.0 mm diameter, 99.999% | 7429-90-5 | 150mm |
| GX1262-10g | Aluminium Shot 3-6 mm, 99.9999% | 7429-90-5 | 10g |
| GX1262-25g | Aluminium Shot 3-6 mm, 99.9999% | 7429-90-5 | 25g |
| GX5453-10g | Aluminium sulfate anhydrous, 99.99% | 10043-01-3 | 10g |
| GX6647-1kg | Aluminium sulfate hydrate | 16828-11-8 | 1kg |
| GX6647-5kg | Aluminium sulfate hydrate | 16828-11-8 | 5kg |
| GX8744-50g | Aluminium titanate, 99+% | 12004-39-6 | 50g |
| GX7939-1m | Aluminium Tube 10.0 mm diameter, 1.0 mm wall thickness, 99.7% | 7429-90-5 | 1m |
| GX7456-1m | Aluminium Wire 0.050 mm diameter, hard, 99.999% | 7429-90-5 | 1m |
| GX2009-5m | Aluminium Wire 0.20 mm diameter, hard, 99.5% | 7429-90-5 | 5m |
| GX2009-25m | Aluminium Wire 0.20 mm diameter, hard, 99.5% | 7429-90-5 | 25m |
| GX6341-10m | Aluminium Wire 0.25 mm diameter, 99.995% | 7429-90-5 | 10m |
| GX6341-25m | Aluminium Wire 0.25 mm diameter, 99.995% | 7429-90-5 | 25m |
| GX2970-5m | Aluminium Wire 0.25 mm diameter, annealed, 99.5% | 7429-90-5 | 5m |
| GX2970-25m | Aluminium Wire 0.25 mm diameter, annealed, 99.5% | 7429-90-5 | 25m |
| GX0533-25m | Aluminium Wire 0.5 mm diameter, 99.95% | 7429-90-5 | 25m |
| GX0533-100m | Aluminium Wire 0.5 mm diameter, 99.95% | 7429-90-5 | 100m |
| GX8086-20m | Aluminium Wire 0.5 mm diameter, 99.999% | 7429-90-5 | 20m |
| GX8086-50m | Aluminium Wire 0.5 mm diameter, 99.999% | 7429-90-5 | 50m |
| GX4840-25m | Aluminium Wire 1.0 mm diameter, 99.95% | 7429-90-5 | 25m |
| GX4840-50m | Aluminium Wire 1.0 mm diameter, 99.95% | 7429-90-5 | 50m |
| GX4840-250m | Aluminium Wire 1.0 mm diameter, 99.95% | 7429-90-5 | 250m |
| GX7920-10m | Aluminium Wire 1.0 mm diameter, 99.999% | 7429-90-5 | 10m |
| GX8576-5m | Aluminium Wire 2.0 mm diameter, 99.5+% | 7429-90-5 | 5m |
| GX8576-25m | Aluminium Wire 2.0 mm diameter, 99.5+% | 7429-90-5 | 25m |
| GX7866-5m | Aluminium Wire 2.0 mm diameter, 99.95% | 7429-90-5 | 5m |
| GX7866-10m | Aluminium Wire 2.0 mm diameter, 99.95% | 7429-90-5 | 10m |
| GX7866-25m | Aluminium Wire 2.0 mm diameter, 99.95% | 7429-90-5 | 25m |
| GX3845-2m | Aluminium Wire 2.0 mm diameter, 99.999% | 7429-90-5 | 2m |
| GX3845-5m | Aluminium Wire 2.0 mm diameter, 99.999% | 7429-90-5 | 5m |
| GX3845-10m | Aluminium Wire 2.0 mm diameter, 99.999% | 7429-90-5 | 10m |
| GX6811-250g | Aluminium, powder | 7429-90-5 | 250g |
| GX6811-500g | Aluminium, powder | 7429-90-5 | 500g |
| GX6811-1kg | Aluminium, powder | 7429-90-5 | 1kg |
| GX5194-250g | Aluminium‚ 2,4-pentanedionate, 97+% | 13963-57-0 | 250g |
| GX5194-1kg | Aluminium‚ 2,4-pentanedionate, 97+% | 13963-57-0 | 1kg |
| GX5194-5kg | Aluminium‚ 2,4-pentanedionate, 97+% | 13963-57-0 | 5kg |
| GX3387-25g | Aluminium(III) nitride Nanopowder, 99 % | 24304-00-5 | 25g |
| GX5582-25g | Aluminium(III) nitride Nanopowder, 99 % | 24304-00-5 | 25g |
| GX3387-50g | Aluminium(III) nitride Nanopowder, 99 % | 24304-00-5 | 50g |
| GX5582-50g | Aluminium(III) nitride Nanopowder, 99 % | 24304-00-5 | 50g |
| GX3387-100g | Aluminium(III) nitride Nanopowder, 99 % | 24304-00-5 | 100g |
| GX5582-100g | Aluminium(III) nitride Nanopowder, 99 % | 24304-00-5 | 100g |
| GX2226-500g | Aluminum Lactate | 18917-91-4 | 500g |
| GP0461-25g | Amantadine | 768-94-5 | 25g |
| GP0461-100g | Amantadine | 768-94-5 | 100g |
| GP6034-25g | Amantadine hydrochloride | 665-66-7 | 25g |
| GP6034-100g | Amantadine hydrochloride | 665-66-7 | 100g |
| GP6034-250g | Amantadine hydrochloride | 665-66-7 | 250g |
| GA1330-1mg | Amastatin hydrochloride | 100938-10-1 | 1mg |
| GA1330-5mg | Amastatin hydrochloride | 100938-10-1 | 5mg |
| GL9680-250ug | Amauromine | 88360-87-6 | 250ug |
| GL9680-1mg | Amauromine | 88360-87-6 | 1mg |
| GP8090-5g | Ambroxol hydrochloride | 23828-92-4 | 5g |
| GP8090-25g | Ambroxol hydrochloride | 23828-92-4 | 25g |
| GL8920-250ug | Ambuic acid | 340774-69-8 | 250ug |
| GL8920-1mg | Ambuic acid | 340774-69-8 | 1mg |
| GW0411-100mg | AMCA-H | 106562-32-7 | 100mg |
| GW0411-500mg | AMCA-H | 106562-32-7 | 500mg |
| GW0411-2g | AMCA-H | 106562-32-7 | 2g |
| GW4752-25mg | AMCA-H N-succinimidyl ester | 113721-87-2 | 25mg |
| GW4752-100mg | AMCA-H N-succinimidyl ester | 113721-87-2 | 100mg |
| GW7519-50mg | AMCA-X | 205124-69-2 | 50mg |
| GW7519-250mg | AMCA-X | 205124-69-2 | 250mg |
| GW0447-10mg | AMCA-X N-succinimidyl ester | 216309-02-3 | 10mg |
| GW0447-100mg | AMCA-X N-succinimidyl ester | 216309-02-3 | 100mg |
| GK7176-10mg | AMD3100 octahydrochloride hydrate | 155148-31-5 | 10mg |
| GK7176-25mg | AMD3100 octahydrochloride hydrate | 155148-31-5 | 25mg |
| GW1838-1mg | AMG-1 | 913376-84-8 | 1mg |
| GW1838-5mg | AMG-1 | 913376-84-8 | 5mg |
| GW1838-10mg | AMG-1 | 913376-84-8 | 10mg |
| GW5854-1mg | AMG-25 | 1003311-62-3 | 1mg |
| GW5854-5mg | AMG-25 | 1003311-62-3 | 5mg |
| GW5854-10mg | AMG-25 | 1003311-62-3 | 10mg |
| GW6572-1mg | AMG-458 | 913376-83-7 | 1mg |
| GW6572-5mg | AMG-458 | 913376-83-7 | 5mg |
| GW6572-10mg | AMG-458 | 913376-83-7 | 10mg |
| GW3616-1mg | AMG-47a | 882663-88-9 | 1mg |
| GW3616-5mg | AMG-47a | 882663-88-9 | 5mg |
| GW3616-10mg | AMG-47a | 882663-88-9 | 10mg |
| GW3598-1mg | AMG-51 | 890019-63-3 | 1mg |
| GW3598-5mg | AMG-51 | 890019-63-3 | 5mg |
| GW3598-10mg | AMG-51 | 890019-63-3 | 10mg |
| GW5501-1mg | AMG-Tie2-1 | 870223-96-4 | 1mg |
| GW5501-5mg | AMG-Tie2-1 | 870223-96-4 | 5mg |
| GW5501-10mg | AMG-Tie2-1 | 870223-96-4 | 10mg |
| GL5806-5mg | AMI-1 | 20324-87-2 | 5mg |
| GL5806-25mg | AMI-1 | 20324-87-2 | 25mg |
| GW3845-50mg | Amicarbazone | 129909-90-6 | 50mg |
| GW3845-100mg | Amicarbazone | 129909-90-6 | 100mg |
| GL4453-1mg | Amidepsine A | 169181-28-6 | 1mg |
| GL4453-2500ug | Amidepsine A | 169181-28-6 | 2500ug |
| GL4968-1mg | Amidepsine D | 79786-34-8 | 1mg |
| GL4968-2500ug | Amidepsine D | 79786-34-8 | 2500ug |
| GT9555-25g | Amido Black 10B (C.I. 20470) | 1064-48-8 | 25g |
| GT9555-100g | Amido Black 10B (C.I. 20470) | 1064-48-8 | 100g |
| GW3472-25mg | Amidoflumet | 84466-05-7 | 25mg |
| GW3472-100mg | Amidoflumet | 84466-05-7 | 100mg |
| GA5426-1g | Amikacin | 37517-28-5 | 1g |
| GA5426-5g | Amikacin | 37517-28-5 | 5g |
| GA2441-250mg | Amikacin disulfate salt | 39831-55-5 | 250mg |
| GA2441-1g | Amikacin disulfate salt | 39831-55-5 | 1g |
| GA2441-5g | Amikacin disulfate salt | 39831-55-5 | 5g |
| GA2441-25g | Amikacin disulfate salt | 39831-55-5 | 25g |
| GA2441-100g | Amikacin disulfate salt | 39831-55-5 | 100g |
| GA9944-5g | Amikacin hydrate | 1257517-67-1 | 5g |
| GA9402-1g | Amikacin sulfate salt | 149022-22-0 | 1g |
| GA9402-5g | Amikacin sulfate salt | 149022-22-0 | 5g |
| GP9032-250mg | Amiloride hydrochloride dihydrate | 17440-83-4 | 250mg |
| GP9032-1g | Amiloride hydrochloride dihydrate | 17440-83-4 | 1g |
| GP9032-5g | Amiloride hydrochloride dihydrate | 17440-83-4 | 5g |
| GE4689-100g | Aminoguanidine bicarbonate | 2582-30-1 | 100g |
| GE4689-500g | Aminoguanidine bicarbonate | 2582-30-1 | 500g |
| GE7773-25g | Aminoguanidine hemisulfate salt | 996-19-0 | 25g |
| GE7773-100g | Aminoguanidine hemisulfate salt | 996-19-0 | 100g |
| GK1374-100g | Aminoguanidine hydrochloride | 1937-19-5 | 100g |
| GK1374-500g | Aminoguanidine hydrochloride | 1937-19-5 | 500g |
| GE6366-25g | Aminophylline | 317-34-0 | 25g |
| GE6366-100g | Aminophylline | 317-34-0 | 100g |
| GK2974-10mg | Aminopterin dihydrate | 54-62-6 | 10mg |
| GK2974-25mg | Aminopterin dihydrate | 54-62-6 | 25mg |
| GK2974-50mg | Aminopterin dihydrate | 54-62-6 | 50mg |
| GK2974-100mg | Aminopterin dihydrate | 54-62-6 | 100mg |
| GP5750-1g | Amiodarone hydrochloride | 19774-82-4 | 1g |
| GC8608-50mg | Amiprilose hydrochloride | 60414-06-4 | 50mg |
| GC8608-100mg | Amiprilose hydrochloride | 60414-06-4 | 100mg |
| GC8608-250mg | Amiprilose hydrochloride | 60414-06-4 | 250mg |
| GC8608-500mg | Amiprilose hydrochloride | 60414-06-4 | 500mg |
| GC8608-1g | Amiprilose hydrochloride | 60414-06-4 | 1g |
| GW3176-25mg | Amisulbrom | 348635-87-0 | 25mg |
| GW3176-100mg | Amisulbrom | 348635-87-0 | 100mg |
| GP0164-100mg | Amisulpride | 71675-85-9 | 100mg |
| GP0164-250mg | Amisulpride | 71675-85-9 | 250mg |
| GP0164-1g | Amisulpride | 71675-85-9 | 1g |
| GP9065-1g | Amlexanox | 68302-57-8 | 1g |
| GP9536-1g | Amlodipine | 88150-42-9 | 1g |
| GP9536-5g | Amlodipine | 88150-42-9 | 5g |
| GP6347-1g | Amlodipine besylate | 111470-99-6 | 1g |
| GP6347-5g | Amlodipine besylate | 111470-99-6 | 5g |
| GE3336-1l | Ammonia hydroxide, 25% solution in water | 1336-21-6 | 1l |
| GE1331-1l | Ammonia hydroxide, 28% solution in water | 1336-21-6 | 1l |
| GS8853-100ml | Ammonia solution, GlenBiol™, suitable for molecular biology | 1336-21-6 | 100ml |
| GK8537-1l | Ammonia, 33% solution in water | 7664-41-7 | 1l |
| GT7479-5mg | Ammonium 7-Fluoro-2,1,3-benzoxadiazole-4-sulfonate | 84806-27-9 | 5mg |
| GT7479-25mg | Ammonium 7-Fluoro-2,1,3-benzoxadiazole-4-sulfonate | 84806-27-9 | 25mg |
| GK8850-100g | Ammonium acetate | 631-61-8 | 100g |
| GK8850-250g | Ammonium acetate | 631-61-8 | 250g |
| GK8850-500g | Ammonium acetate | 631-61-8 | 500g |
| GK8850-1kg | Ammonium acetate | 631-61-8 | 1kg |
| GK8850-5kg | Ammonium acetate | 631-61-8 | 5kg |
| GX2678-250ml | Ammonium acetate 5M solution, GlenBiol™, suitable for molecular biology | 631-61-8 | 250ml |
| GX2678-1l | Ammonium acetate 5M solution, GlenBiol™, suitable for molecular biology | 631-61-8 | 1l |
| GX5459-250ml | Ammonium acetate 7.5M solution, GlenBiol™, suitable for molecular biology | 631-61-8 | 250ml |
| GX5459-1l | Ammonium acetate 7.5M solution, GlenBiol™, suitable for molecular biology | 631-61-8 | 1l |
| GK1129-25g | Ammonium acetate, Ultrapure, for HPLC and LC-MS | 631-61-8 | 25g |
| GK1129-100g | Ammonium acetate, Ultrapure, for HPLC and LC-MS | 631-61-8 | 100g |
| GW0398-500g | Ammonium bicarbonate | 1066-33-7 | 500g |
| GW0398-1kg | Ammonium bicarbonate | 1066-33-7 | 1kg |
| GW0398-5kg | Ammonium bicarbonate | 1066-33-7 | 5kg |
| GX7991-100g | Ammonium bismuth citrate | 31886-41-6 | 100g |
| GX7991-250g | Ammonium bismuth citrate | 31886-41-6 | 250g |
| GX7114-250g | Ammonium bromide | 12124-97-9 | 250g |
| GX7114-1kg | Ammonium bromide | 12124-97-9 | 1kg |
| GX7114-5kg | Ammonium bromide | 12124-97-9 | 5kg |
| GX9596-500g | Ammonium bromide, 99.9% | 12124-97-9 | 500g |
| GX4036-1kg | Ammonium bromide, 99+% | 12124-97-9 | 1kg |
| GK5772-100g | Ammonium carbonate | 506-87-6 | 100g |
| GK5772-500g | Ammonium carbonate | 506-87-6 | 500g |
| GK5772-1kg | Ammonium carbonate | 506-87-6 | 1kg |
| GK7644-250g | Ammonium cerium(IV) nitrate | 16774-21-3 | 250g |
| GK7644-1kg | Ammonium cerium(IV) nitrate | 16774-21-3 | 1kg |
| GX1995-250g | Ammonium cerium(IV) nitrate, 99+% | 16774-21-3 | 250g |
| GX1995-500g | Ammonium cerium(IV) nitrate, 99+% | 16774-21-3 | 500g |
| GX1817-100g | Ammonium cerium(IV) sulfate dihydrate | 10378-47-9 | 100g |
| GX5873-100g | Ammonium cerium(IV) sulfate dihydrate, 99+% | 10378-47-9 | 100g |
| GK0575-100g | Ammonium chloride | 12125-02-9 | 100g |
| GK0575-250g | Ammonium chloride | 12125-02-9 | 250g |
| GK0575-500g | Ammonium chloride | 12125-02-9 | 500g |
| GK0575-1kg | Ammonium chloride | 12125-02-9 | 1kg |
| GK0575-5kg | Ammonium chloride | 12125-02-9 | 5kg |
| GB7832-500ml | Ammonium chloride-ammonium hydroxide buffer solution, 5% in water | 12125-02-9, 1336-21-6 | 500ml |
| GB7832-1l | Ammonium chloride-ammonium hydroxide buffer solution, 5% in water | 12125-02-9, 1336-21-6 | 1l |
| GB7832-2500ml | Ammonium chloride-ammonium hydroxide buffer solution, 5% in water | 12125-02-9, 1336-21-6 | 2500ml |
| GX5993-50g | Ammonium chloride, 99.99% | 12125-02-9 | 50g |
| GX5993-100g | Ammonium chloride, 99.99% | 12125-02-9 | 100g |
| GX0686-50g | Ammonium chloride, 99.999% | 12125-02-9 | 50g |
| GX0686-100g | Ammonium chloride, 99.999% | 12125-02-9 | 100g |
| GL7832-25g | Ammonium citrate tribasic | 3458-72-8 | 25g |
| GL7832-100g | Ammonium citrate tribasic | 3458-72-8 | 100g |
| GL7832-250g | Ammonium citrate tribasic | 3458-72-8 | 250g |
| GL7832-500g | Ammonium citrate tribasic | 3458-72-8 | 500g |
| GL7832-1kg | Ammonium citrate tribasic | 3458-72-8 | 1kg |
| GK8477-100g | Ammonium dihydrogen phosphate | 7722-76-1 | 100g |
| GK8477-250g | Ammonium dihydrogen phosphate | 7722-76-1 | 250g |
| GK8477-500g | Ammonium dihydrogen phosphate | 7722-76-1 | 500g |
| GK8477-1kg | Ammonium dihydrogen phosphate | 7722-76-1 | 1kg |
| GK8477-5kg | Ammonium dihydrogen phosphate | 7722-76-1 | 5kg |
| GX2056-100g | Ammonium dihydrogen phosphate, 99.999% | 7722-76-1 | 100g |
| GX6407-100g | Ammonium dihydrogen phosphate, 99% | 7722-76-1 | 100g |
| GX6407-250g | Ammonium dihydrogen phosphate, 99% | 7722-76-1 | 250g |
| GX6407-500g | Ammonium dihydrogen phosphate, 99% | 7722-76-1 | 500g |
| GX6407-1kg | Ammonium dihydrogen phosphate, 99% | 7722-76-1 | 1kg |
| GX6407-5kg | Ammonium dihydrogen phosphate, 99% | 7722-76-1 | 5kg |
| GX2607-100g | Ammonium fluoride | 12125-01-8 | 100g |
| GX0593-100g | Ammonium formate, 97% | 540-69-2 | 100g |
| GX3901-25g | Ammonium formate, 98% | 540-69-2 | 25g |
| GX1942-250g | Ammonium formate, 99% | 540-69-2 | 250g |
| GX6384-1g | Ammonium hexabromoplatinate(IV) | 17363-02-9 | 1g |
| GX6384-5g | Ammonium hexabromoplatinate(IV) | 17363-02-9 | 5g |
| GX5144-2g | Ammonium hexachloroiridate(III) hydrate, 99.95% (metals basis) | 15752-05-3 | 2g |
| GX2629-1g | Ammonium hexachloroiridate(IV); 99.95% (metals basis) | 16940-92-4 | 1g |
| GX3446-2g | Ammonium hexachloropalladate(IV); 99.95% (metals basis) | 19168-23-1 | 2g |
| GX3446-10g | Ammonium hexachloropalladate(IV); 99.95% (metals basis) | 19168-23-1 | 10g |
| GX0581-1g | Ammonium hexachloroplatinate(IV) | 16919-58-7 | 1g |
| GX0581-5g | Ammonium hexachloroplatinate(IV) | 16919-58-7 | 5g |
| GX3877-1g | Ammonium hexachlororhenate(IV) | 16940-97-9 | 1g |
| GX3877-5g | Ammonium hexachlororhenate(IV) | 16940-97-9 | 5g |
| GX1016-1g | Ammonium hexachlororhodate(III); 99.9+% | 15336-18-2 | 1g |
| GX1016-5g | Ammonium hexachlororhodate(III); 99.9+% | 15336-18-2 | 5g |
| GX7954-100g | Ammonium hexafluorophosphate | 16941-11-0 | 100g |
| GX6397-500g | Ammonium hexafluorosilicate, 98% | 16919-19-0 | 500g |
| GX5944-1g | Ammonium hexanitritorhodate(III) | 61180-97-0 | 1g |
| GX5944-5g | Ammonium hexanitritorhodate(III) | 61180-97-0 | 5g |
| GX0333-50g | Ammonium hydrogen sulfate, 99.9% | 7803-63-6 | 50g |
| GX8488-100g | Ammonium iodide, 99% | 12027-06-4 | 100g |
| GK4017-100g | Ammonium iron(II) sulfate hexahydrate | 7783-85-9 | 100g |
| GK4017-250g | Ammonium iron(II) sulfate hexahydrate | 7783-85-9 | 250g |
| GK4017-500g | Ammonium iron(II) sulfate hexahydrate | 7783-85-9 | 500g |
| GK4017-1kg | Ammonium iron(II) sulfate hexahydrate | 7783-85-9 | 1kg |
| GK4017-5kg | Ammonium iron(II) sulfate hexahydrate | 7783-85-9 | 5kg |
| GK1122-100g | Ammonium iron(III) citrate (Red) | 1185-57-5 | 100g |
| GK1122-250g | Ammonium iron(III) citrate (Red) | 1185-57-5 | 250g |
| GK1122-500g | Ammonium iron(III) citrate (Red) | 1185-57-5 | 500g |
| GK1122-1kg | Ammonium iron(III) citrate (Red) | 1185-57-5 | 1kg |
| GK9348-250g | Ammonium iron(III) sulfate dodecahydrate | 7783-83-7 | 250g |
| GK9348-500g | Ammonium iron(III) sulfate dodecahydrate | 7783-83-7 | 500g |
| GK9348-1kg | Ammonium iron(III) sulfate dodecahydrate | 7783-83-7 | 1kg |
| GK9348-5kg | Ammonium iron(III) sulfate dodecahydrate | 7783-83-7 | 5kg |
| GK0181-100g | Ammonium iron(lll) citrate (Brown) | 1185-57-5 | 100g |
| GK0181-500g | Ammonium iron(lll) citrate (Brown) | 1185-57-5 | 500g |
| GK0181-1kg | Ammonium iron(lll) citrate (Brown) | 1185-57-5 | 1kg |
| GK6140-100g | Ammonium iron(lll) citrate (Green) | 1185-57-5 | 100g |
| GK6140-250g | Ammonium iron(lll) citrate (Green) | 1185-57-5 | 250g |
| GK6140-500g | Ammonium iron(lll) citrate (Green) | 1185-57-5 | 500g |
| GK6140-1kg | Ammonium iron(lll) citrate (Green) | 1185-57-5 | 1kg |
| GK9128-100g | Ammonium iron(lll) citrate (Green); Iron content 14 - 16 % | 1185-57-5 | 100g |
| GK9128-250g | Ammonium iron(lll) citrate (Green); Iron content 14 - 16 % | 1185-57-5 | 250g |
| GK9128-500g | Ammonium iron(lll) citrate (Green); Iron content 14 - 16 % | 1185-57-5 | 500g |
| GK9128-1kg | Ammonium iron(lll) citrate (Green); Iron content 14 - 16 % | 1185-57-5 | 1kg |
| GK9128-5kg | Ammonium iron(lll) citrate (Green); Iron content 14 - 16 % | 1185-57-5 | 5kg |
| GK3854-50g | Ammonium L-(+)-tartrate | 3164-29-2 | 50g |
| GK3854-250g | Ammonium L-(+)-tartrate | 3164-29-2 | 250g |
| GK3854-500g | Ammonium L-(+)-tartrate | 3164-29-2 | 500g |
| GK3854-1kg | Ammonium L-(+)-tartrate | 3164-29-2 | 1kg |
| GC2144-100ml | Ammonium L-lactate | 515-98-0 | 100ml |
| GC2144-250ml | Ammonium L-lactate | 515-98-0 | 250ml |
| GC2144-500ml | Ammonium L-lactate | 515-98-0 | 500ml |
| GC2144-1l | Ammonium L-lactate | 515-98-0 | 1l |
| GK4368-25g | Ammonium metavanadate | 7803-55-6 | 25g |
| GK3904-25g | Ammonium molybdate tetrahydrate | 12054-85-2 | 25g |
| GK3904-100g | Ammonium molybdate tetrahydrate | 12054-85-2 | 100g |
| GK3904-250g | Ammonium molybdate tetrahydrate | 12054-85-2 | 250g |
| GK3904-500g | Ammonium molybdate tetrahydrate | 12054-85-2 | 500g |
| GK3904-1kg | Ammonium molybdate tetrahydrate | 12054-85-2 | 1kg |
| GX0076-100g | Ammonium molybdate tetrahydrate, 99.5% | 12054-85-2 | 100g |
| GX0076-250g | Ammonium molybdate tetrahydrate, 99.5% | 12054-85-2 | 250g |
| GX0076-500g | Ammonium molybdate tetrahydrate, 99.5% | 12054-85-2 | 500g |
| GK9204-500g | Ammonium oxalate monohydrate, ACS | 6009-70-7 | 500g |
| GX9451-100g | Ammonium oxalate, monohydrate, 98% | 6009-70-7 | 100g |
| GX9451-1kg | Ammonium oxalate, monohydrate, 98% | 6009-70-7 | 1kg |
| GK3205-100g | Ammonium pentaborate octahydrate | 12046-03-6 | 100g |
| GK3205-250g | Ammonium pentaborate octahydrate | 12046-03-6 | 250g |
| GK3205-500g | Ammonium pentaborate octahydrate | 12046-03-6 | 500g |
| GK3205-1kg | Ammonium pentaborate octahydrate | 12046-03-6 | 1kg |
| GX5718-500g | Ammonium pentaborate tetrahydrate | 12046-04-7 | 500g |
| GX3119-1g | Ammonium pentachloroaquorhodate(III) | 63771-33-5 | 1g |
| GX3119-5g | Ammonium pentachloroaquorhodate(III) | 63771-33-5 | 5g |
| GX3003-2g | Ammonium perrhenate, 99.9% | 13598-65-7 | 2g |
| GX3003-10g | Ammonium perrhenate, 99.9% | 13598-65-7 | 10g |
| GE6204-100g | Ammonium persulfate | 7727-54-0 | 100g |
| GL1791-1g | Ammonium pyrrolidinedithiocarbamate | 5108-96-3 | 1g |
| GL1791-5g | Ammonium pyrrolidinedithiocarbamate | 5108-96-3 | 5g |
| GL1791-25g | Ammonium pyrrolidinedithiocarbamate | 5108-96-3 | 25g |
| GL1791-100g | Ammonium pyrrolidinedithiocarbamate | 5108-96-3 | 100g |
| GX6382-10g | Ammonium succinate | 2226-88-2 | 10g |
| GK6102-100g | Ammonium sulfamate | 7773-06-0 | 100g |
| GK6102-250g | Ammonium sulfamate | 7773-06-0 | 250g |
| GK6102-500g | Ammonium sulfamate | 7773-06-0 | 500g |
| GK6102-1kg | Ammonium sulfamate | 7773-06-0 | 1kg |
| GK6102-5kg | Ammonium sulfamate | 7773-06-0 | 5kg |
| GE2543-100g | Ammonium sulfate | 7783-20-2 | 100g |
| GE2543-250g | Ammonium sulfate | 7783-20-2 | 250g |
| GE2543-500g | Ammonium sulfate | 7783-20-2 | 500g |
| GE2543-1kg | Ammonium sulfate | 7783-20-2 | 1kg |
| GE2543-5kg | Ammonium sulfate | 7783-20-2 | 5kg |
| GE2543-10kg | Ammonium sulfate | 7783-20-2 | 10kg |
| GX4152-100g | Ammonium sulfate, 99.9999% | 7783-20-2 | 100g |
| GX5799-1g | Ammonium tetrachloroaurate(III) | 13874-04-9 | 1g |
| GX5799-5g | Ammonium tetrachloroaurate(III) | 13874-04-9 | 5g |
| GX0589-2g | Ammonium tetrachloropalladate(II) | 13820-40-1 | 2g |
| GX0589-5g | Ammonium tetrachloropalladate(II) | 13820-40-1 | 5g |
| GX0589-10g | Ammonium tetrachloropalladate(II) | 13820-40-1 | 10g |
| GX7520-1g | Ammonium tetrachloroplatinate(II) | 13820-41-2 | 1g |
| GK7498-1g | Ammonium tetrachloroplatinate(II); 99.9% | 13820-41-2 | 1g |
| GK3645-250g | Ammonium thiocyanate | 1762-95-4 | 250g |
| GK3645-1kg | Ammonium thiocyanate | 1762-95-4 | 1kg |
| GK3645-5kg | Ammonium thiocyanate | 1762-95-4 | 5kg |
| GX9978-25g | Ammonium tungstate hydrate, 99% | 11120-25-5 | 25g |
| GX9978-100g | Ammonium tungstate hydrate, 99% | 11120-25-5 | 100g |
| GX3138-500g | Ammonium-L-tartrate, 99% | 3164-29-2 | 500g |
| GX5161-1g | Ammonium-nitrido-octachlorodiaquodiruthenate(IV); 99.95% (metals basis) | 27316-90-1 | 1g |
| GX5161-5g | Ammonium-nitrido-octachlorodiaquodiruthenate(IV); 99.95% (metals basis) | 27316-90-1 | 5g |
| GW4834-500ug | Amorfrutin A | 80489-90-3 | 500ug |
| GW3206-500ug | Amorfrutin B | 78916-42-4 | 500ug |
| GW3206-1mg | Amorfrutin B | 78916-42-4 | 1mg |
| GP0831-1g | Amorolfine hydrochloride | 78613-38-4 | 1g |
| GP2126-100mg | Amoxapine | 14028-44-5 | 100mg |
| GP0775-1g | Amoxicillin sodium salt | 34642-77-8 | 1g |
| GP0775-5g | Amoxicillin sodium salt | 34642-77-8 | 5g |
| GA7845-1g | Amoxicillin trihydrate, BP, EP grade | 61336-70-7 | 1g |
| GA7845-5g | Amoxicillin trihydrate, BP, EP grade | 61336-70-7 | 5g |
| GA7845-10g | Amoxicillin trihydrate, BP, EP grade | 61336-70-7 | 10g |
| GA7845-25g | Amoxicillin trihydrate, BP, EP grade | 61336-70-7 | 25g |
| GA8986-100mg | Amphotericin B | 1397-89-3 | 100mg |
| GA8986-250mg | Amphotericin B | 1397-89-3 | 250mg |
| GA8986-500mg | Amphotericin B | 1397-89-3 | 500mg |
| GA8986-1g | Amphotericin B | 1397-89-3 | 1g |
| GA8986-5g | Amphotericin B | 1397-89-3 | 5g |
| GA7355-1g | Ampicillin sodium salt | 69-52-3 | 1g |
| GA7355-5g | Ampicillin sodium salt | 69-52-3 | 5g |
| GA7355-10g | Ampicillin sodium salt | 69-52-3 | 10g |
| GA7355-25g | Ampicillin sodium salt | 69-52-3 | 25g |
| GA7355-100g | Ampicillin sodium salt | 69-52-3 | 100g |
| GA0283-5g | Ampicillin sodium salt, cell culture grade | 69-52-3 | 5g |
| GA0283-25g | Ampicillin sodium salt, cell culture grade | 69-52-3 | 25g |
| GA0283-100g | Ampicillin sodium salt, cell culture grade | 69-52-3 | 100g |
| GA2117-5g | Ampicillin trihydrate | 7177-48-2 | 5g |
| GA2117-25g | Ampicillin trihydrate | 7177-48-2 | 25g |
| GA2117-100g | Ampicillin trihydrate | 7177-48-2 | 100g |
| GA8774-5g | Ampicillin trihydrate, USP grade | 7177-48-2 | 5g |
| GA8774-25g | Ampicillin trihydrate, USP grade | 7177-48-2 | 25g |
| GA8774-100g | Ampicillin trihydrate, USP grade | 7177-48-2 | 100g |
| GA3049-5g | Ampicillin, anhydrous | 69-53-4 | 5g |
| GA3049-10g | Ampicillin, anhydrous | 69-53-4 | 10g |
| GA3049-25g | Ampicillin, anhydrous | 69-53-4 | 25g |
| GA3049-100g | Ampicillin, anhydrous | 69-53-4 | 100g |
| GX3272-25mg | Amplisyn Red | 119171-73-2 | 25mg |
| GX3272-200mg | Amplisyn Red | 119171-73-2 | 200mg |
| GW2882-100mg | AMQI | 7270-83-9 | 100mg |
| GW2882-1g | AMQI | 7270-83-9 | 1g |
| GP7331-250mg | Amrinone | 60719-84-8 | 250mg |
| GP7331-1g | Amrinone | 60719-84-8 | 1g |
| GL7076-100mg | Amsacrine hydrochloride | 54301-15-4 | 100mg |
| GW6762-1mg | Amuvatinib | 850879-09-3 | 1mg |
| GW6762-5mg | Amuvatinib | 850879-09-3 | 5mg |
| GW6762-10mg | Amuvatinib | 850879-09-3 | 10mg |
| GC5067-1g | Amygdalin | 29883-15-6 | 1g |
| GC5067-5g | Amygdalin | 29883-15-6 | 5g |
| GC5067-10g | Amygdalin | 29883-15-6 | 10g |
| GC5067-25g | Amygdalin | 29883-15-6 | 25g |
| GK9299-5mg | Anacardic acid | 16611-84-0 | 5mg |
| GK9299-25mg | Anacardic acid | 16611-84-0 | 25mg |
| GP2172-10mg | Anastrozole | 120511-73-1 | 10mg |
| GP2172-25mg | Anastrozole | 120511-73-1 | 25mg |
| GK3145-25mg | Ancymidol | 12771-68-5 | 25mg |
| GK3145-100mg | Ancymidol | 12771-68-5 | 100mg |
| GL6670-250ug | Andrastin A | 174232-42-9 | 250ug |
| GL6670-1mg | Andrastin A | 174232-42-9 | 1mg |
| GP9833-100mg | Andrographolide | 5508-58-7 | 100mg |
| GL5865-1g | Androsterone | 53-41-8 | 1g |
| GW9602-500mg | Anhydrotetracycline hydrochloride | 13803-65-1 | 500mg |
| GK5135-100g | Aniline | 62-53-3 | 100g |
| GT2666-5g | Aniline Blue (C.I. 42755) | 28631-66-5 | 5g |
| GT2666-25g | Aniline Blue (C.I. 42755) | 28631-66-5 | 25g |
| GT2666-100g | Aniline Blue (C.I. 42755) | 28631-66-5 | 100g |
| GT1108-5g | Aniline Blue diammonium salt | 66687-07-8 | 5g |
| GT1108-25g | Aniline Blue diammonium salt | 66687-07-8 | 25g |
| GE8239-250ml | Aniline Blue, 2.5% solution in 2% acetic acid | 28631-66-5 | 250ml |
| GE8239-500ml | Aniline Blue, 2.5% solution in 2% acetic acid | 28631-66-5 | 500ml |
| GX1132-100g | Anisole | 100-66-3 | 100g |
| GS7223-100ml | Anisole, GlenDry™, anhydrous | 100-66-3 | 100ml |
| GS7223-500ml | Anisole, GlenDry™, anhydrous | 100-66-3 | 500ml |
| GS7223-1l | Anisole, GlenDry™, anhydrous | 100-66-3 | 1l |
| GS7223-2500ml | Anisole, GlenDry™, anhydrous | 100-66-3 | 2500ml |
| GA2328-25mg | Anisomycin | 22862-76-6 | 25mg |
| GA2328-100mg | Anisomycin | 22862-76-6 | 100mg |
| GL4628-1mg | Anomalin A | 548740-86-9 | 1mg |
| GA9248-1mg | Ansatrienin A | 82189-03-5 | 1mg |
| GP5451-5g | Antazoline hydrochloride | 2508-72-7 | 5g |
| GP5451-25g | Antazoline hydrochloride | 2508-72-7 | 25g |
| GW6771-10mg | Anthracene-9,10-dipropionic acid disodium salt | 82767-90-6 | 10mg |
| GW6771-100mg | Anthracene-9,10-dipropionic acid disodium salt | 82767-90-6 | 100mg |
| GK6811-25g | Anthracene, 99% | 120-12-7 | 25g |
| GK6811-100g | Anthracene, 99% | 120-12-7 | 100g |
| GK6811-250g | Anthracene, 99% | 120-12-7 | 250g |
| GK6811-500g | Anthracene, 99% | 120-12-7 | 500g |
| GW3595-100mg | Anthrance A | 185318-74-5 | 100mg |
| GW3595-1g | Anthrance A | 185318-74-5 | 1g |
| GK9102-25g | Anthranilic acid | 118-92-3 | 25g |
| GK9102-100g | Anthranilic acid | 118-92-3 | 100g |
| GL8529-25g | Anthraquinone | 84-65-1 | 25g |
| GL8529-100g | Anthraquinone | 84-65-1 | 100g |
| GT1240-25g | Anthrone | 90-44-8 | 25g |
| GT1240-100g | Anthrone | 90-44-8 | 100g |
| GL7021-500ug | Antibiotic L-696,474 | 141994-72-1 | 500ug |
| GA6727-500ug | Antibiotic PF 1052 | 147317-15-5 | 500ug |
| GA6727-1mg | Antibiotic PF 1052 | 147317-15-5 | 1mg |
| GX8708-100g | Antimony Ingot, 99.999% | 7440-36-0 | 100g |
| GX8708-500g | Antimony Ingot, 99.999% | 7440-36-0 | 500g |
| GX7081-50g | Antimony Ingot, 99.9999% | 7440-36-0 | 50g |
| GX7081-250g | Antimony Ingot, 99.9999% | 7440-36-0 | 250g |
| GX7845-25g | Antimony Pieces, 99.999% | 7440-36-0 | 25g |
| GX7845-100g | Antimony Pieces, 99.999% | 7440-36-0 | 100g |
| GX7845-500g | Antimony Pieces, 99.999% | 7440-36-0 | 500g |
| GX8733-25g | Antimony Pieces, 99.9999% | 7440-36-0 | 25g |
| GX8733-50g | Antimony Pieces, 99.9999% | 7440-36-0 | 50g |
| GX8733-250g | Antimony Pieces, 99.9999% | 7440-36-0 | 250g |
| GX2647-100g | Antimony Powder -325 mesh, 99.5% | 7440-36-0 | 100g |
| GX2647-500g | Antimony Powder -325 mesh, 99.5% | 7440-36-0 | 500g |
| GX3000-10g | Antimony Powder max. 250 micron, 99.999% | 7440-36-0 | 10g |
| GX3000-50g | Antimony Powder max. 250 micron, 99.999% | 7440-36-0 | 50g |
| GX3000-100g | Antimony Powder max. 250 micron, 99.999% | 7440-36-0 | 100g |
| GX5626-50mm | Antimony Rod 6 mm diameter, 99.999% | 7440-36-0 | 50mm |
| GX9225-50mm | Antimony Rod 8 mm diameter, 99.999% | 7440-36-0 | 50mm |
| GX5423-50g | Antimony Shot 1-3 mm, 99.999% | 7440-36-0 | 50g |
| GX3665-10g | Antimony Shot 1-3 mm, 99.9999% | 7440-36-0 | 10g |
| GX3665-50g | Antimony Shot 1-3 mm, 99.9999% | 7440-36-0 | 50g |
| GX2461-25g | Antimony tin oxide (ATO); 99,95 % | 12673-86-8 | 25g |
| GX2461-100g | Antimony tin oxide (ATO); 99,95 % | 12673-86-8 | 100g |
| GX2461-250g | Antimony tin oxide (ATO); 99,95 % | 12673-86-8 | 250g |
| GX2461-1kg | Antimony tin oxide (ATO); 99,95 % | 12673-86-8 | 1kg |
| GX2870-25g | Antimony tin oxide, 99.95 % | 12673-86-8 | 25g |
| GX2870-100g | Antimony tin oxide, 99.95 % | 12673-86-8 | 100g |
| GX2870-250g | Antimony tin oxide, 99.95 % | 12673-86-8 | 250g |
| GX2870-1kg | Antimony tin oxide, 99.95 % | 12673-86-8 | 1kg |
| GX1593-10g | Antimony(III) chloride, 99.99+% | 10025-91-9 | 10g |
| GX1593-50g | Antimony(III) chloride, 99.99+% | 10025-91-9 | 50g |
| GX2593-250g | Antimony(III) chloride, 99% | 10025-91-9 | 250g |
| GX8250-250g | Antimony(III) fluoride, 99% | 7783-56-4 | 250g |
| GX5562-10g | Antimony(III) iodide, 99.999% | 7790-44-5 | 10g |
| GX8352-500g | Antimony(III) oxide, 98+% | 1309-64-4 | 500g |
| GX1943-50g | Antimony(III) oxide, 99.9% | 1309-64-4 | 50g |
| GX1943-250g | Antimony(III) oxide, 99.9% | 1309-64-4 | 250g |
| GX8841-25g | Antimony(III) oxide, 99.99+% | 1309-64-4 | 25g |
| GX8841-100g | Antimony(III) oxide, 99.99+% | 1309-64-4 | 100g |
| GX5942-500g | Antimony(III) sulfide | 1345-04-6 | 500g |
| GX8478-250g | Antimony(V) chloride | 7647-18-9 | 250g |
| GX8145-50g | Antimony(V) pentasulfide | 1315-04-4 | 50g |
| GA1794-1mg | Antimycin A1 | 642-15-9 | 1mg |
| GL6582-5mg | Antipain dihydrochloride | 37682-72-7 | 5mg |
| GL6582-25mg | Antipain dihydrochloride | 37682-72-7 | 25mg |
| GW2316-1mg | AP-III-a4 . HCl | 1177827-73-4 | 1mg |
| GW2316-5mg | AP-III-a4 . HCl | 1177827-73-4 | 5mg |
| GW2135-5mg | Apcin | 300815-04-7 | 5mg |
| GW2135-25mg | Apcin | 300815-04-7 | 25mg |
| GA6433-1mg | Aphidicolin | 38966-21-1 | 1mg |
| GA6433-5mg | Aphidicolin | 38966-21-1 | 5mg |
| GA6433-25mg | Aphidicolin | 38966-21-1 | 25mg |
| GL1264-250ug | Aphidicolin 17-acetate | 51103-57-2 | 250ug |
| GL4049-250ug | Aphidicolin-3alpha,18-acetonide | 110386-56-6 | 250ug |
| GL4049-1mg | Aphidicolin-3alpha,18-acetonide | 110386-56-6 | 1mg |
| GA4500-1mg | Apicidin | 183506-66-3 | 1mg |
| GA4500-5mg | Apicidin | 183506-66-3 | 5mg |
| GP1532-25mg | Apigenin | 520-36-5 | 25mg |
| GP1532-100mg | Apigenin | 520-36-5 | 100mg |
| GP1532-250mg | Apigenin | 520-36-5 | 250mg |
| GL6788-1mg | Apigenin 7-glucuronide | 29741-09-1 | 1mg |
| GC2419-5mg | Apigenin-7-glucoside | 578-74-5 | 5mg |
| GC2419-10mg | Apigenin-7-glucoside | 578-74-5 | 10mg |
| GC2419-25mg | Apigenin-7-glucoside | 578-74-5 | 25mg |
| GP7497-50mg | Apixaban | 503612-47-3 | 50mg |
| GE6422-500mg | apo-Transferrin | 11096-37-0 | 500mg |
| GP0822-100mg | Apomorphine hydrochloride | 41372-20-7 | 100mg |
| GA8829-1g | Apramycin sulfate salt | 65710-07-8 | 1g |
| GA8829-5g | Apramycin sulfate salt | 65710-07-8 | 5g |
| GA8829-25g | Apramycin sulfate salt | 65710-07-8 | 25g |
| GP4641-250mg | Aprepitant | 170729-80-3 | 250mg |
| GP4641-1g | Aprepitant | 170729-80-3 | 1g |
| GP2268-5mg | Aprotinin | 9087-70-1 | 5mg |
| GP2268-10mg | Aprotinin | 9087-70-1 | 10mg |
| GP2268-25mg | Aprotinin | 9087-70-1 | 25mg |
| GP2268-100mg | Aprotinin | 9087-70-1 | 100mg |
| GC8174-10g | Arabinogalactan | 9036-66-2 | 10g |
| GE1829-1g | Arachidic acid | 506-30-9 | 1g |
| GE1829-5g | Arachidic acid | 506-30-9 | 5g |
| GK3960-1g | Arachidonic acid, 10% | 506-32-1 | 1g |
| GK3960-5g | Arachidonic acid, 10% | 506-32-1 | 5g |
| GA1926-500ug | Aranciamycin | 72389-06-1 | 500ug |
| GA1926-1mg | Aranciamycin | 72389-06-1 | 1mg |
| GL9104-250ug | Aranorosin | 117184-53-9 | 250ug |
| GL9104-1mg | Aranorosin | 117184-53-9 | 1mg |
| GC0919-10g | Arbutin | 497-76-7 | 10g |
| GC0919-25g | Arbutin | 497-76-7 | 25g |
| GC0919-50g | Arbutin | 497-76-7 | 50g |
| GC0919-100g | Arbutin | 497-76-7 | 100g |
| GY3454-10mg | Arctigenin | 7770-78-7 | 10mg |
| GY3454-50mg | Arctigenin | 7770-78-7 | 50mg |
| GC9872-10mg | Arctiin | 20362-31-6 | 10mg |
| GC9872-50mg | Arctiin | 20362-31-6 | 50mg |
| GP0770-5g | Arecoline hydrobromide | 300-08-3 | 5g |
| GP0770-25g | Arecoline hydrobromide | 300-08-3 | 25g |
| GP6176-10mg | Argatroban | 74863-84-6 | 10mg |
| GP6176-50mg | Argatroban | 74863-84-6 | 50mg |
| GL1974-1mg | Arglabin | 84692-91-1 | 1mg |
| GL1974-5mg | Arglabin | 84692-91-1 | 5mg |
| GP6754-250mg | Aripiprazole | 129722-12-9 | 250mg |
| GP6754-1g | Aripiprazole | 129722-12-9 | 1g |
| GP6754-5g | Aripiprazole | 129722-12-9 | 5g |
| GT9304-5g | Arsenazo III | 1668-00-4 | 5g |
| GX6492-100g | Arsenic Pieces 2-12 mm, 99.999% | 7440-38-2 | 100g |
| GX3954-50g | Arsenic Pieces 2-12 mm, 99.9999% | 7440-38-2 | 50g |
| GX3954-100g | Arsenic Pieces 2-12 mm, 99.9999% | 7440-38-2 | 100g |
| GX1254-100g | Arsenic Powder -20 mesh, 99% | 7440-38-2 | 100g |
| GX0144-5g | Arsenic Powder max. 250 micron, 99.999% | 7440-38-2 | 5g |
| GX0144-25g | Arsenic Powder max. 250 micron, 99.999% | 7440-38-2 | 25g |
| GX8607-5g | Arsenic Powder max. 250 micron, 99.9999% | 7440-38-2 | 5g |
| GX8607-25g | Arsenic Powder max. 250 micron, 99.9999% | 7440-38-2 | 25g |
| GL9620-1g | Artemether | 71963-77-4 | 1g |
| GP0718-100mg | Artemisinin | 63968-64-9 | 100mg |
| GP0718-500mg | Artemisinin | 63968-64-9 | 500mg |
| GP0718-1g | Artemisinin | 63968-64-9 | 1g |
| GA7503-10mg | Artesunate | 88495-63-0 | 10mg |
| GA7503-25mg | Artesunate | 88495-63-0 | 25mg |
| GA7503-100mg | Artesunate | 88495-63-0 | 100mg |
| GA7503-500mg | Artesunate | 88495-63-0 | 500mg |
| GW1967-500mg | Articaine hydrochloride | 23964-57-0 | 500mg |
| GL6666-1mg | AS-252424 | 900515-16-4 | 1mg |
| GL6666-5mg | AS-252424 | 900515-16-4 | 5mg |
| GL6666-10mg | AS-252424 | 900515-16-4 | 10mg |
| GW2970-1mg | AS-703026 | 1236699-92-5 | 1mg |
| GW2970-5mg | AS-703026 | 1236699-92-5 | 5mg |
| GW2970-10mg | AS-703026 | 1236699-92-5 | 10mg |
| GK4694-1g | ASB-14 | 216667-08-2 | 1g |
| GK4694-5g | ASB-14 | 216667-08-2 | 5g |
| GL7015-500ug | Ascolactone | 757995-43-0 | 500ug |
| GL7015-1mg | Ascolactone | 757995-43-0 | 1mg |
| GA1406-1mg | Ascomycin | 104987-12-4 | 1mg |
| GA1406-10mg | Ascomycin | 104987-12-4 | 10mg |
| GA1406-25mg | Ascomycin | 104987-12-4 | 25mg |
| GA1406-50mg | Ascomycin | 104987-12-4 | 50mg |
| GX9315-5g | Ascorbyl tetraisopalmitate | 183476-82-6 | 5g |
| GX9315-10g | Ascorbyl tetraisopalmitate | 183476-82-6 | 10g |
| GX9315-25g | Ascorbyl tetraisopalmitate | 183476-82-6 | 25g |
| GP0603-10mg | Asenapine maleate | 85650-56-2 | 10mg |
| GL0518-5mg | Asiatic acid | 464-92-6 | 5mg |
| GL0518-25mg | Asiatic acid | 464-92-6 | 25mg |
| GC7829-10mg | Asiaticoside | 16830-15-2 | 10mg |
| GC7829-50mg | Asiaticoside | 16830-15-2 | 50mg |
| GE0967-1g | Aspartame | 22839-47-0 | 1g |
| GE0967-5g | Aspartame | 22839-47-0 | 5g |
| GE0967-25g | Aspartame | 22839-47-0 | 25g |
| GE0967-100g | Aspartame | 22839-47-0 | 100g |
| GE0967-250g | Aspartame | 22839-47-0 | 250g |
| GL8441-1mg | Aspergillimide | 195966-93-9 | 1mg |
| GL8441-5mg | Aspergillimide | 195966-93-9 | 5mg |
| GL4853-1mg | Aspergillin PZ | 483305-08-4 | 1mg |
| GL4853-5mg | Aspergillin PZ | 483305-08-4 | 5mg |
| GA4051-1mg | Asperlactone | 76375-62-7 | 1mg |
| GA4051-5mg | Asperlactone | 76375-62-7 | 5mg |
| GL6261-1mg | Asperloxine A | 1mg | |
| GW0191-250ug | Asperphenamate | 63631-36-7 | 250ug |
| GW0191-1mg | Asperphenamate | 63631-36-7 | 1mg |
| GL0242-5mg | Asperulosidic acid | 25368-11-0 | 5mg |
| GL7840-1mg | Aspinonene | 157676-96-5 | 1mg |
| GL7840-5mg | Aspinonene | 157676-96-5 | 5mg |
| GL7290-1mg | Aspochalasin I | 670225-69-1 | 1mg |
| GL7290-2500ug | Aspochalasin I | 670225-69-1 | 2500ug |
| GW8838-100mg | ASPT | 159721-38-7 | 100mg |
| GW8838-1g | ASPT | 159721-38-7 | 1g |
| GL9151-1mg | Aspterric acid | 67309-95-9 | 1mg |
| GA6290-1mg | Aspyrone | 17398-00-4 | 1mg |
| GA6290-5mg | Aspyrone | 17398-00-4 | 5mg |
| GW9454-1mg | AST-487 | 630124-46-8 | 1mg |
| GW9454-5mg | AST-487 | 630124-46-8 | 5mg |
| GW9454-25mg | AST-487 | 630124-46-8 | 25mg |
| GP5817-5mg | Astaxanthin | 472-61-7 | 5mg |
| GP5817-25mg | Astaxanthin | 472-61-7 | 25mg |
| GP5099-10mg | Astemizole | 68844-77-9 | 10mg |
| GL4939-10mg | Astilbin | 29838-67-3 | 10mg |
| GT8099-5g | Astra Blue | 82864-57-1 | 5g |
| GT8099-25g | Astra Blue | 82864-57-1 | 25g |
| GL0129-1mg | Astragaloside IV | 84687-43-4 | 1mg |
| GL0129-5mg | Astragaloside IV | 84687-43-4 | 5mg |
| GW4564-1mg | AT7519 hydrochloride | 902135-91-5 | 1mg |
| GW4564-5mg | AT7519 hydrochloride | 902135-91-5 | 5mg |
| GW4564-10mg | AT7519 hydrochloride | 902135-91-5 | 10mg |
| GW8696-1mg | AT9283 | 896466-04-9 | 1mg |
| GW8696-5mg | AT9283 | 896466-04-9 | 5mg |
| GW8696-10mg | AT9283 | 896466-04-9 | 10mg |
| GP7849-100mg | Atazanavir sulphate | 229975-97-7 | 100mg |
| GP7849-250mg | Atazanavir sulphate | 229975-97-7 | 250mg |
| GP7849-1g | Atazanavir sulphate | 229975-97-7 | 1g |
| GP1091-1g | Atenolol | 29122-68-7 | 1g |
| GP1091-10g | Atenolol | 29122-68-7 | 10g |
| GW1919-100mg | Athidathion | 19691-80-6 | 100mg |
| GW1919-250mg | Athidathion | 19691-80-6 | 250mg |
| GP2889-100mg | Atipamezole hydrochloride | 104075-48-1 | 100mg |
| GP2889-1g | Atipamezole hydrochloride | 104075-48-1 | 1g |
| GP8528-250mg | Atomoxetine hydrochloride | 82248-59-7 | 250mg |
| GP8528-1g | Atomoxetine hydrochloride | 82248-59-7 | 1g |
| GP7735-25mg | Atorvastatin | 134523-00-5 | 25mg |
| GP7735-100mg | Atorvastatin | 134523-00-5 | 100mg |
| GP7735-250mg | Atorvastatin | 134523-00-5 | 250mg |
| GP5009-250mg | Atorvastatin calcium salt | 134523-03-8 | 250mg |
| GP5009-1g | Atorvastatin calcium salt | 134523-03-8 | 1g |
| GP1551-250mg | Atovaquone | 95233-18-4 | 250mg |
| GP1551-1g | Atovaquone | 95233-18-4 | 1g |
| GA9503-250ug | Atpenin A5 | 119509-24-9 | 250ug |
| GA9503-1mg | Atpenin A5 | 119509-24-9 | 1mg |
| GP8154-100mg | Atracurium besylate | 64228-81-5 | 100mg |
| GP8423-1g | Atrazine | 1912-24-9 | 1g |
| GP2470-1g | Atropine | 51-55-8 | 1g |
| GP0750-5g | Atropine sulfate monohydrate | 5908-99-6 | 5g |
| GP0750-25g | Atropine sulfate monohydrate | 5908-99-6 | 25g |
| GL4681-10mg | Aucubin | 479-98-1 | 10mg |
| GT5481-25g | Auramine O (C.I. 41000) | 2465-27-2 | 25g |
| GT5481-50g | Auramine O (C.I. 41000) | 2465-27-2 | 50g |
| GP1600-25mg | Auranofine | 34031-32-8 | 25mg |
| GP1600-100mg | Auranofine | 34031-32-8 | 100mg |
| GA0085-1mg | Aureothin | 2825-00-5 | 1mg |
| GA0085-5mg | Aureothin | 2825-00-5 | 5mg |
| GA0186-500ug | Aureothricin | 574-95-8 | 500ug |
| GA0186-1mg | Aureothricin | 574-95-8 | 1mg |
| GA0186-5mg | Aureothricin | 574-95-8 | 5mg |
| GL9736-100mg | Aurintricarboxylic acid | 4431-00-9 | 100mg |
| GL9736-500mg | Aurintricarboxylic acid | 4431-00-9 | 500mg |
| GE0325-25g | Aurintricarboxylic acid ammonium salt | 569-58-4 | 25g |
| GE0325-100g | Aurintricarboxylic acid ammonium salt | 569-58-4 | 100g |
| GE0325-250g | Aurintricarboxylic acid ammonium salt | 569-58-4 | 250g |
| GA7019-1mg | Aurodox | 12704-90-4 | 1mg |
| GA7019-2500ug | Aurodox | 12704-90-4 | 2500ug |
| GW8342-1mg | AV-412 | 451492-95-8 | 1mg |
| GW8342-5mg | AV-412 | 451492-95-8 | 5mg |
| GW8342-10mg | AV-412 | 451492-95-8 | 10mg |
| GX0016-1g | Avanafil | 330784-47-9 | 1g |
| GL1965-1mg | Averantin | 5803-62-3 | 1mg |
| GL1965-5mg | Averantin | 5803-62-3 | 5mg |
| GW8417-25mg | AVG-Cl | 55720-26-8 | 25mg |
| GE2842-5mg | Avidin, from chicken egg white | 1405-69-2 | 5mg |
| GE2842-10mg | Avidin, from chicken egg white | 1405-69-2 | 10mg |
| GX3450-1mg | Aviptadil Acetate | 40077-57-4 | 1mg |
| GX3450-5mg | Aviptadil Acetate | 40077-57-4 | 5mg |
| GX3450-25mg | Aviptadil Acetate | 40077-57-4 | 25mg |
| GP9798-5mg | Axitinib | 319460-85-0 | 5mg |
| GP9798-25mg | Axitinib | 319460-85-0 | 25mg |
| GW8438-1mg | AZ 960 | 905586-69-8 | 1mg |
| GW8438-5mg | AZ 960 | 905586-69-8 | 5mg |
| GW8438-25mg | AZ 960 | 905586-69-8 | 25mg |
| GW4801-1mg | AZ191 | 1594092-37-1 | 1mg |
| GW4801-5mg | AZ191 | 1594092-37-1 | 5mg |
| GW4801-25mg | AZ191 | 1594092-37-1 | 25mg |
| GW4253-1mg | AZ9482 | 1825345-33-2 | 1mg |
| GW4253-5mg | AZ9482 | 1825345-33-2 | 5mg |
| GW4253-10mg | AZ9482 | 1825345-33-2 | 10mg |
| GX0420-1g | Azamethiphos | 35575-96-3 | 1g |
| GX0420-5g | Azamethiphos | 35575-96-3 | 5g |
| GP1145-1g | Azathioprine | 446-86-6 | 1g |
| GW6998-1mg | AZD 7545 | 252017-04-2 | 1mg |
| GW6998-5mg | AZD 7545 | 252017-04-2 | 5mg |
| GW6998-10mg | AZD 7545 | 252017-04-2 | 10mg |
| GW4562-1mg | AZD-1208 | 1204144-28-4 | 1mg |
| GW4562-5mg | AZD-1208 | 1204144-28-4 | 5mg |
| GW4562-10mg | AZD-1208 | 1204144-28-4 | 10mg |
| GW5430-1mg | AZD-2014 | 1009298-59-2 | 1mg |
| GW5430-5mg | AZD-2014 | 1009298-59-2 | 5mg |
| GW5430-10mg | AZD-2014 | 1009298-59-2 | 10mg |
| GW1592-1mg | AZD-26 | 1357158-81-6 | 1mg |
| GW1592-5mg | AZD-26 | 1357158-81-6 | 5mg |
| GW1592-10mg | AZD-26 | 1357158-81-6 | 10mg |
| GW7781-1mg | AZD-7762 hydrochloride | 860352-01-8 | 1mg |
| GW7781-5mg | AZD-7762 hydrochloride | 860352-01-8 | 5mg |
| GW7781-10mg | AZD-7762 hydrochloride | 860352-01-8 | 10mg |
| GW4102-1mg | AZD-8055 | 1009298-09-2 | 1mg |
| GW4102-5mg | AZD-8055 | 1009298-09-2 | 5mg |
| GW4102-10mg | AZD-8055 | 1009298-09-2 | 10mg |
| GW3804-1mg | AZD-8330 | 869357-68-6 | 1mg |
| GW3804-5mg | AZD-8330 | 869357-68-6 | 5mg |
| GW3804-10mg | AZD-8330 | 869357-68-6 | 10mg |
| GK0163-25g | Azelaic acid, 99% | 123-99-9 | 25g |
| GK0163-100g | Azelaic acid, 99% | 123-99-9 | 100g |
| GK0163-250g | Azelaic acid, 99% | 123-99-9 | 250g |
| GP1332-100mg | Azelastine hydrochloride | 79307-93-0 | 100mg |
| GP1332-250mg | Azelastine hydrochloride | 79307-93-0 | 250mg |
| GP1332-1g | Azelastine hydrochloride | 79307-93-0 | 1g |
| GP5829-100mg | Azelnidipine | 123524-52-7 | 100mg |
| GC8183-2g | Azido 2-Acetamido-2-deoxy-3,4,6-tri-O-acetyl-β-D-glucopyranoside | 6205-69-2 | 2g |
| GC8183-5g | Azido 2-Acetamido-2-deoxy-3,4,6-tri-O-acetyl-β-D-glucopyranoside | 6205-69-2 | 5g |
| GC8183-10g | Azido 2-Acetamido-2-deoxy-3,4,6-tri-O-acetyl-β-D-glucopyranoside | 6205-69-2 | 10g |
| GC8183-25g | Azido 2-Acetamido-2-deoxy-3,4,6-tri-O-acetyl-β-D-glucopyranoside | 6205-69-2 | 25g |
| GX5951-25mg | Azilsartan medoxomil | 863031-21-4 | 25mg |
| GW4869-100mg | Azimsulfuron | 120162-55-2 | 100mg |
| GW4869-1g | Azimsulfuron | 120162-55-2 | 1g |
| GA2043-250mg | Azithromycin dihydrate | 117772-70-0 | 250mg |
| GA2043-1g | Azithromycin dihydrate | 117772-70-0 | 1g |
| GA9075-1g | Azlocillin sodium salt | 37091-65-9 | 1g |
| GW4098-500mg | Azo-Carob Galactomannan | 500mg | |
| GW4098-1g | Azo-Carob Galactomannan | 1g | |
| GT2939-1g | Azomethine-H monosodium salt hydrate | 206752-32-1 | 1g |
| GT2939-5g | Azomethine-H monosodium salt hydrate | 206752-32-1 | 5g |
| GT2939-10g | Azomethine-H monosodium salt hydrate | 206752-32-1 | 10g |
| GT2939-25g | Azomethine-H monosodium salt hydrate | 206752-32-1 | 25g |
| GT1311-25g | Azorubine S (C.I. 16185) | 915-67-3 | 25g |
| GT1311-50g | Azorubine S (C.I. 16185) | 915-67-3 | 50g |
| GT1311-100g | Azorubine S (C.I. 16185) | 915-67-3 | 100g |
| GX7276-1g | Azoxystrobin | 131860-33-8 | 1g |
| GA5815-100mg | Aztreonam | 78110-38-0 | 100mg |
| GA5815-500mg | Aztreonam | 78110-38-0 | 500mg |
| GA5815-1g | Aztreonam | 78110-38-0 | 1g |
| GA5815-5g | Aztreonam | 78110-38-0 | 5g |
| GP3751-100mg | Azulene | 275-51-4 | 100mg |
| GP3751-1g | Azulene | 275-51-4 | 1g |
| GT3888-5g | Azur C (C.I. 52002) | 531-57-7 | 5g |
| GT3888-10g | Azur C (C.I. 52002) | 531-57-7 | 10g |
| GT3888-25g | Azur C (C.I. 52002) | 531-57-7 | 25g |
| GT4045-10g | Azure A (C.I. 52005) | 531-53-3 | 10g |
| GT4045-25g | Azure A (C.I. 52005) | 531-53-3 | 25g |
| GT4045-50g | Azure A (C.I. 52005) | 531-53-3 | 50g |
| GT4045-100g | Azure A (C.I. 52005) | 531-53-3 | 100g |
| GT6233-5g | Azure B (C.I. 52010) | 531-55-5 | 5g |
| GT6233-25g | Azure B (C.I. 52010) | 531-55-5 | 25g |
| GT6233-100g | Azure B (C.I. 52010) | 531-55-5 | 100g |
| GT3719-10g | Azure II | 37247-10-2 | 10g |
| GT3719-25g | Azure II | 37247-10-2 | 25g |
| GT3719-50g | Azure II | 37247-10-2 | 50g |
| GT3719-100g | Azure II | 37247-10-2 | 100g |
| GT3741-25g | Azure II eosinate | 53092-85-6 | 25g |
| GT3741-100g | Azure II eosinate | 53092-85-6 | 100g |
| GH4036-5g | b-Alanine t-butyl ester hydrochloride | 58620-93-2 | 5g |
| GC0862-50mg | b-D-Allopyranose | 7283-09-2 | 50mg |
| GC0862-250mg | b-D-Allopyranose | 7283-09-2 | 250mg |
| GC0862-1g | b-D-Allopyranose | 7283-09-2 | 1g |
| GC5758-100mg | b-D-Galactopyranosyl azide | 35899-89-9 | 100mg |
| GC5758-250mg | b-D-Galactopyranosyl azide | 35899-89-9 | 250mg |
| GC5758-500mg | b-D-Galactopyranosyl azide | 35899-89-9 | 500mg |
| GC5758-1g | b-D-Galactopyranosyl azide | 35899-89-9 | 1g |
| GC5758-2g | b-D-Galactopyranosyl azide | 35899-89-9 | 2g |
| GC1902-100mg | b-D-Glucopyranosyl azide | 20379-59-3 | 100mg |
| GC1902-250mg | b-D-Glucopyranosyl azide | 20379-59-3 | 250mg |
| GC1902-500mg | b-D-Glucopyranosyl azide | 20379-59-3 | 500mg |
| GC1902-1g | b-D-Glucopyranosyl azide | 20379-59-3 | 1g |
| GC1902-2g | b-D-Glucopyranosyl azide | 20379-59-3 | 2g |
| GC8145-10g | b-D-Maltose octaacetate | 22352-19-8 | 10g |
| GC8145-25g | b-D-Maltose octaacetate | 22352-19-8 | 25g |
| GC8145-100g | b-D-Maltose octaacetate | 22352-19-8 | 100g |
| GN8530-100mg | b-Nicotinamide adenine dinucleotide phosphate hydrate | 53-59-8 | 100mg |
| GN8530-250mg | b-Nicotinamide adenine dinucleotide phosphate hydrate | 53-59-8 | 250mg |
| GN9337-100mg | b-Nicotinamide-adenine dinucleotide phosphate tetrasodium salt, reduced | 2646-71-1 | 100mg |
| GN9337-250mg | b-Nicotinamide-adenine dinucleotide phosphate tetrasodium salt, reduced | 2646-71-1 | 250mg |
| GN9337-1g | b-Nicotinamide-adenine dinucleotide phosphate tetrasodium salt, reduced | 2646-71-1 | 1g |
| GA7992-100mg | Bacampicillin hydrochoride | 37661-08-8 | 100mg |
| GL9266-500ug | Bacimethrin | 3690-12-8 | 500ug |
| GL9266-1mg | Bacimethrin | 3690-12-8 | 1mg |
| GA3759-5g | Bacitracin | 1405-87-4 | 5g |
| GA3759-25g | Bacitracin | 1405-87-4 | 25g |
| GA3759-100g | Bacitracin | 1405-87-4 | 100g |
| GA1078-1g | Bacitracin zinc salt | 1405-89-6 | 1g |
| GA1078-5g | Bacitracin zinc salt | 1405-89-6 | 5g |
| GW4947-1mg | Bafetinib | 859212-16-1 | 1mg |
| GW4947-5mg | Bafetinib | 859212-16-1 | 5mg |
| GW4947-10mg | Bafetinib | 859212-16-1 | 10mg |
| GA6363-100ug | Bafilomycin A1 | 88899-55-2 | 100ug |
| GA6363-1mg | Bafilomycin A1 | 88899-55-2 | 1mg |
| GA8347-100ug | Bafilomycin B1 | 88899-56-3 | 100ug |
| GA8347-1mg | Bafilomycin B1 | 88899-56-3 | 1mg |
| GA8347-5mg | Bafilomycin B1 | 88899-56-3 | 5mg |
| GA5404-1mg | Bafilomycin C1 | 88979-61-7 | 1mg |
| GW7574-1mg | Bafilomycin D (high purity) | 98813-13-9 | 1mg |
| GC0614-1g | Baicalin 7-b-D-glucuronide | 21967-41-9 | 1g |
| GC0614-25g | Baicalin 7-b-D-glucuronide | 21967-41-9 | 25g |
| GA6854-25mg | Balofloxacin | 127294-70-6 | 25mg |
| GA6854-100mg | Balofloxacin | 127294-70-6 | 100mg |
| GP7662-250mg | Balsalazide | 80573-04-2 | 250mg |
| GP7662-1g | Balsalazide | 80573-04-2 | 1g |
| GP7647-1g | Balsalazide disodium salt | 150399-21-6 | 1g |
| GW2497-5g | BAPTA tetraethyl ester | 73630-07-6 | 5g |
| GW2497-10g | BAPTA tetraethyl ester | 73630-07-6 | 10g |
| GK3735-250mg | BAPTA tetrasodium salt hydrate | 126824-24-6 | 250mg |
| GK3735-1g | BAPTA tetrasodium salt hydrate | 126824-24-6 | 1g |
| GK6150-25mg | BAPTA-AM | 126150-97-8 | 25mg |
| GK6150-100mg | BAPTA-AM | 126150-97-8 | 100mg |
| GW9910-10mg | Baricitinib | 1187594-09-7 | 10mg |
| GW9910-50mg | Baricitinib | 1187594-09-7 | 50mg |
| GX5645-1kg | Barium acetate, 98+% | 543-80-6 | 1kg |
| GX6609-50g | Barium aluminate, 99+% | 12004-04-5 | 50g |
| GX6609-250g | Barium aluminate, 99+% | 12004-04-5 | 250g |
| GX7895-250g | Barium bromide, dihydrate, 98+% | 7791-28-8 | 250g |
| GX7796-25g | Barium carbonate, 99.99% | 513-77-9 | 25g |
| GX2376-10g | Barium carbonate, 99.999% | 513-77-9 | 10g |
| GX2376-25g | Barium carbonate, 99.999% | 513-77-9 | 25g |
| GX0451-100g | Barium carbonate, 99% | 513-77-9 | 100g |
| GX0451-500g | Barium carbonate, 99% | 513-77-9 | 500g |
| GX0451-1kg | Barium carbonate, 99% | 513-77-9 | 1kg |
| GX0451-5kg | Barium carbonate, 99% | 513-77-9 | 5kg |
| GX0451-10kg | Barium carbonate, 99% | 513-77-9 | 10kg |
| GX3602-100g | Barium carbonate, 99%, ACS grade | 513-77-9 | 100g |
| GX3602-500g | Barium carbonate, 99%, ACS grade | 513-77-9 | 500g |
| GX3602-1kg | Barium carbonate, 99%, ACS grade | 513-77-9 | 1kg |
| GK4364-100g | Barium chloride dihydrate | 10326-27-9 | 100g |
| GK4364-250g | Barium chloride dihydrate | 10326-27-9 | 250g |
| GK4364-500g | Barium chloride dihydrate | 10326-27-9 | 500g |
| GK4364-1kg | Barium chloride dihydrate | 10326-27-9 | 1kg |
| GK4364-5kg | Barium chloride dihydrate | 10326-27-9 | 5kg |
| GX7010-50g | Barium chloride, anhydrous, 99.9% | 10361-37-2 | 50g |
| GX6201-250g | Barium chloride, anhydrous, 99% | 10361-37-2 | 250g |
| GX6201-1kg | Barium chloride, anhydrous, 99% | 10361-37-2 | 1kg |
| GX0287-1g | Barium diphenylamine-4-sulfonate | 6211-24-1 | 1g |
| GX0287-5g | Barium diphenylamine-4-sulfonate | 6211-24-1 | 5g |
| GX0287-25g | Barium diphenylamine-4-sulfonate | 6211-24-1 | 25g |
| GX0287-50g | Barium diphenylamine-4-sulfonate | 6211-24-1 | 50g |
| GX0287-100g | Barium diphenylamine-4-sulfonate | 6211-24-1 | 100g |
| GX3351-500g | Barium fluoride, 97+% | 7787-32-8 | 500g |
| GX0087-50g | Barium fluoride, 99.9% | 7787-32-8 | 50g |
| GX4346-100g | Barium fluoride, 99.9% | 7787-32-8 | 100g |
| GX1455-100g | Barium hydroxide octahydrate, 98% | 12230-71-6 | 100g |
| GX1455-500g | Barium hydroxide octahydrate, 98% | 12230-71-6 | 500g |
| GX1455-1kg | Barium hydroxide octahydrate, 98% | 12230-71-6 | 1kg |
| GX9343-50g | Barium nitrate, 99.95% | 10022-31-8 | 50g |
| GX5821-100g | Barium nitrate, 99% | 10022-31-8 | 100g |
| GX5821-250g | Barium nitrate, 99% | 10022-31-8 | 250g |
| GX5821-500g | Barium nitrate, 99% | 10022-31-8 | 500g |
| GX5821-1kg | Barium nitrate, 99% | 10022-31-8 | 1kg |
| GX2723-10g | Barium oxide, 99.5% | 1304-28-5 | 10g |
| GX2723-50g | Barium oxide, 99.5% | 1304-28-5 | 50g |
| GX6077-500g | Barium Rod 22 mm diameter, under argon, 0.8% Sr, 99.3% | 7440-39-3 | 500g |
| GX7923-500g | Barium Rod 22 mm diameter, under paraffin oil, 0,8% Sr, 99.3% | 7440-39-3 | 500g |
| GX5859-100g | Barium sulfate, 99% | 7727-43-7 | 100g |
| GX5859-250g | Barium sulfate, 99% | 7727-43-7 | 250g |
| GX5859-500g | Barium sulfate, 99% | 7727-43-7 | 500g |
| GX5859-1kg | Barium sulfate, 99% | 7727-43-7 | 1kg |
| GX8528-1g | Barium tetracyanoplatinate(II) | 13755-32-3 | 1g |
| GX8528-5g | Barium tetracyanoplatinate(II) | 13755-32-3 | 5g |
| GX4731-50g | Barium titanate Nanopowder, 100nm, 99.9% | 12047-27-7 | 50g |
| GX4731-250g | Barium titanate Nanopowder, 100nm, 99.9% | 12047-27-7 | 250g |
| GX4731-1kg | Barium titanate Nanopowder, 100nm, 99.9% | 12047-27-7 | 1kg |
| GX3373-50g | Barium titanate Nanopowder, 99,95 % | 12047-27-7 | 50g |
| GX3373-100g | Barium titanate Nanopowder, 99,95 % | 12047-27-7 | 100g |
| GX3373-250g | Barium titanate Nanopowder, 99,95 % | 12047-27-7 | 250g |
| GX3373-1kg | Barium titanate Nanopowder, 99,95 % | 12047-27-7 | 1kg |
| GX2521-50g | Barium titanate, 99.9% | 12047-27-7 | 50g |
| GX6158-25g | Barium titanate, 99.9% | 12047-27-7 | 25g |
| GX2521-100g | Barium titanate, 99.9% | 12047-27-7 | 100g |
| GX6158-100g | Barium titanate, 99.9% | 12047-27-7 | 100g |
| GX5396-10g | Barium titanate, 99.99% | 12047-27-7 | 10g |
| GX5010-500g | Barium titanate, 99% | 12047-27-7 | 500g |
| GX1134-50g | Barium tungstate, 99.9% | 7787-42-0 | 50g |
| GX3559-250g | Barium zirconate, 99% | 12009-21-1 | 250g |
| GX2292-1g | Barium-thd, 99.99% | 17594-47-7 | 1g |
| GX2292-5g | Barium-thd, 99.99% | 17594-47-7 | 5g |
| GT2169-5g | Basic Fuchsin (C.I. 42510) | 632-99-5 | 5g |
| GT2169-25g | Basic Fuchsin (C.I. 42510) | 632-99-5 | 25g |
| GT2169-100g | Basic Fuchsin (C.I. 42510) | 632-99-5 | 100g |
| GT2106-5g | Basic Fuchsin, for flagella staining, certified | 58969-01-0 | 5g |
| GT2106-25g | Basic Fuchsin, for flagella staining, certified | 58969-01-0 | 25g |
| GW4671-5g | Basic Red 12 | 6320-14-5 | 5g |
| GX4798-100g | Basic Red 14 | 12217-48-0 | 100g |
| GT8545-25g | Basic Yellow 40 | 12221-86-2 | 25g |
| GP6031-1g | Bathocuproine | 4733-39-5 | 1g |
| GP6031-5g | Bathocuproine | 4733-39-5 | 5g |
| GT0734-100mg | Bathocuproinedisulfonic acid disodium salt | 52698-84-7 | 100mg |
| GT0734-250mg | Bathocuproinedisulfonic acid disodium salt | 52698-84-7 | 250mg |
| GT0734-500mg | Bathocuproinedisulfonic acid disodium salt | 52698-84-7 | 500mg |
| GT0734-1g | Bathocuproinedisulfonic acid disodium salt | 52698-84-7 | 1g |
| GE7942-1g | Bathophenanthroline, 98% | 1662-01-7 | 1g |
| GE7942-5g | Bathophenanthroline, 98% | 1662-01-7 | 5g |
| GK8638-10mg | Bay 11-7082 | 19542-67-7 | 10mg |
| GK8638-50mg | Bay 11-7082 | 19542-67-7 | 50mg |
| GW7810-1mg | BAY 58-2667 . hydrochloride | 646995-35-9 | 1mg |
| GN2518-10mg | Bay 60-7550 | 439083-90-6 | 10mg |
| GN2518-50mg | Bay 60-7550 | 439083-90-6 | 50mg |
| GW9599-1mg | Bayer-18 | 1251752-12-1 | 1mg |
| GW9599-5mg | Bayer-18 | 1251752-12-1 | 5mg |
| GW9599-10mg | Bayer-18 | 1251752-12-1 | 10mg |
| GW8385-1mg | BBT594 | 882405-89-2 | 1mg |
| GW8385-5mg | BBT594 | 882405-89-2 | 5mg |
| GW8385-10mg | BBT594 | 882405-89-2 | 10mg |
| GW9074-1mg | BE-31405 | 158054-02-5 | 1mg |
| GA8043-1mg | Beauvericin | 26048-05-5 | 1mg |
| GA8043-5mg | Beauvericin | 26048-05-5 | 5mg |
| GA2534-250ug | Becatecarin | 119673-08-4 | 250ug |
| GA2534-1mg | Becatecarin | 119673-08-4 | 1mg |
| GP9547-250mg | Beclometasone dipropionate | 5534-09-8 | 250mg |
| GP9547-1g | Beclometasone dipropionate | 5534-09-8 | 1g |
| GP9547-5g | Beclometasone dipropionate | 5534-09-8 | 5g |
| GA1399-25mg | Bedaquiline fumarate | 845533-86-0 | 25mg |
| GA1399-100mg | Bedaquiline fumarate | 845533-86-0 | 100mg |
| GL6346-500ug | Benadrostin | 117241-60-8 | 500ug |
| GL6346-1mg | Benadrostin | 117241-60-8 | 1mg |
| GP6515-250mg | Bendamustine hydrochloride | 3543-75-7 | 250mg |
| GP6515-1g | Bendamustine hydrochloride | 3543-75-7 | 1g |
| GP2430-5g | Benfotamine | 22457-89-2 | 5g |
| GP2430-25g | Benfotamine | 22457-89-2 | 25g |
| GP1567-100mg | Benidipine hydrochloride | 91599-74-5 | 100mg |
| GP1567-250mg | Benidipine hydrochloride | 91599-74-5 | 250mg |
| GP1567-500mg | Benidipine hydrochloride | 91599-74-5 | 500mg |
| GP8450-1g | Benoxinate hydrochloride | 5987-82-6 | 1g |
| GP8450-5g | Benoxinate hydrochloride | 5987-82-6 | 5g |
| GP7664-1g | Benserazide hydrochloride | 14919-77-8 | 1g |
| GP7664-5g | Benserazide hydrochloride | 14919-77-8 | 5g |
| GP7664-10g | Benserazide hydrochloride | 14919-77-8 | 10g |
| GW3290-1mg | Bentamapimod | 848344-36-5 | 1mg |
| GW3290-5mg | Bentamapimod | 848344-36-5 | 5mg |
| GW3290-10mg | Bentamapimod | 848344-36-5 | 10mg |
| GW6316-25mg | Benthiavalicarb-isopropyl | 177406-68-7 | 25mg |
| GW6316-250mg | Benthiavalicarb-isopropyl | 177406-68-7 | 250mg |
| GK5897-100ml | Benzaldehyde | 100-52-7 | 100ml |
| GK5897-250ml | Benzaldehyde | 100-52-7 | 250ml |
| GK5897-500ml | Benzaldehyde | 100-52-7 | 500ml |
| GK5897-1l | Benzaldehyde | 100-52-7 | 1l |
| GK5897-5l | Benzaldehyde | 100-52-7 | 5l |
| GK4276-25g | Benzalkonium chloride | 63449-41-2 | 25g |
| GK4276-100g | Benzalkonium chloride | 63449-41-2 | 100g |
| GK4276-250g | Benzalkonium chloride | 63449-41-2 | 250g |
| GK4276-500g | Benzalkonium chloride | 63449-41-2 | 500g |
| GK4276-1kg | Benzalkonium chloride | 63449-41-2 | 1kg |
| GK7966-100ml | Benzalkonium chloride, 50% solution in water | 63449-41-2 | 100ml |
| GK7966-250ml | Benzalkonium chloride, 50% solution in water | 63449-41-2 | 250ml |
| GK7966-500ml | Benzalkonium chloride, 50% solution in water | 63449-41-2 | 500ml |
| GK7966-1l | Benzalkonium chloride, 50% solution in water | 63449-41-2 | 1l |
| GK7966-2500ml | Benzalkonium chloride, 50% solution in water | 63449-41-2 | 2500ml |
| GL3631-5g | Benzamide | 55-21-0 | 5g |
| GL3631-25g | Benzamide | 55-21-0 | 25g |
| GK9678-5g | Benzamidine hydrochloride hydrate | 206752-36-5 | 5g |
| GK9678-25g | Benzamidine hydrochloride hydrate | 206752-36-5 | 25g |
| GK9678-100g | Benzamidine hydrochloride hydrate | 206752-36-5 | 100g |
| GK9678-250g | Benzamidine hydrochloride hydrate | 206752-36-5 | 250g |
| GP8819-1g | Benzbromarone | 3562-84-3 | 1g |
| GP8819-5g | Benzbromarone | 3562-84-3 | 5g |
| GL0202-100g | Benzenesulfonamide | 98-10-2 | 100g |
| GL0202-250g | Benzenesulfonamide | 98-10-2 | 250g |
| GL0202-500g | Benzenesulfonamide | 98-10-2 | 500g |
| GK6136-100g | Benzethonium chloride | 121-54-0 | 100g |
| GK6136-250g | Benzethonium chloride | 121-54-0 | 250g |
| GK6136-500g | Benzethonium chloride | 121-54-0 | 500g |
| GK2243-25g | Benzhydrol | 91-01-0 | 25g |
| GK7106-25g | Benzil | 134-81-6 | 25g |
| GP2011-25g | Benzocaine | 94-09-7 | 25g |
| GP2011-100g | Benzocaine | 94-09-7 | 100g |
| GP2011-500g | Benzocaine | 94-09-7 | 500g |
| GP2011-1kg | Benzocaine | 94-09-7 | 1kg |
| GC9109-50mg | Benzocaine glucoside | 28315-50-6 | 50mg |
| GC9109-100mg | Benzocaine glucoside | 28315-50-6 | 100mg |
| GC9109-250mg | Benzocaine glucoside | 28315-50-6 | 250mg |
| GC9109-500mg | Benzocaine glucoside | 28315-50-6 | 500mg |
| GC9109-1g | Benzocaine glucoside | 28315-50-6 | 1g |
| GK5967-25g | Benzoic acid | 65-85-0 | 25g |
| GK5967-100g | Benzoic acid | 65-85-0 | 100g |
| GC8363-1mg | Benzoic acid acyl-β-D-glucuronide | 19237-53-7 | 1mg |
| GC8363-2mg | Benzoic acid acyl-β-D-glucuronide | 19237-53-7 | 2mg |
| GC8363-5mg | Benzoic acid acyl-β-D-glucuronide | 19237-53-7 | 5mg |
| GC8363-10mg | Benzoic acid acyl-β-D-glucuronide | 19237-53-7 | 10mg |
| GK1108-100g | Benzoin | 119-53-9 | 100g |
| GK1108-500g | Benzoin | 119-53-9 | 500g |
| GX1471-100g | Benzonitrile | 100-47-0 | 100g |
| GX1471-500g | Benzonitrile | 100-47-0 | 500g |
| GK3488-25g | Benzophenone | 119-61-9 | 25g |
| GK3488-100g | Benzophenone | 119-61-9 | 100g |
| GK5506-5g | Benzophenone oxime | 574-66-3 | 5g |
| GK5506-10g | Benzophenone oxime | 574-66-3 | 10g |
| GK8288-25g | Benzotriazole | 95-14-7 | 25g |
| GK8288-100g | Benzotriazole | 95-14-7 | 100g |
| GK8288-250g | Benzotriazole | 95-14-7 | 250g |
| GK8288-500g | Benzotriazole | 95-14-7 | 500g |
| GE4655-5g | Benzotriazole-1-yl-oxy-tris-pyrrolidino-phosphonium hexafluorophosphate | 128625-52-5 | 5g |
| GE4655-10g | Benzotriazole-1-yl-oxy-tris-pyrrolidino-phosphonium hexafluorophosphate | 128625-52-5 | 10g |
| GE4655-25g | Benzotriazole-1-yl-oxy-tris-pyrrolidino-phosphonium hexafluorophosphate | 128625-52-5 | 25g |
| GE4655-100g | Benzotriazole-1-yl-oxy-tris-pyrrolidino-phosphonium hexafluorophosphate | 128625-52-5 | 100g |
| GK7133-25g | Benzoyl peroxide | 94-36-0 | 25g |
| GC7198-10mg | Benzyl 2-acetamido-2-deoxy-3-O-β-D-galactopyranosyl-α-D-galactopyranoside | 3554-96-9 | 10mg |
| GC7198-25mg | Benzyl 2-acetamido-2-deoxy-3-O-β-D-galactopyranosyl-α-D-galactopyranoside | 3554-96-9 | 25mg |
| GC7198-50mg | Benzyl 2-acetamido-2-deoxy-3-O-β-D-galactopyranosyl-α-D-galactopyranoside | 3554-96-9 | 50mg |
| GC7198-100mg | Benzyl 2-acetamido-2-deoxy-3-O-β-D-galactopyranosyl-α-D-galactopyranoside | 3554-96-9 | 100mg |
| GC3510-100mg | Benzyl 2-acetamido-2-deoxy-3,6-di-O-benzyl-β-D-glucopyranoside | 62867-63-4 | 100mg |
| GC3510-250mg | Benzyl 2-acetamido-2-deoxy-3,6-di-O-benzyl-β-D-glucopyranoside | 62867-63-4 | 250mg |
| GC3510-500mg | Benzyl 2-acetamido-2-deoxy-3,6-di-O-benzyl-β-D-glucopyranoside | 62867-63-4 | 500mg |
| GC3510-1g | Benzyl 2-acetamido-2-deoxy-3,6-di-O-benzyl-β-D-glucopyranoside | 62867-63-4 | 1g |
| GC3736-250mg | Benzyl 2-acetamido-2-deoxy-4,6-O-isopropylidene-a-D-glucopyranoside | 66026-10-6 | 250mg |
| GC3736-500mg | Benzyl 2-acetamido-2-deoxy-4,6-O-isopropylidene-a-D-glucopyranoside | 66026-10-6 | 500mg |
| GC3736-1g | Benzyl 2-acetamido-2-deoxy-4,6-O-isopropylidene-a-D-glucopyranoside | 66026-10-6 | 1g |
| GC3736-2g | Benzyl 2-acetamido-2-deoxy-4,6-O-isopropylidene-a-D-glucopyranoside | 66026-10-6 | 2g |
| GC9798-500mg | Benzyl 2-acetamido-2-deoxy-4,6-O-isopropylidene-b-D-glucopyranoside | 50605-12-4 | 500mg |
| GC9798-1g | Benzyl 2-acetamido-2-deoxy-4,6-O-isopropylidene-b-D-glucopyranoside | 50605-12-4 | 1g |
| GC9798-2g | Benzyl 2-acetamido-2-deoxy-4,6-O-isopropylidene-b-D-glucopyranoside | 50605-12-4 | 2g |
| GC9798-5g | Benzyl 2-acetamido-2-deoxy-4,6-O-isopropylidene-b-D-glucopyranoside | 50605-12-4 | 5g |
| GC9798-10g | Benzyl 2-acetamido-2-deoxy-4,6-O-isopropylidene-b-D-glucopyranoside | 50605-12-4 | 10g |
| GC3861-1g | Benzyl 2-acetamido-2-deoxy-α-D-glucopyranoside | 13343-62-9 | 1g |
| GC3861-2g | Benzyl 2-acetamido-2-deoxy-α-D-glucopyranoside | 13343-62-9 | 2g |
| GC3861-5g | Benzyl 2-acetamido-2-deoxy-α-D-glucopyranoside | 13343-62-9 | 5g |
| GC3861-10g | Benzyl 2-acetamido-2-deoxy-α-D-glucopyranoside | 13343-62-9 | 10g |
| GC3861-25g | Benzyl 2-acetamido-2-deoxy-α-D-glucopyranoside | 13343-62-9 | 25g |
| GC3420-500mg | Benzyl 2-acetamido-2-deoxy-β-D-glucopyranoside | 13343-67-4 | 500mg |
| GC3420-1g | Benzyl 2-acetamido-2-deoxy-β-D-glucopyranoside | 13343-67-4 | 1g |
| GC3420-2g | Benzyl 2-acetamido-2-deoxy-β-D-glucopyranoside | 13343-67-4 | 2g |
| GC3420-5g | Benzyl 2-acetamido-2-deoxy-β-D-glucopyranoside | 13343-67-4 | 5g |
| GC1254-100mg | Benzyl 2-acetamido-3-O-acetyl-4,6-O-benzylidene-2-deoxy-α-D-glucopyranoside | 13343-64-1 | 100mg |
| GC1254-250mg | Benzyl 2-acetamido-3-O-acetyl-4,6-O-benzylidene-2-deoxy-α-D-glucopyranoside | 13343-64-1 | 250mg |
| GC1254-500mg | Benzyl 2-acetamido-3-O-acetyl-4,6-O-benzylidene-2-deoxy-α-D-glucopyranoside | 13343-64-1 | 500mg |
| GC1254-1g | Benzyl 2-acetamido-3-O-acetyl-4,6-O-benzylidene-2-deoxy-α-D-glucopyranoside | 13343-64-1 | 1g |
| GC1718-50mg | Benzyl 2-acetamido-3-O-acetyl-6-O-benzyl-2-deoxy-α-D-glucopyranoside | 204511-04-6 | 50mg |
| GC1718-100mg | Benzyl 2-acetamido-3-O-acetyl-6-O-benzyl-2-deoxy-α-D-glucopyranoside | 204511-04-6 | 100mg |
| GC1718-250mg | Benzyl 2-acetamido-3-O-acetyl-6-O-benzyl-2-deoxy-α-D-glucopyranoside | 204511-04-6 | 250mg |
| GC1718-500mg | Benzyl 2-acetamido-3-O-acetyl-6-O-benzyl-2-deoxy-α-D-glucopyranoside | 204511-04-6 | 500mg |
| GC1718-1g | Benzyl 2-acetamido-3-O-acetyl-6-O-benzyl-2-deoxy-α-D-glucopyranoside | 204511-04-6 | 1g |
| GC1619-250mg | Benzyl 2-acetamido-3,4-di-O-acetyl-2-deoxy-α-D-glucopyranoside | 33401-01-3 | 250mg |
| GC1619-500mg | Benzyl 2-acetamido-3,4-di-O-acetyl-2-deoxy-α-D-glucopyranoside | 33401-01-3 | 500mg |
| GC1619-1g | Benzyl 2-acetamido-3,4-di-O-acetyl-2-deoxy-α-D-glucopyranoside | 33401-01-3 | 1g |
| GC1619-2g | Benzyl 2-acetamido-3,4-di-O-acetyl-2-deoxy-α-D-glucopyranoside | 33401-01-3 | 2g |
| GC9130-100mg | Benzyl 2-acetamido-3,4-di-O-benzyl-2-deoxy-α-D-glucopyranoside | 55287-54-2 | 100mg |
| GC9130-250mg | Benzyl 2-acetamido-3,4-di-O-benzyl-2-deoxy-α-D-glucopyranoside | 55287-54-2 | 250mg |
| GC9130-500mg | Benzyl 2-acetamido-3,4-di-O-benzyl-2-deoxy-α-D-glucopyranoside | 55287-54-2 | 500mg |
| GC9130-1g | Benzyl 2-acetamido-3,4-di-O-benzyl-2-deoxy-α-D-glucopyranoside | 55287-54-2 | 1g |
| GC8758-1g | Benzyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranoside | 13343-66-3 | 1g |
| GC8758-2g | Benzyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranoside | 13343-66-3 | 2g |
| GC8758-5g | Benzyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranoside | 13343-66-3 | 5g |
| GC8758-10g | Benzyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranoside | 13343-66-3 | 10g |
| GC5472-25mg | Benzyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-α-D-galactopyranoside | 141019-71-8 | 25mg |
| GC5472-50mg | Benzyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-α-D-galactopyranoside | 141019-71-8 | 50mg |
| GC5472-100mg | Benzyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-α-D-galactopyranoside | 141019-71-8 | 100mg |
| GC5472-250mg | Benzyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-α-D-galactopyranoside | 141019-71-8 | 250mg |
| GC5472-500mg | Benzyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-α-D-galactopyranoside | 141019-71-8 | 500mg |
| GC8179-1g | Benzyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-galactopyranoside | 41355-94-6 | 1g |
| GC8179-2g | Benzyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-galactopyranoside | 41355-94-6 | 2g |
| GC8179-5g | Benzyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-galactopyranoside | 41355-94-6 | 5g |
| GC8179-10g | Benzyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-galactopyranoside | 41355-94-6 | 10g |
| GC1709-1g | Benzyl 2-acetamido-4,6-O-benzylidene-2-deoxy-α-D-glucopyranoside | 13343-63-0 | 1g |
| GC1709-2g | Benzyl 2-acetamido-4,6-O-benzylidene-2-deoxy-α-D-glucopyranoside | 13343-63-0 | 2g |
| GC1709-5g | Benzyl 2-acetamido-4,6-O-benzylidene-2-deoxy-α-D-glucopyranoside | 13343-63-0 | 5g |
| GC1709-10g | Benzyl 2-acetamido-4,6-O-benzylidene-2-deoxy-α-D-glucopyranoside | 13343-63-0 | 10g |
| GC1709-25g | Benzyl 2-acetamido-4,6-O-benzylidene-2-deoxy-α-D-glucopyranoside | 13343-63-0 | 25g |
| GC6994-25mg | Benzyl 2-acetamido-6-O-benzyl-2-deoxy-4-O-β-D-galactopyranosyl-α-D-glucopyranoside | 25mg | |
| GC6994-50mg | Benzyl 2-acetamido-6-O-benzyl-2-deoxy-4-O-β-D-galactopyranosyl-α-D-glucopyranoside | 50mg | |
| GC6994-100mg | Benzyl 2-acetamido-6-O-benzyl-2-deoxy-4-O-β-D-galactopyranosyl-α-D-glucopyranoside | 100mg | |
| GC6994-250mg | Benzyl 2-acetamido-6-O-benzyl-2-deoxy-4-O-β-D-galactopyranosyl-α-D-glucopyranoside | 250mg | |
| GC3989-1g | Benzyl 2-deoxy-2-phthalimido-3,4,6-tri-O-acetyl-β-D-glucopyranoside | 80035-31-0 | 1g |
| GC3989-2g | Benzyl 2-deoxy-2-phthalimido-3,4,6-tri-O-acetyl-β-D-glucopyranoside | 80035-31-0 | 2g |
| GC3989-5g | Benzyl 2-deoxy-2-phthalimido-3,4,6-tri-O-acetyl-β-D-glucopyranoside | 80035-31-0 | 5g |
| GC3989-10g | Benzyl 2-deoxy-2-phthalimido-3,4,6-tri-O-acetyl-β-D-glucopyranoside | 80035-31-0 | 10g |
| GC4482-1g | Benzyl 2-deoxy-2-phthalimido-4,6-O-benzylidene-β-D-glucopyranoside | 80035-33-2 | 1g |
| GC4482-2g | Benzyl 2-deoxy-2-phthalimido-4,6-O-benzylidene-β-D-glucopyranoside | 80035-33-2 | 2g |
| GC4482-5g | Benzyl 2-deoxy-2-phthalimido-4,6-O-benzylidene-β-D-glucopyranoside | 80035-33-2 | 5g |
| GC4482-10g | Benzyl 2-deoxy-2-phthalimido-4,6-O-benzylidene-β-D-glucopyranoside | 80035-33-2 | 10g |
| GC6228-500mg | Benzyl 2-deoxy-2-phthalimido-β-D-glucopyranoside | 80035-32-1 | 500mg |
| GC6228-1g | Benzyl 2-deoxy-2-phthalimido-β-D-glucopyranoside | 80035-32-1 | 1g |
| GC6228-2g | Benzyl 2-deoxy-2-phthalimido-β-D-glucopyranoside | 80035-32-1 | 2g |
| GC6228-5g | Benzyl 2-deoxy-2-phthalimido-β-D-glucopyranoside | 80035-32-1 | 5g |
| GC7555-500mg | Benzyl 2-O-tosyl-β-D-arabinopyranoside | 31079-87-5 | 500mg |
| GC7555-1g | Benzyl 2-O-tosyl-β-D-arabinopyranoside | 31079-87-5 | 1g |
| GC7555-2g | Benzyl 2-O-tosyl-β-D-arabinopyranoside | 31079-87-5 | 2g |
| GC7555-5g | Benzyl 2-O-tosyl-β-D-arabinopyranoside | 31079-87-5 | 5g |
| GC9059-100mg | Benzyl 2,2'',3,3'',6-penta-O-acetyl-4'',6''-O-benzylidene-β-D-lactoside | 68115-82-2 | 100mg |
| GC9059-250mg | Benzyl 2,2'',3,3'',6-penta-O-acetyl-4'',6''-O-benzylidene-β-D-lactoside | 68115-82-2 | 250mg |
| GC9059-500mg | Benzyl 2,2'',3,3'',6-penta-O-acetyl-4'',6''-O-benzylidene-β-D-lactoside | 68115-82-2 | 500mg |
| GC9059-1g | Benzyl 2,2'',3,3'',6-penta-O-acetyl-4'',6''-O-benzylidene-β-D-lactoside | 68115-82-2 | 1g |
| GC9059-2g | Benzyl 2,2'',3,3'',6-penta-O-acetyl-4'',6''-O-benzylidene-β-D-lactoside | 68115-82-2 | 2g |
| GC8540-50mg | Benzyl 2,3-anhydro-4-O-benzyl-β-D-ribopyranoside | 76490-96-5 | 50mg |
| GC8540-100mg | Benzyl 2,3-anhydro-4-O-benzyl-β-D-ribopyranoside | 76490-96-5 | 100mg |
| GC8540-250mg | Benzyl 2,3-anhydro-4-O-benzyl-β-D-ribopyranoside | 76490-96-5 | 250mg |
| GC8540-500mg | Benzyl 2,3-anhydro-4-O-benzyl-β-D-ribopyranoside | 76490-96-5 | 500mg |
| GC5854-25mg | Benzyl 2,3-anhydro-4-O-β-D-xylopyranosyl-β-D-ribopyranoside | 69932-61-2 | 25mg |
| GC5854-50mg | Benzyl 2,3-anhydro-4-O-β-D-xylopyranosyl-β-D-ribopyranoside | 69932-61-2 | 50mg |
| GC5854-100mg | Benzyl 2,3-anhydro-4-O-β-D-xylopyranosyl-β-D-ribopyranoside | 69932-61-2 | 100mg |
| GC5854-250mg | Benzyl 2,3-anhydro-4-O-β-D-xylopyranosyl-β-D-ribopyranoside | 69932-61-2 | 250mg |
| GC8866-25mg | Benzyl 2,3-anhydro-4-O-β-D-xylopyranosyl-β-D-ribopyranoside triacetate | 70751-52-9 | 25mg |
| GC8866-50mg | Benzyl 2,3-anhydro-4-O-β-D-xylopyranosyl-β-D-ribopyranoside triacetate | 70751-52-9 | 50mg |
| GC8866-100mg | Benzyl 2,3-anhydro-4-O-β-D-xylopyranosyl-β-D-ribopyranoside triacetate | 70751-52-9 | 100mg |
| GC8866-250mg | Benzyl 2,3-anhydro-4-O-β-D-xylopyranosyl-β-D-ribopyranoside triacetate | 70751-52-9 | 250mg |
| GC8866-500mg | Benzyl 2,3-anhydro-4-O-β-D-xylopyranosyl-β-D-ribopyranoside triacetate | 70751-52-9 | 500mg |
| GC7844-50mg | Benzyl 2,3-anhydro-β-D-ribopyranoside | 67412-71-9 | 50mg |
| GC7844-100mg | Benzyl 2,3-anhydro-β-D-ribopyranoside | 67412-71-9 | 100mg |
| GC7844-250mg | Benzyl 2,3-anhydro-β-D-ribopyranoside | 67412-71-9 | 250mg |
| GC7844-500mg | Benzyl 2,3-anhydro-β-D-ribopyranoside | 67412-71-9 | 500mg |
| GC5434-1g | Benzyl 2,3-di-O-acetyl-4,6-O-benzylidene-α-D-mannopyranoside | 1g | |
| GC5434-2g | Benzyl 2,3-di-O-acetyl-4,6-O-benzylidene-α-D-mannopyranoside | 2g | |
| GC5434-5g | Benzyl 2,3-di-O-acetyl-4,6-O-benzylidene-α-D-mannopyranoside | 5g | |
| GC5434-10g | Benzyl 2,3-di-O-acetyl-4,6-O-benzylidene-α-D-mannopyranoside | 10g | |
| GC5829-1g | Benzyl 2,3-di-O-acetyl-4,6-O-benzylidene-β-D-glucopyranoside | 22893-77-2 | 1g |
| GC5829-2g | Benzyl 2,3-di-O-acetyl-4,6-O-benzylidene-β-D-glucopyranoside | 22893-77-2 | 2g |
| GC5829-5g | Benzyl 2,3-di-O-acetyl-4,6-O-benzylidene-β-D-glucopyranoside | 22893-77-2 | 5g |
| GC5829-10g | Benzyl 2,3-di-O-acetyl-4,6-O-benzylidene-β-D-glucopyranoside | 22893-77-2 | 10g |
| GC0482-50mg | Benzyl 2,3-di-O-benzyl-4-O-methyl-β-D-glucopyranosiduronic acid benzyl ester | 50mg | |
| GC0482-100mg | Benzyl 2,3-di-O-benzyl-4-O-methyl-β-D-glucopyranosiduronic acid benzyl ester | 100mg | |
| GC0482-250mg | Benzyl 2,3-di-O-benzyl-4-O-methyl-β-D-glucopyranosiduronic acid benzyl ester | 250mg | |
| GC0482-500mg | Benzyl 2,3-di-O-benzyl-4-O-methyl-β-D-glucopyranosiduronic acid benzyl ester | 500mg | |
| GC3659-250mg | Benzyl 2,3-di-O-benzyl-4,6-O-benzylidene-β-D-glucopyranoside | 57783-66-1 | 250mg |
| GC3659-500mg | Benzyl 2,3-di-O-benzyl-4,6-O-benzylidene-β-D-glucopyranoside | 57783-66-1 | 500mg |
| GC3659-1g | Benzyl 2,3-di-O-benzyl-4,6-O-benzylidene-β-D-glucopyranoside | 57783-66-1 | 1g |
| GC3659-2g | Benzyl 2,3-di-O-benzyl-4,6-O-benzylidene-β-D-glucopyranoside | 57783-66-1 | 2g |
| GC5678-100mg | Benzyl 2,3-di-O-benzyl-β-D-glucopyranoside | 67831-41-8 | 100mg |
| GC5678-250mg | Benzyl 2,3-di-O-benzyl-β-D-glucopyranoside | 67831-41-8 | 250mg |
| GC5678-500mg | Benzyl 2,3-di-O-benzyl-β-D-glucopyranoside | 67831-41-8 | 500mg |
| GC5678-1g | Benzyl 2,3-di-O-benzyl-β-D-glucopyranoside | 67831-41-8 | 1g |
| GC5678-2g | Benzyl 2,3-di-O-benzyl-β-D-glucopyranoside | 67831-41-8 | 2g |
| GC4013-100mg | Benzyl 2,3-O-isopropylidene-6-O-tosyl-α-L-sorbofuranoside | 1459288-93-7 | 100mg |
| GC4013-250mg | Benzyl 2,3-O-isopropylidene-6-O-tosyl-α-L-sorbofuranoside | 1459288-93-7 | 250mg |
| GC4013-500mg | Benzyl 2,3-O-isopropylidene-6-O-tosyl-α-L-sorbofuranoside | 1459288-93-7 | 500mg |
| GC4013-1g | Benzyl 2,3-O-isopropylidene-6-O-tosyl-α-L-sorbofuranoside | 1459288-93-7 | 1g |
| GC4371-100mg | Benzyl 2,3-O-isopropylidene-α-D-erythrofuranoside | 100mg | |
| GC4371-250mg | Benzyl 2,3-O-isopropylidene-α-D-erythrofuranoside | 250mg | |
| GC4371-500mg | Benzyl 2,3-O-isopropylidene-α-D-erythrofuranoside | 500mg | |
| GC4371-1g | Benzyl 2,3-O-isopropylidene-α-D-erythrofuranoside | 1g | |
| GC1773-1g | Benzyl 2,3-O-isopropylidene-α-D-mannofuranoside | 20689-03-6 | 1g |
| GC1773-2g | Benzyl 2,3-O-isopropylidene-α-D-mannofuranoside | 20689-03-6 | 2g |
| GC1773-5g | Benzyl 2,3-O-isopropylidene-α-D-mannofuranoside | 20689-03-6 | 5g |
| GC1773-10g | Benzyl 2,3-O-isopropylidene-α-D-mannofuranoside | 20689-03-6 | 10g |
| GC9072-500mg | Benzyl 2,3-O-isopropylidene-β-D-erythrofuranoside | 1932192-99-8 | 500mg |
| GC9072-1g | Benzyl 2,3-O-isopropylidene-β-D-erythrofuranoside | 1932192-99-8 | 1g |
| GC9072-2g | Benzyl 2,3-O-isopropylidene-β-D-erythrofuranoside | 1932192-99-8 | 2g |
| GC9072-5g | Benzyl 2,3-O-isopropylidene-β-D-erythrofuranoside | 1932192-99-8 | 5g |
| GC3906-100mg | Benzyl 2,3,4-tri-O-benzyl-α-D-mannopyranoside | 57783-76-3 | 100mg |
| GC3906-250mg | Benzyl 2,3,4-tri-O-benzyl-α-D-mannopyranoside | 57783-76-3 | 250mg |
| GC3906-500mg | Benzyl 2,3,4-tri-O-benzyl-α-D-mannopyranoside | 57783-76-3 | 500mg |
| GC3906-1g | Benzyl 2,3,4-tri-O-benzyl-α-D-mannopyranoside | 57783-76-3 | 1g |
| GC3291-250mg | Benzyl 2,3,4-tri-O-benzyl-β-D-galactopyranoside | 35017-04-0 | 250mg |
| GC3291-500mg | Benzyl 2,3,4-tri-O-benzyl-β-D-galactopyranoside | 35017-04-0 | 500mg |
| GC3291-1g | Benzyl 2,3,4-tri-O-benzyl-β-D-galactopyranoside | 35017-04-0 | 1g |
| GC3291-2g | Benzyl 2,3,4-tri-O-benzyl-β-D-galactopyranoside | 35017-04-0 | 2g |
| GC2972-50mg | Benzyl 2,3,4-tri-O-benzyl-β-D-glucopyranoside | 27851-29-2 | 50mg |
| GC2972-100mg | Benzyl 2,3,4-tri-O-benzyl-β-D-glucopyranoside | 27851-29-2 | 100mg |
| GC2972-250mg | Benzyl 2,3,4-tri-O-benzyl-β-D-glucopyranoside | 27851-29-2 | 250mg |
| GC2972-500mg | Benzyl 2,3,4-tri-O-benzyl-β-D-glucopyranoside | 27851-29-2 | 500mg |
| GC2551-250mg | Benzyl 2,3,4,6-tetra-O-acetyl-β-D-galactopyranoside | 83113-54-6 | 250mg |
| GC2551-500mg | Benzyl 2,3,4,6-tetra-O-acetyl-β-D-galactopyranoside | 83113-54-6 | 500mg |
| GC2551-1g | Benzyl 2,3,4,6-tetra-O-acetyl-β-D-galactopyranoside | 83113-54-6 | 1g |
| GC2551-2g | Benzyl 2,3,4,6-tetra-O-acetyl-β-D-galactopyranoside | 83113-54-6 | 2g |
| GC4665-1g | Benzyl 2,3,4,6-tetra-O-acetyl-β-D-Glucopyranoside | 10343-13-2 | 1g |
| GC4665-2g | Benzyl 2,3,4,6-tetra-O-acetyl-β-D-Glucopyranoside | 10343-13-2 | 2g |
| GC4665-5g | Benzyl 2,3,4,6-tetra-O-acetyl-β-D-Glucopyranoside | 10343-13-2 | 5g |
| GC4665-10g | Benzyl 2,3,4,6-tetra-O-acetyl-β-D-Glucopyranoside | 10343-13-2 | 10g |
| GC5736-250mg | Benzyl 2,3:4,6-di-O-isopropylidene-α-L-sorbofuranoside | 74342-16-8 | 250mg |
| GC5736-500mg | Benzyl 2,3:4,6-di-O-isopropylidene-α-L-sorbofuranoside | 74342-16-8 | 500mg |
| GC5736-1g | Benzyl 2,3:4,6-di-O-isopropylidene-α-L-sorbofuranoside | 74342-16-8 | 1g |
| GC5736-2g | Benzyl 2,3:4,6-di-O-isopropylidene-α-L-sorbofuranoside | 74342-16-8 | 2g |
| GC8598-2g | Benzyl 2,3:5,6-Di-O-isopropylidene-α-D-mannofuranoside | 20689-02-5 | 2g |
| GC8598-5g | Benzyl 2,3:5,6-Di-O-isopropylidene-α-D-mannofuranoside | 20689-02-5 | 5g |
| GC8598-10g | Benzyl 2,3:5,6-Di-O-isopropylidene-α-D-mannofuranoside | 20689-02-5 | 10g |
| GC0595-250mg | Benzyl 2,6-di-O-acetyl-3,4-O-isopropylidene-β-D-galactopyranoside | 16741-10-9 | 250mg |
| GC0595-500mg | Benzyl 2,6-di-O-acetyl-3,4-O-isopropylidene-β-D-galactopyranoside | 16741-10-9 | 500mg |
| GC0595-1g | Benzyl 2,6-di-O-acetyl-3,4-O-isopropylidene-β-D-galactopyranoside | 16741-10-9 | 1g |
| GC0595-2g | Benzyl 2,6-di-O-acetyl-3,4-O-isopropylidene-β-D-galactopyranoside | 16741-10-9 | 2g |
| GC6574-250mg | Benzyl 2,6-di-O-acetyl-β-D-galactopyranoside | 16471-10-9 | 250mg |
| GC6574-500mg | Benzyl 2,6-di-O-acetyl-β-D-galactopyranoside | 16471-10-9 | 500mg |
| GC6574-1g | Benzyl 2,6-di-O-acetyl-β-D-galactopyranoside | 16471-10-9 | 1g |
| GC6574-2g | Benzyl 2,6-di-O-acetyl-β-D-galactopyranoside | 16471-10-9 | 2g |
| GC2050-250mg | Benzyl 2,6-di-O-benzyl-β-D-galactopyranoside | 73108-30-2 | 250mg |
| GC2050-500mg | Benzyl 2,6-di-O-benzyl-β-D-galactopyranoside | 73108-30-2 | 500mg |
| GC2050-1g | Benzyl 2,6-di-O-benzyl-β-D-galactopyranoside | 73108-30-2 | 1g |
| GC2050-2g | Benzyl 2,6-di-O-benzyl-β-D-galactopyranoside | 73108-30-2 | 2g |
| GC5116-100mg | Benzyl 3-O-allyl-2-O-benzyl-4,6-O-benzylidene-β-D-glucopyranoside | 103188-94-9 | 100mg |
| GC5116-250mg | Benzyl 3-O-allyl-2-O-benzyl-4,6-O-benzylidene-β-D-glucopyranoside | 103188-94-9 | 250mg |
| GC5116-500mg | Benzyl 3-O-allyl-2-O-benzyl-4,6-O-benzylidene-β-D-glucopyranoside | 103188-94-9 | 500mg |
| GC5116-1g | Benzyl 3-O-allyl-2-O-benzyl-4,6-O-benzylidene-β-D-glucopyranoside | 103188-94-9 | 1g |
| GC4481-250mg | Benzyl 3-O-allyl-2-O-benzyl-β-D-glucopyranoside | 250mg | |
| GC4481-500mg | Benzyl 3-O-allyl-2-O-benzyl-β-D-glucopyranoside | 500mg | |
| GC4481-1g | Benzyl 3-O-allyl-2-O-benzyl-β-D-glucopyranoside | 1g | |
| GC4481-2g | Benzyl 3-O-allyl-2-O-benzyl-β-D-glucopyranoside | 2g | |
| GC4481-5g | Benzyl 3-O-allyl-2-O-benzyl-β-D-glucopyranoside | 5g | |
| GC9199-250mg | Benzyl 3-O-allyl-4,6-O-benzylidene-β-D-glucopyranoside | 103078-11-1 | 250mg |
| GC9199-500mg | Benzyl 3-O-allyl-4,6-O-benzylidene-β-D-glucopyranoside | 103078-11-1 | 500mg |
| GC9199-1g | Benzyl 3-O-allyl-4,6-O-benzylidene-β-D-glucopyranoside | 103078-11-1 | 1g |
| GC9199-2g | Benzyl 3-O-allyl-4,6-O-benzylidene-β-D-glucopyranoside | 103078-11-1 | 2g |
| GC8780-1g | Benzyl 3-O-allyl-β-D-glucopyranoside | 103130-09-2 | 1g |
| GC8780-2g | Benzyl 3-O-allyl-β-D-glucopyranoside | 103130-09-2 | 2g |
| GC8780-5g | Benzyl 3-O-allyl-β-D-glucopyranoside | 103130-09-2 | 5g |
| GC8780-10g | Benzyl 3-O-allyl-β-D-glucopyranoside | 103130-09-2 | 10g |
| GC8385-1g | Benzyl 3,4-di-O-acetyl-2-deoxy-2-phthalimido-6-O-trityl-β-D-glucopyranoside | 85065-34-5 | 1g |
| GC8385-2g | Benzyl 3,4-di-O-acetyl-2-deoxy-2-phthalimido-6-O-trityl-β-D-glucopyranoside | 85065-34-5 | 2g |
| GC8385-5g | Benzyl 3,4-di-O-acetyl-2-deoxy-2-phthalimido-6-O-trityl-β-D-glucopyranoside | 85065-34-5 | 5g |
| GC8385-10g | Benzyl 3,4-di-O-acetyl-2-deoxy-2-phthalimido-6-O-trityl-β-D-glucopyranoside | 85065-34-5 | 10g |
| GC5245-250mg | Benzyl 3,4-O-isopropylidene-6-tosyl-β-D-galactopyranoside | 167013-75-4 | 250mg |
| GC5245-500mg | Benzyl 3,4-O-isopropylidene-6-tosyl-β-D-galactopyranoside | 167013-75-4 | 500mg |
| GC5245-1g | Benzyl 3,4-O-isopropylidene-6-tosyl-β-D-galactopyranoside | 167013-75-4 | 1g |
| GC5245-2g | Benzyl 3,4-O-isopropylidene-6-tosyl-β-D-galactopyranoside | 167013-75-4 | 2g |
| GC1508-500mg | Benzyl 3,4-O-isopropylidene-β-D-arabinopyranoside | 6336-16-9 | 500mg |
| GC1508-1g | Benzyl 3,4-O-isopropylidene-β-D-arabinopyranoside | 6336-16-9 | 1g |
| GC1508-2g | Benzyl 3,4-O-isopropylidene-β-D-arabinopyranoside | 6336-16-9 | 2g |
| GC1508-5g | Benzyl 3,4-O-isopropylidene-β-D-arabinopyranoside | 6336-16-9 | 5g |
| GC2012-500mg | Benzyl 3,4-O-isopropylidene-β-D-galactopyranoside | 14897-51-9 | 500mg |
| GC2012-1g | Benzyl 3,4-O-isopropylidene-β-D-galactopyranoside | 14897-51-9 | 1g |
| GC2012-2g | Benzyl 3,4-O-isopropylidene-β-D-galactopyranoside | 14897-51-9 | 2g |
| GC2012-5g | Benzyl 3,4-O-isopropylidene-β-D-galactopyranoside | 14897-51-9 | 5g |
| GC8326-100mg | Benzyl 4-O-benzyl-β-D-glucopyranoside | 69492-35-9 | 100mg |
| GC8326-250mg | Benzyl 4-O-benzyl-β-D-glucopyranoside | 69492-35-9 | 250mg |
| GC8326-500mg | Benzyl 4-O-benzyl-β-D-glucopyranoside | 69492-35-9 | 500mg |
| GC8326-1g | Benzyl 4-O-benzyl-β-D-glucopyranoside | 69492-35-9 | 1g |
| GC0395-1g | Benzyl 4,6-O-benzylidene-α-D-mannopyranoside | 40983-94-6 | 1g |
| GC0395-2g | Benzyl 4,6-O-benzylidene-α-D-mannopyranoside | 40983-94-6 | 2g |
| GC0395-5g | Benzyl 4,6-O-benzylidene-α-D-mannopyranoside | 40983-94-6 | 5g |
| GC0395-10g | Benzyl 4,6-O-benzylidene-α-D-mannopyranoside | 40983-94-6 | 10g |
| GC7543-500mg | Benzyl 4,6-O-benzylidene-β-D-glucopyranoside | 58006-32-9 | 500mg |
| GC7543-1g | Benzyl 4,6-O-benzylidene-β-D-glucopyranoside | 58006-32-9 | 1g |
| GC7543-2g | Benzyl 4,6-O-benzylidene-β-D-glucopyranoside | 58006-32-9 | 2g |
| GC7543-5g | Benzyl 4,6-O-benzylidene-β-D-glucopyranoside | 58006-32-9 | 5g |
| GC7543-10g | Benzyl 4,6-O-benzylidene-β-D-glucopyranoside | 58006-32-9 | 10g |
| GC1499-1g | Benzyl 6-O-trityl-α-D-mannopyranoside | 77455-30-2 | 1g |
| GC1499-2g | Benzyl 6-O-trityl-α-D-mannopyranoside | 77455-30-2 | 2g |
| GC1499-5g | Benzyl 6-O-trityl-α-D-mannopyranoside | 77455-30-2 | 5g |
| GC1499-10g | Benzyl 6-O-trityl-α-D-mannopyranoside | 77455-30-2 | 10g |
| GC7422-1g | Benzyl a-D-mannopyranoside | 15548-45-5 | 1g |
| GC7422-2g | Benzyl a-D-mannopyranoside | 15548-45-5 | 2g |
| GC7422-5g | Benzyl a-D-mannopyranoside | 15548-45-5 | 5g |
| GC7422-10g | Benzyl a-D-mannopyranoside | 15548-45-5 | 10g |
| GK3443-250g | Benzyl alcohol | 100-51-6 | 250g |
| GK3443-500g | Benzyl alcohol | 100-51-6 | 500g |
| GK3443-1kg | Benzyl alcohol | 100-51-6 | 1kg |
| GK3443-5kg | Benzyl alcohol | 100-51-6 | 5kg |
| GC6168-500mg | Benzyl b-D-glucopyranoside | 4304-12-5 | 500mg |
| GC6168-1g | Benzyl b-D-glucopyranoside | 4304-12-5 | 1g |
| GC6168-2g | Benzyl b-D-glucopyranoside | 4304-12-5 | 2g |
| GC6168-5g | Benzyl b-D-glucopyranoside | 4304-12-5 | 5g |
| GC6168-10g | Benzyl b-D-glucopyranoside | 4304-12-5 | 10g |
| GK8148-100ml | Benzyl benzoate | 120-51-4 | 100ml |
| GK8148-500ml | Benzyl benzoate | 120-51-4 | 500ml |
| GK8148-1l | Benzyl benzoate | 120-51-4 | 1l |
| GK8148-5l | Benzyl benzoate | 120-51-4 | 5l |
| GK6722-250ml | Benzyl benzoate, BP, Ph. Eur. grade | 120-51-4 | 250ml |
| GK6722-1l | Benzyl benzoate, BP, Ph. Eur. grade | 120-51-4 | 1l |
| GL2673-5g | Benzyl isothiocyanate | 622-78-6 | 5g |
| GX1705-25g | Benzyl nicotinate | 94-44-0 | 25g |
| GX1705-100g | Benzyl nicotinate | 94-44-0 | 100g |
| GX1705-250g | Benzyl nicotinate | 94-44-0 | 250g |
| GK7651-100g | Benzyl salicylate | 118-58-1 | 100g |
| GK7651-500g | Benzyl salicylate | 118-58-1 | 500g |
| GK7651-1kg | Benzyl salicylate | 118-58-1 | 1kg |
| GX3091-25g | Benzyl triphenyl phosphonium bromide | 1449-46-3 | 25g |
| GX3091-100g | Benzyl triphenyl phosphonium bromide | 1449-46-3 | 100g |
| GC6185-50mg | Benzyl α-D-erythrofuranoside | 82883-31-6 | 50mg |
| GC6185-100mg | Benzyl α-D-erythrofuranoside | 82883-31-6 | 100mg |
| GC6185-250mg | Benzyl α-D-erythrofuranoside | 82883-31-6 | 250mg |
| GC6185-500mg | Benzyl α-D-erythrofuranoside | 82883-31-6 | 500mg |
| GC5315-1g | Benzyl β-D-arabinopyranoside | 5329-50-0 | 1g |
| GC5315-2g | Benzyl β-D-arabinopyranoside | 5329-50-0 | 2g |
| GC5315-5g | Benzyl β-D-arabinopyranoside | 5329-50-0 | 5g |
| GC5315-10g | Benzyl β-D-arabinopyranoside | 5329-50-0 | 10g |
| GC4129-100mg | Benzyl β-D-erythrofuranoside | 82883-32-7 | 100mg |
| GC4129-250mg | Benzyl β-D-erythrofuranoside | 82883-32-7 | 250mg |
| GC4129-500mg | Benzyl β-D-erythrofuranoside | 82883-32-7 | 500mg |
| GC4129-1g | Benzyl β-D-erythrofuranoside | 82883-32-7 | 1g |
| GC1553-25mg | Benzyl β-D-xylobioside | 75736-87-7 | 25mg |
| GC1553-50mg | Benzyl β-D-xylobioside | 75736-87-7 | 50mg |
| GC1553-100mg | Benzyl β-D-xylobioside | 75736-87-7 | 100mg |
| GC1553-250mg | Benzyl β-D-xylobioside | 75736-87-7 | 250mg |
| GC3700-25mg | Benzyl β-D-xylobioside pentaacetate | 72661-85-9 | 25mg |
| GC3700-50mg | Benzyl β-D-xylobioside pentaacetate | 72661-85-9 | 50mg |
| GC3700-100mg | Benzyl β-D-xylobioside pentaacetate | 72661-85-9 | 100mg |
| GC3700-250mg | Benzyl β-D-xylobioside pentaacetate | 72661-85-9 | 250mg |
| GC3700-500mg | Benzyl β-D-xylobioside pentaacetate | 72661-85-9 | 500mg |
| GC4752-1mg | Benzyl-13C6 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-α-D-galactopyranoside | 1mg | |
| GC4752-2mg | Benzyl-13C6 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-α-D-galactopyranoside | 2mg | |
| GC4752-5mg | Benzyl-13C6 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-α-D-galactopyranoside | 5mg | |
| GC4752-10mg | Benzyl-13C6 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-α-D-galactopyranoside | 10mg | |
| GK0249-100g | Benzylamine | 100-46-9 | 100g |
| GW8120-25g | Benzylamine hydrochloride | 3287-99-8 | 25g |
| GW8120-100g | Benzylamine hydrochloride | 3287-99-8 | 100g |
| GK9286-10g | Benzyldimethyldodecylammonium chloride | 139-07-1 | 10g |
| GK5743-25g | Benzyldimethylhexadecylammonium chloride | 122-18-9 | 25g |
| GK5743-100g | Benzyldimethylhexadecylammonium chloride | 122-18-9 | 100g |
| GK2853-100g | Benzyldimethyltetradecylammonium chloride dihydrate | 139-08-2 | 100g |
| GK2853-250g | Benzyldimethyltetradecylammonium chloride dihydrate | 139-08-2 | 250g |
| GK2853-500g | Benzyldimethyltetradecylammonium chloride dihydrate | 139-08-2 | 500g |
| GK5113-25g | Benzyltriethylammonium bromide | 5197-95-5 | 25g |
| GK5113-100g | Benzyltriethylammonium bromide | 5197-95-5 | 100g |
| GK5113-250g | Benzyltriethylammonium bromide | 5197-95-5 | 250g |
| GK5113-500g | Benzyltriethylammonium bromide | 5197-95-5 | 500g |
| GK4969-25g | Benzyltriphenylphosphonium chloride | 1100-88-5 | 25g |
| GK4969-100g | Benzyltriphenylphosphonium chloride | 1100-88-5 | 100g |
| GK4969-250g | Benzyltriphenylphosphonium chloride | 1100-88-5 | 250g |
| GW1294-1g | BEP | 878-23-9 | 1g |
| GW1294-5g | BEP | 878-23-9 | 5g |
| GW1294-25g | BEP | 878-23-9 | 25g |
| GY3340-25mg | Berbamine | 478-61-5 | 25mg |
| GL6182-1g | Berbamine dihydrochloride | 6078-17-7 | 1g |
| GL6182-5g | Berbamine dihydrochloride | 6078-17-7 | 5g |
| GK8292-5g | Berberine hydrochloride | 633-65-8 | 5g |
| GK8292-10g | Berberine hydrochloride | 633-65-8 | 10g |
| GL2537-100ml | Bergamot oil | 8007-75-8 | 100ml |
| GL2537-500ml | Bergamot oil | 8007-75-8 | 500ml |
| GL2537-1l | Bergamot oil | 8007-75-8 | 1l |
| GP8615-250mg | Bergenin | 477-90-7 | 250mg |
| GK1240-5g | Beryllium fluoride, 33% (w/w) aqueous solution | 7787-49-7 | 5g |
| GB4358-25g | BES | 10191-18-1 | 25g |
| GB4358-100g | BES | 10191-18-1 | 100g |
| GB4358-250g | BES | 10191-18-1 | 250g |
| GB4358-500g | BES | 10191-18-1 | 500g |
| GB4358-1kg | BES | 10191-18-1 | 1kg |
| GB9133-25g | BES sodium salt | 66992-27-6 | 25g |
| GB9133-100g | BES sodium salt | 66992-27-6 | 100g |
| GB9133-250g | BES sodium salt | 66992-27-6 | 250g |
| GA7849-1mg | Bestatin hydrochloride | 65391-42-6 | 1mg |
| GA7849-5mg | Bestatin hydrochloride | 65391-42-6 | 5mg |
| GA7849-10mg | Bestatin hydrochloride | 65391-42-6 | 10mg |
| GA7849-25mg | Bestatin hydrochloride | 65391-42-6 | 25mg |
| GC1069-100g | beta-Alanine | 107-95-9 | 100g |
| GC1069-250g | beta-Alanine | 107-95-9 | 250g |
| GC1069-500g | beta-Alanine | 107-95-9 | 500g |
| GC1069-1kg | beta-Alanine | 107-95-9 | 1kg |
| GC3427-10g | beta-Alanine ethyl ester hydrochloride | 4244-84-2 | 10g |
| GC3427-25g | beta-Alanine ethyl ester hydrochloride | 4244-84-2 | 25g |
| GC3427-50g | beta-Alanine ethyl ester hydrochloride | 4244-84-2 | 50g |
| GC3427-100g | beta-Alanine ethyl ester hydrochloride | 4244-84-2 | 100g |
| GZ8786-5g | beta-Amylase, from soy | 9000-91-3 | 5g |
| GP8334-1g | beta-Carotene | 7235-40-7 | 1g |
| GP8334-5g | beta-Carotene | 7235-40-7 | 5g |
| GP8334-10g | beta-Carotene | 7235-40-7 | 10g |
| GP8334-25g | beta-Carotene | 7235-40-7 | 25g |
| GK2827-100ml | beta-Citronellol | 106-22-9 | 100ml |
| GP5152-5g | beta-Cyclocitral | 432-25-7 | 5g |
| GP5152-25g | beta-Cyclocitral | 432-25-7 | 25g |
| GC8805-25g | beta-Cyclodextrin | 7585-39-9 | 25g |
| GC8805-100g | beta-Cyclodextrin | 7585-39-9 | 100g |
| GC8805-250g | beta-Cyclodextrin | 7585-39-9 | 250g |
| GC6118-100mg | beta-Cyclodextrin phosphate sodium salt | 199684-61-2 | 100mg |
| GC6118-250mg | beta-Cyclodextrin phosphate sodium salt | 199684-61-2 | 250mg |
| GL7051-5g | beta-D-Glucan, from yeast | 9012-72-0 | 5g |
| GZ4898-100U | beta-Glucosidase, from almonds | 9001-22-3 | 100U |
| GZ4898-250U | beta-Glucosidase, from almonds | 9001-22-3 | 250U |
| GK9068-10g | beta-Glycerol phosphate disodium salt pentahydrate | 13408-09-8 | 10g |
| GK9068-25g | beta-Glycerol phosphate disodium salt pentahydrate | 13408-09-8 | 25g |
| GC5831-50g | beta-Lactose | 5965-66-2 | 50g |
| GC5831-100g | beta-Lactose | 5965-66-2 | 100g |
| GC5831-250g | beta-Lactose | 5965-66-2 | 250g |
| GC5831-500g | beta-Lactose | 5965-66-2 | 500g |
| GW4983-250ug | beta-Mannosylceramide | 1334332-65-8 | 250ug |
| GW4983-1mg | beta-Mannosylceramide | 1334332-65-8 | 1mg |
| GW2463-1mg | beta-Naphthocyclinone | 55050-83-4 | 1mg |
| GV0860-1g | beta-Nicotinamide adenine dinucleotide | 53-84-9 | 1g |
| GV0860-5g | beta-Nicotinamide adenine dinucleotide | 53-84-9 | 5g |
| GV0860-10g | beta-Nicotinamide adenine dinucleotide | 53-84-9 | 10g |
| GV0860-25g | beta-Nicotinamide adenine dinucleotide | 53-84-9 | 25g |
| GE9477-250mg | beta-Nicotinamide adenine dinucleotide phosphate disodium salt | 24292-60-2 | 250mg |
| GE9477-1g | beta-Nicotinamide adenine dinucleotide phosphate disodium salt | 24292-60-2 | 1g |
| GE9477-5g | beta-Nicotinamide adenine dinucleotide phosphate disodium salt | 24292-60-2 | 5g |
| GL2728-1g | beta-Nicotinamide adenine dinucleotide phosphate sodium salt hydrate | 698999-85-8 | 1g |
| GL2728-5g | beta-Nicotinamide adenine dinucleotide phosphate sodium salt hydrate | 698999-85-8 | 5g |
| GK2960-1g | beta-Nicotinamide adenine dinucleotide reduced form, disodium salt | 606-68-8 | 1g |
| GK2960-5g | beta-Nicotinamide adenine dinucleotide reduced form, disodium salt | 606-68-8 | 5g |
| GK2960-25g | beta-Nicotinamide adenine dinucleotide reduced form, disodium salt | 606-68-8 | 25g |
| GE9996-100mg | beta-Nicotinamide mononucleotide | 1094-61-7 | 100mg |
| GA9971-1mg | beta-Rubromycin | 27267-70-5 | 1mg |
| GA9971-5mg | beta-Rubromycin | 27267-70-5 | 5mg |
| GP9580-5mg | beta-Sitosterol, 97% | 83-46-5 | 5mg |
| GP9580-10mg | beta-Sitosterol, 97% | 83-46-5 | 10mg |
| GP9580-25mg | beta-Sitosterol, 97% | 83-46-5 | 25mg |
| GE3671-100g | Betaine hydrochloride | 590-46-5 | 100g |
| GE3671-250g | Betaine hydrochloride | 590-46-5 | 250g |
| GE3671-500g | Betaine hydrochloride | 590-46-5 | 500g |
| GE3671-1kg | Betaine hydrochloride | 590-46-5 | 1kg |
| GE3671-5kg | Betaine hydrochloride | 590-46-5 | 5kg |
| GE7265-100g | Betaine monohydrate | 590-47-6 | 100g |
| GE7265-250g | Betaine monohydrate | 590-47-6 | 250g |
| GE7265-500g | Betaine monohydrate | 590-47-6 | 500g |
| GE7265-1kg | Betaine monohydrate | 590-47-6 | 1kg |
| GE1604-100g | Betaine, anhydrous | 107-43-7 | 100g |
| GE1604-250g | Betaine, anhydrous | 107-43-7 | 250g |
| GE1604-500g | Betaine, anhydrous | 107-43-7 | 500g |
| GE1604-1kg | Betaine, anhydrous | 107-43-7 | 1kg |
| GP0290-1g | Betamethasone | 378-44-9 | 1g |
| GP0290-5g | Betamethasone | 378-44-9 | 5g |
| GP0290-10g | Betamethasone | 378-44-9 | 10g |
| GP7353-100mg | Betamethasone 17-valerate | 2152-44-5 | 100mg |
| GK8107-250mg | Betamethasone 21-phosphate disodium | 151-73-5 | 250mg |
| GK8107-1g | Betamethasone 21-phosphate disodium | 151-73-5 | 1g |
| GP3604-1g | Betamethasone dipropionate | 5593-20-4 | 1g |
| GP3604-5g | Betamethasone dipropionate | 5593-20-4 | 5g |
| GP0555-10mg | Betaxolol hydrochloride | 63659-19-8 | 10mg |
| GP0555-50mg | Betaxolol hydrochloride | 63659-19-8 | 50mg |
| GP0555-100mg | Betaxolol hydrochloride | 63659-19-8 | 100mg |
| GP0555-250mg | Betaxolol hydrochloride | 63659-19-8 | 250mg |
| GP5633-250mg | Betulin | 473-98-3 | 250mg |
| GP5633-1g | Betulin | 473-98-3 | 1g |
| GP5633-5g | Betulin | 473-98-3 | 5g |
| GP1450-25mg | Betulinic acid | 472-15-1 | 25mg |
| GP1450-100mg | Betulinic acid | 472-15-1 | 100mg |
| GP1450-250mg | Betulinic acid | 472-15-1 | 250mg |
| GP1450-500mg | Betulinic acid | 472-15-1 | 500mg |
| GP1450-1g | Betulinic acid | 472-15-1 | 1g |
| GW1189-1mg | BGG463 | 890129-26-7 | 1mg |
| GW1189-5mg | BGG463 | 890129-26-7 | 5mg |
| GW1189-10mg | BGG463 | 890129-26-7 | 10mg |
| GW3237-1mg | BGT226 maleate | 1245537-68-1 | 1mg |
| GW3237-5mg | BGT226 maleate | 1245537-68-1 | 5mg |
| GW3237-10mg | BGT226 maleate | 1245537-68-1 | 10mg |
| GW2372-5mg | BHHCT | 200862-70-0 | 5mg |
| GW2372-100mg | BHHCT | 200862-70-0 | 100mg |
| GW2372-1g | BHHCT | 200862-70-0 | 1g |
| GW6604-100mg | BHHT | 200862-69-7 | 100mg |
| GW6604-500mg | BHHT | 200862-69-7 | 500mg |
| GW2893-1mg | BI-D1870 | 501437-28-1 | 1mg |
| GW2893-5mg | BI-D1870 | 501437-28-1 | 5mg |
| GW2893-10mg | BI-D1870 | 501437-28-1 | 10mg |
| GA6808-50mg | Biapenem | 120410-24-4 | 50mg |
| GA6808-250mg | Biapenem | 120410-24-4 | 250mg |
| GP8076-250mg | Bicalutamide | 90357-06-5 | 250mg |
| GP8076-1g | Bicalutamide | 90357-06-5 | 1g |
| GK3616-1g | Bicinchoninic acid disodium salt hydrate | 979-88-4 | 1g |
| GK3616-5g | Bicinchoninic acid disodium salt hydrate | 979-88-4 | 5g |
| GK3616-10g | Bicinchoninic acid disodium salt hydrate | 979-88-4 | 10g |
| GK3616-25g | Bicinchoninic acid disodium salt hydrate | 979-88-4 | 25g |
| GB1591-25g | BICINE | 150-25-4 | 25g |
| GB1591-100g | BICINE | 150-25-4 | 100g |
| GB1591-250g | BICINE | 150-25-4 | 250g |
| GB1591-500g | BICINE | 150-25-4 | 500g |
| GL5486-5g | Bicyclohexyl | 92-51-3 | 5g |
| GL5486-25g | Bicyclohexyl | 92-51-3 | 25g |
| GT7414-25g | Biebrich Scarlet (C.I. 26905) | 4196-99-0 | 25g |
| GT7414-100g | Biebrich Scarlet (C.I. 26905) | 4196-99-0 | 100g |
| GT0753-100ml | Biebrich scarlet-acid fuchsin solution | - | 100ml |
| GT0753-250ml | Biebrich scarlet-acid fuchsin solution | - | 250ml |
| GP7972-10mg | Bifemelane hydrochloride | 62232-46-6 | 10mg |
| GW3628-100mg | Bifenazate | 149877-41-8 | 100mg |
| GW3628-500mg | Bifenazate | 149877-41-8 | 500mg |
| GP7347-1g | Bifonazole | 60628-96-8 | 1g |
| GP7347-5g | Bifonazole | 60628-96-8 | 5g |
| GP7347-25g | Bifonazole | 60628-96-8 | 25g |
| GL1296-250ug | Bikaverin | 33390-21-5 | 250ug |
| GL1296-1mg | Bikaverin | 33390-21-5 | 1mg |
| GX6607-10g | Bile salts | 361-09-1 / 302-95-4 | 10g |
| GX6607-25g | Bile salts | 361-09-1 / 302-95-4 | 25g |
| GX6607-50g | Bile salts | 361-09-1 / 302-95-4 | 50g |
| GX6607-100g | Bile salts | 361-09-1 / 302-95-4 | 100g |
| GX6607-250g | Bile salts | 361-09-1 / 302-95-4 | 250g |
| GE4042-1g | Bilirubin | 635-65-4 | 1g |
| GE4042-5g | Bilirubin | 635-65-4 | 5g |
| GX7154-5mg | Bimatoprost | 155206-00-1 | 5mg |
| GX7154-25mg | Bimatoprost | 155206-00-1 | 25mg |
| GL6265-1mg | BIO | 667463-62-9 | 1mg |
| GL6265-5mg | BIO | 667463-62-9 | 5mg |
| GL6265-25mg | BIO | 667463-62-9 | 25mg |
| GP7014-1g | Biochanin A | 491-80-5 | 1g |
| GC6476-5mg | Biochanin A b-D-glucuronide | 38482-76-7 | 5mg |
| GC6476-10mg | Biochanin A b-D-glucuronide | 38482-76-7 | 10mg |
| GC6476-25mg | Biochanin A b-D-glucuronide | 38482-76-7 | 25mg |
| GC6476-50mg | Biochanin A b-D-glucuronide | 38482-76-7 | 50mg |
| GK3055-100mg | Biocytin | 576-19-2 | 100mg |
| GK3055-250mg | Biocytin | 576-19-2 | 250mg |
| GW9801-1mg | Biotin-(5-fluorescein)-conjugate | 957494-27-8 | 1mg |
| GW9801-5mg | Biotin-(5-fluorescein)-conjugate | 957494-27-8 | 5mg |
| GW6213-25mg | Biotin-X-NHS | 72040-63-2 | 25mg |
| GW6213-100mg | Biotin-X-NHS | 72040-63-2 | 100mg |
| GE2365-100mg | Biotinyl tyramide | 41994-02-9 | 100mg |
| GE2365-500mg | Biotinyl tyramide | 41994-02-9 | 500mg |
| GL2355-25g | Biphenyl | 92-52-4 | 25g |
| GK8116-100g | Bis-trifluoroacetoxyiodobenzene | 2712-78-9 | 100g |
| GB6605-25g | BIS-TRIS | 6976-37-0 | 25g |
| GB6605-100g | BIS-TRIS | 6976-37-0 | 100g |
| GB6605-250g | BIS-TRIS | 6976-37-0 | 250g |
| GB6605-500g | BIS-TRIS | 6976-37-0 | 500g |
| GB6605-1kg | BIS-TRIS | 6976-37-0 | 1kg |
| GK3758-25g | BIS-TRIS hydrochloride | 124763-51-5 | 25g |
| GK3758-100g | BIS-TRIS hydrochloride | 124763-51-5 | 100g |
| GK3758-250g | BIS-TRIS hydrochloride | 124763-51-5 | 250g |
| GB2945-25g | BIS-TRIS propane | 64431-96-5 | 25g |
| GB2945-100g | BIS-TRIS propane | 64431-96-5 | 100g |
| GB2945-250g | BIS-TRIS propane | 64431-96-5 | 250g |
| GB2945-500g | BIS-TRIS propane | 64431-96-5 | 500g |
| GP2575-1g | Bis(2-carboxyethylgermanium(IV) sesquioxide) | 12758-40-6 | 1g |
| GP2575-5g | Bis(2-carboxyethylgermanium(IV) sesquioxide) | 12758-40-6 | 5g |
| GP2575-10g | Bis(2-carboxyethylgermanium(IV) sesquioxide) | 12758-40-6 | 10g |
| GP2575-25g | Bis(2-carboxyethylgermanium(IV) sesquioxide) | 12758-40-6 | 25g |
| GX5023-25ml | Bis(2-ethylhexyl) adipate | 103-23-1 | 25ml |
| GX6279-25g | Bis(2-ethylhexyl) phosphate | 298-07-7 | 25g |
| GX6279-100g | Bis(2-ethylhexyl) phosphate | 298-07-7 | 100g |
| GS9884-100ml | bis(2-Methoxyethyl) Ether, GlenDry™, anhydrous | 111-96-6 | 100ml |
| GS9884-500ml | bis(2-Methoxyethyl) Ether, GlenDry™, anhydrous | 111-96-6 | 500ml |
| GS9884-1l | bis(2-Methoxyethyl) Ether, GlenDry™, anhydrous | 111-96-6 | 1l |
| GS2001-100ml | bis(2-Methoxyethyl) Ether, GlenDry™, anhydrous over molecular sieve | 111-96-6 | 100ml |
| GS2001-500ml | bis(2-Methoxyethyl) Ether, GlenDry™, anhydrous over molecular sieve | 111-96-6 | 500ml |
| GS2001-1l | bis(2-Methoxyethyl) Ether, GlenDry™, anhydrous over molecular sieve | 111-96-6 | 1l |
| GW0709-1mg | Bis(2,2′-bipyridine)-(5-isothiocyanato-phenanthroline)ruthenium bis(hexafluorophosphate) | 288399-07-5 | 1mg |
| GW0709-5mg | Bis(2,2′-bipyridine)-(5-isothiocyanato-phenanthroline)ruthenium bis(hexafluorophosphate) | 288399-07-5 | 5mg |
| GW0709-25mg | Bis(2,2′-bipyridine)-(5-isothiocyanato-phenanthroline)ruthenium bis(hexafluorophosphate) | 288399-07-5 | 25mg |
| GW8154-1g | Bis(4-bromophenyl)iodonium triflate | 139139-81-4 | 1g |
| GW8154-5g | Bis(4-bromophenyl)iodonium triflate | 139139-81-4 | 5g |
| GW1863-1g | Bis(4-fluorophenyl)iodonium triflate | 732306-64-8 | 1g |
| GW1863-5g | Bis(4-fluorophenyl)iodonium triflate | 732306-64-8 | 5g |
| GW1986-1g | Bis(4-iodophenyl)-iodonium tetrafluoroborate | 1260147-20-3 | 1g |
| GW1986-5g | Bis(4-iodophenyl)-iodonium tetrafluoroborate | 1260147-20-3 | 5g |
| GW9067-10g | Bis(4-methylphenyl)iodonium hexafluorophosphate | 60565-88-0 | 10g |
| GW7661-1g | Bis(4-tert-Butylphenyl) iodoniumhexafluorophosphate | 61358-25-6 | 1g |
| GW7661-10g | Bis(4-tert-Butylphenyl) iodoniumhexafluorophosphate | 61358-25-6 | 10g |
| GW7661-100g | Bis(4-tert-Butylphenyl) iodoniumhexafluorophosphate | 61358-25-6 | 100g |
| GT6965-25g | Bis(cyclohexanone)oxaldihydrazone | 370-81-0 | 25g |
| GT6965-100g | Bis(cyclohexanone)oxaldihydrazone | 370-81-0 | 100g |
| GX7749-5g | Bis(cyclopentadienyl)zirconium dichloride, 97+% | 1291-32-3 | 5g |
| GX7504-1g | Bis(dibenzylideneacetone) palladium(0) | 32005-36-0 | 1g |
| GX3036-1g | Bis(ethylenediamine) palladium(II) chloride, 99.95% (metals basis) | 13963-53-6 | 1g |
| GK6469-5g | Bis(pinacolato)diboron | 73183-34-3 | 5g |
| GK6469-25g | Bis(pinacolato)diboron | 73183-34-3 | 25g |
| GK6469-100g | Bis(pinacolato)diboron | 73183-34-3 | 100g |
| GW7867-10g | Bis(trifluoromethane)sulfonimide lithium salt | 90076-65-6 | 10g |
| GW7867-50g | Bis(trifluoromethane)sulfonimide lithium salt | 90076-65-6 | 50g |
| GK7139-5g | Bis(trimethylsilyl)trifluoroacetamide | 25561-30-2 | 5g |
| GK7139-25g | Bis(trimethylsilyl)trifluoroacetamide | 25561-30-2 | 25g |
| GK0113-1g | Bis(trimethylsilyl)trifluoroacetamide with 1% TMCS | 25561-30-2 | 1g |
| GX9696-1g | Bis(triphenylphosphine) palladium(II) chloride, 99.95% (metals basis) | 13965-03-2 | 1g |
| GX9696-5g | Bis(triphenylphosphine) palladium(II) chloride, 99.95% (metals basis) | 13965-03-2 | 5g |
| GX9818-25g | Bis(triphenylphosphine)nickel (II) chloride | 14264-16-5 | 25g |
| GX7392-1g | Bis(triphenylphosphine)rhodium carbonyl chloride, 99% | 13938-94-8 | 1g |
| GX7392-5g | Bis(triphenylphosphine)rhodium carbonyl chloride, 99% | 13938-94-8 | 5g |
| GX2503-1g | Bis(triphenylphosphine)ruthenium dicarbonyl dichloride | 14564-35-3 | 1g |
| GT5082-500mg | Bisbenzimide H 33258 Fluorochrome trihydrochloride | 23491-45-4 | 500mg |
| GT5082-1g | Bisbenzimide H 33258 Fluorochrome trihydrochloride | 23491-45-4 | 1g |
| GY6887-25mg | Bisdemethoxycurcumin | 33171-05-0 | 25mg |
| GL2668-1mg | Bisindolylmaleimide I base | 133052-90-1 | 1mg |
| GL2668-5mg | Bisindolylmaleimide I base | 133052-90-1 | 5mg |
| GL1078-1mg | Bisindolylmaleimide II | 137592-45-1 | 1mg |
| GL1078-5mg | Bisindolylmaleimide II | 137592-45-1 | 5mg |
| GL9260-1mg | Bisindolylmaleimide III | 137592-43-9 | 1mg |
| GL9260-5mg | Bisindolylmaleimide III | 137592-43-9 | 5mg |
| GK6792-1mg | Bisindolylmaleimide IV | 119139-23-0 | 1mg |
| GK6792-5mg | Bisindolylmaleimide IV | 119139-23-0 | 5mg |
| GL4877-1mg | Bisindolylmaleimide IX methansulfonate | 138489-18-6 | 1mg |
| GL4877-5mg | Bisindolylmaleimide IX methansulfonate | 138489-18-6 | 5mg |
| GL9254-1mg | Bisindolylmaleimide V | 113963-68-1 | 1mg |
| GL9254-5mg | Bisindolylmaleimide V | 113963-68-1 | 5mg |
| GL4749-1mg | Bisindolylmaleimide VIII acetate salt | 138516-31-1 | 1mg |
| GL4749-5mg | Bisindolylmaleimide VIII acetate salt | 138516-31-1 | 5mg |
| GL8289-1mg | Bisindolylmaleimide X hydrochloride | 145317-11-9 | 1mg |
| GL8289-5mg | Bisindolylmaleimide X hydrochloride | 145317-11-9 | 5mg |
| GT3092-25g | Bismarck Brown (C.I. 21010) | 5421-66-9 | 25g |
| GT3092-100g | Bismarck Brown (C.I. 21010) | 5421-66-9 | 100g |
| GT3348-25g | Bismarck Brown Y (C.I. 21000) | 10114-58-6 | 25g |
| GT3348-100g | Bismarck Brown Y (C.I. 21000) | 10114-58-6 | 100g |
| GW3055-1g | Bismerthiazol | 79319-85-0 | 1g |
| GW3055-10g | Bismerthiazol | 79319-85-0 | 10g |
| GX8987-25g | Bismuth acetate, 99.999% | 22306-37-2 | 25g |
| GX8987-100g | Bismuth acetate, 99.999% | 22306-37-2 | 100g |
| GX2199-250g | Bismuth Bar, 99.99% | 7440-69-9 | 250g |
| GX3856-250g | Bismuth Bar, 99.999% | 7440-69-9 | 250g |
| GX8757-50g | Bismuth Bar, 99.9999% | 7440-69-9 | 50g |
| GX3304-25g | Bismuth bromide, 99% | 7787-58-8 | 25g |
| GX3304-100g | Bismuth bromide, 99% | 7787-58-8 | 100g |
| GX9572-100g | Bismuth carbonate basic, 98% | 5892-10-4 | 100g |
| GX9572-250g | Bismuth carbonate basic, 98% | 5892-10-4 | 250g |
| GX9572-500g | Bismuth carbonate basic, 98% | 5892-10-4 | 500g |
| GX9572-1kg | Bismuth carbonate basic, 98% | 5892-10-4 | 1kg |
| GX2068-250g | Bismuth carbonate basic, 99% | 5892-10-4 | 250g |
| GX2068-1kg | Bismuth carbonate basic, 99% | 5892-10-4 | 1kg |
| GX6524-100g | Bismuth chloride hydrate, 99.99+% | 7787-60-2 | 100g |
| GX6524-250g | Bismuth chloride hydrate, 99.99+% | 7787-60-2 | 250g |
| GX6524-1kg | Bismuth chloride hydrate, 99.99+% | 7787-60-2 | 1kg |
| GX6524-5kg | Bismuth chloride hydrate, 99.99+% | 7787-60-2 | 5kg |
| GX6173-100g | Bismuth chloride oxide, 99.9% | 7787-59-9 | 100g |
| GX6173-500g | Bismuth chloride oxide, 99.9% | 7787-59-9 | 500g |
| GX9190-50g | Bismuth chloride oxide, 99.99% | 7787-59-9 | 50g |
| GX1996-250g | Bismuth Granules 0.5-2 mm, 99.99% | 7440-69-9 | 250g |
| GX5286-50g | Bismuth Granules 0.5-2 mm, 99.997% | 7440-69-9 | 50g |
| GX5286-250g | Bismuth Granules 0.5-2 mm, 99.997% | 7440-69-9 | 250g |
| GX0318-50g | Bismuth Granules 1-10 mm, 99.999% | 7440-69-9 | 50g |
| GX0318-250g | Bismuth Granules 1-10 mm, 99.999% | 7440-69-9 | 250g |
| GX7283-250g | Bismuth hydroxide, 99.9% | 10361-43-0 | 250g |
| GX0561-25g | Bismuth iodide, 99% | 7787-64-6 | 25g |
| GX7978-25g | Bismuth molybdate, 99.5% | 13595-85-2 | 25g |
| GX7978-50g | Bismuth molybdate, 99.5% | 13595-85-2 | 50g |
| GX7502-100g | Bismuth Needles, 99.997% | 7440-69-9 | 100g |
| GX1365-250g | Bismuth nitrate hydrate, 98+% | 10035-06-0 | 250g |
| GX3159-25g | Bismuth nitrate hydrate, 99.999% | 10035-06-0 | 25g |
| GX8756-25g | Bismuth nitrate oxide 71% Bi | 10361-46-3 | 25g |
| GX8756-100g | Bismuth nitrate oxide 71% Bi | 10361-46-3 | 100g |
| GX8756-500g | Bismuth nitrate oxide 71% Bi | 10361-46-3 | 500g |
| GX8193-25g | Bismuth oxide (beta)-Nano Powder, 99.9+% | 1304-76-3 | 25g |
| GX8193-100g | Bismuth oxide (beta)-Nano Powder, 99.9+% | 1304-76-3 | 100g |
| GX9845-100g | Bismuth oxide, 99.8% | 1304-76-3 | 100g |
| GX9845-250g | Bismuth oxide, 99.8% | 1304-76-3 | 250g |
| GX9845-1kg | Bismuth oxide, 99.8% | 1304-76-3 | 1kg |
| GX3472-100g | Bismuth oxide, 99.9% | 1304-76-3 | 100g |
| GX8289-100g | Bismuth oxide, 99.9% | 1304-76-3 | 100g |
| GX8289-250g | Bismuth oxide, 99.9% | 1304-76-3 | 250g |
| GX3472-500g | Bismuth oxide, 99.9% | 1304-76-3 | 500g |
| GX8289-500g | Bismuth oxide, 99.9% | 1304-76-3 | 500g |
| GX3752-50g | Bismuth oxide, 99.99% | 1304-76-3 | 50g |
| GX3752-250g | Bismuth oxide, 99.99% | 1304-76-3 | 250g |
| GX4730-50g | Bismuth oxide, 99.999% | 1304-76-3 | 50g |
| GX4730-250g | Bismuth oxide, 99.999% | 1304-76-3 | 250g |
| GX1608-10g | Bismuth oxide, 99.9995% | 1304-79-3 | 10g |
| GX1608-50g | Bismuth oxide, 99.9995% | 1304-79-3 | 50g |
| GX2132-50g | Bismuth Pieces, 99.999% | 7440-69-9 | 50g |
| GX2132-250g | Bismuth Pieces, 99.999% | 7440-69-9 | 250g |
| GX2132-1kg | Bismuth Pieces, 99.999% | 7440-69-9 | 1kg |
| GX4649-50g | Bismuth Pieces, 99.9999% | 7440-69-9 | 50g |
| GX4649-250g | Bismuth Pieces, 99.9999% | 7440-69-9 | 250g |
| GX1211-100g | Bismuth Powder -100, +325 mesh, 99.5% | 7440-69-9 | 100g |
| GX1211-500g | Bismuth Powder -100, +325 mesh, 99.5% | 7440-69-9 | 500g |
| GX4739-100g | Bismuth Powder -100, +325 mesh, 99.99% | 7440-69-9 | 100g |
| GX4739-250g | Bismuth Powder -100, +325 mesh, 99.99% | 7440-69-9 | 250g |
| GX3632-25g | Bismuth Powder -200 mesh, 99.999% | 7440-69-9 | 25g |
| GX3632-100g | Bismuth Powder -200 mesh, 99.999% | 7440-69-9 | 100g |
| GX0171-100g | Bismuth Powder -325 mesh, 99.9% | 7440-69-9 | 100g |
| GX0171-250g | Bismuth Powder -325 mesh, 99.9% | 7440-69-9 | 250g |
| GX5673-100g | Bismuth Powder -325 mesh, 99% | 7440-69-9 | 100g |
| GX5673-500g | Bismuth Powder -325 mesh, 99% | 7440-69-9 | 500g |
| GX6127-50g | Bismuth Powder max. 250 micron, 99.995% | 7440-69-9 | 50g |
| GX6127-250g | Bismuth Powder max. 250 micron, 99.995% | 7440-69-9 | 250g |
| GX6294-240mm | Bismuth Rod 10 mm diameter, 99.999% | 7440-69-9 | 240mm |
| GK1477-100g | Bismuth subnitrate | 1304-85-4 | 100g |
| GK1477-250g | Bismuth subnitrate | 1304-85-4 | 250g |
| GK1477-500g | Bismuth subnitrate | 1304-85-4 | 500g |
| GK6111-100g | Bismuth subnitrate, USP grade | 1304-85-4 | 100g |
| GX1330-1g | Bismuth-thd, 99.9% | 142617-53-6 | 1g |
| GX1330-5g | Bismuth-thd, 99.9% | 142617-53-6 | 5g |
| GX8399-500g | Bismuth(III) citrate | 813-93-4 | 500g |
| GX8399-1kg | Bismuth(III) citrate | 813-93-4 | 1kg |
| GX3049-25g | Bismuth(III) fluoride, 99.999% | 7787-61-3 | 25g |
| GK5350-100g | Bismuth(III) gallate basic hydrate | 99-26-3 | 100g |
| GK5350-250g | Bismuth(III) gallate basic hydrate | 99-26-3 | 250g |
| GK5350-500g | Bismuth(III) gallate basic hydrate | 99-26-3 | 500g |
| GK8852-100g | Bismuth(III) oxide | 1304-76-3 | 100g |
| GK8852-250g | Bismuth(III) oxide | 1304-76-3 | 250g |
| GK8852-500g | Bismuth(III) oxide | 1304-76-3 | 500g |
| GK8852-1kg | Bismuth(III) oxide | 1304-76-3 | 1kg |
| GP0667-100mg | Bisoprolol hemifumarate salt | 104344-23-2 | 100mg |
| GL8984-25g | Bisphenol A | 80-05-7 | 25g |
| GL8984-100g | Bisphenol A | 80-05-7 | 100g |
| GW3575-50mg | Bistrifluron | 201593-84-2 | 50mg |
| GW3575-250mg | Bistrifluron | 201593-84-2 | 250mg |
| GL8763-100mg | Bithionol | 97-18-7 | 100mg |
| GT9214-25g | Biuret | 108-19-0 | 25g |
| GL8747-1mg | BIX 01294 base | 935693-62-2 | 1mg |
| GL8747-5mg | BIX 01294 base | 935693-62-2 | 5mg |
| GL8747-25mg | BIX 01294 base | 935693-62-2 | 25mg |
| GL6636-1mg | BIX 01294 trihydrochloride | 1392399-03-9 | 1mg |
| GL6636-5mg | BIX 01294 trihydrochloride | 1392399-03-9 | 5mg |
| GL6636-25mg | BIX 01294 trihydrochloride | 1392399-03-9 | 25mg |
| GW3612-1mg | BIX02565 | 1311367-27-7 | 1mg |
| GW3612-5mg | BIX02565 | 1311367-27-7 | 5mg |
| GW3612-10mg | BIX02565 | 1311367-27-7 | 10mg |
| GW6773-1mg | BKM120 | 1312445-63-8 | 1mg |
| GW6773-5mg | BKM120 | 1312445-63-8 | 5mg |
| GW6773-10mg | BKM120 | 1312445-63-8 | 10mg |
| GA9443-10mg | Blasticidine S hydrochloride | 3513-03-9 | 10mg |
| GA7621-5mg | Bleomycin sulfate | 9041-93-4 | 5mg |
| GA7621-10mg | Bleomycin sulfate | 9041-93-4 | 10mg |
| GA7621-25mg | Bleomycin sulfate | 9041-93-4 | 25mg |
| GL2252-1mg | BLZ-945 | 953769-46-5 | 1mg |
| GL2252-5mg | BLZ-945 | 953769-46-5 | 5mg |
| GL2252-25mg | BLZ-945 | 953769-46-5 | 25mg |
| GW1704-1mg | BMS-2 | 888719-03-7 | 1mg |
| GW1704-5mg | BMS-2 | 888719-03-7 | 5mg |
| GW1704-10mg | BMS-2 | 888719-03-7 | 10mg |
| GW5318-5mg | BMS-3 | 1338247-30-5 | 5mg |
| GW5318-25mg | BMS-3 | 1338247-30-5 | 25mg |
| GW9859-1mg | BMS-309403 | 300657-03-8 | 1mg |
| GW9859-5mg | BMS-309403 | 300657-03-8 | 5mg |
| GW9859-25mg | BMS-309403 | 300657-03-8 | 25mg |
| GW8214-1mg | BMS-387032 hydrochloride | 345627-90-9 | 1mg |
| GW8214-5mg | BMS-387032 hydrochloride | 345627-90-9 | 5mg |
| GW8214-10mg | BMS-387032 hydrochloride | 345627-90-9 | 10mg |
| GW8582-1mg | BMS-5 | 1338247-35-0 | 1mg |
| GW8582-5mg | BMS-5 | 1338247-35-0 | 5mg |
| GW8582-10mg | BMS-5 | 1338247-35-0 | 10mg |
| GW5097-1mg | BMS-540215 | 649735-46-6 | 1mg |
| GW5097-5mg | BMS-540215 | 649735-46-6 | 5mg |
| GW5097-10mg | BMS-540215 | 649735-46-6 | 10mg |
| GW8409-1mg | BMS-599626 | 714971-09-2 | 1mg |
| GW8409-5mg | BMS-599626 | 714971-09-2 | 5mg |
| GW8409-10mg | BMS-599626 | 714971-09-2 | 10mg |
| GM9790-25g | Boc-Ala-OH | 15761-38-3 | 25g |
| GM9790-100g | Boc-Ala-OH | 15761-38-3 | 100g |
| GM4593-10g | Boc-Ala-OMe | 28875-17-4 | 10g |
| GM9595-5g | Boc-Asn(Trt)-OH | 132388-68-2 | 5g |
| GM9595-25g | Boc-Asn(Trt)-OH | 132388-68-2 | 25g |
| GK5098-1mg | Boc-Asp(OMe)-fluoromethyl ketone | 187389-53-3 | 1mg |
| GK5098-5mg | Boc-Asp(OMe)-fluoromethyl ketone | 187389-53-3 | 5mg |
| GM9023-5g | Boc-Cys(Trt)-OH | 21947-98-8 | 5g |
| GM9023-10g | Boc-Cys(Trt)-OH | 21947-98-8 | 10g |
| GM9023-25g | Boc-Cys(Trt)-OH | 21947-98-8 | 25g |
| GM2534-1g | Boc-D-Asp(OBzl)-OH | 51186-58-4 | 1g |
| GM2534-5g | Boc-D-Asp(OBzl)-OH | 51186-58-4 | 5g |
| GM2534-10g | Boc-D-Asp(OBzl)-OH | 51186-58-4 | 10g |
| GM2534-25g | Boc-D-Asp(OBzl)-OH | 51186-58-4 | 25g |
| GM5576-5g | Boc-D-Glu-OBzl | 34404-30-3 | 5g |
| GM5576-25g | Boc-D-Glu-OBzl | 34404-30-3 | 25g |
| GM3032-1g | Boc-D-Lys(2-Cl-Z)-OH | 57096-11-4 | 1g |
| GM0960-1g | Boc-D-Met-OH | 5241-66-7 | 1g |
| GM0960-5g | Boc-D-Met-OH | 5241-66-7 | 5g |
| GM0960-25g | Boc-D-Met-OH | 5241-66-7 | 25g |
| GM7978-1g | Boc-D-phenylalaninol | 106454-69-7 | 1g |
| GM7978-5g | Boc-D-phenylalaninol | 106454-69-7 | 5g |
| GM7243-5g | Boc-D-Ser(Bzl)-OH | 47173-80-8 | 5g |
| GM0738-25g | Boc-Gln-OH | 13726-85-7 | 25g |
| GM6033-25g | Boc-Glu(OBzl)-OH | 13574-13-5 | 25g |
| GM6033-100g | Boc-Glu(OBzl)-OH | 13574-13-5 | 100g |
| GM8629-5g | Boc-Glu(OcHx)-OH | 73821-97-3 | 5g |
| GM8629-10g | Boc-Glu(OcHx)-OH | 73821-97-3 | 10g |
| GM8629-25g | Boc-Glu(OcHx)-OH | 73821-97-3 | 25g |
| GM0543-5g | Boc-His(Boc)-OH dicyclohexylammonium salt | 31687-58-8 | 5g |
| GM0543-25g | Boc-His(Boc)-OH dicyclohexylammonium salt | 31687-58-8 | 25g |
| GM4410-25g | Boc-Ile-OH | 13139-16-7 | 25g |
| GM1634-25g | Boc-L-Lys(Boc)-OH | 2483-46-7 | 25g |
| GM1634-100g | Boc-L-Lys(Boc)-OH | 2483-46-7 | 100g |
| GM3676-1g | Boc-L-prolinal | 69610-41-9 | 1g |
| GL3169-1mg | Boc-Leu-Arg-Arg-AMC | 109358-46-5 | 1mg |
| GL3169-5mg | Boc-Leu-Arg-Arg-AMC | 109358-46-5 | 5mg |
| GM1662-5g | Boc-Leu-OH hydrate | 13139-15-6 | 5g |
| GM1662-25g | Boc-Leu-OH hydrate | 13139-15-6 | 25g |
| GM1662-100g | Boc-Leu-OH hydrate | 13139-15-6 | 100g |
| GK2576-25g | BOC-Leu-OH monohydrate | 13139-15-6 | 25g |
| GK2576-100g | BOC-Leu-OH monohydrate | 13139-15-6 | 100g |
| GM4502-5g | Boc-Lys(Alloc)-OH dicyclohexylammonium salt | 110637-52-0 | 5g |
| GM6002-25g | Boc-Lys(Boc)-OSu | 30189-36-7 | 25g |
| GM3592-5g | Boc-Lys(Fmoc)-OH | 84624-27-1 | 5g |
| GM3592-25g | Boc-Lys(Fmoc)-OH | 84624-27-1 | 25g |
| GM8936-10g | Boc-Lys(Z)-OH | 2389-45-9 | 10g |
| GM8936-25g | Boc-Lys(Z)-OH | 2389-45-9 | 25g |
| GM5675-5g | Boc-Ser(Bzl)-OH | 23680-31-1 | 5g |
| GM5675-10g | Boc-Ser(Bzl)-OH | 23680-31-1 | 10g |
| GM5675-25g | Boc-Ser(Bzl)-OH | 23680-31-1 | 25g |
| GM3219-5g | Boc-Thr(Bzl)-OH | 15260-10-3 | 5g |
| GM3219-10g | Boc-Thr(Bzl)-OH | 15260-10-3 | 10g |
| GM3219-25g | Boc-Thr(Bzl)-OH | 15260-10-3 | 25g |
| GM5211-5g | Boc-Tle-OH | 62965-35-9 | 5g |
| GM7699-5g | Boc-Tyr(Me)-OH | 53267-93-9 | 5g |
| GM1187-5g | Boc-Val-OH | 13734-41-3 | 5g |
| GM1187-25g | Boc-Val-OH | 13734-41-3 | 25g |
| GM1187-100g | Boc-Val-OH | 13734-41-3 | 100g |
| GP0844-10mg | Boceprevir | 394730-60-0 | 10mg |
| GP0844-25mg | Boceprevir | 394730-60-0 | 25mg |
| GP0844-50mg | Boceprevir | 394730-60-0 | 50mg |
| GL5712-50g | Borage oil | 84012-16-8 | 50g |
| GL5712-100g | Borage oil | 84012-16-8 | 100g |
| GE4425-100g | Boric acid | 10043-35-3 | 100g |
| GE4425-250g | Boric acid | 10043-35-3 | 250g |
| GE4425-500g | Boric acid | 10043-35-3 | 500g |
| GE4425-1kg | Boric acid | 10043-35-3 | 1kg |
| GE4425-5kg | Boric acid | 10043-35-3 | 5kg |
| GX5588-100g | Boric acid, 99.9% | 10043-35-3 | 100g |
| GX7729-10g | Boric acid, 99.999% | 10043-35-3 | 10g |
| GX7729-50g | Boric acid, 99.999% | 10043-35-3 | 50g |
| GY0324-100g | Bornyl acetate | 76-49-3 | 100g |
| GL6068-250ug | Boromycin | 34524-20-4 | 250ug |
| GL6068-1mg | Boromycin | 34524-20-4 | 1mg |
| GX9439-100g | Boron carbide | 12069-32-8 | 100g |
| GX9439-500g | Boron carbide | 12069-32-8 | 500g |
| GX3429-5g | Boron carbide nanopowder, 50nm, 99% | 12069-32-8 | 5g |
| GX3429-10g | Boron carbide nanopowder, 50nm, 99% | 12069-32-8 | 10g |
| GX3429-25g | Boron carbide nanopowder, 50nm, 99% | 12069-32-8 | 25g |
| GX3429-100g | Boron carbide nanopowder, 50nm, 99% | 12069-32-8 | 100g |
| GX8717-250g | Boron nitride | 10043-11-5 | 250g |
| GX5901-5g | Boron nitride Nanopowder, 99.0% | 10043-11-5 | 5g |
| GX5901-10g | Boron nitride Nanopowder, 99.0% | 10043-11-5 | 10g |
| GX5307-10g | Boron nitride Nanopowder, 99.0% [APS 70 nm] | 10043-11-5 | 10g |
| GX5307-25g | Boron nitride Nanopowder, 99.0% [APS 70 nm] | 10043-11-5 | 25g |
| GX5307-50g | Boron nitride Nanopowder, 99.0% [APS 70 nm] | 10043-11-5 | 50g |
| GX5307-100g | Boron nitride Nanopowder, 99.0% [APS 70 nm] | 10043-11-5 | 100g |
| GX1186-100mm | Boron nitride, rod | 10043-11-5 | 100mm |
| GX1186-250mm | Boron nitride, rod | 10043-11-5 | 250mm |
| GX5870-500g | Boron oxide, 97+% | 1303-86-2 | 500g |
| GX5890-25g | Boron oxide, 99.9% | 1303-86-2 | 25g |
| GX5890-50g | Boron oxide, 99.9% | 1303-86-2 | 50g |
| GX8642-25g | Boron oxide, 99.99% | 1303-86-2 | 25g |
| GX8642-100g | Boron oxide, 99.99% | 1303-86-2 | 100g |
| GX7757-10g | Boron oxide, 99.999% | 1303-86-2 | 10g |
| GX7757-50g | Boron oxide, 99.999% | 1303-86-2 | 50g |
| GX9595-100g | Boron phosphate, anhydrous (powder max. 250 microns) | 13308-51-5 | 100g |
| GX9595-500g | Boron phosphate, anhydrous (powder max. 250 microns) | 13308-51-5 | 500g |
| GX2027-25g | Boron Pieces, crystalline, 1-20 mm, 99% | 7440-42-8 | 25g |
| GX2027-100g | Boron Pieces, crystalline, 1-20 mm, 99% | 7440-42-8 | 100g |
| GX4761-1g | Boron Powder max. 1000 micron, crystalline, doping grade, 99.995% | 7440-42-8 | 1g |
| GX4761-5g | Boron Powder max. 1000 micron, crystalline, doping grade, 99.995% | 7440-42-8 | 5g |
| GX6932-1g | Boron Powder, amorphous, 2 micron, 99,9% | 7440-42-8 | 1g |
| GX6932-5g | Boron Powder, amorphous, 2 micron, 99,9% | 7440-42-8 | 5g |
| GX7777-10g | Boron Powder, amorphous, 95-97% | 7440-42-8 | 10g |
| GX7777-50g | Boron Powder, amorphous, 95-97% | 7440-42-8 | 50g |
| GX6952-10g | Boron Powder, crystalline, 40 micron, 99% | 7440-42-8 | 10g |
| GX6952-25g | Boron Powder, crystalline, 40 micron, 99% | 7440-42-8 | 25g |
| GX6952-100g | Boron Powder, crystalline, 40 micron, 99% | 7440-42-8 | 100g |
| GX2200-1g | Boron Powder, crystalline, -4 mesh, 99.95+% | 7440-42-8 | 1g |
| GA9584-500ug | Borrelidin | 7184-60-3 | 500ug |
| GA9584-1mg | Borrelidin | 7184-60-3 | 1mg |
| GA9584-5mg | Borrelidin | 7184-60-3 | 5mg |
| GP0262-5mg | Bortezomib | 179324-69-7 | 5mg |
| GP0262-25mg | Bortezomib | 179324-69-7 | 25mg |
| GP5893-10mg | Bosentan hydrate | 157212-55-0 | 10mg |
| GP5893-50mg | Bosentan hydrate | 157212-55-0 | 50mg |
| GP5893-100mg | Bosentan hydrate | 157212-55-0 | 100mg |
| GW5061-250ug | Bostrycin | 21879-81-2 | 250ug |
| GW5061-1mg | Bostrycin | 21879-81-2 | 1mg |
| GE1877-10g | Bovine Serum Albumin | 9048-46-8 | 10g |
| GE1877-25g | Bovine Serum Albumin | 9048-46-8 | 25g |
| GE1877-50g | Bovine Serum Albumin | 9048-46-8 | 50g |
| GE1877-100g | Bovine Serum Albumin | 9048-46-8 | 100g |
| GE1877-250g | Bovine Serum Albumin | 9048-46-8 | 250g |
| GE1877-500g | Bovine Serum Albumin | 9048-46-8 | 500g |
| GE3699-10g | Bovine Serum Albumin, 98% by electrophoresis | 9048-46-8 | 10g |
| GE3699-25g | Bovine Serum Albumin, 98% by electrophoresis | 9048-46-8 | 25g |
| GE3699-100g | Bovine Serum Albumin, 98% by electrophoresis | 9048-46-8 | 100g |
| GE3699-250g | Bovine Serum Albumin, 98% by electrophoresis | 9048-46-8 | 250g |
| GE3699-500g | Bovine Serum Albumin, 98% by electrophoresis | 9048-46-8 | 500g |
| GK9808-10g | Bovine Serum Albumin, 99% | 9048-46-8 | 10g |
| GK9808-25g | Bovine Serum Albumin, 99% | 9048-46-8 | 25g |
| GK9808-50g | Bovine Serum Albumin, 99% | 9048-46-8 | 50g |
| GK9808-100g | Bovine Serum Albumin, 99% | 9048-46-8 | 100g |
| GK9808-250g | Bovine Serum Albumin, 99% | 9048-46-8 | 250g |
| GK9808-500g | Bovine Serum Albumin, 99% | 9048-46-8 | 500g |
| GX5685-500g | Bovine Serum Albumin, fatty acid free | 9048-46-8 | 500g |
| GX5685-1kg | Bovine Serum Albumin, fatty acid free | 9048-46-8 | 1kg |
| GX7143-500g | Bovine Serum Albumin, GlenCell™, suitable for cell culture | 9048-46-8 | 500g |
| GX7143-1kg | Bovine Serum Albumin, GlenCell™, suitable for cell culture | 9048-46-8 | 1kg |
| GX4209-500g | Bovine Serum Albumin, pH 5.2 | 9048-46-8 | 500g |
| GX4209-1kg | Bovine Serum Albumin, pH 5.2 | 9048-46-8 | 1kg |
| GK4012-500g | Bovine Serum Albumin, protease free | 9048-46-8 | 500g |
| GK4012-1kg | Bovine Serum Albumin, protease free | 9048-46-8 | 1kg |
| GW0930-1mg | BPTES | 314045-39-1 | 1mg |
| GW0930-5mg | BPTES | 314045-39-1 | 5mg |
| GW0930-25mg | BPTES | 314045-39-1 | 25mg |
| GL1210-5mg | bpV(bipy) | 42494-71-3 (anhydrous) | 5mg |
| GW1112-5mg | bpV(bipy) | 1173697-60-3 | 5mg |
| GL1210-25mg | bpV(bipy) | 42494-71-3 (anhydrous) | 25mg |
| GW1112-25mg | bpV(bipy) | 1173697-60-3 | 25mg |
| GL1269-5mg | bpV(HOpic) | 722494-26-0 | 5mg |
| GL1269-25mg | bpV(HOpic) | 722494-26-0 | 25mg |
| GL3049-5mg | bpV(phen) | 171202-16-7 | 5mg |
| GL3049-25mg | bpV(phen) | 171202-16-7 | 25mg |
| GL2206-5mg | bpV(pic) | 148556-27-8 | 5mg |
| GL2206-25mg | bpV(pic) | 148556-27-8 | 25mg |
| GL7446-1mg | BQ-123 sodium salt | 136655-57-7 | 1mg |
| GL7446-5mg | BQ-123 sodium salt | 136655-57-7 | 5mg |
| GK9247-500ug | BQ-788 | 156161-89-6 | 500ug |
| GK9247-1mg | BQ-788 | 156161-89-6 | 1mg |
| GT1202-500ml | Bradford Reagent | - | 500ml |
| GT1202-1l | Bradford Reagent | - | 1l |
| GL7727-5mg | Bradykinin | 121283-65-6 | 5mg |
| GL7727-25mg | Bradykinin | 121283-65-6 | 25mg |
| GA2848-5mg | Brefeldin A | 20350-15-6 | 5mg |
| GA2848-10mg | Brefeldin A | 20350-15-6 | 10mg |
| GA2848-25mg | Brefeldin A | 20350-15-6 | 25mg |
| GA2848-50mg | Brefeldin A | 20350-15-6 | 50mg |
| GA2848-100mg | Brefeldin A | 20350-15-6 | 100mg |
| GW0185-5mg | Brigatinib | 1197953-54-0 | 5mg |
| GW0185-25mg | Brigatinib | 1197953-54-0 | 25mg |
| GD4393-100g | Brij 35 (Laureth-23) | 9002-92-0 | 100g |
| GD4393-500g | Brij 35 (Laureth-23) | 9002-92-0 | 500g |
| GD4393-1kg | Brij 35 (Laureth-23) | 9002-92-0 | 1kg |
| GD6153-100ml | Brij 35, 10% solution in water | 9002-92-0 | 100ml |
| GD6153-1l | Brij 35, 10% solution in water | 9002-92-0 | 1l |
| GD7901-1l | Brij 35, 30% solution in water | 9002-92-0 | 1l |
| GD7901-2500ml | Brij 35, 30% solution in water | 9002-92-0 | 2500ml |
| GT6953-10g | Brilliant Black BN (C.I. 28440) | 2519-30-4 | 10g |
| GT6953-25g | Brilliant Black BN (C.I. 28440) | 2519-30-4 | 25g |
| GT6953-100g | Brilliant Black BN (C.I. 28440) | 2519-30-4 | 100g |
| GT9275-10g | Brilliant Cresyl Blue (C.I. 51010) | 81029-05-2 | 10g |
| GT9275-25g | Brilliant Cresyl Blue (C.I. 51010) | 81029-05-2 | 25g |
| GT8393-50g | Brilliant Crocein (C.I. 27290) | 5413-75-2 | 50g |
| GT8393-100g | Brilliant Crocein (C.I. 27290) | 5413-75-2 | 100g |
| GT8393-250g | Brilliant Crocein (C.I. 27290) | 5413-75-2 | 250g |
| GT6123-25g | Brilliant Green (C.I. 42040) | 633-03-4 | 25g |
| GT6123-100g | Brilliant Green (C.I. 42040) | 633-03-4 | 100g |
| GP9698-250mg | Brimonidine | 59803-98-4 | 250mg |
| GP9698-1g | Brimonidine | 59803-98-4 | 1g |
| GP5583-10mg | Brinzolamide | 138890-62-7 | 10mg |
| GP5583-50mg | Brinzolamide | 138890-62-7 | 50mg |
| GP1791-1mg | Brivanib alaninate | 649735-63-7 | 1mg |
| GP1791-5mg | Brivanib alaninate | 649735-63-7 | 5mg |
| GP1791-10mg | Brivanib alaninate | 649735-63-7 | 10mg |
| GE4830-25g | Bromelain | 37189-34-7 | 25g |
| GE4830-100g | Bromelain | 37189-34-7 | 100g |
| GE4830-250g | Bromelain | 37189-34-7 | 250g |
| GP2862-25g | Bromelain, 1200 GDU/g | 37189-34-7 | 25g |
| GP2862-100g | Bromelain, 1200 GDU/g | 37189-34-7 | 100g |
| GP2862-250g | Bromelain, 1200 GDU/g | 37189-34-7 | 250g |
| GP1741-25g | Bromelain, 2500 GDU/g | 37189-34-7 | 25g |
| GP1741-100g | Bromelain, 2500 GDU/g | 37189-34-7 | 100g |
| GL4176-5mg | Bromfenac sodium | 91714-93-1 | 5mg |
| GL4176-25mg | Bromfenac sodium | 91714-93-1 | 25mg |
| GL4176-100mg | Bromfenac sodium | 91714-93-1 | 100mg |
| GP8354-25g | Bromhexine hydrochloride | 611-75-6 | 25g |
| GP8354-100g | Bromhexine hydrochloride | 611-75-6 | 100g |
| GC9191-1g | Bromo 2,3,4-Tri-O-acetyl-α-D-xylopyranoside | 3068-31-3 | 1g |
| GC9191-2g | Bromo 2,3,4-Tri-O-acetyl-α-D-xylopyranoside | 3068-31-3 | 2g |
| GC9191-5g | Bromo 2,3,4-Tri-O-acetyl-α-D-xylopyranoside | 3068-31-3 | 5g |
| GC8096-500mg | Bromo-2,3,4-tri-O-benzoyl-α-D-glucuronic acid methyl ester | 103674-69-7 | 500mg |
| GC8096-1g | Bromo-2,3,4-tri-O-benzoyl-α-D-glucuronic acid methyl ester | 103674-69-7 | 1g |
| GC8096-2g | Bromo-2,3,4-tri-O-benzoyl-α-D-glucuronic acid methyl ester | 103674-69-7 | 2g |
| GC8096-5g | Bromo-2,3,4-tri-O-benzoyl-α-D-glucuronic acid methyl ester | 103674-69-7 | 5g |
| GL0337-100g | Bromoacetic acid | 79-08-3 | 100g |
| GK9405-100g | Bromobenzene | 108-86-1 | 100g |
| GT1727-100mg | Bromobimane | 71418-44-5 | 100mg |
| GW7200-100mg | Bromobutide | 74712-19-9 | 100mg |
| GW7200-250mg | Bromobutide | 74712-19-9 | 250mg |
| GT2674-100mg | Bromochlorophenol Blue | 2553-71-1 | 100mg |
| GT2674-1g | Bromochlorophenol Blue | 2553-71-1 | 1g |
| GT4023-5g | Bromocresol Green | 76-60-8 | 5g |
| GT4023-25g | Bromocresol Green | 76-60-8 | 25g |
| GT3714-5g | Bromocresol Green sodium salt | 62625-32-5 | 5g |
| GT3714-25g | Bromocresol Green sodium salt | 62625-32-5 | 25g |
| GT3714-100g | Bromocresol Green sodium salt | 62625-32-5 | 100g |
| GT6323-10g | Bromocresol Purple | 115-40-2 | 10g |
| GT6323-25g | Bromocresol Purple | 115-40-2 | 25g |
| GT6323-100g | Bromocresol Purple | 115-40-2 | 100g |
| GT6323-250g | Bromocresol Purple | 115-40-2 | 250g |
| GT2398-5g | Bromocresol Purple sodium salt | 62625-30-3 | 5g |
| GT2398-10g | Bromocresol Purple sodium salt | 62625-30-3 | 10g |
| GT2398-25g | Bromocresol Purple sodium salt | 62625-30-3 | 25g |
| GT2398-50g | Bromocresol Purple sodium salt | 62625-30-3 | 50g |
| GP6938-25mg | Bromocryptine mesylate | 22260-51-1 | 25mg |
| GP6938-100mg | Bromocryptine mesylate | 22260-51-1 | 100mg |
| GK1395-250g | Bromoform | 75-25-2 | 250g |
| GK6888-1g | Bromomethyl acetate | 590-97-6 | 1g |
| GK6888-5g | Bromomethyl acetate | 590-97-6 | 5g |
| GP1233-5g | Bromopheniramine maleate | 980-71-2 | 5g |
| GT2874-5g | Bromophenol Blue | 115-39-9 | 5g |
| GT2874-10g | Bromophenol Blue | 115-39-9 | 10g |
| GT2874-25g | Bromophenol Blue | 115-39-9 | 25g |
| GT2874-50g | Bromophenol Blue | 115-39-9 | 50g |
| GT2874-100g | Bromophenol Blue | 115-39-9 | 100g |
| GT3694-5g | Bromophenol Blue sodium salt | 34725-61-6 | 5g |
| GT3694-25g | Bromophenol Blue sodium salt | 34725-61-6 | 25g |
| GT3694-50g | Bromophenol Blue sodium salt | 34725-61-6 | 50g |
| GT7578-1g | Bromophenol Red | 2800-80-8 | 1g |
| GT7578-5g | Bromophenol Red | 2800-80-8 | 5g |
| GT7578-10g | Bromophenol Red | 2800-80-8 | 10g |
| GT7578-25g | Bromophenol Red | 2800-80-8 | 25g |
| GT3415-5g | Bromophenol Red sodium salt | 102185-50-2 | 5g |
| GT1579-5g | Bromopyrogallol Red | 16574-43-9 | 5g |
| GT6837-5g | Bromothymol Blue | 76-59-5 | 5g |
| GT6837-10g | Bromothymol Blue | 76-59-5 | 10g |
| GT6837-25g | Bromothymol Blue | 76-59-5 | 25g |
| GT6837-50g | Bromothymol Blue | 76-59-5 | 50g |
| GT8636-10g | Bromothymol Blue sodium salt | 34722-90-2 | 10g |
| GT8636-25g | Bromothymol Blue sodium salt | 34722-90-2 | 25g |
| GT8636-50g | Bromothymol Blue sodium salt | 34722-90-2 | 50g |
| GT8636-100g | Bromothymol Blue sodium salt | 34722-90-2 | 100g |
| GK0957-25g | Bromotrimethylsilane | 2857-97-8 | 25g |
| GT8506-1g | Bromoxylenol Blue | 40070-59-5 | 1g |
| GT8506-5g | Bromoxylenol Blue | 40070-59-5 | 5g |
| GT8506-10g | Bromoxylenol Blue | 40070-59-5 | 10g |
| GW6003-5mg | BTBCT | 525560-81-0 | 5mg |
| GW6003-50mg | BTBCT | 525560-81-0 | 50mg |
| GW6003-250mg | BTBCT | 525560-81-0 | 250mg |
| GP6149-250mg | Bucillamine | 65002-17-7 | 250mg |
| GP6149-1g | Bucillamine | 65002-17-7 | 1g |
| GP1820-250mg | Budesonide | 51333-22-3 | 250mg |
| GP1820-1g | Budesonide | 51333-22-3 | 1g |
| GL7257-10mg | Bufalin | 465-21-4 | 10mg |
| GL7257-50mg | Bufalin | 465-21-4 | 50mg |
| GP6678-5g | Bufexamac | 2438-72-4 | 5g |
| GE6195-1l | Buffer solution, pH 10.0 | - | 1l |
| GE5959-1l | Buffer solution, pH 4.0 | - | 1l |
| GE8685-1l | Buffer solution, pH 7.0 | - | 1l |
| GE5737-1l | Buffer solution, pH 7.4 | - | 1l |
| GE4974-1l | Buffer solution, pH 9.0 | - | 1l |
| GP0360-250mg | Bumetanide | 28395-03-1 | 250mg |
| GP0360-1g | Bumetanide | 28395-03-1 | 1g |
| GP0360-5g | Bumetanide | 28395-03-1 | 5g |
| GP0621-1g | Bupivacaine | 38396-39-3 | 1g |
| GP0621-5g | Bupivacaine | 38396-39-3 | 5g |
| GP3506-5g | Bupivacaine hydrochloride | 18010-40-7 | 5g |
| GP3506-25g | Bupivacaine hydrochloride | 18010-40-7 | 25g |
| GP3506-100g | Bupivacaine hydrochloride | 18010-40-7 | 100g |
| GP7829-5g | Busulfan | 55-98-1 | 5g |
| GP7829-10g | Busulfan | 55-98-1 | 10g |
| GP7829-25g | Busulfan | 55-98-1 | 25g |
| GP7829-100g | Busulfan | 55-98-1 | 100g |
| GX4252-1g | Butafosfan | 17316-67-5 | 1g |
| GS5432-100ml | Butan-1-ol, GlenDry™, anhydrous | 71-36-3 | 100ml |
| GS5432-500ml | Butan-1-ol, GlenDry™, anhydrous | 71-36-3 | 500ml |
| GS5432-1l | Butan-1-ol, GlenDry™, anhydrous | 71-36-3 | 1l |
| GS5432-2500ml | Butan-1-ol, GlenDry™, anhydrous | 71-36-3 | 2500ml |
| GS7439-500ml | Butan-1-ol, GlenPure™, analytical grade | 71-36-3 | 500ml |
| GS7439-1l | Butan-1-ol, GlenPure™, analytical grade | 71-36-3 | 1l |
| GS7439-2500ml | Butan-1-ol, GlenPure™, analytical grade | 71-36-3 | 2500ml |
| GW2762-100mg | Butocarboxim | 34681-10-2 | 100mg |
| GW2762-250mg | Butocarboxim | 34681-10-2 | 250mg |
| GW5987-25mg | Butroxydim | 138164-12-2 | 25mg |
| GW5987-100mg | Butroxydim | 138164-12-2 | 100mg |
| GP2383-25g | Butyl 4-aminobenzoate | 94-25-7 | 25g |
| GP2383-100g | Butyl 4-aminobenzoate | 94-25-7 | 100g |
| GY1184-100g | Butyl 4-hydroxybenzoate | 94-26-8 | 100g |
| GY1184-250g | Butyl 4-hydroxybenzoate | 94-26-8 | 250g |
| GY1184-1kg | Butyl 4-hydroxybenzoate | 94-26-8 | 1kg |
| GK3603-100ml | Butyl acetate | 123-86-4 | 100ml |
| GK3603-500ml | Butyl acetate | 123-86-4 | 500ml |
| GK7014-25ml | Butylamine | 109-73-9 | 25ml |
| GK0616-100g | Butylated hydroxyanisole | 25013-16-5 | 100g |
| GK0616-250g | Butylated hydroxyanisole | 25013-16-5 | 250g |
| GK0616-500g | Butylated hydroxyanisole | 25013-16-5 | 500g |
| GK0616-1kg | Butylated hydroxyanisole | 25013-16-5 | 1kg |
| GK4584-500g | Butylated hydroxytoluene | 128-37-0 | 500g |
| GK4584-1kg | Butylated hydroxytoluene | 128-37-0 | 1kg |
| GL4464-250ug | Butylcycloheptylprodigiosin | 352304-41-7 | 250ug |
| GL4464-1mg | Butylcycloheptylprodigiosin | 352304-41-7 | 1mg |
| GK6366-5g | Butyltriphenylphosphonium bromide | 1779-51-7 | 5g |
| GK6366-25g | Butyltriphenylphosphonium bromide | 1779-51-7 | 25g |
| GK6366-100g | Butyltriphenylphosphonium bromide | 1779-51-7 | 100g |
| GK6366-250g | Butyltriphenylphosphonium bromide | 1779-51-7 | 250g |
| GL3233-100g | Butyramide | 541-35-5 | 100g |
| GL3233-500g | Butyramide | 541-35-5 | 500g |
| GK5603-25ml | Butyric acid | 107-92-6 | 25ml |
| GK5603-100ml | Butyric acid | 107-92-6 | 100ml |
| GL5462-2mg | Butyrolactone 3 | 778649-18-6 | 2mg |
| GL5924-200ug | Butyrolactone I | 87414-49-1 | 200ug |
| GL5924-1mg | Butyrolactone I | 87414-49-1 | 1mg |
| GL5924-5mg | Butyrolactone I | 87414-49-1 | 5mg |
| GL0025-500ug | Butyrolactone II | 87414-44-6 | 500ug |
| GE4710-1g | Butyrylcholine chloride | 2963-78-2 | 1g |
| GE4710-5g | Butyrylcholine chloride | 2963-78-2 | 5g |
| GE5713-1g | Butyrylthiocholine chloride | 22026-63-7 | 1g |
| GE5713-5g | Butyrylthiocholine chloride | 22026-63-7 | 5g |
| GE8740-5g | Butyrylthiocholine iodide | 1866-16-6 | 5g |
| GE8740-25g | Butyrylthiocholine iodide | 1866-16-6 | 25g |
| GW6654-1mg | BX-795 | 702675-74-9 | 1mg |
| GW6654-5mg | BX-795 | 702675-74-9 | 5mg |
| GW6654-10mg | BX-795 | 702675-74-9 | 10mg |
| GW1300-1mg | BX-912 | 702674-56-4 | 1mg |
| GW1300-5mg | BX-912 | 702674-56-4 | 5mg |
| GW1300-10mg | BX-912 | 702674-56-4 | 10mg |
| GM1618-5g | Bz-Arg-OEt hydrochloride | 2645-08-1 | 5g |
| GM1618-10g | Bz-Arg-OEt hydrochloride | 2645-08-1 | 10g |
| GM1618-25g | Bz-Arg-OEt hydrochloride | 2645-08-1 | 25g |
| GL5672-1mg | C646 | 328968-36-1 | 1mg |
| GL5672-5mg | C646 | 328968-36-1 | 5mg |
| GW5222-5mg | CA77.1 [CMA Activator] | 2412270-22-3 | 5mg |
| GW5222-25mg | CA77.1 [CMA Activator] | 2412270-22-3 | 25mg |
| GK0751-25mg | Cabazitaxel | 183133-96-2 | 25mg |
| GK0751-100mg | Cabazitaxel | 183133-96-2 | 100mg |
| GW6378-10mg | Cabozantinib | 849217-68-1 | 10mg |
| GW6378-50mg | Cabozantinib | 849217-68-1 | 50mg |
| GP4726-100mg | Cabozantinib malate | 1140909-48-3 | 100mg |
| GP4726-500mg | Cabozantinib malate | 1140909-48-3 | 500mg |
| GP4726-1g | Cabozantinib malate | 1140909-48-3 | 1g |
| GK4749-25g | CABS | 161308-34-5 | 25g |
| GX8912-5g | Cadmium acetate anhydrous, 99.999% | 543-90-8 | 5g |
| GX8912-25g | Cadmium acetate anhydrous, 99.999% | 543-90-8 | 25g |
| GX5619-100g | Cadmium acetate dihydrate, 98+% | 5743-04-4 | 100g |
| GX4807-250g | Cadmium Bar, 99.999% | 7440-43-9 | 250g |
| GX2127-25g | Cadmium carbonate, 99.999% | 513-78-0 | 25g |
| GX1555-100g | Cadmium chloride, anhydrous, 99+% | 10108-64-2 | 100g |
| GX8224-10g | Cadmium fluoride, 99.99+% | 7790-79-6 | 10g |
| GX8224-25g | Cadmium fluoride, 99.99+% | 7790-79-6 | 25g |
| GX8224-100g | Cadmium fluoride, 99.99+% | 7790-79-6 | 100g |
| GX2581-50x50mm | Cadmium Foil 0.125mm, 99.999% | 7440-43-9 | 50x50mm |
| GX2581-100x100mm | Cadmium Foil 0.125mm, 99.999% | 7440-43-9 | 100x100mm |
| GX0787-50x50mm | Cadmium Foil 0.25mm, 99.99% | 7440-43-9 | 50x50mm |
| GX0787-100x100mm | Cadmium Foil 0.25mm, 99.99% | 7440-43-9 | 100x100mm |
| GX0787-100x200mm | Cadmium Foil 0.25mm, 99.99% | 7440-43-9 | 100x200mm |
| GX2652-50x50mm | Cadmium Foil 0.5mm, 99.99% | 7440-43-9 | 50x50mm |
| GX2652-100x100mm | Cadmium Foil 0.5mm, 99.99% | 7440-43-9 | 100x100mm |
| GX2652-100x200mm | Cadmium Foil 0.5mm, 99.99% | 7440-43-9 | 100x200mm |
| GX7681-50x50mm | Cadmium Foil 1.0mm, 99.99% | 7440-43-9 | 50x50mm |
| GX7681-100x100mm | Cadmium Foil 1.0mm, 99.99% | 7440-43-9 | 100x100mm |
| GX7681-100x200mm | Cadmium Foil 1.0mm, 99.99% | 7440-43-9 | 100x200mm |
| GX2578-50g | Cadmium Granules 1-5 mm, 99.999% | 7440-43-9 | 50g |
| GX2578-250g | Cadmium Granules 1-5 mm, 99.999% | 7440-43-9 | 250g |
| GX7208-50g | Cadmium Granules 1-5 mm, 99.9999% | 7440-43-9 | 50g |
| GX7208-250g | Cadmium Granules 1-5 mm, 99.9999% | 7440-43-9 | 250g |
| GX5272-250g | Cadmium iodide, 99% | 7790-80-9 | 250g |
| GX5303-25g | Cadmium oxide, 99.999% | 1306-19-0 | 25g |
| GX5303-100g | Cadmium oxide, 99.999% | 1306-19-0 | 100g |
| GX1084-100g | Cadmium Powder -325 mesh, 99.5% | 7440-43-9 | 100g |
| GX4548-140mm | Cadmium Rod 10 mm diameter, 99.9% | 7440-43-9 | 140mm |
| GX1723-250mm | Cadmium Rod 8 mm diameter, 99.999% | 7440-43-9 | 250mm |
| GX6596-10g | Cadmium selenide, 99.99+% | 1306-24-7 | 10g |
| GX6596-50g | Cadmium selenide, 99.99+% | 1306-24-7 | 50g |
| GX9718-100g | Cadmium sulfate hydrate, 98+% | 15244-35-6 | 100g |
| GX7317-50g | Cadmium sulfate, anhydrous, 99.99+% | 10124-36-4 | 50g |
| GX6019-1m | Cadmium Wire 1.0 mm diameter, 99.999% | 7440-43-9 | 1m |
| GX6019-2m | Cadmium Wire 1.0 mm diameter, 99.999% | 7440-43-9 | 2m |
| GW9174-50mg | Cadusafos | 95465-99-9 | 50mg |
| GW9174-250mg | Cadusafos | 95465-99-9 | 250mg |
| GX0291-1mg | Caerulein, Ceruletide, Cerulein | 17650-98-5 | 1mg |
| GE7657-25g | Caesium chloride | 7647-17-8 | 25g |
| GE7657-100g | Caesium chloride | 7647-17-8 | 100g |
| GE7657-250g | Caesium chloride | 7647-17-8 | 250g |
| GE7657-500g | Caesium chloride | 7647-17-8 | 500g |
| GP1593-5g | Caffeic acid | 331-39-5 | 5g |
| GP1593-10g | Caffeic acid | 331-39-5 | 10g |
| GP1593-25g | Caffeic acid | 331-39-5 | 25g |
| GP1593-50g | Caffeic acid | 331-39-5 | 50g |
| GP1593-100g | Caffeic acid | 331-39-5 | 100g |
| GC3896-1mg | Caffeic acid 3-b-D-glucoside | 24959-81-7 | 1mg |
| GC3896-2mg | Caffeic acid 3-b-D-glucoside | 24959-81-7 | 2mg |
| GC3896-5mg | Caffeic acid 3-b-D-glucoside | 24959-81-7 | 5mg |
| GC3896-10mg | Caffeic acid 3-b-D-glucoside | 24959-81-7 | 10mg |
| GC3896-25mg | Caffeic acid 3-b-D-glucoside | 24959-81-7 | 25mg |
| GC3370-1mg | Caffeic acid 3-O-β-D-glucuronide | 1093679-73-2 | 1mg |
| GC3370-2mg | Caffeic acid 3-O-β-D-glucuronide | 1093679-73-2 | 2mg |
| GC3370-5mg | Caffeic acid 3-O-β-D-glucuronide | 1093679-73-2 | 5mg |
| GC3370-10mg | Caffeic acid 3-O-β-D-glucuronide | 1093679-73-2 | 10mg |
| GK2776-250mg | Caffeic acid phenethyl ester | 104594-70-9 | 250mg |
| GK2776-1g | Caffeic acid phenethyl ester | 104594-70-9 | 1g |
| GP1191-100g | Caffeine, 99% | 58-08-2 | 100g |
| GP1191-500g | Caffeine, 99% | 58-08-2 | 500g |
| GP1191-1kg | Caffeine, 99% | 58-08-2 | 1kg |
| GP3094-25g | Caffeine, Ph. Eur., USP grade | 58-08-2 | 25g |
| GP3094-100g | Caffeine, Ph. Eur., USP grade | 58-08-2 | 100g |
| GP3094-500g | Caffeine, Ph. Eur., USP grade | 58-08-2 | 500g |
| GP3094-1kg | Caffeine, Ph. Eur., USP grade | 58-08-2 | 1kg |
| GK2524-1g | Calcein | 154071-48-4 | 1g |
| GK2524-5g | Calcein | 154071-48-4 | 5g |
| GK2524-10g | Calcein | 154071-48-4 | 10g |
| GK2524-25g | Calcein | 154071-48-4 | 25g |
| GK2524-100g | Calcein | 154071-48-4 | 100g |
| GT0291-1mg | Calcein-AM | 148504-34-1 | 1mg |
| GP9482-1mg | Calcitriol | 32222-06-3 | 1mg |
| GX2908-100g | Calcium 2,4-pentanedionate | 19372-44-2 | 100g |
| GX2908-250g | Calcium 2,4-pentanedionate | 19372-44-2 | 250g |
| GE2473-100g | Calcium acetate hydrate | 62-54-4 | 100g |
| GE2473-250g | Calcium acetate hydrate | 62-54-4 | 250g |
| GE2473-500g | Calcium acetate hydrate | 62-54-4 | 500g |
| GE2473-1kg | Calcium acetate hydrate | 62-54-4 | 1kg |
| GX9364-5g | Calcium aluminate, 99% | 12042-68-1 | 5g |
| GX9364-25g | Calcium aluminate, 99% | 12042-68-1 | 25g |
| GX9364-100g | Calcium aluminate, 99% | 12042-68-1 | 100g |
| GX2588-100g | Calcium boride | 12007-99-7 | 100g |
| GX1601-100g | Calcium carbonate, 99.9% | 471-34-1 | 100g |
| GK3384-500g | Calcium carbonate, 99% | 471-34-1 | 500g |
| GK3384-1kg | Calcium carbonate, 99% | 471-34-1 | 1kg |
| GK3384-5kg | Calcium carbonate, 99% | 471-34-1 | 5kg |
| GX0868-1kg | Calcium carbonate, 99%, precipitated, Ph. Eur., BP, USP, FCC grade | 471-34-1 | 1kg |
| GK8162-5kg | Calcium carbonate, technical | 471-34-1 | 5kg |
| GK8162-25kg | Calcium carbonate, technical | 471-34-1 | 25kg |
| GX4694-100g | Calcium caseinate | 9005-43-0 | 100g |
| GX4694-250g | Calcium caseinate | 9005-43-0 | 250g |
| GX4694-500g | Calcium caseinate | 9005-43-0 | 500g |
| GK9858-100g | Calcium chloride dihydrate | 10035-04-8 | 100g |
| GK9858-250g | Calcium chloride dihydrate | 10035-04-8 | 250g |
| GK9858-500g | Calcium chloride dihydrate | 10035-04-8 | 500g |
| GK9858-1kg | Calcium chloride dihydrate | 10035-04-8 | 1kg |
| GK9858-5kg | Calcium chloride dihydrate | 10035-04-8 | 5kg |
| GX0152-1kg | Calcium chloride dihydrate, fine crystals, Ph. Eur., USP grade | 10035-04-8 | 1kg |
| GK3739-250g | Calcium chloride, anhydrous | 10043-52-4 | 250g |
| GK3739-500g | Calcium chloride, anhydrous | 10043-52-4 | 500g |
| GK3739-1kg | Calcium chloride, anhydrous | 10043-52-4 | 1kg |
| GK3739-5kg | Calcium chloride, anhydrous | 10043-52-4 | 5kg |
| GE5772-250g | Calcium chloride, anhydrous, 95%, granular, 1 mm | 10043-52-4 | 250g |
| GE5772-1kg | Calcium chloride, anhydrous, 95%, granular, 1 mm | 10043-52-4 | 1kg |
| GE5772-5kg | Calcium chloride, anhydrous, 95%, granular, 1 mm | 10043-52-4 | 5kg |
| GK8811-100g | Calcium chloride, anhydrous, granular, 1 - 6 mm | 10043-52-4 | 100g |
| GK8811-250g | Calcium chloride, anhydrous, granular, 1 - 6 mm | 10043-52-4 | 250g |
| GK8811-500g | Calcium chloride, anhydrous, granular, 1 - 6 mm | 10043-52-4 | 500g |
| GK8811-1kg | Calcium chloride, anhydrous, granular, 1 - 6 mm | 10043-52-4 | 1kg |
| GK8811-5kg | Calcium chloride, anhydrous, granular, 1 - 6 mm | 10043-52-4 | 5kg |
| GX0974-1kg | Calcium citrate tetrahydrate | 5785-44-4 | 1kg |
| GC7882-100g | Calcium D-gluconate monohydrate, USP grade | 66905-23-5 | 100g |
| GC7882-250g | Calcium D-gluconate monohydrate, USP grade | 66905-23-5 | 250g |
| GC7882-500g | Calcium D-gluconate monohydrate, USP grade | 66905-23-5 | 500g |
| GC7882-1kg | Calcium D-gluconate monohydrate, USP grade | 66905-23-5 | 1kg |
| GC7882-5kg | Calcium D-gluconate monohydrate, USP grade | 66905-23-5 | 5kg |
| GX2796-100g | Calcium fluoride, 99.5% | 7789-75-5 | 100g |
| GX8804-25g | Calcium fluoride, 99.9% | 7789-75-5 | 25g |
| GX8804-100g | Calcium fluoride, 99.9% | 7789-75-5 | 100g |
| GK2342-500g | Calcium fluoride, 99% | 7789-75-5 | 500g |
| GX2349-100g | Calcium formiate, tech. | 544-17-2 | 100g |
| GX2349-1kg | Calcium formiate, tech. | 544-17-2 | 1kg |
| GE8136-100g | Calcium glycerophosphate | 27214-00-2 | 100g |
| GE8136-250g | Calcium glycerophosphate | 27214-00-2 | 250g |
| GE8136-500g | Calcium glycerophosphate | 27214-00-2 | 500g |
| GE8136-1kg | Calcium glycerophosphate | 27214-00-2 | 1kg |
| GX0580-100g | Calcium Granules -6 mesh, 99.5% | 7440-70-2 | 100g |
| GX1137-100g | Calcium Granules 2-6 mm, 98.5+% | 7440-70-2 | 100g |
| GP2596-1mg | Calcium hopantenate | 17097-76-6 | 1mg |
| GK0014-1kg | Calcium hydroxide | 1305-62-0 | 1kg |
| GK0014-5kg | Calcium hydroxide | 1305-62-0 | 5kg |
| GX9138-1kg | Calcium hydroxide, 96% | 1305-62-0 | 1kg |
| GX2264-1kg | Calcium hypophosphite | 7789-79-9 | 1kg |
| GX6762-500g | Calcium iodide hydrate, tech. | 10102-68-8 | 500g |
| GE5436-1mg | Calcium Ionophore A23187 | 52665-69-7 | 1mg |
| GE5436-5mg | Calcium Ionophore A23187 | 52665-69-7 | 5mg |
| GE5436-10mg | Calcium Ionophore A23187 | 52665-69-7 | 10mg |
| GC5958-5g | Calcium L-threonate | 70753-61-6 | 5g |
| GC5958-25g | Calcium L-threonate | 70753-61-6 | 25g |
| GE4641-100g | Calcium lactate pentahydrate | 28305-25-1 | 100g |
| GE4641-250g | Calcium lactate pentahydrate | 28305-25-1 | 250g |
| GE4641-1kg | Calcium lactate pentahydrate | 28305-25-1 | 1kg |
| GC4356-100g | Calcium lactobionate | 110638-68-1 | 100g |
| GE9273-500g | Calcium nitrate tetrahydrate | 13477-34-4 | 500g |
| GE9273-1kg | Calcium nitrate tetrahydrate | 13477-34-4 | 1kg |
| GE9273-5kg | Calcium nitrate tetrahydrate | 13477-34-4 | 5kg |
| GE9273-10kg | Calcium nitrate tetrahydrate | 13477-34-4 | 10kg |
| GX3982-1kg | Calcium orthophosphate | 7758-87-4 | 1kg |
| GX3982-2kg | Calcium orthophosphate | 7758-87-4 | 2kg |
| GX6350-1kg | Calcium oxalate hydrate, 99% | 5794-28-5 | 1kg |
| GX1175-500g | Calcium oxide | 1305-78-8 | 500g |
| GX1175-1kg | Calcium oxide | 1305-78-8 | 1kg |
| GX1175-5kg | Calcium oxide | 1305-78-8 | 5kg |
| GX5050-10g | Calcium oxide max. 10 microm, 99.99% | 1305-78-8 | 10g |
| GX5050-50g | Calcium oxide max. 10 microm, 99.99% | 1305-78-8 | 50g |
| GX3058-50g | Calcium oxide, 99.95% | 1305-78-8 | 50g |
| GL2559-100g | Calcium phosphate dibasic dihydrate | 7789-77-7 | 100g |
| GL2559-250g | Calcium phosphate dibasic dihydrate | 7789-77-7 | 250g |
| GL2559-500g | Calcium phosphate dibasic dihydrate | 7789-77-7 | 500g |
| GL2559-1kg | Calcium phosphate dibasic dihydrate | 7789-77-7 | 1kg |
| GL2559-5kg | Calcium phosphate dibasic dihydrate | 7789-77-7 | 5kg |
| GL2540-250g | Calcium phosphate dibasic, anhydrous | 7757-93-9 | 250g |
| GL2540-1kg | Calcium phosphate dibasic, anhydrous | 7757-93-9 | 1kg |
| GL2117-100g | Calcium phosphate dibasic, anhydrous, EP, USP grade | 7757-93-9 | 100g |
| GL2117-250g | Calcium phosphate dibasic, anhydrous, EP, USP grade | 7757-93-9 | 250g |
| GL2117-500g | Calcium phosphate dibasic, anhydrous, EP, USP grade | 7757-93-9 | 500g |
| GL2117-1kg | Calcium phosphate dibasic, anhydrous, EP, USP grade | 7757-93-9 | 1kg |
| GL2117-5kg | Calcium phosphate dibasic, anhydrous, EP, USP grade | 7757-93-9 | 5kg |
| GX5985-100g | Calcium phosphate monobasic monohydrate | 10031-30-8 | 100g |
| GX5985-250g | Calcium phosphate monobasic monohydrate | 10031-30-8 | 250g |
| GX5985-500g | Calcium phosphate monobasic monohydrate | 10031-30-8 | 500g |
| GX5985-1kg | Calcium phosphate monobasic monohydrate | 10031-30-8 | 1kg |
| GX5985-5kg | Calcium phosphate monobasic monohydrate | 10031-30-8 | 5kg |
| GE2503-250g | Calcium phosphate tribasic | 12167-74-7 | 250g |
| GE2503-500g | Calcium phosphate tribasic | 12167-74-7 | 500g |
| GE2503-1kg | Calcium phosphate tribasic | 12167-74-7 | 1kg |
| GE2503-5kg | Calcium phosphate tribasic | 12167-74-7 | 5kg |
| GX2539-250g | Calcium propionate | 4075-81-4 | 250g |
| GX2539-1kg | Calcium propionate | 4075-81-4 | 1kg |
| GX2539-5kg | Calcium propionate | 4075-81-4 | 5kg |
| GX9424-1kg | Calcium pyrophosphate, 96+% | 7790-76-3 | 1kg |
| GX9424-5kg | Calcium pyrophosphate, 96+% | 7790-76-3 | 5kg |
| GE6492-25g | Calcium pyruvate | 52009-14-0 | 25g |
| GE6492-100g | Calcium pyruvate | 52009-14-0 | 100g |
| GK5845-1kg | Calcium stearate, non-animal origin | 1592-23-0 | 1kg |
| GK5845-5kg | Calcium stearate, non-animal origin | 1592-23-0 | 5kg |
| GK5062-250g | Calcium sulfate dihydrate | 10101-41-4 | 250g |
| GK5062-1kg | Calcium sulfate dihydrate | 10101-41-4 | 1kg |
| GK5062-5kg | Calcium sulfate dihydrate | 10101-41-4 | 5kg |
| GX7586-1kg | Calcium sulfate dihydrate, BP, Ph. Eur. grade | 10101-41-4 | 1kg |
| GK9093-250g | Calcium sulfate, anhydrous, 99% | 7778-18-9 | 250g |
| GK9093-500g | Calcium sulfate, anhydrous, 99% | 7778-18-9 | 500g |
| GK9093-1kg | Calcium sulfate, anhydrous, 99% | 7778-18-9 | 1kg |
| GK9093-5kg | Calcium sulfate, anhydrous, 99% | 7778-18-9 | 5kg |
| GX0429-250g | Calcium titanate, 99% | 12049-50-2 | 250g |
| GX9049-100g | Calcium tungstate, 99+% | 7790-75-2 | 100g |
| GX9049-250g | Calcium tungstate, 99+% | 7790-75-2 | 250g |
| GK3350-5g | Calconcarboxylic acid | 3737-95-9 | 5g |
| GK3350-25g | Calconcarboxylic acid | 3737-95-9 | 25g |
| GK3350-100g | Calconcarboxylic acid | 3737-95-9 | 100g |
| GK3350-250g | Calconcarboxylic acid | 3737-95-9 | 250g |
| GT2244-5g | Calmagite | 3147-14-6 | 5g |
| GT2244-10g | Calmagite | 3147-14-6 | 10g |
| GT2244-25g | Calmagite | 3147-14-6 | 25g |
| GT2244-100g | Calmagite | 3147-14-6 | 100g |
| GK5680-5mg | Calpain Inhibitor I | 110044-82-1 | 5mg |
| GK5680-25mg | Calpain Inhibitor I | 110044-82-1 | 25mg |
| GK6416-5mg | Calpain Inhibitor II | 145757-50-2 | 5mg |
| GK6416-25mg | Calpain Inhibitor II | 145757-50-2 | 25mg |
| GP3712-100ug | Calphostin C | 121263-19-2 | 100ug |
| GP3712-1mg | Calphostin C | 121263-19-2 | 1mg |
| GL7024-250ug | Calpinactam | 1205538-83-5 | 250ug |
| GL7024-1mg | Calpinactam | 1205538-83-5 | 1mg |
| GK1704-10mg | Calycosin | 20575-57-9 | 10mg |
| GP4306-25mg | Camostat mesylate | 59721-29-8 | 25mg |
| GP4306-100mg | Camostat mesylate | 59721-29-8 | 100mg |
| GL6884-25g | Camphor | 76-22-2 | 25g |
| GL6884-100g | Camphor | 76-22-2 | 100g |
| GK1513-25g | Camphor-10-sulfonic acid | 5872-08-2 | 25g |
| GK1513-100g | Camphor-10-sulfonic acid | 5872-08-2 | 100g |
| GT1682-100ml | Canada balsam | 8007-47-4 | 100ml |
| GT1682-250ml | Canada balsam | 8007-47-4 | 250ml |
| GT1682-500ml | Canada balsam | 8007-47-4 | 500ml |
| GC9385-1mg | Canagliflozin 3-O-β-D-glucuronide | 1mg | |
| GC9385-2mg | Canagliflozin 3-O-β-D-glucuronide | 2mg | |
| GC9385-5mg | Canagliflozin 3-O-β-D-glucuronide | 5mg | |
| GC9385-10mg | Canagliflozin 3-O-β-D-glucuronide | 10mg | |
| GP6212-250mg | Candesartan cilexetil | 145040-37-5 | 250mg |
| GP6212-1g | Candesartan cilexetil | 145040-37-5 | 1g |
| GW7411-1mg | Canertinib | 267243-28-7 | 1mg |
| GW7411-5mg | Canertinib | 267243-28-7 | 5mg |
| GW7411-10mg | Canertinib | 267243-28-7 | 10mg |
| GC5631-1mg | Canrenone-2,2,21,21-d4 | 1mg | |
| GC5631-2mg | Canrenone-2,2,21,21-d4 | 2mg | |
| GC5631-5mg | Canrenone-2,2,21,21-d4 | 5mg | |
| GA2874-1g | Capastat sulphate | 1405-37-4 | 1g |
| GA2874-5g | Capastat sulphate | 1405-37-4 | 5g |
| GP6220-1g | Capecitabine | 154361-50-9 | 1g |
| GX0795-25g | Capryloyl salicylic acid | 78418-01-6 | 25g |
| GB0318-25g | CAPS | 1135-40-6 | 25g |
| GB0318-100g | CAPS | 1135-40-6 | 100g |
| GB0318-250g | CAPS | 1135-40-6 | 250g |
| GB0318-500g | CAPS | 1135-40-6 | 500g |
| GB0318-1kg | CAPS | 1135-40-6 | 1kg |
| GP1219-250mg | Capsaicin, natural | 404-86-4 | 250mg |
| GP1219-1g | Capsaicin, natural | 404-86-4 | 1g |
| GP1219-5g | Capsaicin, natural | 404-86-4 | 5g |
| GP2777-1g | Capsaicin, USP grade | 404-86-4 | 1g |
| GK3881-25g | Capsicum oleoresin, 50%, USP grade | 8023-77-6 | 25g |
| GK3881-50g | Capsicum oleoresin, 50%, USP grade | 8023-77-6 | 50g |
| GK3881-100g | Capsicum oleoresin, 50%, USP grade | 8023-77-6 | 100g |
| GK3881-250g | Capsicum oleoresin, 50%, USP grade | 8023-77-6 | 250g |
| GB7246-25g | CAPSO | 73463-39-5 | 25g |
| GB7246-100g | CAPSO | 73463-39-5 | 100g |
| GB7246-250g | CAPSO | 73463-39-5 | 250g |
| GB7246-500g | CAPSO | 73463-39-5 | 500g |
| GB4515-25g | CAPSO sodium salt | 102601-34-3 | 25g |
| GB4515-100g | CAPSO sodium salt | 102601-34-3 | 100g |
| GB4515-250g | CAPSO sodium salt | 102601-34-3 | 250g |
| GB4515-500g | CAPSO sodium salt | 102601-34-3 | 500g |
| GP2833-5g | Captopril | 62571-86-2 | 5g |
| GP2833-25g | Captopril | 62571-86-2 | 25g |
| GP8250-1g | Carbamazepine | 298-46-4 | 1g |
| GP8250-5g | Carbamazepine | 298-46-4 | 5g |
| GP8250-10g | Carbamazepine | 298-46-4 | 10g |
| GP8250-25g | Carbamazepine | 298-46-4 | 25g |
| GL9772-1g | Carbamoylcholine chloride | 51-83-2 | 1g |
| GL8921-5g | Carbamyl-beta-methylcholine chloride | 590-63-6 | 5g |
| GT3190-25g | Carbazole | 86-74-8 | 25g |
| GT3190-100g | Carbazole | 86-74-8 | 100g |
| GT3190-250g | Carbazole | 86-74-8 | 250g |
| GT3190-500g | Carbazole | 86-74-8 | 500g |
| GP4639-100g | Carbendazole | 10605-21-7 | 100g |
| GA1299-250mg | Carbenicillin disodium salt | 4800-94-6 | 250mg |
| GA1299-1g | Carbenicillin disodium salt | 4800-94-6 | 1g |
| GA1299-5g | Carbenicillin disodium salt | 4800-94-6 | 5g |
| GA1299-10g | Carbenicillin disodium salt | 4800-94-6 | 10g |
| GA1299-25g | Carbenicillin disodium salt | 4800-94-6 | 25g |
| GL0800-250mg | Carbetapentane citrate salt | 23142-01-0 | 250mg |
| GL0800-500mg | Carbetapentane citrate salt | 23142-01-0 | 500mg |
| GL0800-1g | Carbetapentane citrate salt | 23142-01-0 | 1g |
| GP7031-250mg | Carbidopa | 38821-49-7 | 250mg |
| GP7031-1g | Carbidopa | 38821-49-7 | 1g |
| GP8410-5g | Carbimazole | 22232-54-8 | 5g |
| GP8410-25g | Carbimazole | 22232-54-8 | 25g |
| GP7553-5g | Carbinoxamine maleate salt | 3505-38-2 | 5g |
| GP7553-25g | Carbinoxamine maleate salt | 3505-38-2 | 25g |
| GM0472-5g | Carbobenzyloxy-L-valine | 1149-26-4 | 5g |
| GM0472-25g | Carbobenzyloxy-L-valine | 1149-26-4 | 25g |
| GP3206-25g | Carbocisteine | 638-23-3 | 25g |
| GP3206-100g | Carbocisteine | 638-23-3 | 100g |
| GX4445-1g | Carbofuran | 1563-66-2 | 1g |
| GT3597-5g | Carbol Fuchsin | 4197-24-4 | 5g |
| GT3597-25g | Carbol Fuchsin | 4197-24-4 | 25g |
| GT3597-100g | Carbol Fuchsin | 4197-24-4 | 100g |
| GS7652-100ml | Carbon Disulphide, GlenDry™, anhydrous | 75-15-0 | 100ml |
| GS7652-500ml | Carbon Disulphide, GlenDry™, anhydrous | 75-15-0 | 500ml |
| GS8675-500ml | Carbon Disulphide, GlenPure™, analytical grade low in benzene | 75-15-0 | 500ml |
| GW8064-50mg | Carbonate ionophore VII | 222310-82-9 | 50mg |
| GW8064-250mg | Carbonate ionophore VII | 222310-82-9 | 250mg |
| GL5456-100mg | Carbonyl cyanide 3-chlorophenylhydrazone | 555-60-2 | 100mg |
| GX3600-1g | Carbonyl dihydrido tris (triphenylphosphine) ruthenium(II); 99.95% (metals basis) | 25360-32-1 | 1g |
| GX3600-5g | Carbonyl dihydrido tris (triphenylphosphine) ruthenium(II); 99.95% (metals basis) | 25360-32-1 | 5g |
| GX8694-1g | Carbonyltriphenylphosphine-rhodium(I)-2,4-pentanedionate, 99.95% (metals basis) | 25470-96-6 | 1g |
| GX8694-5g | Carbonyltriphenylphosphine-rhodium(I)-2,4-pentanedionate, 99.95% (metals basis) | 25470-96-6 | 5g |
| GW7075-500mg | Carbophenothion | 786-19-6 | 500mg |
| GA9420-25mg | Carboplatin | 41575-94-4 | 25mg |
| GA9420-100mg | Carboplatin | 41575-94-4 | 100mg |
| GA9420-250mg | Carboplatin | 41575-94-4 | 250mg |
| GA9420-500mg | Carboplatin | 41575-94-4 | 500mg |
| GA9420-1g | Carboplatin | 41575-94-4 | 1g |
| GW4492-200mg | Carboxy-DCF | 111843-78-8 | 200mg |
| GW4492-1g | Carboxy-DCF | 111843-78-8 | 1g |
| GW5389-100mg | Carboxy-DCFDA | 127770-45-0 | 100mg |
| GW5389-1g | Carboxy-DCFDA | 127770-45-0 | 1g |
| GW9790-50mg | Carboxy-DCFDA N-succinimidyl ester | 147265-60-9 | 50mg |
| GW9790-250mg | Carboxy-DCFDA N-succinimidyl ester | 147265-60-9 | 250mg |
| GC2160-10g | Carboxymethyl chitosan | 83512-85-0 | 10g |
| GC2160-25g | Carboxymethyl chitosan | 83512-85-0 | 25g |
| GC2160-50g | Carboxymethyl chitosan | 83512-85-0 | 50g |
| GC2160-100g | Carboxymethyl chitosan | 83512-85-0 | 100g |
| GC7698-100g | Carboxymethylcellulose sodium salt, high viscosity | 9004-32-4 | 100g |
| GC7698-250g | Carboxymethylcellulose sodium salt, high viscosity | 9004-32-4 | 250g |
| GC7698-500g | Carboxymethylcellulose sodium salt, high viscosity | 9004-32-4 | 500g |
| GC7698-1kg | Carboxymethylcellulose sodium salt, high viscosity | 9004-32-4 | 1kg |
| GC7698-5kg | Carboxymethylcellulose sodium salt, high viscosity | 9004-32-4 | 5kg |
| GC7604-100g | Carboxymethylcellulose sodium salt, low viscosity | 9004-32-4 | 100g |
| GC7604-250g | Carboxymethylcellulose sodium salt, low viscosity | 9004-32-4 | 250g |
| GC7604-500g | Carboxymethylcellulose sodium salt, low viscosity | 9004-32-4 | 500g |
| GC7604-1kg | Carboxymethylcellulose sodium salt, low viscosity | 9004-32-4 | 1kg |
| GC7604-5kg | Carboxymethylcellulose sodium salt, low viscosity | 9004-32-4 | 5kg |
| GC2916-100g | Carboxymethylcellulose sodium salt, medium viscosity | 9004-32-4 | 100g |
| GC2916-250g | Carboxymethylcellulose sodium salt, medium viscosity | 9004-32-4 | 250g |
| GC2916-500g | Carboxymethylcellulose sodium salt, medium viscosity | 9004-32-4 | 500g |
| GC2916-1kg | Carboxymethylcellulose sodium salt, medium viscosity | 9004-32-4 | 1kg |
| GC2916-5kg | Carboxymethylcellulose sodium salt, medium viscosity | 9004-32-4 | 5kg |
| GC0321-100g | Carboxymethylcellulose sodium salt, very low viscosity | 9004-32-4 | 100g |
| GC0321-250g | Carboxymethylcellulose sodium salt, very low viscosity | 9004-32-4 | 250g |
| GC0321-500g | Carboxymethylcellulose sodium salt, very low viscosity | 9004-32-4 | 500g |
| GC0321-1kg | Carboxymethylcellulose sodium salt, very low viscosity | 9004-32-4 | 1kg |
| GC0321-5kg | Carboxymethylcellulose sodium salt, very low viscosity | 9004-32-4 | 5kg |
| GK7814-10mg | Carboxytolbutamide | 2224-10-4 | 10mg |
| GK9563-5mg | Cardamonin | 19309-14-9 | 5mg |
| GK9563-25mg | Cardamonin | 19309-14-9 | 25mg |
| GT1409-50mg | Cardiogreen | 3599-32-4 | 50mg |
| GT1409-100mg | Cardiogreen | 3599-32-4 | 100mg |
| GT1409-250mg | Cardiogreen | 3599-32-4 | 250mg |
| GT1101-100mg | Cardiogreen, 95%, USP grade | 3599-32-4 | 100mg |
| GT1101-250mg | Cardiogreen, 95%, USP grade | 3599-32-4 | 250mg |
| GP8753-5mg | Carfilzomib | 868540-17-4 | 5mg |
| GP8753-10mg | Carfilzomib | 868540-17-4 | 10mg |
| GP8753-25mg | Carfilzomib | 868540-17-4 | 25mg |
| GP0362-1g | Carisoprodol | 78-44-4 | 1g |
| GT9400-5g | Carmine (C.I. 75470) | 1390-65-4 | 5g |
| GT9400-25g | Carmine (C.I. 75470) | 1390-65-4 | 25g |
| GT9400-100g | Carmine (C.I. 75470) | 1390-65-4 | 100g |
| GT3566-25g | Carmine (C.I. 75470); certified | 1390-65-4 | 25g |
| GT8708-1g | Carminic acid | 1260-17-9 | 1g |
| GT8708-5g | Carminic acid | 1260-17-9 | 5g |
| GT8708-25g | Carminic acid | 1260-17-9 | 25g |
| GP5925-10mg | Carmofure | 61422-45-5 | 10mg |
| GP5925-25mg | Carmofure | 61422-45-5 | 25mg |
| GP5925-50mg | Carmofure | 61422-45-5 | 50mg |
| GP5925-100mg | Carmofure | 61422-45-5 | 100mg |
| GP0434-5mg | Carnosol | 5957-80-2 | 5mg |
| GP0434-10mg | Carnosol | 5957-80-2 | 10mg |
| GP0434-25mg | Carnosol | 5957-80-2 | 25mg |
| GW2787-10mg | Caroverin | 23465-76-1 | 10mg |
| GW2787-50mg | Caroverin | 23465-76-1 | 50mg |
| GP6077-100mg | Carprofen | 53716-49-7 | 100mg |
| GP9460-10g | Carvacrol | 499-75-2 | 10g |
| GP9460-25g | Carvacrol | 499-75-2 | 25g |
| GP9460-100g | Carvacrol | 499-75-2 | 100g |
| GP1095-1g | Carvedilol | 72956-09-3 | 1g |
| GP1095-5g | Carvedilol | 72956-09-3 | 5g |
| GP1095-10g | Carvedilol | 72956-09-3 | 10g |
| GP1095-25g | Carvedilol | 72956-09-3 | 25g |
| GE4125-100g | Casein | 9000-71-9 | 100g |
| GE4125-250g | Casein | 9000-71-9 | 250g |
| GE4125-500g | Casein | 9000-71-9 | 500g |
| GE4125-1kg | Casein | 9000-71-9 | 1kg |
| GE4125-5kg | Casein | 9000-71-9 | 5kg |
| GE5861-100g | Casein sodium salt | 9005-46-3 | 100g |
| GE5861-250g | Casein sodium salt | 9005-46-3 | 250g |
| GE5861-500g | Casein sodium salt | 9005-46-3 | 500g |
| GE5861-1kg | Casein sodium salt | 9005-46-3 | 1kg |
| GP8659-10mg | Caspofungin acetate | 179463-17-3 | 10mg |
| GP8659-50mg | Caspofungin acetate | 179463-17-3 | 50mg |
| GP5690-100mg | Castanospermine | 79831-76-8 | 100mg |
| GP5690-250mg | Castanospermine | 79831-76-8 | 250mg |
| GP5690-500mg | Castanospermine | 79831-76-8 | 500mg |
| GP5690-1g | Castanospermine | 79831-76-8 | 1g |
| GL4383-500ml | Castor oil, Ph. Eur. grade | 8001-79-4 | 500ml |
| GL4383-1l | Castor oil, Ph. Eur. grade | 8001-79-4 | 1l |
| GZ3941-100mg | Catalase, 40,000 U/mg protein | 9001-05-2 | 100mg |
| GZ3941-1g | Catalase, 40,000 U/mg protein | 9001-05-2 | 1g |
| GE8287-100KU | Catalase, from Aspergillus Niger | 9001-05-2 | 100KU |
| GC8147-25mg | Catalpol | 2415-24-9 | 25mg |
| GC8147-100mg | Catalpol | 2415-24-9 | 100mg |
| GP5013-100mg | Catechin | 7295-85-4 | 100mg |
| GP5013-500mg | Catechin | 7295-85-4 | 500mg |
| GP5013-1g | Catechin | 7295-85-4 | 1g |
| GW5918-1mg | CC-401 hydrochloride | 395104-30-0 | 1mg |
| GW5918-5mg | CC-401 hydrochloride | 395104-30-0 | 5mg |
| GW5918-10mg | CC-401 hydrochloride | 395104-30-0 | 10mg |
| GW0047-1mg | CCT244747 | 1404095-34-6 | 1mg |
| GW0047-5mg | CCT244747 | 1404095-34-6 | 5mg |
| GW0047-10mg | CCT244747 | 1404095-34-6 | 10mg |
| GK8139-25g | CD-3 | 25646-71-3 | 25g |
| GL6882-25ml | Cedar oil | 8000-27-9 | 25ml |
| GL6882-100ml | Cedar oil | 8000-27-9 | 100ml |
| GL6882-500ml | Cedar oil | 8000-27-9 | 500ml |
| GA0871-100mg | Cefaclor | 53994-73-3 | 100mg |
| GA0871-250mg | Cefaclor | 53994-73-3 | 250mg |
| GA0871-1g | Cefaclor | 53994-73-3 | 1g |
| GA0871-5g | Cefaclor | 53994-73-3 | 5g |
| GA2276-100mg | Cefadroxil monohydrate | 66592-87-8 | 100mg |
| GA1648-5g | Cefalexin | 15686-71-2 | 5g |
| GA1648-10g | Cefalexin | 15686-71-2 | 10g |
| GA1648-25g | Cefalexin | 15686-71-2 | 25g |
| GA5297-100mg | Cefalonium hydrate | 5575-21-3 | 100mg |
| GA5297-250mg | Cefalonium hydrate | 5575-21-3 | 250mg |
| GA3485-5g | Cefalotin | 153-61-7 | 5g |
| GA3485-10g | Cefalotin | 153-61-7 | 10g |
| GA3485-25g | Cefalotin | 153-61-7 | 25g |
| GA7688-100mg | Cefamandole nafate | 42540-40-9 | 100mg |
| GA9567-100mg | Cefamandole sodium salt | 30034-03-8 | 100mg |
| GA9567-500mg | Cefamandole sodium salt | 30034-03-8 | 500mg |
| GP5306-250mg | Cefapirin sodium salt | 24356-60-3 | 250mg |
| GP5306-1g | Cefapirin sodium salt | 24356-60-3 | 1g |
| GA2577-250mg | Cefazolin | 25953-19-9 | 250mg |
| GA2577-1g | Cefazolin | 25953-19-9 | 1g |
| GA2577-5g | Cefazolin | 25953-19-9 | 5g |
| GA4751-1g | Cefazolin sodium salt | 27164-46-1 | 1g |
| GA4751-5g | Cefazolin sodium salt | 27164-46-1 | 5g |
| GA4490-100mg | Cefdinir | 91832-40-5 | 100mg |
| GA4490-1g | Cefdinir | 91832-40-5 | 1g |
| GA4490-5g | Cefdinir | 91832-40-5 | 5g |
| GA6734-1g | Cefditoren pivoxil | 117467-28-4 | 1g |
| GA4627-1g | Cefditoren sodium salt | 104146-53-4 | 1g |
| GA3114-1g | Cefepime dihydrochloride hydrate | 123171-59-5 | 1g |
| GA2558-250mg | Cefixime trihydrate | 125110-14-7 | 250mg |
| GA2558-1g | Cefixime trihydrate | 125110-14-7 | 1g |
| GA4116-250mg | Cefmetazole sodium salt | 56796-39-5 | 250mg |
| GA4116-1g | Cefmetazole sodium salt | 56796-39-5 | 1g |
| GA8575-1g | Cefoperazone | 62893-19-0 | 1g |
| GA8575-5g | Cefoperazone | 62893-19-0 | 5g |
| GA8838-1g | Cefoperazone sodium salt | 62893-20-3 | 1g |
| GA8838-5g | Cefoperazone sodium salt | 62893-20-3 | 5g |
| GA8838-25g | Cefoperazone sodium salt | 62893-20-3 | 25g |
| GA3583-1g | Cefotaxime sodium salt | 64485-93-4 | 1g |
| GA3583-5g | Cefotaxime sodium salt | 64485-93-4 | 5g |
| GA3583-25g | Cefotaxime sodium salt | 64485-93-4 | 25g |
| GA5476-100mg | Cefotetan disodium salt | 74356-00-6 | 100mg |
| GA5476-1g | Cefotetan disodium salt | 74356-00-6 | 1g |
| GL6662-100mg | Cefotiam dihydrochloride hydrate | 66309-69-1 | 100mg |
| GL6662-250mg | Cefotiam dihydrochloride hydrate | 66309-69-1 | 250mg |
| GA4412-250mg | Cefoxitin sodium salt | 33564-30-6 | 250mg |
| GA4412-1g | Cefoxitin sodium salt | 33564-30-6 | 1g |
| GA4412-5g | Cefoxitin sodium salt | 33564-30-6 | 5g |
| GA2123-250mg | Cefpirome sulfate | 98753-19-6 | 250mg |
| GA2123-1g | Cefpirome sulfate | 98753-19-6 | 1g |
| GA5004-250mg | Cefpodoxime free acid | 80210-62-4 | 250mg |
| GA5004-1g | Cefpodoxime free acid | 80210-62-4 | 1g |
| GA2186-25mg | Cefpodoxime proxetil | 87239-81-4 | 25mg |
| GA7534-100mg | Cefpodoxime sodium salt | 82619-04-3 | 100mg |
| GA0910-1g | Cefprozil monohydrate | 121123-17-9 | 1g |
| GA1461-250mg | Cefsulodin sodium salt hydrate | 52152-93-9 | 250mg |
| GA1461-1g | Cefsulodin sodium salt hydrate | 52152-93-9 | 1g |
| GA1461-5g | Cefsulodin sodium salt hydrate | 52152-93-9 | 5g |
| GA6002-1g | Ceftazidime hydrate | 78439-06-2 | 1g |
| GA1898-1g | Ceftazidime hydrate, contains approx. 10% sodium carbonate | 78439-06-2 | 1g |
| GA1898-5g | Ceftazidime hydrate, contains approx. 10% sodium carbonate | 78439-06-2 | 5g |
| GA7818-10mg | Ceftibuten hydrate | 97519-39-6 | 10mg |
| GA7818-25mg | Ceftibuten hydrate | 97519-39-6 | 25mg |
| GA7818-50mg | Ceftibuten hydrate | 97519-39-6 | 50mg |
| GA7818-100mg | Ceftibuten hydrate | 97519-39-6 | 100mg |
| GA7212-100mg | Ceftiofur | 80370-57-6 | 100mg |
| GA7212-1g | Ceftiofur | 80370-57-6 | 1g |
| GA9252-100mg | Ceftiofur hydrochloride | 103980-44-5 | 100mg |
| GA9758-1g | Ceftiofur sodium salt | 104010-37-9 | 1g |
| GA1367-25mg | Ceftizoxime | 68401-81-0 | 25mg |
| GA1367-100mg | Ceftizoxime | 68401-81-0 | 100mg |
| GA1247-250mg | Ceftizoxime sodium salt | 68401-82-1 | 250mg |
| GA1247-1g | Ceftizoxime sodium salt | 68401-82-1 | 1g |
| GA6812-1g | Ceftriaxone disodium salt hemi(heptahydrate) | 104376-79-6 | 1g |
| GA6812-5g | Ceftriaxone disodium salt hemi(heptahydrate) | 104376-79-6 | 5g |
| GA6812-25g | Ceftriaxone disodium salt hemi(heptahydrate) | 104376-79-6 | 25g |
| GA9610-100mg | Cefuroxime | 55268-75-2 | 100mg |
| GA9610-250mg | Cefuroxime | 55268-75-2 | 250mg |
| GA9610-1g | Cefuroxime | 55268-75-2 | 1g |
| GA1625-1g | Cefuroxime sodium salt | 56238-63-2 | 1g |
| GA1625-5g | Cefuroxime sodium salt | 56238-63-2 | 5g |
| GP7348-5mg | Celastrol | 34157-83-0 | 5mg |
| GP7348-10mg | Celastrol | 34157-83-0 | 10mg |
| GP7348-50mg | Celastrol | 34157-83-0 | 50mg |
| GP8233-250mg | Celecoxib | 169590-42-5 | 250mg |
| GP8233-1g | Celecoxib | 169590-42-5 | 1g |
| GC8644-1mg | Celecoxib carboxylic acid acyl-b-D-glucuronide | 264236-79-5 | 1mg |
| GC8644-2mg | Celecoxib carboxylic acid acyl-b-D-glucuronide | 264236-79-5 | 2mg |
| GC8644-5mg | Celecoxib carboxylic acid acyl-b-D-glucuronide | 264236-79-5 | 5mg |
| GC8644-10mg | Celecoxib carboxylic acid acyl-b-D-glucuronide | 264236-79-5 | 10mg |
| GT3004-10g | Celestine blue | 1562-90-9 | 10g |
| GT3004-25g | Celestine blue | 1562-90-9 | 25g |
| GC2580-1mg | Cellobiulose | 26391-66-2 | 1mg |
| GC2580-2mg | Cellobiulose | 26391-66-2 | 2mg |
| GC2580-5mg | Cellobiulose | 26391-66-2 | 5mg |
| GC2580-10mg | Cellobiulose | 26391-66-2 | 10mg |
| GC2580-25mg | Cellobiulose | 26391-66-2 | 25mg |
| GC5469-25mg | Cellotetraose | 38819-01-1 | 25mg |
| GC5469-50mg | Cellotetraose | 38819-01-1 | 50mg |
| GC5469-100mg | Cellotetraose | 38819-01-1 | 100mg |
| GC5469-250mg | Cellotetraose | 38819-01-1 | 250mg |
| GV0115-100g | Cellulose, microcrystalline powder, 50 micron | 9004-34-6 | 100g |
| GV0115-250g | Cellulose, microcrystalline powder, 50 micron | 9004-34-6 | 250g |
| GV0115-500g | Cellulose, microcrystalline powder, 50 micron | 9004-34-6 | 500g |
| GV0115-1kg | Cellulose, microcrystalline powder, 50 micron | 9004-34-6 | 1kg |
| GV9004-250g | Cellulose, microcrystalline powder, 50 micron, BP, Ph. Eur., USP grade | 9004-34-6 | 250g |
| GV9004-1kg | Cellulose, microcrystalline powder, 50 micron, BP, Ph. Eur., USP grade | 9004-34-6 | 1kg |
| GV9019-25g | Cellulose, microcrystalline powder, 90 micron | 9004-34-6 | 25g |
| GV9019-100g | Cellulose, microcrystalline powder, 90 micron | 9004-34-6 | 100g |
| GV9019-250g | Cellulose, microcrystalline powder, 90 micron | 9004-34-6 | 250g |
| GV9019-500g | Cellulose, microcrystalline powder, 90 micron | 9004-34-6 | 500g |
| GV9019-1kg | Cellulose, microcrystalline powder, 90 micron | 9004-34-6 | 1kg |
| GV7681-250g | Cellulose, microcrystalline powder, 90 micron, BP, Ph. Eur., USP grade | 9004-34-6 | 250g |
| GV7681-1kg | Cellulose, microcrystalline powder, 90 micron, BP, Ph. Eur., USP grade | 9004-34-6 | 1kg |
| GW6518-1mg | CEP-33779 | 1257704-57-6 | 1mg |
| GW6518-5mg | CEP-33779 | 1257704-57-6 | 5mg |
| GW6518-10mg | CEP-33779 | 1257704-57-6 | 10mg |
| GL7294-1mg | Cephalochromin | 25908-26-3 | 1mg |
| GL7294-5mg | Cephalochromin | 25908-26-3 | 5mg |
| GX7542-5mg | Cephalotaxine | 24316-19-6 | 5mg |
| GX7542-10mg | Cephalotaxine | 24316-19-6 | 10mg |
| GA6496-1g | Cephalothin sodium salt | 58-71-9 | 1g |
| GA6496-5g | Cephalothin sodium salt | 58-71-9 | 5g |
| GP8908-50mg | Cepharanthine | 481-49-2 | 50mg |
| GP8908-100mg | Cepharanthine | 481-49-2 | 100mg |
| GP8908-250mg | Cepharanthine | 481-49-2 | 250mg |
| GP8908-500mg | Cepharanthine | 481-49-2 | 500mg |
| GA8023-500mg | Cephradine | 38821-53-3 | 500mg |
| GA8023-1g | Cephradine | 38821-53-3 | 1g |
| GA8023-5g | Cephradine | 38821-53-3 | 5g |
| GA1747-1mg | Cercosporin | 35082-49-6 | 1mg |
| GA1747-5mg | Cercosporin | 35082-49-6 | 5mg |
| GX5397-25x50mm | Cerium Foil 0.25mm, 99.9% | 7440-45-1 | 25x50mm |
| GX0145-100g | Cerium hydroxide, 99.9% | 12014-56-1 | 100g |
| GX0145-250g | Cerium hydroxide, 99.9% | 12014-56-1 | 250g |
| GX0145-500g | Cerium hydroxide, 99.9% | 12014-56-1 | 500g |
| GX0145-1kg | Cerium hydroxide, 99.9% | 12014-56-1 | 1kg |
| GX4393-100g | Cerium hydroxide, 99.99% | 12014-56-1 | 100g |
| GX4393-250g | Cerium hydroxide, 99.99% | 12014-56-1 | 250g |
| GX4393-500g | Cerium hydroxide, 99.99% | 12014-56-1 | 500g |
| GX4393-1kg | Cerium hydroxide, 99.99% | 12014-56-1 | 1kg |
| GX3427-250g | Cerium phosphate hydrate, 99.9% | 13454-71-2 | 250g |
| GX9155-50g | Cerium Pieces max. 13 mm, 99.9% | 7440-45-1 | 50g |
| GX2972-100g | Cerium Rod 12.5 mm diameter, 99.9% | 7440-45-1 | 100g |
| GX3674-10cm | Cerium Wire 1 mm diameter, 99.9% | 7440-45-1 | 10cm |
| GX3674-25cm | Cerium Wire 1 mm diameter, 99.9% | 7440-45-1 | 25cm |
| GX6721-100g | Cerium(III) acetate hydrate, 99.9% | 206996-60-3 | 100g |
| GX6721-250g | Cerium(III) acetate hydrate, 99.9% | 206996-60-3 | 250g |
| GX6980-100g | Cerium(III) acetate hydrate, 99.999% | 206996-60-3 | 100g |
| GX4341-10g | Cerium(III) bromide, anhydrous, 99.9% | 14457-87-5 | 10g |
| GX5012-100g | Cerium(III) carbonate hydrate, 99.9% | 5853-16-7 | 100g |
| GX5012-500g | Cerium(III) carbonate hydrate, 99.9% | 5853-16-7 | 500g |
| GX7567-100g | Cerium(III) carbonate hydrate, 99.99% | 5853-16-7 | 100g |
| GX7567-500g | Cerium(III) carbonate hydrate, 99.99% | 5853-16-7 | 500g |
| GX4404-100g | Cerium(III) carbonate hydrate, 99.999% | 5853-16-7 | 100g |
| GK0556-100g | Cerium(III) chloride heptahydrate | 18618-55-8 | 100g |
| GK0556-500g | Cerium(III) chloride heptahydrate | 18618-55-8 | 500g |
| GX8358-250g | Cerium(III) chloride hydrate, 99.9% | 19423-76-8 | 250g |
| GX8358-1kg | Cerium(III) chloride hydrate, 99.9% | 19423-76-8 | 1kg |
| GX1327-250g | Cerium(III) chloride hydrate, 99.99% | 19423-76-8 | 250g |
| GX1327-1kg | Cerium(III) chloride hydrate, 99.99% | 19423-76-8 | 1kg |
| GX5741-100g | Cerium(III) chloride hydrate, 99.999% | 19423-76-8 | 100g |
| GX6202-10g | Cerium(III) chloride, anhydrous, 99.5+% | 7790-86-5 | 10g |
| GX6202-50g | Cerium(III) chloride, anhydrous, 99.5+% | 7790-86-5 | 50g |
| GX6202-250g | Cerium(III) chloride, anhydrous, 99.5+% | 7790-86-5 | 250g |
| GX2205-10g | Cerium(III) chloride, anhydrous, 99.9% | 7790-86-5 | 10g |
| GX2205-25g | Cerium(III) chloride, anhydrous, 99.9% | 7790-86-5 | 25g |
| GX2205-100g | Cerium(III) chloride, anhydrous, 99.9% | 7790-86-5 | 100g |
| GX1483-100g | Cerium(III) fluoride anhydrous, 99.9% | 7758-88-5 | 100g |
| GX1483-250g | Cerium(III) fluoride anhydrous, 99.9% | 7758-88-5 | 250g |
| GX1483-1kg | Cerium(III) fluoride anhydrous, 99.9% | 7758-88-5 | 1kg |
| GX6513-10g | Cerium(III) fluoride anhydrous, 99.999% | 7758-88-5 | 10g |
| GX6513-25g | Cerium(III) fluoride anhydrous, 99.999% | 7758-88-5 | 25g |
| GX6513-100g | Cerium(III) fluoride anhydrous, 99.999% | 7758-88-5 | 100g |
| GX3407-10g | Cerium(III) fluoride, 99.9% | 7758-88-5 | 10g |
| GX3407-25g | Cerium(III) fluoride, 99.9% | 7758-88-5 | 25g |
| GX3407-100g | Cerium(III) fluoride, 99.9% | 7758-88-5 | 100g |
| GX8403-500g | Cerium(III) fluoride, 99% | 7758-88-5 | 500g |
| GK5085-100g | Cerium(III) nitrate hexahydrate | 10294-41-4 | 100g |
| GK5085-250g | Cerium(III) nitrate hexahydrate | 10294-41-4 | 250g |
| GK5085-500g | Cerium(III) nitrate hexahydrate | 10294-41-4 | 500g |
| GX4597-250g | Cerium(III) nitrate hexahydrate, 99.9% | 10294-41-4 | 250g |
| GX4597-1kg | Cerium(III) nitrate hexahydrate, 99.9% | 10294-41-4 | 1kg |
| GX1603-250g | Cerium(III) oxalate, 99.9% | 139-42-4 | 250g |
| GX1669-50g | Cerium(III) sulfate, anhydrous, 99.9% | 13454-94-9 | 50g |
| GX1915-50g | Cerium(IV) oxide-Nano Powder, 99.5+% | 1306-38-3 | 50g |
| GX5584-50g | Cerium(IV) oxide-Nano Powder, 99.5+% | 1306-38-3 | 50g |
| GX5584-100g | Cerium(IV) oxide-Nano Powder, 99.5+% | 1306-38-3 | 100g |
| GX7459-250g | Cerium(IV) oxide, 99.9% | 1306-38-3 | 250g |
| GX3994-25g | Cerium(IV) oxide, 99.9% | 1306-38-3 | 25g |
| GX7459-1kg | Cerium(IV) oxide, 99.9% | 1306-38-3 | 1kg |
| GX3994-100g | Cerium(IV) oxide, 99.9% | 1306-38-3 | 100g |
| GX9234-25g | Cerium(IV) oxide, 99.99% | 1306-38-3 | 25g |
| GX9234-100g | Cerium(IV) oxide, 99.99% | 1306-38-3 | 100g |
| GX1622-25g | Cerium(IV) oxide, 99.999% | 1306-38-3 | 25g |
| GX7584-10g | Cerium(IV) oxide, 99.999% | 1306-38-3 | 10g |
| GX1622-100g | Cerium(IV) oxide, 99.999% | 1306-38-3 | 100g |
| GX1156-250g | Cerium(IV) oxide, 99% | 1306-38-3 | 250g |
| GX1156-1kg | Cerium(IV) oxide, 99% | 1306-38-3 | 1kg |
| GX5310-25g | Cerium(IV) oxide, nanopowder, 99.95% | 1306-38-3 | 25g |
| GX0322-25g | Cerium(IV) sulfate | 13590-82-4 | 25g |
| GX0322-100g | Cerium(IV) sulfate | 13590-82-4 | 100g |
| GX0322-250g | Cerium(IV) sulfate | 13590-82-4 | 250g |
| GX7470-25g | Cerium(IV) sulfate anhydrous, 99% | 13590-82-4 | 25g |
| GX7470-500g | Cerium(IV) sulfate anhydrous, 99% | 13590-82-4 | 500g |
| GX9863-100g | Cerium(IV) sulfate tetrahydrate | 10294-42-5 | 100g |
| GX9863-250g | Cerium(IV) sulfate tetrahydrate | 10294-42-5 | 250g |
| GX9863-500g | Cerium(IV) sulfate tetrahydrate | 10294-42-5 | 500g |
| GA8298-10mg | Cerulenin | 17397-89-6 | 10mg |
| GX8142-50g | Cesium acetate, 99.9% | 3396-11-0 | 50g |
| GX8142-100g | Cesium acetate, 99.9% | 3396-11-0 | 100g |
| GX3596-25g | Cesium acetate, 99.99% | 3396-11-0 | 25g |
| GX3596-100g | Cesium acetate, 99.99% | 3396-11-0 | 100g |
| GX2996-50g | Cesium acetate, 99% | 3396-11-0 | 50g |
| GX2996-250g | Cesium acetate, 99% | 3396-11-0 | 250g |
| GX7343-25g | Cesium bromide, 99.9% | 7787-69-1 | 25g |
| GX7343-100g | Cesium bromide, 99.9% | 7787-69-1 | 100g |
| GX1093-100g | Cesium bromide, 99% | 7787-69-1 | 100g |
| GX4299-50g | Cesium carbonate, 99.9% | 534-17-8 | 50g |
| GX4299-250g | Cesium carbonate, 99.9% | 534-17-8 | 250g |
| GX9334-25g | Cesium carbonate, 99.99% | 534-17-8 | 25g |
| GX9334-100g | Cesium carbonate, 99.99% | 534-17-8 | 100g |
| GX4672-10g | Cesium carbonate, 99.995% | 534-17-8 | 10g |
| GX4672-50g | Cesium carbonate, 99.995% | 534-17-8 | 50g |
| GX3537-100g | Cesium carbonate, 99% | 534-17-8 | 100g |
| GX3537-250g | Cesium carbonate, 99% | 534-17-8 | 250g |
| GX3537-1kg | Cesium carbonate, 99% | 534-17-8 | 1kg |
| GX3346-50g | Cesium chloride, 99.9% | 7647-17-8 | 50g |
| GX3346-250g | Cesium chloride, 99.9% | 7647-17-8 | 250g |
| GX3401-25g | Cesium chloride, 99.99% | 7647-17-8 | 25g |
| GX3401-100g | Cesium chloride, 99.99% | 7647-17-8 | 100g |
| GX6704-50g | Cesium chloride, 99% | 7647-17-8 | 50g |
| GX6704-250g | Cesium chloride, 99% | 7647-17-8 | 250g |
| GX5259-25g | Cesium fluoride, 99.9% | 13400-13-0 | 25g |
| GX5259-100g | Cesium fluoride, 99.9% | 13400-13-0 | 100g |
| GX3712-25g | Cesium fluoride, 99.99% | 13400-13-0 | 25g |
| GX3712-100g | Cesium fluoride, 99.99% | 13400-13-0 | 100g |
| GX0633-25g | Cesium fluoride, 99.999% | 13400-13-0 | 25g |
| GX3811-25g | Cesium hydrogen carbonate, 99.99% | 29703-01-3 | 25g |
| GX3811-100g | Cesium hydrogen carbonate, 99.99% | 29703-01-3 | 100g |
| GX5386-25g | Cesium hydrogen carbonate, 99% | 29703-01-3 | 25g |
| GX5386-100g | Cesium hydrogen carbonate, 99% | 29703-01-3 | 100g |
| GX5111-50g | Cesium iodide, 99.9% | 7789-17-5 | 50g |
| GX5111-100g | Cesium iodide, 99.9% | 7789-17-5 | 100g |
| GX5111-250g | Cesium iodide, 99.9% | 7789-17-5 | 250g |
| GX6626-25g | Cesium iodide, 99.99% | 7789-17-5 | 25g |
| GX6626-100g | Cesium iodide, 99.99% | 7789-17-5 | 100g |
| GX0604-50g | Cesium iodide, 99% | 7789-17-5 | 50g |
| GX0604-250g | Cesium iodide, 99% | 7789-17-5 | 250g |
| GX4170-100g | Cesium nitrate, 99.9% | 7789-18-6 | 100g |
| GX4170-250g | Cesium nitrate, 99.9% | 7789-18-6 | 250g |
| GX8481-25g | Cesium nitrate, 99.99% | 7789-18-6 | 25g |
| GX8481-100g | Cesium nitrate, 99.99% | 7789-18-6 | 100g |
| GX3362-10g | Cesium nitrate, 99.999% | 7789-18-6 | 10g |
| GX3362-50g | Cesium nitrate, 99.999% | 7789-18-6 | 50g |
| GX3250-100g | Cesium nitrate, 99% | 7789-18-6 | 100g |
| GX3250-250g | Cesium nitrate, 99% | 7789-18-6 | 250g |
| GX6120-50g | Cesium sulfate, 99.5% | 10294-54-9 | 50g |
| GX6120-250g | Cesium sulfate, 99.5% | 10294-54-9 | 250g |
| GX6406-25g | Cesium sulfate, 99.9% | 10294-54-9 | 25g |
| GX6406-100g | Cesium sulfate, 99.9% | 10294-54-9 | 100g |
| GP4015-250mg | Cetirizine dihydrochloride | 83881-52-1 | 250mg |
| GP4015-1g | Cetirizine dihydrochloride | 83881-52-1 | 1g |
| GP4015-5g | Cetirizine dihydrochloride | 83881-52-1 | 5g |
| GP9031-25g | Cetrimide | 1119-97-7 | 25g |
| GP9031-100g | Cetrimide | 1119-97-7 | 100g |
| GP9031-250g | Cetrimide | 1119-97-7 | 250g |
| GP9031-500g | Cetrimide | 1119-97-7 | 500g |
| GP9031-1kg | Cetrimide | 1119-97-7 | 1kg |
| GK0601-100g | Cetyldimethylethylammonium bromide | 124-03-8 | 100g |
| GK4657-25g | Cetylpyridinium bromide | 140-72-7 | 25g |
| GK4657-100g | Cetylpyridinium bromide | 140-72-7 | 100g |
| GK4657-250g | Cetylpyridinium bromide | 140-72-7 | 250g |
| GK4657-500g | Cetylpyridinium bromide | 140-72-7 | 500g |
| GA9566-25g | Cetylpyridinium chloride monohydrate | 6004-24-6 | 25g |
| GA9566-100g | Cetylpyridinium chloride monohydrate | 6004-24-6 | 100g |
| GA9566-250g | Cetylpyridinium chloride monohydrate | 6004-24-6 | 250g |
| GA9566-500g | Cetylpyridinium chloride monohydrate | 6004-24-6 | 500g |
| GA9566-1kg | Cetylpyridinium chloride monohydrate | 6004-24-6 | 1kg |
| GW2058-1mg | CFI-400437 | 1mg | |
| GW2058-5mg | CFI-400437 | 5mg | |
| GW2058-10mg | CFI-400437 | 10mg | |
| GL2101-100ug | cGAMP disodium salt | 849214-04-6 | 100ug |
| GL2101-500ug | cGAMP disodium salt | 849214-04-6 | 500ug |
| GK5122-1mg | CGP-53353 | 145915-60-2 | 1mg |
| GW6344-1mg | CH4987655 | 874101-00-5 | 1mg |
| GW6344-5mg | CH4987655 | 874101-00-5 | 5mg |
| GW6344-10mg | CH4987655 | 874101-00-5 | 10mg |
| GW5885-1mg | CH5132799 | 1007207-67-1 | 1mg |
| GW5885-5mg | CH5132799 | 1007207-67-1 | 5mg |
| GW5885-10mg | CH5132799 | 1007207-67-1 | 10mg |
| GL4649-1mg | Chaetoglobosin A | 50335-03-0 | 1mg |
| GL4649-5mg | Chaetoglobosin A | 50335-03-0 | 5mg |
| GW3177-1mg | Chaetoglobosin C | 50645-76-6 | 1mg |
| GW6792-1mg | Chaetoglobosin F | 55945-75-0 | 1mg |
| GL0398-1mg | Chaetoviridin A | 128252-98-2 | 1mg |
| GL0398-5mg | Chaetoviridin A | 128252-98-2 | 5mg |
| GL8173-500ug | Chalcomycin | 20283-48-1 | 500ug |
| GL8173-1mg | Chalcomycin | 20283-48-1 | 1mg |
| GY2537-20mg | Chamazulene | 529-05-5 | 20mg |
| GB6883-1g | CHAPS | 75621-03-3 | 1g |
| GB6883-5g | CHAPS | 75621-03-3 | 5g |
| GB6883-10g | CHAPS | 75621-03-3 | 10g |
| GB6883-25g | CHAPS | 75621-03-3 | 25g |
| GB6883-50g | CHAPS | 75621-03-3 | 50g |
| GB7497-500mg | CHAPSO | 82473-24-3 | 500mg |
| GB7497-1g | CHAPSO | 82473-24-3 | 1g |
| GB7497-5g | CHAPSO | 82473-24-3 | 5g |
| GA4206-5mg | Chartreusin | 6377-18-0 | 5mg |
| GA4206-25mg | Chartreusin | 6377-18-0 | 25mg |
| GY5277-5mg | Chebulagic acid | 23094-71-5 | 5mg |
| GK3169-10mg | Chebulinic acid | 18942-26-2 | 10mg |
| GP2808-1mg | Chelerythrine chloride | 3895-92-9 | 1mg |
| GP2808-5mg | Chelerythrine chloride | 3895-92-9 | 5mg |
| GP2808-25mg | Chelerythrine chloride | 3895-92-9 | 25mg |
| GP7061-5g | Chenodeoxycholic acid | 474-25-9 | 5g |
| GP7061-25g | Chenodeoxycholic acid | 474-25-9 | 25g |
| GP7061-100g | Chenodeoxycholic acid | 474-25-9 | 100g |
| GL7692-500mg | Chenodeoxycholic acid sodium salt | 2646-38-0 | 500mg |
| GL7692-1g | Chenodeoxycholic acid sodium salt | 2646-38-0 | 1g |
| GL7692-5g | Chenodeoxycholic acid sodium salt | 2646-38-0 | 5g |
| GL7692-25g | Chenodeoxycholic acid sodium salt | 2646-38-0 | 25g |
| GB1106-25g | CHES | 103-47-9 | 25g |
| GB1106-100g | CHES | 103-47-9 | 100g |
| GB1106-250g | CHES | 103-47-9 | 250g |
| GB1106-500g | CHES | 103-47-9 | 500g |
| GB1106-1kg | CHES | 103-47-9 | 1kg |
| GA8919-1mg | Chetomin | 1403-36-7 | 1mg |
| GA8919-5mg | Chetomin | 1403-36-7 | 5mg |
| GK9771-25g | Chicago Sky Blue 6B | 2610-05-1 | 25g |
| GL0945-10mg | Chicoric acid | 6537-80-0 | 10mg |
| GC0425-25g | Chitin | 1398-61-4 | 25g |
| GC0425-100g | Chitin | 1398-61-4 | 100g |
| GC0425-250g | Chitin | 1398-61-4 | 250g |
| GC0425-500g | Chitin | 1398-61-4 | 500g |
| GC0425-1kg | Chitin | 1398-61-4 | 1kg |
| GC2490-100g | Chitin, technical grade | 1398-61-4 | 100g |
| GC2490-250g | Chitin, technical grade | 1398-61-4 | 250g |
| GC2490-1kg | Chitin, technical grade | 1398-61-4 | 1kg |
| GC1909-10g | Chitosan | 9012-76-4 | 10g |
| GC1909-25g | Chitosan | 9012-76-4 | 25g |
| GC1909-100g | Chitosan | 9012-76-4 | 100g |
| GC1909-250g | Chitosan | 9012-76-4 | 250g |
| GP5480-25g | Chitosan (10 cps); very low molecular weight | 9012-76-4 | 25g |
| GP5480-100g | Chitosan (10 cps); very low molecular weight | 9012-76-4 | 100g |
| GP5480-250g | Chitosan (10 cps); very low molecular weight | 9012-76-4 | 250g |
| GP5480-500g | Chitosan (10 cps); very low molecular weight | 9012-76-4 | 500g |
| GP5480-1kg | Chitosan (10 cps); very low molecular weight | 9012-76-4 | 1kg |
| GP7788-500g | Chitosan (10 cps); very low molecular weight, non-animal from fermentation, suitable for biotechnology | 9012-76-4 | 500g |
| GP7788-1kg | Chitosan (10 cps); very low molecular weight, non-animal from fermentation, suitable for biotechnology | 9012-76-4 | 1kg |
| GP7325-25g | Chitosan (100 - 300 cps); low molecular weight | 9012-76-4 | 25g |
| GP7325-100g | Chitosan (100 - 300 cps); low molecular weight | 9012-76-4 | 100g |
| GP7325-250g | Chitosan (100 - 300 cps); low molecular weight | 9012-76-4 | 250g |
| GP7325-500g | Chitosan (100 - 300 cps); low molecular weight | 9012-76-4 | 500g |
| GP7325-1kg | Chitosan (100 - 300 cps); low molecular weight | 9012-76-4 | 1kg |
| GP4666-500g | Chitosan (100 - 300 cps); low molecular weight, non-animal from fermentation, suitable for biotechnology | 9012-76-4 | 500g |
| GP4666-1kg | Chitosan (100 - 300 cps); low molecular weight, non-animal from fermentation, suitable for biotechnology | 9012-76-4 | 1kg |
| GP5053-25g | Chitosan (1000 - 2000 cps); high molecular weight | 9012-76-4 | 25g |
| GP5053-100g | Chitosan (1000 - 2000 cps); high molecular weight | 9012-76-4 | 100g |
| GP5053-250g | Chitosan (1000 - 2000 cps); high molecular weight | 9012-76-4 | 250g |
| GP5053-500g | Chitosan (1000 - 2000 cps); high molecular weight | 9012-76-4 | 500g |
| GP5053-1kg | Chitosan (1000 - 2000 cps); high molecular weight | 9012-76-4 | 1kg |
| GP8689-25g | Chitosan (2000 - 3500 cps); very high molecular weight | 9012-76-4 | 25g |
| GP8689-100g | Chitosan (2000 - 3500 cps); very high molecular weight | 9012-76-4 | 100g |
| GP8689-250g | Chitosan (2000 - 3500 cps); very high molecular weight | 9012-76-4 | 250g |
| GP8689-500g | Chitosan (2000 - 3500 cps); very high molecular weight | 9012-76-4 | 500g |
| GP8689-1kg | Chitosan (2000 - 3500 cps); very high molecular weight | 9012-76-4 | 1kg |
| GP8523-25g | Chitosan (30 - 100 cps); low molecular weight | 9012-76-4 | 25g |
| GP8523-100g | Chitosan (30 - 100 cps); low molecular weight | 9012-76-4 | 100g |
| GP8523-250g | Chitosan (30 - 100 cps); low molecular weight | 9012-76-4 | 250g |
| GP8523-500g | Chitosan (30 - 100 cps); low molecular weight | 9012-76-4 | 500g |
| GP8523-1kg | Chitosan (30 - 100 cps); low molecular weight | 9012-76-4 | 1kg |
| GP0343-500g | Chitosan (30 - 100 cps); low molecular weight, non-animal from fermentation, suitable for biotechnology | 9012-76-4 | 500g |
| GP0343-1kg | Chitosan (30 - 100 cps); low molecular weight, non-animal from fermentation, suitable for biotechnology | 9012-76-4 | 1kg |
| GP8956-25g | Chitosan (300 - 1000 cps); medium molecular weight | 9012-76-4 | 25g |
| GP8956-100g | Chitosan (300 - 1000 cps); medium molecular weight | 9012-76-4 | 100g |
| GP8956-250g | Chitosan (300 - 1000 cps); medium molecular weight | 9012-76-4 | 250g |
| GP8956-500g | Chitosan (300 - 1000 cps); medium molecular weight | 9012-76-4 | 500g |
| GP8956-1kg | Chitosan (300 - 1000 cps); medium molecular weight | 9012-76-4 | 1kg |
| GP4208-500g | Chitosan (300 - 1000 cps); medium molecular weight, non-animal from fermentation, suitable for biotechnology | 9012-76-4 | 500g |
| GP4208-1kg | Chitosan (300 - 1000 cps); medium molecular weight, non-animal from fermentation, suitable for biotechnology | 9012-76-4 | 1kg |
| GP2129-25g | Chitosan (3000 - 6500 cps); very high molecular weight | 9012-76-4 | 25g |
| GP2129-100g | Chitosan (3000 - 6500 cps); very high molecular weight | 9012-76-4 | 100g |
| GP2129-250g | Chitosan (3000 - 6500 cps); very high molecular weight | 9012-76-4 | 250g |
| GP2129-500g | Chitosan (3000 - 6500 cps); very high molecular weight | 9012-76-4 | 500g |
| GP2129-1kg | Chitosan (3000 - 6500 cps); very high molecular weight | 9012-76-4 | 1kg |
| GP1318-25g | Chitosan (5 cps); ultra low molecular weight | 9012-76-4 | 25g |
| GP1318-100g | Chitosan (5 cps); ultra low molecular weight | 9012-76-4 | 100g |
| GP1318-250g | Chitosan (5 cps); ultra low molecular weight | 9012-76-4 | 250g |
| GP1318-500g | Chitosan (5 cps); ultra low molecular weight | 9012-76-4 | 500g |
| GP1318-1kg | Chitosan (5 cps); ultra low molecular weight | 9012-76-4 | 1kg |
| GP9640-500g | Chitosan (5 cps); ultra low molecular weight, non-animal from fermentation, suitable for biotechnology | 9012-76-4 | 500g |
| GP9640-1kg | Chitosan (5 cps); ultra low molecular weight, non-animal from fermentation, suitable for biotechnology | 9012-76-4 | 1kg |
| GU8920-25g | Chitosan hydrochloride (10 - 120 cps) | 70694-72-3 | 25g |
| GU8920-100g | Chitosan hydrochloride (10 - 120 cps) | 70694-72-3 | 100g |
| GU8920-250g | Chitosan hydrochloride (10 - 120 cps) | 70694-72-3 | 250g |
| GU8920-500g | Chitosan hydrochloride (10 - 120 cps) | 70694-72-3 | 500g |
| GU0761-25g | Chitosan oligosaccharide | 148411-57-8 | 25g |
| GU0761-100g | Chitosan oligosaccharide | 148411-57-8 | 100g |
| GU0761-250g | Chitosan oligosaccharide | 148411-57-8 | 250g |
| GU0761-500g | Chitosan oligosaccharide | 148411-57-8 | 500g |
| GU0761-1kg | Chitosan oligosaccharide | 148411-57-8 | 1kg |
| GU3511-25g | Chitosan oligosaccharide, fungal origin | 148411-57-8 | 25g |
| GU3511-100g | Chitosan oligosaccharide, fungal origin | 148411-57-8 | 100g |
| GE4907-25g | Chitosan, from squid | 9012-76-4 | 25g |
| GE4907-100g | Chitosan, from squid | 9012-76-4 | 100g |
| GE4907-250g | Chitosan, from squid | 9012-76-4 | 250g |
| GE4907-500g | Chitosan, from squid | 9012-76-4 | 500g |
| GE4907-1kg | Chitosan, from squid | 9012-76-4 | 1kg |
| GC9009-50g | Chitosan, low molecular weight | 9012-76-4 | 50g |
| GC9009-100g | Chitosan, low molecular weight | 9012-76-4 | 100g |
| GC1115-25mg | Chitotriose trihydrochloride | 41708-93-4 | 25mg |
| GE3211-25g | Chloral hydrate, 99% | 302-17-0 | 25g |
| GE3211-100g | Chloral hydrate, 99% | 302-17-0 | 100g |
| GP0879-250mg | Chlorambucil | 305-03-3 | 250mg |
| GP0879-1g | Chlorambucil | 305-03-3 | 1g |
| GP0879-5g | Chlorambucil | 305-03-3 | 5g |
| GE5939-25g | Chloramine T trihydrate | 7080-50-4 | 25g |
| GE5939-100g | Chloramine T trihydrate | 7080-50-4 | 100g |
| GE5939-250g | Chloramine T trihydrate | 7080-50-4 | 250g |
| GE5939-500g | Chloramine T trihydrate | 7080-50-4 | 500g |
| GE5939-1kg | Chloramine T trihydrate | 7080-50-4 | 1kg |
| GA0258-5g | Chloramphenicol | 56-75-7 | 5g |
| GA0258-25g | Chloramphenicol | 56-75-7 | 25g |
| GA0258-100g | Chloramphenicol | 56-75-7 | 100g |
| GA0258-250g | Chloramphenicol | 56-75-7 | 250g |
| GA0258-500g | Chloramphenicol | 56-75-7 | 500g |
| GA0258-1kg | Chloramphenicol | 56-75-7 | 1kg |
| GA5075-100mg | Chloramphenicol palmitate | 530-43-8 | 100mg |
| GA5075-250mg | Chloramphenicol palmitate | 530-43-8 | 250mg |
| GA5075-1g | Chloramphenicol palmitate | 530-43-8 | 1g |
| GA0505-100g | Chloramphenicol, USP grade | 56-75-7 | 100g |
| GX0195-100g | Chloranilic acid, barium salt | 13435-46-6 | 100g |
| GT4928-5g | Chlorazol Black (C.I. 30235) | 1937-37-7 | 5g |
| GT4928-25g | Chlorazol Black (C.I. 30235) | 1937-37-7 | 25g |
| GT4928-50g | Chlorazol Black (C.I. 30235) | 1937-37-7 | 50g |
| GT4928-100g | Chlorazol Black (C.I. 30235) | 1937-37-7 | 100g |
| GX8839-1g | Chlorfenapyr | 122453-73-0 | 1g |
| GP9341-1g | Chlorhexidine | 55-56-1 | 1g |
| GP9341-50g | Chlorhexidine | 55-56-1 | 50g |
| GP9341-250g | Chlorhexidine | 55-56-1 | 250g |
| GA1676-1g | Chlorhexidine diacetate salt hydrate | 56-95-1 | 1g |
| GA1676-5g | Chlorhexidine diacetate salt hydrate | 56-95-1 | 5g |
| GA1676-25g | Chlorhexidine diacetate salt hydrate | 56-95-1 | 25g |
| GA1676-100g | Chlorhexidine diacetate salt hydrate | 56-95-1 | 100g |
| GP2120-25g | Chlorhexidine digluconate, 20% in water | 18472-51-0 | 25g |
| GP9664-1g | Chlormethine hydrochloride | 55-86-7 | 1g |
| GW4279-250mg | Chlornitrofen | 1836-77-7 | 250mg |
| GW4279-1g | Chlornitrofen | 1836-77-7 | 1g |
| GK6154-100g | Chloroacetic acid | 79-11-8 | 100g |
| GS9671-100ml | Chlorobenzene, GlenDry™, anhydrous | 108-90-7 | 100ml |
| GS9671-500ml | Chlorobenzene, GlenDry™, anhydrous | 108-90-7 | 500ml |
| GS9671-1l | Chlorobenzene, GlenDry™, anhydrous | 108-90-7 | 1l |
| GS9671-2500ml | Chlorobenzene, GlenDry™, anhydrous | 108-90-7 | 2500ml |
| GS4307-500ml | Chlorobenzene, GlenPure™, analytical grade | 108-90-7 | 500ml |
| GS4307-1l | Chlorobenzene, GlenPure™, analytical grade | 108-90-7 | 1l |
| GS4307-2500ml | Chlorobenzene, GlenPure™, analytical grade | 108-90-7 | 2500ml |
| GP8327-100g | Chlorobutanol | 6001-64-5 | 100g |
| GP8327-250g | Chlorobutanol | 6001-64-5 | 250g |
| GP8327-500g | Chlorobutanol | 6001-64-5 | 500g |
| GS1454-100ml | Chloroform, GlenDry™, anhydrous stabilised with amylene | 67-66-3 | 100ml |
| GS1454-500ml | Chloroform, GlenDry™, anhydrous stabilised with amylene | 67-66-3 | 500ml |
| GS1454-1l | Chloroform, GlenDry™, anhydrous stabilised with amylene | 67-66-3 | 1l |
| GS1454-2500ml | Chloroform, GlenDry™, anhydrous stabilised with amylene | 67-66-3 | 2500ml |
| GS1447-100ml | Chloroform, GlenDry™, anhydrous stabilised with amylene over molecular sieve | 67-66-3 | 100ml |
| GS1447-500ml | Chloroform, GlenDry™, anhydrous stabilised with amylene over molecular sieve | 67-66-3 | 500ml |
| GS1447-1l | Chloroform, GlenDry™, anhydrous stabilised with amylene over molecular sieve | 67-66-3 | 1l |
| GS1447-2500ml | Chloroform, GlenDry™, anhydrous stabilised with amylene over molecular sieve | 67-66-3 | 2500ml |
| GS0166-500ml | Chloroform, GlenPure™, analytical grade stabilised with amylene | 67-66-3 | 500ml |
| GS0166-1l | Chloroform, GlenPure™, analytical grade stabilised with amylene | 67-66-3 | 1l |
| GS0166-2500ml | Chloroform, GlenPure™, analytical grade stabilised with amylene | 67-66-3 | 2500ml |
| GS8231-500ml | Chloroform, GlenPure™, analytical grade stabilised with ethanol | 67-66-3 | 500ml |
| GS8231-1l | Chloroform, GlenPure™, analytical grade stabilised with ethanol | 67-66-3 | 1l |
| GS8231-2500ml | Chloroform, GlenPure™, analytical grade stabilised with ethanol | 67-66-3 | 2500ml |
| GX1862-500ml | Chloroform:Isoamyl alcohol 24:1 | - | 500ml |
| GX1862-1l | Chloroform:Isoamyl alcohol 24:1 | - | 1l |
| GE3686-250mg | Chlorogenic acid | 327-97-9 | 250mg |
| GE3686-1g | Chlorogenic acid | 327-97-9 | 1g |
| GE3686-5g | Chlorogenic acid | 327-97-9 | 5g |
| GL6075-1mg | Chloroguanabenz acetate | 23113-55-5 | 1mg |
| GL6075-5mg | Chloroguanabenz acetate | 23113-55-5 | 5mg |
| GT3722-5g | Chlorophenol Red | 4430-20-0 | 5g |
| GT3722-10g | Chlorophenol Red | 4430-20-0 | 10g |
| GT3722-25g | Chlorophenol Red | 4430-20-0 | 25g |
| GT3722-50g | Chlorophenol Red | 4430-20-0 | 50g |
| GT3351-5g | Chlorophenol Red sodium salt | 123333-64-2 | 5g |
| GC5710-1mg | Chlorophenol red β-D-cellotrioside | 1mg | |
| GC5710-2mg | Chlorophenol red β-D-cellotrioside | 2mg | |
| GC5710-5mg | Chlorophenol red β-D-cellotrioside | 5mg | |
| GC5710-10mg | Chlorophenol red β-D-cellotrioside | 10mg | |
| GK0681-1g | Chloroplatinic acid hexahydrate | 18497-13-7 | 1g |
| GX8564-1g | Chloroplatinic acid hydrate | 26023-84-7 | 1g |
| GA7477-25g | Chloroquine diphosphate salt | 50-63-5 | 25g |
| GK4650-25g | Chlorotrimethylsilane | 75-77-4 | 25g |
| GK8706-500g | Chlorotriphenylmethane | 76-83-5 | 500g |
| GP7266-5g | Chlorpromazine hydrochloride | 69-09-0 | 5g |
| GP7266-25g | Chlorpromazine hydrochloride | 69-09-0 | 25g |
| GL6406-25g | Chlorpropamide | 94-20-2 | 25g |
| GX2033-1g | Chlorpropham | 101-21-3 | 1g |
| GX2033-5g | Chlorpropham | 101-21-3 | 5g |
| GX2033-25g | Chlorpropham | 101-21-3 | 25g |
| GE2650-100mg | Chlorsulfuron | 64902-72-3 | 100mg |
| GE2650-250mg | Chlorsulfuron | 64902-72-3 | 250mg |
| GA8098-1g | Chlortetracycline hydrochloride | 64-72-2 | 1g |
| GA8098-5g | Chlortetracycline hydrochloride | 64-72-2 | 5g |
| GA8098-25g | Chlortetracycline hydrochloride | 64-72-2 | 25g |
| GA8098-100g | Chlortetracycline hydrochloride | 64-72-2 | 100g |
| GP6973-25g | Chlorzoxazone | 95-25-0 | 25g |
| GP6973-100g | Chlorzoxazone | 95-25-0 | 100g |
| GP6973-250g | Chlorzoxazone | 95-25-0 | 250g |
| GT2746-25g | Chocolate Brown HT (C.I. 20285) | 4553-89-3 | 25g |
| GT2746-100g | Chocolate Brown HT (C.I. 20285) | 4553-89-3 | 100g |
| GT2746-250g | Chocolate Brown HT (C.I. 20285) | 4553-89-3 | 250g |
| GV0048-250mg | Cholecalciferol | 67-97-0 | 250mg |
| GV0048-1g | Cholecalciferol | 67-97-0 | 1g |
| GV0048-5g | Cholecalciferol | 67-97-0 | 5g |
| GV0048-10g | Cholecalciferol | 67-97-0 | 10g |
| GV0048-25g | Cholecalciferol | 67-97-0 | 25g |
| GE1295-5g | Cholesterol | 57-88-5 | 5g |
| GE1295-25g | Cholesterol | 57-88-5 | 25g |
| GE1295-100g | Cholesterol | 57-88-5 | 100g |
| GE1295-250g | Cholesterol | 57-88-5 | 250g |
| GE1295-500g | Cholesterol | 57-88-5 | 500g |
| GE7110-1g | Cholesterol, non-animal origin | 57-88-5 | 1g |
| GE0100-100g | Cholesterol, USP/NF grade, from lanolin | 57-88-5 | 100g |
| GE0100-250g | Cholesterol, USP/NF grade, from lanolin | 57-88-5 | 250g |
| GE0100-500g | Cholesterol, USP/NF grade, from lanolin | 57-88-5 | 500g |
| GE0100-1kg | Cholesterol, USP/NF grade, from lanolin | 57-88-5 | 1kg |
| GE0043-50g | Cholesteryl acetate | 604-35-3 | 50g |
| GE0043-100g | Cholesteryl acetate | 604-35-3 | 100g |
| GW6273-50mg | Cholesteryl coumarin-3-carboxylate | 196091-78-8 | 50mg |
| GW6273-250mg | Cholesteryl coumarin-3-carboxylate | 196091-78-8 | 250mg |
| GL2093-1g | Cholesteryl phenylacetate | 33998-26-4 | 1g |
| GD0884-25g | Cholic acid | 81-25-4 | 25g |
| GD0884-100g | Cholic acid | 81-25-4 | 100g |
| GD0884-250g | Cholic acid | 81-25-4 | 250g |
| GD0884-500g | Cholic acid | 81-25-4 | 500g |
| GD0884-1kg | Cholic acid | 81-25-4 | 1kg |
| GD5134-10g | Cholic acid sodium salt hydrate | 206986-87-0 | 10g |
| GD5134-25g | Cholic acid sodium salt hydrate | 206986-87-0 | 25g |
| GD5134-100g | Cholic acid sodium salt hydrate | 206986-87-0 | 100g |
| GD5134-250g | Cholic acid sodium salt hydrate | 206986-87-0 | 250g |
| GD5134-500g | Cholic acid sodium salt hydrate | 206986-87-0 | 500g |
| GL2853-100g | Choline bitartrate | 87-67-2 | 100g |
| GL2853-250g | Choline bitartrate | 87-67-2 | 250g |
| GL2853-500g | Choline bitartrate | 87-67-2 | 500g |
| GL2853-1kg | Choline bitartrate | 87-67-2 | 1kg |
| GV0497-100g | Choline chloride | 67-48-1 | 100g |
| GV0497-250g | Choline chloride | 67-48-1 | 250g |
| GV0497-500g | Choline chloride | 67-48-1 | 500g |
| GV0497-1kg | Choline chloride | 67-48-1 | 1kg |
| GV9961-25g | Choline chloride, USP grade | 67-48-1 | 25g |
| GV9961-100g | Choline chloride, USP grade | 67-48-1 | 100g |
| GV9961-250g | Choline chloride, USP grade | 67-48-1 | 250g |
| GV1490-1kg | Choline dihydrogen citrate | 77-91-8 | 1kg |
| GC6763-5g | Chondroitin sulfate A sodium salt | 39455-18-0 | 5g |
| GC6763-10g | Chondroitin sulfate A sodium salt | 39455-18-0 | 10g |
| GC6763-25g | Chondroitin sulfate A sodium salt | 39455-18-0 | 25g |
| GC6763-50g | Chondroitin sulfate A sodium salt | 39455-18-0 | 50g |
| GC6763-100g | Chondroitin sulfate A sodium salt | 39455-18-0 | 100g |
| GC0982-1g | Chondroitin sulfate sodium, from bovine origin | 9082-07-9 | 1g |
| GC0982-5g | Chondroitin sulfate sodium, from bovine origin | 9082-07-9 | 5g |
| GC0982-25g | Chondroitin sulfate sodium, from bovine origin | 9082-07-9 | 25g |
| GC0982-50g | Chondroitin sulfate sodium, from bovine origin | 9082-07-9 | 50g |
| GC3554-50g | Chondroitin sulfate sodium, from bovine origin, USP grade | 9082-07-9 | 50g |
| GK9782-25g | Chrome Azurol S | 1667-99-8 | 25g |
| GK9782-100g | Chrome Azurol S | 1667-99-8 | 100g |
| GT5884-25g | Chromeazurol B | 1796-92-5 | 25g |
| GX0027-50g | Chromium boride | 12007-16-8 | 50g |
| GX4494-50g | Chromium boride, 99+% | 12006-79-0 | 50g |
| GX2872-100g | Chromium boride, 99+% | 12007-38-0 | 100g |
| GX2744-100g | Chromium carbide max. 10 micron | 12012-35-0 | 100g |
| GX2744-250g | Chromium carbide max. 10 micron | 12012-35-0 | 250g |
| GX8032-10g | Chromium carbide, 99% | 12075-40-0 | 10g |
| GX3062-10g | Chromium carbide, 99% | 12105-81-6 | 10g |
| GX8032-25g | Chromium carbide, 99% | 12075-40-0 | 25g |
| GX3062-25g | Chromium carbide, 99% | 12105-81-6 | 25g |
| GX8032-100g | Chromium carbide, 99% | 12075-40-0 | 100g |
| GX3062-100g | Chromium carbide, 99% | 12105-81-6 | 100g |
| GX0410-250g | Chromium electrolytic pieces, 99.9% | 7440-47-3 | 250g |
| GX0410-1kg | Chromium electrolytic pieces, 99.9% | 7440-47-3 | 1kg |
| GX0257-25x25mm | Chromium Foil 0.5 mm, 99.95% | 7440-47-3 | 25x25mm |
| GX0257-50x50mm | Chromium Foil 0.5 mm, 99.95% | 7440-47-3 | 50x50mm |
| GX1682-50x50mm | Chromium Foil 1 mm, 99.95% | 7440-47-3 | 50x50mm |
| GX1682-100x100mm | Chromium Foil 1 mm, 99.95% | 7440-47-3 | 100x100mm |
| GX7997-50g | Chromium Granules 0.5-2 mm low oxygen, 99.98% | 7440-47-3 | 50g |
| GX7311-25g | Chromium Granules 1-3 mm, 99.94+% | 7440-47-3 | 25g |
| GX7311-100g | Chromium Granules 1-3 mm, 99.94+% | 7440-47-3 | 100g |
| GX7377-250g | Chromium Granules 1-3 mm, 99+% | 7440-47-3 | 250g |
| GX7377-1kg | Chromium Granules 1-3 mm, 99+% | 7440-47-3 | 1kg |
| GX6873-10g | Chromium Nanopowder, coated with oleic acid, 99,5 % | 7440-47-3 | 10g |
| GX4749-50g | Chromium nitride, 99% | 12053-27-9 | 50g |
| GV9468-5g | Chromium picolinate | 14639-25-9 | 5g |
| GV9468-10g | Chromium picolinate | 14639-25-9 | 10g |
| GV9468-25g | Chromium picolinate | 14639-25-9 | 25g |
| GX2285-10g | Chromium Pieces 1-6 mm, 99.998% | 7440-47-3 | 10g |
| GX2285-25g | Chromium Pieces 1-6 mm, 99.998% | 7440-47-3 | 25g |
| GX5688-25g | Chromium Pieces 2-4.7 mm, 99.99% | 7440-47-3 | 25g |
| GX5688-100g | Chromium Pieces 2-4.7 mm, 99.99% | 7440-47-3 | 100g |
| GX4156-25g | Chromium Pieces 3-6 mm, 99.99% | 7440-47-3 | 25g |
| GX4156-100g | Chromium Pieces 3-6 mm, 99.99% | 7440-47-3 | 100g |
| GX7117-25g | Chromium Pieces max. 25 mm, 99.99% | 7440-47-3 | 25g |
| GX7117-100g | Chromium Pieces max. 25 mm, 99.99% | 7440-47-3 | 100g |
| GX9992-250g | Chromium Pieces max. 25 mm, 99+% | 7440-47-3 | 250g |
| GX9992-1kg | Chromium Pieces max. 25 mm, 99+% | 7440-47-3 | 1kg |
| GX7481-10g | Chromium Powder -100, +325 mesh, 99.99% | 7440-47-3 | 10g |
| GX7481-50g | Chromium Powder -100, +325 mesh, 99.99% | 7440-47-3 | 50g |
| GX0993-100g | Chromium Powder max. 500 micron, 99.9% | 7440-47-3 | 100g |
| GX0993-250g | Chromium Powder max. 500 micron, 99.9% | 7440-47-3 | 250g |
| GX0993-1kg | Chromium Powder max. 500 micron, 99.9% | 7440-47-3 | 1kg |
| GX6846-50mm | Chromium Rod 1 mm diameter, 99.9+% | 7440-47-3 | 50mm |
| GX3857-50mm | Chromium Rod 2 mm diameter, 99.9+% | 7440-47-3 | 50mm |
| GX8217-50mm | Chromium Rod 3 mm diameter, 99.9+% | 7440-47-3 | 50mm |
| GX7727-50mm | Chromium Rod 5 mm diameter, 99.9+% | 7440-47-3 | 50mm |
| GX3634-10mm | Chromium Rod 6 mm diameter, 99.7% | 7440-47-3 | 10mm |
| GX3634-25mm | Chromium Rod 6 mm diameter, 99.7% | 7440-47-3 | 25mm |
| GX3634-80mm | Chromium Rod 6 mm diameter, 99.7% | 7440-47-3 | 80mm |
| GX6042-100g | Chromium silicide, 99.5% | 12018-09-6 | 100g |
| GX6042-250g | Chromium silicide, 99.5% | 12018-09-6 | 250g |
| GX4955-10g | Chromium(II) fluoride | 10049-10-2 | 10g |
| GX8870-250g | Chromium(III) 2,4-pentanedionate | 21679-31-2 | 250g |
| GX8870-1kg | Chromium(III) 2,4-pentanedionate | 21679-31-2 | 1kg |
| GX7557-100g | Chromium(III) chloride hexahydrate | 10060-12-5 | 100g |
| GX7557-250g | Chromium(III) chloride hexahydrate | 10060-12-5 | 250g |
| GX7557-500g | Chromium(III) chloride hexahydrate | 10060-12-5 | 500g |
| GX7557-1kg | Chromium(III) chloride hexahydrate | 10060-12-5 | 1kg |
| GX6223-5g | Chromium(III) chloride, anhydrous, 97% | 10025-73-7 | 5g |
| GX6223-25g | Chromium(III) chloride, anhydrous, 97% | 10025-73-7 | 25g |
| GX6343-25g | Chromium(III) chloride, hexahydrate, 99.995% | 10060-12-5 | 25g |
| GX7644-250g | Chromium(III) nitrate, nonahydrate, 97% | 7789-02-8 | 250g |
| GX0244-25g | Chromium(III) oxide Nanopowder, 99+ % | 1308-38-9 | 25g |
| GX0244-250g | Chromium(III) oxide Nanopowder, 99+ % | 1308-38-9 | 250g |
| GX0492-10g | Chromium(III) oxide, 99.97% | 1308-38-9 | 10g |
| GX8616-500g | Chromium(III) potassium sulfate dodecahydrate | 7788-99-0 | 500g |
| GT1771-10mg | Chromoionophore I | 125829-24-5 | 10mg |
| GT1771-20mg | Chromoionophore I | 125829-24-5 | 20mg |
| GT1771-100mg | Chromoionophore I | 125829-24-5 | 100mg |
| GT1481-10g | Chromotrope 2B | 548-80-1 | 10g |
| GT1481-25g | Chromotrope 2B | 548-80-1 | 25g |
| GT1481-100g | Chromotrope 2B | 548-80-1 | 100g |
| GT8047-25g | Chromotrope 2R (C.I. 16570) | 4197-07-3 | 25g |
| GT8047-100g | Chromotrope 2R (C.I. 16570) | 4197-07-3 | 100g |
| GL4239-10g | Chromotrope FB (C.I. 14720) | 3567-69-9 | 10g |
| GL4239-25g | Chromotrope FB (C.I. 14720) | 3567-69-9 | 25g |
| GL4239-50g | Chromotrope FB (C.I. 14720) | 3567-69-9 | 50g |
| GL4239-100g | Chromotrope FB (C.I. 14720) | 3567-69-9 | 100g |
| GL4239-250g | Chromotrope FB (C.I. 14720) | 3567-69-9 | 250g |
| GT6352-25g | Chromotropic acid sodium salt | 5808-22-0 | 25g |
| GT6352-100g | Chromotropic acid sodium salt | 5808-22-0 | 100g |
| GT6352-250g | Chromotropic acid sodium salt | 5808-22-0 | 250g |
| GT6352-500g | Chromotropic acid sodium salt | 5808-22-0 | 500g |
| GP8179-25g | Chrysin | 480-40-0 | 25g |
| GP8179-100g | Chrysin | 480-40-0 | 100g |
| GY6852-5mg | Chrysin 7-glucuronide | 35775-49-6 | 5mg |
| GA3480-250ug | Chrysomycin A | 82196-88-1 | 250ug |
| GA3480-1mg | Chrysomycin A | 82196-88-1 | 1mg |
| GA9550-250ug | Chrysomycin B | 83852-56-6 | 250ug |
| GA9550-1mg | Chrysomycin B | 83852-56-6 | 1mg |
| GA8690-25mg | Chrysophanol | 481-74-3 | 25mg |
| GL8838-5mg | CHS-828 | 200484-11-3 | 5mg |
| GL8838-25mg | CHS-828 | 200484-11-3 | 25mg |
| GT9393-5g | Cibacron Brilliant Red 3B-A | 17681-50-4 | 5g |
| GT9393-25g | Cibacron Brilliant Red 3B-A | 17681-50-4 | 25g |
| GP3015-1g | Ciclopirox | 29342-05-0 | 1g |
| GP3015-5g | Ciclopirox | 29342-05-0 | 5g |
| GA7329-1g | Ciclopirox olamine | 41621-49-2 | 1g |
| GA7329-5g | Ciclopirox olamine | 41621-49-2 | 5g |
| GP0753-10mg | Cidofovir hydrate | 113852-37-2 | 10mg |
| GL8018-1mg | Ciglitizone | 74772-77-3 | 1mg |
| GL8018-5mg | Ciglitizone | 74772-77-3 | 5mg |
| GL8018-25mg | Ciglitizone | 74772-77-3 | 25mg |
| GP8376-100mg | Cilastatin sodium salt | 81129-83-1 | 100mg |
| GP7846-1g | Cilostazol | 73963-72-1 | 1g |
| GP7846-5g | Cilostazol | 73963-72-1 | 5g |
| GP0061-5g | Cimetidine | 51481-61-9 | 5g |
| GP0061-10g | Cimetidine | 51481-61-9 | 10g |
| GP0061-25g | Cimetidine | 51481-61-9 | 25g |
| GW9831-5g | Cinchocaine | 85-79-0 | 5g |
| GW9831-10g | Cinchocaine | 85-79-0 | 10g |
| GP1244-10g | Cinchonidine | 485-71-2 | 10g |
| GP1244-25g | Cinchonidine | 485-71-2 | 25g |
| GP1244-100g | Cinchonidine | 485-71-2 | 100g |
| GK1431-25g | Cinchonine | 118-10-5 | 25g |
| GK1431-100g | Cinchonine | 118-10-5 | 100g |
| GK1431-250g | Cinchonine | 118-10-5 | 250g |
| GL3074-25g | Cinnamon oil, from leaf | 8015-91-6 | 25g |
| GL3074-100g | Cinnamon oil, from leaf | 8015-91-6 | 100g |
| GL7838-5mg | Cinnamtannin B-1 | 88082-60-4 | 5mg |
| GW9974-50g | Cinnamyltriphenylphosphonium chloride | 1530-35-4 | 50g |
| GW9974-100g | Cinnamyltriphenylphosphonium chloride | 1530-35-4 | 100g |
| GP9214-10g | Cinnarizine | 298-57-7 | 10g |
| GT8023-100mg | Cinnoline hydrochloride | 5949-24-6 | 100mg |
| GT8023-250mg | Cinnoline hydrochloride | 5949-24-6 | 250mg |
| GT8023-1g | Cinnoline hydrochloride | 5949-24-6 | 1g |
| GP7595-5mg | Cinobufagin | 470-37-1 | 5mg |
| GP7595-25mg | Cinobufagin | 470-37-1 | 25mg |
| GA2067-100mg | Cinoxacin | 28657-80-9 | 100mg |
| GA2067-1g | Cinoxacin | 28657-80-9 | 1g |
| GC0593-1mg | Ciprofibrate acyl-β-D-glucuronide | 102623-15-4 | 1mg |
| GC0593-2mg | Ciprofibrate acyl-β-D-glucuronide | 102623-15-4 | 2mg |
| GC0593-5mg | Ciprofibrate acyl-β-D-glucuronide | 102623-15-4 | 5mg |
| GC0593-10mg | Ciprofibrate acyl-β-D-glucuronide | 102623-15-4 | 10mg |
| GC0593-25mg | Ciprofibrate acyl-β-D-glucuronide | 102623-15-4 | 25mg |
| GA2367-1g | Ciprofloxacin hydrochloride monohydrate | 86393-32-0 | 1g |
| GA2367-5g | Ciprofloxacin hydrochloride monohydrate | 86393-32-0 | 5g |
| GA2367-25g | Ciprofloxacin hydrochloride monohydrate | 86393-32-0 | 25g |
| GP3881-5g | Ciprofloxacin, 98% | 85721-33-1 | 5g |
| GP3881-25g | Ciprofloxacin, 98% | 85721-33-1 | 25g |
| GA9068-5g | Ciprofloxacin, USP grade | 85721-33-1 | 5g |
| GA9068-25g | Ciprofloxacin, USP grade | 85721-33-1 | 25g |
| GW0717-10mg | cis-11-Methyl-2-dodecenoic acid | 677354-23-3 | 10mg |
| GW0717-100mg | cis-11-Methyl-2-dodecenoic acid | 677354-23-3 | 100mg |
| GW0247-100mg | cis-2-Decenoic acid | 15790-91-7 | 100mg |
| GW3885-10mg | cis-2-Dodecenoic acid | 55928-65-9 | 10mg |
| GK0953-100mg | cis-4,7,10,13,16,19-Docosahexaenoic acid, 98% | 6217-54-5 | 100mg |
| GK0953-1g | cis-4,7,10,13,16,19-Docosahexaenoic acid, 98% | 6217-54-5 | 1g |
| GK4054-250mg | cis-5,8,11,14,17-Eicosapentaenoic acid, 96% | 10417-94-4 | 250mg |
| GK4054-1g | cis-5,8,11,14,17-Eicosapentaenoic acid, 96% | 10417-94-4 | 1g |
| GX4154-1g | cis-Dichlorodiamine platinum(II); 99.95% (metals basis) | 15663-27-1 | 1g |
| GX4154-5g | cis-Dichlorodiamine platinum(II); 99.95% (metals basis) | 15663-27-1 | 5g |
| GL0434-100mg | Cisapride monohydrate | 260779-88-2 | 100mg |
| GA8978-25mg | Cisplatin | 15663-27-1 | 25mg |
| GA8978-100mg | Cisplatin | 15663-27-1 | 100mg |
| GA8978-250mg | Cisplatin | 15663-27-1 | 250mg |
| GA8978-1g | Cisplatin | 15663-27-1 | 1g |
| GP8111-100mg | Citalopram hydrobromide | 59729-32-7 | 100mg |
| GP8111-250mg | Citalopram hydrobromide | 59729-32-7 | 250mg |
| GP8111-500mg | Citalopram hydrobromide | 59729-32-7 | 500mg |
| GP8111-1g | Citalopram hydrobromide | 59729-32-7 | 1g |
| GP4568-5g | Citicoline sodium salt | 33818-15-4 | 5g |
| GP4568-10g | Citicoline sodium salt | 33818-15-4 | 10g |
| GP4568-25g | Citicoline sodium salt | 33818-15-4 | 25g |
| GL7641-25ml | Citral | 5392-40-5 | 25ml |
| GL7641-100ml | Citral | 5392-40-5 | 100ml |
| GL7641-500ml | Citral | 5392-40-5 | 500ml |
| GE4475-100ml | Citrate buffer, 0.09M solution | 100ml | |
| GE4475-250ml | Citrate buffer, 0.09M solution | 250ml | |
| GB4634-100ml | Citrate concentrated buffer, 4% solution, non-sterile | 68-04-2 | 100ml |
| GB4634-250ml | Citrate concentrated buffer, 4% solution, non-sterile | 68-04-2 | 250ml |
| GB4634-500ml | Citrate concentrated buffer, 4% solution, non-sterile | 68-04-2 | 500ml |
| GB3820-1l | Citrate concentrated buffer, 4% solution, sterile | 68-04-2 | 1l |
| GK0024-250g | Citric acid monohydrate | 5949-29-1 | 250g |
| GK0024-500g | Citric acid monohydrate | 5949-29-1 | 500g |
| GK0024-1kg | Citric acid monohydrate | 5949-29-1 | 1kg |
| GK0024-5kg | Citric acid monohydrate | 5949-29-1 | 5kg |
| GK0024-10kg | Citric acid monohydrate | 5949-29-1 | 10kg |
| GK9002-250g | Citric acid monohydrate, Ultrapure | 5949-29-1 | 250g |
| GK9002-1kg | Citric acid monohydrate, Ultrapure | 5949-29-1 | 1kg |
| GK9002-5kg | Citric acid monohydrate, Ultrapure | 5949-29-1 | 5kg |
| GK9002-10kg | Citric acid monohydrate, Ultrapure | 5949-29-1 | 10kg |
| GV4009-250g | Citric acid, anhydrous, 99.5%, BP, Ph. Eur., USP grade | 77-92-9 | 250g |
| GV4009-500g | Citric acid, anhydrous, 99.5%, BP, Ph. Eur., USP grade | 77-92-9 | 500g |
| GV4009-1kg | Citric acid, anhydrous, 99.5%, BP, Ph. Eur., USP grade | 77-92-9 | 1kg |
| GV4009-5kg | Citric acid, anhydrous, 99.5%, BP, Ph. Eur., USP grade | 77-92-9 | 5kg |
| GV2911-500g | Citric acid, anhydrous, 99% | 77-92-9 | 500g |
| GV2911-1kg | Citric acid, anhydrous, 99% | 77-92-9 | 1kg |
| GV2911-5kg | Citric acid, anhydrous, 99% | 77-92-9 | 5kg |
| GV2911-10kg | Citric acid, anhydrous, 99% | 77-92-9 | 10kg |
| GW5425-1mg | Citrinalin A | 1256635-19-4 | 1mg |
| GW5425-2500ug | Citrinalin A | 1256635-19-4 | 2500ug |
| GP8412-1mg | Citrinin | 518-75-2 | 1mg |
| GP8412-5mg | Citrinin | 518-75-2 | 5mg |
| GP8412-25mg | Citrinin | 518-75-2 | 25mg |
| GL9602-1mg | CJ-21058 | 405072-57-3 | 1mg |
| GL9602-5mg | CJ-21058 | 405072-57-3 | 5mg |
| GW4210-1mg | CK2 Inhibitor 10 | 1361229-76-6 | 1mg |
| GW4210-5mg | CK2 Inhibitor 10 | 1361229-76-6 | 5mg |
| GA3225-1mg | Cladospirone bisepoxide | 152607-03-9 | 1mg |
| GA3225-5mg | Cladospirone bisepoxide | 152607-03-9 | 5mg |
| GA8846-100mg | Clarithromycin | 81103-11-9 | 100mg |
| GA8846-250mg | Clarithromycin | 81103-11-9 | 250mg |
| GA8846-1g | Clarithromycin | 81103-11-9 | 1g |
| GW3158-10mg | Clarithromycin N-oxide | 118074-07-0 | 10mg |
| GW3158-25mg | Clarithromycin N-oxide | 118074-07-0 | 25mg |
| GW3158-100mg | Clarithromycin N-oxide | 118074-07-0 | 100mg |
| GK6045-200ug | clasto-Lactacystin b-lactone | 154226-60-5 | 200ug |
| GK6045-1mg | clasto-Lactacystin b-lactone | 154226-60-5 | 1mg |
| GP8280-100mg | Clevudine | 163252-36-6 | 100mg |
| GP8280-250mg | Clevudine | 163252-36-6 | 250mg |
| GA1965-25g | Climbazole | 38083-17-9 | 25g |
| GA1965-100g | Climbazole | 38083-17-9 | 100g |
| GA1965-250g | Climbazole | 38083-17-9 | 250g |
| GA6414-25mg | Clinafloxacin | 105956-97-6 | 25mg |
| GA9308-1g | Clindamycin 2-phosphate | 24729-96-2 | 1g |
| GA9308-5g | Clindamycin 2-phosphate | 24729-96-2 | 5g |
| GA9308-25g | Clindamycin 2-phosphate | 24729-96-2 | 25g |
| GA5034-250mg | Clindamycin hydrochloride | 21462-39-5 | 250mg |
| GA5034-1g | Clindamycin hydrochloride | 21462-39-5 | 1g |
| GA5034-5g | Clindamycin hydrochloride | 21462-39-5 | 5g |
| GA2166-25mg | Clindamycin palmitate hydrochloride | 36688-78-5 | 25mg |
| GP2221-1g | Clobetasol propionate | 25122-46-7 | 1g |
| GP2221-5g | Clobetasol propionate | 25122-46-7 | 5g |
| GP0268-1g | Clobetasol propionate, USP grade | 25122-46-7 | 1g |
| GP0268-5g | Clobetasol propionate, USP grade | 25122-46-7 | 5g |
| GP6103-1g | Clodronate disodium salt hydrate | 88416-50-6 | 1g |
| GA9061-1g | Clofazimine | 2030-63-9 | 1g |
| GA9061-5g | Clofazimine | 2030-63-9 | 5g |
| GK6504-50g | Clofibric acid | 882-09-7 | 50g |
| GP4170-1g | Clomiphene citrate | 50-41-9 | 1g |
| GP4170-5g | Clomiphene citrate | 50-41-9 | 5g |
| GP9545-1g | Clomipramine hydrochloride | 17321-77-6 | 1g |
| GP9545-5g | Clomipramine hydrochloride | 17321-77-6 | 5g |
| GP9545-10g | Clomipramine hydrochloride | 17321-77-6 | 10g |
| GP9545-25g | Clomipramine hydrochloride | 17321-77-6 | 25g |
| GP5303-1g | Clonidine hydrochloride | 4205-91-8 | 1g |
| GP5303-5g | Clonidine hydrochloride | 4205-91-8 | 5g |
| GA0864-100mg | Clopidol | 2971-90-6 | 100mg |
| GA0864-250mg | Clopidol | 2971-90-6 | 250mg |
| GW1684-50mg | Clothianidin-d3 | 1262776-24-8 | 50mg |
| GW1684-100mg | Clothianidin-d3 | 1262776-24-8 | 100mg |
| GA8137-5g | Clotrimazole | 23593-75-1 | 5g |
| GA8137-25g | Clotrimazole | 23593-75-1 | 25g |
| GA8137-100g | Clotrimazole | 23593-75-1 | 100g |
| GK8390-100ml | Clove oil | 8000-34-8 | 100ml |
| GK8390-500ml | Clove oil | 8000-34-8 | 500ml |
| GA4688-1g | Cloxacillin sodium salt | 642-78-4 | 1g |
| GA4688-5g | Cloxacillin sodium salt | 642-78-4 | 5g |
| GA4688-25g | Cloxacillin sodium salt | 642-78-4 | 25g |
| GP7633-100mg | Clozapine | 5786-21-0 | 100mg |
| GP7633-250mg | Clozapine | 5786-21-0 | 250mg |
| GP7633-1g | Clozapine | 5786-21-0 | 1g |
| GP7633-5g | Clozapine | 5786-21-0 | 5g |
| GY5145-1mg | Cnidicin | 14348-21-1 | 1mg |
| GX5107-25g | Cobalt boride | 12045-01-1 | 25g |
| GX9431-25g | Cobalt Flake, electrolytic, 99.9% | 7440-48-4 | 25g |
| GX9431-100g | Cobalt Flake, electrolytic, 99.9% | 7440-48-4 | 100g |
| GX5174-50x50mm | Cobalt Foil 0.1 mm, 99.9% | 7440-48-4 | 50x50mm |
| GX1228-50x50mm | Cobalt Foil 0.1 mm, 99.99+% | 7440-48-4 | 50x50mm |
| GX3725-50x50mm | Cobalt Foil 0.125 mm, 99.9% | 7440-48-4 | 50x50mm |
| GX3367-50x50mm | Cobalt Foil 0.25 mm, 99.95% | 7440-48-4 | 50x50mm |
| GX4517-25x25mm | Cobalt Foil 0.5 mm, 99.9% | 7440-48-4 | 25x25mm |
| GX4517-50x50mm | Cobalt Foil 0.5 mm, 99.9% | 7440-48-4 | 50x50mm |
| GX4517-100x100mm | Cobalt Foil 0.5 mm, 99.9% | 7440-48-4 | 100x100mm |
| GX6216-10g | Cobalt Granules 1-1.5 mm, 99.99% (metals basis) | 7440-48-4 | 10g |
| GX6216-50g | Cobalt Granules 1-1.5 mm, 99.99% (metals basis) | 7440-48-4 | 50g |
| GX4966-5g | Cobalt Nanopowder, 99,8 % | 7440-48-4 | 5g |
| GX4966-10g | Cobalt Nanopowder, 99,8 % | 7440-48-4 | 10g |
| GX4966-25g | Cobalt Nanopowder, 99,8 % | 7440-48-4 | 25g |
| GX4966-100g | Cobalt Nanopowder, 99,8 % | 7440-48-4 | 100g |
| GX9558-10g | Cobalt Pellets 6 x 5 - 7 mm, 99.95% | 7440-48-4 | 10g |
| GX9558-50g | Cobalt Pellets 6 x 5 - 7 mm, 99.95% | 7440-48-4 | 50g |
| GX8242-25g | Cobalt Powder - 200, + 325 mesh (Ni max. 1500 ppm); 99.8+% | 7440-48-4 | 25g |
| GX8242-100g | Cobalt Powder - 200, + 325 mesh (Ni max. 1500 ppm); 99.8+% | 7440-48-4 | 100g |
| GX8234-100g | Cobalt Powder -200 mesh, 99.9% | 7440-48-4 | 100g |
| GX8234-500g | Cobalt Powder -200 mesh, 99.9% | 7440-48-4 | 500g |
| GX2161-5g | Cobalt Powder -50 mesh (Ni max. 1500 ppm); 99.99% | 7440-48-4 | 5g |
| GX2161-25g | Cobalt Powder -50 mesh (Ni max. 1500 ppm); 99.99% | 7440-48-4 | 25g |
| GX4468-25g | Cobalt Powder 2-4 micron, 99.5% | 7440-48-4 | 25g |
| GX4468-100g | Cobalt Powder 2-4 micron, 99.5% | 7440-48-4 | 100g |
| GX6439-50mm | Cobalt Rod 12 mm diameter, 99.95% | 7440-48-4 | 50mm |
| GX6761-50mm | Cobalt Rod 5 mm diameter, 99.995% | 7440-48-4 | 50mm |
| GX0438-50mm | Cobalt Rod 5.0 mm diameter, 99.95% | 7440-48-4 | 50mm |
| GX0438-150mm | Cobalt Rod 5.0 mm diameter, 99.95% | 7440-48-4 | 150mm |
| GX8510-50g | Cobalt Shot max. 13 mm (Ni max. 2000 ppm); 99.5% | 7440-48-4 | 50g |
| GX8510-100g | Cobalt Shot max. 13 mm (Ni max. 2000 ppm); 99.5% | 7440-48-4 | 100g |
| GX8510-500g | Cobalt Shot max. 13 mm (Ni max. 2000 ppm); 99.5% | 7440-48-4 | 500g |
| GX6736-5g | Cobalt thiocyanate, 98% | 3017-60-5 | 5g |
| GX6736-25g | Cobalt thiocyanate, 98% | 3017-60-5 | 25g |
| GX6736-100g | Cobalt thiocyanate, 98% | 3017-60-5 | 100g |
| GX7689-25cm | Cobalt Wire 0.5 mm diameter, 99.95% | 7440-48-4 | 25cm |
| GX7689-1m | Cobalt Wire 0.5 mm diameter, 99.95% | 7440-48-4 | 1m |
| GX1752-10cm | Cobalt Wire 1.0 mm diameter, 99.998% | 7440-48-4 | 10cm |
| GX1752-50cm | Cobalt Wire 1.0 mm diameter, 99.998% | 7440-48-4 | 50cm |
| GX7928-2cm | Cobalt Wire 2.0 mm diameter, 99.99+% | 7440-48-4 | 2cm |
| GX7928-10cm | Cobalt Wire 2.0 mm diameter, 99.99+% | 7440-48-4 | 10cm |
| GX5497-25g | Cobalt(II,III) oxide-Nano Powder, 99.8% | 1308-06-1 | 25g |
| GX5497-100g | Cobalt(II,III) oxide-Nano Powder, 99.8% | 1308-06-1 | 100g |
| GX6239-250g | Cobalt(II,III) oxide, 98+% | 1308-06-1 | 250g |
| GX6239-1kg | Cobalt(II,III) oxide, 98+% | 1308-06-1 | 1kg |
| GX8543-250g | Cobalt(II,III) oxide, 99.97+% | 1308-06-1 | 250g |
| GX8543-1kg | Cobalt(II,III) oxide, 99.97+% | 1308-06-1 | 1kg |
| GX9460-100g | Cobalt(II) 2,4-pentanedionate, 98% | 14024-48-7 | 100g |
| GK1133-25g | Cobalt(II) acetate tetrahydrate | 6147-53-1 | 25g |
| GK1133-100g | Cobalt(II) acetate tetrahydrate | 6147-53-1 | 100g |
| GK1133-250g | Cobalt(II) acetate tetrahydrate | 6147-53-1 | 250g |
| GK1133-500g | Cobalt(II) acetate tetrahydrate | 6147-53-1 | 500g |
| GK1133-1kg | Cobalt(II) acetate tetrahydrate | 6147-53-1 | 1kg |
| GX5571-50g | Cobalt(II) acetate, anhydrous | 71-48-7 | 50g |
| GX5571-100g | Cobalt(II) acetate, anhydrous | 71-48-7 | 100g |
| GX5571-250g | Cobalt(II) acetate, anhydrous | 71-48-7 | 250g |
| GK0520-25g | Cobalt(II) chloride hexahydrate | 7791-13-1 | 25g |
| GK0520-100g | Cobalt(II) chloride hexahydrate | 7791-13-1 | 100g |
| GK0520-250g | Cobalt(II) chloride hexahydrate | 7791-13-1 | 250g |
| GK0520-500g | Cobalt(II) chloride hexahydrate | 7791-13-1 | 500g |
| GK0520-1kg | Cobalt(II) chloride hexahydrate | 7791-13-1 | 1kg |
| GX7281-10g | Cobalt(II) chloride-1,5-Tetrahydrofuran | 10g | |
| GX7281-25g | Cobalt(II) chloride-1,5-Tetrahydrofuran | 25g | |
| GK0658-25g | Cobalt(II) chloride, anhydrous | 7646-79-9 | 25g |
| GK0658-100g | Cobalt(II) chloride, anhydrous | 7646-79-9 | 100g |
| GK0658-250g | Cobalt(II) chloride, anhydrous | 7646-79-9 | 250g |
| GK0658-500g | Cobalt(II) chloride, anhydrous | 7646-79-9 | 500g |
| GX6043-10g | Cobalt(II) fluoride | 10026-17-2 | 10g |
| GX0081-500g | Cobalt(II) hydroxide | 21041-93-0 | 500g |
| GK6333-25g | Cobalt(II) nitrate hexahydrate | 10026-22-9 | 25g |
| GK6333-100g | Cobalt(II) nitrate hexahydrate | 10026-22-9 | 100g |
| GK6333-250g | Cobalt(II) nitrate hexahydrate | 10026-22-9 | 250g |
| GK6333-500g | Cobalt(II) nitrate hexahydrate | 10026-22-9 | 500g |
| GX7772-100g | Cobalt(II) sulfate heptahydrate | 10026-24-1 | 100g |
| GX7772-250g | Cobalt(II) sulfate heptahydrate | 10026-24-1 | 250g |
| GX7772-500g | Cobalt(II) sulfate heptahydrate | 10026-24-1 | 500g |
| GX7772-1kg | Cobalt(II) sulfate heptahydrate | 10026-24-1 | 1kg |
| GX8406-50g | Cobalt(III) 2,4-pentanedionate, 98% | 21679-46-9 | 50g |
| GX1019-10g | Cobalt(III) fluoride, 99% | 10026-18-3 | 10g |
| GX1019-25g | Cobalt(III) fluoride, 99% | 10026-18-3 | 25g |
| GW8373-1mg | Cochliodone A | 1072931-48-6 | 1mg |
| GL7150-100g | Coconut oil | 8001-31-8 | 100g |
| GL7150-500g | Coconut oil | 8001-31-8 | 500g |
| GK0114-25mg | Coenzyme A hydrate | 85-61-0 | 25mg |
| GK0114-100mg | Coenzyme A hydrate | 85-61-0 | 100mg |
| GK0114-250mg | Coenzyme A hydrate | 85-61-0 | 250mg |
| GL9113-25mg | Coenzyme A sodium salt hydrate | 55672-92-9 | 25mg |
| GL9113-100mg | Coenzyme A sodium salt hydrate | 55672-92-9 | 100mg |
| GE3164-500mg | Coenzyme A trilithium salt | 18439-24-2 | 500mg |
| GP8985-100mg | Coenzyme B12 | 13870-90-1 | 100mg |
| GP6626-100mg | Coenzyme Q10 | 303-98-0 | 100mg |
| GP6626-1g | Coenzyme Q10 | 303-98-0 | 1g |
| GP6626-5g | Coenzyme Q10 | 303-98-0 | 5g |
| GP6620-100mg | Colchicine | 64-86-8 | 100mg |
| GP6620-500mg | Colchicine | 64-86-8 | 500mg |
| GP6620-1g | Colchicine | 64-86-8 | 1g |
| GP6620-5g | Colchicine | 64-86-8 | 5g |
| GA2961-1g | Colistin sodium methanesulfonate | 8068-28-8 | 1g |
| GA2961-5g | Colistin sodium methanesulfonate | 8068-28-8 | 5g |
| GA9867-100mg | Colistin sulfate salt | 1264-72-8 | 100mg |
| GA9867-500mg | Colistin sulfate salt | 1264-72-8 | 500mg |
| GA9867-1g | Colistin sulfate salt | 1264-72-8 | 1g |
| GA9867-5g | Colistin sulfate salt | 1264-72-8 | 5g |
| GW9578-10mg | Collagenase Chromophore-Substrate Component A | 118081-33-7 | 10mg |
| GW9578-50mg | Collagenase Chromophore-Substrate Component A | 118081-33-7 | 50mg |
| GW5573-50mg | Collagenase-Chromophore-Substrate Test Substance | 98640-71-2 | 50mg |
| GW5573-500mg | Collagenase-Chromophore-Substrate Test Substance | 98640-71-2 | 500mg |
| GW5573-2500mg | Collagenase-Chromophore-Substrate Test Substance | 98640-71-2 | 2500mg |
| GK1470-10mg | Combretastatin A4 | 117048-59-6 | 10mg |
| GK1470-50mg | Combretastatin A4 | 117048-59-6 | 50mg |
| GL3740-10mg | Compound 112254 | 949745-75-9 | 10mg |
| GL3740-50mg | Compound 112254 | 949745-75-9 | 50mg |
| GL8859-10mg | Compound 112254 hydrochloride | 949745-75-9 (base) | 10mg |
| GL8859-50mg | Compound 112254 hydrochloride | 949745-75-9 (base) | 50mg |
| GL2080-200ug | Compound 34 | 564462-36-8 | 200ug |
| GL2080-1mg | Compound 34 | 564462-36-8 | 1mg |
| GL3746-250ug | Compound E | 209986-17-4 | 250ug |
| GL3746-1mg | Compound E | 209986-17-4 | 1mg |
| GL3746-5mg | Compound E | 209986-17-4 | 5mg |
| GA7236-25ug | Concanamycin A | 80890-47-7 | 25ug |
| GA7236-100ug | Concanamycin A | 80890-47-7 | 100ug |
| GA7236-1mg | Concanamycin A | 80890-47-7 | 1mg |
| GL5497-25ug | Concanamycin B | 81552-33-2 | 25ug |
| GL5497-100ug | Concanamycin B | 81552-33-2 | 100ug |
| GL5497-500ug | Concanamycin B | 81552-33-2 | 500ug |
| GA8504-25ug | Concanamycin C | 81552-34-3 | 25ug |
| GA8504-100ug | Concanamycin C | 81552-34-3 | 100ug |
| GA8504-500ug | Concanamycin C | 81552-34-3 | 500ug |
| GC6347-25mg | Concanavalin A | 11028-71-0 | 25mg |
| GT5674-25g | Congo Red (C.I. 22120) | 573-58-0 | 25g |
| GT5674-100g | Congo Red (C.I. 22120) | 573-58-0 | 100g |
| GT5674-250g | Congo Red (C.I. 22120) | 573-58-0 | 250g |
| GW2714-50ug | Convulxin | 37206-04-5 | 50ug |
| GT0353-5g | Coomassie Brilliant Blue G250 (C.I. 42655) | 6104-58-1 | 5g |
| GT0353-25g | Coomassie Brilliant Blue G250 (C.I. 42655) | 6104-58-1 | 25g |
| GT0353-100g | Coomassie Brilliant Blue G250 (C.I. 42655) | 6104-58-1 | 100g |
| GT3543-5g | Coomassie Brilliant Blue R250 (C.I. 42660) | 6104-59-2 | 5g |
| GT3543-25g | Coomassie Brilliant Blue R250 (C.I. 42660) | 6104-59-2 | 25g |
| GT3543-100g | Coomassie Brilliant Blue R250 (C.I. 42660) | 6104-59-2 | 100g |
| GX9861-100g | Copovidone | 25086-89-9 | 100g |
| GX9861-250g | Copovidone | 25086-89-9 | 250g |
| GX3180-25g | Copper aluminate, 99+% | 12042-92-1 | 25g |
| GX3180-100g | Copper aluminate, 99+% | 12042-92-1 | 100g |
| GX1957-200g | Copper Bar, 99.999% | 7440-50-8 | 200g |
| GX1957-800g | Copper Bar, 99.999% | 7440-50-8 | 800g |
| GX9218-200g | Copper Bar, 99.9998 | 7440-50-8 | 200g |
| GX9218-800g | Copper Bar, 99.9998 | 7440-50-8 | 800g |
| GX6999-50g | Copper Clippings 2.4 x 5 mm, 99.99% | 7440-50-8 | 50g |
| GX6999-250g | Copper Clippings 2.4 x 5 mm, 99.99% | 7440-50-8 | 250g |
| GX9961-50x50mm | Copper Foil (OFHC) 0.1 mm, 99.99% | 7440-50-8 | 50x50mm |
| GX9961-100x100mm | Copper Foil (OFHC) 0.1 mm, 99.99% | 7440-50-8 | 100x100mm |
| GX9961-150x150mm | Copper Foil (OFHC) 0.1 mm, 99.99% | 7440-50-8 | 150x150mm |
| GX6963-50x50mm | Copper Foil (OFHC) 0.25 mm, 99.95+% | 7440-50-8 | 50x50mm |
| GX6963-100x100mm | Copper Foil (OFHC) 0.25 mm, 99.95+% | 7440-50-8 | 100x100mm |
| GX6963-150x150mm | Copper Foil (OFHC) 0.25 mm, 99.95+% | 7440-50-8 | 150x150mm |
| GX8989-50x50mm | Copper Foil (OFHC) 0.5 mm, 99.95+% | 7440-50-8 | 50x50mm |
| GX8989-100x100mm | Copper Foil (OFHC) 0.5 mm, 99.95+% | 7440-50-8 | 100x100mm |
| GX7255-50x50mm | Copper Foil (OFHC) 1.0 mm, annealed, 99.99% | 7440-50-8 | 50x50mm |
| GX7255-100x100mm | Copper Foil (OFHC) 1.0 mm, annealed, 99.99% | 7440-50-8 | 100x100mm |
| GX5618-50x50mm | Copper Foil 0.025 mm, 99.9% | 7440-50-8 | 50x50mm |
| GX5618-100x100mm | Copper Foil 0.025 mm, 99.9% | 7440-50-8 | 100x100mm |
| GX4083-150x150mm | Copper Foil 0.035 mm, 99.95% | 7440-50-8 | 150x150mm |
| GX3203-50x50mm | Copper Foil 0.05 mm (OFHC); hard, 99.95+% | 7440-50-8 | 50x50mm |
| GX3203-100x100mm | Copper Foil 0.05 mm (OFHC); hard, 99.95+% | 7440-50-8 | 100x100mm |
| GX1206-50x50mm | Copper Foil 0.05 mm, 99.995+% | 7440-50-8 | 50x50mm |
| GX1206-100x100mm | Copper Foil 0.05 mm, 99.995+% | 7440-50-8 | 100x100mm |
| GX9753-50x50mm | Copper Foil 0.05 mm, hard, 99.9% | 7440-50-8 | 50x50mm |
| GX9753-100x100mm | Copper Foil 0.05 mm, hard, 99.9% | 7440-50-8 | 100x100mm |
| GX6307-150x150mm | Copper Foil 0.07 mm, 99.95% | 7440-50-8 | 150x150mm |
| GX2765-50x50mm | Copper Foil 0.1 mm, 99.99+% | 7440-50-8 | 50x50mm |
| GX2765-100x100mm | Copper Foil 0.1 mm, 99.99+% | 7440-50-8 | 100x100mm |
| GX0632-50x50mm | Copper Foil 0.1 mm, annealed, 99.998% | 7440-50-8 | 50x50mm |
| GX0632-100x100mm | Copper Foil 0.1 mm, annealed, 99.998% | 7440-50-8 | 100x100mm |
| GX1695-50x50mm | Copper Foil 0.125 mm (OFHC); annealed, 99.99% | 7440-50-8 | 50x50mm |
| GX1695-100x100mm | Copper Foil 0.125 mm (OFHC); annealed, 99.99% | 7440-50-8 | 100x100mm |
| GX3150-50x50mm | Copper Foil 0.125 mm, 99.995% | 7440-50-8 | 50x50mm |
| GX3150-100x100mm | Copper Foil 0.125 mm, 99.995% | 7440-50-8 | 100x100mm |
| GX4010-100x100mm | Copper Foil 0.25 mm, 99.9% | 7440-50-8 | 100x100mm |
| GX4010-100x200mm | Copper Foil 0.25 mm, 99.9% | 7440-50-8 | 100x200mm |
| GX3491-100x100mm | Copper Foil 0.25 mm, 99.99+% | 7440-50-8 | 100x100mm |
| GX5230-50x50mm | Copper Foil 0.25 mm, 99.995% | 7440-50-8 | 50x50mm |
| GX5230-100x100mm | Copper Foil 0.25 mm, 99.995% | 7440-50-8 | 100x100mm |
| GX9034-50x50mm | Copper Foil 0.5 mm, 99.99+% | 7440-50-8 | 50x50mm |
| GX9034-100x100mm | Copper Foil 0.5 mm, 99.99+% | 7440-50-8 | 100x100mm |
| GX5226-25x25mm | Copper Foil 0.5 mm, 99.995+% | 7440-50-8 | 25x25mm |
| GX5226-50x50mm | Copper Foil 0.5 mm, 99.995+% | 7440-50-8 | 50x50mm |
| GX5226-100x100mm | Copper Foil 0.5 mm, 99.995+% | 7440-50-8 | 100x100mm |
| GX0796-50x50mm | Copper Foil 1.0 mm, 99.99+% | 7440-50-8 | 50x50mm |
| GX0796-100x100mm | Copper Foil 1.0 mm, 99.99+% | 7440-50-8 | 100x100mm |
| GX0796-150x150mm | Copper Foil 1.0 mm, 99.99+% | 7440-50-8 | 150x150mm |
| GX8621-100x100mm | Copper Gauze 40 mesh, woven from 0.224 mm diameter wire, 99.9% | 7440-50-8 | 100x100mm |
| GX2423-50x50mm | Copper Gauze 50 mesh, woven from 0.18 mm diameter wire, 99.9% | 7440-50-8 | 50x50mm |
| GX2423-100x100mm | Copper Gauze 50 mesh, woven from 0.18 mm diameter wire, 99.9% | 7440-50-8 | 100x100mm |
| GX1781-5g | Copper Nanopowder, 99,9 % | 7440-50-8 | 5g |
| GX1781-10g | Copper Nanopowder, 99,9 % | 7440-50-8 | 10g |
| GX1781-25g | Copper Nanopowder, 99,9 % | 7440-50-8 | 25g |
| GX1781-100g | Copper Nanopowder, 99,9 % | 7440-50-8 | 100g |
| GX2223-10g | Copper nanopowder, 99.5% [50nm] | 7440-50-8 | 10g |
| GX2223-25g | Copper nanopowder, 99.5% [50nm] | 7440-50-8 | 25g |
| GX2223-100g | Copper nanopowder, 99.5% [50nm] | 7440-50-8 | 100g |
| GX3076-1kg | Copper Pellets 15 mm, 99.9% | 7440-50-8 | 1kg |
| GX9321-100g | Copper Pellets 6 x 6 mm, 99.99% | 7440-50-8 | 100g |
| GX4414-50g | Copper Powder -20, +50 mesh, 99.95% | 7440-50-8 | 50g |
| GX4414-250g | Copper Powder -20, +50 mesh, 99.95% | 7440-50-8 | 250g |
| GX9201-50g | Copper Powder Cu-OF atomized >=10 micron, d50 = 15 micron, 99.95% | 7440-50-8 | 50g |
| GX9201-250g | Copper Powder Cu-OF atomized >=10 micron, d50 = 15 micron, 99.95% | 7440-50-8 | 250g |
| GX6222-1kg | Copper Powder max. 100 micron, 99.8% | 7440-50-8 | 1kg |
| GX0368-100g | Copper Powder max. 150 micron, spherical, 99.99% | 7440-50-8 | 100g |
| GX1935-1kg | Copper Powder max. 250 micron, 99.8% | 7440-50-8 | 1kg |
| GX8965-1kg | Copper Powder max. 500 micron, 99.8% | 7440-50-8 | 1kg |
| GX4942-250g | Copper Powder, spherical -325 mesh, 99% | 7440-50-8 | 250g |
| GX7202-200mm | Copper Rod (OFHC) 12.7 mm diameter , 99.95+% | 7440-50-8 | 200mm |
| GX8539-100mm | Copper Rod (OFHC) 25 mm diameter, 99.99+% | 7440-50-8 | 100mm |
| GX9645-50mm | Copper Rod (OFHC) 50 mm diameter, 99.99% | 7440-50-8 | 50mm |
| GX9447-100mm | Copper Rod (OFHC) 6.35 mm diameter, 99.99+% | 7440-50-8 | 100mm |
| GX9447-250mm | Copper Rod (OFHC) 6.35 mm diameter, 99.99+% | 7440-50-8 | 250mm |
| GX6906-50mm | Copper Rod (OFHC) 80 mm diameter, 99.99+% | 7440-50-8 | 50mm |
| GX0571-130mm | Copper Rod 13.5 mm diameter, 99.999% | 7440-50-8 | 130mm |
| GX4210-150mm | Copper Rod 3.2 x 150 mm, 99.99+% | 7440-50-8 | 150mm |
| GX6693-300mm | Copper Rod 9.0 mm diameter, 99.98% | 7440-50-8 | 300mm |
| GX6217-50x50mm | Copper Sheet (OFHC) 2 mm, 99.95+% | 7440-50-8 | 50x50mm |
| GX6217-100x100mm | Copper Sheet (OFHC) 2 mm, 99.95+% | 7440-50-8 | 100x100mm |
| GX6217-150x150mm | Copper Sheet (OFHC) 2 mm, 99.95+% | 7440-50-8 | 150x150mm |
| GX9478-50x50mm | Copper Sheet (OFHC) 3.15 mm, 99.99% | 7440-50-8 | 50x50mm |
| GX9478-100x100mm | Copper Sheet (OFHC) 3.15 mm, 99.99% | 7440-50-8 | 100x100mm |
| GX8012-100x100mm | Copper Sheet (OFHC) 6.35 mm, 99.99% | 7440-50-8 | 100x100mm |
| GX0908-50x50mm | Copper Sheet 2 mm, 99.995+% | 7440-50-8 | 50x50mm |
| GX8885-50x50mm | Copper Sheet 3.15 mm, 99.995+% | 7440-50-8 | 50x50mm |
| GX2241-100x100mm | Copper Sheet 6.35 mm, 99.995+% | 7440-50-8 | 100x100mm |
| GX0360-50g | Copper Shot 2-6 mm, 99.9% | 7440-50-8 | 50g |
| GX0360-250g | Copper Shot 2-6 mm, 99.9% | 7440-50-8 | 250g |
| GX4110-50g | Copper Shot 2-6 mm, 99.999% | 7440-50-8 | 50g |
| GX4110-250g | Copper Shot 2-6 mm, 99.999% | 7440-50-8 | 250g |
| GX3657-10g | Copper Shot 3-5 mm, 99.9999% | 7440-50-8 | 10g |
| GX3657-50g | Copper Shot 3-5 mm, 99.9999% | 7440-50-8 | 50g |
| GX2252-50g | Copper Shot max. 6 mm, vacuum melted, 99.999% | 7440-50-8 | 50g |
| GX2252-250g | Copper Shot max. 6 mm, vacuum melted, 99.999% | 7440-50-8 | 250g |
| GX0341-10g | Copper tetramethylheptanedionate, 99.9% | 14040-05-2 | 10g |
| GX9426-25g | Copper tungstate, 99.5% | 13587-35-4 | 25g |
| GX9426-100g | Copper tungstate, 99.5% | 13587-35-4 | 100g |
| GX8473-50g | Copper vanadate, 99.5% | 12789-09-2 | 50g |
| GX2464-25m | Copper Wire (OFHC) 0.05 mm diameter, annealed, 99.99% | 7440-50-8 | 25m |
| GX9269-10m | Copper Wire (OFHC) 0.1 mm diameter, annealed, 99.9% | 7440-50-8 | 10m |
| GX9269-25m | Copper Wire (OFHC) 0.1 mm diameter, annealed, 99.9% | 7440-50-8 | 25m |
| GX2254-10m | Copper Wire (OFHC) 0.125 mm diameter, annealed, 99.99% | 7440-50-8 | 10m |
| GX2254-25m | Copper Wire (OFHC) 0.125 mm diameter, annealed, 99.99% | 7440-50-8 | 25m |
| GX1090-10m | Copper Wire (OFHC) 0.2 mm diameter, annealed, 99.99% | 7440-50-8 | 10m |
| GX1090-25m | Copper Wire (OFHC) 0.2 mm diameter, annealed, 99.99% | 7440-50-8 | 25m |
| GX0943-10m | Copper Wire (OFHC) 0.25 mm diameter, annealed, 99.99% | 7440-50-8 | 10m |
| GX0943-25m | Copper Wire (OFHC) 0.25 mm diameter, annealed, 99.99% | 7440-50-8 | 25m |
| GX3655-10m | Copper Wire (OFHC) 0.4 mm diameter, annealed, 99.99% | 7440-50-8 | 10m |
| GX3655-25m | Copper Wire (OFHC) 0.4 mm diameter, annealed, 99.99% | 7440-50-8 | 25m |
| GX3345-10m | Copper Wire (OFHC) 0.5 mm diameter, 99.95+% | 7440-50-8 | 10m |
| GX3345-25m | Copper Wire (OFHC) 0.5 mm diameter, 99.95+% | 7440-50-8 | 25m |
| GX0672-1m | Copper Wire (OFHC) 1.0 mm diameter, annealed, 99.99% | 7440-50-8 | 1m |
| GX0672-5m | Copper Wire (OFHC) 1.0 mm diameter, annealed, 99.99% | 7440-50-8 | 5m |
| GX1053-1m | Copper Wire (OFHC) 1.5 mm diameter, annealed, 99.99% | 7440-50-8 | 1m |
| GX1053-5m | Copper Wire (OFHC) 1.5 mm diameter, annealed, 99.99% | 7440-50-8 | 5m |
| GX7589-1m | Copper Wire (OFHC) 2.0 mm diameter, annealed, 99.99% | 7440-50-8 | 1m |
| GX2547-10m | Copper Wire 0.1 mm diameter, 99.995+% | 7440-50-8 | 10m |
| GX8929-10m | Copper Wire 0.125 mm diameter, annealed, 99.998% | 7440-50-8 | 10m |
| GX8929-25m | Copper Wire 0.125 mm diameter, annealed, 99.998% | 7440-50-8 | 25m |
| GX4746-25m | Copper Wire 0.25 mm diameter, 99.9% | 7440-50-8 | 25m |
| GX4746-50m | Copper Wire 0.25 mm diameter, 99.9% | 7440-50-8 | 50m |
| GX4746-100m | Copper Wire 0.25 mm diameter, 99.9% | 7440-50-8 | 100m |
| GX4831-10m | Copper Wire 0.25 mm diameter, 99.995+% | 7440-50-8 | 10m |
| GX4831-25m | Copper Wire 0.25 mm diameter, 99.995+% | 7440-50-8 | 25m |
| GX4330-25m | Copper Wire 0.5 mm diameter, 99.9% | 7440-50-8 | 25m |
| GX4330-100m | Copper Wire 0.5 mm diameter, 99.9% | 7440-50-8 | 100m |
| GX3607-10m | Copper Wire 0.5 mm diameter, annealed, 99.995+% | 7440-50-8 | 10m |
| GX8177-1m | Copper Wire 0.75 mm diameter, annealed, 99.995+% | 7440-50-8 | 1m |
| GX8177-5m | Copper Wire 0.75 mm diameter, annealed, 99.995+% | 7440-50-8 | 5m |
| GX3143-50m | Copper Wire 1.0 mm diameter, 99.9% | 7440-50-8 | 50m |
| GX3143-100m | Copper Wire 1.0 mm diameter, 99.9% | 7440-50-8 | 100m |
| GX6629-1m | Copper Wire 1.0 mm diameter, 99.99+% | 7440-50-8 | 1m |
| GX6629-5m | Copper Wire 1.0 mm diameter, 99.99+% | 7440-50-8 | 5m |
| GX8874-1m | Copper Wire 1.5 mm diameter, annealed, 99.999% | 7440-50-8 | 1m |
| GX8874-5m | Copper Wire 1.5 mm diameter, annealed, 99.999% | 7440-50-8 | 5m |
| GX7867-1m | Copper Wire 2.0 mm diameter, annealed, 99.995+% | 7440-50-8 | 1m |
| GX1888-500g | Copper(I) bromide | 7787-70-4 | 500g |
| GK4381-100g | Copper(I) chloride | 7758-89-6 | 100g |
| GK4381-500g | Copper(I) chloride | 7758-89-6 | 500g |
| GK4381-1kg | Copper(I) chloride | 7758-89-6 | 1kg |
| GX7017-500g | Copper(I) chloride, anhydrous, 97+% | 7758-89-6 | 500g |
| GX2675-25g | Copper(I) iodide, 99.999% | 7681-65-4 | 25g |
| GX4471-1kg | Copper(I) oxide | 1317-39-1 | 1kg |
| GX3380-100g | Copper(I) oxide, 99% | 1317-39-1 | 100g |
| GX3380-250g | Copper(I) oxide, 99% | 1317-39-1 | 250g |
| GX3738-250g | Copper(I) sulfide, 98+% | 22205-45-4 | 250g |
| GX5762-50g | Copper(I) thiocyanate | 1111-67-7 | 50g |
| GX5762-100g | Copper(I) thiocyanate | 1111-67-7 | 100g |
| GX5762-250g | Copper(I) thiocyanate | 1111-67-7 | 250g |
| GX7274-250g | Copper(II) 2,4-pentanedionate | 13395-16-9 | 250g |
| GK0898-25g | Copper(II) acetate monohydrate | 6046-93-1 | 25g |
| GK0898-100g | Copper(II) acetate monohydrate | 6046-93-1 | 100g |
| GK0898-250g | Copper(II) acetate monohydrate | 6046-93-1 | 250g |
| GK0898-500g | Copper(II) acetate monohydrate | 6046-93-1 | 500g |
| GK0898-1kg | Copper(II) acetate monohydrate | 6046-93-1 | 1kg |
| GK0122-25g | Copper(II) acetate, anhydrous | 142-71-2 | 25g |
| GK0122-100g | Copper(II) acetate, anhydrous | 142-71-2 | 100g |
| GK3536-25g | Copper(II) bromide | 7789-45-9 | 25g |
| GK3536-100g | Copper(II) bromide | 7789-45-9 | 100g |
| GK3536-250g | Copper(II) bromide | 7789-45-9 | 250g |
| GK3536-500g | Copper(II) bromide | 7789-45-9 | 500g |
| GK3536-1kg | Copper(II) bromide | 7789-45-9 | 1kg |
| GX6283-500g | Copper(II) carbonate basic, Cu min. 55% | 12069-69-1 | 500g |
| GK5717-100g | Copper(II) chloride dihydrate | 10125-13-0 | 100g |
| GK5717-250g | Copper(II) chloride dihydrate | 10125-13-0 | 250g |
| GK5717-500g | Copper(II) chloride dihydrate | 10125-13-0 | 500g |
| GK5717-1kg | Copper(II) chloride dihydrate | 10125-13-0 | 1kg |
| GK5717-5kg | Copper(II) chloride dihydrate | 10125-13-0 | 5kg |
| GK8996-100g | Copper(II) chloride, anhydrous | 7447-39-4 | 100g |
| GK8996-250g | Copper(II) chloride, anhydrous | 7447-39-4 | 250g |
| GK8996-500g | Copper(II) chloride, anhydrous | 7447-39-4 | 500g |
| GK8996-1kg | Copper(II) chloride, anhydrous | 7447-39-4 | 1kg |
| GK8996-2500g | Copper(II) chloride, anhydrous | 7447-39-4 | 2500g |
| GC2612-100g | Copper(II) D-gluconate | 527-09-3 | 100g |
| GC2612-250g | Copper(II) D-gluconate | 527-09-3 | 250g |
| GC2612-500g | Copper(II) D-gluconate | 527-09-3 | 500g |
| GC2612-1kg | Copper(II) D-gluconate | 527-09-3 | 1kg |
| GW7206-50mg | Copper(II) ionophore IV | 849629-03-4 | 50mg |
| GW7206-250mg | Copper(II) ionophore IV | 849629-03-4 | 250mg |
| GX6874-100g | Copper(II) nitrate trihydrate | 10031-43-3 | 100g |
| GX6874-250g | Copper(II) nitrate trihydrate | 10031-43-3 | 250g |
| GX6874-500g | Copper(II) nitrate trihydrate | 10031-43-3 | 500g |
| GX6874-1kg | Copper(II) nitrate trihydrate | 10031-43-3 | 1kg |
| GX4787-25g | Copper(II) nitrate, hydrate, 99.999% | 10031-43-3 | 25g |
| GX2222-50g | Copper(II) oxide Nanopowder, 99,9 % | 1317-38-0 | 50g |
| GX2222-250g | Copper(II) oxide Nanopowder, 99,9 % | 1317-38-0 | 250g |
| GX1818-10g | Copper(II) oxide, 99.999% | 1317-38-0 | 10g |
| GX1818-50g | Copper(II) oxide, 99.999% | 1317-38-0 | 50g |
| GX1818-25g | Copper(II) oxide, 99.999% | 1317-38-0 | 25g |
| GX6347-100g | Copper(II) oxide, 99% | 1317-38-0 | 100g |
| GX4332-1kg | Copper(II) oxide, tech.,96+% | 1317-38-0 | 1kg |
| GT7088-5g | Copper(II) phthalocyanine | 147-14-8 | 5g |
| GT7088-25g | Copper(II) phthalocyanine | 147-14-8 | 25g |
| GX3834-1kg | Copper(II) pyrophosphate | 304671-71-4 | 1kg |
| GX3834-5kg | Copper(II) pyrophosphate | 304671-71-4 | 5kg |
| GK0112-100g | Copper(II) sulfate pentahydrate | 7758-99-8 | 100g |
| GK0112-500g | Copper(II) sulfate pentahydrate | 7758-99-8 | 500g |
| GK0112-1kg | Copper(II) sulfate pentahydrate | 7758-99-8 | 1kg |
| GK0112-5kg | Copper(II) sulfate pentahydrate | 7758-99-8 | 5kg |
| GK6560-500g | Copper(II) sulfate pentahydrate, 99%, Ph. Eur. grade | 7758-99-8 | 500g |
| GK6560-1kg | Copper(II) sulfate pentahydrate, 99%, Ph. Eur. grade | 7758-99-8 | 1kg |
| GX8887-1kg | Copper(II) sulfate, anhydrous, 98% | 7758-98-7 | 1kg |
| GX8887-5kg | Copper(II) sulfate, anhydrous, 98% | 7758-98-7 | 5kg |
| GK7077-500g | Copper(II) sulfate, anhydrous, Ph. Eur. grade | 7758-98-7 | 500g |
| GK7077-1kg | Copper(II) sulfate, anhydrous, Ph. Eur. grade | 7758-98-7 | 1kg |
| GX4112-50g | Copper(II) sulfide, 99.5% | 1317-40-4 | 50g |
| GX4112-250g | Copper(II) sulfide, 99.5% | 1317-40-4 | 250g |
| GW2432-25g | Copper(II) tartrate hydrate | 946843-80-7 | 25g |
| GW2432-100g | Copper(II) tartrate hydrate | 946843-80-7 | 100g |
| GX6318-1kg | Copper(II) tetrafluoroborate, 50% solution | 38465-60-0 | 1kg |
| GX7476-250g | Copper(lI) oxide, 99.99% | 1317-38-0 | 250g |
| GK8335-5g | Copper(ll) dioctadecanoate | 660-60-6 | 5g |
| GK8335-25g | Copper(ll) dioctadecanoate | 660-60-6 | 25g |
| GK8335-100g | Copper(ll) dioctadecanoate | 660-60-6 | 100g |
| GA1331-10mg | Cordycepin | 73-03-0 | 10mg |
| GA1331-25mg | Cordycepin | 73-03-0 | 25mg |
| GA1331-100mg | Cordycepin | 73-03-0 | 100mg |
| GC8106-10mg | Corilagin | 23094-69-1 | 10mg |
| GC8106-50mg | Corilagin | 23094-69-1 | 50mg |
| GL7753-500ml | Corn oil | 8001-30-7 | 500ml |
| GL8496-10mg | Corosolic acid | 4547-24-4 | 10mg |
| GL8496-50mg | Corosolic acid | 4547-24-4 | 50mg |
| GP3184-500mg | Corticosterone | 50-22-6 | 500mg |
| GP7495-1g | Cortisone | 53-06-5 | 1g |
| GX8820-25mg | Costunolide | 553-21-9 | 25mg |
| GL3259-500ml | Cottonseed oil | 8001-29-4 | 500ml |
| GL3259-1l | Cottonseed oil | 8001-29-4 | 1l |
| GW5505-1g | Coumaphos | 56-72-4 | 1g |
| GW5505-5g | Coumaphos | 56-72-4 | 5g |
| GK2204-25g | Coumarin | 91-64-5 | 25g |
| GK2204-100g | Coumarin | 91-64-5 | 100g |
| GK2204-250g | Coumarin | 91-64-5 | 250g |
| GK2204-500g | Coumarin | 91-64-5 | 500g |
| GK2204-1kg | Coumarin | 91-64-5 | 1kg |
| GK3599-1g | Coumarin 6 | 38215-36-0 | 1g |
| GK3599-5g | Coumarin 6 | 38215-36-0 | 5g |
| GK3599-10g | Coumarin 6 | 38215-36-0 | 10g |
| GK3599-25g | Coumarin 6 | 38215-36-0 | 25g |
| GL8151-100mg | Coumarin 7 | 27425-55-4 | 100mg |
| GL8151-1g | Coumarin 7 | 27425-55-4 | 1g |
| GW9386-50mg | Coumarin-6-sulfonyl chloride | 10543-42-7 | 50mg |
| GW3270-1mg | CP-724714 | 383432-38-0 | 1mg |
| GW3270-5mg | CP-724714 | 383432-38-0 | 5mg |
| GW3270-10mg | CP-724714 | 383432-38-0 | 10mg |
| GZ9654-1KU | Creatinase | 37340-58-2 | 1KU |
| GE9561-25g | Creatine monohydrate | 6020-87-7 | 25g |
| GE9561-100g | Creatine monohydrate | 6020-87-7 | 100g |
| GE9561-250g | Creatine monohydrate | 6020-87-7 | 250g |
| GE9561-500g | Creatine monohydrate | 6020-87-7 | 500g |
| GE9561-1kg | Creatine monohydrate | 6020-87-7 | 1kg |
| GE7721-5g | Creatine phosphate disodium salt hydrate | 922-32-7 | 5g |
| GE7721-25g | Creatine phosphate disodium salt hydrate | 922-32-7 | 25g |
| GE7721-100g | Creatine phosphate disodium salt hydrate | 922-32-7 | 100g |
| GV1128-25g | Creatine, anhydrous | 57-00-1 | 25g |
| GZ5654-1KU | Creatininase | 9025-13-2 | 1KU |
| GK8780-25g | Creatinine | 60-27-5 | 25g |
| GK8780-100g | Creatinine | 60-27-5 | 100g |
| GT0793-25g | Cresol Red | 1733-12-6 | 25g |
| GT0793-100g | Cresol Red | 1733-12-6 | 100g |
| GT1602-5g | Cresol Red sodium salt | 62625-29-0 | 5g |
| GT1602-25g | Cresol Red sodium salt | 62625-29-0 | 25g |
| GT1602-100g | Cresol Red sodium salt | 62625-29-0 | 100g |
| GT8071-1g | Cresyl Violet acetate | 10510-54-0 | 1g |
| GT8071-5g | Cresyl Violet acetate | 10510-54-0 | 5g |
| GW2561-10mg | Crizotinib | 877399-52-5 | 10mg |
| GT0121-25g | Crocein Orange G | 1934-20-9 | 25g |
| GT0121-100g | Crocein Orange G | 1934-20-9 | 100g |
| GT9692-100mg | Croconic acid | 488-86-8 | 100mg |
| GT9692-250mg | Croconic acid | 488-86-8 | 250mg |
| GT9692-500mg | Croconic acid | 488-86-8 | 500mg |
| GT9692-1g | Croconic acid | 488-86-8 | 1g |
| GP8420-1g | Cromolyn sodium salt | 15826-37-6 | 1g |
| GP8420-5g | Cromolyn sodium salt | 15826-37-6 | 5g |
| GP8420-25g | Cromolyn sodium salt | 15826-37-6 | 25g |
| GX1396-100mg | Crotaline | 315-22-0 | 100mg |
| GX1396-250mg | Crotaline | 315-22-0 | 250mg |
| GX1396-500mg | Crotaline | 315-22-0 | 500mg |
| GX1396-1g | Crotaline | 315-22-0 | 1g |
| GP2631-5g | Crotamiton | 483-63-6 | 5g |
| GP2631-25g | Crotamiton | 483-63-6 | 25g |
| GP3585-5mg | Cryptotanshinone | 35825-57-1 | 5mg |
| GT6539-5g | Crystal Ponceau 6R (C.I. 16250) | 2766-77-0 | 5g |
| GT6539-25g | Crystal Ponceau 6R (C.I. 16250) | 2766-77-0 | 25g |
| GT6539-100g | Crystal Ponceau 6R (C.I. 16250) | 2766-77-0 | 100g |
| GA9809-25g | Crystal Violet (C.I. 42555) | 548-62-9 | 25g |
| GA9809-100g | Crystal Violet (C.I. 42555) | 548-62-9 | 100g |
| GA9809-250g | Crystal Violet (C.I. 42555) | 548-62-9 | 250g |
| GA9809-500g | Crystal Violet (C.I. 42555) | 548-62-9 | 500g |
| GA0011-25g | Crystal Violet (C.I. 42555); USP grade | 548-62-9 | 25g |
| GA0011-100g | Crystal Violet (C.I. 42555); USP grade | 548-62-9 | 100g |
| GA9396-500ml | Crystal violet, 1% solution | 548-62-9 | 500ml |
| GA9396-1l | Crystal violet, 1% solution | 548-62-9 | 1l |
| GW1762-1mg | CTPB | 586976-24-1 | 1mg |
| GW1762-5mg | CTPB | 586976-24-1 | 5mg |
| GY2441-1mg | Cucurbitacin B | 6199-67-3 | 1mg |
| GY2441-5mg | Cucurbitacin B | 6199-67-3 | 5mg |
| GY2441-25mg | Cucurbitacin B | 6199-67-3 | 25mg |
| GY1460-1mg | Cucurbitacin E | 18444-66-1 | 1mg |
| GY1460-5mg | Cucurbitacin E | 18444-66-1 | 5mg |
| GY1460-25mg | Cucurbitacin E | 18444-66-1 | 25mg |
| GT0764-25g | Cupferron | 135-20-6 | 25g |
| GT0764-100g | Cupferron | 135-20-6 | 100g |
| GT0764-250g | Cupferron | 135-20-6 | 250g |
| GT0764-500g | Cupferron | 135-20-6 | 500g |
| GP8291-1g | Curcumin | 458-37-7 | 1g |
| GP8291-5g | Curcumin | 458-37-7 | 5g |
| GP8291-25g | Curcumin | 458-37-7 | 25g |
| GP8291-50g | Curcumin | 458-37-7 | 50g |
| GP8291-100g | Curcumin | 458-37-7 | 100g |
| GC7926-1mg | Curcumin 4-O-β-D-glucuronide | 227466-72-0 | 1mg |
| GC7926-2mg | Curcumin 4-O-β-D-glucuronide | 227466-72-0 | 2mg |
| GC7926-5mg | Curcumin 4-O-β-D-glucuronide | 227466-72-0 | 5mg |
| GC7926-10mg | Curcumin 4-O-β-D-glucuronide | 227466-72-0 | 10mg |
| GP7022-10mg | Curcumin, pure, 98% | 458-37-7 | 10mg |
| GP7022-50mg | Curcumin, pure, 98% | 458-37-7 | 50mg |
| GP7022-250mg | Curcumin, pure, 98% | 458-37-7 | 250mg |
| GL2917-1g | Curdlan | 54724-00-4 | 1g |
| GL2917-5g | Curdlan | 54724-00-4 | 5g |
| GA6429-1mg | Curvularin | 10140-70-2 | 1mg |
| GA6429-5mg | Curvularin | 10140-70-2 | 5mg |
| GL0062-1mg | Curvulin | 19054-27-4 | 1mg |
| GL0062-5mg | Curvulin | 19054-27-4 | 5mg |
| GW7982-1mg | CX-4945 hydrochloride | 1009820-21-6 | 1mg |
| GW7982-5mg | CX-4945 hydrochloride | 1009820-21-6 | 5mg |
| GW7982-25mg | CX-4945 hydrochloride | 1009820-21-6 | 25mg |
| GW7022-1mg | CX-6258 | 1202916-90-2 | 1mg |
| GW7022-5mg | CX-6258 | 1202916-90-2 | 5mg |
| GW7022-10mg | CX-6258 | 1202916-90-2 | 10mg |
| GK7537-5mg | Cyanidin chloride | 528-58-5 | 5mg |
| GC2852-1mg | Cyanidin-3-O-galactoside chloride | 27661-36-5 | 1mg |
| GC2852-2mg | Cyanidin-3-O-galactoside chloride | 27661-36-5 | 2mg |
| GC2852-5mg | Cyanidin-3-O-galactoside chloride | 27661-36-5 | 5mg |
| GC2852-10mg | Cyanidin-3-O-galactoside chloride | 27661-36-5 | 10mg |
| GC2852-25mg | Cyanidin-3-O-galactoside chloride | 27661-36-5 | 25mg |
| GC4701-1mg | Cyanidin-3-O-glucoside | 7084-24-4 | 1mg |
| GW0803-1mg | CYC116 | 693228-63-6 | 1mg |
| GW0803-5mg | CYC116 | 693228-63-6 | 5mg |
| GW0803-10mg | CYC116 | 693228-63-6 | 10mg |
| GL3913-5mg | Cyclic Pifithrin-alpha hydrobromide | 511296-88-1 | 5mg |
| GL3913-10mg | Cyclic Pifithrin-alpha hydrobromide | 511296-88-1 | 10mg |
| GL3913-50mg | Cyclic Pifithrin-alpha hydrobromide | 511296-88-1 | 50mg |
| GL3526-1mg | Cycloaspeptide A | 109171-13-3 | 1mg |
| GL3526-5mg | Cycloaspeptide A | 109171-13-3 | 5mg |
| GW9900-50mg | Cycloastragenol | 84605-18-5 | 50mg |
| GW9900-100mg | Cycloastragenol | 84605-18-5 | 100mg |
| GP8769-1g | Cyclobenzaprine hydrochloride | 6202-23-9 | 1g |
| GP8769-5g | Cyclobenzaprine hydrochloride | 6202-23-9 | 5g |
| GP8769-10g | Cyclobenzaprine hydrochloride | 6202-23-9 | 10g |
| GK7632-100ml | Cyclohexane, 99% | 110-82-7 | 100ml |
| GS5948-100ml | Cyclohexane, GlenDry™, anhydrous | 110-82-7 | 100ml |
| GS5948-500ml | Cyclohexane, GlenDry™, anhydrous | 110-82-7 | 500ml |
| GS5948-1l | Cyclohexane, GlenDry™, anhydrous | 110-82-7 | 1l |
| GS5948-2500ml | Cyclohexane, GlenDry™, anhydrous | 110-82-7 | 2500ml |
| GS5141-100ml | Cyclohexane, GlenDry™, anhydrous over molecular sieve | 110-82-7 | 100ml |
| GS5141-500ml | Cyclohexane, GlenDry™, anhydrous over molecular sieve | 110-82-7 | 500ml |
| GS5141-1l | Cyclohexane, GlenDry™, anhydrous over molecular sieve | 110-82-7 | 1l |
| GS5141-2500ml | Cyclohexane, GlenDry™, anhydrous over molecular sieve | 110-82-7 | 2500ml |
| GS6572-500ml | Cyclohexane, GlenPure™, analytical grade | 110-82-7 | 500ml |
| GS6572-1l | Cyclohexane, GlenPure™, analytical grade | 110-82-7 | 1l |
| GS6572-2500ml | Cyclohexane, GlenPure™, analytical grade | 110-82-7 | 2500ml |
| GS6038-100ml | Cyclohexanone, GlenDry™, anhydrous | 108-94-1 | 100ml |
| GS6038-500ml | Cyclohexanone, GlenDry™, anhydrous | 108-94-1 | 500ml |
| GS6038-1l | Cyclohexanone, GlenDry™, anhydrous | 108-94-1 | 1l |
| GS6038-2500ml | Cyclohexanone, GlenDry™, anhydrous | 108-94-1 | 2500ml |
| GS3077-500ml | Cyclohexanone, GlenPure™, analytical grade | 108-94-1 | 500ml |
| GS3077-1l | Cyclohexanone, GlenPure™, analytical grade | 108-94-1 | 1l |
| GS3077-2500ml | Cyclohexanone, GlenPure™, analytical grade | 108-94-1 | 2500ml |
| GA3429-1g | Cycloheximide | 66-81-9 | 1g |
| GA3429-5g | Cycloheximide | 66-81-9 | 5g |
| GW9837-25g | Cyclohexyl isocyanate | 3173-53-3 | 25g |
| GK9927-10g | Cyclohexyl salicylate | 25485-88-5 | 10g |
| GL2803-1mg | Cyclopamine | 4449-51-8 | 1mg |
| GL2803-5mg | Cyclopamine | 4449-51-8 | 5mg |
| GL0615-1mg | Cyclopenin | 19553-26-5 | 1mg |
| GL0615-5mg | Cyclopenin | 19553-26-5 | 5mg |
| GK6770-1mg | Cyclopenol | 20007-85-6 | 1mg |
| GK2037-1g | Cyclophosphamide monohydrate | 6055-19-2 | 1g |
| GK2037-5g | Cyclophosphamide monohydrate | 6055-19-2 | 5g |
| GA6323-25mg | Cyclosporin A | 59865-13-3 | 25mg |
| GA6323-100mg | Cyclosporin A | 59865-13-3 | 100mg |
| GA6323-250mg | Cyclosporin A | 59865-13-3 | 250mg |
| GA6323-500mg | Cyclosporin A | 59865-13-3 | 500mg |
| GA6323-1g | Cyclosporin A | 59865-13-3 | 1g |
| GA6323-5g | Cyclosporin A | 59865-13-3 | 5g |
| GA2331-100mg | Cyclosporin A, USP grade | 59865-13-3 | 100mg |
| GA2331-250mg | Cyclosporin A, USP grade | 59865-13-3 | 250mg |
| GP9440-1mg | Cyclosporin D | 63775-96-2 | 1mg |
| GP9440-5mg | Cyclosporin D | 63775-96-2 | 5mg |
| GL1342-1mg | Cyclosporin H | 83602-39-5 | 1mg |
| GL1342-5mg | Cyclosporin H | 83602-39-5 | 5mg |
| GW7399-25mg | Cyflufenamid | 180409-60-3 | 25mg |
| GW7399-100mg | Cyflufenamid | 180409-60-3 | 100mg |
| GW7399-500mg | Cyflufenamid | 180409-60-3 | 500mg |
| GL3276-1mg | Cynarin | 30964-13-7 | 1mg |
| GL3276-5mg | Cynarin | 30964-13-7 | 5mg |
| GY8068-5mg | Cynaropicrin | 35730-78-0 | 5mg |
| GL0073-1g | Cypermethrin | 52315-07-8 | 1g |
| GL0073-5g | Cypermethrin | 52315-07-8 | 5g |
| GA6777-5g | Cyproconazole | 94361-06-5 | 5g |
| GL4393-5g | Cyproheptadine hydrochloride sesquihydrate | 41354-29-4 | 5g |
| GL4393-25g | Cyproheptadine hydrochloride sesquihydrate | 41354-29-4 | 25g |
| GP6849-1g | Cyproterone acetate | 427-51-0 | 1g |
| GP5710-5g | Cyromazin | 66215-27-8 | 5g |
| GP5710-25g | Cyromazin | 66215-27-8 | 25g |
| GP5710-100g | Cyromazin | 66215-27-8 | 100g |
| GK9885-25g | Cystamine dihydrochloride | 56-17-7 | 25g |
| GK9885-100g | Cystamine dihydrochloride | 56-17-7 | 100g |
| GK9885-250g | Cystamine dihydrochloride | 56-17-7 | 250g |
| GK6502-25g | Cysteamine hydrochloride | 156-57-0 | 25g |
| GK6502-100g | Cysteamine hydrochloride | 156-57-0 | 100g |
| GK6502-250g | Cysteamine hydrochloride | 156-57-0 | 250g |
| GP6403-100mg | Cytarabine | 147-94-4 | 100mg |
| GP6403-500mg | Cytarabine | 147-94-4 | 500mg |
| GP6403-1g | Cytarabine | 147-94-4 | 1g |
| GP6403-5g | Cytarabine | 147-94-4 | 5g |
| GC1136-1g | Cytidine | 65-46-3 | 1g |
| GC1136-5g | Cytidine | 65-46-3 | 5g |
| GC1136-25g | Cytidine | 65-46-3 | 25g |
| GN9752-100mg | Cytidine 5'-triphosphate disodium salt hydrate | 36051-68-0 | 100mg |
| GN9752-1g | Cytidine 5'-triphosphate disodium salt hydrate | 36051-68-0 | 1g |
| GN9992-1g | Cytidine 5''-diphosphate disodium salt | 54394-90-0 | 1g |
| GE2975-1g | Cytidine 5''-monophosphate | 63-37-6 | 1g |
| GE2975-5g | Cytidine 5''-monophosphate | 63-37-6 | 5g |
| GP9015-100mg | Cytidine 5’-triphosphate disodium salt dihydrate | 81012-87-5 | 100mg |
| GP9015-500mg | Cytidine 5’-triphosphate disodium salt dihydrate | 81012-87-5 | 500mg |
| GP9015-1g | Cytidine 5’-triphosphate disodium salt dihydrate | 81012-87-5 | 1g |
| GE9117-1g | Cytidine-5''-diphosphate trisodium salt dihydrate | 34393-59-4 | 1g |
| GP1733-100mg | Cytisine | 485-35-8 | 100mg |
| GP1733-250mg | Cytisine | 485-35-8 | 250mg |
| GP1733-500mg | Cytisine | 485-35-8 | 500mg |
| GA2080-1mg | Cytochalasin B | 14930-96-2 | 1mg |
| GA2080-5mg | Cytochalasin B | 14930-96-2 | 5mg |
| GL9543-1mg | Cytochalasin H | 53760-19-3 | 1mg |
| GL9543-5mg | Cytochalasin H | 53760-19-3 | 5mg |
| GL7048-1mg | Cytochalasin J | 53760-20-6 | 1mg |
| GL7048-5mg | Cytochalasin J | 53760-20-6 | 5mg |
| GE9437-100mg | Cytochrome C, from equine heart | 9007-43-6 | 100mg |
| GE9437-250mg | Cytochrome C, from equine heart | 9007-43-6 | 250mg |
| GE9437-500mg | Cytochrome C, from equine heart | 9007-43-6 | 500mg |
| GE9437-1g | Cytochrome C, from equine heart | 9007-43-6 | 1g |
| GE8084-1g | Cytosine | 71-30-7 | 1g |
| GE8084-5g | Cytosine | 71-30-7 | 5g |
| GE8084-25g | Cytosine | 71-30-7 | 25g |
| GE8084-100g | Cytosine | 71-30-7 | 100g |
| GE8537-25mg | Cytosine-beta-D-arabinofuranoside-5''-monophosphate | 7075-11-8 | 25mg |
| GE8537-100mg | Cytosine-beta-D-arabinofuranoside-5''-monophosphate | 7075-11-8 | 100mg |
| GL5051-250ug | Cytostatin | 682329-63-1 | 250ug |
| GC9540-1g | D-(-)-Erythrose | 583-50-6 | 1g |
| GC9966-100g | D-(-)-Fructose | 57-48-7 | 100g |
| GC9966-250g | D-(-)-Fructose | 57-48-7 | 250g |
| GC9966-500g | D-(-)-Fructose | 57-48-7 | 500g |
| GC9966-1kg | D-(-)-Fructose | 57-48-7 | 1kg |
| GC9966-5kg | D-(-)-Fructose | 57-48-7 | 5kg |
| GK0142-5g | D-(-)-Mandelic acid | 611-71-2 | 5g |
| GK0142-25g | D-(-)-Mandelic acid | 611-71-2 | 25g |
| GK0142-100g | D-(-)-Mandelic acid | 611-71-2 | 100g |
| GK0142-250g | D-(-)-Mandelic acid | 611-71-2 | 250g |
| GX9487-5g | D-(-)-Pantolactone | 599-04-2 | 5g |
| GX9487-10g | D-(-)-Pantolactone | 599-04-2 | 10g |
| GX9487-25g | D-(-)-Pantolactone | 599-04-2 | 25g |
| GX9487-50g | D-(-)-Pantolactone | 599-04-2 | 50g |
| GE1274-5g | D-(-)-Quinic acid | 77-95-2 | 5g |
| GE1274-25g | D-(-)-Quinic acid | 77-95-2 | 25g |
| GE1274-100g | D-(-)-Quinic acid | 77-95-2 | 100g |
| GC2963-250mg | D-(-)-Tagatose | 87-81-0 | 250mg |
| GC2963-1g | D-(-)-Tagatose | 87-81-0 | 1g |
| GC2963-5g | D-(-)-Tagatose | 87-81-0 | 5g |
| GC7600-5g | D-(+)-Arabitol | 488-82-4 | 5g |
| GC7600-25g | D-(+)-Arabitol | 488-82-4 | 25g |
| GC7600-100g | D-(+)-Arabitol | 488-82-4 | 100g |
| GC7600-250g | D-(+)-Arabitol | 488-82-4 | 250g |
| GV9012-1g | D-(+)-Biotin, 98% | 58-85-5 | 1g |
| GV9012-5g | D-(+)-Biotin, 98% | 58-85-5 | 5g |
| GV4685-1g | D-(+)-Biotin, EP, USP grade | 58-85-5 | 1g |
| GV4685-5g | D-(+)-Biotin, EP, USP grade | 58-85-5 | 5g |
| GV4685-10g | D-(+)-Biotin, EP, USP grade | 58-85-5 | 10g |
| GV4685-25g | D-(+)-Biotin, EP, USP grade | 58-85-5 | 25g |
| GL5750-1g | D-(+)-Camphoric acid | 124-83-4 | 1g |
| GC8006-5g | D-(+)-Cellobiose | 528-50-7 | 5g |
| GC8006-25g | D-(+)-Cellobiose | 528-50-7 | 25g |
| GC8006-100g | D-(+)-Cellobiose | 528-50-7 | 100g |
| GC0754-10mg | D-(+)-Cellotriose | 33404-34-1 | 10mg |
| GC0754-25mg | D-(+)-Cellotriose | 33404-34-1 | 25mg |
| GC0754-50mg | D-(+)-Cellotriose | 33404-34-1 | 50mg |
| GC0754-100mg | D-(+)-Cellotriose | 33404-34-1 | 100mg |
| GC6238-500mg | D-(+)-Fucose | 3615-37-0 | 500mg |
| GC6238-1g | D-(+)-Fucose | 3615-37-0 | 1g |
| GC6238-5g | D-(+)-Fucose | 3615-37-0 | 5g |
| GC4603-10mg | D-(+)-Galactosamine hydrochloride | 1772-03-8 | 10mg |
| GC4603-250mg | D-(+)-Galactosamine hydrochloride | 1772-03-8 | 250mg |
| GC4603-1g | D-(+)-Galactosamine hydrochloride | 1772-03-8 | 1g |
| GC4603-5g | D-(+)-Galactosamine hydrochloride | 1772-03-8 | 5g |
| GC7360-100g | D-(+)-Galactose | 59-23-4 | 100g |
| GC7360-250g | D-(+)-Galactose | 59-23-4 | 250g |
| GC7360-500g | D-(+)-Galactose | 59-23-4 | 500g |
| GC7360-1kg | D-(+)-Galactose | 59-23-4 | 1kg |
| GC7360-5kg | D-(+)-Galactose | 59-23-4 | 5kg |
| GC8777-100g | D-(+)-Galactose, non-animal origin | 59-23-4 | 100g |
| GC8777-250g | D-(+)-Galactose, non-animal origin | 59-23-4 | 250g |
| GC6294-5g | D-(+)-Galacturonic acid monohydrate | 91510-62-2 | 5g |
| GC6294-10g | D-(+)-Galacturonic acid monohydrate | 91510-62-2 | 10g |
| GC6294-25g | D-(+)-Galacturonic acid monohydrate | 91510-62-2 | 25g |
| GC5349-250g | D-(+)-Glucose monohydrate | 14431-43-7 | 250g |
| GC5349-500g | D-(+)-Glucose monohydrate | 14431-43-7 | 500g |
| GC5349-1kg | D-(+)-Glucose monohydrate | 14431-43-7 | 1kg |
| GC5349-5kg | D-(+)-Glucose monohydrate | 14431-43-7 | 5kg |
| GC5349-10kg | D-(+)-Glucose monohydrate | 14431-43-7 | 10kg |
| GC5349-25kg | D-(+)-Glucose monohydrate | 14431-43-7 | 25kg |
| GC9110-1kg | D-(+)-Glucose monohydrate, Ph. Eur., USP grade | 14431-43-7 | 1kg |
| GC9110-5kg | D-(+)-Glucose monohydrate, Ph. Eur., USP grade | 14431-43-7 | 5kg |
| GC6947-100g | D-(+)-Glucose, anhydrous | 50-99-7 | 100g |
| GC6947-500g | D-(+)-Glucose, anhydrous | 50-99-7 | 500g |
| GC6947-1kg | D-(+)-Glucose, anhydrous | 50-99-7 | 1kg |
| GC6947-5kg | D-(+)-Glucose, anhydrous | 50-99-7 | 5kg |
| GC6947-10kg | D-(+)-Glucose, anhydrous | 50-99-7 | 10kg |
| GC0103-1kg | D-(+)-Glucose, anhydrous, Ph. Eur., USP grade | 50-99-7 | 1kg |
| GC0103-5kg | D-(+)-Glucose, anhydrous, Ph. Eur., USP grade | 50-99-7 | 5kg |
| GC1102-100g | D-(+)-Maltose monohydrate, 95% | 6363-53-7 | 100g |
| GC1102-500g | D-(+)-Maltose monohydrate, 95% | 6363-53-7 | 500g |
| GC1102-1kg | D-(+)-Maltose monohydrate, 95% | 6363-53-7 | 1kg |
| GC5556-100g | D-(+)-Maltose monohydrate, USP/NF grade | 6363-53-7 | 100g |
| GC5556-250g | D-(+)-Maltose monohydrate, USP/NF grade | 6363-53-7 | 250g |
| GC5556-1kg | D-(+)-Maltose monohydrate, USP/NF grade | 6363-53-7 | 1kg |
| GC5556-5kg | D-(+)-Maltose monohydrate, USP/NF grade | 6363-53-7 | 5kg |
| GC5556-10kg | D-(+)-Maltose monohydrate, USP/NF grade | 6363-53-7 | 10kg |
| GC5556-25kg | D-(+)-Maltose monohydrate, USP/NF grade | 6363-53-7 | 25kg |
| GC7397-25g | D-(+)-Mannose | 3458-28-4 | 25g |
| GC7397-100g | D-(+)-Mannose | 3458-28-4 | 100g |
| GC7397-250g | D-(+)-Mannose | 3458-28-4 | 250g |
| GC7397-500g | D-(+)-Mannose | 3458-28-4 | 500g |
| GC8181-500g | D-(+)-Mannose, 99%, from wood | 3458-28-4 | 500g |
| GC6165-5g | D-(+)-Melezitose hydrate | 207511-10-2 | 5g |
| GC6165-10g | D-(+)-Melezitose hydrate | 207511-10-2 | 10g |
| GC6165-25g | D-(+)-Melezitose hydrate | 207511-10-2 | 25g |
| GC9604-5g | D-(+)-Melibiose monohydrate | 66009-10-7 | 5g |
| GC9604-10g | D-(+)-Melibiose monohydrate | 66009-10-7 | 10g |
| GC9604-25g | D-(+)-Melibiose monohydrate | 66009-10-7 | 25g |
| GC7900-25g | D-(+)-Trehalose dihydrate | 6138-23-4 | 25g |
| GC7900-100g | D-(+)-Trehalose dihydrate | 6138-23-4 | 100g |
| GC7900-250g | D-(+)-Trehalose dihydrate | 6138-23-4 | 250g |
| GC7900-500g | D-(+)-Trehalose dihydrate | 6138-23-4 | 500g |
| GC7900-1kg | D-(+)-Trehalose dihydrate | 6138-23-4 | 1kg |
| GC1201-25g | D-(+)-Trehalose dihydrate, Ph. Eur. grade | 6138-23-4 | 25g |
| GC1201-100g | D-(+)-Trehalose dihydrate, Ph. Eur. grade | 6138-23-4 | 100g |
| GC1201-250g | D-(+)-Trehalose dihydrate, Ph. Eur. grade | 6138-23-4 | 250g |
| GC1201-500g | D-(+)-Trehalose dihydrate, Ph. Eur. grade | 6138-23-4 | 500g |
| GC1516-1g | D-(+)-Trehalose, anhydrous | 99-20-7 | 1g |
| GC1516-5g | D-(+)-Trehalose, anhydrous | 99-20-7 | 5g |
| GC1516-25g | D-(+)-Trehalose, anhydrous | 99-20-7 | 25g |
| GC1516-100g | D-(+)-Trehalose, anhydrous | 99-20-7 | 100g |
| GC5855-1g | D-(+)-Turanose | 547-25-1 | 1g |
| GC5855-5g | D-(+)-Turanose | 547-25-1 | 5g |
| GC9897-100g | D-(+)-Xylose | 58-86-6 | 100g |
| GC9897-250g | D-(+)-Xylose | 58-86-6 | 250g |
| GC9897-500g | D-(+)-Xylose | 58-86-6 | 500g |
| GC9897-1kg | D-(+)-Xylose | 58-86-6 | 1kg |
| GC9897-5kg | D-(+)-Xylose | 58-86-6 | 5kg |
| GC4822-1kg | D-(+)-Xylose, USP grade | 58-86-6 | 1kg |
| GK9553-5g | D-a-Tocopherol succinate | 4345-03-3 | 5g |
| GK9553-25g | D-a-Tocopherol succinate | 4345-03-3 | 25g |
| GK9553-100g | D-a-Tocopherol succinate | 4345-03-3 | 100g |
| GM9575-5g | D-Alanine | 338-69-2 | 5g |
| GM9575-25g | D-Alanine | 338-69-2 | 25g |
| GM9575-100g | D-Alanine | 338-69-2 | 100g |
| GC3267-250mg | D-Allose | 2595-97-3 | 250mg |
| GC3267-1g | D-Allose | 2595-97-3 | 1g |
| GM7112-1g | D-Allylglycin | 54594-06-8 | 1g |
| GM7112-5g | D-Allylglycin | 54594-06-8 | 5g |
| GK2339-5g | D-alpha-Tocopherol polyethylene glycol succinate | 9002-96-4 | 5g |
| GK2339-25g | D-alpha-Tocopherol polyethylene glycol succinate | 9002-96-4 | 25g |
| GC6439-25g | D-Arabinose | 10323-20-3 | 25g |
| GC6439-50g | D-Arabinose | 10323-20-3 | 50g |
| GC6439-100g | D-Arabinose | 10323-20-3 | 100g |
| GC6439-500g | D-Arabinose | 10323-20-3 | 500g |
| GM7267-1g | D-Arginine | 157-06-2 | 1g |
| GM7267-5g | D-Arginine | 157-06-2 | 5g |
| GM7267-25g | D-Arginine | 157-06-2 | 25g |
| GM5489-1g | D-Arginine monohydrochloride | 627-75-8 | 1g |
| GM5489-5g | D-Arginine monohydrochloride | 627-75-8 | 5g |
| GM5903-25g | D-Asparagine monohydrate | 5794-24-1 | 25g |
| GM5903-100g | D-Asparagine monohydrate | 5794-24-1 | 100g |
| GM9048-25g | D-Asparagine, anhydrous | 2058-58-4 | 25g |
| GM2767-5g | D-Aspartic acid | 1783-96-6 | 5g |
| GM2767-25g | D-Aspartic acid | 1783-96-6 | 25g |
| GM2767-100g | D-Aspartic acid | 1783-96-6 | 100g |
| GM2767-250g | D-Aspartic acid | 1783-96-6 | 250g |
| GW9462-100mg | D-Biotin p-nitrophenyl ester | 33755-53-2 | 100mg |
| GC9824-100mg | D-Cellobiitol | 535-94-4 | 100mg |
| GC9824-250mg | D-Cellobiitol | 535-94-4 | 250mg |
| GC9824-500mg | D-Cellobiitol | 535-94-4 | 500mg |
| GC9824-1g | D-Cellobiitol | 535-94-4 | 1g |
| GC9824-2g | D-Cellobiitol | 535-94-4 | 2g |
| GC3050-10mg | D-Cellobionic acid, ammonium salt | 10mg | |
| GC3050-25mg | D-Cellobionic acid, ammonium salt | 25mg | |
| GC3050-50mg | D-Cellobionic acid, ammonium salt | 50mg | |
| GC3050-100mg | D-Cellobionic acid, ammonium salt | 100mg | |
| GC9481-5g | D-Cellobiose octaacetate | 5346-90-7 | 5g |
| GC9481-25g | D-Cellobiose octaacetate | 5346-90-7 | 25g |
| GC5850-25mg | D-Cellobiose-1''-13C | 25mg | |
| GC5850-50mg | D-Cellobiose-1''-13C | 50mg | |
| GC5850-100mg | D-Cellobiose-1''-13C | 100mg | |
| GC5850-250mg | D-Cellobiose-1''-13C | 250mg | |
| GC3538-250mg | D-Cellobiosyl trichloroacetimidate heptaacetate | 250330-69-9 | 250mg |
| GC3538-500mg | D-Cellobiosyl trichloroacetimidate heptaacetate | 250330-69-9 | 500mg |
| GC3538-1g | D-Cellobiosyl trichloroacetimidate heptaacetate | 250330-69-9 | 1g |
| GC3538-2g | D-Cellobiosyl trichloroacetimidate heptaacetate | 250330-69-9 | 2g |
| GC0849-10mg | D-Cellotetraose tetradecaacetate | 83058-25-7 | 10mg |
| GC0849-25mg | D-Cellotetraose tetradecaacetate | 83058-25-7 | 25mg |
| GC0849-50mg | D-Cellotetraose tetradecaacetate | 83058-25-7 | 50mg |
| GC0849-100mg | D-Cellotetraose tetradecaacetate | 83058-25-7 | 100mg |
| GC0849-250mg | D-Cellotetraose tetradecaacetate | 83058-25-7 | 250mg |
| GC4690-10mg | D-Cellotriose undecaacetate | 17690-94-7 | 10mg |
| GC4690-25mg | D-Cellotriose undecaacetate | 17690-94-7 | 25mg |
| GC4690-50mg | D-Cellotriose undecaacetate | 17690-94-7 | 50mg |
| GC4690-100mg | D-Cellotriose undecaacetate | 17690-94-7 | 100mg |
| GC4690-250mg | D-Cellotriose undecaacetate | 17690-94-7 | 250mg |
| GA9717-100mg | D-Cycloserine | 68-41-7 | 100mg |
| GA9717-1g | D-Cycloserine | 68-41-7 | 1g |
| GA9717-5g | D-Cycloserine | 68-41-7 | 5g |
| GA9717-25g | D-Cycloserine | 68-41-7 | 25g |
| GM7143-100mg | D-Cysteine | 921-01-7 | 100mg |
| GM7143-500mg | D-Cysteine | 921-01-7 | 500mg |
| GM7143-1g | D-Cysteine | 921-01-7 | 1g |
| GM8208-250mg | D-Cysteine hydrochloride monohydrate | 32443-99-5 | 250mg |
| GM8208-500mg | D-Cysteine hydrochloride monohydrate | 32443-99-5 | 500mg |
| GM8208-1g | D-Cysteine hydrochloride monohydrate | 32443-99-5 | 1g |
| GM8208-5g | D-Cysteine hydrochloride monohydrate | 32443-99-5 | 5g |
| GM5889-1g | D-Cystine | 349-46-2 | 1g |
| GM5889-5g | D-Cystine | 349-46-2 | 5g |
| GW2520-1mg | D-erythro-Dihydrosphingosine 1-phosphate | 19794-97-9 | 1mg |
| GW2520-5mg | D-erythro-Dihydrosphingosine 1-phosphate | 19794-97-9 | 5mg |
| GC6103-1mg | D-Fructofuranuronic acid | 1mg | |
| GC6103-2mg | D-Fructofuranuronic acid | 2mg | |
| GC6103-5mg | D-Fructofuranuronic acid | 5mg | |
| GC6103-10mg | D-Fructofuranuronic acid | 10mg | |
| GC6103-25mg | D-Fructofuranuronic acid | 25mg | |
| GC5619-1g | D-Fructose 1,6-diphosphate trisodium salt octahydrate | 81028-91-3 | 1g |
| GC5619-5g | D-Fructose 1,6-diphosphate trisodium salt octahydrate | 81028-91-3 | 5g |
| GC1976-250mg | D-Fructose 1,6-diphosphate trisodium salt, anhydrous | 38099-82-0 | 250mg |
| GC1976-1g | D-Fructose 1,6-diphosphate trisodium salt, anhydrous | 38099-82-0 | 1g |
| GC1976-5g | D-Fructose 1,6-diphosphate trisodium salt, anhydrous | 38099-82-0 | 5g |
| GC1944-500mg | D-Fructose-6-phosphate disodium salt | 26177-86-6 | 500mg |
| GC1944-1g | D-Fructose-6-phosphate disodium salt | 26177-86-6 | 1g |
| GC8555-5g | D-Galactal | 21193-75-9 | 5g |
| GC8555-10g | D-Galactal | 21193-75-9 | 10g |
| GC8555-25g | D-Galactal | 21193-75-9 | 25g |
| GC8555-50g | D-Galactal | 21193-75-9 | 50g |
| GC0117-1g | D-Galactose diethyldithioacetal | 5463-33-2 | 1g |
| GC0117-2g | D-Galactose diethyldithioacetal | 5463-33-2 | 2g |
| GC0117-5g | D-Galactose diethyldithioacetal | 5463-33-2 | 5g |
| GC0117-10g | D-Galactose diethyldithioacetal | 5463-33-2 | 10g |
| GC5981-50mg | D-Galacturonic acid benzyl ester | 129519-24-0 | 50mg |
| GC5981-100mg | D-Galacturonic acid benzyl ester | 129519-24-0 | 100mg |
| GC5981-250mg | D-Galacturonic acid benzyl ester | 129519-24-0 | 250mg |
| GC5981-500mg | D-Galacturonic acid benzyl ester | 129519-24-0 | 500mg |
| GC4898-5g | D-Galacturonic acid sodium salt | 14984-39-5 | 5g |
| GC4898-25g | D-Galacturonic acid sodium salt | 14984-39-5 | 25g |
| GC4898-250g | D-Galacturonic acid sodium salt | 14984-39-5 | 250g |
| GC5777-10mg | D-Globotriose undecaacetate | 116182-08-2 | 10mg |
| GC5777-25mg | D-Globotriose undecaacetate | 116182-08-2 | 25mg |
| GC5777-50mg | D-Globotriose undecaacetate | 116182-08-2 | 50mg |
| GC5777-100mg | D-Globotriose undecaacetate | 116182-08-2 | 100mg |
| GC9693-10g | D-Glucal | 13265-84-4 | 10g |
| GC9693-25g | D-Glucal | 13265-84-4 | 25g |
| GC9693-50g | D-Glucal | 13265-84-4 | 50g |
| GC9693-100g | D-Glucal | 13265-84-4 | 100g |
| GC7683-100mg | D-Glucofuranuronic acid, γ-lactone-1,6-13C2 | 100mg | |
| GC7683-250mg | D-Glucofuranuronic acid, γ-lactone-1,6-13C2 | 250mg | |
| GC7683-500mg | D-Glucofuranuronic acid, γ-lactone-1,6-13C2 | 500mg | |
| GC7683-1g | D-Glucofuranuronic acid, γ-lactone-1,6-13C2 | 1g | |
| GX4314-1l | D-Gluconic acid, 50% solution | 526-95-4 | 1l |
| GX4314-2500ml | D-Gluconic acid, 50% solution | 526-95-4 | 2500ml |
| GX4314-5l | D-Gluconic acid, 50% solution | 526-95-4 | 5l |
| GC5247-250g | D-Glucono-1,5-lactone | 90-80-2 | 250g |
| GC5247-1kg | D-Glucono-1,5-lactone | 90-80-2 | 1kg |
| GC5247-5kg | D-Glucono-1,5-lactone | 90-80-2 | 5kg |
| GC0780-1g | D-Glucopyranuronic acid | 528-16-5 | 1g |
| GC0780-10g | D-Glucopyranuronic acid | 528-16-5 | 10g |
| GC0780-25g | D-Glucopyranuronic acid | 528-16-5 | 25g |
| GC0780-50g | D-Glucopyranuronic acid | 528-16-5 | 50g |
| GC9126-25mg | D-Glucosamine 2-sulfate sodium salt | 38899-05-7 | 25mg |
| GC2859-25g | D-Glucosamine hydrochloride | 66-84-2 | 25g |
| GC2859-50g | D-Glucosamine hydrochloride | 66-84-2 | 50g |
| GC2859-100g | D-Glucosamine hydrochloride | 66-84-2 | 100g |
| GC2859-250g | D-Glucosamine hydrochloride | 66-84-2 | 250g |
| GC2859-500g | D-Glucosamine hydrochloride | 66-84-2 | 500g |
| GC2859-1kg | D-Glucosamine hydrochloride | 66-84-2 | 1kg |
| GC4951-250g | D-Glucosamine hydrochloride, USP grade | 66-84-2 | 250g |
| GC4951-1kg | D-Glucosamine hydrochloride, USP grade | 66-84-2 | 1kg |
| GC1036-25g | D-Glucosamine sulfate, potassium chloride salt | 14999-43-0 | 25g |
| GC1036-100g | D-Glucosamine sulfate, potassium chloride salt | 14999-43-0 | 100g |
| GC1036-250g | D-Glucosamine sulfate, potassium chloride salt | 14999-43-0 | 250g |
| GC1036-500g | D-Glucosamine sulfate, potassium chloride salt | 14999-43-0 | 500g |
| GC2964-500mg | D-Glucose-1-13C | 40762-22-9 | 500mg |
| GC2964-1g | D-Glucose-1-13C | 40762-22-9 | 1g |
| GC2964-2g | D-Glucose-1-13C | 40762-22-9 | 2g |
| GC2964-5g | D-Glucose-1-13C | 40762-22-9 | 5g |
| GC9936-100mg | D-Glucose-1,2,3,4,5,6-13C6 | 110187-42-3 | 100mg |
| GC9936-500mg | D-Glucose-1,2,3,4,5,6-13C6 | 110187-42-3 | 500mg |
| GC9936-1g | D-Glucose-1,2,3,4,5,6-13C6 | 110187-42-3 | 1g |
| GC7048-50mg | D-Glucose-1,6-13C2 | 201741-04-0 | 50mg |
| GC7048-100mg | D-Glucose-1,6-13C2 | 201741-04-0 | 100mg |
| GC7048-250mg | D-Glucose-1,6-13C2 | 201741-04-0 | 250mg |
| GC7048-500mg | D-Glucose-1,6-13C2 | 201741-04-0 | 500mg |
| GC9849-500mg | D-Glucose-6-phosphate disodium salt | 3671-99-6 | 500mg |
| GC9849-1g | D-Glucose-6-phosphate disodium salt | 3671-99-6 | 1g |
| GC9849-5g | D-Glucose-6-phosphate disodium salt | 3671-99-6 | 5g |
| GC9849-10g | D-Glucose-6-phosphate disodium salt | 3671-99-6 | 10g |
| GC9849-25g | D-Glucose-6-phosphate disodium salt | 3671-99-6 | 25g |
| GC0472-100mg | D-Glucose-6-phosphate monosodium salt | 54010-71-8 | 100mg |
| GC0472-500mg | D-Glucose-6-phosphate monosodium salt | 54010-71-8 | 500mg |
| GC0472-1g | D-Glucose-6-phosphate monosodium salt | 54010-71-8 | 1g |
| GC9013-5g | D-Glucuronic acid | 6556-12-3 | 5g |
| GC9013-25g | D-Glucuronic acid | 6556-12-3 | 25g |
| GC9013-100g | D-Glucuronic acid | 6556-12-3 | 100g |
| GC9013-250g | D-Glucuronic acid | 6556-12-3 | 250g |
| GC8431-5g | D-Glucuronic acid sodium salt monohydrate | 207300-70-7 | 5g |
| GC8431-25g | D-Glucuronic acid sodium salt monohydrate | 207300-70-7 | 25g |
| GC8431-100g | D-Glucuronic acid sodium salt monohydrate | 207300-70-7 | 100g |
| GC8431-250g | D-Glucuronic acid sodium salt monohydrate | 207300-70-7 | 250g |
| GC2507-25g | D-Glucurono-3,6-lactone | 32449-92-6 | 25g |
| GC2507-250g | D-Glucurono-3,6-lactone | 32449-92-6 | 250g |
| GE7245-1g | D-Glutamic acid | 6893-26-1 | 1g |
| GE7245-5g | D-Glutamic acid | 6893-26-1 | 5g |
| GE7245-10g | D-Glutamic acid | 6893-26-1 | 10g |
| GE7245-25g | D-Glutamic acid | 6893-26-1 | 25g |
| GE7245-100g | D-Glutamic acid | 6893-26-1 | 100g |
| GM5255-1g | D-Glutamine | 5959-95-5 | 1g |
| GM5255-5g | D-Glutamine | 5959-95-5 | 5g |
| GM5255-10g | D-Glutamine | 5959-95-5 | 10g |
| GM2039-5g | D-Histidine | 351-50-8 | 5g |
| GM2039-25g | D-Histidine | 351-50-8 | 25g |
| GE0015-100mg | D-Isoleucine | 319-78-8 | 100mg |
| GE0015-250mg | D-Isoleucine | 319-78-8 | 250mg |
| GE0015-500mg | D-Isoleucine | 319-78-8 | 500mg |
| GC9781-1g | D-Lactitol monohydrate | 81025-04-9 | 1g |
| GC9781-5g | D-Lactitol monohydrate | 81025-04-9 | 5g |
| GC9781-25g | D-Lactitol monohydrate | 81025-04-9 | 25g |
| GM7879-1g | D-Leucine | 328-38-1 | 1g |
| GM7879-5g | D-Leucine | 328-38-1 | 5g |
| GM7879-10g | D-Leucine | 328-38-1 | 10g |
| GM7879-25g | D-Leucine | 328-38-1 | 25g |
| GP9319-10mg | D-Luciferin | 2591-17-5 | 10mg |
| GP9319-25mg | D-Luciferin | 2591-17-5 | 25mg |
| GP9319-50mg | D-Luciferin | 2591-17-5 | 50mg |
| GP9319-100mg | D-Luciferin | 2591-17-5 | 100mg |
| GW9100-50mg | D-Luciferin potassium salt | 115144-35-9 | 50mg |
| GW9100-250mg | D-Luciferin potassium salt | 115144-35-9 | 250mg |
| GP8979-25mg | D-Luciferin sodium salt | 103404-75-7 | 25mg |
| GP8979-100mg | D-Luciferin sodium salt | 103404-75-7 | 100mg |
| GM3691-1g | D-Lysine | 923-27-3 | 1g |
| GM4656-1g | D-Lysine monohydrochloride | 7274-88-6 | 1g |
| GM4656-5g | D-Lysine monohydrochloride | 7274-88-6 | 5g |
| GM4656-25g | D-Lysine monohydrochloride | 7274-88-6 | 25g |
| GC8890-1g | D-Maltose 2,2'',3,3'',4'',6,6''-heptaacetate | 56285-96-2 | 1g |
| GC8890-2g | D-Maltose 2,2'',3,3'',4'',6,6''-heptaacetate | 56285-96-2 | 2g |
| GC8890-5g | D-Maltose 2,2'',3,3'',4'',6,6''-heptaacetate | 56285-96-2 | 5g |
| GC8890-10g | D-Maltose 2,2'',3,3'',4'',6,6''-heptaacetate | 56285-96-2 | 10g |
| GC4590-250mg | D-Maltotriose undecaacetate | 76821-26-6 | 250mg |
| GC4590-500mg | D-Maltotriose undecaacetate | 76821-26-6 | 500mg |
| GC4590-1g | D-Maltotriose undecaacetate | 76821-26-6 | 1g |
| GC4590-2g | D-Maltotriose undecaacetate | 76821-26-6 | 2g |
| GC5587-100g | D-Mannitol | 69-65-8 | 100g |
| GC5587-250g | D-Mannitol | 69-65-8 | 250g |
| GC5587-500g | D-Mannitol | 69-65-8 | 500g |
| GC5587-1kg | D-Mannitol | 69-65-8 | 1kg |
| GC5587-5kg | D-Mannitol | 69-65-8 | 5kg |
| GC1282-250g | D-Mannitol, EP, USP grade | 69-65-8 | 250g |
| GC1282-1kg | D-Mannitol, EP, USP grade | 69-65-8 | 1kg |
| GC0915-50mg | D-Mannofuranuronic acid, γ-lactone | 575-64-4 | 50mg |
| GC0915-100mg | D-Mannofuranuronic acid, γ-lactone | 575-64-4 | 100mg |
| GC0915-250mg | D-Mannofuranuronic acid, γ-lactone | 575-64-4 | 250mg |
| GC0915-500mg | D-Mannofuranuronic acid, γ-lactone | 575-64-4 | 500mg |
| GC6042-5mg | D-Mannoheptulose | 3615-44-9 | 5mg |
| GC6042-25mg | D-Mannoheptulose | 3615-44-9 | 25mg |
| GC9575-5mg | D-Mannopyranuronic acid | 2538633-95-1 | 5mg |
| GC9575-10mg | D-Mannopyranuronic acid | 2538633-95-1 | 10mg |
| GC9575-25mg | D-Mannopyranuronic acid | 2538633-95-1 | 25mg |
| GC9575-50mg | D-Mannopyranuronic acid | 2538633-95-1 | 50mg |
| GC5971-10mg | D-Mannopyranuronic acid, sodium salt | 10mg | |
| GC5971-25mg | D-Mannopyranuronic acid, sodium salt | 25mg | |
| GC5971-50mg | D-Mannopyranuronic acid, sodium salt | 50mg | |
| GC5971-100mg | D-Mannopyranuronic acid, sodium salt | 100mg | |
| GC1764-10mg | D-Mannosamine hydrochloride | 5505-63-5 | 10mg |
| GC1764-100mg | D-Mannosamine hydrochloride | 5505-63-5 | 100mg |
| GC1764-500mg | D-Mannosamine hydrochloride | 5505-63-5 | 500mg |
| GC1764-1g | D-Mannosamine hydrochloride | 5505-63-5 | 1g |
| GC1764-5g | D-Mannosamine hydrochloride | 5505-63-5 | 5g |
| GM6497-5g | D-Methionine | 348-67-4 | 5g |
| GM6497-25g | D-Methionine | 348-67-4 | 25g |
| GM6497-100g | D-Methionine | 348-67-4 | 100g |
| GL2499-5mg | D-NMMA monoacetate | 137694-75-8 | 5mg |
| GL2499-25mg | D-NMMA monoacetate | 137694-75-8 | 25mg |
| GL2499-100mg | D-NMMA monoacetate | 137694-75-8 | 100mg |
| GM2284-1g | D-Ornithine monohydrochloride | 16682-12-5 | 1g |
| GM2284-5g | D-Ornithine monohydrochloride | 16682-12-5 | 5g |
| GM2284-10g | D-Ornithine monohydrochloride | 16682-12-5 | 10g |
| GM2284-25g | D-Ornithine monohydrochloride | 16682-12-5 | 25g |
| GP3689-5g | D-Pantethine hydrate | 16816-67-4 | 5g |
| GP3689-25g | D-Pantethine hydrate | 16816-67-4 | 25g |
| GP8490-25g | D-Panthenol | 81-13-0 | 25g |
| GP8490-100g | D-Panthenol | 81-13-0 | 100g |
| GE3451-25g | D-Pantothenic acid calcium salt | 137-08-6 | 25g |
| GE3451-100g | D-Pantothenic acid calcium salt | 137-08-6 | 100g |
| GE3451-250g | D-Pantothenic acid calcium salt | 137-08-6 | 250g |
| GE3451-500g | D-Pantothenic acid calcium salt | 137-08-6 | 500g |
| GE3451-1kg | D-Pantothenic acid calcium salt | 137-08-6 | 1kg |
| GE9583-25g | D-Pantothenic acid calcium salt, USP grade | 137-08-6 | 25g |
| GE9583-100g | D-Pantothenic acid calcium salt, USP grade | 137-08-6 | 100g |
| GA2413-5g | D-Penicillamine | 52-67-5 | 5g |
| GA2413-10g | D-Penicillamine | 52-67-5 | 10g |
| GA2413-25g | D-Penicillamine | 52-67-5 | 25g |
| GA2413-100g | D-Penicillamine | 52-67-5 | 100g |
| GA5612-1g | D-Penicillamine, USP grade | 52-67-5 | 1g |
| GA5612-5g | D-Penicillamine, USP grade | 52-67-5 | 5g |
| GA5612-10g | D-Penicillamine, USP grade | 52-67-5 | 10g |
| GA5612-25g | D-Penicillamine, USP grade | 52-67-5 | 25g |
| GA5612-100g | D-Penicillamine, USP grade | 52-67-5 | 100g |
| GM8043-5g | D-Phenylalanine | 673-06-3 | 5g |
| GM8043-25g | D-Phenylalanine | 673-06-3 | 25g |
| GM8043-100g | D-Phenylalanine | 673-06-3 | 100g |
| GM6313-5g | D-Phenylalanine methyl ester hydrochloride | 13033-84-6 | 5g |
| GM6313-10g | D-Phenylalanine methyl ester hydrochloride | 13033-84-6 | 10g |
| GM6313-25g | D-Phenylalanine methyl ester hydrochloride | 13033-84-6 | 25g |
| GM9107-500mg | D-Proline | 344-25-2 | 500mg |
| GM9107-1g | D-Proline | 344-25-2 | 1g |
| GM9107-5g | D-Proline | 344-25-2 | 5g |
| GM9107-25g | D-Proline | 344-25-2 | 25g |
| GM9107-100g | D-Proline | 344-25-2 | 100g |
| GC4633-10g | D-Raffinose pentahydrate | 17629-30-0 | 10g |
| GC4633-25g | D-Raffinose pentahydrate | 17629-30-0 | 25g |
| GC4633-50g | D-Raffinose pentahydrate | 17629-30-0 | 50g |
| GC4633-100g | D-Raffinose pentahydrate | 17629-30-0 | 100g |
| GC0856-25g | D-Ribose | 50-69-1 | 25g |
| GC0856-100g | D-Ribose | 50-69-1 | 100g |
| GC0856-250g | D-Ribose | 50-69-1 | 250g |
| GC0856-500g | D-Ribose | 50-69-1 | 500g |
| GC0856-1kg | D-Ribose | 50-69-1 | 1kg |
| GC1803-100mg | D-Ribose-5-phosphate disodium salt hydrate | 18265-46-8 | 100mg |
| GC1803-1g | D-Ribose-5-phosphate disodium salt hydrate | 18265-46-8 | 1g |
| GC4870-5g | D-Salicin | 138-52-3 | 5g |
| GC4870-25g | D-Salicin | 138-52-3 | 25g |
| GC4870-100g | D-Salicin | 138-52-3 | 100g |
| GW8825-25mg | D-Selenocystine | 26932-45-6 | 25mg |
| GW8825-50mg | D-Selenocystine | 26932-45-6 | 50mg |
| GM2756-5g | D-Serine | 312-84-5 | 5g |
| GM2756-10g | D-Serine | 312-84-5 | 10g |
| GM2756-25g | D-Serine | 312-84-5 | 25g |
| GM2756-50g | D-Serine | 312-84-5 | 50g |
| GM2756-100g | D-Serine | 312-84-5 | 100g |
| GM2636-5g | D-Serine methyl ester hydrochloride | 5874-57-7 | 5g |
| GM2636-25g | D-Serine methyl ester hydrochloride | 5874-57-7 | 25g |
| GM2636-100g | D-Serine methyl ester hydrochloride | 5874-57-7 | 100g |
| GC2278-100g | D-Sorbitol | 50-70-4 | 100g |
| GC2278-250g | D-Sorbitol | 50-70-4 | 250g |
| GC2278-500g | D-Sorbitol | 50-70-4 | 500g |
| GC2278-1kg | D-Sorbitol | 50-70-4 | 1kg |
| GC2278-5kg | D-Sorbitol | 50-70-4 | 5kg |
| GC1670-1kg | D-Sorbitol, Ph. Eur., USP/NF grade | 50-70-4 | 1kg |
| GK1855-25g | D-Tartaric acid | 147-71-7 | 25g |
| GK1855-100g | D-Tartaric acid | 147-71-7 | 100g |
| GK1855-500g | D-Tartaric acid | 147-71-7 | 500g |
| GM1465-100mg | D-tert-Leucine | 26782-71-8 | 100mg |
| GM1465-250mg | D-tert-Leucine | 26782-71-8 | 250mg |
| GM1465-500mg | D-tert-Leucine | 26782-71-8 | 500mg |
| GM1465-2g | D-tert-Leucine | 26782-71-8 | 2g |
| GM7406-5g | D-Threonine | 632-20-2 | 5g |
| GM7406-25g | D-Threonine | 632-20-2 | 25g |
| GM7406-100g | D-Threonine | 632-20-2 | 100g |
| GM5015-5g | D-Tryptophan | 153-94-6 | 5g |
| GM5015-25g | D-Tryptophan | 153-94-6 | 25g |
| GM5015-100g | D-Tryptophan | 153-94-6 | 100g |
| GM7921-1g | D-Tryptophan methyl ester hydrochloride | 14907-27-8 | 1g |
| GM7921-5g | D-Tryptophan methyl ester hydrochloride | 14907-27-8 | 5g |
| GM2446-500mg | D-Tyrosine | 556-02-5 | 500mg |
| GM2446-1g | D-Tyrosine | 556-02-5 | 1g |
| GM2446-5g | D-Tyrosine | 556-02-5 | 5g |
| GM2446-10g | D-Tyrosine | 556-02-5 | 10g |
| GM2446-25g | D-Tyrosine | 556-02-5 | 25g |
| GM5893-5g | D-Valine | 640-68-6 | 5g |
| GM5893-25g | D-Valine | 640-68-6 | 25g |
| GM5893-100g | D-Valine | 640-68-6 | 100g |
| GM9253-1g | D-Valine methyl ester hydrochloride | 7146-15-8 | 1g |
| GM9253-5g | D-Valine methyl ester hydrochloride | 7146-15-8 | 5g |
| GM9253-25g | D-Valine methyl ester hydrochloride | 7146-15-8 | 25g |
| GC9922-50mg | D-Xylobiose | 83113-52-4 | 50mg |
| GC9922-100mg | D-Xylobiose | 83113-52-4 | 100mg |
| GC9922-250mg | D-Xylobiose | 83113-52-4 | 250mg |
| GC9922-500mg | D-Xylobiose | 83113-52-4 | 500mg |
| GK8620-100g | D(+)-Lactose monohydrate | 64044-51-5 | 100g |
| GK8620-250g | D(+)-Lactose monohydrate | 64044-51-5 | 250g |
| GK8620-500g | D(+)-Lactose monohydrate | 64044-51-5 | 500g |
| GK8620-1kg | D(+)-Lactose monohydrate | 64044-51-5 | 1kg |
| GK8620-5kg | D(+)-Lactose monohydrate | 64044-51-5 | 5kg |
| GW3056-50mg | DAABD-AE | 913253-56-2 | 50mg |
| GW3056-250mg | DAABD-AE | 913253-56-2 | 250mg |
| GP5669-50mg | Dabigatran etexilate | 211915-06-9 | 50mg |
| GP5669-250mg | Dabigatran etexilate | 211915-06-9 | 250mg |
| GW8521-1mg | DABPH | 1392835-67-4 | 1mg |
| GW8521-5mg | DABPH | 1392835-67-4 | 5mg |
| GA1142-250mg | Dacarbazine | 4342-03-4 | 250mg |
| GA1142-1g | Dacarbazine | 4342-03-4 | 1g |
| GA1142-5g | Dacarbazine | 4342-03-4 | 5g |
| GW3554-10mg | DACB-CN | 203256-20-6 | 10mg |
| GW3554-100mg | DACB-CN | 203256-20-6 | 100mg |
| GW8060-5mg | DACM | 55145-14-7 | 5mg |
| GW8060-25mg | DACM | 55145-14-7 | 25mg |
| GT2309-1mg | DAF-2 | 205391-01-1 | 1mg |
| GT2309-5mg | DAF-2 | 205391-01-1 | 5mg |
| GW5342-1mg | DAF-2 DA | 205391-02-2 | 1mg |
| GW5342-5mg | DAF-2 DA | 205391-02-2 | 5mg |
| GW0500-1mg | DAF-2 DA Solution | 205391-02-2 | 1mg |
| GW5419-1mg | DAF-2T | 208850-35-5 | 1mg |
| GW5419-5mg | DAF-2T | 208850-35-5 | 5mg |
| GW6609-1mg | DAF-2T Solution | 208850-35-5 | 1mg |
| GW9642-1mg | DAF-4 DA | 1mg | |
| GW9642-5mg | DAF-4 DA | 5mg | |
| GW9642-10mg | DAF-4 DA | 10mg | |
| GW8107-1mg | DAF-4 DA Solution | 208850-34-4 | 1mg |
| GW3304-1mg | DAF-4T | 212558-80-0 | 1mg |
| GW3304-5mg | DAF-4T | 212558-80-0 | 5mg |
| GW3304-10mg | DAF-4T | 212558-80-0 | 10mg |
| GP3581-250mg | Daidzein | 486-66-8 | 250mg |
| GP3581-1g | Daidzein | 486-66-8 | 1g |
| GC3816-100mg | Daidzin | 552-66-9 | 100mg |
| GC3816-250mg | Daidzin | 552-66-9 | 250mg |
| GC3816-500mg | Daidzin | 552-66-9 | 500mg |
| GC3816-1g | Daidzin | 552-66-9 | 1g |
| GC3816-2g | Daidzin | 552-66-9 | 2g |
| GL0893-1mg | DAMGO | 950492-85-0 | 1mg |
| GL0893-5mg | DAMGO | 950492-85-0 | 5mg |
| GP5327-5g | Daminozide | 1596-84-5 | 5g |
| GP5327-25g | Daminozide | 1596-84-5 | 25g |
| GE3985-5mg | Danshensu sodium salt | 76822-21-4 | 5mg |
| GK1213-5g | Dansyl chloride, 95% | 605-65-2 | 5g |
| GK1213-25g | Dansyl chloride, 95% | 605-65-2 | 25g |
| GK5103-1g | Dansyl chloride, 99% | 605-65-2 | 1g |
| GK5103-5g | Dansyl chloride, 99% | 605-65-2 | 5g |
| GW4407-1g | Dansylamide | 1431-39-6 | 1g |
| GW4407-5g | Dansylamide | 1431-39-6 | 5g |
| GW0087-250mg | Dansylcadaverine | 10121-91-2 | 250mg |
| GP0222-1g | Dantrolene sodium salt | 14663-23-1 | 1g |
| GP0222-5g | Dantrolene sodium salt | 14663-23-1 | 5g |
| GW8108-1mg | Danusertib | 827318-97-8 | 1mg |
| GW8108-5mg | Danusertib | 827318-97-8 | 5mg |
| GW8108-10mg | Danusertib | 827318-97-8 | 10mg |
| GP5853-25mg | Dapagliflozin | 461432-26-8 | 25mg |
| GP5853-100mg | Dapagliflozin | 461432-26-8 | 100mg |
| GC4120-1mg | Dapagliflozin 2-O-β-D-glucuronide | 1mg | |
| GC4120-2mg | Dapagliflozin 2-O-β-D-glucuronide | 2mg | |
| GC4120-5mg | Dapagliflozin 2-O-β-D-glucuronide | 5mg | |
| GC0515-1mg | Dapagliflozin 3-O-β-D-glucuronide | 1351438-75-9 | 1mg |
| GC0515-2mg | Dapagliflozin 3-O-β-D-glucuronide | 1351438-75-9 | 2mg |
| GC0515-5mg | Dapagliflozin 3-O-β-D-glucuronide | 1351438-75-9 | 5mg |
| GW9134-10mg | Dapansutrile | 54863-37-5 | 10mg |
| GW9134-50mg | Dapansutrile | 54863-37-5 | 50mg |
| GP6841-1g | Dapoxetine hydrochloride | 129938-20-1 | 1g |
| GP6841-5g | Dapoxetine hydrochloride | 129938-20-1 | 5g |
| GA5546-25g | Dapsone | 80-08-0 | 25g |
| GA5546-100g | Dapsone | 80-08-0 | 100g |
| GA5546-250g | Dapsone | 80-08-0 | 250g |
| GA5546-500g | Dapsone | 80-08-0 | 500g |
| GK0567-5mg | DAPT | 208255-80-5 | 5mg |
| GK0567-25mg | DAPT | 208255-80-5 | 25mg |
| GA1723-5mg | Daptomycin | 103060-53-3 | 5mg |
| GA1723-25mg | Daptomycin | 103060-53-3 | 25mg |
| GA1723-100mg | Daptomycin | 103060-53-3 | 100mg |
| GW7529-1mg | DAR-1 | 261351-43-3 | 1mg |
| GW7529-5mg | DAR-1 | 261351-43-3 | 5mg |
| GW7529-25mg | DAR-1 | 261351-43-3 | 25mg |
| GW9719-1mg | DAR-1 Solution | 261351-43-3 | 1mg |
| GW5595-1mg | DAR-1T | 261351-46-6 | 1mg |
| GW5595-5mg | DAR-1T | 261351-46-6 | 5mg |
| GW0136-1mg | DAR-1T Solution | 261351-46-6 | 1mg |
| GW8659-1mg | DAR-2 | 261351-45-5 | 1mg |
| GW8659-5mg | DAR-2 | 261351-45-5 | 5mg |
| GW8659-25mg | DAR-2 | 261351-45-5 | 25mg |
| GW5599-1mg | DAR-2 Solution | 261351-45-5 | 1mg |
| GW5966-1mg | DAR-2T | 261351-48-8 | 1mg |
| GW5966-5mg | DAR-2T | 261351-48-8 | 5mg |
| GW3895-1mg | DAR-4 | 339527-78-5 | 1mg |
| GW3895-5mg | DAR-4 | 339527-78-5 | 5mg |
| GW6996-1mg | DAR-4 Solution | 339527-78-5 | 1mg |
| GW9829-1mg | DAR-4M | 339527-79-6 | 1mg |
| GW9829-5mg | DAR-4M | 339527-79-6 | 5mg |
| GW9618-1mg | DAR-4M Solution | 339527-79-6 | 1mg |
| GW2770-1mg | DAR-4MT | 339527-82-1 | 1mg |
| GW2770-5mg | DAR-4MT | 339527-82-1 | 5mg |
| GW2711-1mg | DAR-4MT Solution | 339527-82-1 | 1mg |
| GW1186-1mg | DAR-4T | 1mg | |
| GW1186-5mg | DAR-4T | 5mg | |
| GW2484-1mg | DAR-4T Solution | 1mg | |
| GW1128-1mg | DAR-M | 261351-44-4 | 1mg |
| GW1128-5mg | DAR-M | 261351-44-4 | 5mg |
| GW7701-1mg | DAR-M Solution | 261351-44-4 | 1mg |
| GW1738-1mg | DAR-MT | 261351-47-7 | 1mg |
| GW1738-5mg | DAR-MT | 261351-47-7 | 5mg |
| GW3215-1mg | DAR-MT Solution | 261351-47-7 | 1mg |
| GP5767-10mg | Darunavir | 206361-99-1 | 10mg |
| GP5767-50mg | Darunavir | 206361-99-1 | 50mg |
| GW1808-10mg | Darunavir . ethanolate | 635728-49-3 | 10mg |
| GW1808-50mg | Darunavir . ethanolate | 635728-49-3 | 50mg |
| GW6480-1g | Dasatinib | 302962-49-8 | 1g |
| GA7448-5mg | Daunorubicin hydrochloride, EP grade | 23541-50-6 | 5mg |
| GA7448-10mg | Daunorubicin hydrochloride, EP grade | 23541-50-6 | 10mg |
| GA7448-25mg | Daunorubicin hydrochloride, EP grade | 23541-50-6 | 25mg |
| GW3799-1g | DCFDA | 2044-85-1 | 1g |
| GW3799-5g | DCFDA | 2044-85-1 | 5g |
| GW4157-10mg | DCIA | 76877-34-4 | 10mg |
| GW4157-20mg | DCIA | 76877-34-4 | 20mg |
| GW4157-100mg | DCIA | 76877-34-4 | 100mg |
| GE2726-25g | DEAE-Cellulose, preswollen | 9013-34-7 | 25g |
| GE2726-50g | DEAE-Cellulose, preswollen | 9013-34-7 | 50g |
| GE2726-100g | DEAE-Cellulose, preswollen | 9013-34-7 | 100g |
| GE2726-250g | DEAE-Cellulose, preswollen | 9013-34-7 | 250g |
| GL5342-100ug | Debromohymenialdisine | 75593-17-8 | 100ug |
| GK1190-25g | Decanal | 112-31-2 | 25g |
| GK2505-100g | Decanoic acid | 334-48-5 | 100g |
| GL8578-1mg | Decarestrictine D | 127393-89-9 | 1mg |
| GL8578-5mg | Decarestrictine D | 127393-89-9 | 5mg |
| GA0244-1mg | Decoyinine | 2004-04-8 | 1mg |
| GA0244-5mg | Decoyinine | 2004-04-8 | 5mg |
| GC7081-1g | Decyl b-D-glucopyranoside | 58846-77-8 | 1g |
| GC7081-5g | Decyl b-D-glucopyranoside | 58846-77-8 | 5g |
| GC0811-500mg | Decyl b-D-maltopyranoside, 99% | 82494-09-5 | 500mg |
| GC0811-1g | Decyl b-D-maltopyranoside, 99% | 82494-09-5 | 1g |
| GC3210-250mg | Decyl b-D-thioglucopyranoside | 98854-16-1 | 250mg |
| GK7126-10g | Decyltrimethylammonium bromide | 2082-84-0 | 10g |
| GC7251-1mg | Deferasirox acyl-β-D-glucuronide | 1233196-91-2 | 1mg |
| GC7251-2mg | Deferasirox acyl-β-D-glucuronide | 1233196-91-2 | 2mg |
| GC7251-5mg | Deferasirox acyl-β-D-glucuronide | 1233196-91-2 | 5mg |
| GC7251-10mg | Deferasirox acyl-β-D-glucuronide | 1233196-91-2 | 10mg |
| GC2279-1mg | Deferiprone 3-O-b-D-glucuronide | 141675-48-1 | 1mg |
| GC2279-2mg | Deferiprone 3-O-b-D-glucuronide | 141675-48-1 | 2mg |
| GC2279-5mg | Deferiprone 3-O-b-D-glucuronide | 141675-48-1 | 5mg |
| GC2279-10mg | Deferiprone 3-O-b-D-glucuronide | 141675-48-1 | 10mg |
| GP7998-100mg | Deflazacort | 14484-47-0 | 100mg |
| GP8945-100mg | Dehydroandrographolide | 134418-28-3 | 100mg |
| GP3148-5mg | Dehydroequol | 81267-65-4 | 5mg |
| GP3148-25mg | Dehydroequol | 81267-65-4 | 25mg |
| GW5337-1mg | Delanzomib [CEP-18770] | 847499-27-8 | 1mg |
| GW5337-5mg | Delanzomib [CEP-18770] | 847499-27-8 | 5mg |
| GW5337-25mg | Delanzomib [CEP-18770] | 847499-27-8 | 25mg |
| GK1634-100mg | Deltamethrin | 52918-63-5 | 100mg |
| GK1634-1g | Deltamethrin | 52918-63-5 | 1g |
| GA7186-250mg | Demeclocycline hydrochloride | 64-73-3 | 250mg |
| GA7186-1g | Demeclocycline hydrochloride | 64-73-3 | 1g |
| GP5459-5mg | Demecolcine | 477-30-5 | 5mg |
| GP5459-25mg | Demecolcine | 477-30-5 | 25mg |
| GL0560-5mg | Demethoxycurcumin | 22608-11-3 | 5mg |
| GL0560-25mg | Demethoxycurcumin | 22608-11-3 | 25mg |
| GE9090-1g | Denatonium benzoate | 3734-33-6 | 1g |
| GE9090-5g | Denatonium benzoate | 3734-33-6 | 5g |
| GE9090-10g | Denatonium benzoate | 3734-33-6 | 10g |
| GE9090-25g | Denatonium benzoate | 3734-33-6 | 25g |
| GE7887-5g | Denatonium benzoate, granules | 3734-33-6 | 5g |
| GE7887-10g | Denatonium benzoate, granules | 3734-33-6 | 10g |
| GY6383-5mg | Dendrobine | 2115-91-5 | 5mg |
| GD8955-10g | Deoxycholic acid | 83-44-3 | 10g |
| GD8955-25g | Deoxycholic acid | 83-44-3 | 25g |
| GD8955-100g | Deoxycholic acid | 83-44-3 | 100g |
| GD8955-250g | Deoxycholic acid | 83-44-3 | 250g |
| GD8955-500g | Deoxycholic acid | 83-44-3 | 500g |
| GD5695-5g | Deoxycholic acid sodium salt | 302-95-4 | 5g |
| GD5695-25g | Deoxycholic acid sodium salt | 302-95-4 | 25g |
| GD5695-100g | Deoxycholic acid sodium salt | 302-95-4 | 100g |
| GD5695-250g | Deoxycholic acid sodium salt | 302-95-4 | 250g |
| GD5695-500g | Deoxycholic acid sodium salt | 302-95-4 | 500g |
| GL5039-1mg | Deoxymanumycin A | 1mg | |
| GL5039-5mg | Deoxymanumycin A | 5mg | |
| GZ2164-5000U | Deoxyribonuclease I | 9003-98-9 | 5000U |
| GZ2164-25000U | Deoxyribonuclease I | 9003-98-9 | 25000U |
| GE7850-500mg | Dequalinium chloride | 522-51-0 | 500mg |
| GW3015-1mg | Dermcidin-1L (human) . TFA | 478898-18-9 | 1mg |
| GW3015-5mg | Dermcidin-1L (human) . TFA | 478898-18-9 | 5mg |
| GW2786-5mg | Desacetylcolchicine d-u200btartrate | 49720-72-1 | 5mg |
| GW2786-25mg | Desacetylcolchicine d-u200btartrate | 49720-72-1 | 25mg |
| GW2786-100mg | Desacetylcolchicine d-u200btartrate | 49720-72-1 | 100mg |
| GE5475-10mg | Desethylamodiaquine | 79352-78-6 | 10mg |
| GE5475-25mg | Desethylamodiaquine | 79352-78-6 | 25mg |
| GP5073-1g | Desferrioxamine B mesylate | 138-14-7 | 1g |
| GP7090-1mg | Desmopressin acetate | 16789-98-3 | 1mg |
| GP7090-5mg | Desmopressin acetate | 16789-98-3 | 5mg |
| GP5321-100mg | Desogestrel | 54024-22-5 | 100mg |
| GE1466-1g | Dess-Martin Periodinane | 87413-09-0 | 1g |
| GE1466-5g | Dess-Martin Periodinane | 87413-09-0 | 5g |
| GE1466-25g | Dess-Martin Periodinane | 87413-09-0 | 25g |
| GW1968-5EA | Destaining bags, ethidium bromide | - | 5EA |
| GP9626-100mg | Desvenlafaxine succinate | 386750-22-7 | 100mg |
| GP9626-250mg | Desvenlafaxine succinate | 386750-22-7 | 250mg |
| GX0380-500g | Devarda's alloy | 8049-11-4 | 500g |
| GP8543-250mg | Dexamethasone | 50-02-2 | 250mg |
| GP8543-1g | Dexamethasone | 50-02-2 | 1g |
| GP8543-5g | Dexamethasone | 50-02-2 | 5g |
| GC9546-1mg | Dexamethasone 21-O-β-D-galactopyranoside | 92901-23-0 | 1mg |
| GC9546-2mg | Dexamethasone 21-O-β-D-galactopyranoside | 92901-23-0 | 2mg |
| GC9546-5mg | Dexamethasone 21-O-β-D-galactopyranoside | 92901-23-0 | 5mg |
| GC9546-10mg | Dexamethasone 21-O-β-D-galactopyranoside | 92901-23-0 | 10mg |
| GX3546-500mg | Dexamethasone 21-phosphate disodium salt | 2392-39-4 | 500mg |
| GX3546-1g | Dexamethasone 21-phosphate disodium salt | 2392-39-4 | 1g |
| GX3546-5g | Dexamethasone 21-phosphate disodium salt | 2392-39-4 | 5g |
| GL6086-1g | Dexamethasone 21-phosphate disodium salt, USP grade | 2392-39-4 | 1g |
| GL6086-5g | Dexamethasone 21-phosphate disodium salt, USP grade | 2392-39-4 | 5g |
| GC5559-1mg | Dexibuprofen acyl-β-D-glucuronide | 98649-76-4 | 1mg |
| GC5559-2mg | Dexibuprofen acyl-β-D-glucuronide | 98649-76-4 | 2mg |
| GC5559-5mg | Dexibuprofen acyl-β-D-glucuronide | 98649-76-4 | 5mg |
| GC5559-10mg | Dexibuprofen acyl-β-D-glucuronide | 98649-76-4 | 10mg |
| GP3263-100mg | Dexlansoprazole | 138530-94-6 | 100mg |
| GW7920-25mg | Dexmedetomidine hydrochloride | 145108-58-3 | 25mg |
| GW7920-100mg | Dexmedetomidine hydrochloride | 145108-58-3 | 100mg |
| GP2739-100mg | Dexrazoxane | 24584-09-6 | 100mg |
| GP2739-250mg | Dexrazoxane | 24584-09-6 | 250mg |
| GE1910-100mg | Dextran 1,000 | 9004-54-0 | 100mg |
| GE1910-500mg | Dextran 1,000 | 9004-54-0 | 500mg |
| GE1910-1g | Dextran 1,000 | 9004-54-0 | 1g |
| GE1910-5g | Dextran 1,000 | 9004-54-0 | 5g |
| GC0854-25g | Dextran 10,000 | 9004-54-0 | 25g |
| GC0854-100g | Dextran 10,000 | 9004-54-0 | 100g |
| GC6054-100g | Dextran 100,000 | 9004-54-0 | 100g |
| GC6054-250g | Dextran 100,000 | 9004-54-0 | 250g |
| GC9974-25g | Dextran 200,000 | 9004-54-0 | 25g |
| GC9974-100g | Dextran 200,000 | 9004-54-0 | 100g |
| GC7757-25g | Dextran 250,000 | 9004-54-0 | 25g |
| GC7757-100g | Dextran 250,000 | 9004-54-0 | 100g |
| GX1617-25g | Dextran 4,000 | 9004-54-0 | 25g |
| GX1617-100g | Dextran 4,000 | 9004-54-0 | 100g |
| GE2215-25g | Dextran 40,000 | 9004-54-0 | 25g |
| GE2215-100g | Dextran 40,000 | 9004-54-0 | 100g |
| GE2215-250g | Dextran 40,000 | 9004-54-0 | 250g |
| GE2215-500g | Dextran 40,000 | 9004-54-0 | 500g |
| GC5456-25g | Dextran 5,000 | 9004-54-0 | 25g |
| GC5456-100g | Dextran 5,000 | 9004-54-0 | 100g |
| GC5456-500g | Dextran 5,000 | 9004-54-0 | 500g |
| GC9091-25g | Dextran 6,000 | 9004-54-0 | 25g |
| GC9091-100g | Dextran 6,000 | 9004-54-0 | 100g |
| GE4231-25g | Dextran 70,000 | 9004-54-0 | 25g |
| GE4231-100g | Dextran 70,000 | 9004-54-0 | 100g |
| GE4231-250g | Dextran 70,000 | 9004-54-0 | 250g |
| GE4231-500g | Dextran 70,000 | 9004-54-0 | 500g |
| GC2426-1g | Dextran sulfate sodium salt, MW approx. 500,000 | 9011-18-1 | 1g |
| GC2426-5g | Dextran sulfate sodium salt, MW approx. 500,000 | 9011-18-1 | 5g |
| GC2426-10g | Dextran sulfate sodium salt, MW approx. 500,000 | 9011-18-1 | 10g |
| GC2140-5g | Dextran sulfate sodium salt, MW approx. 8,000 | 9011-18-1 | 5g |
| GC2140-10g | Dextran sulfate sodium salt, MW approx. 8,000 | 9011-18-1 | 10g |
| GC2140-25g | Dextran sulfate sodium salt, MW approx. 8,000 | 9011-18-1 | 25g |
| GC2140-100g | Dextran sulfate sodium salt, MW approx. 8,000 | 9011-18-1 | 100g |
| GC6810-100g | Dextrin | 9004-53-9 | 100g |
| GC6810-250g | Dextrin | 9004-53-9 | 250g |
| GL9006-5g | Dextromethorphan hydrobromide monohydrate | 6700-34-1 | 5g |
| GL9006-10g | Dextromethorphan hydrobromide monohydrate | 6700-34-1 | 10g |
| GL9006-25g | Dextromethorphan hydrobromide monohydrate | 6700-34-1 | 25g |
| GW8162-100mg | DHPDS | 61255-63-8 | 100mg |
| GW8162-1g | DHPDS | 61255-63-8 | 1g |
| GW9563-2500mg | Di-(2-picolyl)amine | 1539-42-0 | 2500mg |
| GW9563-5g | Di-(2-picolyl)amine | 1539-42-0 | 5g |
| GW9563-25g | Di-(2-picolyl)amine | 1539-42-0 | 25g |
| GT0430-5mg | Di-8-ANEPPS | 157134-53-7 | 5mg |
| GK1214-100g | di-Ammonium hydrogen citrate | 3012-65-5 | 100g |
| GK1214-250g | di-Ammonium hydrogen citrate | 3012-65-5 | 250g |
| GK1214-500g | di-Ammonium hydrogen citrate | 3012-65-5 | 500g |
| GK1214-1kg | di-Ammonium hydrogen citrate | 3012-65-5 | 1kg |
| GK0736-250g | di-Ammonium hydrogen phosphate | 7783-28-0 | 250g |
| GK0736-500g | di-Ammonium hydrogen phosphate | 7783-28-0 | 500g |
| GK0736-1kg | di-Ammonium hydrogen phosphate | 7783-28-0 | 1kg |
| GK0736-5kg | di-Ammonium hydrogen phosphate | 7783-28-0 | 5kg |
| GX8577-500g | di-Ammonium hydrogen phosphate, technical, 97% | 7783-28-0 | 500g |
| GX8577-1kg | di-Ammonium hydrogen phosphate, technical, 97% | 7783-28-0 | 1kg |
| GX8577-5kg | di-Ammonium hydrogen phosphate, technical, 97% | 7783-28-0 | 5kg |
| GS1865-100ml | Di-iso-propyl Ether, GlenDry™, anhydrous stabilised with BHT | 108-20-3 | 100ml |
| GS1865-500ml | Di-iso-propyl Ether, GlenDry™, anhydrous stabilised with BHT | 108-20-3 | 500ml |
| GS1865-1l | Di-iso-propyl Ether, GlenDry™, anhydrous stabilised with BHT | 108-20-3 | 1l |
| GS1865-2500ml | Di-iso-propyl Ether, GlenDry™, anhydrous stabilised with BHT | 108-20-3 | 2500ml |
| GS7207-500ml | Di-iso-propyl Ether, GlenPure™, analytical grade stabilised with BHT | 108-20-3 | 500ml |
| GS7207-1l | Di-iso-propyl Ether, GlenPure™, analytical grade stabilised with BHT | 108-20-3 | 1l |
| GS7207-2500ml | Di-iso-propyl Ether, GlenPure™, analytical grade stabilised with BHT | 108-20-3 | 2500ml |
| GS7181-100ml | Di-iso-propylethylamine, GlenBiol™, suitable for molecular biology | 7087-68-5 | 100ml |
| GS7181-500ml | Di-iso-propylethylamine, GlenBiol™, suitable for molecular biology | 7087-68-5 | 500ml |
| GS9122-100ml | Di-iso-propylethylamine, GlenDry™, anhydrous | 7087-68-5 | 100ml |
| GS9122-500ml | Di-iso-propylethylamine, GlenDry™, anhydrous | 7087-68-5 | 500ml |
| GK7879-25g | Di-p-toluoyl-L-tartaric acid | 32634-66-5 | 25g |
| GK7879-100g | Di-p-toluoyl-L-tartaric acid | 32634-66-5 | 100g |
| GK7879-250g | Di-p-toluoyl-L-tartaric acid | 32634-66-5 | 250g |
| GE6381-250g | di-Potassium hydrogen phosphate trihydrate | 16788-57-1 | 250g |
| GE6381-500g | di-Potassium hydrogen phosphate trihydrate | 16788-57-1 | 500g |
| GE6381-1kg | di-Potassium hydrogen phosphate trihydrate | 16788-57-1 | 1kg |
| GB6304-1l | di-Potassium hydrogen phosphate, 1M solution | 7758-11-4 | 1l |
| GB6304-2500ml | di-Potassium hydrogen phosphate, 1M solution | 7758-11-4 | 2500ml |
| GK8010-100g | di-Potassium hydrogen phosphate, anhydrous | 7758-11-4 | 100g |
| GK8010-250g | di-Potassium hydrogen phosphate, anhydrous | 7758-11-4 | 250g |
| GK8010-500g | di-Potassium hydrogen phosphate, anhydrous | 7758-11-4 | 500g |
| GK8010-1kg | di-Potassium hydrogen phosphate, anhydrous | 7758-11-4 | 1kg |
| GK8010-5kg | di-Potassium hydrogen phosphate, anhydrous | 7758-11-4 | 5kg |
| GX5630-1kg | di-Potassium hydrogen phosphate, anhydrous, ACS grade | 7758-11-4 | 1kg |
| GX5630-5kg | di-Potassium hydrogen phosphate, anhydrous, ACS grade | 7758-11-4 | 5kg |
| GK7412-1kg | di-Potassium hydrogen phosphate, anhydrous, Ph. Eur. grade | 7758-11-4 | 1kg |
| GB0899-500g | di-Sodium hydrogen phosphate anhydrous, EP, USP grade | 7558-79-4 | 500g |
| GB0899-1kg | di-Sodium hydrogen phosphate anhydrous, EP, USP grade | 7558-79-4 | 1kg |
| GB0899-5kg | di-Sodium hydrogen phosphate anhydrous, EP, USP grade | 7558-79-4 | 5kg |
| GK8671-100g | di-Sodium hydrogen phosphate dihydrate, Ph. Eur., USP grade | 10028-24-7 | 100g |
| GK8671-250g | di-Sodium hydrogen phosphate dihydrate, Ph. Eur., USP grade | 10028-24-7 | 250g |
| GK8671-500g | di-Sodium hydrogen phosphate dihydrate, Ph. Eur., USP grade | 10028-24-7 | 500g |
| GK8671-1kg | di-Sodium hydrogen phosphate dihydrate, Ph. Eur., USP grade | 10028-24-7 | 1kg |
| GK8671-5kg | di-Sodium hydrogen phosphate dihydrate, Ph. Eur., USP grade | 10028-24-7 | 5kg |
| GK0517-250g | di-Sodium hydrogen phosphate dodecahydrate, 99%, Ph. Eur., USP grade | 10039-32-4 | 250g |
| GK0517-1kg | di-Sodium hydrogen phosphate dodecahydrate, 99%, Ph. Eur., USP grade | 10039-32-4 | 1kg |
| GK0517-5kg | di-Sodium hydrogen phosphate dodecahydrate, 99%, Ph. Eur., USP grade | 10039-32-4 | 5kg |
| GK3179-100g | di-Sodium hydrogen phosphate, anhydrous | 7558-79-4 | 100g |
| GK3179-250g | di-Sodium hydrogen phosphate, anhydrous | 7558-79-4 | 250g |
| GK3179-500g | di-Sodium hydrogen phosphate, anhydrous | 7558-79-4 | 500g |
| GK3179-1kg | di-Sodium hydrogen phosphate, anhydrous | 7558-79-4 | 1kg |
| GK3179-5kg | di-Sodium hydrogen phosphate, anhydrous | 7558-79-4 | 5kg |
| GE4403-25g | Di-tert-butyl dicarbonate | 24424-99-5 | 25g |
| GE4403-100g | Di-tert-butyl dicarbonate | 24424-99-5 | 100g |
| GE4403-250g | Di-tert-butyl dicarbonate | 24424-99-5 | 250g |
| GE4403-500g | Di-tert-butyl dicarbonate | 24424-99-5 | 500g |
| GW1040-5ml | Di-tert-butylcyclopentadiene | 73046-16-9 | 5ml |
| GW1040-25ml | Di-tert-butylcyclopentadiene | 73046-16-9 | 25ml |
| GX5999-1g | Di-u-chloro bis[chloro(cyclohexene) platinum(II)], 99.95% (metals basis) | 12176-53-3 | 1g |
| GX5999-5g | Di-u-chloro bis[chloro(cyclohexene) platinum(II)], 99.95% (metals basis) | 12176-53-3 | 5g |
| GL2663-500ug | Diastovaricin I | 102281-52-7 | 500ug |
| GL2663-1mg | Diastovaricin I | 102281-52-7 | 1mg |
| GL2663-5mg | Diastovaricin I | 102281-52-7 | 5mg |
| GP5034-25g | Diatrizoic acid dihydrate | 50978-11-5 | 25g |
| GP5034-100g | Diatrizoic acid dihydrate | 50978-11-5 | 100g |
| GL3756-10g | Diatrizoic acid dihydrate, USP grade | 50978-11-5 | 10g |
| GW2095-200mg | DIB-Cl | 162756-62-9 | 200mg |
| GW2095-1g | DIB-Cl | 162756-62-9 | 1g |
| GA4403-10mg | Dibekacin sulfate | 58580-55-5 | 10mg |
| GK5381-5g | Dibenzothiophene | 132-65-0 | 5g |
| GK5381-25g | Dibenzothiophene | 132-65-0 | 25g |
| GX8535-1g | Dibenzyl phosphate | 1623-08-1 | 1g |
| GX8535-5g | Dibenzyl phosphate | 1623-08-1 | 5g |
| GX8535-25g | Dibenzyl phosphate | 1623-08-1 | 25g |
| GW7767-100mg | Dibenzylfluorescein | 97744-44-0 | 100mg |
| GW7767-500mg | Dibenzylfluorescein | 97744-44-0 | 500mg |
| GW2933-1g | Dibucaine hydrochloride | 61-12-1 | 1g |
| GW2933-5g | Dibucaine hydrochloride | 61-12-1 | 5g |
| GW2933-25g | Dibucaine hydrochloride | 61-12-1 | 25g |
| GX4306-50g | Dibutyltin diacetate | 1067-33-0 | 50g |
| GX3063-250g | Dibutyltin dichloride, 98% | 683-18-1 | 250g |
| GK8171-250mg | Dicamba | 1918-00-9 | 250mg |
| GK8171-1g | Dicamba | 1918-00-9 | 1g |
| GX0614-2g | Dichloro (cycloocta-1,5-dienyl) palladium(II); 99.95% (metals basis) | 12107-56-1 | 2g |
| GX0614-10g | Dichloro (cycloocta-1,5-dienyl) palladium(II); 99.95% (metals basis) | 12107-56-1 | 10g |
| GX3739-1g | Dichloro (cycloocta-1,5-dienyl) ruthenium(II) polymer | 50982-12-2 | 1g |
| GX3739-5g | Dichloro (cycloocta-1,5-dienyl) ruthenium(II) polymer | 50982-12-2 | 5g |
| GX6600-1g | Dichloro(cycloocta-1,5-dienyl) platinum(II); 99.95% (metals basis) | 12080-32-9 | 1g |
| GX6600-5g | Dichloro(cycloocta-1,5-dienyl) platinum(II); 99.95% (metals basis) | 12080-32-9 | 5g |
| GX3273-1g | Dichloro[1,1''-ferrocenylbis(diphenylphosphine)]palladium(II)dichloromethane adduct | 95464-05-4 | 1g |
| GX3273-5g | Dichloro[1,1''-ferrocenylbis(diphenylphosphine)]palladium(II)dichloromethane adduct | 95464-05-4 | 5g |
| GE0235-10g | Dichloroacetic acid sodium salt | 2156-56-1 | 10g |
| GE0235-50g | Dichloroacetic acid sodium salt | 2156-56-1 | 50g |
| GE0235-100g | Dichloroacetic acid sodium salt | 2156-56-1 | 100g |
| GX7724-1g | Dichlorobis(acetonitrile) palladium(II); 99% | 14592-56-4 | 1g |
| GX4755-1g | Dichlorobis(benzonitrile) palladium(II) | 14220-64-5 | 1g |
| GX2546-1g | Dichlorodiammine palladium(II); 99.95% (metals basis) | 14323-43-4 | 1g |
| GK1713-25g | Dichloroisocyanuric acid sodium salt | 2893-78-9 | 25g |
| GK1784-50g | Dichloroisocyanuric acid sodium salt dihydrate | 51580-86-0 | 50g |
| GK1784-100g | Dichloroisocyanuric acid sodium salt dihydrate | 51580-86-0 | 100g |
| GK1784-250g | Dichloroisocyanuric acid sodium salt dihydrate | 51580-86-0 | 250g |
| GK1784-500g | Dichloroisocyanuric acid sodium salt dihydrate | 51580-86-0 | 500g |
| GK1784-1kg | Dichloroisocyanuric acid sodium salt dihydrate | 51580-86-0 | 1kg |
| GK9913-500ml | Dichloromethane | 75-09-2 | 500ml |
| GK9913-1l | Dichloromethane | 75-09-2 | 1l |
| GK9913-2500ml | Dichloromethane | 75-09-2 | 2500ml |
| GS0032-1l | Dichloromethane, GlenBiol™, suitable for molecular biology stabilised with amylene | 75-09-2 | 1l |
| GS0032-2500ml | Dichloromethane, GlenBiol™, suitable for molecular biology stabilised with amylene | 75-09-2 | 2500ml |
| GS3987-100ml | Dichloromethane, GlenDry™, anhydrous stabilised with amylene | 75-09-2 | 100ml |
| GS3987-500ml | Dichloromethane, GlenDry™, anhydrous stabilised with amylene | 75-09-2 | 500ml |
| GS3987-1l | Dichloromethane, GlenDry™, anhydrous stabilised with amylene | 75-09-2 | 1l |
| GS3987-2500ml | Dichloromethane, GlenDry™, anhydrous stabilised with amylene | 75-09-2 | 2500ml |
| GS5271-100ml | Dichloromethane, GlenDry™, anhydrous stabilised with amylene extra dry | 75-09-2 | 100ml |
| GS5271-500ml | Dichloromethane, GlenDry™, anhydrous stabilised with amylene extra dry | 75-09-2 | 500ml |
| GS5271-1l | Dichloromethane, GlenDry™, anhydrous stabilised with amylene extra dry | 75-09-2 | 1l |
| GS5271-2500ml | Dichloromethane, GlenDry™, anhydrous stabilised with amylene extra dry | 75-09-2 | 2500ml |
| GS0168-100ml | Dichloromethane, GlenDry™, anhydrous stabilised with amylene over molecular sieve | 75-09-2 | 100ml |
| GS0168-500ml | Dichloromethane, GlenDry™, anhydrous stabilised with amylene over molecular sieve | 75-09-2 | 500ml |
| GS0168-1l | Dichloromethane, GlenDry™, anhydrous stabilised with amylene over molecular sieve | 75-09-2 | 1l |
| GS0168-2500ml | Dichloromethane, GlenDry™, anhydrous stabilised with amylene over molecular sieve | 75-09-2 | 2500ml |
| GS2852-500ml | Dichloromethane, GlenPure™, analytical grade stabilised with amylene | 75-09-2 | 500ml |
| GS2852-1l | Dichloromethane, GlenPure™, analytical grade stabilised with amylene | 75-09-2 | 1l |
| GS2852-2500ml | Dichloromethane, GlenPure™, analytical grade stabilised with amylene | 75-09-2 | 2500ml |
| GS0199-2500ml | Dichloromethane, GlenUltra™, analytical grade, stabilised with amylene, for LC | 75-09-2 | 2500ml |
| GS9127-2500ml | Dichloromethane, GlenUltra™, analytical grade, stabilised with cyclohexene/amylene, for GC | 75-09-2 | 2500ml |
| GP6995-25g | Diclazuril | 101831-37-2 | 25g |
| GC8579-1mg | Diclofenac acyl-D-glucuronide | 64118-81-6 | 1mg |
| GC8579-2mg | Diclofenac acyl-D-glucuronide | 64118-81-6 | 2mg |
| GC8579-5mg | Diclofenac acyl-D-glucuronide | 64118-81-6 | 5mg |
| GC8579-10mg | Diclofenac acyl-D-glucuronide | 64118-81-6 | 10mg |
| GX9078-250mg | Diclofenac potassium salt | 15307-81-0 | 250mg |
| GX9078-1g | Diclofenac potassium salt | 15307-81-0 | 1g |
| GX9078-5g | Diclofenac potassium salt | 15307-81-0 | 5g |
| GP9539-5g | Diclofenac sodium salt | 15307-79-6 | 5g |
| GP9539-25g | Diclofenac sodium salt | 15307-79-6 | 25g |
| GX8255-25g | Diclofenac, free acid | 15307-86-5 | 25g |
| GW7731-50mg | Diclofop | 40843-25-2 | 50mg |
| GW7731-250mg | Diclofop | 40843-25-2 | 250mg |
| GW6887-500mg | Diclofop-methyl | 51338-27-3 | 500mg |
| GW6887-1g | Diclofop-methyl | 51338-27-3 | 1g |
| GA0338-1g | Dicloxacillin sodium salt monohydrate | 13412-64-1 | 1g |
| GA0338-5g | Dicloxacillin sodium salt monohydrate | 13412-64-1 | 5g |
| GK1149-100g | Dicyandiamide | 461-58-5 | 100g |
| GP9351-25mg | Didanosine | 69655-05-6 | 25mg |
| GP9351-100mg | Didanosine | 69655-05-6 | 100mg |
| GP9351-250mg | Didanosine | 69655-05-6 | 250mg |
| GP9351-500mg | Didanosine | 69655-05-6 | 500mg |
| GK7231-5g | Didecyldimethylammonium chloride | 7173-51-5 | 5g |
| GK0001-500ml | Didecyldimethylammonium chloride, 50% solution | 7173-51-5 | 500ml |
| GK0001-1l | Didecyldimethylammonium chloride, 50% solution | 7173-51-5 | 1l |
| GX5162-10mg | Dienogest | 65928-58-7 | 10mg |
| GX5162-50mg | Dienogest | 65928-58-7 | 50mg |
| GK1823-25g | Diethanolamine | 111-42-2 | 25g |
| GK1823-100g | Diethanolamine | 111-42-2 | 100g |
| GK1823-500g | Diethanolamine | 111-42-2 | 500g |
| GK1823-1kg | Diethanolamine | 111-42-2 | 1kg |
| GK1823-5kg | Diethanolamine | 111-42-2 | 5kg |
| GS6907-100ml | Diethyl Ether, GlenDry™, anhydrous stabilised with BHT | 60-29-7 | 100ml |
| GS6907-500ml | Diethyl Ether, GlenDry™, anhydrous stabilised with BHT | 60-29-7 | 500ml |
| GS6907-1l | Diethyl Ether, GlenDry™, anhydrous stabilised with BHT | 60-29-7 | 1l |
| GS6907-2500ml | Diethyl Ether, GlenDry™, anhydrous stabilised with BHT | 60-29-7 | 2500ml |
| GS5963-100ml | Diethyl Ether, GlenDry™, anhydrous stabilised with BHT over molecular sieve | 60-29-7 | 100ml |
| GS5963-500ml | Diethyl Ether, GlenDry™, anhydrous stabilised with BHT over molecular sieve | 60-29-7 | 500ml |
| GS5963-1l | Diethyl Ether, GlenDry™, anhydrous stabilised with BHT over molecular sieve | 60-29-7 | 1l |
| GS5963-2500ml | Diethyl Ether, GlenDry™, anhydrous stabilised with BHT over molecular sieve | 60-29-7 | 2500ml |
| GS1781-100ml | Diethyl Ether, GlenDry™, anhydrous stabilised with ethanol | 60-29-7 | 100ml |
| GS1781-500ml | Diethyl Ether, GlenDry™, anhydrous stabilised with ethanol | 60-29-7 | 500ml |
| GS1781-1l | Diethyl Ether, GlenDry™, anhydrous stabilised with ethanol | 60-29-7 | 1l |
| GS1781-2500ml | Diethyl Ether, GlenDry™, anhydrous stabilised with ethanol | 60-29-7 | 2500ml |
| GS8536-100ml | Diethyl Ether, GlenDry™, anhydrous stabilised with ethanol over molecular sieve | 60-29-7 | 100ml |
| GS8536-500ml | Diethyl Ether, GlenDry™, anhydrous stabilised with ethanol over molecular sieve | 60-29-7 | 500ml |
| GS8536-1l | Diethyl Ether, GlenDry™, anhydrous stabilised with ethanol over molecular sieve | 60-29-7 | 1l |
| GS8536-2500ml | Diethyl Ether, GlenDry™, anhydrous stabilised with ethanol over molecular sieve | 60-29-7 | 2500ml |
| GS4017-500ml | Diethyl Ether, GlenPure™, analytical grade stabilised with BHT | 60-29-7 | 500ml |
| GS4017-1l | Diethyl Ether, GlenPure™, analytical grade stabilised with BHT | 60-29-7 | 1l |
| GS4017-2500ml | Diethyl Ether, GlenPure™, analytical grade stabilised with BHT | 60-29-7 | 2500ml |
| GS7637-500ml | Diethyl Ether, GlenPure™, analytical grade stabilised with copper | 60-29-7 | 500ml |
| GS7637-1l | Diethyl Ether, GlenPure™, analytical grade stabilised with copper | 60-29-7 | 1l |
| GS7637-2500ml | Diethyl Ether, GlenPure™, analytical grade stabilised with copper | 60-29-7 | 2500ml |
| GS4510-500ml | Diethyl Ether, GlenPure™, analytical grade stabilised with ethanol | 60-29-7 | 500ml |
| GS4510-1l | Diethyl Ether, GlenPure™, analytical grade stabilised with ethanol | 60-29-7 | 1l |
| GS4510-2500ml | Diethyl Ether, GlenPure™, analytical grade stabilised with ethanol | 60-29-7 | 2500ml |
| GE8191-5g | Diethyl pyrocarbonate | 1609-47-8 | 5g |
| GE8191-25g | Diethyl pyrocarbonate | 1609-47-8 | 25g |
| GE8191-50g | Diethyl pyrocarbonate | 1609-47-8 | 50g |
| GE8191-100g | Diethyl pyrocarbonate | 1609-47-8 | 100g |
| GK1276-100g | Diethyl succinate | 123-25-1 | 100g |
| GK1276-1kg | Diethyl succinate | 123-25-1 | 1kg |
| GK3170-100ml | Diethylamine | 109-89-7 | 100ml |
| GK2667-100ml | Diethylene glycol | 111-46-6 | 100ml |
| GK5457-25g | Diethylene glycol monoethyl ether, 99% | 111-90-0 | 25g |
| GK5457-100g | Diethylene glycol monoethyl ether, 99% | 111-90-0 | 100g |
| GK8265-100g | Diethylenetriamine pentaacetic acid | 67-43-6 | 100g |
| GK8265-250g | Diethylenetriamine pentaacetic acid | 67-43-6 | 250g |
| GK8265-500g | Diethylenetriamine pentaacetic acid | 67-43-6 | 500g |
| GK8265-1kg | Diethylenetriamine pentaacetic acid | 67-43-6 | 1kg |
| GA2223-250mg | Difenoconazole | 119446-68-3 | 250mg |
| GE3953-1l | Differentiation Solution for Regressive Staining | 1l | |
| GL5210-500ug | Differolide | 106750-00-9 | 500ug |
| GL5210-1mg | Differolide | 106750-00-9 | 1mg |
| GA5618-100mg | Difloxacin hydrochloride | 91296-86-5 | 100mg |
| GA5618-1g | Difloxacin hydrochloride | 91296-86-5 | 1g |
| GX3395-1g | Diflufenican | 83164-33-4 | 1g |
| GX3395-5g | Diflufenican | 83164-33-4 | 5g |
| GL2053-5g | Diflunisal | 22494-42-4 | 5g |
| GC2602-1mg | Diflunisal acyl-β-D-glucuronide | 58446-30-3 | 1mg |
| GC2602-2mg | Diflunisal acyl-β-D-glucuronide | 58446-30-3 | 2mg |
| GC2602-5mg | Diflunisal acyl-β-D-glucuronide | 58446-30-3 | 5mg |
| GC2602-10mg | Diflunisal acyl-β-D-glucuronide | 58446-30-3 | 10mg |
| GW1953-2500mg | Difluoromethyl phenyl sulfone | 1535-65-5 | 2500mg |
| GW1953-10g | Difluoromethyl phenyl sulfone | 1535-65-5 | 10g |
| GC6858-1mg | Digeneaside, sodium salt | 68005-65-2 | 1mg |
| GC6858-2mg | Digeneaside, sodium salt | 68005-65-2 | 2mg |
| GC6858-5mg | Digeneaside, sodium salt | 68005-65-2 | 5mg |
| GC6858-10mg | Digeneaside, sodium salt | 68005-65-2 | 10mg |
| GC6858-25mg | Digeneaside, sodium salt | 68005-65-2 | 25mg |
| GC7189-100mg | Digitonin | 11024-24-1 | 100mg |
| GC7189-500mg | Digitonin | 11024-24-1 | 500mg |
| GC7189-1g | Digitonin | 11024-24-1 | 1g |
| GC1807-100mg | Digoxin | 20830-75-5 | 100mg |
| GC1807-500mg | Digoxin | 20830-75-5 | 500mg |
| GC1807-1g | Digoxin | 20830-75-5 | 1g |
| GC1807-5g | Digoxin | 20830-75-5 | 5g |
| GP1911-25mg | Dihydralazine sulfate | 7327-87-9 | 25mg |
| GP1911-100mg | Dihydralazine sulfate | 7327-87-9 | 100mg |
| GW6730-1mg | Dihydro-beta-naphthocyclinone | 85425-18-9 | 1mg |
| GY7819-50mg | Dihydroartemisinin | 71939-50-9 | 50mg |
| GY7819-250mg | Dihydroartemisinin | 71939-50-9 | 250mg |
| GP2727-1g | Dihydroartemisinin | 131175-87-6 | 1g |
| GY7819-1g | Dihydroartemisinin | 71939-50-9 | 1g |
| GC9321-1mg | Dihydroartemisinin O-β-D-glucuronide | 198976-06-6 | 1mg |
| GC9321-2mg | Dihydroartemisinin O-β-D-glucuronide | 198976-06-6 | 2mg |
| GC9321-5mg | Dihydroartemisinin O-β-D-glucuronide | 198976-06-6 | 5mg |
| GC9321-10mg | Dihydroartemisinin O-β-D-glucuronide | 198976-06-6 | 10mg |
| GK0514-5mg | Dihydrocapsaicin | 19408-84-5 | 5mg |
| GK0514-25mg | Dihydrocapsaicin | 19408-84-5 | 25mg |
| GW6716-10mg | Dihydrocapsiate | 205687-03-2 | 10mg |
| GW6716-100mg | Dihydrocapsiate | 205687-03-2 | 100mg |
| GW5990-250ug | Dihydrochlamydocin | 157618-75-2 | 250ug |
| GW5990-1mg | Dihydrochlamydocin | 157618-75-2 | 1mg |
| GP0119-100mg | Dihydroergotoxine mesylate | 8067-24-1 | 100mg |
| GK8945-10mg | Dihydroethidium | 104821-25-2 | 10mg |
| GK8945-25mg | Dihydroethidium | 104821-25-2 | 25mg |
| GK8945-100mg | Dihydroethidium | 104821-25-2 | 100mg |
| GW1298-1g | Dihydrofluorescein diacetate | 35340-49-9 | 1g |
| GW1298-10g | Dihydrofluorescein diacetate | 35340-49-9 | 10g |
| GX0885-1g | Dihydrogen hexabromoplatinate(IV) hydrate | 20596-34-3 | 1g |
| GX0885-5g | Dihydrogen hexabromoplatinate(IV) hydrate | 20596-34-3 | 5g |
| GX7672-1g | Dihydrogen hexachloroplatinate(IV); solution | 16941-12-1 | 1g |
| GX7672-5g | Dihydrogen hexachloroplatinate(IV); solution | 16941-12-1 | 5g |
| GX7672-25g | Dihydrogen hexachloroplatinate(IV); solution | 16941-12-1 | 25g |
| GX9297-1g | Dihydrogen hexachloroplatinate(lV) hydrate, 99.95% (metals basis) | 26023-84-7 | 1g |
| GX9297-5g | Dihydrogen hexachloroplatinate(lV) hydrate, 99.95% (metals basis) | 26023-84-7 | 5g |
| GX5103-1g | Dihydrogen hexahydroxyplatinate(lV); 99.95% (metals basis) | 51850-20-5 | 1g |
| GX5103-5g | Dihydrogen hexahydroxyplatinate(lV); 99.95% (metals basis) | 51850-20-5 | 5g |
| GX2846-1g | Dihydrogenhexachloroiridate(IV); solution | 16941-92-7 | 1g |
| GX2846-5g | Dihydrogenhexachloroiridate(IV); solution | 16941-92-7 | 5g |
| GL0334-1mg | Dihydromanumycin A | 1mg | |
| GY5058-5mg | Dihydromyricetin | 27200-12-0 | 5mg |
| GY5058-25mg | Dihydromyricetin | 27200-12-0 | 25mg |
| GK1010-5mg | Dihydroproscar | 98319-24-5 | 5mg |
| GK1010-25mg | Dihydroproscar | 98319-24-5 | 25mg |
| GK1010-100mg | Dihydroproscar | 98319-24-5 | 100mg |
| GT4594-2mg | Dihydrorhodamine 123 | 109244-58-8 | 2mg |
| GT4594-10mg | Dihydrorhodamine 123 | 109244-58-8 | 10mg |
| GT4594-125mg | Dihydrorhodamine 123 | 109244-58-8 | 125mg |
| GA8949-5g | Dihydrostreptomycin sesquisulfate | 5490-27-7 | 5g |
| GA8949-25g | Dihydrostreptomycin sesquisulfate | 5490-27-7 | 25g |
| GA8949-100g | Dihydrostreptomycin sesquisulfate | 5490-27-7 | 100g |
| GW4271-50mg | Dihydroxy-MEID | 730963-39-0 | 50mg |
| GW4271-100mg | Dihydroxy-MEID | 730963-39-0 | 100mg |
| GX7746-1l | Diisoheptyl phthalate | 71888-89-6 | 1l |
| GK5790-5g | Diisopropyl azodicarboxylate | 2446-83-5 | 5g |
| GX0839-100ml | Diisopropyl ether, 99%, stabilised | 108-20-3 | 100ml |
| GX0839-1l | Diisopropyl ether, 99%, stabilised | 108-20-3 | 1l |
| GP7645-25mg | Diloxanide furoate | 3736-81-0 | 25mg |
| GP7645-100mg | Diloxanide furoate | 3736-81-0 | 100mg |
| GP7645-250mg | Diloxanide furoate | 3736-81-0 | 250mg |
| GP1599-1g | Diltiazem hydrochloride | 33286-22-5 | 1g |
| GP1599-5g | Diltiazem hydrochloride | 33286-22-5 | 5g |
| GP1599-10g | Diltiazem hydrochloride | 33286-22-5 | 10g |
| GP1599-25g | Diltiazem hydrochloride | 33286-22-5 | 25g |
| GE2418-25g | Dimedone | 126-81-8 | 25g |
| GE2418-100g | Dimedone | 126-81-8 | 100g |
| GP7751-25g | Dimenhydrinate | 523-87-5 | 25g |
| GL3644-100ml | Dimethyl disulfide | 624-92-0 | 100ml |
| GK0623-500g | Dimethyl fumarate | 624-49-7 | 500g |
| GX0667-5g | Dimethyl germanium dichloride | 1529-48-2 | 5g |
| GX0455-25g | Dimethyl phthalate | 131-11-3 | 25g |
| GL9563-500ml | Dimethyl sulfide | 75-18-3 | 500ml |
| GX8036-25g | Dimethyl sulfone | 67-71-0 | 25g |
| GK2245-100ml | Dimethyl sulfoxide | 67-68-5 | 100ml |
| GK2245-500ml | Dimethyl sulfoxide | 67-68-5 | 500ml |
| GK2245-1l | Dimethyl sulfoxide | 67-68-5 | 1l |
| GK2245-5l | Dimethyl sulfoxide | 67-68-5 | 5l |
| GW3058-100ml | Dimethyl sulfoxide, Ph. Eur., USP grade | 67-68-5 | 100ml |
| GW3058-1l | Dimethyl sulfoxide, Ph. Eur., USP grade | 67-68-5 | 1l |
| GT5992-25g | Dimethyl Yellow (C.I. 11020) | 60-11-7 | 25g |
| GT5992-100g | Dimethyl Yellow (C.I. 11020) | 60-11-7 | 100g |
| GT5992-500g | Dimethyl Yellow (C.I. 11020) | 60-11-7 | 500g |
| GS8952-100ml | Dimethylacetamide, GlenDry™, anhydrous | 127-19-5 | 100ml |
| GS8952-500ml | Dimethylacetamide, GlenDry™, anhydrous | 127-19-5 | 500ml |
| GS8952-1l | Dimethylacetamide, GlenDry™, anhydrous | 127-19-5 | 1l |
| GS8952-2500ml | Dimethylacetamide, GlenDry™, anhydrous | 127-19-5 | 2500ml |
| GS5607-500ml | Dimethylacetamide, GlenPure™, analytical grade | 127-19-5 | 500ml |
| GS5607-1l | Dimethylacetamide, GlenPure™, analytical grade | 127-19-5 | 1l |
| GS5607-2500ml | Dimethylacetamide, GlenPure™, analytical grade | 127-19-5 | 2500ml |
| GK9552-1g | Dimethylethylammoniumpropane sulfonate | 160255-06-1 | 1g |
| GS6580-2500ml | Dimethylformamide, GlenBiol™, suitable for molecular biology | 68-12-2 | 2500ml |
| GS3406-2500ml | Dimethylformamide, GlenBiol™, suitable for molecular biology with molecular sieve | 68-12-2 | 2500ml |
| GS4658-100ml | Dimethylformamide, GlenDry™, anhydrous over molecular sieve | 68-12-2 | 100ml |
| GS4658-500ml | Dimethylformamide, GlenDry™, anhydrous over molecular sieve | 68-12-2 | 500ml |
| GS4658-1l | Dimethylformamide, GlenDry™, anhydrous over molecular sieve | 68-12-2 | 1l |
| GS4658-2500ml | Dimethylformamide, GlenDry™, anhydrous over molecular sieve | 68-12-2 | 2500ml |
| GS8409-500ml | Dimethylformamide, GlenPure™, analytical grade | 68-12-2 | 500ml |
| GS8409-1l | Dimethylformamide, GlenPure™, analytical grade | 68-12-2 | 1l |
| GS8409-2500ml | Dimethylformamide, GlenPure™, analytical grade | 68-12-2 | 2500ml |
| GE1844-25g | Dimethylglyoxime | 95-45-4 | 25g |
| GE1844-100g | Dimethylglyoxime | 95-45-4 | 100g |
| GE1844-250g | Dimethylglyoxime | 95-45-4 | 250g |
| GE1844-500g | Dimethylglyoxime | 95-45-4 | 500g |
| GK3403-25g | Dimethylglyoxime disodium salt | 75006-64-3 | 25g |
| GK3403-100g | Dimethylglyoxime disodium salt | 75006-64-3 | 100g |
| GK3403-250g | Dimethylglyoxime disodium salt | 75006-64-3 | 250g |
| GW0892-5g | Dimethylindodicarbocyanine | 54268-70-1 | 5g |
| GW6008-100mg | Dimethylsulfoniopropionate . HCl | 4337-33-1 | 100mg |
| GW1571-50mg | Dimethylvinphos | 2274-67-1 | 50mg |
| GW1571-250mg | Dimethylvinphos | 2274-67-1 | 250mg |
| GA4721-25g | Dimetridazole | 551-92-8 | 25g |
| GA4721-100g | Dimetridazole | 551-92-8 | 100g |
| GA4721-250g | Dimetridazole | 551-92-8 | 250g |
| GT2471-250mg | Dimidium bromide | 518-67-2 | 250mg |
| GT2471-1g | Dimidium bromide | 518-67-2 | 1g |
| GT2471-5g | Dimidium bromide | 518-67-2 | 5g |
| GT1911-250mg | Dimidium bromide, 95% | 518-67-2 | 250mg |
| GT1911-1g | Dimidium bromide, 95% | 518-67-2 | 1g |
| GT1911-5g | Dimidium bromide, 95% | 518-67-2 | 5g |
| GA5509-1g | Diminazene diaceturate | 908-54-3 | 1g |
| GA5509-5g | Diminazene diaceturate | 908-54-3 | 5g |
| GA5509-25g | Diminazene diaceturate | 908-54-3 | 25g |
| GP6244-10mg | Dinoprost tromethamine | 38562-01-5 | 10mg |
| GW5174-100mg | Dinotefuran | 165252-70-0 | 100mg |
| GW5174-1g | Dinotefuran | 165252-70-0 | 1g |
| GK2341-25g | Dioctyl sulfosuccinate sodium salt | 577-11-7 | 25g |
| GX3368-100g | Dioctyltin oxide, 97+% | 870-08-6 | 100g |
| GC9259-25mg | Dioscin | 19057-60-4 | 25mg |
| GP5659-1g | Diosgenin | 512-04-9 | 1g |
| GP5659-5g | Diosgenin | 512-04-9 | 5g |
| GP5659-10g | Diosgenin | 512-04-9 | 10g |
| GC1309-1mg | Diosmetin 3''-O-β-D-glucuronide | 152503-50-9 | 1mg |
| GC1309-2mg | Diosmetin 3''-O-β-D-glucuronide | 152503-50-9 | 2mg |
| GC1309-5mg | Diosmetin 3''-O-β-D-glucuronide | 152503-50-9 | 5mg |
| GC1309-10mg | Diosmetin 3''-O-β-D-glucuronide | 152503-50-9 | 10mg |
| GC2826-1mg | Diosmetin 3'',7-di-O-β-D-glucuronide | 152503-51-0 | 1mg |
| GC2826-2mg | Diosmetin 3'',7-di-O-β-D-glucuronide | 152503-51-0 | 2mg |
| GC2826-5mg | Diosmetin 3'',7-di-O-β-D-glucuronide | 152503-51-0 | 5mg |
| GC2826-10mg | Diosmetin 3'',7-di-O-β-D-glucuronide | 152503-51-0 | 10mg |
| GY4535-5mg | Diosmetin 7-O-β-D-glucuronide | 35110-20-4 | 5mg |
| GY4535-10mg | Diosmetin 7-O-β-D-glucuronide | 35110-20-4 | 10mg |
| GY4535-25mg | Diosmetin 7-O-β-D-glucuronide | 35110-20-4 | 25mg |
| GY4535-50mg | Diosmetin 7-O-β-D-glucuronide | 35110-20-4 | 50mg |
| GC4611-5g | Diosmin | 520-27-4 | 5g |
| GC4611-10g | Diosmin | 520-27-4 | 10g |
| GC4611-25g | Diosmin | 520-27-4 | 25g |
| GP7830-25g | Diphenhydramine hydrochloride | 147-24-0 | 25g |
| GP7830-100g | Diphenhydramine hydrochloride | 147-24-0 | 100g |
| GK5426-25g | Diphenyl ether | 101-84-8 | 25g |
| GT3395-25g | Diphenylamine | 122-39-4 | 25g |
| GT3395-100g | Diphenylamine | 122-39-4 | 100g |
| GT3395-250g | Diphenylamine | 122-39-4 | 250g |
| GT3395-500g | Diphenylamine | 122-39-4 | 500g |
| GT3395-1kg | Diphenylamine | 122-39-4 | 1kg |
| GK6653-5g | Diphenylamine-4-sulfonic acid sodium salt | 6152-67-6 | 5g |
| GK6653-25g | Diphenylamine-4-sulfonic acid sodium salt | 6152-67-6 | 25g |
| GX4696-5g | Diphenylcarbazone | 538-62-5 | 5g |
| GX4696-25g | Diphenylcarbazone | 538-62-5 | 25g |
| GW1913-5g | Diphenyliodonium hexafluorophosphate | 58109-40-3 | 5g |
| GW1913-25g | Diphenyliodonium hexafluorophosphate | 58109-40-3 | 25g |
| GW9227-5g | Diphenyliodonium triflate | 66003-76-7 | 5g |
| GD3668-25g | Dipropylene glycol | 25265-71-8 | 25g |
| GD3668-100g | Dipropylene glycol | 25265-71-8 | 100g |
| GD3668-250g | Dipropylene glycol | 25265-71-8 | 250g |
| GK6793-500ml | Dipropylene glycol monomethyl ether | 34590-94-8 | 500ml |
| GK6793-1l | Dipropylene glycol monomethyl ether | 34590-94-8 | 1l |
| GB6832-25g | DIPSO | 68399-80-4 | 25g |
| GB6832-100g | DIPSO | 68399-80-4 | 100g |
| GB6832-250g | DIPSO | 68399-80-4 | 250g |
| GB6832-500g | DIPSO | 68399-80-4 | 500g |
| GB8985-25g | DIPSO sodium salt | 102783-62-0 | 25g |
| GB8985-100g | DIPSO sodium salt | 102783-62-0 | 100g |
| GB8985-250g | DIPSO sodium salt | 102783-62-0 | 250g |
| GK9666-5g | Dipyridamole | 58-32-2 | 5g |
| GK9666-10g | Dipyridamole | 58-32-2 | 10g |
| GK9666-25g | Dipyridamole | 58-32-2 | 25g |
| GT1078-5g | Direct Red 80 (C.I. 35780) | 2610-10-8 | 5g |
| GT1078-25g | Direct Red 80 (C.I. 35780) | 2610-10-8 | 25g |
| GT1078-100g | Direct Red 80 (C.I. 35780) | 2610-10-8 | 100g |
| GT5274-25g | Direct Yellow 50 (C.I. 29025) | 3214-47-9 | 25g |
| GT5274-100g | Direct Yellow 50 (C.I. 29025) | 3214-47-9 | 100g |
| GA7887-25mg | Dirithromycin | 62013-04-1 | 25mg |
| GA7887-1g | Dirithromycin | 62013-04-1 | 1g |
| GK8134-100g | Disodium hydrogen citrate sesquihydrate | 6132-05-4 | 100g |
| GK8134-250g | Disodium hydrogen citrate sesquihydrate | 6132-05-4 | 250g |
| GK8134-500g | Disodium hydrogen citrate sesquihydrate | 6132-05-4 | 500g |
| GK8134-1kg | Disodium hydrogen citrate sesquihydrate | 6132-05-4 | 1kg |
| GK9860-1kg | Disodium hydrogen phosphate heptahydrate, USP grade | 7782-85-6 | 1kg |
| GE2883-100mg | Disopyramide | 3737-09-5 | 100mg |
| GT6746-25g | Disperse Blue 14 | 2475-44-7 | 25g |
| GX7065-5g | Dithiooxamide | 79-40-3 | 5g |
| GX7065-25g | Dithiooxamide | 79-40-3 | 25g |
| GX7065-100g | Dithiooxamide | 79-40-3 | 100g |
| GT8493-10g | Dithizone | 60-10-6 | 10g |
| GT8493-25g | Dithizone | 60-10-6 | 25g |
| GT8493-50g | Dithizone | 60-10-6 | 50g |
| GC2421-10g | Dithranol | 1143-38-0 | 10g |
| GC2421-25g | Dithranol | 1143-38-0 | 25g |
| GK2056-1g | DL-2-Aminoadipic acid | 542-32-5 | 1g |
| GM8773-1g | DL-3-Aminoisobutyric acid | 144-90-1 | 1g |
| GW2691-1g | DL-3-Hydroxybutyric acid sodium salt | 150-83-4 | 1g |
| GW2691-10g | DL-3-Hydroxybutyric acid sodium salt | 150-83-4 | 10g |
| GW5908-250mg | DL-3-Hydroxyisobutyric acid sodium salt | 1219589-99-7 | 250mg |
| GW5908-1g | DL-3-Hydroxyisobutyric acid sodium salt | 1219589-99-7 | 1g |
| GM1654-250mg | DL-5-Hydroxylysine hydrochloride | 13204-98-3 | 250mg |
| GM1654-500mg | DL-5-Hydroxylysine hydrochloride | 13204-98-3 | 500mg |
| GM1654-1g | DL-5-Hydroxylysine hydrochloride | 13204-98-3 | 1g |
| GM4363-25g | DL-Alanine | 302-72-7 | 25g |
| GM4363-100g | DL-Alanine | 302-72-7 | 100g |
| GM4363-250g | DL-Alanine | 302-72-7 | 250g |
| GM4363-500g | DL-Alanine | 302-72-7 | 500g |
| GM4363-1kg | DL-Alanine | 302-72-7 | 1kg |
| GM4363-5kg | DL-Alanine | 302-72-7 | 5kg |
| GM3513-5g | DL-Alanine ethyl ester hydrochloride | 617-27-6 | 5g |
| GM3513-25g | DL-Alanine ethyl ester hydrochloride | 617-27-6 | 25g |
| GK9120-1g | DL-alpha-Lipoic acid | 1077-28-7 | 1g |
| GK9120-5g | DL-alpha-Lipoic acid | 1077-28-7 | 5g |
| GK9120-10g | DL-alpha-Lipoic acid | 1077-28-7 | 10g |
| GK9120-25g | DL-alpha-Lipoic acid | 1077-28-7 | 25g |
| GK9120-50g | DL-alpha-Lipoic acid | 1077-28-7 | 50g |
| GK9120-100g | DL-alpha-Lipoic acid | 1077-28-7 | 100g |
| GK1941-1g | DL-alpha-Lipoic acid, USP grade | 1077-28-7 | 1g |
| GK1941-5g | DL-alpha-Lipoic acid, USP grade | 1077-28-7 | 5g |
| GV2512-250g | DL-alpha-Tocopherol acetate, 50% powder form | 7695-91-2 | 250g |
| GV2512-500g | DL-alpha-Tocopherol acetate, 50% powder form | 7695-91-2 | 500g |
| GV2512-1kg | DL-alpha-Tocopherol acetate, 50% powder form | 7695-91-2 | 1kg |
| GV8989-250g | DL-alpha-Tocopherol acetate, 50% powder form, Ph. Eur., USP grade | 7695-91-2 | 250g |
| GV8989-1kg | DL-alpha-Tocopherol acetate, 50% powder form, Ph. Eur., USP grade | 7695-91-2 | 1kg |
| GV1022-25g | DL-alpha-Tocopherol acetate, EP/USP/FCC grade | 7695-91-2 | 25g |
| GV1022-100g | DL-alpha-Tocopherol acetate, EP/USP/FCC grade | 7695-91-2 | 100g |
| GV1022-250g | DL-alpha-Tocopherol acetate, EP/USP/FCC grade | 7695-91-2 | 250g |
| GV1022-500g | DL-alpha-Tocopherol acetate, EP/USP/FCC grade | 7695-91-2 | 500g |
| GP3425-25g | DL-alpha-Tocopherol, 96% | 10191-41-0 | 25g |
| GP3425-100g | DL-alpha-Tocopherol, 96% | 10191-41-0 | 100g |
| GP3425-500g | DL-alpha-Tocopherol, 96% | 10191-41-0 | 500g |
| GP3425-1kg | DL-alpha-Tocopherol, 96% | 10191-41-0 | 1kg |
| GP5981-25g | DL-alpha-Tocopherol, Ph. Eur., USP grade | 10191-41-0 | 25g |
| GP5981-100g | DL-alpha-Tocopherol, Ph. Eur., USP grade | 10191-41-0 | 100g |
| GP5981-500g | DL-alpha-Tocopherol, Ph. Eur., USP grade | 10191-41-0 | 500g |
| GP5981-1kg | DL-alpha-Tocopherol, Ph. Eur., USP grade | 10191-41-0 | 1kg |
| GP8735-100g | DL-alpha-Tocopherol, USP grade | 10191-41-0 | 100g |
| GP8735-500g | DL-alpha-Tocopherol, USP grade | 10191-41-0 | 500g |
| GC1241-10g | DL-Arabinose | 147-81-9 | 10g |
| GC1241-25g | DL-Arabinose | 147-81-9 | 25g |
| GC1241-100g | DL-Arabinose | 147-81-9 | 100g |
| GM7749-5g | DL-Arginine | 7200-25-1 | 5g |
| GM7749-25g | DL-Arginine | 7200-25-1 | 25g |
| GM7171-1g | DL-Arginine hydrochloride | 32042-43-6 | 1g |
| GM7171-5g | DL-Arginine hydrochloride | 32042-43-6 | 5g |
| GM7171-25g | DL-Arginine hydrochloride | 32042-43-6 | 25g |
| GM7171-100g | DL-Arginine hydrochloride | 32042-43-6 | 100g |
| GM5023-100g | DL-Asparagine monohydrate | 3130-87-8 | 100g |
| GM5023-500g | DL-Asparagine monohydrate | 3130-87-8 | 500g |
| GM6777-100g | DL-Aspartic acid | 617-45-8 | 100g |
| GM6777-250g | DL-Aspartic acid | 617-45-8 | 250g |
| GM6777-500g | DL-Aspartic acid | 617-45-8 | 500g |
| GM6777-1kg | DL-Aspartic acid | 617-45-8 | 1kg |
| GM6777-2kg | DL-Aspartic acid | 617-45-8 | 2kg |
| GH7212-50g | DL-Aspartic acid magnesium salt tetrahydrate | 215528-79-3 | 50g |
| GH7212-250g | DL-Aspartic acid magnesium salt tetrahydrate | 215528-79-3 | 250g |
| GM8717-100g | DL-Carnitine hydrochloride | 461-05-2 | 100g |
| GM8717-500g | DL-Carnitine hydrochloride | 461-05-2 | 500g |
| GM8717-1kg | DL-Carnitine hydrochloride | 461-05-2 | 1kg |
| GM6393-1g | DL-Cysteine | 3374-22-9 | 1g |
| GE1122-5g | DL-Cysteine hydrochloride monohydrate | 116797-51-4 | 5g |
| GE1122-10g | DL-Cysteine hydrochloride monohydrate | 116797-51-4 | 10g |
| GM5088-1g | DL-Cystine | 923-32-0 | 1g |
| GM5088-5g | DL-Cystine | 923-32-0 | 5g |
| GC3928-5g | DL-Dithiothreitol, 98% | 3483-12-3 | 5g |
| GC3928-10g | DL-Dithiothreitol, 98% | 3483-12-3 | 10g |
| GC3928-25g | DL-Dithiothreitol, 98% | 3483-12-3 | 25g |
| GC3928-50g | DL-Dithiothreitol, 98% | 3483-12-3 | 50g |
| GC3928-100g | DL-Dithiothreitol, 98% | 3483-12-3 | 100g |
| GC1199-5g | DL-Dithiothreitol, 99% | 3483-12-3 | 5g |
| GC1199-10g | DL-Dithiothreitol, 99% | 3483-12-3 | 10g |
| GC1199-25g | DL-Dithiothreitol, 99% | 3483-12-3 | 25g |
| GC1199-50g | DL-Dithiothreitol, 99% | 3483-12-3 | 50g |
| GC1199-100g | DL-Dithiothreitol, 99% | 3483-12-3 | 100g |
| GM4302-100g | DL-Glutamic acid monohydrate | 19285-83-7 | 100g |
| GM4302-250g | DL-Glutamic acid monohydrate | 19285-83-7 | 250g |
| GM4302-500g | DL-Glutamic acid monohydrate | 19285-83-7 | 500g |
| GM4302-1kg | DL-Glutamic acid monohydrate | 19285-83-7 | 1kg |
| GM6216-5g | DL-Histidine | 4998-57-6 | 5g |
| GM6216-25g | DL-Histidine | 4998-57-6 | 25g |
| GM6216-100g | DL-Histidine | 4998-57-6 | 100g |
| GM7239-5g | DL-Histidine monohydrochloride monohydrate | 123333-71-1 | 5g |
| GM7239-25g | DL-Histidine monohydrochloride monohydrate | 123333-71-1 | 25g |
| GM7239-100g | DL-Histidine monohydrochloride monohydrate | 123333-71-1 | 100g |
| GM0565-1g | DL-Homoserine | 1927-25-9 | 1g |
| GM0565-5g | DL-Homoserine | 1927-25-9 | 5g |
| GV8998-1g | DL-Isocitric acid trisodium salt hydrate | 1637-73-6 | 1g |
| GV8998-5g | DL-Isocitric acid trisodium salt hydrate | 1637-73-6 | 5g |
| GM0912-5g | DL-Isoleucine | 443-79-8 | 5g |
| GM0912-10g | DL-Isoleucine | 443-79-8 | 10g |
| GM0912-25g | DL-Isoleucine | 443-79-8 | 25g |
| GM0912-50g | DL-Isoleucine | 443-79-8 | 50g |
| GM0912-100g | DL-Isoleucine | 443-79-8 | 100g |
| GC2885-100g | DL-Lactic acid, 85% solution | 50-21-5 | 100g |
| GC2885-250g | DL-Lactic acid, 85% solution | 50-21-5 | 250g |
| GC2885-500g | DL-Lactic acid, 85% solution | 50-21-5 | 500g |
| GM9742-25g | DL-Leucine | 328-39-2 | 25g |
| GM9742-50g | DL-Leucine | 328-39-2 | 50g |
| GM9742-100g | DL-Leucine | 328-39-2 | 100g |
| GM9742-250g | DL-Leucine | 328-39-2 | 250g |
| GM9803-1g | DL-Lysine | 70-54-2 | 1g |
| GM9803-5g | DL-Lysine | 70-54-2 | 5g |
| GM5914-25g | DL-Lysine monohydrochloride | 70-53-1 | 25g |
| GM5914-100g | DL-Lysine monohydrochloride | 70-53-1 | 100g |
| GK7059-100g | DL-Malic acid | 6915-15-7 | 100g |
| GK7059-250g | DL-Malic acid | 6915-15-7 | 250g |
| GK7059-500g | DL-Malic acid | 6915-15-7 | 500g |
| GK7059-1kg | DL-Malic acid | 6915-15-7 | 1kg |
| GK7059-5kg | DL-Malic acid | 6915-15-7 | 5kg |
| GX1468-100g | DL-Malic acid disodium salt | 676-46-0 | 100g |
| GX1468-500g | DL-Malic acid disodium salt | 676-46-0 | 500g |
| GK9854-250g | DL-Mandelic acid | 90-64-2 | 250g |
| GK9854-1kg | DL-Mandelic acid | 90-64-2 | 1kg |
| GL0768-100g | DL-Menthol | 89-78-1 | 100g |
| GL0768-250g | DL-Menthol | 89-78-1 | 250g |
| GM2607-100g | DL-Methionine | 59-51-8 | 100g |
| GM2607-250g | DL-Methionine | 59-51-8 | 250g |
| GM2607-500g | DL-Methionine | 59-51-8 | 500g |
| GM2607-1kg | DL-Methionine | 59-51-8 | 1kg |
| GM2607-5kg | DL-Methionine | 59-51-8 | 5kg |
| GM0955-25g | DL-Norleucine | 616-06-8 | 25g |
| GM0955-100g | DL-Norleucine | 616-06-8 | 100g |
| GM0521-5g | DL-Ornithine monohydrochloride | 1069-31-4 | 5g |
| GM0521-10g | DL-Ornithine monohydrochloride | 1069-31-4 | 10g |
| GM0521-25g | DL-Ornithine monohydrochloride | 1069-31-4 | 25g |
| GM0521-50g | DL-Ornithine monohydrochloride | 1069-31-4 | 50g |
| GX6080-10g | DL-Pantolactone | 79-50-5 | 10g |
| GX6080-25g | DL-Pantolactone | 79-50-5 | 25g |
| GM5287-25g | DL-Phenylalanine | 150-30-1 | 25g |
| GM5287-100g | DL-Phenylalanine | 150-30-1 | 100g |
| GM5287-250g | DL-Phenylalanine | 150-30-1 | 250g |
| GM5287-500g | DL-Phenylalanine | 150-30-1 | 500g |
| GM5287-1kg | DL-Phenylalanine | 150-30-1 | 1kg |
| GE2316-5g | DL-Phenylalanine methyl ester hydrochloride | 5619-07-8 | 5g |
| GE2316-25g | DL-Phenylalanine methyl ester hydrochloride | 5619-07-8 | 25g |
| GM7043-1g | DL-Proline | 609-36-9 | 1g |
| GM7043-5g | DL-Proline | 609-36-9 | 5g |
| GM7043-25g | DL-Proline | 609-36-9 | 25g |
| GM7043-100g | DL-Proline | 609-36-9 | 100g |
| GM9506-100g | DL-Serine | 302-84-1 | 100g |
| GM9506-250g | DL-Serine | 302-84-1 | 250g |
| GM9506-500g | DL-Serine | 302-84-1 | 500g |
| GM9506-1kg | DL-Serine | 302-84-1 | 1kg |
| GE1397-1g | DL-Serine ethyl ester hydrochloride | 3940-27-0 | 1g |
| GE1397-5g | DL-Serine ethyl ester hydrochloride | 3940-27-0 | 5g |
| GE1397-25g | DL-Serine ethyl ester hydrochloride | 3940-27-0 | 25g |
| GE1397-100g | DL-Serine ethyl ester hydrochloride | 3940-27-0 | 100g |
| GM7745-10g | DL-Serine methyl ester hydrochloride | 5619-04-5 | 10g |
| GM7745-25g | DL-Serine methyl ester hydrochloride | 5619-04-5 | 25g |
| GM7745-50g | DL-Serine methyl ester hydrochloride | 5619-04-5 | 50g |
| GM7745-100g | DL-Serine methyl ester hydrochloride | 5619-04-5 | 100g |
| GK1879-100g | DL-Tartaric acid | 133-37-9 | 100g |
| GK1879-250g | DL-Tartaric acid | 133-37-9 | 250g |
| GK1879-500g | DL-Tartaric acid | 133-37-9 | 500g |
| GK1879-1kg | DL-Tartaric acid | 133-37-9 | 1kg |
| GM7260-500mg | DL-tert-Leucine | 33105-81-6 | 500mg |
| GM7260-1g | DL-tert-Leucine | 33105-81-6 | 1g |
| GL2922-5mg | DL-Thiorphan | 76721-89-6 | 5mg |
| GL2922-25mg | DL-Thiorphan | 76721-89-6 | 25mg |
| GM8351-25g | DL-Threonine | 80-68-2 | 25g |
| GM8351-100g | DL-Threonine | 80-68-2 | 100g |
| GM8351-250g | DL-Threonine | 80-68-2 | 250g |
| GM8351-500g | DL-Threonine | 80-68-2 | 500g |
| GK5665-25g | DL-Tropic acid | 552-63-6 | 25g |
| GM0325-5g | DL-Tryptophan | 54-12-6 | 5g |
| GM0325-25g | DL-Tryptophan | 54-12-6 | 25g |
| GM0325-100g | DL-Tryptophan | 54-12-6 | 100g |
| GE0673-1g | DL-Tryptophan methyl ester hydrochloride | 5619-09-0 | 1g |
| GE0673-5g | DL-Tryptophan methyl ester hydrochloride | 5619-09-0 | 5g |
| GE0673-10g | DL-Tryptophan methyl ester hydrochloride | 5619-09-0 | 10g |
| GM6469-10g | DL-Tyrosine | 556-03-6 | 10g |
| GM6469-25g | DL-Tyrosine | 556-03-6 | 25g |
| GM6469-50g | DL-Tyrosine | 556-03-6 | 50g |
| GM6469-100g | DL-Tyrosine | 556-03-6 | 100g |
| GM6469-250g | DL-Tyrosine | 556-03-6 | 250g |
| GM3274-25g | DL-Valine | 516-06-3 | 25g |
| GM3274-100g | DL-Valine | 516-06-3 | 100g |
| GM3274-250g | DL-Valine | 516-06-3 | 250g |
| GM3274-500g | DL-Valine | 516-06-3 | 500g |
| GM3274-1kg | DL-Valine | 516-06-3 | 1kg |
| GC6865-5g | DL-Xylose | 25990-60-7 | 5g |
| GW8766-1mg | DMAPB | 827036-76-0 | 1mg |
| GW8766-5mg | DMAPB | 827036-76-0 | 5mg |
| GW4248-1mg | DMAT | 749234-11-5 | 1mg |
| GW4248-5mg | DMAT | 749234-11-5 | 5mg |
| GW4248-25mg | DMAT | 749234-11-5 | 25mg |
| GL6369-5mg | DMNQ | 6956-96-3 | 5mg |
| GL6369-10mg | DMNQ | 6956-96-3 | 10mg |
| GL6369-25mg | DMNQ | 6956-96-3 | 25mg |
| GP5102-25mg | Docetaxel | 114977-28-5 | 25mg |
| GP5102-100mg | Docetaxel | 114977-28-5 | 100mg |
| GP5102-250mg | Docetaxel | 114977-28-5 | 250mg |
| GL6499-25g | Docosane | 629-97-0 | 25g |
| GC7623-250mg | Dodecanoyl-D-sucrose | 25339-99-5 | 250mg |
| GK5416-10g | Dodecenylsuccinic acid | 29658-97-7 | 10g |
| GC5636-1g | Dodecyl a-D-maltopyranoside | 116183-64-3 | 1g |
| GC5636-5g | Dodecyl a-D-maltopyranoside | 116183-64-3 | 5g |
| GC5636-25g | Dodecyl a-D-maltopyranoside | 116183-64-3 | 25g |
| GC4399-100mg | Dodecyl b-D-maltopyranoside, 99% | 69227-93-6 | 100mg |
| GC4399-250mg | Dodecyl b-D-maltopyranoside, 99% | 69227-93-6 | 250mg |
| GC4399-500mg | Dodecyl b-D-maltopyranoside, 99% | 69227-93-6 | 500mg |
| GC4399-1g | Dodecyl b-D-maltopyranoside, 99% | 69227-93-6 | 1g |
| GC4399-5g | Dodecyl b-D-maltopyranoside, 99% | 69227-93-6 | 5g |
| GC7339-1g | Dodecyl b-D-maltopyranoside, 99%, low alpha | 69227-93-6 | 1g |
| GC7339-5g | Dodecyl b-D-maltopyranoside, 99%, low alpha | 69227-93-6 | 5g |
| GE9576-10g | Dodecyltrimethylammonium bromide | 1119-94-4 | 10g |
| GE9576-25g | Dodecyltrimethylammonium bromide | 1119-94-4 | 25g |
| GE9576-100g | Dodecyltrimethylammonium bromide | 1119-94-4 | 100g |
| GE9576-250g | Dodecyltrimethylammonium bromide | 1119-94-4 | 250g |
| GE1100-10g | Dodecyltrimethylammonium bromide, 99%, for IPC | 1119-94-4 | 10g |
| GC7041-5g | Dodecyltrimethylammonium chloride | 112-00-5 | 5g |
| GC7041-25g | Dodecyltrimethylammonium chloride | 112-00-5 | 25g |
| GC7041-100g | Dodecyltrimethylammonium chloride | 112-00-5 | 100g |
| GC7041-250g | Dodecyltrimethylammonium chloride | 112-00-5 | 250g |
| GC7041-500g | Dodecyltrimethylammonium chloride | 112-00-5 | 500g |
| GP8363-25mg | Dofetilide | 115256-11-6 | 25mg |
| GP8363-100mg | Dofetilide | 115256-11-6 | 100mg |
| GP5620-25g | Domiphen bromide | 538-71-6 | 25g |
| GP5620-100g | Domiphen bromide | 538-71-6 | 100g |
| GP3849-50mg | Domperidone | 57808-66-9 | 50mg |
| GP3849-250mg | Domperidone | 57808-66-9 | 250mg |
| GP3849-1g | Domperidone | 57808-66-9 | 1g |
| GP8656-250mg | Donepezil hydrochloride | 120011-70-3 | 250mg |
| GL6813-1g | Dopamine hydrochloride | 62-31-7 | 1g |
| GA9212-250mg | Doripenem | 148016-81-3 | 250mg |
| GA9212-1g | Doripenem | 148016-81-3 | 1g |
| GP4335-100mg | Dorzolamide hydrochloride | 130693-82-2 | 100mg |
| GP3558-1g | Dothiepin hydrochloride | 897-15-4 | 1g |
| GP6685-100mg | Doxapram hydrochloride | 7081-53-0 | 100mg |
| GP9708-100mg | Doxazosin mesylate | 77883-43-3 | 100mg |
| GP9708-250mg | Doxazosin mesylate | 77883-43-3 | 250mg |
| GP9056-25mg | Doxorubicin hydrochloride, 98% | 25316-40-9 | 25mg |
| GP9056-100mg | Doxorubicin hydrochloride, 98% | 25316-40-9 | 100mg |
| GA4969-10mg | Doxorubicin hydrochloride, USP grade | 25316-40-9 | 10mg |
| GA4969-25mg | Doxorubicin hydrochloride, USP grade | 25316-40-9 | 25mg |
| GA4969-50mg | Doxorubicin hydrochloride, USP grade | 25316-40-9 | 50mg |
| GA4969-100mg | Doxorubicin hydrochloride, USP grade | 25316-40-9 | 100mg |
| GA1726-1g | Doxycycline hyclate | 24390-14-5 | 1g |
| GA1726-5g | Doxycycline hyclate | 24390-14-5 | 5g |
| GA1726-10g | Doxycycline hyclate | 24390-14-5 | 10g |
| GA1726-25g | Doxycycline hyclate | 24390-14-5 | 25g |
| GA1726-100g | Doxycycline hyclate | 24390-14-5 | 100g |
| GA4252-500mg | Doxycycline hydrochloride | 10592-13-9 | 500mg |
| GA4252-1g | Doxycycline hydrochloride | 10592-13-9 | 1g |
| GA1221-5g | Doxycycline monohydrate | 17086-28-1 | 5g |
| GA1221-25g | Doxycycline monohydrate | 17086-28-1 | 25g |
| GA1221-100g | Doxycycline monohydrate | 17086-28-1 | 100g |
| GW2555-25mg | DPM | 143503-03-1 | 25mg |
| GW2555-250mg | DPM | 143503-03-1 | 250mg |
| GK3734-1mg | DPQ | 129075-73-6 | 1mg |
| GK3734-5mg | DPQ | 129075-73-6 | 5mg |
| GK2734-100g | Dried Aluminium Hydroxide Gel | 21645-51-2 | 100g |
| GK1474-100mg | Drometrizole trisiloxane | 155633-54-8 | 100mg |
| GP5350-250mg | Dronedarone hydrochloride | 141625-93-6 | 250mg |
| GP5350-1g | Dronedarone hydrochloride | 141625-93-6 | 1g |
| GP1726-1g | Droperidol | 548-73-2 | 1g |
| GP1726-5g | Droperidol | 548-73-2 | 5g |
| GK1621-250mg | Drospirenone | 67392-87-4 | 250mg |
| GP2082-10mg | Drotaverine hydrochloride | 985-12-6 | 10mg |
| GL0837-25mg | Ds(+)-threo-Isocitric acid trisodium salt | 903507-52-8 | 25mg |
| GL0837-100mg | Ds(+)-threo-Isocitric acid trisodium salt | 903507-52-8 | 100mg |
| GW5435-1mg | DSP-1 | 1609395-29-0 | 1mg |
| GW5435-5mg | DSP-1 | 1609395-29-0 | 5mg |
| GW5435-10mg | DSP-1 | 1609395-29-0 | 10mg |
| GW5273-1mg | DSP-2 | 1609395-31-4 | 1mg |
| GW5273-5mg | DSP-2 | 1609395-31-4 | 5mg |
| GW5273-10mg | DSP-2 | 1609395-31-4 | 10mg |
| GW6830-1mg | DSP-3 | 1609395-32-5 | 1mg |
| GW6830-5mg | DSP-3 | 1609395-32-5 | 5mg |
| GW6830-10mg | DSP-3 | 1609395-32-5 | 10mg |
| GW4214-1g | DTTCI | 3071-70-3 | 1g |
| GW4214-5g | DTTCI | 3071-70-3 | 5g |
| GC5527-25g | Dulcitol | 608-66-2 | 25g |
| GC5527-100g | Dulcitol | 608-66-2 | 100g |
| GC5527-250g | Dulcitol | 608-66-2 | 250g |
| GP0383-1g | Dutasteride | 164656-23-9 | 1g |
| GP9526-5mg | Dynasore hydrate | 304448-55-3 | 5mg |
| GP9526-25mg | Dynasore hydrate | 304448-55-3 | 25mg |
| GW8556-500ug | DYRK1 Inhibitor Negative Control AnnH79 | 500ug | |
| GW2289-500ug | DYRK1A/B Inhibitor AnnH31 | 241809-12-1 | 500ug |
| GW9805-500ug | DYRK1A/B Inhibitor AnnH75 | 500ug | |
| GX9699-50g | Dysprosium acetate hydrate, 99.9% | 15280-55-4 | 50g |
| GX7296-50g | Dysprosium acetate hydrate, 99.999% | 15280-55-4 | 50g |
| GX3671-25g | Dysprosium carbonate hydrate, 99.999% | 38245-35-1 | 25g |
| GX0213-10g | Dysprosium Chips, 99.9% | 7429-91-6 | 10g |
| GX0213-50g | Dysprosium Chips, 99.9% | 7429-91-6 | 50g |
| GX6115-25g | Dysprosium chloride hydrate, 99.99% | 15059-52-6 | 25g |
| GX6115-100g | Dysprosium chloride hydrate, 99.99% | 15059-52-6 | 100g |
| GX7443-25g | Dysprosium fluoride, anhydrous, 99.9% | 13569-80-7 | 25g |
| GX7443-100g | Dysprosium fluoride, anhydrous, 99.9% | 13569-80-7 | 100g |
| GX1664-25x50mm | Dysprosium Foil 0.25mm, 99.9% | 7429-91-6 | 25x50mm |
| GX7912-25x50mm | Dysprosium Foil 0.5mm, 99.9% | 7429-91-6 | 25x50mm |
| GX4427-25g | Dysprosium nitrate hydrate, 99.9% | 10031-49-9 | 25g |
| GX4427-100g | Dysprosium nitrate hydrate, 99.9% | 10031-49-9 | 100g |
| GX3037-10g | Dysprosium oxide-Nano Powder, 99.9% | 1308-87-8 | 10g |
| GX3037-50g | Dysprosium oxide-Nano Powder, 99.9% | 1308-87-8 | 50g |
| GX3451-25g | Dysprosium oxide, 99.9% | 1308-87-8 | 25g |
| GX3451-100g | Dysprosium oxide, 99.9% | 1308-87-8 | 100g |
| GX8951-25g | Dysprosium oxide, 99.99% | 1308-87-8 | 25g |
| GX8951-100g | Dysprosium oxide, 99.99% | 1308-87-8 | 100g |
| GX6051-10g | Dysprosium Pieces 13 mm, 99.9% | 7429-91-6 | 10g |
| GX6051-50g | Dysprosium Pieces 13 mm, 99.9% | 7429-91-6 | 50g |
| GX0465-10g | Dysprosium Pieces distilled, 99.99% | 7429-91-6 | 10g |
| GX0465-25g | Dysprosium Pieces distilled, 99.99% | 7429-91-6 | 25g |
| GX8361-5g | Dysprosium Powder, 99.9% | 7429-91-6 | 5g |
| GX8361-25g | Dysprosium Powder, 99.9% | 7429-91-6 | 25g |
| GX6568-10mm | Dysprosium Rod 12.5 mm diameter, 99.9% | 7429-91-6 | 10mm |
| GX6568-50mm | Dysprosium Rod 12.5 mm diameter, 99.9% | 7429-91-6 | 50mm |
| GX7609-25mm | Dysprosium Rod 6.35 mm diameter, 99.9% | 7429-91-6 | 25mm |
| GX7609-100mm | Dysprosium Rod 6.35 mm diameter, 99.9% | 7429-91-6 | 100mm |
| GX1115-50g | Dysprosium sulfate hydrate, 99.9% | 10031-50-2 | 50g |
| GX8494-50g | Dysprosium sulfate hydrate, 99.999% | 10031-50-2 | 50g |
| GX5087-1g | Dysprosium sulfide, 99.9% | 12133-10-7 | 1g |
| GX5087-5g | Dysprosium sulfide, 99.9% | 12133-10-7 | 5g |
| GL4130-5mg | E-64 protease inhibitor | 66701-25-5 | 5mg |
| GL4130-25mg | E-64 protease inhibitor | 66701-25-5 | 25mg |
| GL9790-1mg | E-64d protease inhibitor | 88321-09-9 | 1mg |
| GL9790-5mg | E-64d protease inhibitor | 88321-09-9 | 5mg |
| GL9790-25mg | E-64d protease inhibitor | 88321-09-9 | 25mg |
| GW2433-1mg | E7080 | 417716-92-8 | 1mg |
| GW2433-5mg | E7080 | 417716-92-8 | 5mg |
| GW2433-10mg | E7080 | 417716-92-8 | 10mg |
| GP4285-1mg | Ebselen | 60940-34-3 | 1mg |
| GP4285-5mg | Ebselen | 60940-34-3 | 5mg |
| GP4285-25mg | Ebselen | 60940-34-3 | 25mg |
| GL0233-10mg | Echinacoside | 82854-37-3 | 10mg |
| GY5332-10mg | Eclalbasaponin I | 158511-59-2 | 10mg |
| GA7153-250mg | Econazole | 27220-47-9 | 250mg |
| GA7153-1g | Econazole | 27220-47-9 | 1g |
| GA5978-5g | Econazole nitrate salt | 24169-02-6 | 5g |
| GA5978-25g | Econazole nitrate salt | 24169-02-6 | 25g |
| GA5978-100g | Econazole nitrate salt | 24169-02-6 | 100g |
| GC6273-1mg | Ecopipam O-β-D-glucuronide | 141456-09-9 | 1mg |
| GC6273-2mg | Ecopipam O-β-D-glucuronide | 141456-09-9 | 2mg |
| GC6273-5mg | Ecopipam O-β-D-glucuronide | 141456-09-9 | 5mg |
| GC6273-10mg | Ecopipam O-β-D-glucuronide | 141456-09-9 | 10mg |
| GC7047-1mg | Ecopipam-d6 | 1mg | |
| GC7047-2mg | Ecopipam-d6 | 2mg | |
| GC7047-5mg | Ecopipam-d6 | 5mg | |
| GC7047-10mg | Ecopipam-d6 | 10mg | |
| GC7047-25mg | Ecopipam-d6 | 25mg | |
| GC5186-1mg | Ecopipam-d6 O-β-D-glucuronide | 1mg | |
| GC5186-2mg | Ecopipam-d6 O-β-D-glucuronide | 2mg | |
| GE1963-25g | Ectoine | 96702-03-3 | 25g |
| GE1963-100g | Ectoine | 96702-03-3 | 100g |
| GC2219-1mg | Edaravone O-β-D-glucuronide | 67566-02-3 | 1mg |
| GC2219-2mg | Edaravone O-β-D-glucuronide | 67566-02-3 | 2mg |
| GC2219-5mg | Edaravone O-β-D-glucuronide | 67566-02-3 | 5mg |
| GC2219-10mg | Edaravone O-β-D-glucuronide | 67566-02-3 | 10mg |
| GC2219-25mg | Edaravone O-β-D-glucuronide | 67566-02-3 | 25mg |
| GM6988-5g | EDC free base | 1892-57-5 | 5g |
| GM6988-25g | EDC free base | 1892-57-5 | 25g |
| GP0849-5g | EDC hydrochloride | 25952-53-8 | 5g |
| GP0849-25g | EDC hydrochloride | 25952-53-8 | 25g |
| GP0849-100g | EDC hydrochloride | 25952-53-8 | 100g |
| GP0849-250g | EDC hydrochloride | 25952-53-8 | 250g |
| GE1219-500g | Edetic acid, BP, Ph. Eur. grade | 60-00-4 | 500g |
| GE1219-1kg | Edetic acid, BP, Ph. Eur. grade | 60-00-4 | 1kg |
| GE4011-100g | EDTA | 60-00-4 | 100g |
| GE4011-250g | EDTA | 60-00-4 | 250g |
| GE4011-500g | EDTA | 60-00-4 | 500g |
| GE4011-1kg | EDTA | 60-00-4 | 1kg |
| GE8581-250g | EDTA calcium disodium salt dihydrate, BP, Ph. Eur., USP grade | 6766-87-6 | 250g |
| GE8581-500g | EDTA calcium disodium salt dihydrate, BP, Ph. Eur., USP grade | 6766-87-6 | 500g |
| GE8581-1kg | EDTA calcium disodium salt dihydrate, BP, Ph. Eur., USP grade | 6766-87-6 | 1kg |
| GE5635-100g | EDTA dipotassium salt dihydrate | 25102-12-9 | 100g |
| GE5635-250g | EDTA dipotassium salt dihydrate | 25102-12-9 | 250g |
| GE5635-500g | EDTA dipotassium salt dihydrate | 25102-12-9 | 500g |
| GE3023-100g | EDTA disodium salt dihydrate | 6381-92-6 | 100g |
| GE3023-250g | EDTA disodium salt dihydrate | 6381-92-6 | 250g |
| GE3023-500g | EDTA disodium salt dihydrate | 6381-92-6 | 500g |
| GE3023-1kg | EDTA disodium salt dihydrate | 6381-92-6 | 1kg |
| GE3023-5kg | EDTA disodium salt dihydrate | 6381-92-6 | 5kg |
| GX8832-500g | EDTA disodium salt dihydrate, 99%, Ph. Eur. grade | 6381-92-6 | 500g |
| GX8832-1kg | EDTA disodium salt dihydrate, 99%, Ph. Eur. grade | 6381-92-6 | 1kg |
| GX8832-5kg | EDTA disodium salt dihydrate, 99%, Ph. Eur. grade | 6381-92-6 | 5kg |
| GX3802-25g | EDTA disodium zinc salt hydrate | 176736-49-5 | 25g |
| GX3802-100g | EDTA disodium zinc salt hydrate | 176736-49-5 | 100g |
| GX3802-250g | EDTA disodium zinc salt hydrate | 176736-49-5 | 250g |
| GX3802-500g | EDTA disodium zinc salt hydrate | 176736-49-5 | 500g |
| GE7700-100g | EDTA ferric sodium salt | 15708-41-5 | 100g |
| GE7700-250g | EDTA ferric sodium salt | 15708-41-5 | 250g |
| GE7700-500g | EDTA ferric sodium salt | 15708-41-5 | 500g |
| GE7700-1kg | EDTA ferric sodium salt | 15708-41-5 | 1kg |
| GE3956-25g | EDTA magnesium disodium salt hydrate | 14402-88-1 | 25g |
| GE3956-100g | EDTA magnesium disodium salt hydrate | 14402-88-1 | 100g |
| GE3956-250g | EDTA magnesium disodium salt hydrate | 14402-88-1 | 250g |
| GE3956-500g | EDTA magnesium disodium salt hydrate | 14402-88-1 | 500g |
| GE3956-1kg | EDTA magnesium disodium salt hydrate | 14402-88-1 | 1kg |
| GX6009-25g | EDTA manganese disodium salt hydrate | 15375-84-5 | 25g |
| GX6009-100g | EDTA manganese disodium salt hydrate | 15375-84-5 | 100g |
| GX6009-250g | EDTA manganese disodium salt hydrate | 15375-84-5 | 250g |
| GX6009-500g | EDTA manganese disodium salt hydrate | 15375-84-5 | 500g |
| GE7722-500ml | EDTA solution, 0.1M in water | 60-00-4 | 500ml |
| GE5993-500ml | EDTA solution, 0.5M in water | 60-00-4 | 500ml |
| GK0795-100g | EDTA tetrasodium salt dihydrate | 10378-23-1 | 100g |
| GK0795-250g | EDTA tetrasodium salt dihydrate | 10378-23-1 | 250g |
| GK0795-500g | EDTA tetrasodium salt dihydrate | 10378-23-1 | 500g |
| GK0795-1kg | EDTA tetrasodium salt dihydrate | 10378-23-1 | 1kg |
| GK0795-2500g | EDTA tetrasodium salt dihydrate | 10378-23-1 | 2500g |
| GE3450-100g | EDTA tetrasodium salt hydrate | 194491-31-1 | 100g |
| GE3450-250g | EDTA tetrasodium salt hydrate | 194491-31-1 | 250g |
| GE3450-500g | EDTA tetrasodium salt hydrate | 194491-31-1 | 500g |
| GE3450-1kg | EDTA tetrasodium salt hydrate | 194491-31-1 | 1kg |
| GE3450-5kg | EDTA tetrasodium salt hydrate | 194491-31-1 | 5kg |
| GL1464-25g | EDTA tripotassium salt dihydrate | 65501-24-8 | 25g |
| GL1464-100g | EDTA tripotassium salt dihydrate | 65501-24-8 | 100g |
| GL1464-250g | EDTA tripotassium salt dihydrate | 65501-24-8 | 250g |
| GL1464-500g | EDTA tripotassium salt dihydrate | 65501-24-8 | 500g |
| GE9701-100g | EDTA trisodium salt dihydrate | 150-38-9 | 100g |
| GE9701-250g | EDTA trisodium salt dihydrate | 150-38-9 | 250g |
| GE9701-500g | EDTA trisodium salt dihydrate | 150-38-9 | 500g |
| GP6354-25mg | Efavirenz | 154598-52-4 | 25mg |
| GP6354-100mg | Efavirenz | 154598-52-4 | 100mg |
| GE7249-10g | EGTA | 67-42-5 | 10g |
| GE7249-25g | EGTA | 67-42-5 | 25g |
| GE7249-50g | EGTA | 67-42-5 | 50g |
| GE7249-100g | EGTA | 67-42-5 | 100g |
| GE9981-10g | EGTA, 99% | 67-42-5 | 10g |
| GE9981-25g | EGTA, 99% | 67-42-5 | 25g |
| GE9981-50g | EGTA, 99% | 67-42-5 | 50g |
| GE9981-100g | EGTA, 99% | 67-42-5 | 100g |
| GE9981-250g | EGTA, 99% | 67-42-5 | 250g |
| GP1385-10mg | EIDD-2801 | 2492423-29-5 | 10mg |
| GP1385-50mg | EIDD-2801 | 2492423-29-5 | 50mg |
| GP5778-10mg | Elacridar | 143664-11-3 | 10mg |
| GP5778-50mg | Elacridar | 143664-11-3 | 50mg |
| GP5778-100mg | Elacridar | 143664-11-3 | 100mg |
| GL7222-1mg | Elasnin | 68112-21-0 | 1mg |
| GL7222-5mg | Elasnin | 68112-21-0 | 5mg |
| GL1320-5mg | Elastatinal microbial | 51798-45-9 | 5mg |
| GL1320-25mg | Elastatinal microbial | 51798-45-9 | 25mg |
| GW9811-1mg | Elbasvir | 1370468-36-2 | 1mg |
| GW9811-5mg | Elbasvir | 1370468-36-2 | 5mg |
| GP7432-10g | Ellagic acid, 90%, technical | 476-66-4 | 10g |
| GP5363-1g | Ellagic acid, 95% | 476-66-4 | 1g |
| GP5363-5g | Ellagic acid, 95% | 476-66-4 | 5g |
| GP5363-25g | Ellagic acid, 95% | 476-66-4 | 25g |
| GC5494-1mg | Eltrombopag acyl-β-D-glucuronide | 1mg | |
| GC5494-2mg | Eltrombopag acyl-β-D-glucuronide | 2mg | |
| GC5494-5mg | Eltrombopag acyl-β-D-glucuronide | 5mg | |
| GP4572-10mg | Elvitegravir | 697761-98-1 | 10mg |
| GP4572-25mg | Elvitegravir | 697761-98-1 | 25mg |
| GL0042-250ug | EM574 | 110480-13-2 | 250ug |
| GL0042-1mg | EM574 | 110480-13-2 | 1mg |
| GP2114-25g | Emamectin benzoate, 95% | 155569-91-8 | 25g |
| GA2860-50mg | Emetine dihydrochloride hydrate | 316-42-7 | 50mg |
| GP5697-100mg | Emodin | 518-82-1 | 100mg |
| GP5697-250mg | Emodin | 518-82-1 | 250mg |
| GP5697-500mg | Emodin | 518-82-1 | 500mg |
| GP5697-1g | Emodin | 518-82-1 | 1g |
| GX6640-10mg | Empagliflozin | 864070-44-0 | 10mg |
| GX6640-50mg | Empagliflozin | 864070-44-0 | 50mg |
| GC7615-1mg | Empagliflozin 2-O-β-D-glucuronide | 1mg | |
| GC7615-2mg | Empagliflozin 2-O-β-D-glucuronide | 2mg | |
| GC7615-5mg | Empagliflozin 2-O-β-D-glucuronide | 5mg | |
| GC7615-10mg | Empagliflozin 2-O-β-D-glucuronide | 10mg | |
| GC6323-1mg | Empagliflozin 3-O-β-D-glucuronide | 1mg | |
| GC6323-2mg | Empagliflozin 3-O-β-D-glucuronide | 2mg | |
| GC6323-5mg | Empagliflozin 3-O-β-D-glucuronide | 5mg | |
| GC6323-10mg | Empagliflozin 3-O-β-D-glucuronide | 10mg | |
| GC6156-1mg | Empagliflozin 4-O-β-D-glucuronide | 1mg | |
| GC6156-2mg | Empagliflozin 4-O-β-D-glucuronide | 2mg | |
| GC6156-5mg | Empagliflozin 4-O-β-D-glucuronide | 5mg | |
| GC6156-10mg | Empagliflozin 4-O-β-D-glucuronide | 10mg | |
| GC6310-1mg | Empagliflozin 6-O-β-D-glucuronide | 1mg | |
| GC6310-2mg | Empagliflozin 6-O-β-D-glucuronide | 2mg | |
| GC6310-5mg | Empagliflozin 6-O-β-D-glucuronide | 5mg | |
| GC6310-10mg | Empagliflozin 6-O-β-D-glucuronide | 10mg | |
| GP7326-25mg | Emtricitabine | 143491-57-0 | 25mg |
| GP7326-100mg | Emtricitabine | 143491-57-0 | 100mg |
| GP7326-250mg | Emtricitabine | 143491-57-0 | 250mg |
| GP7214-1g | Enalapril maleate salt | 76095-16-4 | 1g |
| GP7214-5g | Enalapril maleate salt | 76095-16-4 | 5g |
| GW0255-50mg | Enalaprilat | 76420-72-9 | 50mg |
| GW0255-250mg | Enalaprilat | 76420-72-9 | 250mg |
| GP3972-25mg | Enalaprilat hydrate | 84680-54-6 | 25mg |
| GP3972-50mg | Enalaprilat hydrate | 84680-54-6 | 50mg |
| GP3972-100mg | Enalaprilat hydrate | 84680-54-6 | 100mg |
| GW5616-500ug | Enniatin A | 2503-13-1 | 500ug |
| GW9382-1mg | Enniatin A1 | 4530-21-6 | 1mg |
| GW8528-1mg | Enniatin B1 | 19914-20-6 | 1mg |
| GA5196-100mg | Enoxacin | 74011-58-8 | 100mg |
| GA5196-1g | Enoxacin | 74011-58-8 | 1g |
| GA5196-5g | Enoxacin | 74011-58-8 | 5g |
| GA5196-25g | Enoxacin | 74011-58-8 | 25g |
| GP8041-1g | Enoxolone | 471-53-4 | 1g |
| GP8041-5g | Enoxolone | 471-53-4 | 5g |
| GP8041-25g | Enoxolone | 471-53-4 | 25g |
| GP8041-100g | Enoxolone | 471-53-4 | 100g |
| GP1750-10mg | Enprofylline | 41078-02-8 | 10mg |
| GA3066-1g | Enrofloxacin | 93106-60-6 | 1g |
| GA3066-5g | Enrofloxacin | 93106-60-6 | 5g |
| GA3066-25g | Enrofloxacin | 93106-60-6 | 25g |
| GP9755-100mg | Entacapone | 130929-57-6 | 100mg |
| GP9755-250mg | Entacapone | 130929-57-6 | 250mg |
| GP9755-1g | Entacapone | 130929-57-6 | 1g |
| GP8732-100mg | Entecavir hydrate | 209216-23-9 | 100mg |
| GP8732-250mg | Entecavir hydrate | 209216-23-9 | 250mg |
| GL6982-250ug | Enterocin | 59678-46-5 | 250ug |
| GL6982-1mg | Enterocin | 59678-46-5 | 1mg |
| GX7514-1kg | Entfettungssalz Typ A / Degreasing salt Type A | 1kg | |
| GP3697-1mg | Entinostat | 209783-80-2 | 1mg |
| GP3697-5mg | Entinostat | 209783-80-2 | 5mg |
| GP3697-25mg | Entinostat | 209783-80-2 | 25mg |
| GT8630-10g | Eosin B | 56360-46-4 | 10g |
| GT8630-25g | Eosin B | 56360-46-4 | 25g |
| GT6445-10g | Eosin B (C.I. 45400) | 548-24-3 | 10g |
| GT6445-25g | Eosin B (C.I. 45400) | 548-24-3 | 25g |
| GT6445-100g | Eosin B (C.I. 45400) | 548-24-3 | 100g |
| GT2503-25g | Eosin Y (C.I. 45380:2) | 15086-94-9 | 25g |
| GT2503-100g | Eosin Y (C.I. 45380:2) | 15086-94-9 | 100g |
| GT2884-25g | Eosin Y disodium salt (C.I. 45380) | 17372-87-1 | 25g |
| GT2884-100g | Eosin Y disodium salt (C.I. 45380) | 17372-87-1 | 100g |
| GT2884-250g | Eosin Y disodium salt (C.I. 45380) | 17372-87-1 | 250g |
| GT0244-500ml | Eosin Y solution, 1% aqueous | 15086-94-9 | 500ml |
| GT0244-1l | Eosin Y solution, 1% aqueous | 15086-94-9 | 1l |
| GT9663-500ml | Eosin Y solution, alcoholic | 15086-94-9 | 500ml |
| GT9663-1l | Eosin Y solution, alcoholic | 15086-94-9 | 1l |
| GT8474-250ml | Eosin Y solution, alcoholic with phloxine | 15086-94-9 | 250ml |
| GT8474-1l | Eosin Y solution, alcoholic with phloxine | 15086-94-9 | 1l |
| GW1599-50mg | Eosin-5-isothiocyanate | 60520-47-0 | 50mg |
| GW1599-250mg | Eosin-5-isothiocyanate | 60520-47-0 | 250mg |
| GW6692-5mg | Epacadostat | 1204669-58-8 | 5mg |
| GW6692-25mg | Epacadostat | 1204669-58-8 | 25mg |
| GL3272-1mg | epi-Aszonalenin A | 908853-14-5 | 1mg |
| GL3272-5mg | epi-Aszonalenin A | 908853-14-5 | 5mg |
| GP6146-1g | Epiandrosterone | 481-29-8 | 1g |
| GP7016-10mg | Epicatechin gallate | 1257-08-5 | 10mg |
| GP7016-25mg | Epicatechin gallate | 1257-08-5 | 25mg |
| GP4379-5mg | Epicatechin, 95% | 490-46-0 | 5mg |
| GP4379-25mg | Epicatechin, 95% | 490-46-0 | 25mg |
| GC6613-10mg | Epicellobiose | 27452-49-9 | 10mg |
| GC6613-25mg | Epicellobiose | 27452-49-9 | 25mg |
| GC6613-50mg | Epicellobiose | 27452-49-9 | 50mg |
| GC6613-100mg | Epicellobiose | 27452-49-9 | 100mg |
| GL6737-50mg | Epicoprostanol | 516-92-7 | 50mg |
| GL6737-100mg | Epicoprostanol | 516-92-7 | 100mg |
| GL6737-250mg | Epicoprostanol | 516-92-7 | 250mg |
| GP2119-5mg | Epigallocatechin | 970-74-1 | 5mg |
| GP2119-10mg | Epigallocatechin | 970-74-1 | 10mg |
| GP0260-5mg | Epigallocatechin gallate | 989-51-5 | 5mg |
| GP0260-10mg | Epigallocatechin gallate | 989-51-5 | 10mg |
| GP0260-50mg | Epigallocatechin gallate | 989-51-5 | 50mg |
| GC9893-1mg | Epimaltose | 70832-27-8 | 1mg |
| GC9893-2mg | Epimaltose | 70832-27-8 | 2mg |
| GC9893-5mg | Epimaltose | 70832-27-8 | 5mg |
| GC9893-10mg | Epimaltose | 70832-27-8 | 10mg |
| GP2165-1g | Epinephrine | 51-43-4 | 1g |
| GP2175-5mg | Epirubicin hydrochloride | 56390-09-1 | 5mg |
| GP2175-10mg | Epirubicin hydrochloride | 56390-09-1 | 10mg |
| GP0150-100mg | Eplerenone | 107724-20-9 | 100mg |
| GW0951-5g | Epoxidised linseed oil | 8016-11-3 | 5g |
| GW0951-25g | Epoxidised linseed oil | 8016-11-3 | 25g |
| GW6988-10g | Epoxidized soya bean oil | 8013-07-8 | 10g |
| GW6988-50g | Epoxidized soya bean oil | 8013-07-8 | 50g |
| GL3424-50ug | Epoxomicin | 134381-21-8 | 50ug |
| GL3424-100ug | Epoxomicin | 134381-21-8 | 100ug |
| GL3424-250ug | Epoxomicin | 134381-21-8 | 250ug |
| GL3424-500ug | Epoxomicin | 134381-21-8 | 500ug |
| GW5052-5mg | EPZ-6438 | 1403254-99-8 | 5mg |
| GW5052-10mg | EPZ-6438 | 1403254-99-8 | 10mg |
| GW5052-25mg | EPZ-6438 | 1403254-99-8 | 25mg |
| GW5052-100mg | EPZ-6438 | 1403254-99-8 | 100mg |
| GW5417-1mg | EPZ015666 | 1616391-65-1 | 1mg |
| GW5417-5mg | EPZ015666 | 1616391-65-1 | 5mg |
| GW5417-10mg | EPZ015666 | 1616391-65-1 | 10mg |
| GC7067-1mg | Equilin 3-O-β-D-glucuronide | 76663-60-0 | 1mg |
| GC7067-2mg | Equilin 3-O-β-D-glucuronide | 76663-60-0 | 2mg |
| GC7067-5mg | Equilin 3-O-β-D-glucuronide | 76663-60-0 | 5mg |
| GC7067-10mg | Equilin 3-O-β-D-glucuronide | 76663-60-0 | 10mg |
| GW5144-1mg | ER 172594-06 hydrobromide | 474550-69-1 | 1mg |
| GW5144-5mg | ER 172594-06 hydrobromide | 474550-69-1 | 5mg |
| GW5144-10mg | ER 172594-06 hydrobromide | 474550-69-1 | 10mg |
| GL5645-1mg | Erastin | 571203-78-6 | 1mg |
| GL5645-5mg | Erastin | 571203-78-6 | 5mg |
| GX5093-50g | Erbium acetate hydrate, 99.9% | 15280-57-6 | 50g |
| GX6288-50g | Erbium acetate hydrate, 99.999% | 15280-57-6 | 50g |
| GX7977-25g | Erbium carbonate hydrate, 99.9% | 22992-83-2 | 25g |
| GX7977-100g | Erbium carbonate hydrate, 99.9% | 22992-83-2 | 100g |
| GX1788-25g | Erbium carbonate hydrate, 99.999% | 22992-83-2 | 25g |
| GX1788-100g | Erbium carbonate hydrate, 99.999% | 22992-83-2 | 100g |
| GX3754-5g | Erbium Chips, 99.9% | 7440-52-0 | 5g |
| GX3754-10g | Erbium Chips, 99.9% | 7440-52-0 | 10g |
| GX3754-50g | Erbium Chips, 99.9% | 7440-52-0 | 50g |
| GX3099-10g | Erbium chloride anhydrous, 99.9% | 10138-41-7 | 10g |
| GX3099-50g | Erbium chloride anhydrous, 99.9% | 10138-41-7 | 50g |
| GX3951-25g | Erbium chloride hydrate, 99.9% | 10025-75-9 | 25g |
| GX3951-100g | Erbium chloride hydrate, 99.9% | 10025-75-9 | 100g |
| GX5135-25g | Erbium chloride hydrate, 99.99% | 10025-75-9 | 25g |
| GX5135-100g | Erbium chloride hydrate, 99.99% | 10025-75-9 | 100g |
| GX9751-25g | Erbium chloride hydrate, 99.999% | 10025-75-9 | 25g |
| GX9751-100g | Erbium chloride hydrate, 99.999% | 10025-75-9 | 100g |
| GX4766-25g | Erbium fluoride anhydrous, 99.9% | 13760-83-3 | 25g |
| GX4766-100g | Erbium fluoride anhydrous, 99.9% | 13760-83-3 | 100g |
| GX6921-25x50mm | Erbium Foil 0.25mm, 99.9% | 7440-52-0 | 25x50mm |
| GX9661-25x50mm | Erbium Foil 0.5mm, 99.9% | 7440-52-0 | 25x50mm |
| GX3638-50g | Erbium hydroxide, 99.999% | 14646-16-3 | 50g |
| GX1257-25g | Erbium nitrate hydrate, 99.9% | 10031-51-3 | 25g |
| GX1257-100g | Erbium nitrate hydrate, 99.9% | 10031-51-3 | 100g |
| GX6639-50g | Erbium oxalate hydrate, 99.9% | 30618-31-6 | 50g |
| GX5412-50g | Erbium oxalate hydrate, 99.999% | 30618-31-6 | 50g |
| GX9056-10g | Erbium oxide-Nano Powder, 99.9% | 12061-16-4 | 10g |
| GX9056-50g | Erbium oxide-Nano Powder, 99.9% | 12061-16-4 | 50g |
| GX1956-25g | Erbium oxide, 99.9% | 12061-16-4 | 25g |
| GX1956-100g | Erbium oxide, 99.9% | 12061-16-4 | 100g |
| GX1956-500g | Erbium oxide, 99.9% | 12061-16-4 | 500g |
| GX2558-10g | Erbium oxide, 99.99% | 12061-16-4 | 10g |
| GX2558-50g | Erbium oxide, 99.99% | 12061-16-4 | 50g |
| GX2558-100g | Erbium oxide, 99.99% | 12061-16-4 | 100g |
| GX2558-500g | Erbium oxide, 99.99% | 12061-16-4 | 500g |
| GX6503-10g | Erbium oxide, 99.999% | 12061-16-4 | 10g |
| GX7624-25g | Erbium oxide, 99.999% | 12061-16-4 | 25g |
| GX6503-50g | Erbium oxide, 99.999% | 12061-16-4 | 50g |
| GX4431-250g | Erbium oxide, 99+% | 12061-16-4 | 250g |
| GX4431-1kg | Erbium oxide, 99+% | 12061-16-4 | 1kg |
| GX1857-10g | Erbium Pieces 13 mm, 99.9% | 7440-52-0 | 10g |
| GX1857-50g | Erbium Pieces 13 mm, 99.9% | 7440-52-0 | 50g |
| GX6516-5g | Erbium Powder, 99.9% | 7440-52-0 | 5g |
| GX6516-25g | Erbium Powder, 99.9% | 7440-52-0 | 25g |
| GX1877-10mm | Erbium Rod 6.35 mm diameter, 99.9% | 7440-52-0 | 10mm |
| GX1877-25mm | Erbium Rod 6.35 mm diameter, 99.9% | 7440-52-0 | 25mm |
| GX8034-25g | Erbium sulfate hydrate, 99.9% | 10031-52-4 | 25g |
| GX8034-100g | Erbium sulfate hydrate, 99.9% | 10031-52-4 | 100g |
| GX0295-10g | Erbium sulfate octahydrate, 99.999% | 10031-52-4 | 10g |
| GX0295-25g | Erbium sulfate octahydrate, 99.999% | 10031-52-4 | 25g |
| GX6121-25cm | Erbium Wire 1 mm diameter, 99.9% | 7440-52-0 | 25cm |
| GX6121-50cm | Erbium Wire 1 mm diameter, 99.9% | 7440-52-0 | 50cm |
| GX1722-1g | Erbium-thd, 99.9% | 35733-23-4 | 1g |
| GL0564-1mg | Eremofortin A | 62445-06-1 | 1mg |
| GL0564-5mg | Eremofortin A | 62445-06-1 | 5mg |
| GL2057-1mg | Eremofortin B | 60048-73-9 | 1mg |
| GL2057-5mg | Eremofortin B | 60048-73-9 | 5mg |
| GL1651-1g | Ergosterol | 57-87-4 | 1g |
| GL1651-5g | Ergosterol | 57-87-4 | 5g |
| GL1651-10g | Ergosterol | 57-87-4 | 10g |
| GL1651-25g | Ergosterol | 57-87-4 | 25g |
| GT9710-25g | Erichrome Blue Black R (C.I. 15705) | 2538-85-4 | 25g |
| GT9710-100g | Erichrome Blue Black R (C.I. 15705) | 2538-85-4 | 100g |
| GT2024-25g | Eriochrome Black T (C.I. 14645) | 1787-61-7 | 25g |
| GT2024-100g | Eriochrome Black T (C.I. 14645) | 1787-61-7 | 100g |
| GT2024-250g | Eriochrome Black T (C.I. 14645) | 1787-61-7 | 250g |
| GT2024-500g | Eriochrome Black T (C.I. 14645) | 1787-61-7 | 500g |
| GT1416-100g | Eriochrome Black T (C.I. 14645); ACS grade | 1787-61-7 | 100g |
| GT1416-250g | Eriochrome Black T (C.I. 14645); ACS grade | 1787-61-7 | 250g |
| GT1416-500g | Eriochrome Black T (C.I. 14645); ACS grade | 1787-61-7 | 500g |
| GT1416-1kg | Eriochrome Black T (C.I. 14645); ACS grade | 1787-61-7 | 1kg |
| GT5063-25g | Eriochrome blue-black B (C.I. 14640) | 3564-14-5 | 25g |
| GT5063-100g | Eriochrome blue-black B (C.I. 14640) | 3564-14-5 | 100g |
| GT6219-25g | Eriochrome Cyanine R (C.I. 43820) | 3564-18-9 | 25g |
| GT6219-100g | Eriochrome Cyanine R (C.I. 43820) | 3564-18-9 | 100g |
| GT2562-10g | Erioglaucine (C.I. 42090) | 3844-45-9 | 10g |
| GT2562-25g | Erioglaucine (C.I. 42090) | 3844-45-9 | 25g |
| GT2562-100g | Erioglaucine (C.I. 42090) | 3844-45-9 | 100g |
| GP0576-1g | Erlotinib | 183321-74-6 | 1g |
| GP3306-100mg | Erlotinib hydrochloride | 183319-69-9 | 100mg |
| GP3306-1g | Erlotinib hydrochloride | 183319-69-9 | 1g |
| GA8176-100mg | Ertapenem sodium salt | 153773-82-1 | 100mg |
| GA8176-250mg | Ertapenem sodium salt | 153773-82-1 | 250mg |
| GA8176-1g | Ertapenem sodium salt | 153773-82-1 | 1g |
| GC5043-1mg | Ertugliflozin 3-O-β-D-glucuronide | 1500090-85-6 | 1mg |
| GC5043-2mg | Ertugliflozin 3-O-β-D-glucuronide | 1500090-85-6 | 2mg |
| GC5043-5mg | Ertugliflozin 3-O-β-D-glucuronide | 1500090-85-6 | 5mg |
| GC5043-10mg | Ertugliflozin 3-O-β-D-glucuronide | 1500090-85-6 | 10mg |
| GA1145-5g | Erythromycin | 114-07-8 | 5g |
| GA1145-10g | Erythromycin | 114-07-8 | 10g |
| GA1145-25g | Erythromycin | 114-07-8 | 25g |
| GA1145-100g | Erythromycin | 114-07-8 | 100g |
| GT6599-10g | Erythrosin B | 15905-32-5 | 10g |
| GT6599-25g | Erythrosin B | 15905-32-5 | 25g |
| GT6599-50g | Erythrosin B | 15905-32-5 | 50g |
| GT6599-250g | Erythrosin B | 15905-32-5 | 250g |
| GT2668-10g | Erythrosin B sodium salt (C.I. 45430) | 16423-68-0 | 10g |
| GT2668-25g | Erythrosin B sodium salt (C.I. 45430) | 16423-68-0 | 25g |
| GT2668-50g | Erythrosin B sodium salt (C.I. 45430) | 16423-68-0 | 50g |
| GT8461-10g | Erythrosin B sodium salt (C.I. 45430); certified | 16423-68-0 | 10g |
| GT8461-25g | Erythrosin B sodium salt (C.I. 45430); certified | 16423-68-0 | 25g |
| GT8461-50g | Erythrosin B sodium salt (C.I. 45430); certified | 16423-68-0 | 50g |
| GT8461-100g | Erythrosin B sodium salt (C.I. 45430); certified | 16423-68-0 | 100g |
| GC8310-1g | Escin | 6805-41-0 | 1g |
| GC8310-5g | Escin | 6805-41-0 | 5g |
| GC8310-10g | Escin | 6805-41-0 | 10g |
| GP5432-100mg | Escitalopram oxalate | 219861-08-2 | 100mg |
| GP5432-250mg | Escitalopram oxalate | 219861-08-2 | 250mg |
| GP5432-500mg | Escitalopram oxalate | 219861-08-2 | 500mg |
| GP5432-1g | Escitalopram oxalate | 219861-08-2 | 1g |
| GC4131-5g | Esculin hydrate | 531-75-9 | 5g |
| GC4131-10g | Esculin hydrate | 531-75-9 | 10g |
| GC4131-25g | Esculin hydrate | 531-75-9 | 25g |
| GC4131-50g | Esculin hydrate | 531-75-9 | 50g |
| GC4131-100g | Esculin hydrate | 531-75-9 | 100g |
| GP0973-25mg | Esmolol hydrochloride | 81161-17-3 | 25mg |
| GP0973-100mg | Esmolol hydrochloride | 81161-17-3 | 100mg |
| GL1313-1g | Esomeprazole magnesium salt hydrate | 668985-31-7 | 1g |
| GP5980-1g | Esomeprazole sodium salt hydrate | 161796-78-7 | 1g |
| GP9683-1g | Estradiol | 50-28-2 | 1g |
| GP9683-5g | Estradiol | 50-28-2 | 5g |
| GP9683-10g | Estradiol | 50-28-2 | 10g |
| GP9683-25g | Estradiol | 50-28-2 | 25g |
| GC7268-1mg | Estradiol 17-O-β-D-glucuronide | 1806-98-0 | 1mg |
| GC7268-5mg | Estradiol 17-O-β-D-glucuronide | 1806-98-0 | 5mg |
| GC7268-10mg | Estradiol 17-O-β-D-glucuronide | 1806-98-0 | 10mg |
| GC7268-25mg | Estradiol 17-O-β-D-glucuronide | 1806-98-0 | 25mg |
| GC7268-50mg | Estradiol 17-O-β-D-glucuronide | 1806-98-0 | 50mg |
| GC1668-1mg | Estradiol 3-O-β-D-glucuronide | 15270-30-1 | 1mg |
| GC1668-2mg | Estradiol 3-O-β-D-glucuronide | 15270-30-1 | 2mg |
| GC1668-5mg | Estradiol 3-O-β-D-glucuronide | 15270-30-1 | 5mg |
| GC1668-10mg | Estradiol 3-O-β-D-glucuronide | 15270-30-1 | 10mg |
| GC1668-25mg | Estradiol 3-O-β-D-glucuronide | 15270-30-1 | 25mg |
| GK5552-5g | Estrone 3-methyl ether | 1624-62-0 | 5g |
| GL8298-5mg | Estrone 3-sulfate sodium salt | 438-67-5 | 5mg |
| GL8298-10mg | Estrone 3-sulfate sodium salt | 438-67-5 | 10mg |
| GL8298-25mg | Estrone 3-sulfate sodium salt | 438-67-5 | 25mg |
| GL8298-50mg | Estrone 3-sulfate sodium salt | 438-67-5 | 50mg |
| GC9570-5mg | Estrone b-D-glucuronide | 2479-90-5 | 5mg |
| GC9570-10mg | Estrone b-D-glucuronide | 2479-90-5 | 10mg |
| GC9570-25mg | Estrone b-D-glucuronide | 2479-90-5 | 25mg |
| GC9570-50mg | Estrone b-D-glucuronide | 2479-90-5 | 50mg |
| GC9570-100mg | Estrone b-D-glucuronide | 2479-90-5 | 100mg |
| GC2791-10mg | Estrone-2,4,16,16-d4 | 53866-34-5 | 10mg |
| GC2791-25mg | Estrone-2,4,16,16-d4 | 53866-34-5 | 25mg |
| GC2791-50mg | Estrone-2,4,16,16-d4 | 53866-34-5 | 50mg |
| GC5815-1mg | Estrone-2,4,16,16-d4 3-O-β-D-glucuronide | 1mg | |
| GC5815-2mg | Estrone-2,4,16,16-d4 3-O-β-D-glucuronide | 2mg | |
| GC5815-5mg | Estrone-2,4,16,16-d4 3-O-β-D-glucuronide | 5mg | |
| GA3438-5g | Ethacridine lactate salt monohydrate | 6402-23-9 | 5g |
| GA3438-10g | Ethacridine lactate salt monohydrate | 6402-23-9 | 10g |
| GA3438-25g | Ethacridine lactate salt monohydrate | 6402-23-9 | 25g |
| GA3438-100g | Ethacridine lactate salt monohydrate | 6402-23-9 | 100g |
| GA7275-25g | Ethambutol dihydrochloride | 1070-11-7 | 25g |
| GA7275-100g | Ethambutol dihydrochloride | 1070-11-7 | 100g |
| GK6948-100ml | Ethanolamine | 141-43-5 | 100ml |
| GK6948-500ml | Ethanolamine | 141-43-5 | 500ml |
| GK6948-1l | Ethanolamine | 141-43-5 | 1l |
| GK6948-5l | Ethanolamine | 141-43-5 | 5l |
| GK0319-25g | Ethanolamine hydrochloride | 2002-24-6 | 25g |
| GT1710-1g | Ethidium bromide | 1239-45-8 | 1g |
| GT1710-5g | Ethidium bromide | 1239-45-8 | 5g |
| GT1710-25g | Ethidium bromide | 1239-45-8 | 25g |
| GT5677-5mg | Ethidium bromide monoazide | 58880-05-0 | 5mg |
| GT9211-10ml | Ethidium bromide, 10mg/ml in water | 1239-45-8 | 10ml |
| GT0540-1mg | Ethidium homodimer I | 61926-22-5 | 1mg |
| GT0540-5mg | Ethidium homodimer I | 61926-22-5 | 5mg |
| GT0540-10mg | Ethidium homodimer I | 61926-22-5 | 10mg |
| GP3324-1g | Ethinylestradiol | 57-63-6 | 1g |
| GP3324-5g | Ethinylestradiol | 57-63-6 | 5g |
| GA6196-5g | Ethionamide | 536-33-4 | 5g |
| GA6196-10g | Ethionamide | 536-33-4 | 10g |
| GA6196-25g | Ethionamide | 536-33-4 | 25g |
| GA6196-100g | Ethionamide | 536-33-4 | 100g |
| GP7068-1g | Ethisterone | 434-03-7 | 1g |
| GP7068-5g | Ethisterone | 434-03-7 | 5g |
| GP7068-10g | Ethisterone | 434-03-7 | 10g |
| GK2628-200g | Ethoxylated hydrogenated castor oil | 61788-85-0 | 200g |
| GK2628-1kg | Ethoxylated hydrogenated castor oil | 61788-85-0 | 1kg |
| GX9766-5g | Ethyl (hydroxyimino)cyanoacetate | 3849-21-6 | 5g |
| GX9766-25g | Ethyl (hydroxyimino)cyanoacetate | 3849-21-6 | 25g |
| GX9766-100g | Ethyl (hydroxyimino)cyanoacetate | 3849-21-6 | 100g |
| GC6710-1g | Ethyl 1-thio-α-L-rhamnopyranoside | 127753-94-0 | 1g |
| GC6710-2g | Ethyl 1-thio-α-L-rhamnopyranoside | 127753-94-0 | 2g |
| GC6710-5g | Ethyl 1-thio-α-L-rhamnopyranoside | 127753-94-0 | 5g |
| GC6710-10g | Ethyl 1-thio-α-L-rhamnopyranoside | 127753-94-0 | 10g |
| GC1322-500mg | Ethyl 1-thio-β-D-xylopyranoside | 2595-46-2 | 500mg |
| GC1322-1g | Ethyl 1-thio-β-D-xylopyranoside | 2595-46-2 | 1g |
| GC1322-2g | Ethyl 1-thio-β-D-xylopyranoside | 2595-46-2 | 2g |
| GC1322-5g | Ethyl 1-thio-β-D-xylopyranoside | 2595-46-2 | 5g |
| GC1237-500mg | Ethyl 2-deoxy-1-thio-2-trichloroacetylamino-β-D-glucopyranoside | 635684-80-9 | 500mg |
| GC1237-1g | Ethyl 2-deoxy-1-thio-2-trichloroacetylamino-β-D-glucopyranoside | 635684-80-9 | 1g |
| GC1237-2g | Ethyl 2-deoxy-1-thio-2-trichloroacetylamino-β-D-glucopyranoside | 635684-80-9 | 2g |
| GC1237-5g | Ethyl 2-deoxy-1-thio-2-trichloroacetylamino-β-D-glucopyranoside | 635684-80-9 | 5g |
| GC1560-1g | Ethyl 2-O-benzoyl-3-O-benzyl-1-thio-β-D-glucopyranoside | 187153-36-2 | 1g |
| GC1560-2g | Ethyl 2-O-benzoyl-3-O-benzyl-1-thio-β-D-glucopyranoside | 187153-36-2 | 2g |
| GC1560-5g | Ethyl 2-O-benzoyl-3-O-benzyl-1-thio-β-D-glucopyranoside | 187153-36-2 | 5g |
| GC1560-10g | Ethyl 2-O-benzoyl-3-O-benzyl-1-thio-β-D-glucopyranoside | 187153-36-2 | 10g |
| GC8803-250mg | Ethyl 2-thio-α-D-fructofuranoside | 80763-60-6 | 250mg |
| GC8803-500mg | Ethyl 2-thio-α-D-fructofuranoside | 80763-60-6 | 500mg |
| GC8803-1g | Ethyl 2-thio-α-D-fructofuranoside | 80763-60-6 | 1g |
| GC8803-2g | Ethyl 2-thio-α-D-fructofuranoside | 80763-60-6 | 2g |
| GC2672-100mg | Ethyl 2-thio-β-D-fructofuranoside | 80763-61-7 | 100mg |
| GC2672-250mg | Ethyl 2-thio-β-D-fructofuranoside | 80763-61-7 | 250mg |
| GC2672-500mg | Ethyl 2-thio-β-D-fructofuranoside | 80763-61-7 | 500mg |
| GC2672-1g | Ethyl 2-thio-β-D-fructofuranoside | 80763-61-7 | 1g |
| GC6715-1g | Ethyl 2,3-Di-O-benzyl-4,6-O-benzylidene-1-deoxy-1-thio-α-D-mannopyranoside S-Oxide | 188357-34-8 | 1g |
| GC6715-2g | Ethyl 2,3-Di-O-benzyl-4,6-O-benzylidene-1-deoxy-1-thio-α-D-mannopyranoside S-Oxide | 188357-34-8 | 2g |
| GC6715-5g | Ethyl 2,3-Di-O-benzyl-4,6-O-benzylidene-1-deoxy-1-thio-α-D-mannopyranoside S-Oxide | 188357-34-8 | 5g |
| GC6715-10g | Ethyl 2,3-Di-O-benzyl-4,6-O-benzylidene-1-deoxy-1-thio-α-D-mannopyranoside S-Oxide | 188357-34-8 | 10g |
| GC3205-1g | Ethyl 2,3-di-O-benzyl-4,6-O-benzylidene-1-thio-β-D-galactopyranoside | 1208999-29-4 | 1g |
| GC3205-2g | Ethyl 2,3-di-O-benzyl-4,6-O-benzylidene-1-thio-β-D-galactopyranoside | 1208999-29-4 | 2g |
| GC3205-5g | Ethyl 2,3-di-O-benzyl-4,6-O-benzylidene-1-thio-β-D-galactopyranoside | 1208999-29-4 | 5g |
| GC3205-10g | Ethyl 2,3-di-O-benzyl-4,6-O-benzylidene-1-thio-β-D-galactopyranoside | 1208999-29-4 | 10g |
| GC9919-500mg | Ethyl 2,3,4-tri-O-acetyl-1-thio-α-L-rhamnopyranoside | 125520-01-6 | 500mg |
| GC9919-1g | Ethyl 2,3,4-tri-O-acetyl-1-thio-α-L-rhamnopyranoside | 125520-01-6 | 1g |
| GC9919-2g | Ethyl 2,3,4-tri-O-acetyl-1-thio-α-L-rhamnopyranoside | 125520-01-6 | 2g |
| GC9919-5g | Ethyl 2,3,4-tri-O-acetyl-1-thio-α-L-rhamnopyranoside | 125520-01-6 | 5g |
| GC1219-1g | Ethyl 2,3,4-tri-O-acetyl-1-thio-β-D-xylopyranoside | 2771-53-1 | 1g |
| GC1219-2g | Ethyl 2,3,4-tri-O-acetyl-1-thio-β-D-xylopyranoside | 2771-53-1 | 2g |
| GC1219-5g | Ethyl 2,3,4-tri-O-acetyl-1-thio-β-D-xylopyranoside | 2771-53-1 | 5g |
| GC1219-10g | Ethyl 2,3,4-tri-O-acetyl-1-thio-β-D-xylopyranoside | 2771-53-1 | 10g |
| GC2352-100mg | Ethyl 2,3,4-tri-O-acetyl-1-thio-β-L-rhamnopyranoside | 69558-02-7 | 100mg |
| GC2352-250mg | Ethyl 2,3,4-tri-O-acetyl-1-thio-β-L-rhamnopyranoside | 69558-02-7 | 250mg |
| GC2352-500mg | Ethyl 2,3,4-tri-O-acetyl-1-thio-β-L-rhamnopyranoside | 69558-02-7 | 500mg |
| GC2352-1g | Ethyl 2,3,4-tri-O-acetyl-1-thio-β-L-rhamnopyranoside | 69558-02-7 | 1g |
| GC8924-500mg | Ethyl 2,3,4-tri-O-benzyl-1-thio-β-D-xylopyranoside | 2307255-53-2 | 500mg |
| GC8924-1g | Ethyl 2,3,4-tri-O-benzyl-1-thio-β-D-xylopyranoside | 2307255-53-2 | 1g |
| GC8924-2g | Ethyl 2,3,4-tri-O-benzyl-1-thio-β-D-xylopyranoside | 2307255-53-2 | 2g |
| GC8924-5g | Ethyl 2,3,4-tri-O-benzyl-1-thio-β-D-xylopyranoside | 2307255-53-2 | 5g |
| GC8924-10g | Ethyl 2,3,4-tri-O-benzyl-1-thio-β-D-xylopyranoside | 2307255-53-2 | 10g |
| GC3494-1g | Ethyl 2,3,4,6-tetra-O-acetyl-1-thio-D-mannopyranoside (min. 85% α-anomer) | 99031-86-4 | 1g |
| GC3494-5g | Ethyl 2,3,4,6-tetra-O-acetyl-1-thio-D-mannopyranoside (min. 85% α-anomer) | 99031-86-4 | 5g |
| GC3494-10g | Ethyl 2,3,4,6-tetra-O-acetyl-1-thio-D-mannopyranoside (min. 85% α-anomer) | 99031-86-4 | 10g |
| GC3494-25g | Ethyl 2,3,4,6-tetra-O-acetyl-1-thio-D-mannopyranoside (min. 85% α-anomer) | 99031-86-4 | 25g |
| GC1120-100mg | Ethyl 2,3,4,6-tetra-O-acetyl-1-thio-β-D-mannopyranoside | 125354-48-5 | 100mg |
| GC1120-250mg | Ethyl 2,3,4,6-tetra-O-acetyl-1-thio-β-D-mannopyranoside | 125354-48-5 | 250mg |
| GC1120-500mg | Ethyl 2,3,4,6-tetra-O-acetyl-1-thio-β-D-mannopyranoside | 125354-48-5 | 500mg |
| GC1120-1g | Ethyl 2,3,4,6-tetra-O-acetyl-1-thio-β-D-mannopyranoside | 125354-48-5 | 1g |
| GC0667-1g | Ethyl 2,3,4,6-tetra-O-acetyl-a-D-thioglucopyranoside | 52645-73-5 | 1g |
| GC0667-2g | Ethyl 2,3,4,6-tetra-O-acetyl-a-D-thioglucopyranoside | 52645-73-5 | 2g |
| GC0667-5g | Ethyl 2,3,4,6-tetra-O-acetyl-a-D-thioglucopyranoside | 52645-73-5 | 5g |
| GC0667-10g | Ethyl 2,3,4,6-tetra-O-acetyl-a-D-thioglucopyranoside | 52645-73-5 | 10g |
| GC0667-25g | Ethyl 2,3,4,6-tetra-O-acetyl-a-D-thioglucopyranoside | 52645-73-5 | 25g |
| GC5656-5g | Ethyl 2,3,4,6-tetra-O-acetyl-b-D-thiogalactopyranoside | 55722-49-1 | 5g |
| GC5656-10g | Ethyl 2,3,4,6-tetra-O-acetyl-b-D-thiogalactopyranoside | 55722-49-1 | 10g |
| GC5656-25g | Ethyl 2,3,4,6-tetra-O-acetyl-b-D-thiogalactopyranoside | 55722-49-1 | 25g |
| GC5656-50g | Ethyl 2,3,4,6-tetra-O-acetyl-b-D-thiogalactopyranoside | 55722-49-1 | 50g |
| GC7327-1g | Ethyl 2,3,4,6-Tetra-O-acetyl-α-D-thiomannopyranoside | 79389-52-9 | 1g |
| GC7327-2g | Ethyl 2,3,4,6-Tetra-O-acetyl-α-D-thiomannopyranoside | 79389-52-9 | 2g |
| GC7327-5g | Ethyl 2,3,4,6-Tetra-O-acetyl-α-D-thiomannopyranoside | 79389-52-9 | 5g |
| GC7327-10g | Ethyl 2,3,4,6-Tetra-O-acetyl-α-D-thiomannopyranoside | 79389-52-9 | 10g |
| GC7492-500mg | Ethyl 2,3,4,6-tetra-O-benzyl-b-D-thiogalactopyranoside | 125411-99-6 | 500mg |
| GC7492-1g | Ethyl 2,3,4,6-tetra-O-benzyl-b-D-thiogalactopyranoside | 125411-99-6 | 1g |
| GC7492-2g | Ethyl 2,3,4,6-tetra-O-benzyl-b-D-thiogalactopyranoside | 125411-99-6 | 2g |
| GC7492-5g | Ethyl 2,3,4,6-tetra-O-benzyl-b-D-thiogalactopyranoside | 125411-99-6 | 5g |
| GC7492-10g | Ethyl 2,3,4,6-tetra-O-benzyl-b-D-thiogalactopyranoside | 125411-99-6 | 10g |
| GC8484-1g | Ethyl 2,3,4,6-tetra-O-benzyl-b-D-thioglucopyranoside | 108739-67-9 | 1g |
| GC8484-2g | Ethyl 2,3,4,6-tetra-O-benzyl-b-D-thioglucopyranoside | 108739-67-9 | 2g |
| GC8484-5g | Ethyl 2,3,4,6-tetra-O-benzyl-b-D-thioglucopyranoside | 108739-67-9 | 5g |
| GC8484-10g | Ethyl 2,3,4,6-tetra-O-benzyl-b-D-thioglucopyranoside | 108739-67-9 | 10g |
| GC8775-1g | Ethyl 2,3,6-tri-O-benzyl-1-thio-β-D-galactopyranoside | 152964-77-7 | 1g |
| GC8775-2g | Ethyl 2,3,6-tri-O-benzyl-1-thio-β-D-galactopyranoside | 152964-77-7 | 2g |
| GC8775-5g | Ethyl 2,3,6-tri-O-benzyl-1-thio-β-D-galactopyranoside | 152964-77-7 | 5g |
| GC8775-10g | Ethyl 2,3,6-tri-O-benzyl-1-thio-β-D-galactopyranoside | 152964-77-7 | 10g |
| GC4895-1g | Ethyl 2,4,6-tri-O-acetyl-3-O-allyl-1-thio-β-D-glucopyranoside | 128716-36-9 | 1g |
| GC4895-2g | Ethyl 2,4,6-tri-O-acetyl-3-O-allyl-1-thio-β-D-glucopyranoside | 128716-36-9 | 2g |
| GC4895-5g | Ethyl 2,4,6-tri-O-acetyl-3-O-allyl-1-thio-β-D-glucopyranoside | 128716-36-9 | 5g |
| GC4895-10g | Ethyl 2,4,6-tri-O-acetyl-3-O-allyl-1-thio-β-D-glucopyranoside | 128716-36-9 | 10g |
| GC4895-25g | Ethyl 2,4,6-tri-O-acetyl-3-O-allyl-1-thio-β-D-glucopyranoside | 128716-36-9 | 25g |
| GC6395-2g | Ethyl 2,4,6-tri-O-acetyl-3-O-benzyl-1-thio-β-D-glucopyranoside | 146530-62-3 | 2g |
| GC6395-5g | Ethyl 2,4,6-tri-O-acetyl-3-O-benzyl-1-thio-β-D-glucopyranoside | 146530-62-3 | 5g |
| GC6395-10g | Ethyl 2,4,6-tri-O-acetyl-3-O-benzyl-1-thio-β-D-glucopyranoside | 146530-62-3 | 10g |
| GC6395-25g | Ethyl 2,4,6-tri-O-acetyl-3-O-benzyl-1-thio-β-D-glucopyranoside | 146530-62-3 | 25g |
| GC9083-500mg | Ethyl 3-O-acetyl-2-deoxy-2-phthalimido-1-thio-β-D-glucopyranose | 189188-19-0 | 500mg |
| GC9083-1g | Ethyl 3-O-acetyl-2-deoxy-2-phthalimido-1-thio-β-D-glucopyranose | 189188-19-0 | 1g |
| GC9083-2g | Ethyl 3-O-acetyl-2-deoxy-2-phthalimido-1-thio-β-D-glucopyranose | 189188-19-0 | 2g |
| GC9083-5g | Ethyl 3-O-acetyl-2-deoxy-2-phthalimido-1-thio-β-D-glucopyranose | 189188-19-0 | 5g |
| GC5951-100mg | Ethyl 3-O-acetyl-2-deoxy-4-O-mesyl-2-phthalimido-1-thio-β-D-glucopyranose | 100mg | |
| GC5951-250mg | Ethyl 3-O-acetyl-2-deoxy-4-O-mesyl-2-phthalimido-1-thio-β-D-glucopyranose | 250mg | |
| GC5951-500mg | Ethyl 3-O-acetyl-2-deoxy-4-O-mesyl-2-phthalimido-1-thio-β-D-glucopyranose | 500mg | |
| GC5951-1g | Ethyl 3-O-acetyl-2-deoxy-4-O-mesyl-2-phthalimido-1-thio-β-D-glucopyranose | 1g | |
| GC5676-500mg | Ethyl 3-O-acetyl-4,6-O-benzylidene-2-deoxy-2-phthalimido-1-thio-β-D-glucopyranoside | 125520-04-9 | 500mg |
| GC5676-1g | Ethyl 3-O-acetyl-4,6-O-benzylidene-2-deoxy-2-phthalimido-1-thio-β-D-glucopyranoside | 125520-04-9 | 1g |
| GC5676-2g | Ethyl 3-O-acetyl-4,6-O-benzylidene-2-deoxy-2-phthalimido-1-thio-β-D-glucopyranoside | 125520-04-9 | 2g |
| GC5676-5g | Ethyl 3-O-acetyl-4,6-O-benzylidene-2-deoxy-2-phthalimido-1-thio-β-D-glucopyranoside | 125520-04-9 | 5g |
| GC3597-500mg | Ethyl 3-O-allyl-2-O-benzyl-4,6-O-benzylidene-1-thio-β-D-galactopyranoside | 1203549-89-6 | 500mg |
| GC3597-1g | Ethyl 3-O-allyl-2-O-benzyl-4,6-O-benzylidene-1-thio-β-D-galactopyranoside | 1203549-89-6 | 1g |
| GC3597-2g | Ethyl 3-O-allyl-2-O-benzyl-4,6-O-benzylidene-1-thio-β-D-galactopyranoside | 1203549-89-6 | 2g |
| GC3597-5g | Ethyl 3-O-allyl-2-O-benzyl-4,6-O-benzylidene-1-thio-β-D-galactopyranoside | 1203549-89-6 | 5g |
| GC8670-100mg | Ethyl 3-O-allyl-4-O-benzyl-2-O-naphthylmethyl-1-thio-β-D-glucopyranoside | 100mg | |
| GC8670-250mg | Ethyl 3-O-allyl-4-O-benzyl-2-O-naphthylmethyl-1-thio-β-D-glucopyranoside | 250mg | |
| GC8670-500mg | Ethyl 3-O-allyl-4-O-benzyl-2-O-naphthylmethyl-1-thio-β-D-glucopyranoside | 500mg | |
| GC8670-1g | Ethyl 3-O-allyl-4-O-benzyl-2-O-naphthylmethyl-1-thio-β-D-glucopyranoside | 1g | |
| GC2392-100mg | Ethyl 3-O-allyl-4-O-benzyl-2-O-naphthylmethyl-1-thio-β-D-glucopyranosiduronic acid benzyl ester | 100mg | |
| GC2392-250mg | Ethyl 3-O-allyl-4-O-benzyl-2-O-naphthylmethyl-1-thio-β-D-glucopyranosiduronic acid benzyl ester | 250mg | |
| GC2392-500mg | Ethyl 3-O-allyl-4-O-benzyl-2-O-naphthylmethyl-1-thio-β-D-glucopyranosiduronic acid benzyl ester | 500mg | |
| GC2392-1g | Ethyl 3-O-allyl-4-O-benzyl-2-O-naphthylmethyl-1-thio-β-D-glucopyranosiduronic acid benzyl ester | 1g | |
| GC9995-100mg | Ethyl 3-O-allyl-4-O-levulinoyl-2-O-naphthylmethyl-1-thio-β-D-glucopyranosiduronic acid benzyl ester | 100mg | |
| GC9995-250mg | Ethyl 3-O-allyl-4-O-levulinoyl-2-O-naphthylmethyl-1-thio-β-D-glucopyranosiduronic acid benzyl ester | 250mg | |
| GC9995-500mg | Ethyl 3-O-allyl-4-O-levulinoyl-2-O-naphthylmethyl-1-thio-β-D-glucopyranosiduronic acid benzyl ester | 500mg | |
| GC9995-1g | Ethyl 3-O-allyl-4-O-levulinoyl-2-O-naphthylmethyl-1-thio-β-D-glucopyranosiduronic acid benzyl ester | 1g | |
| GC6223-1g | Ethyl 3-O-allyl-4,6-O-benzylidene-1-thio-β-D-glucopyranoside | 1186583-15-2 | 1g |
| GC6223-2g | Ethyl 3-O-allyl-4,6-O-benzylidene-1-thio-β-D-glucopyranoside | 1186583-15-2 | 2g |
| GC6223-5g | Ethyl 3-O-allyl-4,6-O-benzylidene-1-thio-β-D-glucopyranoside | 1186583-15-2 | 5g |
| GC6223-10g | Ethyl 3-O-allyl-4,6-O-benzylidene-1-thio-β-D-glucopyranoside | 1186583-15-2 | 10g |
| GC1543-500mg | Ethyl 3-O-allyl-4,6-O-benzylidene-2-O-levulinoyl-1-thio-β-D-glucopyranoside | 1186583-16-3 | 500mg |
| GC1543-1g | Ethyl 3-O-allyl-4,6-O-benzylidene-2-O-levulinoyl-1-thio-β-D-glucopyranoside | 1186583-16-3 | 1g |
| GC1543-2g | Ethyl 3-O-allyl-4,6-O-benzylidene-2-O-levulinoyl-1-thio-β-D-glucopyranoside | 1186583-16-3 | 2g |
| GC1543-5g | Ethyl 3-O-allyl-4,6-O-benzylidene-2-O-levulinoyl-1-thio-β-D-glucopyranoside | 1186583-16-3 | 5g |
| GC7343-100mg | Ethyl 3-O-allyl-4,6-O-benzylidene-2-O-naphthylmethyl-1-thio-β-D-glucopyranoside | 100mg | |
| GC7343-250mg | Ethyl 3-O-allyl-4,6-O-benzylidene-2-O-naphthylmethyl-1-thio-β-D-glucopyranoside | 250mg | |
| GC7343-500mg | Ethyl 3-O-allyl-4,6-O-benzylidene-2-O-naphthylmethyl-1-thio-β-D-glucopyranoside | 500mg | |
| GC7343-1g | Ethyl 3-O-allyl-4,6-O-benzylidene-2-O-naphthylmethyl-1-thio-β-D-glucopyranoside | 1g | |
| GC4046-500mg | Ethyl 3-O-benzyl-1-thio-β-D-glucopyranoside | 884844-03-5 | 500mg |
| GC4046-1g | Ethyl 3-O-benzyl-1-thio-β-D-glucopyranoside | 884844-03-5 | 1g |
| GC4046-2g | Ethyl 3-O-benzyl-1-thio-β-D-glucopyranoside | 884844-03-5 | 2g |
| GC4046-5g | Ethyl 3-O-benzyl-1-thio-β-D-glucopyranoside | 884844-03-5 | 5g |
| GC4046-10g | Ethyl 3-O-benzyl-1-thio-β-D-glucopyranoside | 884844-03-5 | 10g |
| GC4833-100mg | Ethyl 3-O-benzyl-2-O-(4-methoxybenzyl)-1-thio-β-D-glucopyranosiduronic acid benzyl ester | 100mg | |
| GC4833-250mg | Ethyl 3-O-benzyl-2-O-(4-methoxybenzyl)-1-thio-β-D-glucopyranosiduronic acid benzyl ester | 250mg | |
| GC4833-500mg | Ethyl 3-O-benzyl-2-O-(4-methoxybenzyl)-1-thio-β-D-glucopyranosiduronic acid benzyl ester | 500mg | |
| GC4833-1g | Ethyl 3-O-benzyl-2-O-(4-methoxybenzyl)-1-thio-β-D-glucopyranosiduronic acid benzyl ester | 1g | |
| GC6484-500mg | Ethyl 3-O-benzyl-2-O-levulinoyl-1-thio-β-D-glucopyranoside | 500mg | |
| GC6484-1g | Ethyl 3-O-benzyl-2-O-levulinoyl-1-thio-β-D-glucopyranoside | 1g | |
| GC6484-2g | Ethyl 3-O-benzyl-2-O-levulinoyl-1-thio-β-D-glucopyranoside | 2g | |
| GC6484-5g | Ethyl 3-O-benzyl-2-O-levulinoyl-1-thio-β-D-glucopyranoside | 5g | |
| GC0503-50mg | Ethyl 3-O-benzyl-2-O-levulinoyl-6-O-trityl-1-thio-β-D-glucopyranoside | 50mg | |
| GC0503-100mg | Ethyl 3-O-benzyl-2-O-levulinoyl-6-O-trityl-1-thio-β-D-glucopyranoside | 100mg | |
| GC0503-250mg | Ethyl 3-O-benzyl-2-O-levulinoyl-6-O-trityl-1-thio-β-D-glucopyranoside | 250mg | |
| GC0503-500mg | Ethyl 3-O-benzyl-2-O-levulinoyl-6-O-trityl-1-thio-β-D-glucopyranoside | 500mg | |
| GC0503-1g | Ethyl 3-O-benzyl-2-O-levulinoyl-6-O-trityl-1-thio-β-D-glucopyranoside | 1g | |
| GC1097-1g | Ethyl 3-O-benzyl-4,6-O-benzylidene-1-thio-β-D-glucopyranoside | 146608-95-9 | 1g |
| GC1097-2g | Ethyl 3-O-benzyl-4,6-O-benzylidene-1-thio-β-D-glucopyranoside | 146608-95-9 | 2g |
| GC1097-5g | Ethyl 3-O-benzyl-4,6-O-benzylidene-1-thio-β-D-glucopyranoside | 146608-95-9 | 5g |
| GC1097-10g | Ethyl 3-O-benzyl-4,6-O-benzylidene-1-thio-β-D-glucopyranoside | 146608-95-9 | 10g |
| GC3904-500mg | Ethyl 3-O-benzyl-4,6-O-benzylidene-2-O-levulinoyl-1-thio-β-D-glucopyranoside | 889129-00-4 | 500mg |
| GC3904-1g | Ethyl 3-O-benzyl-4,6-O-benzylidene-2-O-levulinoyl-1-thio-β-D-glucopyranoside | 889129-00-4 | 1g |
| GC3904-2g | Ethyl 3-O-benzyl-4,6-O-benzylidene-2-O-levulinoyl-1-thio-β-D-glucopyranoside | 889129-00-4 | 2g |
| GC3904-5g | Ethyl 3-O-benzyl-4,6-O-benzylidene-2-O-levulinoyl-1-thio-β-D-glucopyranoside | 889129-00-4 | 5g |
| GC6962-500mg | Ethyl 3,4-di-O-acetyl-2-deoxy-2-phthalimido-1-thio-β-D-glucopyranoside | 131545-00-1 | 500mg |
| GC6962-1g | Ethyl 3,4-di-O-acetyl-2-deoxy-2-phthalimido-1-thio-β-D-glucopyranoside | 131545-00-1 | 1g |
| GC6962-2g | Ethyl 3,4-di-O-acetyl-2-deoxy-2-phthalimido-1-thio-β-D-glucopyranoside | 131545-00-1 | 2g |
| GC6962-5g | Ethyl 3,4-di-O-acetyl-2-deoxy-2-phthalimido-1-thio-β-D-glucopyranoside | 131545-00-1 | 5g |
| GC7887-100mg | Ethyl 3,4-di-O-benzyl-2-O-levulinoyl-1-thio-β-D-glucopyranosiduronic acid benzyl ester | 100mg | |
| GC7887-250mg | Ethyl 3,4-di-O-benzyl-2-O-levulinoyl-1-thio-β-D-glucopyranosiduronic acid benzyl ester | 250mg | |
| GC7887-500mg | Ethyl 3,4-di-O-benzyl-2-O-levulinoyl-1-thio-β-D-glucopyranosiduronic acid benzyl ester | 500mg | |
| GC7887-1g | Ethyl 3,4-di-O-benzyl-2-O-levulinoyl-1-thio-β-D-glucopyranosiduronic acid benzyl ester | 1g | |
| GC3581-250mg | Ethyl 3,4-O-isopropylidene-1-thio-β-D-galactopyranoside | 172146-95-1 | 250mg |
| GC3581-500mg | Ethyl 3,4-O-isopropylidene-1-thio-β-D-galactopyranoside | 172146-95-1 | 500mg |
| GC3581-1g | Ethyl 3,4-O-isopropylidene-1-thio-β-D-galactopyranoside | 172146-95-1 | 1g |
| GC3581-2g | Ethyl 3,4-O-isopropylidene-1-thio-β-D-galactopyranoside | 172146-95-1 | 2g |
| GC3581-5g | Ethyl 3,4-O-isopropylidene-1-thio-β-D-galactopyranoside | 172146-95-1 | 5g |
| GC9636-500mg | Ethyl 3,4,6-tri-O-acetyl-2-deoxy-1-thio-2-trichloroacetylamino-β-D-glucopyranoside | 169557-88-4 | 500mg |
| GC9636-1g | Ethyl 3,4,6-tri-O-acetyl-2-deoxy-1-thio-2-trichloroacetylamino-β-D-glucopyranoside | 169557-88-4 | 1g |
| GC9636-2g | Ethyl 3,4,6-tri-O-acetyl-2-deoxy-1-thio-2-trichloroacetylamino-β-D-glucopyranoside | 169557-88-4 | 2g |
| GC9636-5g | Ethyl 3,4,6-tri-O-acetyl-2-deoxy-1-thio-2-trichloroacetylamino-β-D-glucopyranoside | 169557-88-4 | 5g |
| GC1914-500mg | Ethyl 3,4,6-tri-O-acetyl-2-deoxy-2-phthalimido-b-D-thioglucopyranoside | 99409-32-2 | 500mg |
| GC1914-1g | Ethyl 3,4,6-tri-O-acetyl-2-deoxy-2-phthalimido-b-D-thioglucopyranoside | 99409-32-2 | 1g |
| GC1914-2g | Ethyl 3,4,6-tri-O-acetyl-2-deoxy-2-phthalimido-b-D-thioglucopyranoside | 99409-32-2 | 2g |
| GC1914-5g | Ethyl 3,4,6-tri-O-acetyl-2-deoxy-2-phthalimido-b-D-thioglucopyranoside | 99409-32-2 | 5g |
| GC1914-10g | Ethyl 3,4,6-tri-O-acetyl-2-deoxy-2-phthalimido-b-D-thioglucopyranoside | 99409-32-2 | 10g |
| GC3959-500mg | Ethyl 3,4,6-tri-O-benzyl-1-thio-β-D-galactopyranoside | 162600-08-0 | 500mg |
| GC3959-1g | Ethyl 3,4,6-tri-O-benzyl-1-thio-β-D-galactopyranoside | 162600-08-0 | 1g |
| GC3959-2g | Ethyl 3,4,6-tri-O-benzyl-1-thio-β-D-galactopyranoside | 162600-08-0 | 2g |
| GC3959-5g | Ethyl 3,4,6-tri-O-benzyl-1-thio-β-D-galactopyranoside | 162600-08-0 | 5g |
| GK5881-1kg | Ethyl 4-hydroxybenzoate sodium salt, Ph. Eur. grade | 35285-68-8 | 1kg |
| GK5881-5kg | Ethyl 4-hydroxybenzoate sodium salt, Ph. Eur. grade | 35285-68-8 | 5kg |
| GX1191-100g | Ethyl 4-hydroxybenzoate, 99% | 120-47-8 | 100g |
| GX1191-250g | Ethyl 4-hydroxybenzoate, 99% | 120-47-8 | 250g |
| GX1191-500g | Ethyl 4-hydroxybenzoate, 99% | 120-47-8 | 500g |
| GX1191-1kg | Ethyl 4-hydroxybenzoate, 99% | 120-47-8 | 1kg |
| GK8938-1kg | Ethyl 4-hydroxybenzoate, Ph. Eur. grade | 120-47-8 | 1kg |
| GC3623-100mg | Ethyl 4-O-allyl-3,6-di-O-benzyl-2-O-levulinoyl-1-thio-β-D-glucopyranoside | 100mg | |
| GC3623-250mg | Ethyl 4-O-allyl-3,6-di-O-benzyl-2-O-levulinoyl-1-thio-β-D-glucopyranoside | 250mg | |
| GC3623-500mg | Ethyl 4-O-allyl-3,6-di-O-benzyl-2-O-levulinoyl-1-thio-β-D-glucopyranoside | 500mg | |
| GC3623-1g | Ethyl 4-O-allyl-3,6-di-O-benzyl-2-O-levulinoyl-1-thio-β-D-glucopyranoside | 1g | |
| GC8375-1g | Ethyl 4,6-O-benzylidene-b-D-thiogalactopyranoside | 56119-28-9 | 1g |
| GC8375-2g | Ethyl 4,6-O-benzylidene-b-D-thiogalactopyranoside | 56119-28-9 | 2g |
| GC8375-5g | Ethyl 4,6-O-benzylidene-b-D-thiogalactopyranoside | 56119-28-9 | 5g |
| GC8375-10g | Ethyl 4,6-O-benzylidene-b-D-thiogalactopyranoside | 56119-28-9 | 10g |
| GC8375-25g | Ethyl 4,6-O-benzylidene-b-D-thiogalactopyranoside | 56119-28-9 | 25g |
| GK9497-250ml | Ethyl acetate | 141-78-6 | 250ml |
| GK9497-500ml | Ethyl acetate | 141-78-6 | 500ml |
| GK9497-1l | Ethyl acetate | 141-78-6 | 1l |
| GK9497-2500ml | Ethyl acetate | 141-78-6 | 2500ml |
| GK9497-5l | Ethyl acetate | 141-78-6 | 5l |
| GS7058-100ml | Ethyl Acetate, GlenDry™, anhydrous | 141-78-6 | 100ml |
| GS7058-500ml | Ethyl Acetate, GlenDry™, anhydrous | 141-78-6 | 500ml |
| GS7058-1l | Ethyl Acetate, GlenDry™, anhydrous | 141-78-6 | 1l |
| GS7058-2500ml | Ethyl Acetate, GlenDry™, anhydrous | 141-78-6 | 2500ml |
| GS4125-100ml | Ethyl Acetate, GlenDry™, anhydrous over molecular sieve | 141-78-6 | 100ml |
| GS4125-500ml | Ethyl Acetate, GlenDry™, anhydrous over molecular sieve | 141-78-6 | 500ml |
| GS4125-1l | Ethyl Acetate, GlenDry™, anhydrous over molecular sieve | 141-78-6 | 1l |
| GS4125-2500ml | Ethyl Acetate, GlenDry™, anhydrous over molecular sieve | 141-78-6 | 2500ml |
| GS6927-500ml | Ethyl Acetate, GlenPure™, analytical grade | 141-78-6 | 500ml |
| GS6927-1l | Ethyl Acetate, GlenPure™, analytical grade | 141-78-6 | 1l |
| GS6927-2500ml | Ethyl Acetate, GlenPure™, analytical grade | 141-78-6 | 2500ml |
| GS0494-2500ml | Ethyl Acetate, GlenUltra™, analytical grade, for LC | 141-78-6 | 2500ml |
| GW4571-5g | Ethyl azidoacetate | 637-81-0 | 5g |
| GW4571-25g | Ethyl azidoacetate | 637-81-0 | 25g |
| GW9984-25ml | Ethyl azidoacetate Solution 25% in ethanol | 637-81-0 | 25ml |
| GW2091-25ml | Ethyl azidoacetate Solution, 25% in toluene | 637-81-0 | 25ml |
| GW0665-25ml | Ethyl azidoacetate Solution, 30% in methylene chloride | 637-81-0 | 25ml |
| GL4777-5g | Ethyl benzoate | 93-89-0 | 5g |
| GL4777-25g | Ethyl benzoate | 93-89-0 | 25g |
| GK7759-25g | Ethyl bromodifluoroacetate | 667-27-6 | 25g |
| GK4787-25g | Ethyl carbazate | 4114-31-2 | 25g |
| GK4787-100g | Ethyl carbazate | 4114-31-2 | 100g |
| GK4787-250g | Ethyl carbazate | 4114-31-2 | 250g |
| GC4298-100g | Ethyl cellulose, 100 cP | 9004-57-3 | 100g |
| GC4298-500g | Ethyl cellulose, 100 cP | 9004-57-3 | 500g |
| GT8354-5g | Ethyl eosin | 6359-05-3 | 5g |
| GT8354-25g | Ethyl eosin | 6359-05-3 | 25g |
| GT8354-50g | Ethyl eosin | 6359-05-3 | 50g |
| GT8354-100g | Ethyl eosin | 6359-05-3 | 100g |
| GK4257-100ml | Ethyl formate | 109-94-4 | 100ml |
| GK4257-250ml | Ethyl formate | 109-94-4 | 250ml |
| GK4257-500ml | Ethyl formate | 109-94-4 | 500ml |
| GK4257-1l | Ethyl formate | 109-94-4 | 1l |
| GW7721-5g | Ethyl fumaroyl chloride | 26367-48-6 | 5g |
| GK3846-100g | Ethyl glyoxylate, 50% solution in toluene | 924-44-7 | 100g |
| GX3522-1kg | Ethyl Lactate | 97-64-3 | 1kg |
| GX0837-25g | Ethyl maltol | 4940-11-8 | 25g |
| GX0837-100g | Ethyl maltol | 4940-11-8 | 100g |
| GX0446-5g | Ethyl methanesulfonate | 62-50-0 | 5g |
| GX0446-10g | Ethyl methanesulfonate | 62-50-0 | 10g |
| GX0446-25g | Ethyl methanesulfonate | 62-50-0 | 25g |
| GX0446-100g | Ethyl methanesulfonate | 62-50-0 | 100g |
| GK6290-100g | Ethyl nicotinate | 614-18-6 | 100g |
| GK7670-100ml | Ethyl oleate | 111-62-6 | 100ml |
| GK7670-1l | Ethyl oleate | 111-62-6 | 1l |
| GT4651-25g | Ethyl Orange sodium salt | 62758-12-7 | 25g |
| GT4651-100g | Ethyl Orange sodium salt | 62758-12-7 | 100g |
| GW7673-25g | Ethyl pentafluoropropionate | 426-65-3 | 25g |
| GK2643-25ml | Ethyl propionate | 105-37-3 | 25ml |
| GK2643-500ml | Ethyl propionate | 105-37-3 | 500ml |
| GT2065-25g | Ethyl Violet (C.I. 42600) | 2390-59-2 | 25g |
| GT2065-100g | Ethyl Violet (C.I. 42600) | 2390-59-2 | 100g |
| GC3831-10mg | Ethyl β-D-cellobioside | 528577-66-4 | 10mg |
| GC3831-25mg | Ethyl β-D-cellobioside | 528577-66-4 | 25mg |
| GC3831-50mg | Ethyl β-D-cellobioside | 528577-66-4 | 50mg |
| GC3831-100mg | Ethyl β-D-cellobioside | 528577-66-4 | 100mg |
| GC9652-100mg | Ethyl β-D-cellobioside heptaacetate | 107243-31-2 | 100mg |
| GC9652-250mg | Ethyl β-D-cellobioside heptaacetate | 107243-31-2 | 250mg |
| GC9652-500mg | Ethyl β-D-cellobioside heptaacetate | 107243-31-2 | 500mg |
| GC9652-1g | Ethyl β-D-cellobioside heptaacetate | 107243-31-2 | 1g |
| GC3642-10mg | Ethyl β-D-galactopyranoside | 18997-88-1 | 10mg |
| GC3642-25mg | Ethyl β-D-galactopyranoside | 18997-88-1 | 25mg |
| GC3642-50mg | Ethyl β-D-galactopyranoside | 18997-88-1 | 50mg |
| GC3642-100mg | Ethyl β-D-galactopyranoside | 18997-88-1 | 100mg |
| GC1447-1g | Ethyl β-D-Thiogalactopyranoside | 56245-60-4 | 1g |
| GC1447-2g | Ethyl β-D-Thiogalactopyranoside | 56245-60-4 | 2g |
| GC1447-5g | Ethyl β-D-Thiogalactopyranoside | 56245-60-4 | 5g |
| GC1447-10g | Ethyl β-D-Thiogalactopyranoside | 56245-60-4 | 10g |
| GC1447-25g | Ethyl β-D-Thiogalactopyranoside | 56245-60-4 | 25g |
| GX8942-25g | Ethyl-2-bromoisovalerate | 609-12-1 | 25g |
| GK7641-100ml | Ethylene glycol | 107-21-1 | 100ml |
| GK7641-500ml | Ethylene glycol | 107-21-1 | 500ml |
| GK7641-1l | Ethylene glycol | 107-21-1 | 1l |
| GK7641-5l | Ethylene glycol | 107-21-1 | 5l |
| GK2138-5g | Ethylene glycol monohexyl ether | 112-25-4 | 5g |
| GK5741-25ml | Ethylenediamine | 107-15-3 | 25ml |
| GK5741-100ml | Ethylenediamine | 107-15-3 | 100ml |
| GK6724-100g | Ethylenediamine dihydrochloride | 333-18-6 | 100g |
| GP3560-1g | Etidronate disodium salt | 7414-83-7 | 1g |
| GK9830-25g | Etidronic acid monohydrate | 25211-86-3 | 25g |
| GK9830-100g | Etidronic acid monohydrate | 25211-86-3 | 100g |
| GW5449-25mg | Etobenzanid | 79540-50-4 | 25mg |
| GW5449-100mg | Etobenzanid | 79540-50-4 | 100mg |
| GP1738-100mg | Etodolac | 41340-25-4 | 100mg |
| GP6181-250mg | Etofenamate | 30544-47-9 | 250mg |
| GP6181-1g | Etofenamate | 30544-47-9 | 1g |
| GL9418-10mg | Etomidate | 33125-97-2 | 10mg |
| GC1751-1mg | Etonogestrel 17-O-β-D-glucuronide | 1mg | |
| GC1751-2mg | Etonogestrel 17-O-β-D-glucuronide | 2mg | |
| GC1751-5mg | Etonogestrel 17-O-β-D-glucuronide | 5mg | |
| GC1751-10mg | Etonogestrel 17-O-β-D-glucuronide | 10mg | |
| GA8194-25mg | Etoposide | 33419-42-0 | 25mg |
| GA8194-100mg | Etoposide | 33419-42-0 | 100mg |
| GP7329-25mg | Etoricoxib | 202409-33-4 | 25mg |
| GP7329-100mg | Etoricoxib | 202409-33-4 | 100mg |
| GW3400-100mg | Etoxazole | 153233-91-1 | 100mg |
| GW3400-250mg | Etoxazole | 153233-91-1 | 250mg |
| GW3400-1g | Etoxazole | 153233-91-1 | 1g |
| GK9909-5ml | Eugenol | 97-53-0 | 5ml |
| GK9909-25ml | Eugenol | 97-53-0 | 25ml |
| GL0095-5mg | Eupatilin | 22368-21-4 | 5mg |
| GL0095-25mg | Eupatilin | 22368-21-4 | 25mg |
| GY2280-1mg | Euphol | 514-47-6 | 1mg |
| GY2280-5mg | Euphol | 514-47-6 | 5mg |
| GY2280-25mg | Euphol | 514-47-6 | 25mg |
| GX2865-5g | Europium acetate hydrate, 99.999% | 62667-64-5 | 5g |
| GX2865-10g | Europium acetate hydrate, 99.999% | 62667-64-5 | 10g |
| GX5832-5g | Europium carbonate hydrate, 99.9% | 86546-99-8 | 5g |
| GX5832-10g | Europium carbonate hydrate, 99.9% | 86546-99-8 | 10g |
| GX9779-10g | Europium carbonate hydrate, 99.999% | 86546-99-8 | 10g |
| GX3876-5g | Europium chloride hydrate, 99.9% | 13759-92-7 | 5g |
| GX3876-25g | Europium chloride hydrate, 99.9% | 13759-92-7 | 25g |
| GX2404-5g | Europium chloride hydrate, 99.999% | 13759-92-7 | 5g |
| GX2404-25g | Europium chloride hydrate, 99.999% | 13759-92-7 | 25g |
| GX9209-1g | Europium D-3-trifluoroacetylcamphorate | 34830-11-0 | 1g |
| GX1197-5g | Europium fluoride anhydrous, 99.9% | 13765-25-8 | 5g |
| GX1197-25g | Europium fluoride anhydrous, 99.9% | 13765-25-8 | 25g |
| GX9328-1g | Europium fluoride anhydrous, 99.999% | 13765-25-8 | 1g |
| GX9328-5g | Europium fluoride anhydrous, 99.999% | 13765-25-8 | 5g |
| GX9328-25g | Europium fluoride anhydrous, 99.999% | 13765-25-8 | 25g |
| GX5469-2g | Europium nitrate hexahydrate, 99.9% | 10031-53-5 | 2g |
| GX5469-5g | Europium nitrate hexahydrate, 99.9% | 10031-53-5 | 5g |
| GX5469-25g | Europium nitrate hexahydrate, 99.9% | 10031-53-5 | 25g |
| GX9920-10g | Europium oxalate hydrate, 99.9% | 3269-12-3 | 10g |
| GX9920-50g | Europium oxalate hydrate, 99.9% | 3269-12-3 | 50g |
| GX2616-5g | Europium oxide, 99.9% | 1308-96-9 | 5g |
| GX2616-25g | Europium oxide, 99.9% | 1308-96-9 | 25g |
| GX9376-1g | Europium oxide, 99.99+% | 1308-96-9 | 1g |
| GX9376-5g | Europium oxide, 99.99+% | 1308-96-9 | 5g |
| GX9376-25g | Europium oxide, 99.99+% | 1308-96-9 | 25g |
| GX9376-100g | Europium oxide, 99.99+% | 1308-96-9 | 100g |
| GX7218-1g | Europium oxide, 99.999+% | 1308-96-9 | 1g |
| GX7218-5g | Europium oxide, 99.999+% | 1308-96-9 | 5g |
| GX7218-25g | Europium oxide, 99.999+% | 1308-96-9 | 25g |
| GX9979-5g | Europium Pieces distilled, 99.99% | 7440-53-1 | 5g |
| GX9979-10g | Europium Pieces distilled, 99.99% | 7440-53-1 | 10g |
| GX6710-1g | Europium Pieces, 99.9% (partially oxidized, under mineral oil) | 7440-53-1 | 1g |
| GX6710-5g | Europium Pieces, 99.9% (partially oxidized, under mineral oil) | 7440-53-1 | 5g |
| GX6834-10g | Europium sulfate hydrate, 99.999% | 20814-06-6 | 10g |
| GX4035-1g | Europium-fod | 17631-68-4 | 1g |
| GX1796-1g | Europium-thd | 15522-71-1 | 1g |
| GT1064-10g | Evans Blue (C.I. 23860) | 314-13-6 | 10g |
| GT1064-25g | Evans Blue (C.I. 23860) | 314-13-6 | 25g |
| GT1064-50g | Evans Blue (C.I. 23860) | 314-13-6 | 50g |
| GT1064-100g | Evans Blue (C.I. 23860) | 314-13-6 | 100g |
| GP1203-1mg | Everolimus | 159351-69-6 | 1mg |
| GP1203-5mg | Everolimus | 159351-69-6 | 5mg |
| GP1203-25mg | Everolimus | 159351-69-6 | 25mg |
| GP1203-1ml | Everolimus | 159351-69-6 | 1ml |
| GP6452-250mg | Exemestane | 107868-30-4 | 250mg |
| GP6452-500mg | Exemestane | 107868-30-4 | 500mg |
| GP6452-1g | Exemestane | 107868-30-4 | 1g |
| GP8120-25mg | Ezetimibe | 163222-33-1 | 25mg |
| GP8120-100mg | Ezetimibe | 163222-33-1 | 100mg |
| GP8120-250mg | Ezetimibe | 163222-33-1 | 250mg |
| GC0776-1mg | Ezetimibe b-D-glucuronide | 190448-57-8 | 1mg |
| GC0776-2mg | Ezetimibe b-D-glucuronide | 190448-57-8 | 2mg |
| GC0776-5mg | Ezetimibe b-D-glucuronide | 190448-57-8 | 5mg |
| GC0776-10mg | Ezetimibe b-D-glucuronide | 190448-57-8 | 10mg |
| GW8230-10mg | FAMC | 127192-67-0 | 10mg |
| GW8230-50mg | FAMC | 127192-67-0 | 50mg |
| GP8401-100mg | Famciclovir | 104227-87-4 | 100mg |
| GP8401-1g | Famciclovir | 104227-87-4 | 1g |
| GP1586-1g | Famotidine | 76824-35-6 | 1g |
| GP1586-5g | Famotidine | 76824-35-6 | 5g |
| GP1586-25g | Famotidine | 76824-35-6 | 25g |
| GA3330-10mg | Faropenem sodium salt | 122547-49-3 | 10mg |
| GA3330-250mg | Faropenem sodium salt | 122547-49-3 | 250mg |
| GT6286-25g | Fast Black K salt hemi zinc chloride | 64071-86-9 | 25g |
| GT7674-10g | Fast Blue B salt | 14263-94-6 | 10g |
| GT7674-25g | Fast Blue B salt | 14263-94-6 | 25g |
| GT7674-100g | Fast Blue B salt | 14263-94-6 | 100g |
| GT8040-5g | Fast Blue BB (C.I. 37175) | 120-00-3 | 5g |
| GT8040-25g | Fast Blue BB (C.I. 37175) | 120-00-3 | 25g |
| GT8040-100g | Fast Blue BB (C.I. 37175) | 120-00-3 | 100g |
| GT5977-1g | Fast Blue BB salt | 5486-84-0 | 1g |
| GT5977-5g | Fast Blue BB salt | 5486-84-0 | 5g |
| GT5977-10g | Fast Blue BB salt | 5486-84-0 | 10g |
| GT5977-25g | Fast Blue BB salt | 5486-84-0 | 25g |
| GT5977-100g | Fast Blue BB salt | 5486-84-0 | 100g |
| GT4853-100g | Fast Garnet GBC base | 97-56-3 | 100g |
| GT4853-500g | Fast Garnet GBC base | 97-56-3 | 500g |
| GT3407-5g | Fast Green FCF (C.I. 42053) | 2353-45-9 | 5g |
| GT3407-10g | Fast Green FCF (C.I. 42053) | 2353-45-9 | 10g |
| GT3407-25g | Fast Green FCF (C.I. 42053) | 2353-45-9 | 25g |
| GT3407-100g | Fast Green FCF (C.I. 42053) | 2353-45-9 | 100g |
| GX5533-3x100ml | Fast Panoptic Staining Kit for Haematology (RUO) | - | 3x100ml |
| GX5533-3x500ml | Fast Panoptic Staining Kit for Haematology (RUO) | - | 3x500ml |
| GT5711-5g | Fast Red KL salt | 86780-25-8 | 5g |
| GT5711-10g | Fast Red KL salt | 86780-25-8 | 10g |
| GT5711-25g | Fast Red KL salt | 86780-25-8 | 25g |
| GT3891-25g | Fast Red RC salt | 68025-25-2 | 25g |
| GT1478-1g | Fast Red TR hemi(zinc chloride) salt | 89453-69-0 | 1g |
| GT1478-5g | Fast Red TR hemi(zinc chloride) salt | 89453-69-0 | 5g |
| GT6181-25g | Fast Sulphon Black F (C.I. 26990) | 3682-47-1 | 25g |
| GT4837-25g | Fat Brown B | 6535-42-8 | 25g |
| GT3248-100g | Fat Brown RR | 6416-57-5 | 100g |
| GW0159-5mg | Favipiravir | 259793-96-9 | 5mg |
| GW0159-25mg | Favipiravir | 259793-96-9 | 25mg |
| GP4754-1g | Febuxostat | 144060-53-7 | 1g |
| GC3926-1mg | Febuxostat acyl-β-D-glucuronide | 1351692-92-6 | 1mg |
| GC3926-2mg | Febuxostat acyl-β-D-glucuronide | 1351692-92-6 | 2mg |
| GC3926-5mg | Febuxostat acyl-β-D-glucuronide | 1351692-92-6 | 5mg |
| GC3926-10mg | Febuxostat acyl-β-D-glucuronide | 1351692-92-6 | 10mg |
| GP8252-1g | Felodipine | 72509-76-3 | 1g |
| GP8252-5g | Felodipine | 72509-76-3 | 5g |
| GP4784-5g | Fenbendazole | 43210-67-9 | 5g |
| GP4784-10g | Fenbendazole | 43210-67-9 | 10g |
| GP4784-25g | Fenbendazole | 43210-67-9 | 25g |
| GP4850-5g | Fenofibrate | 49562-28-9 | 5g |
| GP4850-25g | Fenofibrate | 49562-28-9 | 25g |
| GP4336-1g | Fenofibric acid | 42017-89-0 | 1g |
| GP4336-5g | Fenofibric acid | 42017-89-0 | 5g |
| GC1783-1mg | Fenofibryl D-glucuronide | 60318-63-0 | 1mg |
| GC1783-2mg | Fenofibryl D-glucuronide | 60318-63-0 | 2mg |
| GC1783-5mg | Fenofibryl D-glucuronide | 60318-63-0 | 5mg |
| GC1783-10mg | Fenofibryl D-glucuronide | 60318-63-0 | 10mg |
| GP8749-25mg | Fenoldopam mesylate | 67227-57-0 | 25mg |
| GP8749-100mg | Fenoldopam mesylate | 67227-57-0 | 100mg |
| GC6842-1mg | Fenoprofen acyl-β-D-glucuronide | 35440-36-9 | 1mg |
| GC6842-5mg | Fenoprofen acyl-β-D-glucuronide | 35440-36-9 | 5mg |
| GC6842-10mg | Fenoprofen acyl-β-D-glucuronide | 35440-36-9 | 10mg |
| GC6842-25mg | Fenoprofen acyl-β-D-glucuronide | 35440-36-9 | 25mg |
| GC0166-1mg | Fenoprofen-d9 acyl-β-D-glucuronide | 1mg | |
| GC0166-2mg | Fenoprofen-d9 acyl-β-D-glucuronide | 2mg | |
| GC0166-5mg | Fenoprofen-d9 acyl-β-D-glucuronide | 5mg | |
| GP8861-10mg | Fenretinide | 65646-68-6 | 10mg |
| GP8861-25mg | Fenretinide | 65646-68-6 | 25mg |
| GP1083-100mg | Fenticonazole nitrate | 73151-29-8 | 100mg |
| GP1083-250mg | Fenticonazole nitrate | 73151-29-8 | 250mg |
| GL6974-5g | Fenvalerate | 51630-58-1 | 5g |
| GL6974-25g | Fenvalerate | 51630-58-1 | 25g |
| GW0492-100mg | Ferimzone | 89269-64-7 | 100mg |
| GW0492-500mg | Ferimzone | 89269-64-7 | 500mg |
| GX4516-5g | Ferrocene | 102-54-5 | 5g |
| GX4516-25g | Ferrocene | 102-54-5 | 25g |
| GC7340-100g | Ferrous L-lactate | 5905-52-2 | 100g |
| GC7340-500g | Ferrous L-lactate | 5905-52-2 | 500g |
| GC7340-1kg | Ferrous L-lactate | 5905-52-2 | 1kg |
| GT7999-5g | Ferrozine | 69898-45-9 | 5g |
| GT7999-10g | Ferrozine | 69898-45-9 | 10g |
| GT7999-25g | Ferrozine | 69898-45-9 | 25g |
| GP6734-5g | Ferulic acid | 1135-24-6 | 5g |
| GP6734-25g | Ferulic acid | 1135-24-6 | 25g |
| GP6734-100g | Ferulic acid | 1135-24-6 | 100g |
| GP5447-250mg | Fexofenadine hydrochloride | 153439-40-8 | 250mg |
| GP5447-1g | Fexofenadine hydrochloride | 153439-40-8 | 1g |
| GP5447-5g | Fexofenadine hydrochloride | 153439-40-8 | 5g |
| GA3227-25mg | Fidaxomicin | 873857-62-6 | 25mg |
| GA3227-100mg | Fidaxomicin | 873857-62-6 | 100mg |
| GP8835-25mg | Finasteride | 98319-26-7 | 25mg |
| GP8835-100mg | Finasteride | 98319-26-7 | 100mg |
| GP8835-250mg | Finasteride | 98319-26-7 | 250mg |
| GP8835-500mg | Finasteride | 98319-26-7 | 500mg |
| GP8835-1g | Finasteride | 98319-26-7 | 1g |
| GP1210-1g | Finasteride, USP grade | 98319-26-7 | 1g |
| GW3619-1mg | FINDY | 1507367-37-4 | 1mg |
| GW3619-5mg | FINDY | 1507367-37-4 | 5mg |
| GP3498-10mg | Fingolimod hydrochloride | 162359-56-0 | 10mg |
| GP3498-25mg | Fingolimod hydrochloride | 162359-56-0 | 25mg |
| GP3498-100mg | Fingolimod hydrochloride | 162359-56-0 | 100mg |
| GK6304-100mg | Fipronil | 120068-37-3 | 100mg |
| GK6304-1g | Fipronil | 120068-37-3 | 1g |
| GL7384-100mg | Fisetin | 345909-34-4 | 100mg |
| GY3086-1g | Fisetin, 90% | 528-48-3 | 1g |
| GY3086-5g | Fisetin, 90% | 528-48-3 | 5g |
| GK6971-1mg | FK-506 monohydrate | 109581-93-3 | 1mg |
| GK6971-5mg | FK-506 monohydrate | 109581-93-3 | 5mg |
| GK6971-25mg | FK-506 monohydrate | 109581-93-3 | 25mg |
| GL7680-1mg | FK-866 | 658084-64-1 | 1mg |
| GL7680-5mg | FK-866 | 658084-64-1 | 5mg |
| GV4061-50mg | Flavin adenine dinucleotide disodium salt hydrate | 84366-81-4 | 50mg |
| GV4061-250mg | Flavin adenine dinucleotide disodium salt hydrate | 84366-81-4 | 250mg |
| GV4061-1g | Flavin adenine dinucleotide disodium salt hydrate | 84366-81-4 | 1g |
| GP3700-100mg | Flecainide acetate salt | 54143-56-5 | 100mg |
| GP3700-250mg | Flecainide acetate salt | 54143-56-5 | 250mg |
| GP3700-1g | Flecainide acetate salt | 54143-56-5 | 1g |
| GA2775-1g | Fleroxacin | 79660-72-3 | 1g |
| GA2775-25g | Fleroxacin | 79660-72-3 | 25g |
| GW2705-5mg | Flibanserin | 167933-07-5 | 5mg |
| GW2705-25mg | Flibanserin | 167933-07-5 | 25mg |
| GA3827-500mg | Florfenicol | 73231-34-2 | 500mg |
| GA3827-1g | Florfenicol | 73231-34-2 | 1g |
| GC8043-5mg | Floridoside | 534-68-9 | 5mg |
| GC8043-10mg | Floridoside | 534-68-9 | 10mg |
| GC8043-25mg | Floridoside | 534-68-9 | 25mg |
| GC8043-50mg | Floridoside | 534-68-9 | 50mg |
| GC8043-100mg | Floridoside | 534-68-9 | 100mg |
| GX7568-500g | Florisil, 30 - 60 mesh | 1343-88-0 | 500g |
| GE3010-100g | Florisil, 60 - 100 mesh | 1343-88-0 | 100g |
| GE3010-250g | Florisil, 60 - 100 mesh | 1343-88-0 | 250g |
| GP4098-100mg | Floxuridine | 50-91-9 | 100mg |
| GP4098-250mg | Floxuridine | 50-91-9 | 250mg |
| GP4098-500mg | Floxuridine | 50-91-9 | 500mg |
| GW8182-10mg | Fluazifop | 69335-91-7 | 10mg |
| GW2901-2ml | Fluazifop solution 10 µg/ml in ethyl acetate | 69335-91-7 | 2ml |
| GA1291-5g | Flubendazole | 31430-15-6 | 5g |
| GA1291-25g | Flubendazole | 31430-15-6 | 25g |
| GA4540-5g | Flubendazole, Ph. Eur. grade | 31430-15-6 | 5g |
| GA1968-1g | Flucloxacillin sodium salt | 1847-24-1 | 1g |
| GA1968-5g | Flucloxacillin sodium salt | 1847-24-1 | 5g |
| GA4147-100mg | Fluconazole | 86386-73-4 | 100mg |
| GA4147-1g | Fluconazole | 86386-73-4 | 1g |
| GA4147-5g | Fluconazole | 86386-73-4 | 5g |
| GP0418-25mg | Fludarabine phosphate | 75607-67-9 | 25mg |
| GL8956-1g | Fludrocortisone acetate | 514-36-3 | 1g |
| GL8956-5g | Fludrocortisone acetate | 514-36-3 | 5g |
| GX9953-100mg | Flufenacet | 142459-58-3 | 100mg |
| GP1380-25mg | Flumazenil | 78755-81-4 | 25mg |
| GP1380-100mg | Flumazenil | 78755-81-4 | 100mg |
| GP1380-250mg | Flumazenil | 78755-81-4 | 250mg |
| GA3854-1g | Flumequine | 42835-25-6 | 1g |
| GA3854-5g | Flumequine | 42835-25-6 | 5g |
| GA3854-10g | Flumequine | 42835-25-6 | 10g |
| GA2414-50mg | Flumethasone | 2135-17-3 | 50mg |
| GA2414-500mg | Flumethasone | 2135-17-3 | 500mg |
| GA2414-1g | Flumethasone | 2135-17-3 | 1g |
| GW1206-100mg | Flumetsulam | 98967-40-9 | 100mg |
| GW1206-1g | Flumetsulam | 98967-40-9 | 1g |
| GW0293-50mg | Flumiclorac | 87547-04-4 | 50mg |
| GW0293-250mg | Flumiclorac | 87547-04-4 | 250mg |
| GW0293-1g | Flumiclorac | 87547-04-4 | 1g |
| GP9404-1g | Flunarizine hydrochloride | 30484-77-6 | 1g |
| GP9404-5g | Flunarizine hydrochloride | 30484-77-6 | 5g |
| GP9404-10g | Flunarizine hydrochloride | 30484-77-6 | 10g |
| GL3822-100mg | Flunixin meglumine | 42461-84-7 | 100mg |
| GL3822-250mg | Flunixin meglumine | 42461-84-7 | 250mg |
| GL3822-500mg | Flunixin meglumine | 42461-84-7 | 500mg |
| GK9773-1mg | Fluo 3-AM suitable for fluorescence | 121714-22-5 | 1mg |
| GK9773-10mg | Fluo 3-AM suitable for fluorescence | 121714-22-5 | 10mg |
| GW2736-1mg | Fluo-3 | 123632-39-3 | 1mg |
| GW2736-5mg | Fluo-3 | 123632-39-3 | 5mg |
| GP1949-100mg | Fluocinolone acetonide | 67-73-2 | 100mg |
| GP1949-1g | Fluocinolone acetonide | 67-73-2 | 1g |
| GP1949-5g | Fluocinolone acetonide | 67-73-2 | 5g |
| GE4837-25g | Fluorene | 86-73-7 | 25g |
| GE4837-100g | Fluorene | 86-73-7 | 100g |
| GT9946-25mg | Fluorescamine | 38183-12-9 | 25mg |
| GT9946-100mg | Fluorescamine | 38183-12-9 | 100mg |
| GT9946-250mg | Fluorescamine | 38183-12-9 | 250mg |
| GT9946-500mg | Fluorescamine | 38183-12-9 | 500mg |
| GT9946-1g | Fluorescamine | 38183-12-9 | 1g |
| GT3509-100g | Fluorescein (C.I. 45350.1) | 2321-07-5 | 100g |
| GT3509-500g | Fluorescein (C.I. 45350.1) | 2321-07-5 | 500g |
| GT8666-100mg | Fluorescein 5(6)-isothiocyanate | 27072-45-3 | 100mg |
| GT8666-250mg | Fluorescein 5(6)-isothiocyanate | 27072-45-3 | 250mg |
| GT8666-1g | Fluorescein 5(6)-isothiocyanate | 27072-45-3 | 1g |
| GT5229-5g | Fluorescein diacetate | 596-09-8 | 5g |
| GT5229-10g | Fluorescein diacetate | 596-09-8 | 10g |
| GT5229-25g | Fluorescein diacetate | 596-09-8 | 25g |
| GT5229-100g | Fluorescein diacetate | 596-09-8 | 100g |
| GW4006-25mg | Fluorescein diacetate 5-u200bmaleimide | 150322-01-3 | 25mg |
| GW4006-100mg | Fluorescein diacetate 5-u200bmaleimide | 150322-01-3 | 100mg |
| GW7708-25mg | Fluorescein diacetate 6-maleimide | 400606-13-5 | 25mg |
| GW8666-5g | Fluorescein dibutyrate | 7298-65-9 | 5g |
| GW8666-25g | Fluorescein dibutyrate | 7298-65-9 | 25g |
| GW0286-1g | Fluorescein dicaproate | 7364-90-1 | 1g |
| GW8115-100mg | Fluorescein dioctanoate | 19722-86-2 | 100mg |
| GW8115-250mg | Fluorescein dioctanoate | 19722-86-2 | 250mg |
| GW0957-1g | Fluorescein dipropionate | 7276-28-0 | 1g |
| GT3648-100mg | Fluorescein isothiocyanate isomer I, 97.5% | 3326-32-7 | 100mg |
| GT3648-250mg | Fluorescein isothiocyanate isomer I, 97.5% | 3326-32-7 | 250mg |
| GT3648-1g | Fluorescein isothiocyanate isomer I, 97.5% | 3326-32-7 | 1g |
| GC4008-5mg | Fluorescein methyl ester β-D-cellobioside | 5mg | |
| GC4008-10mg | Fluorescein methyl ester β-D-cellobioside | 10mg | |
| GC4008-25mg | Fluorescein methyl ester β-D-cellobioside | 25mg | |
| GC4008-50mg | Fluorescein methyl ester β-D-cellobioside | 50mg | |
| GC5422-5mg | Fluorescein methyl ester β-D-glucopyranoside | 1395879-36-3 | 5mg |
| GC5422-10mg | Fluorescein methyl ester β-D-glucopyranoside | 1395879-36-3 | 10mg |
| GC5422-25mg | Fluorescein methyl ester β-D-glucopyranoside | 1395879-36-3 | 25mg |
| GC5422-50mg | Fluorescein methyl ester β-D-glucopyranoside | 1395879-36-3 | 50mg |
| GW3408-50mg | Fluorescein octadecyl ester | 138833-46-2 | 50mg |
| GW3408-500mg | Fluorescein octadecyl ester | 138833-46-2 | 500mg |
| GT1410-100g | Fluorescein sodium salt, 90% (C.I. 45350) | 518-47-8 | 100g |
| GT1410-500g | Fluorescein sodium salt, 90% (C.I. 45350) | 518-47-8 | 500g |
| GT3976-100g | Fluorescein sodium salt, 98% (C.I. 45350) | 518-47-8 | 100g |
| GW8567-50mg | Fluorescein-5-thiosemicarbazide | 76863-28-0 | 50mg |
| GW8567-100mg | Fluorescein-5-thiosemicarbazide | 76863-28-0 | 100mg |
| GW8567-500mg | Fluorescein-5-thiosemicarbazide | 76863-28-0 | 500mg |
| GT9206-250mg | Fluoresceinamine, isomer I | 3326-34-9 | 250mg |
| GT9206-1g | Fluoresceinamine, isomer I | 3326-34-9 | 1g |
| GT9206-10g | Fluoresceinamine, isomer I | 3326-34-9 | 10g |
| GL8131-1g | Fluorescent Brightener 28 | 4404-43-7 | 1g |
| GL8131-5g | Fluorescent Brightener 28 | 4404-43-7 | 5g |
| GL8131-25g | Fluorescent Brightener 28 | 4404-43-7 | 25g |
| GT5235-1g | Fluorescent Brightener 28 sodium salt | 4193-55-9 | 1g |
| GT5235-5g | Fluorescent Brightener 28 sodium salt | 4193-55-9 | 5g |
| GT5235-25g | Fluorescent Brightener 28 sodium salt | 4193-55-9 | 25g |
| GW5754-5g | Fluorescin | 518-44-5 | 5g |
| GW5754-25g | Fluorescin | 518-44-5 | 25g |
| GP8238-250mg | Fluorometholone | 426-13-1 | 250mg |
| GP8238-1g | Fluorometholone | 426-13-1 | 1g |
| GP4431-10mg | Fluoxetine hydrochloride | 56296-78-7 | 10mg |
| GP4431-50mg | Fluoxetine hydrochloride | 56296-78-7 | 50mg |
| GP2994-1g | Fluphenazine hydrochloride | 146-56-5 | 1g |
| GP0623-100mg | Flupirtine maleate salt | 75507-68-5 | 100mg |
| GP0623-250mg | Flupirtine maleate salt | 75507-68-5 | 250mg |
| GP0623-1g | Flupirtine maleate salt | 75507-68-5 | 1g |
| GW8432-5g | Flupropanate | 756-09-2 | 5g |
| GW4390-10mg | Flupyrsulfuron-methyl sodium | 144740-54-5 | 10mg |
| GW4390-25mg | Flupyrsulfuron-methyl sodium | 144740-54-5 | 25mg |
| GW4390-50mg | Flupyrsulfuron-methyl sodium | 144740-54-5 | 50mg |
| GA8630-1g | Flurbiprofen | 5104-49-4 | 1g |
| GA8630-5g | Flurbiprofen | 5104-49-4 | 5g |
| GA8630-25g | Flurbiprofen | 5104-49-4 | 25g |
| GC4336-10mg | Flurbiprofen D-glucitol ester | 10mg | |
| GC4336-25mg | Flurbiprofen D-glucitol ester | 25mg | |
| GC4336-50mg | Flurbiprofen D-glucitol ester | 50mg | |
| GC4336-100mg | Flurbiprofen D-glucitol ester | 100mg | |
| GC4336-250mg | Flurbiprofen D-glucitol ester | 250mg | |
| GC2879-25mg | Flurbiprofen D-mannitol ester | 25mg | |
| GC2879-50mg | Flurbiprofen D-mannitol ester | 50mg | |
| GC2879-100mg | Flurbiprofen D-mannitol ester | 100mg | |
| GC2879-250mg | Flurbiprofen D-mannitol ester | 250mg | |
| GK2844-250mg | Fluridone | 59756-60-4 | 250mg |
| GK2844-1g | Fluridone | 59756-60-4 | 1g |
| GY4609-100mg | Flurprimidol | 56425-91-3 | 100mg |
| GY4609-250mg | Flurprimidol | 56425-91-3 | 250mg |
| GW3742-100mg | Flusulfamide | 106917-52-6 | 100mg |
| GW3742-500mg | Flusulfamide | 106917-52-6 | 500mg |
| GP6311-1g | Flutamide | 13311-84-7 | 1g |
| GP6311-5g | Flutamide | 13311-84-7 | 5g |
| GP5011-25mg | Fluticasone propionate | 80474-14-2 | 25mg |
| GP5011-100mg | Fluticasone propionate | 80474-14-2 | 100mg |
| GP9431-1g | Fluvastatin sodium salt | 93957-55-2 | 1g |
| GP8417-1g | Fluvoxamine maleate | 61718-82-9 | 1g |
| GP8417-5g | Fluvoxamine maleate | 61718-82-9 | 5g |
| GE3236-1g | Fmoc chloride | 28920-43-6 | 1g |
| GE3236-5g | Fmoc chloride | 28920-43-6 | 5g |
| GM5706-1g | Fmoc N-hydroxysuccinimide ester | 82911-69-1 | 1g |
| GM5706-5g | Fmoc N-hydroxysuccinimide ester | 82911-69-1 | 5g |
| GM5706-25g | Fmoc N-hydroxysuccinimide ester | 82911-69-1 | 25g |
| GM5706-100g | Fmoc N-hydroxysuccinimide ester | 82911-69-1 | 100g |
| GM2728-1g | Fmoc-1-Nal-OH | 96402-49-2 | 1g |
| GM2728-5g | Fmoc-1-Nal-OH | 96402-49-2 | 5g |
| GM0202-1g | Fmoc-11-Aun-OH | 88574-07-6 | 1g |
| GM0202-5g | Fmoc-11-Aun-OH | 88574-07-6 | 5g |
| GM0242-1g | Fmoc-6-Ahx-OH | 88574-06-5 | 1g |
| GM0242-5g | Fmoc-6-Ahx-OH | 88574-06-5 | 5g |
| GM0242-10g | Fmoc-6-Ahx-OH | 88574-06-5 | 10g |
| GM7432-5g | Fmoc-Ala-OH | 35661-39-3 | 5g |
| GM7432-25g | Fmoc-Ala-OH | 35661-39-3 | 25g |
| GM7432-100g | Fmoc-Ala-OH | 35661-39-3 | 100g |
| GM7432-250g | Fmoc-Ala-OH | 35661-39-3 | 250g |
| GM2318-25g | Fmoc-Arg-OH | 91000-69-0 | 25g |
| GM9958-5g | Fmoc-Arg(Pbf)-OH | 154445-77-9 | 5g |
| GM9958-25g | Fmoc-Arg(Pbf)-OH | 154445-77-9 | 25g |
| GM9958-100g | Fmoc-Arg(Pbf)-OH | 154445-77-9 | 100g |
| GM9958-250g | Fmoc-Arg(Pbf)-OH | 154445-77-9 | 250g |
| GM3743-25g | Fmoc-Asn-OH | 71989-16-7 | 25g |
| GM6525-5g | Fmoc-Asn(Trt)-OH | 132388-59-1 | 5g |
| GM6525-25g | Fmoc-Asn(Trt)-OH | 132388-59-1 | 25g |
| GM6525-100g | Fmoc-Asn(Trt)-OH | 132388-59-1 | 100g |
| GM2923-250mg | Fmoc-Asp-OAll | 144120-53-6 | 250mg |
| GM2923-1g | Fmoc-Asp-OAll | 144120-53-6 | 1g |
| GM2923-5g | Fmoc-Asp-OAll | 144120-53-6 | 5g |
| GM4936-25g | Fmoc-Asp-OH | 119062-05-4 | 25g |
| GM6999-1g | Fmoc-Asp(OtBu)-OH | 71989-14-5 | 1g |
| GM6999-10g | Fmoc-Asp(OtBu)-OH | 71989-14-5 | 10g |
| GM6999-50g | Fmoc-Asp(OtBu)-OH | 71989-14-5 | 50g |
| GM6999-100g | Fmoc-Asp(OtBu)-OH | 71989-14-5 | 100g |
| GM6924-1g | Fmoc-Cha-OH | 135673-97-1 | 1g |
| GX2966-1g | Fmoc-Cys(STmp)-OH | 1403834-74-1 | 1g |
| GM8515-5g | Fmoc-Cys(Trt)-OH | 103213-32-7 | 5g |
| GM8515-25g | Fmoc-Cys(Trt)-OH | 103213-32-7 | 25g |
| GM8515-100g | Fmoc-Cys(Trt)-OH | 103213-32-7 | 100g |
| GM8515-250g | Fmoc-Cys(Trt)-OH | 103213-32-7 | 250g |
| GM6660-5g | Fmoc-D-Ala-OH | 79990-15-1 | 5g |
| GM6660-25g | Fmoc-D-Ala-OH | 79990-15-1 | 25g |
| GM3013-5g | Fmoc-D-Arg(Pbf)-OH | 187618-60-6 | 5g |
| GM3013-25g | Fmoc-D-Arg(Pbf)-OH | 187618-60-6 | 25g |
| GM0704-5g | Fmoc-D-Cys(Acm)-OH | 168300-88-7 | 5g |
| GM3440-1g | Fmoc-D-Gln(Trt)-OH | 200623-62-7 | 1g |
| GM3440-5g | Fmoc-D-Gln(Trt)-OH | 200623-62-7 | 5g |
| GM7634-5g | Fmoc-D-Glu(OtBu)-OH | 104091-08-9 | 5g |
| GM7634-25g | Fmoc-D-Glu(OtBu)-OH | 104091-08-9 | 25g |
| GM9599-1g | Fmoc-D-Ile-OH | 143688-83-9 | 1g |
| GM1149-5g | Fmoc-D-Leu-OH | 114360-54-2 | 5g |
| GM1149-25g | Fmoc-D-Leu-OH | 114360-54-2 | 25g |
| GM4759-5g | Fmoc-D-Lys(Boc)-OH | 92122-45-7 | 5g |
| GM4759-25g | Fmoc-D-Lys(Boc)-OH | 92122-45-7 | 25g |
| GM6386-5g | Fmoc-D-Phe-OH | 86123-10-6 | 5g |
| GM6386-25g | Fmoc-D-Phe-OH | 86123-10-6 | 25g |
| GM1101-5g | Fmoc-D-Pro-OH | 101555-62-8 | 5g |
| GM1101-25g | Fmoc-D-Pro-OH | 101555-62-8 | 25g |
| GM0291-1g | Fmoc-D-Ser(tBu)-OH | 128107-47-1 | 1g |
| GM0291-5g | Fmoc-D-Ser(tBu)-OH | 128107-47-1 | 5g |
| GM0291-25g | Fmoc-D-Ser(tBu)-OH | 128107-47-1 | 25g |
| GM2517-1g | Fmoc-D-Trp(Boc)-OH | 163619-04-3 | 1g |
| GM2517-5g | Fmoc-D-Trp(Boc)-OH | 163619-04-3 | 5g |
| GM1475-5g | Fmoc-D-Tyr(tBu)-OH | 118488-18-9 | 5g |
| GM1475-25g | Fmoc-D-Tyr(tBu)-OH | 118488-18-9 | 25g |
| GM6407-5g | Fmoc-D-Val-OH | 84624-17-9 | 5g |
| GM6407-25g | Fmoc-D-Val-OH | 84624-17-9 | 25g |
| GM7760-1g | Fmoc-Dap(Boc)-OH | 162558-25-0 | 1g |
| GM6370-1g | Fmoc-Dap(Fmoc)-OH | 201473-90-7 | 1g |
| GM7436-25g | Fmoc-Gln-OH | 71989-20-3 | 25g |
| GM4670-1g | Fmoc-Gln(Trt)-OH | 132327-80-1 | 1g |
| GM4670-5g | Fmoc-Gln(Trt)-OH | 132327-80-1 | 5g |
| GM4670-25g | Fmoc-Gln(Trt)-OH | 132327-80-1 | 25g |
| GM4670-100g | Fmoc-Gln(Trt)-OH | 132327-80-1 | 100g |
| GZ0287-1g | Fmoc-Glu-OtBu | 84793-07-7 | 1g |
| GZ0287-5g | Fmoc-Glu-OtBu | 84793-07-7 | 5g |
| GZ0287-25g | Fmoc-Glu-OtBu | 84793-07-7 | 25g |
| GM6206-1g | Fmoc-Glu(OAll)-OH | 133464-46-7 | 1g |
| GM6206-5g | Fmoc-Glu(OAll)-OH | 133464-46-7 | 5g |
| GM7333-10g | Fmoc-Glu(OtBu)-OH | 71989-18-9 | 10g |
| GM7333-25g | Fmoc-Glu(OtBu)-OH | 71989-18-9 | 25g |
| GM1343-25g | Fmoc-Gly-OH | 29022-11-5 | 25g |
| GM1343-100g | Fmoc-Gly-OH | 29022-11-5 | 100g |
| GM1343-250g | Fmoc-Gly-OH | 29022-11-5 | 250g |
| GM2917-5g | Fmoc-His(Trt)-OH | 109425-51-6 | 5g |
| GM2917-25g | Fmoc-His(Trt)-OH | 109425-51-6 | 25g |
| GM2917-100g | Fmoc-His(Trt)-OH | 109425-51-6 | 100g |
| GM5252-5g | Fmoc-Hyp(tBu)-OH | 122996-47-8 | 5g |
| GM4384-5g | Fmoc-Ile-OH | 71989-23-6 | 5g |
| GM4384-25g | Fmoc-Ile-OH | 71989-23-6 | 25g |
| GM4384-100g | Fmoc-Ile-OH | 71989-23-6 | 100g |
| GM9237-1g | Fmoc-L-Lys(Dde)-OH | 150629-67-7 | 1g |
| GM9237-5g | Fmoc-L-Lys(Dde)-OH | 150629-67-7 | 5g |
| GM2337-5g | Fmoc-L-Val-OSu | 130878-68-1 | 5g |
| GM2337-25g | Fmoc-L-Val-OSu | 130878-68-1 | 25g |
| GM6129-25g | Fmoc-Leu-OH | 35661-60-0 | 25g |
| GM6129-100g | Fmoc-Leu-OH | 35661-60-0 | 100g |
| GM6129-250g | Fmoc-Leu-OH | 35661-60-0 | 250g |
| GH6681-1g | Fmoc-Leu-Ser(Psi(Me,Me)pro)-OH | 339531-50-9 | 1g |
| GM9940-5g | Fmoc-Lys(Alloc)-OH | 146982-27-6 | 5g |
| GM4549-500mg | Fmoc-Lys(biotinyl)-OH | 146987-10-2 | 500mg |
| GM4549-1g | Fmoc-Lys(biotinyl)-OH | 146987-10-2 | 1g |
| GM7550-10g | Fmoc-Lys(Boc)-OH | 71989-26-9 | 10g |
| GM7550-25g | Fmoc-Lys(Boc)-OH | 71989-26-9 | 25g |
| GM7550-50g | Fmoc-Lys(Boc)-OH | 71989-26-9 | 50g |
| GM7550-100g | Fmoc-Lys(Boc)-OH | 71989-26-9 | 100g |
| GM6452-5g | Fmoc-Lys(Mtt)-OH | 167393-62-6 | 5g |
| GM6487-25g | Fmoc-Met-OH | 71989-28-1 | 25g |
| GM6487-100g | Fmoc-Met-OH | 71989-28-1 | 100g |
| GM7903-500mg | Fmoc-N-(2-Boc-aminoethyl)-Gly-OH | 141743-15-9 | 500mg |
| GM7903-1g | Fmoc-N-(2-Boc-aminoethyl)-Gly-OH | 141743-15-9 | 1g |
| GM6383-1g | Fmoc-N-Me-Ala-OH | 84000-07-7 | 1g |
| GM6383-5g | Fmoc-N-Me-Ala-OH | 84000-07-7 | 5g |
| GM6456-5g | Fmoc-N-Me-Asp(OtBu)-OH | 152548-66-8 | 5g |
| GM2661-1g | Fmoc-N-Me-Glu(OtBu)-OH | 200616-40-6 | 1g |
| GM4616-1g | Fmoc-N-Me-Ile-OH | 138775-22-1 | 1g |
| GM4616-5g | Fmoc-N-Me-Ile-OH | 138775-22-1 | 5g |
| GM8614-1g | Fmoc-N-Me-Phe-OH | 77128-73-5 | 1g |
| GM8614-5g | Fmoc-N-Me-Phe-OH | 77128-73-5 | 5g |
| GM3655-5g | Fmoc-N-Me-Ser(tBu)-OH | 197632-77-2 | 5g |
| GM1535-1g | Fmoc-N-Me-Val-OH | 84000-11-3 | 1g |
| GM1535-5g | Fmoc-N-Me-Val-OH | 84000-11-3 | 5g |
| GM1535-25g | Fmoc-N-Me-Val-OH | 84000-11-3 | 25g |
| GM7876-1g | Fmoc-O-ethyl-D-tyrosine | 162502-65-0 | 1g |
| GM0032-5g | Fmoc-Orn(Alloc)-OH | 147290-11-7 | 5g |
| GM0032-10g | Fmoc-Orn(Alloc)-OH | 147290-11-7 | 10g |
| GM0032-25g | Fmoc-Orn(Alloc)-OH | 147290-11-7 | 25g |
| GM2306-5g | Fmoc-Orn(Boc)-OH | 109425-55-0 | 5g |
| GM2306-25g | Fmoc-Orn(Boc)-OH | 109425-55-0 | 25g |
| GM5097-10g | Fmoc-Phe-OH | 35661-40-6 | 10g |
| GM5097-100g | Fmoc-Phe-OH | 35661-40-6 | 100g |
| GM1025-100mg | Fmoc-Phe(4-Boc2-guanidino)-OH | 187283-25-6 | 100mg |
| GM1025-500mg | Fmoc-Phe(4-Boc2-guanidino)-OH | 187283-25-6 | 500mg |
| GM2265-25g | Fmoc-Pro-OH | 71989-31-6 | 25g |
| GM2265-100g | Fmoc-Pro-OH | 71989-31-6 | 100g |
| GM2265-250g | Fmoc-Pro-OH | 71989-31-6 | 250g |
| GM6914-1g | Fmoc-Pro-OPfp | 86060-90-4 | 1g |
| GM6914-5g | Fmoc-Pro-OPfp | 86060-90-4 | 5g |
| GM4391-250mg | Fmoc-propargyl-Gly-OH | 198561-07-8 | 250mg |
| GM4391-1g | Fmoc-propargyl-Gly-OH | 198561-07-8 | 1g |
| GM8696-5g | Fmoc-Sar-OH | 77128-70-2 | 5g |
| GM8696-25g | Fmoc-Sar-OH | 77128-70-2 | 25g |
| GM5887-1g | Fmoc-Sar-OPfp | 159631-29-5 | 1g |
| GM5887-5g | Fmoc-Sar-OPfp | 159631-29-5 | 5g |
| GM5887-10g | Fmoc-Sar-OPfp | 159631-29-5 | 10g |
| GM5457-1g | Fmoc-Ser-OH | 73724-45-5 | 1g |
| GM5457-5g | Fmoc-Ser-OH | 73724-45-5 | 5g |
| GM5621-100mg | Fmoc-Ser(beta-D-GlcNAc(Ac)3)-OH | 160067-63-0 | 100mg |
| GM0224-5g | Fmoc-Ser(tBu)-OH | 71989-33-8 | 5g |
| GM0224-25g | Fmoc-Ser(tBu)-OH | 71989-33-8 | 25g |
| GM0224-100g | Fmoc-Ser(tBu)-OH | 71989-33-8 | 100g |
| GM0784-1g | Fmoc-Ser(Trt)-OH | 111061-56-4 | 1g |
| GM0784-5g | Fmoc-Ser(Trt)-OH | 111061-56-4 | 5g |
| GM5290-500mg | Fmoc-Thr(TBDMS)-OH | 146346-82-9 | 500mg |
| GM5290-1g | Fmoc-Thr(TBDMS)-OH | 146346-82-9 | 1g |
| GM9332-1g | Fmoc-Thr(tBu)-OH | 71989-35-0 | 1g |
| GM9332-5g | Fmoc-Thr(tBu)-OH | 71989-35-0 | 5g |
| GM9332-10g | Fmoc-Thr(tBu)-OH | 71989-35-0 | 10g |
| GM9332-25g | Fmoc-Thr(tBu)-OH | 71989-35-0 | 25g |
| GM9332-100g | Fmoc-Thr(tBu)-OH | 71989-35-0 | 100g |
| GM3465-1g | Fmoc-Tmb-Gly-OH | 166881-43-2 | 1g |
| GM3465-5g | Fmoc-Tmb-Gly-OH | 166881-43-2 | 5g |
| GM3465-25g | Fmoc-Tmb-Gly-OH | 166881-43-2 | 25g |
| GM9019-5g | Fmoc-Trp-OH | 35737-15-6 | 5g |
| GM9019-25g | Fmoc-Trp-OH | 35737-15-6 | 25g |
| GM9019-100g | Fmoc-Trp-OH | 35737-15-6 | 100g |
| GM7354-5g | Fmoc-Trp(Boc)-OH | 143824-78-6 | 5g |
| GM7354-25g | Fmoc-Trp(Boc)-OH | 143824-78-6 | 25g |
| GM7354-100g | Fmoc-Trp(Boc)-OH | 143824-78-6 | 100g |
| GM6164-10g | Fmoc-Tyr(tBu)-OH | 71989-38-3 | 10g |
| GM6164-25g | Fmoc-Tyr(tBu)-OH | 71989-38-3 | 25g |
| GM6164-100g | Fmoc-Tyr(tBu)-OH | 71989-38-3 | 100g |
| GM1305-5g | Fmoc-Val-OH | 68858-20-8 | 5g |
| GM1305-25g | Fmoc-Val-OH | 68858-20-8 | 25g |
| GM1305-100g | Fmoc-Val-OH | 68858-20-8 | 100g |
| GM1305-250g | Fmoc-Val-OH | 68858-20-8 | 250g |
| GW2022-5mg | FOAA | 233759-98-3 | 5mg |
| GW2022-25mg | FOAA | 233759-98-3 | 25mg |
| GW2022-250mg | FOAA | 233759-98-3 | 250mg |
| GP3487-5g | Folic acid | 59-30-3 | 5g |
| GP3487-25g | Folic acid | 59-30-3 | 25g |
| GP3487-50g | Folic acid | 59-30-3 | 50g |
| GP3487-100g | Folic acid | 59-30-3 | 100g |
| GP0140-5g | Folic acid, USP grade | 59-30-3 | 5g |
| GP0140-25g | Folic acid, USP grade | 59-30-3 | 25g |
| GP6553-250mg | Folinic acid calcium salt hydrate | 1492-18-8 | 250mg |
| GP6553-1g | Folinic acid calcium salt hydrate | 1492-18-8 | 1g |
| GP6553-5g | Folinic acid calcium salt hydrate | 1492-18-8 | 5g |
| GC5562-1mg | Fondaparinux intermediate | 114870-00-7 | 1mg |
| GC5562-2mg | Fondaparinux intermediate | 114870-00-7 | 2mg |
| GC5562-5mg | Fondaparinux intermediate | 114870-00-7 | 5mg |
| GC5562-10mg | Fondaparinux intermediate | 114870-00-7 | 10mg |
| GP7709-1mg | Foretinib | 849217-64-7 | 1mg |
| GP7709-5mg | Foretinib | 849217-64-7 | 5mg |
| GP7709-10mg | Foretinib | 849217-64-7 | 10mg |
| GX7106-1l | Formaldehyde solution, 36.5 - 38.0% | 50-00-0 | 1l |
| GE0900-1l | Formalin, 10% solution, neutral buffered | - | 1l |
| GE0900-2500ml | Formalin, 10% solution, neutral buffered | - | 2500ml |
| GE0227-1l | Formalin, 10% solution, neutral buffered with 0.03% Eosin | - | 1l |
| GE0227-2500ml | Formalin, 10% solution, neutral buffered with 0.03% Eosin | - | 2500ml |
| GE1691-500ml | Formamide | 75-12-7 | 500ml |
| GE1691-1l | Formamide | 75-12-7 | 1l |
| GE1691-2500ml | Formamide | 75-12-7 | 2500ml |
| GS9663-100ml | Formamide, GlenBiol™, suitable for molecular biology | 75-12-7 | 100ml |
| GK5373-25g | Formamidine disulfide dihydrochloride | 14807-75-1 | 25g |
| GK4394-100ml | Formic acid | 64-18-6 | 100ml |
| GP6496-100mg | Formononetin | 485-72-3 | 100mg |
| GP6496-1g | Formononetin | 485-72-3 | 1g |
| GC1919-5mg | Formononetin-b-D-glucuronide sodium salt | 18524-03-3 | 5mg |
| GC1919-10mg | Formononetin-b-D-glucuronide sodium salt | 18524-03-3 | 10mg |
| GC1919-25mg | Formononetin-b-D-glucuronide sodium salt | 18524-03-3 | 25mg |
| GC1919-50mg | Formononetin-b-D-glucuronide sodium salt | 18524-03-3 | 50mg |
| GK0194-10mg | Formoterol fumarate dihydrate | 183814-30-4 | 10mg |
| GK0194-50mg | Formoterol fumarate dihydrate | 183814-30-4 | 50mg |
| GP2059-1mg | Forskolin | 66575-29-9 | 1mg |
| GP2059-5mg | Forskolin | 66575-29-9 | 5mg |
| GP2059-10mg | Forskolin | 66575-29-9 | 10mg |
| GP2059-25mg | Forskolin | 66575-29-9 | 25mg |
| GP2059-50mg | Forskolin | 66575-29-9 | 50mg |
| GP9120-100mg | Fosfomycin tromethamine | 78964-85-9 | 100mg |
| GA9030-10ug | Fostriecin | 87860-39-7 | 10ug |
| GA3510-1g | Framycetin sulfate | 4146-30-9 | 1g |
| GW0280-1mg | Fridamycin A | 30270-05-4 | 1mg |
| GW3457-1mg | Fridamycin B | 1mg | |
| GW7288-1mg | Fridamycin E | 116120-54-8 | 1mg |
| GC4489-5mg | Fructosazine | 13185-73-4 | 5mg |
| GC4489-10mg | Fructosazine | 13185-73-4 | 10mg |
| GC4489-25mg | Fructosazine | 13185-73-4 | 25mg |
| GC4489-50mg | Fructosazine | 13185-73-4 | 50mg |
| GC4489-100mg | Fructosazine | 13185-73-4 | 100mg |
| GL8499-100ug | FSL-1 | 322455-70-9 | 100ug |
| GC5403-10g | Fucoidan | 9072-19-9 | 10g |
| GC5403-25g | Fucoidan | 9072-19-9 | 25g |
| GP9451-25mg | Fulvestrant | 129453-61-8 | 25mg |
| GL6056-1mg | Fulvic acid | 479-66-3 | 1mg |
| GL6056-5mg | Fulvic acid | 479-66-3 | 5mg |
| GA9027-1mg | Fumagillin | 23110-15-8 | 1mg |
| GA9027-5mg | Fumagillin | 23110-15-8 | 5mg |
| GA9027-10mg | Fumagillin | 23110-15-8 | 10mg |
| GP3315-100g | Fumaric acid | 110-17-8 | 100g |
| GP3315-1kg | Fumaric acid | 110-17-8 | 1kg |
| GP3315-5kg | Fumaric acid | 110-17-8 | 5kg |
| GW1267-1mg | Fumigaclavine A | 6879-59-0 | 1mg |
| GW1267-5mg | Fumigaclavine A | 6879-59-0 | 5mg |
| GA2954-250ug | Fumitremorgin C | 118974-02-0 | 250ug |
| GA2954-1mg | Fumitremorgin C | 118974-02-0 | 1mg |
| GL6785-1mg | Funalenone | 259728-61-5 | 1mg |
| GK7854-1mg | Fura 2 pentapotassium salt | 113694-64-7 | 1mg |
| GK3824-1mg | Fura 2-AM | 108964-32-5 | 1mg |
| GC3407-5mg | Furaneol β-D-glucopyranoside | 121063-56-7 | 5mg |
| GC3407-10mg | Furaneol β-D-glucopyranoside | 121063-56-7 | 10mg |
| GC3407-25mg | Furaneol β-D-glucopyranoside | 121063-56-7 | 25mg |
| GC3407-50mg | Furaneol β-D-glucopyranoside | 121063-56-7 | 50mg |
| GC3407-100mg | Furaneol β-D-glucopyranoside | 121063-56-7 | 100mg |
| GW3446-10mg | Furanone C-30 | 247167-54-0 | 10mg |
| GW3446-25mg | Furanone C-30 | 247167-54-0 | 25mg |
| GW3446-100mg | Furanone C-30 | 247167-54-0 | 100mg |
| GW3062-10mg | Furanone C-56 | 199744-38-2 | 10mg |
| GW3062-100mg | Furanone C-56 | 199744-38-2 | 100mg |
| GW3062-1g | Furanone C-56 | 199744-38-2 | 1g |
| GA1580-10g | Furazolidone | 67-45-8 | 10g |
| GA1580-25g | Furazolidone | 67-45-8 | 25g |
| GA1580-100g | Furazolidone | 67-45-8 | 100g |
| GL4799-25g | Furfural | 98-01-1 | 25g |
| GL5996-1g | Furil | 492-94-4 | 1g |
| GL5996-5g | Furil | 492-94-4 | 5g |
| GP0523-1g | Furosemide | 54-31-9 | 1g |
| GP0523-5g | Furosemide | 54-31-9 | 5g |
| GP0523-10g | Furosemide | 54-31-9 | 10g |
| GC1299-1mg | Furosemide acyl-b-D-glucuronide | 72967-59-0 | 1mg |
| GC1299-2mg | Furosemide acyl-b-D-glucuronide | 72967-59-0 | 2mg |
| GC1299-5mg | Furosemide acyl-b-D-glucuronide | 72967-59-0 | 5mg |
| GC1299-10mg | Furosemide acyl-b-D-glucuronide | 72967-59-0 | 10mg |
| GL1111-1mg | Fuscin | 83-85-2 | 1mg |
| GL1111-2500ug | Fuscin | 83-85-2 | 2500ug |
| GA1848-100mg | Fusidic acid | 6990-06-3 | 100mg |
| GA1848-250mg | Fusidic acid | 6990-06-3 | 250mg |
| GA1848-1g | Fusidic acid | 6990-06-3 | 1g |
| GA1411-1g | Fusidic acid sodium salt | 751-94-0 | 1g |
| GA8310-1g | Fusidic acid sodium salt, EP grade | 751-94-0 | 1g |
| GA8310-5g | Fusidic acid sodium salt, EP grade | 751-94-0 | 5g |
| GA2946-250mg | G418 disulphate salt | 108321-42-2 | 250mg |
| GA2946-1g | G418 disulphate salt | 108321-42-2 | 1g |
| GA2946-5g | G418 disulphate salt | 108321-42-2 | 5g |
| GC0885-500ug | GA1-Ganglioside | 71012-19-6 | 500ug |
| GC0885-1mg | GA1-Ganglioside | 71012-19-6 | 1mg |
| GC5605-100ug | GA2-Ganglioside | 35960-33-9 | 100ug |
| GP0653-1g | Gabapentin | 60142-96-3 | 1g |
| GP0653-5g | Gabapentin | 60142-96-3 | 5g |
| GP0653-25g | Gabapentin | 60142-96-3 | 25g |
| GP0006-25mg | Gaboxadol hydrochloride | 85118-33-8 | 25mg |
| GX8768-50g | Gadolinium acetate hydrate, 99.9% | 15280-53-2 | 50g |
| GX6633-50g | Gadolinium acetate hydrate, 99.999% | 15280-53-2 | 50g |
| GX5428-10g | Gadolinium carbonate hydrate, 99.999% | 38245-36-2 | 10g |
| GX5428-50g | Gadolinium carbonate hydrate, 99.999% | 38245-36-2 | 50g |
| GX9153-10g | Gadolinium Chips, 99.9% | 7440-54-2 | 10g |
| GX9153-50g | Gadolinium Chips, 99.9% | 7440-54-2 | 50g |
| GX1913-5g | Gadolinium chloride anhydrous, 99.9% | 10138-52-0 | 5g |
| GX1913-25g | Gadolinium chloride anhydrous, 99.9% | 10138-52-0 | 25g |
| GX0630-25g | Gadolinium chloride hydrate, 99.99% | 13450-84-5 | 25g |
| GX0630-100g | Gadolinium chloride hydrate, 99.99% | 13450-84-5 | 100g |
| GX5115-5g | Gadolinium chloride hydrate, 99.999% | 13450-84-5 | 5g |
| GX5115-25g | Gadolinium chloride hydrate, 99.999% | 13450-84-5 | 25g |
| GX5115-100g | Gadolinium chloride hydrate, 99.999% | 13450-84-5 | 100g |
| GX5835-10g | Gadolinium fluoride anhydrous, 99.9% | 13765-26-9 | 10g |
| GX5835-25g | Gadolinium fluoride anhydrous, 99.9% | 13765-26-9 | 25g |
| GX5835-100g | Gadolinium fluoride anhydrous, 99.9% | 13765-26-9 | 100g |
| GX0112-25g | Gadolinium fluoride anhydrous, 99.99% | 13765-26-9 | 25g |
| GX0112-100g | Gadolinium fluoride anhydrous, 99.99% | 13765-26-9 | 100g |
| GX9517-25g | Gadolinium fluoride anhydrous, 99.999% | 13765-26-9 | 25g |
| GX5380-25x50mm | Gadolinium Foil 0.25mm, 99.9% | 7440-54-2 | 25x50mm |
| GX8762-10g | Gadolinium gallium oxide, 99.9+% | 12024-36-1 | 10g |
| GX5536-50g | Gadolinium hydroxide, 99.999% | 100634-91-1 | 50g |
| GX6783-50g | Gadolinium nitrate hexahydrate, 99.9% | 19598-90-4 | 50g |
| GX4565-100g | Gadolinium oxalate hydrate, 99.9% | 51373-60-5 | 100g |
| GX4565-500g | Gadolinium oxalate hydrate, 99.9% | 51373-60-5 | 500g |
| GX3089-100g | Gadolinium oxalate hydrate, 99.99% | 51373-60-5 | 100g |
| GX3089-500g | Gadolinium oxalate hydrate, 99.99% | 51373-60-5 | 500g |
| GX7750-50g | Gadolinium oxide, 99.9% | 12064-62-9 | 50g |
| GX7750-100g | Gadolinium oxide, 99.9% | 12064-62-9 | 100g |
| GX7750-250g | Gadolinium oxide, 99.9% | 12064-62-9 | 250g |
| GX7750-1kg | Gadolinium oxide, 99.9% | 12064-62-9 | 1kg |
| GX6036-25g | Gadolinium oxide, 99.99% | 12064-62-9 | 25g |
| GX2903-25g | Gadolinium oxide, 99.99% | 12064-62-9 | 25g |
| GX6036-100g | Gadolinium oxide, 99.99% | 12064-62-9 | 100g |
| GX2903-100g | Gadolinium oxide, 99.99% | 12064-62-9 | 100g |
| GX6036-500g | Gadolinium oxide, 99.99% | 12064-62-9 | 500g |
| GX2903-250g | Gadolinium oxide, 99.99% | 12064-62-9 | 250g |
| GX5926-5g | Gadolinium oxide, 99.999% | 12064-62-9 | 5g |
| GX5926-25g | Gadolinium oxide, 99.999% | 12064-62-9 | 25g |
| GX0489-5g | Gadolinium oxide, 99.9999% | 12064-62-9 | 5g |
| GX0489-25g | Gadolinium oxide, 99.9999% | 12064-62-9 | 25g |
| GX8269-25g | Gadolinium oxide, 99.9999% | 12064-62-9 | 25g |
| GX0489-100g | Gadolinium oxide, 99.9999% | 12064-62-9 | 100g |
| GX9822-10g | Gadolinium Pieces distilled, 99.99% | 7440-54-2 | 10g |
| GX9822-25g | Gadolinium Pieces distilled, 99.99% | 7440-54-2 | 25g |
| GX8860-10g | Gadolinium Pieces, 99.9% | 7440-54-2 | 10g |
| GX8860-50g | Gadolinium Pieces, 99.9% | 7440-54-2 | 50g |
| GX8077-5g | Gadolinium Powder, 99.9% | 7440-54-2 | 5g |
| GX8077-25g | Gadolinium Powder, 99.9% | 7440-54-2 | 25g |
| GX3282-10mm | Gadolinium Rod 12.5 mm diameter, 99.9% | 7440-54-2 | 10mm |
| GX3282-25mm | Gadolinium Rod 12.5 mm diameter, 99.9% | 7440-54-2 | 25mm |
| GX6274-25mm | Gadolinium Rod 6.35 mm diameter, 99.9% | 7440-54-2 | 25mm |
| GX6274-50mm | Gadolinium Rod 6.35 mm diameter, 99.9% | 7440-54-2 | 50mm |
| GX8991-10g | Gadolinium sulfate hydrate, 99.9% | 13450-87-8 | 10g |
| GX8991-50g | Gadolinium sulfate hydrate, 99.9% | 13450-87-8 | 50g |
| GX1347-50g | Gadolinium sulfate hydrate, 99.999% | 13450-87-8 | 50g |
| GX7383-50mm | Gadolinium Wire 2 mm diameter, 99.9% | 7440-54-2 | 50mm |
| GX7383-250mm | Gadolinium Wire 2 mm diameter, 99.9% | 7440-54-2 | 250mm |
| GX3860-25g | Gadolinium(III) chloride hexahydrate, 99.9% | 13450-84-5 | 25g |
| GX3860-100g | Gadolinium(III) chloride hexahydrate, 99.9% | 13450-84-5 | 100g |
| GX3860-250g | Gadolinium(III) chloride hexahydrate, 99.9% | 13450-84-5 | 250g |
| GP0136-25mg | Galangin | 548-83-4 | 25mg |
| GP0136-100mg | Galangin | 548-83-4 | 100mg |
| GP2704-100mg | Galanthamine hydrobromide | 1953-04-4 | 100mg |
| GC4006-5mg | Gallic acid 3-O-β-D-glucopyranoside | 91984-84-8 | 5mg |
| GC4006-10mg | Gallic acid 3-O-β-D-glucopyranoside | 91984-84-8 | 10mg |
| GC4006-25mg | Gallic acid 3-O-β-D-glucopyranoside | 91984-84-8 | 25mg |
| GC4006-50mg | Gallic acid 3-O-β-D-glucopyranoside | 91984-84-8 | 50mg |
| GC2783-10mg | Gallic acid 4-O-β-D-glucopyranoside | 84274-52-2 | 10mg |
| GC2783-25mg | Gallic acid 4-O-β-D-glucopyranoside | 84274-52-2 | 25mg |
| GC2783-50mg | Gallic acid 4-O-β-D-glucopyranoside | 84274-52-2 | 50mg |
| GC2783-100mg | Gallic acid 4-O-β-D-glucopyranoside | 84274-52-2 | 100mg |
| GK3777-25g | Gallic acid monohydrate | 5995-86-8 | 25g |
| GK3777-100g | Gallic acid monohydrate | 5995-86-8 | 100g |
| GK3777-250g | Gallic acid monohydrate | 5995-86-8 | 250g |
| GK3777-500g | Gallic acid monohydrate | 5995-86-8 | 500g |
| GK7318-25g | Gallic acid, anhydrous | 149-91-7 | 25g |
| GK7318-100g | Gallic acid, anhydrous | 149-91-7 | 100g |
| GK7318-250g | Gallic acid, anhydrous | 149-91-7 | 250g |
| GK7318-500g | Gallic acid, anhydrous | 149-91-7 | 500g |
| GK7318-1kg | Gallic acid, anhydrous | 149-91-7 | 1kg |
| GK3445-100g | Gallic acid, anhydrous, ACS grade | 149-91-7 | 100g |
| GK3445-500g | Gallic acid, anhydrous, ACS grade | 149-91-7 | 500g |
| GX0988-2g | Gallium antimonide, 99.99% | 12064-03-8 | 2g |
| GX0470-2g | Gallium arsenide, 99.999% | 1303-00-0 | 2g |
| GX0470-10g | Gallium arsenide, 99.999% | 1303-00-0 | 10g |
| GX0470-50g | Gallium arsenide, 99.999% | 1303-00-0 | 50g |
| GX3243-1g | Gallium arsenide, 99.9999% | 1303-00-0 | 1g |
| GX5196-5g | Gallium bromide, anhydrous, 99.999% | 13450-88-9 | 5g |
| GX0846-10g | Gallium nitride, 99.99% | 25617-97-4 | 10g |
| GX2239-25g | Gallium Pellets max. 8 mm, 99.99% | 7440-55-3 | 25g |
| GX2239-100g | Gallium Pellets max. 8 mm, 99.99% | 7440-55-3 | 100g |
| GX6258-25g | Gallium Pellets max. 8 mm, 99.999% | 7440-55-3 | 25g |
| GX6258-100g | Gallium Pellets max. 8 mm, 99.999% | 7440-55-3 | 100g |
| GX3229-25g | Gallium Pellets max. 8 mm, 99.9999% | 7440-55-3 | 25g |
| GX3229-100g | Gallium Pellets max. 8 mm, 99.9999% | 7440-55-3 | 100g |
| GX8408-2g | Gallium phosphide, 99.999% | 12063-98-8 | 2g |
| GX8408-10g | Gallium phosphide, 99.999% | 12063-98-8 | 10g |
| GX4776-10g | Gallium Pieces, | 7440-55-3 | 10g |
| GX4776-50g | Gallium Pieces, | 7440-55-3 | 50g |
| GX4776-100g | Gallium Pieces, | 7440-55-3 | 100g |
| GX7573-10g | Gallium Pieces, 99.99% | 7440-55-3 | 10g |
| GX7573-50g | Gallium Pieces, 99.99% | 7440-55-3 | 50g |
| GX7573-100g | Gallium Pieces, 99.99% | 7440-55-3 | 100g |
| GX1351-10g | Gallium Pieces, 99.9999% | 7440-55-3 | 10g |
| GX1351-50g | Gallium Pieces, 99.9999% | 7440-55-3 | 50g |
| GX1351-100g | Gallium Pieces, 99.9999% | 7440-55-3 | 100g |
| GX9105-10g | Gallium Pieces, 99.99999% | 7440-55-3 | 10g |
| GX9105-50g | Gallium Pieces, 99.99999% | 7440-55-3 | 50g |
| GX9105-100g | Gallium Pieces, 99.99999% | 7440-55-3 | 100g |
| GX3127-10g | Gallium,Indium,Tin-alloy 66,20.5,13.5%, Eutectic alloy, m.p.ca. 15°C, 99.99+% | 7440-55-3 | 10g |
| GX3127-50g | Gallium,Indium,Tin-alloy 66,20.5,13.5%, Eutectic alloy, m.p.ca. 15°C, 99.99+% | 7440-55-3 | 50g |
| GX3127-100g | Gallium,Indium,Tin-alloy 66,20.5,13.5%, Eutectic alloy, m.p.ca. 15°C, 99.99+% | 7440-55-3 | 100g |
| GX3722-1g | Gallium(II) telluride, 99.999% | 12024-14-5 | 1g |
| GX3722-2g | Gallium(II) telluride, 99.999% | 12024-14-5 | 2g |
| GX6560-25g | Gallium(III) chloride, anhydrous, 99.999% | 13450-90-3 | 25g |
| GX6560-100g | Gallium(III) chloride, anhydrous, 99.999% | 13450-90-3 | 100g |
| GX3798-5g | Gallium(III) ethoxide, 99.9% | 2572-25-0 | 5g |
| GX4847-5g | Gallium(III) iodide, anhydrous, 99.999% | 13450-91-4 | 5g |
| GX0816-500ml | Gallium(III) nitrate solution | 69365-72-6 | 500ml |
| GX0816-1l | Gallium(III) nitrate solution | 69365-72-6 | 1l |
| GX2811-10g | Gallium(III) nitrate, hydrate, 99.9% | 69365-72-6 | 10g |
| GX2811-25g | Gallium(III) nitrate, hydrate, 99.9% | 69365-72-6 | 25g |
| GX2811-100g | Gallium(III) nitrate, hydrate, 99.9% | 69365-72-6 | 100g |
| GX4498-10g | Gallium(III) oxide, 99.99% | 12024-21-4 | 10g |
| GX4498-50g | Gallium(III) oxide, 99.99% | 12024-21-4 | 50g |
| GX5811-10g | Gallium(III) oxide, 99.995+% | 12024-21-4 | 10g |
| GX5811-25g | Gallium(III) oxide, 99.995+% | 12024-21-4 | 25g |
| GX5811-100g | Gallium(III) oxide, 99.995+% | 12024-21-4 | 100g |
| GX8608-10g | Gallium(III) sulfate hydrate, 99.99% | 13780-42-2 | 10g |
| GX1805-2g | Gallium(III) sulfide, 99.95% | 12024-22-5 | 2g |
| GT7909-10g | Gallocyanine | 1562-85-2 | 10g |
| GL8216-10mg | Gambogic acid | 2752-65-0 | 10mg |
| GC5312-25mg | Gamithromycin | 145435-72-9 | 25mg |
| GE4986-250mg | Gamma globulin, human | 9007-83-4 | 250mg |
| GE4986-1g | Gamma globulin, human | 9007-83-4 | 1g |
| GE4986-5g | Gamma globulin, human | 9007-83-4 | 5g |
| GX3420-50g | gamma-Aluminium oxide Nanopowder, 99.9 % | 1344-28-1 | 50g |
| GX3420-250g | gamma-Aluminium oxide Nanopowder, 99.9 % | 1344-28-1 | 250g |
| GX3420-1kg | gamma-Aluminium oxide Nanopowder, 99.9 % | 1344-28-1 | 1kg |
| GX9359-1kg | gamma-Aluminium oxide Nanopowder, 99%+ [APS 20 nm, SSA LT 300m2/g] | 1344-28-1 | 1kg |
| GX1999-25g | gamma-Aluminium oxide, nanopowder, 99.95% | 1344-28-1 | 25g |
| GC9842-25g | gamma-Cyclodextrin | 17465-86-0 | 25g |
| GC9842-100g | gamma-Cyclodextrin | 17465-86-0 | 100g |
| GL2105-5mg | gamma-Glu-Leu | 2566-39-4 | 5mg |
| GX8246-25g | gamma-Iron(III) oxide nanopowder | 1309-37-1 | 25g |
| GX8246-100g | gamma-Iron(III) oxide nanopowder | 1309-37-1 | 100g |
| GP0852-100g | gamma-Valerolactone | 108-29-2 | 100g |
| GL5132-10mg | Ganaxolone | 38398-32-2 | 10mg |
| GL5132-25mg | Ganaxolone | 38398-32-2 | 25mg |
| GA3804-5g | Ganciclovir | 82410-32-0 | 5g |
| GA3804-25g | Ganciclovir | 82410-32-0 | 25g |
| GL7283-1mg | GANT61 | 500579-04-4 | 1mg |
| GL7283-5mg | GANT61 | 500579-04-4 | 5mg |
| GL7339-5mg | Gardiquimod | 1020412-43-4 | 5mg |
| GL7339-25mg | Gardiquimod | 1020412-43-4 | 25mg |
| GP2111-50mg | Gatifloxacin hydrate | 180200-66-2 | 50mg |
| GP2111-250mg | Gatifloxacin hydrate | 180200-66-2 | 250mg |
| GW8774-1mg | GCI1746 | 910232-84-7 | 1mg |
| GW8774-5mg | GCI1746 | 910232-84-7 | 5mg |
| GW8774-10mg | GCI1746 | 910232-84-7 | 10mg |
| GC3309-1mg | GD1a-Ganglioside | 12707-58-3 | 1mg |
| GC3309-5mg | GD1a-Ganglioside | 12707-58-3 | 5mg |
| GC0141-1mg | GD1b-Ganglioside | 19553-76-5 | 1mg |
| GC7995-500ug | GD3-Ganglioside | 62010-37-1 | 500ug |
| GC7995-1mg | GD3-Ganglioside | 62010-37-1 | 1mg |
| GW2186-1mg | GDC-0032 | 1282512-48-4 | 1mg |
| GW2186-5mg | GDC-0032 | 1282512-48-4 | 5mg |
| GW2186-10mg | GDC-0032 | 1282512-48-4 | 10mg |
| GW5412-1mg | GDC-046 | 1258292-64-6 | 1mg |
| GW5412-5mg | GDC-046 | 1258292-64-6 | 5mg |
| GW5412-10mg | GDC-046 | 1258292-64-6 | 10mg |
| GW4351-1mg | GDC-0941 | 957054-30-7 | 1mg |
| GW4351-5mg | GDC-0941 | 957054-30-7 | 5mg |
| GW4351-10mg | GDC-0941 | 957054-30-7 | 10mg |
| GP9843-100mg | Gefitinib | 184475-35-2 | 100mg |
| GP9843-250mg | Gefitinib | 184475-35-2 | 250mg |
| GP9843-500mg | Gefitinib | 184475-35-2 | 500mg |
| GE2739-100g | Gelatin, powdered, from porcine skin, 240g bloom | 9000-70-8 | 100g |
| GE2739-250g | Gelatin, powdered, from porcine skin, 240g bloom | 9000-70-8 | 250g |
| GE2739-500g | Gelatin, powdered, from porcine skin, 240g bloom | 9000-70-8 | 500g |
| GE2739-1kg | Gelatin, powdered, from porcine skin, 240g bloom | 9000-70-8 | 1kg |
| GE1298-1kg | Gelatin, powdered, from porcine skin, 280g bloom | 9000-70-8 | 1kg |
| GA6838-10mg | Geldanamycin | 30562-34-6 | 10mg |
| GA6838-25mg | Geldanamycin | 30562-34-6 | 25mg |
| GA6838-100mg | Geldanamycin | 30562-34-6 | 100mg |
| GX3344-100g | Gellan Gum, high acyl | 71010-52-1 | 100g |
| GX3344-250g | Gellan Gum, high acyl | 71010-52-1 | 250g |
| GX3344-500g | Gellan Gum, high acyl | 71010-52-1 | 500g |
| GX3344-1kg | Gellan Gum, high acyl | 71010-52-1 | 1kg |
| GC8968-500g | Gellan Gum, low acyl | 71010-52-1 | 500g |
| GC8968-1kg | Gellan Gum, low acyl | 71010-52-1 | 1kg |
| GP9877-25mg | Gemcitabine | 95058-81-4 | 25mg |
| GP9877-100mg | Gemcitabine | 95058-81-4 | 100mg |
| GP8917-100mg | Gemcitabine hydrochloride | 122111-03-9 | 100mg |
| GP1460-5g | Gemfibrozil | 25812-30-0 | 5g |
| GP1460-25g | Gemfibrozil | 25812-30-0 | 25g |
| GC3133-1mg | Gemfibrozil b-D-glucuronide | 91683-38-4 | 1mg |
| GC3133-2mg | Gemfibrozil b-D-glucuronide | 91683-38-4 | 2mg |
| GC3133-5mg | Gemfibrozil b-D-glucuronide | 91683-38-4 | 5mg |
| GC3133-10mg | Gemfibrozil b-D-glucuronide | 91683-38-4 | 10mg |
| GK9185-250ml | Genapol X-080 | 9043-30-5 | 250ml |
| GK9185-1l | Genapol X-080 | 9043-30-5 | 1l |
| GK9185-5l | Genapol X-080 | 9043-30-5 | 5l |
| GL8880-1g | Genipin | 6902-77-8 | 1g |
| GL8880-5g | Genipin | 6902-77-8 | 5g |
| GY1954-10mg | Geniposidic acid | 27741-01-1 | 10mg |
| GP7710-5mg | Genistein | 446-72-0 | 5mg |
| GP7710-100mg | Genistein | 446-72-0 | 100mg |
| GP7710-10mg | Genistein | 446-72-0 | 10mg |
| GP7710-50mg | Genistein | 446-72-0 | 50mg |
| GP7710-250mg | Genistein | 446-72-0 | 250mg |
| GC2802-10mg | Genistin | 529-59-9 | 10mg |
| GC2802-25mg | Genistin | 529-59-9 | 25mg |
| GC2802-50mg | Genistin | 529-59-9 | 50mg |
| GC2802-100mg | Genistin | 529-59-9 | 100mg |
| GC2802-250mg | Genistin | 529-59-9 | 250mg |
| GA1270-1mg | Gentamicin C1 pentaacetate salt | 25876-10-2 | 1mg |
| GA1270-10mg | Gentamicin C1 pentaacetate salt | 25876-10-2 | 10mg |
| GA4559-10mg | Gentamicin C1a pentaacetate salt | 26098-04-4 | 10mg |
| GA4559-25mg | Gentamicin C1a pentaacetate salt | 26098-04-4 | 25mg |
| GA2476-5mg | Gentamicin C2 pentaacetate salt | 287916-51-2 | 5mg |
| GA7939-1g | Gentamicin sulfate | 1405-41-0 | 1g |
| GA7939-5g | Gentamicin sulfate | 1405-41-0 | 5g |
| GA7939-10g | Gentamicin sulfate | 1405-41-0 | 10g |
| GA7939-25g | Gentamicin sulfate | 1405-41-0 | 25g |
| GC3903-5mg | Gentiopicroside | 20831-76-9 | 5mg |
| GC3903-25mg | Gentiopicroside | 20831-76-9 | 25mg |
| GK7955-5g | Gentisic acid | 490-79-9 | 5g |
| GK7955-25g | Gentisic acid | 490-79-9 | 25g |
| GK7955-100g | Gentisic acid | 490-79-9 | 100g |
| GA9165-1mg | Geodin | 427-63-4 | 1mg |
| GA9165-5mg | Geodin | 427-63-4 | 5mg |
| GK9543-100ml | Geraniol | 106-24-1 | 100ml |
| GC0550-1mg | Geranyl b-D-glucoside | 22850-13-1 | 1mg |
| GC0550-5mg | Geranyl b-D-glucoside | 22850-13-1 | 5mg |
| GC0550-10mg | Geranyl b-D-glucoside | 22850-13-1 | 10mg |
| GC0550-25mg | Geranyl b-D-glucoside | 22850-13-1 | 25mg |
| GC0550-50mg | Geranyl b-D-glucoside | 22850-13-1 | 50mg |
| GX2887-100g | Germanium chloride, 99.999% | 10038-98-9 | 100g |
| GX2202-10g | Germanium Pieces max. 2 cm (50 Ohm cm); 99.9999+% | 7440-56-4 | 10g |
| GX2202-50g | Germanium Pieces max. 2 cm (50 Ohm cm); 99.9999+% | 7440-56-4 | 50g |
| GX2202-100g | Germanium Pieces max. 2 cm (50 Ohm cm); 99.9999+% | 7440-56-4 | 100g |
| GX6006-10g | Germanium Pieces max. 2 cm, 99.999% | 7440-56-4 | 10g |
| GX6006-25g | Germanium Pieces max. 2 cm, 99.999% | 7440-56-4 | 25g |
| GX6006-100g | Germanium Pieces max. 2 cm, 99.999% | 7440-56-4 | 100g |
| GX5891-10g | Germanium Powder, ltn. 250 microns, 99.99% | 7440-56-4 | 10g |
| GX5891-25g | Germanium Powder, ltn. 250 microns, 99.99% | 7440-56-4 | 25g |
| GX3772-5g | Germanium(II) telluride, 99.999% | 12025-39-7 | 5g |
| GX6261-10g | Germanium(IV) oxide electronic grade, 99.999% | 1310-53-8 | 10g |
| GX6261-25g | Germanium(IV) oxide electronic grade, 99.999% | 1310-53-8 | 25g |
| GX6261-100g | Germanium(IV) oxide electronic grade, 99.999% | 1310-53-8 | 100g |
| GC7516-1mg | Gestodene 17-O-β-D-glucuronide | 1mg | |
| GC7516-2mg | Gestodene 17-O-β-D-glucuronide | 2mg | |
| GC7516-5mg | Gestodene 17-O-β-D-glucuronide | 5mg | |
| GC7516-10mg | Gestodene 17-O-β-D-glucuronide | 10mg | |
| GK2857-1mg | GF 109203X hydrochloride | 176504-36-2 | 1mg |
| GK2857-5mg | GF 109203X hydrochloride | 176504-36-2 | 5mg |
| GK0226-1g | Gibberellic acid | 77-06-5 | 1g |
| GK0226-5g | Gibberellic acid | 77-06-5 | 5g |
| GK0226-10g | Gibberellic acid | 77-06-5 | 10g |
| GK0226-25g | Gibberellic acid | 77-06-5 | 25g |
| GL8740-1g | Gibberellin A4 (contains A7) | 468-44-0 | 1g |
| GT6821-100ml | Giemsa Stain | 51811-82-6 | 100ml |
| GT6821-250ml | Giemsa Stain | 51811-82-6 | 250ml |
| GT7801-5g | Giemsa stain, powder | 51811-82-6 | 5g |
| GT7801-10g | Giemsa stain, powder | 51811-82-6 | 10g |
| GT7801-25g | Giemsa stain, powder | 51811-82-6 | 25g |
| GT7801-50g | Giemsa stain, powder | 51811-82-6 | 50g |
| GT7801-100g | Giemsa stain, powder | 51811-82-6 | 100g |
| GT5290-5g | Giemsa stain, powder, certified | 51811-82-6 | 5g |
| GT5290-10g | Giemsa stain, powder, certified | 51811-82-6 | 10g |
| GT5290-25g | Giemsa stain, powder, certified | 51811-82-6 | 25g |
| GT5290-50g | Giemsa stain, powder, certified | 51811-82-6 | 50g |
| GT5290-100g | Giemsa stain, powder, certified | 51811-82-6 | 100g |
| GA3547-100ug | Gilvocarcin V | 77879-90-4 | 100ug |
| GA3547-250ug | Gilvocarcin V | 77879-90-4 | 250ug |
| GA3547-1mg | Gilvocarcin V | 77879-90-4 | 1mg |
| GW1779-1g | Gimeracil | 103766-25-2 | 1g |
| GW1779-5g | Gimeracil | 103766-25-2 | 5g |
| GP9109-25mg | Ginkgolide A | 15291-75-5 | 25mg |
| GP5638-10mg | Ginkgolide B | 15291-77-7 | 10mg |
| GP5638-50mg | Ginkgolide B | 15291-77-7 | 50mg |
| GP0779-10mg | Ginkgolide C | 15291-76-6 | 10mg |
| GP0779-50mg | Ginkgolide C | 15291-76-6 | 50mg |
| GC8201-25mg | Ginsenoside Rb1 | 41753-43-9 | 25mg |
| GC2429-25mg | Ginsenoside Rd | 52705-93-8 | 25mg |
| GC5949-100mg | Ginsenoside Re | 52286-59-6 | 100mg |
| GC4250-5mg | Ginsenoside Rg3 | 14197-60-5 | 5mg |
| GC4250-25mg | Ginsenoside Rg3 | 14197-60-5 | 25mg |
| GC5991-10mg | Ginsenoside Ro | 34367-04-9 | 10mg |
| GW0261-5mg | Gitoxin | 4562-36-1 | 5mg |
| GW0261-25mg | Gitoxin | 4562-36-1 | 25mg |
| GL7457-5mg | Glabridin | 59870-68-7 | 5mg |
| GP1424-1g | Glimepiride | 93479-97-1 | 1g |
| GP6193-500mg | Glipizide | 29094-61-9 | 500mg |
| GP6193-1g | Glipizide | 29094-61-9 | 1g |
| GP4220-100mg | Gliquidone | 33342-05-1 | 100mg |
| GP4220-500mg | Gliquidone | 33342-05-1 | 500mg |
| GW4142-250ug | Globosuxanthone A | 917091-74-8 | 250ug |
| GW4142-1mg | Globosuxanthone A | 917091-74-8 | 1mg |
| GC0735-1mg | Globotriose | 66580-68-5 | 1mg |
| GC0735-5mg | Globotriose | 66580-68-5 | 5mg |
| GC0735-10mg | Globotriose | 66580-68-5 | 10mg |
| GC0735-25mg | Globotriose | 66580-68-5 | 25mg |
| GC0735-50mg | Globotriose | 66580-68-5 | 50mg |
| GW4741-1mg | GLPG0634 | 1206161-97-8 | 1mg |
| GW4741-5mg | GLPG0634 | 1206161-97-8 | 5mg |
| GW4741-10mg | GLPG0634 | 1206161-97-8 | 10mg |
| GC6800-100g | Gluconic acid manganese salt | 6485-39-8 | 100g |
| GC6800-250g | Gluconic acid manganese salt | 6485-39-8 | 250g |
| GC6800-500g | Gluconic acid manganese salt | 6485-39-8 | 500g |
| GC6800-1kg | Gluconic acid manganese salt | 6485-39-8 | 1kg |
| GC6411-100g | Gluconic acid zinc(II) salt | 4468-02-4 | 100g |
| GC6411-250g | Gluconic acid zinc(II) salt | 4468-02-4 | 250g |
| GC6411-500g | Gluconic acid zinc(II) salt | 4468-02-4 | 500g |
| GC6411-1kg | Gluconic acid zinc(II) salt | 4468-02-4 | 1kg |
| GZ1910-250KU | Glucose Oxidase | 9001-37-0 | 250KU |
| GZ3212-500U | Glucose-6-phosphate dehydrogenase | 9001-40-5 | 500U |
| GZ3212-1KU | Glucose-6-phosphate dehydrogenase | 9001-40-5 | 1KU |
| GX1626-1g | Glufosinate ammonium | 77182-82-2 | 1g |
| GC0694-100ml | Glutaraldehyde solution, 25% in water | 111-30-8 | 100ml |
| GC0694-500ml | Glutaraldehyde solution, 25% in water | 111-30-8 | 500ml |
| GC4387-100ml | Glutaraldehyde solution, 50% in water | 111-30-8 | 100ml |
| GC4387-500ml | Glutaraldehyde solution, 50% in water | 111-30-8 | 500ml |
| GK5553-100g | Glutaric acid | 110-94-1 | 100g |
| GK5553-500g | Glutaric acid | 110-94-1 | 500g |
| GK8999-250g | Glutaric anhydride | 108-55-4 | 250g |
| GK8999-500g | Glutaric anhydride | 108-55-4 | 500g |
| GE1520-1g | Glutathione reduced | 70-18-8 | 1g |
| GE1520-5g | Glutathione reduced | 70-18-8 | 5g |
| GE1520-10g | Glutathione reduced | 70-18-8 | 10g |
| GE1520-25g | Glutathione reduced | 70-18-8 | 25g |
| GE1520-100g | Glutathione reduced | 70-18-8 | 100g |
| GE4956-500g | Gluten, from wheat | 8002-80-0 | 500g |
| GM3209-1g | Gly-Ala | 3695-73-6 | 1g |
| GM3209-5g | Gly-Ala | 3695-73-6 | 5g |
| GB5355-25g | Gly-Gly | 556-50-3 | 25g |
| GB5355-100g | Gly-Gly | 556-50-3 | 100g |
| GB5355-250g | Gly-Gly | 556-50-3 | 250g |
| GB5355-500g | Gly-Gly | 556-50-3 | 500g |
| GM2651-1g | Gly-Leu | 869-19-2 | 1g |
| GM6220-1g | Gly-Pro | 704-15-4 | 1g |
| GM6220-5g | Gly-Pro | 704-15-4 | 5g |
| GM3985-5g | Gly-Tyr | 658-79-7 | 5g |
| GM3985-25g | Gly-Tyr | 658-79-7 | 25g |
| GP8701-1g | Glybenclamide | 10238-21-8 | 1g |
| GP8701-5g | Glybenclamide | 10238-21-8 | 5g |
| GP8701-10g | Glybenclamide | 10238-21-8 | 10g |
| GC2187-250ml | Glycerol | 56-81-5 | 250ml |
| GC2187-500ml | Glycerol | 56-81-5 | 500ml |
| GC2187-1l | Glycerol | 56-81-5 | 1l |
| GC2187-5l | Glycerol | 56-81-5 | 5l |
| GC3178-100ml | Glycerol formal, 99%, stabilised | 99569-11-6 | 100ml |
| GC3178-250ml | Glycerol formal, 99%, stabilised | 99569-11-6 | 250ml |
| GC3178-500ml | Glycerol formal, 99%, stabilised | 99569-11-6 | 500ml |
| GC3178-1l | Glycerol formal, 99%, stabilised | 99569-11-6 | 1l |
| GX3699-100g | Glycerol Monocaprylocaprate | - | 100g |
| GX3699-500g | Glycerol Monocaprylocaprate | - | 500g |
| GC7456-25g | Glycerol phosphate disodium salt hydrate (mixture of isomers), 99% | 55073-41-1 | 25g |
| GC7456-100g | Glycerol phosphate disodium salt hydrate (mixture of isomers), 99% | 55073-41-1 | 100g |
| GC7456-250g | Glycerol phosphate disodium salt hydrate (mixture of isomers), 99% | 55073-41-1 | 250g |
| GC7456-500g | Glycerol phosphate disodium salt hydrate (mixture of isomers), 99% | 55073-41-1 | 500g |
| GC7456-1kg | Glycerol phosphate disodium salt hydrate (mixture of isomers), 99% | 55073-41-1 | 1kg |
| GC3404-100g | Glycerol-1-phosphate magnesium salt hydrate | 927-20-8 | 100g |
| GC3404-250g | Glycerol-1-phosphate magnesium salt hydrate | 927-20-8 | 250g |
| GC3404-500g | Glycerol-1-phosphate magnesium salt hydrate | 927-20-8 | 500g |
| GC3404-1kg | Glycerol-1-phosphate magnesium salt hydrate | 927-20-8 | 1kg |
| GC5551-500ml | Glycerol, 99.5%, Ph. Eur., USP, Ultrapure | 56-81-5 | 500ml |
| GC5551-1l | Glycerol, 99.5%, Ph. Eur., USP, Ultrapure | 56-81-5 | 1l |
| GC5551-2500ml | Glycerol, 99.5%, Ph. Eur., USP, Ultrapure | 56-81-5 | 2500ml |
| GK3896-5g | Glycidol | 556-52-5 | 5g |
| GM2385-100g | Glycine | 56-40-6 | 100g |
| GM2385-250g | Glycine | 56-40-6 | 250g |
| GM2385-500g | Glycine | 56-40-6 | 500g |
| GM2385-1kg | Glycine | 56-40-6 | 1kg |
| GM2385-5kg | Glycine | 56-40-6 | 5kg |
| GM7497-100g | Glycine benzyl ester hydrochloride | 2462-31-9 | 100g |
| GB7317-250ml | Glycine buffer solution | 250ml | |
| GB7317-1l | Glycine buffer solution | 1l | |
| GM6023-100g | Glycine ethyl ester hydrochloride | 623-33-6 | 100g |
| GM6023-250g | Glycine ethyl ester hydrochloride | 623-33-6 | 250g |
| GM6023-500g | Glycine ethyl ester hydrochloride | 623-33-6 | 500g |
| GM6023-1kg | Glycine ethyl ester hydrochloride | 623-33-6 | 1kg |
| GM6023-2500g | Glycine ethyl ester hydrochloride | 623-33-6 | 2500g |
| GE1802-25g | Glycine hydrochloride | 6000-43-7 | 25g |
| GE1802-100g | Glycine hydrochloride | 6000-43-7 | 100g |
| GE1802-250g | Glycine hydrochloride | 6000-43-7 | 250g |
| GE1802-500g | Glycine hydrochloride | 6000-43-7 | 500g |
| GE1802-1kg | Glycine hydrochloride | 6000-43-7 | 1kg |
| GK9427-25g | Glycine sodium salt | 6000-44-8 | 25g |
| GK9427-100g | Glycine sodium salt | 6000-44-8 | 100g |
| GM6763-1g | Glycine tert-butyl ester hydrochloride | 27532-96-3 | 1g |
| GM6763-5g | Glycine tert-butyl ester hydrochloride | 27532-96-3 | 5g |
| GM2320-100g | Glycine, EP, USP grade | 56-40-6 | 100g |
| GM2320-250g | Glycine, EP, USP grade | 56-40-6 | 250g |
| GM2320-500g | Glycine, EP, USP grade | 56-40-6 | 500g |
| GM2320-1kg | Glycine, EP, USP grade | 56-40-6 | 1kg |
| GM2320-5kg | Glycine, EP, USP grade | 56-40-6 | 5kg |
| GL7698-10mg | Glycitein | 40957-83-3 | 10mg |
| GL7698-25mg | Glycitein | 40957-83-3 | 25mg |
| GC2327-25mg | Glycitin | 40246-10-4 | 25mg |
| GK7114-100mg | Glycochenodeoxycholic acid sodium salt | 16564-43-5 | 100mg |
| GK7114-250mg | Glycochenodeoxycholic acid sodium salt | 16564-43-5 | 250mg |
| GK7114-1g | Glycochenodeoxycholic acid sodium salt | 16564-43-5 | 1g |
| GM1948-1g | Glycocholic acid | 475-31-0 | 1g |
| GM1948-5g | Glycocholic acid | 475-31-0 | 5g |
| GC7172-1g | Glycogen | 9005-79-2 | 1g |
| GC7172-5g | Glycogen | 9005-79-2 | 5g |
| GC1413-25mg | Glycogen, from plant | 9005-79-2 | 25mg |
| GC1413-100mg | Glycogen, from plant | 9005-79-2 | 100mg |
| GC1413-500mg | Glycogen, from plant | 9005-79-2 | 500mg |
| GC1413-1g | Glycogen, from plant | 9005-79-2 | 1g |
| GU4066-1g | Glycol chitosan | 123938-86-3 | 1g |
| GV0978-100g | Glycolic acid | 79-14-1 | 100g |
| GV0978-250g | Glycolic acid | 79-14-1 | 250g |
| GV0978-500g | Glycolic acid | 79-14-1 | 500g |
| GV0978-1kg | Glycolic acid | 79-14-1 | 1kg |
| GE5631-500ml | Glycolic acid, 70% solution in water | 79-14-1 | 500ml |
| GL3345-25mg | Glycopyrrolate | 596-51-0 | 25mg |
| GL3345-100mg | Glycopyrrolate | 596-51-0 | 100mg |
| GL1421-1g | Glycoursodeoxycholic acid | 64480-66-6 | 1g |
| GL1421-5g | Glycoursodeoxycholic acid | 64480-66-6 | 5g |
| GH2981-1g | Glycyl-L-glutamine monohydrate | 172669-64-6 | 1g |
| GC9316-1g | Glycyrrhizic acid | 1405-86-3 | 1g |
| GK2256-1g | Glycyrrhizic acid ammonium salt | 53956-04-0 | 1g |
| GK2256-5g | Glycyrrhizic acid ammonium salt | 53956-04-0 | 5g |
| GK2256-25g | Glycyrrhizic acid ammonium salt | 53956-04-0 | 25g |
| GK2256-100g | Glycyrrhizic acid ammonium salt | 53956-04-0 | 100g |
| GK0591-100g | Glyoxal, 40% in water | 107-22-2 | 100g |
| GK1723-25g | Glyoxylic acid hydrate | 563-96-2 | 25g |
| GK1723-100g | Glyoxylic acid hydrate | 563-96-2 | 100g |
| GK1723-500g | Glyoxylic acid hydrate | 563-96-2 | 500g |
| GK2369-250g | Glyoxylic acid, 50% in water | 298-12-4 | 250g |
| GK2369-1kg | Glyoxylic acid, 50% in water | 298-12-4 | 1kg |
| GC2176-1mg | GM1-Ganglioside | 37758-47-7 | 1mg |
| GC2176-5mg | GM1-Ganglioside | 37758-47-7 | 5mg |
| GC2176-10mg | GM1-Ganglioside | 37758-47-7 | 10mg |
| GC6057-500ug | GM2-Ganglioside | 19600-01-2 | 500ug |
| GC6381-1mg | GM3-Ganglioside | 54827-14-4 | 1mg |
| GW3723-1mg | GNE-477 | 1032754-81-6 | 1mg |
| GW3723-5mg | GNE-477 | 1032754-81-6 | 5mg |
| GW3723-10mg | GNE-477 | 1032754-81-6 | 10mg |
| GW1637-1mg | GNE-490 | 1033739-92-2 | 1mg |
| GW1637-5mg | GNE-490 | 1033739-92-2 | 5mg |
| GW1637-10mg | GNE-490 | 1033739-92-2 | 10mg |
| GW9776-1mg | GNE-493 | 1033735-94-2 | 1mg |
| GW9776-5mg | GNE-493 | 1033735-94-2 | 5mg |
| GW9776-10mg | GNE-493 | 1033735-94-2 | 10mg |
| GW4938-1mg | GNF-5837 | 1033769-28-6 | 1mg |
| GW4938-5mg | GNF-5837 | 1033769-28-6 | 5mg |
| GW4938-10mg | GNF-5837 | 1033769-28-6 | 10mg |
| GX8617-5g | Gold conducting paste 85-90% Au | 7440-57-5 | 5g |
| GX8617-10g | Gold conducting paste 85-90% Au | 7440-57-5 | 10g |
| GX2515-25x25mm | Gold Foil 0.01mm, 99.9% | 7440-57-5 | 25x25mm |
| GX2515-50x50mm | Gold Foil 0.01mm, 99.9% | 7440-57-5 | 50x50mm |
| GX2305-25x25mm | Gold Foil 0.025mm, 99.99% | 7440-57-5 | 25x25mm |
| GX2305-50x50mm | Gold Foil 0.025mm, 99.99% | 7440-57-5 | 50x50mm |
| GX5660-50x50mm | Gold Foil 0.05mm, 99.9% | 7440-57-5 | 50x50mm |
| GX8161-10x10mm | Gold Foil 0.127mm, 99.99% | 7440-57-5 | 10x10mm |
| GX2217-25x25mm | Gold Foil 0.1mm, 99.9% | 7440-57-5 | 25x25mm |
| GX2217-50x50mm | Gold Foil 0.1mm, 99.9% | 7440-57-5 | 50x50mm |
| GX6369-25x25mm | Gold Foil 0.1mm, 99.995% | 7440-57-5 | 25x25mm |
| GX0893-10x10mm | Gold Foil 0.25mm, 99.9% | 7440-57-5 | 10x10mm |
| GX0893-25x25mm | Gold Foil 0.25mm, 99.9% | 7440-57-5 | 25x25mm |
| GX9858-10x10mm | Gold Foil 0.25mm, 99.99% | 7440-57-5 | 10x10mm |
| GX9858-25x25mm | Gold Foil 0.25mm, 99.99% | 7440-57-5 | 25x25mm |
| GX4983-10x10mm | Gold Foil 0.5mm, 99.9% | 7440-57-5 | 10x10mm |
| GX0324-50x50mm | Gold Gauze 1024 mesh/cm², 0.06 mm wire diameter, 99.99% | 7440-57-5 | 50x50mm |
| GX0324-100x100mm | Gold Gauze 1024 mesh/cm², 0.06 mm wire diameter, 99.99% | 7440-57-5 | 100x100mm |
| GX7159-1g | Gold Granules 0.2-0.5 mm, 99.99% (metals basis) | 7440-57-5 | 1g |
| GX7927-1g | Gold Granules max. 1.5 mm, 99.999% (metals basis) | 7440-57-5 | 1g |
| GX1742-1g | Gold Granules max. 5 mm, 99.99% | 7440-57-5 | 1g |
| GX1742-2g | Gold Granules max. 5 mm, 99.99% | 7440-57-5 | 2g |
| GX1742-10g | Gold Granules max. 5 mm, 99.99% | 7440-57-5 | 10g |
| GX1014-1g | Gold powder 0.3-3 micron, 99.9+% | 7440-57-5 | 1g |
| GX1014-5g | Gold powder 0.3-3 micron, 99.9+% | 7440-57-5 | 5g |
| GX7015-1g | Gold Powder 1.5-4 micron, 99.9+% | 7440-57-5 | 1g |
| GX4428-1g | Gold Powder max. 1 micron, 99.9+% | 7440-57-5 | 1g |
| GX4428-5g | Gold Powder max. 1 micron, 99.9+% | 7440-57-5 | 5g |
| GX3698-25m | Gold Wire 0.025 mm diameter, 99.99% | 7440-57-5 | 25m |
| GX5523-10m | Gold Wire 0.05 mm diameter, 99.99% | 7440-57-5 | 10m |
| GX1233-1m | Gold Wire 0.1 mm diameter, 99.99% | 7440-57-5 | 1m |
| GX1233-5m | Gold Wire 0.1 mm diameter, 99.99% | 7440-57-5 | 5m |
| GX5149-2m | Gold Wire 0.127 mm diameter, 99.99% | 7440-57-5 | 2m |
| GX5149-10m | Gold Wire 0.127 mm diameter, 99.99% | 7440-57-5 | 10m |
| GX6172-25cm | Gold Wire 0.25 mm diameter, 99.9% | 7440-57-5 | 25cm |
| GX6172-1m | Gold Wire 0.25 mm diameter, 99.9% | 7440-57-5 | 1m |
| GX6172-5m | Gold Wire 0.25 mm diameter, 99.9% | 7440-57-5 | 5m |
| GX1122-25cm | Gold Wire 0.25 mm diameter, 99.995% | 7440-57-5 | 25cm |
| GX1122-100cm | Gold Wire 0.25 mm diameter, 99.995% | 7440-57-5 | 100cm |
| GX7550-1m | Gold Wire 0.3 mm diameter, 99.9% | 7440-57-5 | 1m |
| GX7904-5cm | Gold Wire 1.0 mm diameter, 99.9% | 7440-57-5 | 5cm |
| GX7904-25cm | Gold Wire 1.0 mm diameter, 99.9% | 7440-57-5 | 25cm |
| GX5838-2cm | Gold Wire 1.0 mm diameter, 99.99% | 7440-57-5 | 2cm |
| GX5838-10cm | Gold Wire 1.0 mm diameter, 99.99% | 7440-57-5 | 10cm |
| GX5838-50cm | Gold Wire 1.0 mm diameter, 99.99% | 7440-57-5 | 50cm |
| GX1838-2cm | Gold Wire 1.0 mm diameter, 99.999% | 7440-57-5 | 2cm |
| GX1838-10cm | Gold Wire 1.0 mm diameter, 99.999% | 7440-57-5 | 10cm |
| GX5878-5cm | Gold Wire 1.5 mm diameter, 99.9% | 7440-57-5 | 5cm |
| GX5878-25cm | Gold Wire 1.5 mm diameter, 99.9% | 7440-57-5 | 25cm |
| GX5094-5cm | Gold Wire 1.5 mm diameter, 99.995% | 7440-57-5 | 5cm |
| GX5094-25cm | Gold Wire 1.5 mm diameter, 99.995% | 7440-57-5 | 25cm |
| GX9759-5cm | Gold Wire 2.0 mm diameter, 99.9% | 7440-57-5 | 5cm |
| GX9759-10cm | Gold Wire 2.0 mm diameter, 99.9% | 7440-57-5 | 10cm |
| GX5128-1g | Gold(I)pinanylmercaptide | 68365-85-7 | 1g |
| GX5128-10g | Gold(I)pinanylmercaptide | 68365-85-7 | 10g |
| GX9027-5g | Gold(III) bromide | 10294-28-7 | 5g |
| GX8162-1g | Gold(III) chloride anhydrous, 99.99% | 13453-07-1 | 1g |
| GX8162-5g | Gold(III) chloride anhydrous, 99.99% | 13453-07-1 | 5g |
| GX2564-1g | Gold(III) iodide, 99.95% (metals basis) | 13453-24-2 | 1g |
| GX3779-1g | Gold/Germanium 88/12 wt% Granules max. 3 mm, 99.99% (metals basis) | 7440-57-5 | 1g |
| GX3779-5g | Gold/Germanium 88/12 wt% Granules max. 3 mm, 99.99% (metals basis) | 7440-57-5 | 5g |
| GX3779-10g | Gold/Germanium 88/12 wt% Granules max. 3 mm, 99.99% (metals basis) | 7440-57-5 | 10g |
| GP6680-25mg | Gossypol | 303-45-7 | 25mg |
| GP6680-100mg | Gossypol | 303-45-7 | 100mg |
| GP6680-250mg | Gossypol | 303-45-7 | 250mg |
| GX3431-250mg | Gossypol-acetic acid | 12542-36-8 | 250mg |
| GX3431-1g | Gossypol-acetic acid | 12542-36-8 | 1g |
| GC8688-100ug | GQ1b-Ganglioside | 68652-37-9 | 100ug |
| GC8688-500ug | GQ1b-Ganglioside | 68652-37-9 | 500ug |
| GY4248-10mg | Gracillin | 19083-00-2 | 10mg |
| GT5199-100ml | Gram's Iodine | 12298-68-9 | 100ml |
| GW9675-250ml | Gram’s Decoloriser Solution | 37348-17-7 | 250ml |
| GW9675-2500ml | Gram’s Decoloriser Solution | 37348-17-7 | 2500ml |
| GP3615-250mg | Granisetron hydrochloride | 107007-99-8 | 250mg |
| GP3615-500mg | Granisetron hydrochloride | 107007-99-8 | 500mg |
| GP3615-1g | Granisetron hydrochloride | 107007-99-8 | 1g |
| GX6750-25g | Graphene Nanopowder, 99.5 %, 11 - 15 nm | 34343-98-0 | 25g |
| GX6750-100g | Graphene Nanopowder, 99.5 %, 11 - 15 nm | 34343-98-0 | 100g |
| GX6750-250g | Graphene Nanopowder, 99.5 %, 11 - 15 nm | 34343-98-0 | 250g |
| GX3231-25g | Graphene Nanopowder, 99.5 %, 6 - 8 nm | 34343-98-0 | 25g |
| GX3231-100g | Graphene Nanopowder, 99.5 %, 6 - 8 nm | 34343-98-0 | 100g |
| GX3231-250g | Graphene Nanopowder, 99.5 %, 6 - 8 nm | 34343-98-0 | 250g |
| GX7364-25g | Graphene Nanopowder, 99.5 %, approx. 2nm | 34343-98-0 | 25g |
| GX7364-100g | Graphene Nanopowder, 99.5 %, approx. 2nm | 34343-98-0 | 100g |
| GX7364-250g | Graphene Nanopowder, 99.5 %, approx. 2nm | 34343-98-0 | 250g |
| GX0782-100x200mm | Graphite foil 0.25 x 100 x 200 mm, 0,5-1% ash | 7782-42-5 | 100x200mm |
| GX0782-500x1000mm | Graphite foil 0.25 x 100 x 200 mm, 0,5-1% ash | 7782-42-5 | 500x1000mm |
| GX4132-100x200mm | Graphite foil 0.5 x 100 x 200 mm, 0,5-1% ash | 7782-42-5 | 100x200mm |
| GX4132-500x1000mm | Graphite foil 0.5 x 100 x 200 mm, 0,5-1% ash | 7782-42-5 | 500x1000mm |
| GX3597-250x500mm | Graphite foil 1.0 x 250 x 500 mm, 0,5-1% ash | 7782-42-5 | 250x500mm |
| GX0508-10g | Graphite Nanopowder, 99.9 % | 7782-42-5 | 10g |
| GX0508-100g | Graphite Nanopowder, 99.9 % | 7782-42-5 | 100g |
| GX0508-500g | Graphite Nanopowder, 99.9 % | 7782-42-5 | 500g |
| GX3891-250x500mm | Graphite plate 2mm, 0.5-1% ash | 7782-42-5 | 250x500mm |
| GX4018-500g | Graphite powder 40-100 micron, 0,4% ash, 99+% | 7782-42-5 | 500g |
| GX4018-1kg | Graphite powder 40-100 micron, 0,4% ash, 99+% | 7782-42-5 | 1kg |
| GX4790-100g | Graphite powder max. 300ppm ash, 99.9+% | 7782-42-5 | 100g |
| GX4790-500g | Graphite powder max. 300ppm ash, 99.9+% | 7782-42-5 | 500g |
| GX8018-300mm | Graphite rod 17 mm diameter, max. 5 ppm ash | 7782-42-5 | 300mm |
| GX8341-300mm | Graphite rod 20 x 300 mm, max. 10 ppm ash | 7782-42-5 | 300mm |
| GX7130-300mm | Graphite rod 20 x 300 mm, max. 100 ppm ash | 7782-42-5 | 300mm |
| GX6587-300mm | Graphite rod 3.05 x 300 mm max. 10 ppm ash, 99.999+% | 7782-42-5 | 300mm |
| GX6587-5x300mm | Graphite rod 3.05 x 300 mm max. 10 ppm ash, 99.999+% | 7782-42-5 | 5x300mm |
| GX6273-300mm | Graphite rod 30 x 300 mm, max. 10 ppm ash | 7782-42-5 | 300mm |
| GX2987-300mm | Graphite rod 30 x 300 mm, max. 100 ppm ash | 7782-42-5 | 300mm |
| GX6512-500mm | Graphite rod 60 mm diameter | 7782-42-5 | 500mm |
| GP1475-5mg | Grazoprevir | 1350514-68-9 | 5mg |
| GW6492-1mg | Green CMFDA | 136832-63-8 | 1mg |
| GW6492-5mg | Green CMFDA | 136832-63-8 | 5mg |
| GW6492-25mg | Green CMFDA | 136832-63-8 | 25mg |
| GA6599-5g | Griseofulvin | 126-07-8 | 5g |
| GA6599-25g | Griseofulvin | 126-07-8 | 25g |
| GA6599-50g | Griseofulvin | 126-07-8 | 50g |
| GW8225-5mg | GS-441524 (Remdesivir Metabolite) | 1191237-69-0 | 5mg |
| GW8225-10mg | GS-441524 (Remdesivir Metabolite) | 1191237-69-0 | 10mg |
| GW8376-100mg | GSH-OEt | 92614-59-0 | 100mg |
| GW8376-500mg | GSH-OEt | 92614-59-0 | 500mg |
| GL0956-1mg | GSK-429286 | 864082-47-3 | 1mg |
| GL0956-5mg | GSK-429286 | 864082-47-3 | 5mg |
| GL0956-10mg | GSK-429286 | 864082-47-3 | 10mg |
| GW0843-1mg | GSK-A1 | 1416334-69-4 | 1mg |
| GW0843-5mg | GSK-A1 | 1416334-69-4 | 5mg |
| GW0843-10mg | GSK-A1 | 1416334-69-4 | 10mg |
| GW7601-1mg | GSK-F1 | 1402345-92-9 | 1mg |
| GW7601-5mg | GSK-F1 | 1402345-92-9 | 5mg |
| GW7601-10mg | GSK-F1 | 1402345-92-9 | 10mg |
| GW4131-1mg | GSK-J1 | 1373422-53-7 | 1mg |
| GW4131-5mg | GSK-J1 | 1373422-53-7 | 5mg |
| GW4131-10mg | GSK-J1 | 1373422-53-7 | 10mg |
| GW7563-1mg | GSK1120212 | 871700-17-3 | 1mg |
| GW7563-5mg | GSK1120212 | 871700-17-3 | 5mg |
| GW7563-10mg | GSK1120212 | 871700-17-3 | 10mg |
| GW9665-1mg | GSK2126458 | 1086062-66-9 | 1mg |
| GW9665-5mg | GSK2126458 | 1086062-66-9 | 5mg |
| GW9665-10mg | GSK2126458 | 1086062-66-9 | 10mg |
| GW4758-1mg | GSK25 | 874119-56-9 | 1mg |
| GW4758-5mg | GSK25 | 874119-56-9 | 5mg |
| GW4758-10mg | GSK25 | 874119-56-9 | 10mg |
| GE1408-1mg | GSK2606414 | 1337531-36-8 | 1mg |
| GE1408-5mg | GSK2606414 | 1337531-36-8 | 5mg |
| GE1408-10mg | GSK2606414 | 1337531-36-8 | 10mg |
| GW7934-1mg | GSK2837808A | 1445879-21-9 | 1mg |
| GW7934-5mg | GSK2837808A | 1445879-21-9 | 5mg |
| GW3442-5mg | GSK690693 | 937174-76-0 | 5mg |
| GW3442-25mg | GSK690693 | 937174-76-0 | 25mg |
| GC4593-1mg | GT1b-Ganglioside | 59247-13-1 | 1mg |
| GC4593-5mg | GT1b-Ganglioside | 59247-13-1 | 5mg |
| GK7789-100g | Guaiacol | 90-05-1 | 100g |
| GK7789-500g | Guaiacol | 90-05-1 | 500g |
| GK7789-1kg | Guaiacol | 90-05-1 | 1kg |
| GP0595-25g | Guaiacol glyceryl ether | 93-14-1 | 25g |
| GP0595-100g | Guaiacol glyceryl ether | 93-14-1 | 100g |
| GP0595-250g | Guaiacol glyceryl ether | 93-14-1 | 250g |
| GP0595-500g | Guaiacol glyceryl ether | 93-14-1 | 500g |
| GP0595-1kg | Guaiacol glyceryl ether | 93-14-1 | 1kg |
| GE3837-10g | Guaiazulene | 489-84-9 | 10g |
| GE3837-25g | Guaiazulene | 489-84-9 | 25g |
| GP1667-100mg | Guanfacine hydrochloride | 29110-48-3 | 100mg |
| GE7025-100g | Guanidine carbonate | 593-85-1 | 100g |
| GE7025-500g | Guanidine carbonate | 593-85-1 | 500g |
| GE4739-100ml | Guanidine hydrochloride solution, 6M | 50-01-1 | 100ml |
| GE4739-500ml | Guanidine hydrochloride solution, 6M | 50-01-1 | 500ml |
| GE4739-1l | Guanidine hydrochloride solution, 6M | 50-01-1 | 1l |
| GE1001-100ml | Guanidine hydrochloride solution, 8M | 50-01-1 | 100ml |
| GE1001-500ml | Guanidine hydrochloride solution, 8M | 50-01-1 | 500ml |
| GE1914-25g | Guanidine hydrochloride, 99% | 50-01-1 | 25g |
| GE1914-100g | Guanidine hydrochloride, 99% | 50-01-1 | 100g |
| GE1914-250g | Guanidine hydrochloride, 99% | 50-01-1 | 250g |
| GE1914-500g | Guanidine hydrochloride, 99% | 50-01-1 | 500g |
| GE1914-1kg | Guanidine hydrochloride, 99% | 50-01-1 | 1kg |
| GE1694-100g | Guanidine thiocyanate | 593-84-0 | 100g |
| GE1694-250g | Guanidine thiocyanate | 593-84-0 | 250g |
| GE1694-500g | Guanidine thiocyanate | 593-84-0 | 500g |
| GE1694-1kg | Guanidine thiocyanate | 593-84-0 | 1kg |
| GE1694-5kg | Guanidine thiocyanate | 593-84-0 | 5kg |
| GE0617-5g | Guanine | 73-40-5 | 5g |
| GE0617-25g | Guanine | 73-40-5 | 25g |
| GE0617-100g | Guanine | 73-40-5 | 100g |
| GE6103-5g | Guanine hydrochloride | 635-39-2 | 5g |
| GE6103-25g | Guanine hydrochloride | 635-39-2 | 25g |
| GE6103-100g | Guanine hydrochloride | 635-39-2 | 100g |
| GE8690-1g | Guanosine | 118-00-3 | 1g |
| GE8690-10g | Guanosine | 118-00-3 | 10g |
| GE8690-25g | Guanosine | 118-00-3 | 25g |
| GE8690-100g | Guanosine | 118-00-3 | 100g |
| GE8690-250g | Guanosine | 118-00-3 | 250g |
| GK2200-5mg | Guanosine 5''-[beta,gamma-imido]triphosphate tetralithium salt hydrate | 64564-03-0 | 5mg |
| GE3702-100mg | Guanosine 5''-diphosphate disodium salt | 7415-69-2 | 100mg |
| GE3702-250mg | Guanosine 5''-diphosphate disodium salt | 7415-69-2 | 250mg |
| GE5826-250mg | Guanosine 5''-monophosphate disodium salt hydrate | 5550-12-9 | 250mg |
| GE5826-1g | Guanosine 5''-monophosphate disodium salt hydrate | 5550-12-9 | 1g |
| GE5826-5g | Guanosine 5''-monophosphate disodium salt hydrate | 5550-12-9 | 5g |
| GE5826-25g | Guanosine 5''-monophosphate disodium salt hydrate | 5550-12-9 | 25g |
| GN6493-1g | Guanosine 5''-triphosphate sodium salt hydrate | 36051-31-7 | 1g |
| GE2026-1g | Guanosine-5''-triphosphate disodium salt | 56001-37-7 | 1g |
| GC3578-250g | Guar | 9000-30-0 | 250g |
| GC3578-500g | Guar | 9000-30-0 | 500g |
| GC3578-1kg | Guar | 9000-30-0 | 1kg |
| GL6162-25g | Guinea Green B | 4680-78-8 | 25g |
| GL6162-100g | Guinea Green B | 4680-78-8 | 100g |
| GC5029-100g | Gum arabic | 9000-01-5 | 100g |
| GC5029-250g | Gum arabic | 9000-01-5 | 250g |
| GC5029-500g | Gum arabic | 9000-01-5 | 500g |
| GC5029-1kg | Gum arabic | 9000-01-5 | 1kg |
| GC0655-500g | Gum arabic, Ph. Eur., USP grade | 9000-01-5 | 500g |
| GC0655-1kg | Gum arabic, Ph. Eur., USP grade | 9000-01-5 | 1kg |
| GC1863-250g | Gum rosin | 8050-09-7 | 250g |
| GC1863-500g | Gum rosin | 8050-09-7 | 500g |
| GC1863-1kg | Gum rosin | 8050-09-7 | 1kg |
| GC1863-5kg | Gum rosin | 8050-09-7 | 5kg |
| GC6544-25g | Gum storax | 8046-19-3 | 25g |
| GW8614-1mg | GW-441756 | 504433-23-2 | 1mg |
| GW8614-5mg | GW-441756 | 504433-23-2 | 5mg |
| GW8614-10mg | GW-441756 | 504433-23-2 | 10mg |
| GW5601-1mg | GW-806742X | 1mg | |
| GW5601-5mg | GW-806742X | 5mg | |
| GW5601-10mg | GW-806742X | 10mg | |
| GL5444-1mg | GW1929 | 196808-24-9 | 1mg |
| GL5444-5mg | GW1929 | 196808-24-9 | 5mg |
| GL5444-25mg | GW1929 | 196808-24-9 | 25mg |
| GW4055-1mg | GW311616A hydrochloride | 197890-44-1 | 1mg |
| GW4055-5mg | GW311616A hydrochloride | 197890-44-1 | 5mg |
| GW4055-25mg | GW311616A hydrochloride | 197890-44-1 | 25mg |
| GW9340-1mg | GW501516 | 317318-70-0 | 1mg |
| GW9340-5mg | GW501516 | 317318-70-0 | 5mg |
| GW9340-25mg | GW501516 | 317318-70-0 | 25mg |
| GL5577-1mg | GW7647 | 265129-71-3 | 1mg |
| GL7524-10mg | GYY 4137 | 106740-09-4 | 10mg |
| GL7524-50mg | GYY 4137 | 106740-09-4 | 50mg |
| GK6037-10mg | H-8 dihydrochloride | 113276-94-1 | 10mg |
| GK6037-50mg | H-8 dihydrochloride | 113276-94-1 | 50mg |
| GK1902-1mg | H-89 dihydrochloride hydrate | 130964-39-5 | 1mg |
| GK1902-5mg | H-89 dihydrochloride hydrate | 130964-39-5 | 5mg |
| GK1902-25mg | H-89 dihydrochloride hydrate | 130964-39-5 | 25mg |
| GH0012-25mg | H-Cys-Gly-OH | 19246-18-5 | 25mg |
| GM6197-1g | H-D-Pro-NH2 | 62937-45-5 | 1g |
| GM6197-5g | H-D-Pro-NH2 | 62937-45-5 | 5g |
| GW8955-5mg | H-D-Val-Leu-Lys-pNA dihydrochloride | 62354-43-2 | 5mg |
| GW8955-25mg | H-D-Val-Leu-Lys-pNA dihydrochloride | 62354-43-2 | 25mg |
| GW7750-100mg | H-Met-AMC | 94367-35-8 | 100mg |
| GW7750-2g | H-Met-AMC | 94367-35-8 | 2g |
| GW5494-1mg | H1152 | 871543-07-6 | 1mg |
| GW5494-5mg | H1152 | 871543-07-6 | 5mg |
| GW5494-10mg | H1152 | 871543-07-6 | 10mg |
| GT7295-5g | Haematoxylin (C.I. 75290) | 517-28-2 | 5g |
| GT7295-10g | Haematoxylin (C.I. 75290) | 517-28-2 | 10g |
| GT7295-25g | Haematoxylin (C.I. 75290) | 517-28-2 | 25g |
| GT7295-100g | Haematoxylin (C.I. 75290) | 517-28-2 | 100g |
| GT2100-5g | Haematoxylin, 75% (C.I. 75290) | 517-28-2 | 5g |
| GT2100-25g | Haematoxylin, 75% (C.I. 75290) | 517-28-2 | 25g |
| GT2100-100g | Haematoxylin, 75% (C.I. 75290) | 517-28-2 | 100g |
| GX8475-25g | Hafnium boride, 99+% | 12007-23-7 | 25g |
| GX4386-25g | Hafnium carbide, 99+% | 12069-85-1 | 25g |
| GX4386-100g | Hafnium carbide, 99+% | 12069-85-1 | 100g |
| GX5747-25g | Hafnium chloride, 98% | 13499-05-3 | 25g |
| GX5747-100g | Hafnium chloride, 98% | 13499-05-3 | 100g |
| GX5457-5g | Hafnium fluoride | 13709-52-9 | 5g |
| GX6916-25x25mm | Hafnium Foil 0.25mm, 99+% | 7440-58-6 | 25x25mm |
| GX6916-50x50mm | Hafnium Foil 0.25mm, 99+% | 7440-58-6 | 50x50mm |
| GX0390-10g | Hafnium hydride, 99.5+% | 12770-26-2 | 10g |
| GX0390-25g | Hafnium hydride, 99.5+% | 12770-26-2 | 25g |
| GX3057-10g | Hafnium nitride, 99% | 25817-87-2 | 10g |
| GX8601-10g | Hafnium oxide, 99.9% | 12055-23-1 | 10g |
| GX7878-10g | Hafnium oxide, 99.9% | 12055-23-1 | 10g |
| GX8601-50g | Hafnium oxide, 99.9% | 12055-23-1 | 50g |
| GX7878-50g | Hafnium oxide, 99.9% | 12055-23-1 | 50g |
| GX2093-5g | Hafnium oxide, 99.95% | 12055-23-1 | 5g |
| GX2093-25g | Hafnium oxide, 99.95% | 12055-23-1 | 25g |
| GX2511-50g | Hafnium oxide, 99+% (contains max. 0.5% Zr) | 12055-23-1 | 50g |
| GX2511-250g | Hafnium oxide, 99+% (contains max. 0.5% Zr) | 12055-23-1 | 250g |
| GX4340-100g | Hafnium oxide, 99+% (contains max. 4.5% Zr) | 12055-23-1 | 100g |
| GX4340-250g | Hafnium oxide, 99+% (contains max. 4.5% Zr) | 12055-23-1 | 250g |
| GX6390-100g | Hafnium Pieces max. 55 mm appr. 100-300 g (price per weight); 99.8% | 7440-58-6 | 100g |
| GX6390-250g | Hafnium Pieces max. 55 mm appr. 100-300 g (price per weight); 99.8% | 7440-58-6 | 250g |
| GX6390-500g | Hafnium Pieces max. 55 mm appr. 100-300 g (price per weight); 99.8% | 7440-58-6 | 500g |
| GX4121-10g | Hafnium Pieces, 99.9% | 7440-58-6 | 10g |
| GX4121-25g | Hafnium Pieces, 99.9% | 7440-58-6 | 25g |
| GX4121-100g | Hafnium Pieces, 99.9% | 7440-58-6 | 100g |
| GX4121-250g | Hafnium Pieces, 99.9% | 7440-58-6 | 250g |
| GX0485-5g | Hafnium Powder -325 mesh, 99.8% | 7440-58-6 | 5g |
| GX0157-50mm | Hafnium Rod 6.35 mm diameter, 99.8% | 7440-58-6 | 50mm |
| GX0157-100mm | Hafnium Rod 6.35 mm diameter, 99.8% | 7440-58-6 | 100mm |
| GX1173-2g | Hafnium silicide, 99.5% | 12401-56-8 | 2g |
| GX1173-5g | Hafnium silicide, 99.5% | 12401-56-8 | 5g |
| GX8723-2g | Hafnium t-butoxide, 99.9% | 2172-02-3 | 2g |
| GX8723-10g | Hafnium t-butoxide, 99.9% | 2172-02-3 | 10g |
| GX1874-25cm | Hafnium Wire 1.0 mm diameter, 99+% | 7440-58-6 | 25cm |
| GX1874-50cm | Hafnium Wire 1.0 mm diameter, 99+% | 7440-58-6 | 50cm |
| GW1930-50mg | Halofenozide | 112226-61-6 | 50mg |
| GW1930-250mg | Halofenozide | 112226-61-6 | 250mg |
| GK8532-10mg | Halofuginone hydrobromide | 64924-67-0 | 10mg |
| GP4309-1g | Harmine | 442-51-3 | 1g |
| GP8204-100mg | Harmol hydrochloride hydrate | 40580-83-4 | 100mg |
| GE0815-250ml | Hartman’s Fixative | 250ml | |
| GE0815-500ml | Hartman’s Fixative | 500ml | |
| GA1613-250ug | Harzianopyridone | 137813-88-8 | 250ug |
| GA1613-1mg | Harzianopyridone | 137813-88-8 | 1mg |
| GL2700-250ug | Harzianum A | 156250-74-7 | 250ug |
| GL2700-1mg | Harzianum A | 156250-74-7 | 1mg |
| GE0156-10g | HATU | 148893-10-1 | 10g |
| GE0156-25g | HATU | 148893-10-1 | 25g |
| GE0156-100g | HATU | 148893-10-1 | 100g |
| GE0864-25g | HBTU | 94790-37-1 | 25g |
| GE0864-100g | HBTU | 94790-37-1 | 100g |
| GE0864-500g | HBTU | 94790-37-1 | 500g |
| GE0864-1kg | HBTU | 94790-37-1 | 1kg |
| GW2310-50mg | HCPI | 151589-38-7 | 50mg |
| GW2310-250mg | HCPI | 151589-38-7 | 250mg |
| GY6797-10mg | Hederacoside C | 14216-03-6 | 10mg |
| GL2626-500ug | Helenalin | 6754-13-8 | 500ug |
| GL2626-1mg | Helenalin | 6754-13-8 | 1mg |
| GL8551-250ug | Heliquinomycin | 178182-49-5 | 250ug |
| GL8551-500ug | Heliquinomycin | 178182-49-5 | 500ug |
| GW8826-1mg | Hellebrin | 13289-18-4 | 1mg |
| GW8826-5mg | Hellebrin | 13289-18-4 | 5mg |
| GL0753-1mg | Helvolic acid | 29400-42-8 | 1mg |
| GL0753-5mg | Helvolic acid | 29400-42-8 | 5mg |
| GT7429-10g | Hematein | 475-25-2 | 10g |
| GT7429-25g | Hematein | 475-25-2 | 25g |
| GT7429-50g | Hematein | 475-25-2 | 50g |
| GT4757-250ml | Hematoxylin Solution, Gill No. 1 | 250ml | |
| GT4757-1l | Hematoxylin Solution, Gill No. 1 | 1l | |
| GT3728-250ml | Hematoxylin Solution, Gill No. 2 | 250ml | |
| GT3728-1l | Hematoxylin Solution, Gill No. 2 | 1l | |
| GT7060-250ml | Hematoxylin Solution, Gill No. 3 | 250ml | |
| GT7060-1l | Hematoxylin Solution, Gill No. 3 | 1l | |
| GT0111-250ml | Hematoxylin Solution, Harris Modified | - | 250ml |
| GT0111-1l | Hematoxylin Solution, Harris Modified | - | 1l |
| GT4631-250ml | Hematoxylin Solution, Mayer's | - | 250ml |
| GT4631-1l | Hematoxylin Solution, Mayer's | - | 1l |
| GE9985-1g | Hemin, 98% | 16009-13-5 | 1g |
| GE9985-5g | Hemin, 98% | 16009-13-5 | 5g |
| GE9985-10g | Hemin, 98% | 16009-13-5 | 10g |
| GE9985-25g | Hemin, 98% | 16009-13-5 | 25g |
| GL7038-10g | Hemoglobin | 9008-02-0 | 10g |
| GL6667-25g | Heneicosane | 629-94-7 | 25g |
| GC2822-250mg | Heparin lithium salt | 9045-22-1 | 250mg |
| GC2822-1g | Heparin lithium salt | 9045-22-1 | 1g |
| GC2822-5g | Heparin lithium salt | 9045-22-1 | 5g |
| GC2310-100mg | Heparin sodium salt | 9041-08-1 | 100mg |
| GC2310-250mg | Heparin sodium salt | 9041-08-1 | 250mg |
| GC2310-1g | Heparin sodium salt | 9041-08-1 | 1g |
| GC9695-1g | Heparin sodium salt, Ph. Eur. grade | 9041-08-1 | 1g |
| GK1938-25g | HEPBS | 161308-36-7 | 25g |
| GK1938-100g | HEPBS | 161308-36-7 | 100g |
| GB3086-10g | HEPES | 7365-45-9 | 10g |
| GB3086-25g | HEPES | 7365-45-9 | 25g |
| GB3086-100g | HEPES | 7365-45-9 | 100g |
| GB3086-500g | HEPES | 7365-45-9 | 500g |
| GB3086-1kg | HEPES | 7365-45-9 | 1kg |
| GK6272-25g | HEPES hemisodium salt | 103404-87-1 | 25g |
| GK6272-100g | HEPES hemisodium salt | 103404-87-1 | 100g |
| GB9181-25g | HEPES sodium salt | 75277-39-3 | 25g |
| GB9181-100g | HEPES sodium salt | 75277-39-3 | 100g |
| GB9181-250g | HEPES sodium salt | 75277-39-3 | 250g |
| GB9181-500g | HEPES sodium salt | 75277-39-3 | 500g |
| GB9181-1kg | HEPES sodium salt | 75277-39-3 | 1kg |
| GE8587-500ml | HEPES sodium salt, 1M solution | 75277-39-3 | 500ml |
| GE8587-1l | HEPES sodium salt, 1M solution | 75277-39-3 | 1l |
| GM5581-1kg | HEPES, 99.5%, GlenCell™, suitable for cell culture | 7365-45-9 | 1kg |
| GB8306-25g | HEPPS | 16052-06-5 | 25g |
| GB8306-100g | HEPPS | 16052-06-5 | 100g |
| GB8306-250g | HEPPS | 16052-06-5 | 250g |
| GB8306-500g | HEPPS | 16052-06-5 | 500g |
| GB8306-1kg | HEPPS | 16052-06-5 | 1kg |
| GB2637-100g | HEPPSO | 68399-78-0 | 100g |
| GB2637-500g | HEPPSO | 68399-78-0 | 500g |
| GC0495-100mg | Hepta-O-acetyl-b-lactosyl azide | 30854-62-7 | 100mg |
| GC0495-250mg | Hepta-O-acetyl-b-lactosyl azide | 30854-62-7 | 250mg |
| GC0495-500mg | Hepta-O-acetyl-b-lactosyl azide | 30854-62-7 | 500mg |
| GC0495-1g | Hepta-O-acetyl-b-lactosyl azide | 30854-62-7 | 1g |
| GL9144-1g | Heptadecanoic acid | 506-12-7 | 1g |
| GL9144-5g | Heptadecanoic acid | 506-12-7 | 5g |
| GC9584-1g | Heptakis(2,6-di-O-methyl)-b-cyclodextrin | 51166-71-3 | 1g |
| GC9584-5g | Heptakis(2,6-di-O-methyl)-b-cyclodextrin | 51166-71-3 | 5g |
| GC9584-10g | Heptakis(2,6-di-O-methyl)-b-cyclodextrin | 51166-71-3 | 10g |
| GS8770-100ml | Heptane fraction, GlenDry™, anhydrous | 100ml | |
| GS8770-500ml | Heptane fraction, GlenDry™, anhydrous | 500ml | |
| GS8770-1l | Heptane fraction, GlenDry™, anhydrous | 1l | |
| GS8770-1l | Heptane fraction, GlenDry™, anhydrous | 1l | |
| GS8770-2500ml | Heptane fraction, GlenDry™, anhydrous | 2500ml | |
| GS8315-500ml | Heptane fraction, GlenPure™, analytical grade | 500ml | |
| GS8315-1l | Heptane fraction, GlenPure™, analytical grade | 1l | |
| GS8315-2500ml | Heptane fraction, GlenPure™, analytical grade | 2500ml | |
| GK7040-1l | Heptane, technical grade | 142-82-5 | 1l |
| GK7040-2500ml | Heptane, technical grade | 142-82-5 | 2500ml |
| GK7479-100ml | Heptanoic acid | 111-14-8 | 100ml |
| GL6923-250ug | Heptelidic acid | 57710-57-3 | 250ug |
| GL6923-1mg | Heptelidic acid | 57710-57-3 | 1mg |
| GW8820-100mg | Heptenophos | 23560-59-0 | 100mg |
| GW8820-500mg | Heptenophos | 23560-59-0 | 500mg |
| GC5331-500mg | Heptyl b-D-glucopyranoside | 78617-12-6 | 500mg |
| GC5331-1g | Heptyl b-D-glucopyranoside | 78617-12-6 | 1g |
| GC8635-1g | Heptyl beta-D-thioglucopyranoside | 85618-20-8 | 1g |
| GA2466-100ug | Herbimycin A | 70563-58-5 | 100ug |
| GA2466-1mg | Herbimycin A | 70563-58-5 | 1mg |
| GW6376-250ug | Herquline A | 71812-08-3 | 250ug |
| GW6376-1mg | Herquline A | 71812-08-3 | 1mg |
| GP5086-5g | Hesperetin | 520-33-2 | 5g |
| GC7197-1mg | Hesperetin 3''-O-β-D-glucuronide | 1237479-05-8 | 1mg |
| GC7197-5mg | Hesperetin 3''-O-β-D-glucuronide | 1237479-05-8 | 5mg |
| GC7197-10mg | Hesperetin 3''-O-β-D-glucuronide | 1237479-05-8 | 10mg |
| GC7197-25mg | Hesperetin 3''-O-β-D-glucuronide | 1237479-05-8 | 25mg |
| GC7470-1mg | Hesperetin 3'',7-di-O-β-D-glucuronide | 1mg | |
| GC7470-5mg | Hesperetin 3'',7-di-O-β-D-glucuronide | 5mg | |
| GC7470-10mg | Hesperetin 3'',7-di-O-β-D-glucuronide | 10mg | |
| GC7470-25mg | Hesperetin 3'',7-di-O-β-D-glucuronide | 25mg | |
| GC7470-50mg | Hesperetin 3'',7-di-O-β-D-glucuronide | 50mg | |
| GC2489-1mg | Hesperetin 7-O-β-D-glucopyranoside | 906320-94-3 | 1mg |
| GC2489-2mg | Hesperetin 7-O-β-D-glucopyranoside | 906320-94-3 | 2mg |
| GC2489-5mg | Hesperetin 7-O-β-D-glucopyranoside | 906320-94-3 | 5mg |
| GC2489-10mg | Hesperetin 7-O-β-D-glucopyranoside | 906320-94-3 | 10mg |
| GC2489-25mg | Hesperetin 7-O-β-D-glucopyranoside | 906320-94-3 | 25mg |
| GC1198-1mg | Hesperetin 7-O-β-D-glucuronide | 1237479-09-2 | 1mg |
| GC1198-5mg | Hesperetin 7-O-β-D-glucuronide | 1237479-09-2 | 5mg |
| GC1198-10mg | Hesperetin 7-O-β-D-glucuronide | 1237479-09-2 | 10mg |
| GC1198-25mg | Hesperetin 7-O-β-D-glucuronide | 1237479-09-2 | 25mg |
| GC6376-25g | Hesperidin | 520-26-3 | 25g |
| GC6376-100g | Hesperidin | 520-26-3 | 100g |
| GX6519-10g | Hexaammine cobalt(III) chloride, 99.999% | 10534-89-1 | 10g |
| GX6519-50g | Hexaammine cobalt(III) chloride, 99.999% | 10534-89-1 | 50g |
| GX0711-25g | Hexabutylditin, 98+% | 813-19-4 | 25g |
| GA6437-1g | Hexachlorophene | 70-30-4 | 1g |
| GA6437-5g | Hexachlorophene | 70-30-4 | 5g |
| GA6437-10g | Hexachlorophene | 70-30-4 | 10g |
| GL0310-1mg | Hexacyclinic acid | 309757-85-5 | 1mg |
| GL0310-5mg | Hexacyclinic acid | 309757-85-5 | 5mg |
| GC1423-25mg | Hexadecyl β-D-glucopyranoside | 75319-63-0 | 25mg |
| GC1423-50mg | Hexadecyl β-D-glucopyranoside | 75319-63-0 | 50mg |
| GC1423-100mg | Hexadecyl β-D-glucopyranoside | 75319-63-0 | 100mg |
| GC1423-250mg | Hexadecyl β-D-glucopyranoside | 75319-63-0 | 250mg |
| GC1149-100mg | Hexadecyl β-D-xylopyranoside | 115211-19-3 | 100mg |
| GC1149-250mg | Hexadecyl β-D-xylopyranoside | 115211-19-3 | 250mg |
| GC1149-500mg | Hexadecyl β-D-xylopyranoside | 115211-19-3 | 500mg |
| GC1149-1g | Hexadecyl β-D-xylopyranoside | 115211-19-3 | 1g |
| GE9991-10g | Hexadecyltrimethylammonium chloride | 112-02-7 | 10g |
| GE9991-25g | Hexadecyltrimethylammonium chloride | 112-02-7 | 25g |
| GE9991-100g | Hexadecyltrimethylammonium chloride | 112-02-7 | 100g |
| GS9159-25ml | Hexafluoropropan-2-ol, GlenPure™, analytical grade | 920-66-1 | 25ml |
| GS9159-100ml | Hexafluoropropan-2-ol, GlenPure™, analytical grade | 920-66-1 | 100ml |
| GK4253-100g | Hexahydro-1,3,5-tris(hydroxyethyl)-s-triazine, 74% solution in water | 4719-04-4 | 100g |
| GC6012-100mg | Hexakis (2,3,6-tri-O-methyl)-alpha-cyclodextrin | 68715-56-0 | 100mg |
| GK9101-10g | Hexamethyldisilane | 1450-14-2 | 10g |
| GK9101-50g | Hexamethyldisilane | 1450-14-2 | 50g |
| GK5441-25g | Hexamethylenetetramine | 100-97-0 | 25g |
| GK5441-100g | Hexamethylenetetramine | 100-97-0 | 100g |
| GK9166-5mg | Hexamidine diisethionate | 659-40-5 | 5mg |
| GK6193-1l | Hexanal | 66-25-1 | 1l |
| GS2256-100ml | Hexane fraction, GlenDry™, anhydrous | 73513-42-5 | 100ml |
| GS2256-500ml | Hexane fraction, GlenDry™, anhydrous | 73513-42-5 | 500ml |
| GS2256-1l | Hexane fraction, GlenDry™, anhydrous | 73513-42-5 | 1l |
| GS2256-2500ml | Hexane fraction, GlenDry™, anhydrous | 73513-42-5 | 2500ml |
| GS6546-500ml | Hexane fraction, GlenPure™, analytical grade | 73513-42-5 | 500ml |
| GS6546-1l | Hexane fraction, GlenPure™, analytical grade | 73513-42-5 | 1l |
| GS6546-2500ml | Hexane fraction, GlenPure™, analytical grade | 73513-42-5 | 2500ml |
| GK3289-100ml | Hexanoic acid | 142-62-1 | 100ml |
| GK3289-500ml | Hexanoic acid | 142-62-1 | 500ml |
| GK3289-1l | Hexanoic acid | 142-62-1 | 1l |
| GP7328-1g | Hexestrol | 84-16-2 | 1g |
| GC4449-100mg | Hexyl b-D-glucopyranoside | 59080-45-4 | 100mg |
| GC4449-500mg | Hexyl b-D-glucopyranoside | 59080-45-4 | 500mg |
| GC4449-1g | Hexyl b-D-glucopyranoside | 59080-45-4 | 1g |
| GP0090-1g | Hinokitiol | 499-44-5 | 1g |
| GP0090-5g | Hinokitiol | 499-44-5 | 5g |
| GM5145-500g | Hippuric acid | 495-69-2 | 500g |
| GM2902-25g | Hippuric acid sodium salt | 532-94-5 | 25g |
| GL9196-1g | Histamine | 51-45-6 | 1g |
| GL9196-5g | Histamine | 51-45-6 | 5g |
| GE0339-1g | Histamine dihydrochloride | 56-92-8 | 1g |
| GE0339-5g | Histamine dihydrochloride | 56-92-8 | 5g |
| GE0339-25g | Histamine dihydrochloride | 56-92-8 | 25g |
| GW9327-5g | HITCI | 19764-96-6 | 5g |
| GZ3821-5000U | HL-Nuclease | 9025-65-4 | 5000U |
| GZ3821-25000U | HL-Nuclease | 9025-65-4 | 25000U |
| GE0426-25g | HOBt hydrate | 123333-53-9 | 25g |
| GE0426-100g | HOBt hydrate | 123333-53-9 | 100g |
| GE0426-250g | HOBt hydrate | 123333-53-9 | 250g |
| GE0426-500g | HOBt hydrate | 123333-53-9 | 500g |
| GW7550-25mg | Hoechst 33342 | 875756-97-1 | 25mg |
| GW7550-500mg | Hoechst 33342 | 875756-97-1 | 500mg |
| GW7550-5g | Hoechst 33342 | 875756-97-1 | 5g |
| GW7787-5mg | Hoechst 34580 | 911004-45-0 | 5mg |
| GW7787-50mg | Hoechst 34580 | 911004-45-0 | 50mg |
| GW9897-5ml | Hoechst 34580 solution (20 mM in water); 11.2 mg/ml in water | 911004-45-0 | 5ml |
| GX8652-10g | Holmium acetate hydrate, 99.999% | 312619-49-1 | 10g |
| GX8856-5g | Holmium Chips, 99.9% | 7440-60-0 | 5g |
| GX8856-25g | Holmium Chips, 99.9% | 7440-60-0 | 25g |
| GX8485-25g | Holmium chloride hydrate, 99.9% | 14914-84-2 | 25g |
| GX8485-100g | Holmium chloride hydrate, 99.9% | 14914-84-2 | 100g |
| GX6686-10g | Holmium fluoride, anhydrous, 99.9% | 13760-78-6 | 10g |
| GX6686-50g | Holmium fluoride, anhydrous, 99.9% | 13760-78-6 | 50g |
| GX6207-10g | Holmium fluoride, anhydrous, 99.999% | 13760-78-6 | 10g |
| GX6207-50g | Holmium fluoride, anhydrous, 99.999% | 13760-78-6 | 50g |
| GX4423-10x10mm | Holmium Foil 0.25mm, 99.9% | 7440-60-0 | 10x10mm |
| GX4423-25x25mm | Holmium Foil 0.25mm, 99.9% | 7440-60-0 | 25x25mm |
| GX4423-25x50mm | Holmium Foil 0.25mm, 99.9% | 7440-60-0 | 25x50mm |
| GX4706-10g | Holmium hydroxide hydrate, 99.9% | 12054-57-8 | 10g |
| GX4706-50g | Holmium hydroxide hydrate, 99.9% | 12054-57-8 | 50g |
| GX3168-25g | Holmium oxalate hydrate, 99.9% | 28965-57-3 | 25g |
| GX3168-100g | Holmium oxalate hydrate, 99.9% | 28965-57-3 | 100g |
| GX8215-5g | Holmium oxide, 99.9% | 12055-62-8 | 5g |
| GX8215-25g | Holmium oxide, 99.9% | 12055-62-8 | 25g |
| GX8215-100g | Holmium oxide, 99.9% | 12055-62-8 | 100g |
| GX8140-10g | Holmium oxide, 99.99% | 12055-62-8 | 10g |
| GX8140-50g | Holmium oxide, 99.99% | 12055-62-8 | 50g |
| GX3447-1g | Holmium Pieces distilled, 99.99% | 7440-60-0 | 1g |
| GX3447-5g | Holmium Pieces distilled, 99.99% | 7440-60-0 | 5g |
| GX3447-25g | Holmium Pieces distilled, 99.99% | 7440-60-0 | 25g |
| GX2124-5g | Holmium Pieces, 99.9% | 7440-60-0 | 5g |
| GX2124-25g | Holmium Pieces, 99.9% | 7440-60-0 | 25g |
| GX8288-5g | Holmium Powder, 99.9% | 7440-60-0 | 5g |
| GX8288-25g | Holmium Powder, 99.9% | 7440-60-0 | 25g |
| GX0352-10g | Holmium sulfate hydrate, 99.9% | 15622-40-9 | 10g |
| GX0352-25g | Holmium sulfate hydrate, 99.9% | 15622-40-9 | 25g |
| GX2709-10g | Holmium sulfate hydrate, 99.999% | 15622-40-9 | 10g |
| GX4392-1g | Holmium sulfide, 99.9% | 12162-59-3 | 1g |
| GX8998-5cm | Holmium Wire 1 mm diameter, 99.9% | 7440-60-0 | 5cm |
| GX8998-25cm | Holmium Wire 1 mm diameter, 99.9% | 7440-60-0 | 25cm |
| GX8998-50cm | Holmium Wire 1 mm diameter, 99.9% | 7440-60-0 | 50cm |
| GX5335-1g | Holmium-fod, 99% | 18323-97-2 | 1g |
| GE3427-1g | Homatropine hydrobromide | 51-56-9 | 1g |
| GE3427-10g | Homatropine hydrobromide | 51-56-9 | 10g |
| GE3427-25g | Homatropine hydrobromide | 51-56-9 | 25g |
| GC7606-5mg | Homofuraneol β-D-glucopyranoside | 5mg | |
| GC7606-10mg | Homofuraneol β-D-glucopyranoside | 10mg | |
| GC7606-25mg | Homofuraneol β-D-glucopyranoside | 25mg | |
| GC7606-50mg | Homofuraneol β-D-glucopyranoside | 50mg | |
| GC7606-100mg | Homofuraneol β-D-glucopyranoside | 100mg | |
| GA3648-250mg | Honokiol | 35354-74-6 | 250mg |
| GA3648-1g | Honokiol | 35354-74-6 | 1g |
| GL5849-1g | Hordenine | 539-15-1 | 1g |
| GL5849-5g | Hordenine | 539-15-1 | 5g |
| GL5849-50g | Hordenine | 539-15-1 | 50g |
| GL0121-500ug | Hormaomycin | 121548-21-8 | 500ug |
| GL0121-1mg | Hormaomycin | 121548-21-8 | 1mg |
| GK1476-1g | Hyaluronic acid | 9004-61-9 | 1g |
| GC4582-5g | Hyaluronic acid sodium salt, m.w. 1.0 - 1.5 MDa | 9067-32-7 | 5g |
| GC4582-25g | Hyaluronic acid sodium salt, m.w. 1.0 - 1.5 MDa | 9067-32-7 | 25g |
| GC4582-100g | Hyaluronic acid sodium salt, m.w. 1.0 - 1.5 MDa | 9067-32-7 | 100g |
| GC4582-250g | Hyaluronic acid sodium salt, m.w. 1.0 - 1.5 MDa | 9067-32-7 | 250g |
| GC7932-5g | Hyaluronic acid sodium salt, m.w. 1.5MDa | 9067-32-7 | 5g |
| GC7932-25g | Hyaluronic acid sodium salt, m.w. 1.5MDa | 9067-32-7 | 25g |
| GC7932-100g | Hyaluronic acid sodium salt, m.w. 1.5MDa | 9067-32-7 | 100g |
| GC3902-25g | Hyaluronic acid sodium salt, m.w. 2.0 MDa | 9067-32-7 | 25g |
| GC3902-100g | Hyaluronic acid sodium salt, m.w. 2.0 MDa | 9067-32-7 | 100g |
| GC0118-5g | Hyaluronic acid sodium salt, m.w. 200 - 400 kDa | 9067-32-7 | 5g |
| GC0118-25g | Hyaluronic acid sodium salt, m.w. 200 - 400 kDa | 9067-32-7 | 25g |
| GC0118-100g | Hyaluronic acid sodium salt, m.w. 200 - 400 kDa | 9067-32-7 | 100g |
| GC9726-5g | Hyaluronic acid sodium salt, m.w. 3,000 - 5,000 | 9067-32-7 | 5g |
| GC9726-25g | Hyaluronic acid sodium salt, m.w. 3,000 - 5,000 | 9067-32-7 | 25g |
| GC9726-100g | Hyaluronic acid sodium salt, m.w. 3,000 - 5,000 | 9067-32-7 | 100g |
| GC9726-250g | Hyaluronic acid sodium salt, m.w. 3,000 - 5,000 | 9067-32-7 | 250g |
| GC6191-5g | Hyaluronic acid sodium salt, m.w. 30,000 - 50,000 | 9067-32-7 | 5g |
| GC6191-25g | Hyaluronic acid sodium salt, m.w. 30,000 - 50,000 | 9067-32-7 | 25g |
| GC6191-100g | Hyaluronic acid sodium salt, m.w. 30,000 - 50,000 | 9067-32-7 | 100g |
| GC6191-250g | Hyaluronic acid sodium salt, m.w. 30,000 - 50,000 | 9067-32-7 | 250g |
| GC6191-500g | Hyaluronic acid sodium salt, m.w. 30,000 - 50,000 | 9067-32-7 | 500g |
| GC0005-5g | Hyaluronic acid sodium salt, m.w. 50,000 - 100,000 | 9067-32-7 | 5g |
| GC0005-25g | Hyaluronic acid sodium salt, m.w. 50,000 - 100,000 | 9067-32-7 | 25g |
| GC0005-100g | Hyaluronic acid sodium salt, m.w. 50,000 - 100,000 | 9067-32-7 | 100g |
| GC0005-250g | Hyaluronic acid sodium salt, m.w. 50,000 - 100,000 | 9067-32-7 | 250g |
| GC7733-25g | Hyaluronic acid sodium salt, m.w. 750 kDa - 1.0 MDa | 9067-32-7 | 25g |
| GC7733-100g | Hyaluronic acid sodium salt, m.w. 750 kDa - 1.0 MDa | 9067-32-7 | 100g |
| GC7733-250g | Hyaluronic acid sodium salt, m.w. 750 kDa - 1.0 MDa | 9067-32-7 | 250g |
| GE8970-100mg | Hyaluronidase | 9001-54-1 | 100mg |
| GE8970-250mg | Hyaluronidase | 9001-54-1 | 250mg |
| GW9866-100mg | Hydramethylnon | 67485-29-4 | 100mg |
| GW9866-1g | Hydramethylnon | 67485-29-4 | 1g |
| GK6594-100g | Hydrazine dihydrochloride | 5341-61-7 | 100g |
| GK6594-500g | Hydrazine dihydrochloride | 5341-61-7 | 500g |
| GK4864-25g | Hydrazine sulfate | 10034-93-2 | 25g |
| GK5212-10g | Hydrindantin dihydrate | 5950-69-6 | 10g |
| GK5212-25g | Hydrindantin dihydrate | 5950-69-6 | 25g |
| GK5212-50g | Hydrindantin dihydrate | 5950-69-6 | 50g |
| GX3547-500ml | Hydriodic acid, stabilised, 57% solution in water | 10034-85-2 | 500ml |
| GX3547-1l | Hydriodic acid, stabilised, 57% solution in water | 10034-85-2 | 1l |
| GS1085-1l | Hydrochloric acid 1% | 7647-01-0 | 1l |
| GK5744-100ml | Hydrochloric acid 36%, GlenCell™, suitable for cell culture | 7647-01-0 | 100ml |
| GK5744-500ml | Hydrochloric acid 36%, GlenCell™, suitable for cell culture | 7647-01-0 | 500ml |
| GK2225-500ml | Hydrochloric acid 37% | 7647-01-0 | 500ml |
| GK2225-1l | Hydrochloric acid 37% | 7647-01-0 | 1l |
| GK2225-2500ml | Hydrochloric acid 37% | 7647-01-0 | 2500ml |
| GX8401-1l | Hydrochloric acid, 1M solution | 7647-01-0 | 1l |
| GE3443-1l | Hydrochloric acid, 4% (w/v) in water | 7647-01-0 | 1l |
| GX0143-500ml | Hydrochloric acid, 6M solution | 7647-01-0 | 500ml |
| GX0143-1l | Hydrochloric acid, 6M solution | 7647-01-0 | 1l |
| GE0436-5g | Hydrochlorothiazide | 58-93-5 | 5g |
| GE0436-25g | Hydrochlorothiazide | 58-93-5 | 25g |
| GE0436-100g | Hydrochlorothiazide | 58-93-5 | 100g |
| GP8860-1g | Hydrocortisone | 50-23-7 | 1g |
| GP8860-5g | Hydrocortisone | 50-23-7 | 5g |
| GP8860-10g | Hydrocortisone | 50-23-7 | 10g |
| GP8860-25g | Hydrocortisone | 50-23-7 | 25g |
| GK1717-100mg | Hydrocortisone 21-hemisuccinate sodium salt | 125-04-2 | 100mg |
| GA8586-1g | Hydrocortisone acetate | 50-03-3 | 1g |
| GA8586-5g | Hydrocortisone acetate | 50-03-3 | 5g |
| GA8586-10g | Hydrocortisone acetate | 50-03-3 | 10g |
| GP5848-1g | Hydrocortisone butyrate | 13609-67-1 | 1g |
| GP1580-250mg | Hydrocortisone hemisuccinate | 2203-97-6 | 250mg |
| GP1580-1g | Hydrocortisone hemisuccinate | 2203-97-6 | 1g |
| GE1911-100ml | Hydrogen peroxide, 30% | 7722-84-1 | 100ml |
| GE1911-500ml | Hydrogen peroxide, 30% | 7722-84-1 | 500ml |
| GE7978-500ml | Hydrogen peroxide, 35% | 7722-84-1 | 500ml |
| GE3243-100g | Hydrogen peroxide, 6% in water | 7722-84-1 | 100g |
| GE3243-500g | Hydrogen peroxide, 6% in water | 7722-84-1 | 500g |
| GS8182-1l | Hydrogen peroxide, 7.5% in water | 7722-84-1 | 1l |
| GX2720-1g | Hydrogen tetrachloroaurate(III) hydrate | 27988-77-8 | 1g |
| GX6701-1g | Hydrogen tetrachloroaurate(III) hydrate, 99.95% (metals basis) | 16961-25-4 | 1g |
| GX6701-5g | Hydrogen tetrachloroaurate(III) hydrate, 99.95% (metals basis) | 16961-25-4 | 5g |
| GK2942-1g | Hydrogen tetrachloroaurate(III) trihydrate | 16961-25-4 | 1g |
| GX6315-1g | Hydrogen tetrachloroaurate(III); solution | 16903-35-8 | 1g |
| GX6315-5g | Hydrogen tetrachloroaurate(III); solution | 16903-35-8 | 5g |
| GX7968-100g | Hydrogenated bisphenol A | 80-04-6 | 100g |
| GX7968-500g | Hydrogenated bisphenol A | 80-04-6 | 500g |
| GK8747-10g | Hydroquinidine hydrochloride | 1476-98-8 | 10g |
| GK8747-25g | Hydroquinidine hydrochloride | 1476-98-8 | 25g |
| GK8747-100g | Hydroquinidine hydrochloride | 1476-98-8 | 100g |
| GK0341-100g | Hydroquinone | 123-31-9 | 100g |
| GK0341-250g | Hydroquinone | 123-31-9 | 250g |
| GK0341-500g | Hydroquinone | 123-31-9 | 500g |
| GK0341-1kg | Hydroquinone | 123-31-9 | 1kg |
| GX0225-5g | Hydroxethyl-p-phenylenediamine sulfate | 93841-25-9 | 5g |
| GX0225-10g | Hydroxethyl-p-phenylenediamine sulfate | 93841-25-9 | 10g |
| GX0225-25g | Hydroxethyl-p-phenylenediamine sulfate | 93841-25-9 | 25g |
| GE5819-250mg | Hydroxocobalamin acetate | 22465-48-1 | 250mg |
| GE5819-1g | Hydroxocobalamin acetate | 22465-48-1 | 1g |
| GT4927-25g | Hydroxy naphthol blue disodium salt | 165660-27-5 | 25g |
| GT4927-100g | Hydroxy naphthol blue disodium salt | 165660-27-5 | 100g |
| GX1336-1kg | Hydroxyapatite | 1306-06-5 | 1kg |
| GC2271-1mg | Hydroxychloroquine O-β-D-glucuronide | - | 1mg |
| GC2271-2mg | Hydroxychloroquine O-β-D-glucuronide | - | 2mg |
| GC2271-5mg | Hydroxychloroquine O-β-D-glucuronide | - | 5mg |
| GK2606-1g | Hydroxychloroquine sulfate | 747-36-4 | 1g |
| GC2093-25g | Hydroxyethyl cellulose, high viscosity | 9004-62-0 | 25g |
| GC2093-100g | Hydroxyethyl cellulose, high viscosity | 9004-62-0 | 100g |
| GC2093-250g | Hydroxyethyl cellulose, high viscosity | 9004-62-0 | 250g |
| GC2093-500g | Hydroxyethyl cellulose, high viscosity | 9004-62-0 | 500g |
| GC2093-1kg | Hydroxyethyl cellulose, high viscosity | 9004-62-0 | 1kg |
| GC0004-25g | Hydroxyethyl cellulose, low viscosity | 9004-62-0 | 25g |
| GC0004-100g | Hydroxyethyl cellulose, low viscosity | 9004-62-0 | 100g |
| GC0004-250g | Hydroxyethyl cellulose, low viscosity | 9004-62-0 | 250g |
| GC0004-500g | Hydroxyethyl cellulose, low viscosity | 9004-62-0 | 500g |
| GC0004-1kg | Hydroxyethyl cellulose, low viscosity | 9004-62-0 | 1kg |
| GC2547-25g | Hydroxyethyl cellulose, medium viscosity | 9004-62-0 | 25g |
| GC2547-100g | Hydroxyethyl cellulose, medium viscosity | 9004-62-0 | 100g |
| GC2547-250g | Hydroxyethyl cellulose, medium viscosity | 9004-62-0 | 250g |
| GC2547-500g | Hydroxyethyl cellulose, medium viscosity | 9004-62-0 | 500g |
| GC2547-1kg | Hydroxyethyl cellulose, medium viscosity | 9004-62-0 | 1kg |
| GC9711-25g | Hydroxyethyl cellulose, very low viscosity | 9004-62-0 | 25g |
| GC9711-100g | Hydroxyethyl cellulose, very low viscosity | 9004-62-0 | 100g |
| GC9711-250g | Hydroxyethyl cellulose, very low viscosity | 9004-62-0 | 250g |
| GC9711-500g | Hydroxyethyl cellulose, very low viscosity | 9004-62-0 | 500g |
| GC9711-1kg | Hydroxyethyl cellulose, very low viscosity | 9004-62-0 | 1kg |
| GC7474-100g | Hydroxyethyl starch 200/0.5 | 9005-27-0 | 100g |
| GP8298-25mg | Hydroxyflutamide | 52806-53-8 | 25mg |
| GE6505-100g | Hydroxylamine hydrochloride | 5470-11-1 | 100g |
| GE6505-250g | Hydroxylamine hydrochloride | 5470-11-1 | 250g |
| GE6505-500g | Hydroxylamine hydrochloride | 5470-11-1 | 500g |
| GE6505-1kg | Hydroxylamine hydrochloride | 5470-11-1 | 1kg |
| GE6505-5kg | Hydroxylamine hydrochloride | 5470-11-1 | 5kg |
| GE5136-1kg | Hydroxylamine sulfate | 10039-54-0 | 1kg |
| GK6032-100mg | Hydroxymethyl EDOT | 146796-02-3 | 100mg |
| GK6032-500mg | Hydroxymethyl EDOT | 146796-02-3 | 500mg |
| GT3182-10g | Hydroxynaphthol blue | 63451-35-4 | 10g |
| GT3182-25g | Hydroxynaphthol blue | 63451-35-4 | 25g |
| GT3182-50g | Hydroxynaphthol blue | 63451-35-4 | 50g |
| GT3182-100g | Hydroxynaphthol blue | 63451-35-4 | 100g |
| GC4566-25g | Hydroxypropyl cellulose, low-substituted | 9004-64-2 | 25g |
| GC4566-100g | Hydroxypropyl cellulose, low-substituted | 9004-64-2 | 100g |
| GC4566-250g | Hydroxypropyl cellulose, low-substituted | 9004-64-2 | 250g |
| GC4566-500g | Hydroxypropyl cellulose, low-substituted | 9004-64-2 | 500g |
| GC4566-1kg | Hydroxypropyl cellulose, low-substituted | 9004-64-2 | 1kg |
| GW9028-10mg | Hydroxystilbamidine bis(methanesulfonate) | 223769-64-0 | 10mg |
| GP0795-5g | Hydroxyurea | 127-07-1 | 5g |
| GP0795-25g | Hydroxyurea | 127-07-1 | 25g |
| GP0795-100g | Hydroxyurea | 127-07-1 | 100g |
| GK7844-10g | Hydroxyzine dihydrochloride | 2192-20-3 | 10g |
| GA7834-100mg | Hygromycin B | 31282-04-9 | 100mg |
| GA7834-500mg | Hygromycin B | 31282-04-9 | 500mg |
| GA7834-1g | Hygromycin B | 31282-04-9 | 1g |
| GA7834-5g | Hygromycin B | 31282-04-9 | 5g |
| GA0644-500ug | Hymeglusin | 29066-42-0 | 500ug |
| GA0644-1mg | Hymeglusin | 29066-42-0 | 1mg |
| GA0644-2500ug | Hymeglusin | 29066-42-0 | 2500ug |
| GW0536-1mg | Hymenidin | 107019-95-4 | 1mg |
| GE3688-10g | Hyodeoxycholic acid | 83-49-8 | 10g |
| GL2427-500ug | Hyperforin (dicyclohexylammonium) salt | 238074-03-8 | 500ug |
| GL2427-1mg | Hyperforin (dicyclohexylammonium) salt | 238074-03-8 | 1mg |
| GE3282-1mg | Hypericin | 548-04-9 | 1mg |
| GE3282-5mg | Hypericin | 548-04-9 | 5mg |
| GE3282-10mg | Hypericin | 548-04-9 | 10mg |
| GA6404-250ug | Hypothemycin | 76958-67-3 | 250ug |
| GA6404-1mg | Hypothemycin | 76958-67-3 | 1mg |
| GE9204-5g | Hypoxanthine | 68-94-0 | 5g |
| GE9204-25g | Hypoxanthine | 68-94-0 | 25g |
| GE9204-100g | Hypoxanthine | 68-94-0 | 100g |
| GW4589-1mg | I-BET762 | 1260907-17-2 | 1mg |
| GW4589-5mg | I-BET762 | 1260907-17-2 | 5mg |
| GW4589-10mg | I-BET762 | 1260907-17-2 | 10mg |
| GP8563-1g | Ibandronate sodium salt monohydrate | 138926-19-9 | 1g |
| GP8742-5mg | Ibrutinib | 936563-96-1 | 5mg |
| GP8742-25mg | Ibrutinib | 936563-96-1 | 25mg |
| GP7898-10mg | Ibudilast | 50847-11-5 | 10mg |
| GP7898-50mg | Ibudilast | 50847-11-5 | 50mg |
| GP1763-1g | Ibuprofen | 15687-27-1 | 1g |
| GP1763-5g | Ibuprofen | 15687-27-1 | 5g |
| GP1763-25g | Ibuprofen | 15687-27-1 | 25g |
| GP1763-100g | Ibuprofen | 15687-27-1 | 100g |
| GC2836-1mg | Ibuprofen acyl-b-D-glucuronide | 115075-59-7 | 1mg |
| GC2836-2mg | Ibuprofen acyl-b-D-glucuronide | 115075-59-7 | 2mg |
| GC2836-5mg | Ibuprofen acyl-b-D-glucuronide | 115075-59-7 | 5mg |
| GC2836-10mg | Ibuprofen acyl-b-D-glucuronide | 115075-59-7 | 10mg |
| GW8964-1mg | IC87114 | 371242-69-2 | 1mg |
| GW8964-5mg | IC87114 | 371242-69-2 | 5mg |
| GW8964-10mg | IC87114 | 371242-69-2 | 10mg |
| GC6166-250mg | Icariin | 489-32-7 | 250mg |
| GC6166-1g | Icariin | 489-32-7 | 1g |
| GK0375-1mg | ID-8 | 147591-46-6 | 1mg |
| GK0375-5mg | ID-8 | 147591-46-6 | 5mg |
| GK0375-25mg | ID-8 | 147591-46-6 | 25mg |
| GW0448-5mg | IDA | 163556-04-5 | 5mg |
| GW0448-25mg | IDA | 163556-04-5 | 25mg |
| GW0448-250mg | IDA | 163556-04-5 | 250mg |
| GP4628-1g | Idebenone | 58186-27-9 | 1g |
| GP4628-5g | Idebenone | 58186-27-9 | 5g |
| GC9783-1mg | Iguratimod-d5 | 1mg | |
| GC9783-2mg | Iguratimod-d5 | 2mg | |
| GC9783-5mg | Iguratimod-d5 | 5mg | |
| GL3175-1mg | IHR-1 | 548779-60-8 | 1mg |
| GL3175-5mg | IHR-1 | 548779-60-8 | 5mg |
| GL6686-1mg | IHR-NAc | 1mg | |
| GL6686-5mg | IHR-NAc | 5mg | |
| GL6740-100ug | Ilimaquinone | 71678-03-0 | 100ug |
| GK4753-1mg | Ilomastat | 142880-36-2 | 1mg |
| GK4753-5mg | Ilomastat | 142880-36-2 | 5mg |
| GP4375-25mg | Imatinib mesylate | 220127-57-1 | 25mg |
| GP4375-100mg | Imatinib mesylate | 220127-57-1 | 100mg |
| GA4370-1g | Imazalil | 35554-44-0 | 1g |
| GA4370-10g | Imazalil | 35554-44-0 | 10g |
| GE4955-100mg | Imidacloprid | 138261-41-3 | 100mg |
| GE4955-1g | Imidacloprid | 138261-41-3 | 1g |
| GP3008-25mg | Imidapril hydrochloride | 89396-94-1 | 25mg |
| GP3008-100mg | Imidapril hydrochloride | 89396-94-1 | 100mg |
| GB9580-25g | Imidazole | 288-32-4 | 25g |
| GB9580-100g | Imidazole | 288-32-4 | 100g |
| GB9580-250g | Imidazole | 288-32-4 | 250g |
| GB9580-500g | Imidazole | 288-32-4 | 500g |
| GB9580-1kg | Imidazole | 288-32-4 | 1kg |
| GB9580-2500g | Imidazole | 288-32-4 | 2500g |
| GB9580-5kg | Imidazole | 288-32-4 | 5kg |
| GK1136-100g | Imidazole hydrochloride | 1467-16-9 | 100g |
| GK1136-250g | Imidazole hydrochloride | 1467-16-9 | 250g |
| GK1136-500g | Imidazole hydrochloride | 1467-16-9 | 500g |
| GB4854-100g | Imidazole, 99.5% | 288-32-4 | 100g |
| GB4854-500g | Imidazole, 99.5% | 288-32-4 | 500g |
| GB4854-1kg | Imidazole, 99.5% | 288-32-4 | 1kg |
| GB4854-5kg | Imidazole, 99.5% | 288-32-4 | 5kg |
| GX1741-25g | Imidazolidinyl urea | 39236-46-9 | 25g |
| GX1741-100g | Imidazolidinyl urea | 39236-46-9 | 100g |
| GM8284-100g | Iminodiacetic acid | 142-73-4 | 100g |
| GM8284-500g | Iminodiacetic acid | 142-73-4 | 500g |
| GM8284-1kg | Iminodiacetic acid | 142-73-4 | 1kg |
| GM8284-5kg | Iminodiacetic acid | 142-73-4 | 5kg |
| GK8864-25g | Iminostilbene | 256-96-2 | 25g |
| GK8864-100g | Iminostilbene | 256-96-2 | 100g |
| GA1119-100mg | Imipenem | 74431-23-5 | 100mg |
| GA1119-250mg | Imipenem | 74431-23-5 | 250mg |
| GA1119-500mg | Imipenem | 74431-23-5 | 500mg |
| GA1119-1g | Imipenem | 74431-23-5 | 1g |
| GP8148-100mg | Imipenem and Cilastatin sodium salt (1:1 mixture, with added sodium bicarbonate) | 74431-23-5 / 81129-83-1 | 100mg |
| GP9049-100mg | Imiquimod | 99011-02-6 | 100mg |
| GP9049-250mg | Imiquimod | 99011-02-6 | 250mg |
| GW3483-100ml | Immersion oil | - | 100ml |
| GL5875-1mg | Imperatorin | 482-44-0 | 1mg |
| GL5875-5mg | Imperatorin | 482-44-0 | 5mg |
| GL5875-25mg | Imperatorin | 482-44-0 | 25mg |
| GY7220-1mg | Incensole | 22419-74-5 | 1mg |
| GY7797-1mg | Incensole acetate | 34701-53-6 | 1mg |
| GP2749-1g | Indapamide | 26807-65-8 | 1g |
| GP2749-5g | Indapamide | 26807-65-8 | 5g |
| GP2749-10g | Indapamide | 26807-65-8 | 10g |
| GT6891-25g | Indigo (C.I. 73000) | 482-89-3 | 25g |
| GT6891-100g | Indigo (C.I. 73000) | 482-89-3 | 100g |
| GT4851-25g | Indigo Carmine (C.I. 73015) | 860-22-0 | 25g |
| GT4851-100g | Indigo Carmine (C.I. 73015) | 860-22-0 | 100g |
| GT4851-250g | Indigo Carmine (C.I. 73015) | 860-22-0 | 250g |
| GT4851-500g | Indigo Carmine (C.I. 73015) | 860-22-0 | 500g |
| GP6821-10mg | Indinavir sulphate hydrate | 157810-81-6 | 10mg |
| GP6821-50mg | Indinavir sulphate hydrate | 157810-81-6 | 50mg |
| GP6821-100mg | Indinavir sulphate hydrate | 157810-81-6 | 100mg |
| GX8407-2g | Indium antimonide, 99.999% | 1312-41-0 | 2g |
| GX8407-10g | Indium antimonide, 99.999% | 1312-41-0 | 10g |
| GX3071-5g | Indium arsenide, 99.999% | 1303-11-3 | 5g |
| GX4048-250g | Indium Bar, 99.999% | 7440-74-6 | 250g |
| GX1607-100g | Indium Bar, 99.9999% | 7440-74-6 | 100g |
| GX0765-25x25mm | Indium Foil 0.05 mm, 99.995% | 7440-74-6 | 25x25mm |
| GX0765-50x50mm | Indium Foil 0.05 mm, 99.995% | 7440-74-6 | 50x50mm |
| GX0765-100x100mm | Indium Foil 0.05 mm, 99.995% | 7440-74-6 | 100x100mm |
| GX8197-25x25mm | Indium Foil 0.1 mm, 99.995% | 7440-74-6 | 25x25mm |
| GX8197-50x50mm | Indium Foil 0.1 mm, 99.995% | 7440-74-6 | 50x50mm |
| GX8197-100x100mm | Indium Foil 0.1 mm, 99.995% | 7440-74-6 | 100x100mm |
| GX9681-100x100mm | Indium Foil 0.1 mm, 99.999% | 7440-74-6 | 100x100mm |
| GX9681-100x200mm | Indium Foil 0.1 mm, 99.999% | 7440-74-6 | 100x200mm |
| GX0445-50x50mm | Indium Foil 0.125 mm, 99.99% | 7440-74-6 | 50x50mm |
| GX0445-50x100mm | Indium Foil 0.125 mm, 99.99% | 7440-74-6 | 50x100mm |
| GX0445-100x100mm | Indium Foil 0.125 mm, 99.99% | 7440-74-6 | 100x100mm |
| GX0445-100x200mm | Indium Foil 0.125 mm, 99.99% | 7440-74-6 | 100x200mm |
| GX0323-25x25mm | Indium Foil 0.20 mm, 99.999% | 7440-74-6 | 25x25mm |
| GX0323-50x50mm | Indium Foil 0.20 mm, 99.999% | 7440-74-6 | 50x50mm |
| GX4026-50x50mm | Indium Foil 0.25 mm, 99.99% | 7440-74-6 | 50x50mm |
| GX4026-50x100mm | Indium Foil 0.25 mm, 99.99% | 7440-74-6 | 50x100mm |
| GX4026-100x100mm | Indium Foil 0.25 mm, 99.99% | 7440-74-6 | 100x100mm |
| GX4026-100x200mm | Indium Foil 0.25 mm, 99.99% | 7440-74-6 | 100x200mm |
| GX0416-100x100mm | Indium Foil 0.25 mm, 99.999% | 7440-74-6 | 100x100mm |
| GX0416-100x200mm | Indium Foil 0.25 mm, 99.999% | 7440-74-6 | 100x200mm |
| GX0587-50x50mm | Indium Foil 0.5 mm, 99.99% | 7440-74-6 | 50x50mm |
| GX0587-50x100mm | Indium Foil 0.5 mm, 99.99% | 7440-74-6 | 50x100mm |
| GX0587-100x100mm | Indium Foil 0.5 mm, 99.99% | 7440-74-6 | 100x100mm |
| GX0587-100x200mm | Indium Foil 0.5 mm, 99.99% | 7440-74-6 | 100x200mm |
| GX9490-50x50mm | Indium Foil 1.0 mm, 99.99% | 7440-74-6 | 50x50mm |
| GX9490-50x100mm | Indium Foil 1.0 mm, 99.99% | 7440-74-6 | 50x100mm |
| GX9490-100x100mm | Indium Foil 1.0 mm, 99.99% | 7440-74-6 | 100x100mm |
| GX9490-100x200mm | Indium Foil 1.0 mm, 99.99% | 7440-74-6 | 100x200mm |
| GX3517-25g | Indium hydroxide, 99.99% | 20661-21-6 | 25g |
| GX3517-100g | Indium hydroxide, 99.99% | 20661-21-6 | 100g |
| GX9666-10g | Indium oxide-Nano Powder, 99.99% | 1312-43-2 | 10g |
| GX9666-25g | Indium oxide-Nano Powder, 99.99% | 1312-43-2 | 25g |
| GX8681-25g | Indium oxide, 99.9% | 1312-43-2 | 25g |
| GX8681-100g | Indium oxide, 99.9% | 1312-43-2 | 100g |
| GX7726-25g | Indium oxide, 99.99% | 1312-43-2 | 25g |
| GX7726-100g | Indium oxide, 99.99% | 1312-43-2 | 100g |
| GX8152-10g | Indium oxide, 99.999% | 1312-43-2 | 10g |
| GX8152-25g | Indium oxide, 99.999% | 1312-43-2 | 25g |
| GX0999-25g | Indium Pieces, 99.999% | 7440-74-6 | 25g |
| GX0999-100g | Indium Pieces, 99.999% | 7440-74-6 | 100g |
| GX7682-10g | Indium Powder + 2% MgO, max. 200 micron, 99.99% | 7440-74-6 | 10g |
| GX7682-50g | Indium Powder + 2% MgO, max. 200 micron, 99.99% | 7440-74-6 | 50g |
| GX1238-10g | Indium Powder +2% MgO, max. 200 micron, 99.999% | 7440-74-6 | 10g |
| GX1238-50g | Indium Powder +2% MgO, max. 200 micron, 99.999% | 7440-74-6 | 50g |
| GX3108-25mm | Indium Rod 10 mm diameter, 99.999% | 7440-74-6 | 25mm |
| GX3108-100mm | Indium Rod 10 mm diameter, 99.999% | 7440-74-6 | 100mm |
| GX7598-25mm | Indium Rod 10 mm diameter, 99.9999% | 7440-74-6 | 25mm |
| GX7598-100mm | Indium Rod 10 mm diameter, 99.9999% | 7440-74-6 | 100mm |
| GX3208-25g | Indium Shot 1-3 mm, 99.99% | 7440-74-6 | 25g |
| GX3208-100g | Indium Shot 1-3 mm, 99.99% | 7440-74-6 | 100g |
| GX0950-25g | Indium Shot 1-3 mm, 99.999% | 7440-74-6 | 25g |
| GX0950-100g | Indium Shot 1-3 mm, 99.999% | 7440-74-6 | 100g |
| GX1279-25g | Indium Shot 1-3 mm, 99.9999% | 7440-74-6 | 25g |
| GX1279-100g | Indium Shot 1-3 mm, 99.9999% | 7440-74-6 | 100g |
| GX1779-5g | Indium telluride, 99.999% | 1312-45-4 | 5g |
| GX1779-25g | Indium telluride, 99.999% | 1312-45-4 | 25g |
| GX7572-10g | Indium tin oxide-Nano Powder, 99.99% | 50926-11-9 | 10g |
| GX8938-10g | Indium tin oxide, 99.99% | 50926-11-9 | 10g |
| GX8938-50g | Indium tin oxide, 99.99% | 50926-11-9 | 50g |
| GX9776-1m | Indium Wire 0.25 mm diameter, 99.99% | 7440-74-6 | 1m |
| GX5545-50cm | Indium Wire 0.5 mm diameter, 99.99% | 7440-74-6 | 50cm |
| GX5545-2m | Indium Wire 0.5 mm diameter, 99.99% | 7440-74-6 | 2m |
| GX5545-10m | Indium Wire 0.5 mm diameter, 99.99% | 7440-74-6 | 10m |
| GX7095-50cm | Indium Wire 0.5 mm diameter, 99.999% | 7440-74-6 | 50cm |
| GX7095-2m | Indium Wire 0.5 mm diameter, 99.999% | 7440-74-6 | 2m |
| GX7095-10m | Indium Wire 0.5 mm diameter, 99.999% | 7440-74-6 | 10m |
| GX4005-50cm | Indium Wire 1.0 mm diameter, 99.99% | 7440-74-6 | 50cm |
| GX4005-1m | Indium Wire 1.0 mm diameter, 99.99% | 7440-74-6 | 1m |
| GX4005-5m | Indium Wire 1.0 mm diameter, 99.99% | 7440-74-6 | 5m |
| GX7210-50cm | Indium Wire 1.0 mm diameter, 99.999% | 7440-74-6 | 50cm |
| GX7210-1m | Indium Wire 1.0 mm diameter, 99.999% | 7440-74-6 | 1m |
| GX7210-5m | Indium Wire 1.0 mm diameter, 99.999% | 7440-74-6 | 5m |
| GX5038-50cm | Indium Wire 1.5 mm diameter, 99.99% | 7440-74-6 | 50cm |
| GX5038-1m | Indium Wire 1.5 mm diameter, 99.99% | 7440-74-6 | 1m |
| GX5038-5m | Indium Wire 1.5 mm diameter, 99.99% | 7440-74-6 | 5m |
| GX1285-50cm | Indium Wire 1.5 mm diameter, 99.999% | 7440-74-6 | 50cm |
| GX8640-1m | Indium Wire 1.6 mm diameter, 99.995% | 7440-74-6 | 1m |
| GX8640-5m | Indium Wire 1.6 mm diameter, 99.995% | 7440-74-6 | 5m |
| GX8626-10cm | Indium Wire 2.0 mm diameter, 99.99% | 7440-74-6 | 10cm |
| GX8626-50cm | Indium Wire 2.0 mm diameter, 99.99% | 7440-74-6 | 50cm |
| GX8626-1m | Indium Wire 2.0 mm diameter, 99.99% | 7440-74-6 | 1m |
| GX0648-10cm | Indium Wire 2.0 mm diameter, 99.999% | 7440-74-6 | 10cm |
| GX0648-50cm | Indium Wire 2.0 mm diameter, 99.999% | 7440-74-6 | 50cm |
| GX0648-1m | Indium Wire 2.0 mm diameter, 99.999% | 7440-74-6 | 1m |
| GX9072-10cm | Indium Wire 3.0 mm diameter, 99.99% | 7440-74-6 | 10cm |
| GX9072-50cm | Indium Wire 3.0 mm diameter, 99.99% | 7440-74-6 | 50cm |
| GX5124-10cm | Indium Wire 3.0 mm diameter, 99.999% | 7440-74-6 | 10cm |
| GX5124-50cm | Indium Wire 3.0 mm diameter, 99.999% | 7440-74-6 | 50cm |
| GX4571-1g | Indium-thd, 99.9% | 34269-03-9 | 1g |
| GX4571-10g | Indium-thd, 99.9% | 34269-03-9 | 10g |
| GX6379-100g | Indium,Bismuth 66.3,33.7 Rod 6 mm | 7440-74-6 | 100g |
| GX9378-5g | Indium(III) bromide, anhydrous, 99.99+% | 13465-09-3 | 5g |
| GX9378-25g | Indium(III) bromide, anhydrous, 99.99+% | 13465-09-3 | 25g |
| GX9970-5g | Indium(III) chloride, anhydrous | 10025-82-8 | 5g |
| GX9970-25g | Indium(III) chloride, anhydrous | 10025-82-8 | 25g |
| GX9970-100g | Indium(III) chloride, anhydrous | 10025-82-8 | 100g |
| GX7018-25g | Indium(III) iodide, 99.99% | 13510-35-5 | 25g |
| GX7637-25g | Indium(III) nitrate, 99.99% | 13770-61-1 | 25g |
| GX7637-100g | Indium(III) nitrate, 99.99% | 13770-61-1 | 100g |
| GX6252-10g | Indium(III) sulfate, 98%, anhydrous | 13464-82-9 | 10g |
| GX6252-25g | Indium(III) sulfate, 98%, anhydrous | 13464-82-9 | 25g |
| GX6252-50g | Indium(III) sulfate, 98%, anhydrous | 13464-82-9 | 50g |
| GX6252-100g | Indium(III) sulfate, 98%, anhydrous | 13464-82-9 | 100g |
| GX6224-100g | Indium(III) sulfate, 99.99%, anhydrous | 13464-82-9 | 100g |
| GK5410-1mg | Indo 1-AM | 112926-02-0 | 1mg |
| GW0741-2mg | Indo-1 pentapotassium salt | 132319-56-3 | 2mg |
| GW0741-25mg | Indo-1 pentapotassium salt | 132319-56-3 | 25mg |
| GK0968-25g | Indole | 120-72-9 | 25g |
| GK0968-100g | Indole | 120-72-9 | 100g |
| GK0968-500g | Indole | 120-72-9 | 500g |
| GV0584-1g | Indole-3-acetic acid sodium salt | 6505-45-9 | 1g |
| GV0584-5g | Indole-3-acetic acid sodium salt | 6505-45-9 | 5g |
| GK6266-5g | Indole-3-acetonitrile | 771-51-7 | 5g |
| GK7772-5g | Indole-3-butyric acid | 133-32-4 | 5g |
| GK7772-25g | Indole-3-butyric acid | 133-32-4 | 25g |
| GK7772-100g | Indole-3-butyric acid | 133-32-4 | 100g |
| GE0004-5g | Indole-3-butyric acid potassium salt | 60096-23-3 | 5g |
| GE0004-25g | Indole-3-butyric acid potassium salt | 60096-23-3 | 25g |
| GE0004-100g | Indole-3-butyric acid potassium salt | 60096-23-3 | 100g |
| GK5424-1g | Indole-3-carbinol | 700-06-1 | 1g |
| GK5424-5g | Indole-3-carbinol | 700-06-1 | 5g |
| GK5424-25g | Indole-3-carbinol | 700-06-1 | 25g |
| GK9020-5g | Indole-3-carboxaldehyde | 487-89-8 | 5g |
| GK9020-10g | Indole-3-carboxaldehyde | 487-89-8 | 10g |
| GK9020-25g | Indole-3-carboxaldehyde | 487-89-8 | 25g |
| GK9020-100g | Indole-3-carboxaldehyde | 487-89-8 | 100g |
| GK6319-5g | Indole-3-propionic acid | 830-96-6 | 5g |
| GK6319-25g | Indole-3-propionic acid | 830-96-6 | 25g |
| GA3090-5g | Indomethacin | 53-86-1 | 5g |
| GA3090-10g | Indomethacin | 53-86-1 | 10g |
| GA3090-25g | Indomethacin | 53-86-1 | 25g |
| GA3090-100g | Indomethacin | 53-86-1 | 100g |
| GC0423-1mg | Indomethacin acyl-b-D-glucuronide | 75523-11-4 | 1mg |
| GC0423-2mg | Indomethacin acyl-b-D-glucuronide | 75523-11-4 | 2mg |
| GC0423-5mg | Indomethacin acyl-b-D-glucuronide | 75523-11-4 | 5mg |
| GC0423-10mg | Indomethacin acyl-b-D-glucuronide | 75523-11-4 | 10mg |
| GW1194-5mg | INDY | 1169755-45-6 | 5mg |
| GW1194-25mg | INDY | 1169755-45-6 | 25mg |
| GL8088-1mg | Ingenol-3-angelate | 75567-37-2 | 1mg |
| GL8088-5mg | Ingenol-3-angelate | 75567-37-2 | 5mg |
| GL4474-1mg | Ingenol-5,20-acetonide | 77573-43-4 | 1mg |
| GL4474-5mg | Ingenol-5,20-acetonide | 77573-43-4 | 5mg |
| GE4681-5g | Inosine | 58-63-9 | 5g |
| GE4681-25g | Inosine | 58-63-9 | 25g |
| GE4681-100g | Inosine | 58-63-9 | 100g |
| GE4681-250g | Inosine | 58-63-9 | 250g |
| GE4681-500g | Inosine | 58-63-9 | 500g |
| GE4681-1kg | Inosine | 58-63-9 | 1kg |
| GL1863-5g | Inosine 5''-monophosphate disodium salt hydrate | 352195-40-5 | 5g |
| GL1863-25g | Inosine 5''-monophosphate disodium salt hydrate | 352195-40-5 | 25g |
| GL1863-100g | Inosine 5''-monophosphate disodium salt hydrate | 352195-40-5 | 100g |
| GE1021-1g | Insulin Human, recombinant | 11061-68-0 | 1g |
| GC4090-100g | Inulin | 9005-80-5 | 100g |
| GC4090-250g | Inulin | 9005-80-5 | 250g |
| GC4090-500g | Inulin | 9005-80-5 | 500g |
| GC4090-1kg | Inulin | 9005-80-5 | 1kg |
| GX5278-100g | Iodic acid, 99.5+% | 7782-68-5 | 100g |
| GX5466-100g | Iodine pentoxide, 99% | 12029-98-0 | 100g |
| GX9934-25g | Iodine Powder, crystalline, resublimed, ACS, 99.8+% | 7553-56-2 | 25g |
| GX9934-100g | Iodine Powder, crystalline, resublimed, ACS, 99.8+% | 7553-56-2 | 100g |
| GX1393-100g | Iodine trichloride | 865-44-1 | 100g |
| GX5831-25g | Iodine, 99% | 7553-56-2 | 25g |
| GX5831-100g | Iodine, 99% | 7553-56-2 | 100g |
| GX5831-250g | Iodine, 99% | 7553-56-2 | 250g |
| GX5831-500g | Iodine, 99% | 7553-56-2 | 500g |
| GK5945-25g | Iodine, Ph. Eur. | 7553-56-2 | 25g |
| GK5945-100g | Iodine, Ph. Eur. | 7553-56-2 | 100g |
| GK5945-250g | Iodine, Ph. Eur. | 7553-56-2 | 250g |
| GK5945-500g | Iodine, Ph. Eur. | 7553-56-2 | 500g |
| GK5945-1kg | Iodine, Ph. Eur. | 7553-56-2 | 1kg |
| GP8799-25mg | Iodixanol | 92339-11-2 | 25mg |
| GP8799-100mg | Iodixanol | 92339-11-2 | 100mg |
| GK6681-5g | Iodoacetamide | 144-48-9 | 5g |
| GK6681-25g | Iodoacetamide | 144-48-9 | 25g |
| GK7946-25g | Iodoacetic acid sodium salt | 305-53-3 | 25g |
| GP9090-5g | Iohexol | 66108-95-0 | 5g |
| GP9090-25g | Iohexol | 66108-95-0 | 25g |
| GP9090-50g | Iohexol | 66108-95-0 | 50g |
| GP9090-100g | Iohexol | 66108-95-0 | 100g |
| GA7872-1mg | Ionomycin | 56092-81-0 | 1mg |
| GA7872-5mg | Ionomycin | 56092-81-0 | 5mg |
| GA7872-10mg | Ionomycin | 56092-81-0 | 10mg |
| GA1562-1mg | Ionomycin calcium salt | 56092-82-1 | 1mg |
| GA1562-5mg | Ionomycin calcium salt | 56092-82-1 | 5mg |
| GA1562-10mg | Ionomycin calcium salt | 56092-82-1 | 10mg |
| GP4065-1g | Iopamidol | 60166-93-0 | 1g |
| GC3873-25g | iota-Carrageenan, Type II | 9062-07-1 | 25g |
| GC3873-100g | iota-Carrageenan, Type II | 9062-07-1 | 100g |
| GC3873-250g | iota-Carrageenan, Type II | 9062-07-1 | 250g |
| GW3149-1mg | IPI-145 | 1201438-56-3 | 1mg |
| GW3149-5mg | IPI-145 | 1201438-56-3 | 5mg |
| GW3149-10mg | IPI-145 | 1201438-56-3 | 10mg |
| GL5159-250mg | Ipratropium bromide monohydrate | 66985-17-9 | 250mg |
| GL5159-1g | Ipratropium bromide monohydrate | 66985-17-9 | 1g |
| GC6586-5g | IPTG | 367-93-1 | 5g |
| GC6586-10g | IPTG | 367-93-1 | 10g |
| GC6586-25g | IPTG | 367-93-1 | 25g |
| GC6586-100g | IPTG | 367-93-1 | 100g |
| GC2102-25g | IPTG, 99.5%, dioxane free | 367-93-1 | 25g |
| GC2102-100g | IPTG, 99.5%, dioxane free | 367-93-1 | 100g |
| GW5488-250mg | IR-783 | 115970-66-6 | 250mg |
| GP0710-50mg | Irbesartan | 138402-11-6 | 50mg |
| GP0710-250mg | Irbesartan | 138402-11-6 | 250mg |
| GX2934-25x25mm | Iridium Foil 0.125mm, 99.9% | 7439-88-5 | 25x25mm |
| GX3365-10cm | Iridium Wire 0.13 mm diameter, 99+% | 7439-88-5 | 10cm |
| GX3365-20cm | Iridium Wire 0.13 mm diameter, 99+% | 7439-88-5 | 20cm |
| GX6867-1cm | Iridium Wire 1mm diameter, 99.9% | 7439-88-5 | 1cm |
| GX6867-5cm | Iridium Wire 1mm diameter, 99.9% | 7439-88-5 | 5cm |
| GX6867-10cm | Iridium Wire 1mm diameter, 99.9% | 7439-88-5 | 10cm |
| GX4455-1g | Iridium(III) 2,4-pentanedionate, 99.95% (metals basis) | 15635-87-7 | 1g |
| GX4455-5g | Iridium(III) 2,4-pentanedionate, 99.95% (metals basis) | 15635-87-7 | 5g |
| GX0286-100mg | Iridium(III) chloride trihydrate | 13569-57-8 | 100mg |
| GX4338-1g | Iridium(III) chloride, insoluble | 10025-83-9 | 1g |
| GX4338-5g | Iridium(III) chloride, insoluble | 10025-83-9 | 5g |
| GP2560-100mg | Irinotecan hydrochloride trihydrate | 136572-09-3 | 100mg |
| GP2560-250mg | Irinotecan hydrochloride trihydrate | 136572-09-3 | 250mg |
| GL3227-500ug | Iromycin A | 213137-53-2 | 500ug |
| GL3227-1mg | Iromycin A | 213137-53-2 | 1mg |
| GL3227-5mg | Iromycin A | 213137-53-2 | 5mg |
| GX1690-25g | Iron boride, 99% | 12006-84-7 | 25g |
| GX0263-10g | Iron disilicide, 99+% | 12022-99-0 | 10g |
| GX0263-50g | Iron disilicide, 99+% | 12022-99-0 | 50g |
| GX0830-100g | Iron Flakes, electrolytic, 99.9% | 7439-89-6 | 100g |
| GX0830-500g | Iron Flakes, electrolytic, 99.9% | 7439-89-6 | 500g |
| GX4046-100x100mm | Iron Foil 0.025 mm, hard (coated with oil); 99.5% | 7439-89-6 | 100x100mm |
| GX5450-100x100mm | Iron Foil 0.05 mm, hard, 99.5% | 7439-89-6 | 100x100mm |
| GX9346-100x100mm | Iron Foil 0.125 mm, hard (coated with oil); 99.5% | 7439-89-6 | 100x100mm |
| GX4418-100x100mm | Iron Foil 0.25mm, 99.5% | 7439-89-6 | 100x100mm |
| GX4418-150x150mm | Iron Foil 0.25mm, 99.5% | 7439-89-6 | 150x150mm |
| GX7684-100x100mm | Iron Foil 0.5mm, 99.5% | 7439-89-6 | 100x100mm |
| GX6896-25x25mm | Iron Foil 0.5mm, 99.99+% | 7439-89-6 | 25x25mm |
| GX6896-50x50mm | Iron Foil 0.5mm, 99.99+% | 7439-89-6 | 50x50mm |
| GX4057-100x100mm | Iron Foil 1.0mm, 99.5% | 7439-89-6 | 100x100mm |
| GX8892-25x25mm | Iron Foil 1.0mm, 99.995% | 7439-89-6 | 25x25mm |
| GX8892-50x50mm | Iron Foil 1.0mm, 99.995% | 7439-89-6 | 50x50mm |
| GX2751-100x100mm | Iron Foil 1.5mm, 99.5% | 7439-89-6 | 100x100mm |
| GX0385-10g | Iron Nanopowder, 99.7% [50nm] | 7439-89-6 | 10g |
| GX0385-25g | Iron Nanopowder, 99.7% [50nm] | 7439-89-6 | 25g |
| GX0385-100g | Iron Nanopowder, 99.7% [50nm] | 7439-89-6 | 100g |
| GX0077-100g | Iron Pellets 6 x 6 mm, 99.9% | 7439-89-6 | 100g |
| GX2614-100g | Iron Pieces 0.5-1.5 mm, 99.97% | 7439-89-6 | 100g |
| GX2614-250g | Iron Pieces 0.5-1.5 mm, 99.97% | 7439-89-6 | 250g |
| GX5945-500g | Iron Pieces max. 25 mm, 99.9% | 7439-89-6 | 500g |
| GX8550-100g | Iron Pieces max. 25 mm, 99.99% | 7439-89-6 | 100g |
| GX2565-50g | Iron Powder -100, +325 mesh, 99.9% | 7439-89-6 | 50g |
| GX6948-100g | Iron Powder ex carbonyl, 10 micron, 99.5% | 7439-89-6 | 100g |
| GX1889-10g | Iron Powder, 99.99+% | 7439-89-6 | 10g |
| GX4767-100mm | Iron Rod 12.7 mm diameter, 99.9% | 7439-89-6 | 100mm |
| GX4767-300mm | Iron Rod 12.7 mm diameter, 99.9% | 7439-89-6 | 300mm |
| GX2304-250mm | Iron Rod 19 mm diameter, 99.98% | 7439-89-6 | 250mm |
| GX8876-25cm | Iron Rod 2.0 mm diameter, 99.99+% | 7439-89-6 | 25cm |
| GX6462-25mm | Iron Rod 5.0 mm diameter, 99.99% | 7439-89-6 | 25mm |
| GX6462-50mm | Iron Rod 5.0 mm diameter, 99.99% | 7439-89-6 | 50mm |
| GX6462-100mm | Iron Rod 5.0 mm diameter, 99.99% | 7439-89-6 | 100mm |
| GX8646-100mm | Iron Rod 9.5 mm diameter, 99.9% | 7439-89-6 | 100mm |
| GX8646-300mm | Iron Rod 9.5 mm diameter, 99.9% | 7439-89-6 | 300mm |
| GX0670-50x50mm | Iron Sheet 2mm, 99.8% | 7439-89-6 | 50x50mm |
| GX0670-100x100mm | Iron Sheet 2mm, 99.8% | 7439-89-6 | 100x100mm |
| GC0709-25g | Iron sucrose | 8047-67-4 | 25g |
| GC0709-50g | Iron sucrose | 8047-67-4 | 50g |
| GC0709-100g | Iron sucrose | 8047-67-4 | 100g |
| GX9047-25m | Iron Wire 0.25 mm diameter, 99.5% | 7439-89-6 | 25m |
| GX9047-100m | Iron Wire 0.25 mm diameter, 99.5% | 7439-89-6 | 100m |
| GX8463-1m | Iron Wire 0.25 mm diameter, 99.99+% | 7439-89-6 | 1m |
| GX9432-5m | Iron Wire 0.5 mm diameter, 99.5% | 7439-89-6 | 5m |
| GX9432-25m | Iron Wire 0.5 mm diameter, 99.5% | 7439-89-6 | 25m |
| GX7070-1m | Iron Wire 0.5 mm diameter, 99.99+% | 7439-89-6 | 1m |
| GX4113-10m | Iron Wire 1.0 mm diameter, 99.5% | 7439-89-6 | 10m |
| GX4113-25m | Iron Wire 1.0 mm diameter, 99.5% | 7439-89-6 | 25m |
| GX7401-25cm | Iron Wire 1.0 mm diameter, 99.99+% | 7439-89-6 | 25cm |
| GX7401-50cm | Iron Wire 1.0 mm diameter, 99.99+% | 7439-89-6 | 50cm |
| GX6228-25cm | Iron Wire 2.0 mm diameter, 99.99+% | 7439-89-6 | 25cm |
| GX4317-500mm | Iron,Cobalt 90,10 wt% Wire 0.5 mm diameter | 7439-89-6 | 500mm |
| GX6983-500mm | Iron,Nickel 90,10 wt% Wire 0.5 mm diameter | 7439-89-6 | 500mm |
| GX0576-250g | Iron(II, III) oxide, 97% | 1317-61-9 | 250g |
| GX0576-1kg | Iron(II, III) oxide, 97% | 1317-61-9 | 1kg |
| GX9050-100g | Iron(II, III) oxide, 99.5% | 1317-61-9 | 100g |
| GX9050-500g | Iron(II, III) oxide, 99.5% | 1317-61-9 | 500g |
| GX6555-25g | Iron(II,III) oxide nanopowder (Magnetite); 98% [20 - 30 nm] | 1317-61-9 | 25g |
| GX6555-100g | Iron(II,III) oxide nanopowder (Magnetite); 98% [20 - 30 nm] | 1317-61-9 | 100g |
| GX6555-250g | Iron(II,III) oxide nanopowder (Magnetite); 98% [20 - 30 nm] | 1317-61-9 | 250g |
| GX6555-1kg | Iron(II,III) oxide nanopowder (Magnetite); 98% [20 - 30 nm] | 1317-61-9 | 1kg |
| GX8025-25g | Iron(II) bromide anhydrous, 99.5% | 7789-46-0 | 25g |
| GX2777-100g | Iron(II) chloride tetrahydrate | 13478-10-9 | 100g |
| GX2777-250g | Iron(II) chloride tetrahydrate | 13478-10-9 | 250g |
| GX2777-500g | Iron(II) chloride tetrahydrate | 13478-10-9 | 500g |
| GX2777-1kg | Iron(II) chloride tetrahydrate | 13478-10-9 | 1kg |
| GX0652-25g | Iron(II) fluoride | 7789-28-8 | 25g |
| GX1573-500g | Iron(II) fumarate | 141-01-5 | 500g |
| GX4628-100g | Iron(II) gluconate dihydrate, USP grade | 22830-45-1 | 100g |
| GX4628-500g | Iron(II) gluconate dihydrate, USP grade | 22830-45-1 | 500g |
| GX4628-1kg | Iron(II) gluconate dihydrate, USP grade | 22830-45-1 | 1kg |
| GX0698-10g | Iron(II) oxalate, dihydrate, 99.99+% | 18989-10-1 | 10g |
| GK7413-250g | Iron(II) sulfate heptahydate, 99.5% | 7782-63-0 | 250g |
| GK7413-500g | Iron(II) sulfate heptahydate, 99.5% | 7782-63-0 | 500g |
| GK7413-1kg | Iron(II) sulfate heptahydate, 99.5% | 7782-63-0 | 1kg |
| GK7413-5kg | Iron(II) sulfate heptahydate, 99.5% | 7782-63-0 | 5kg |
| GK8990-1kg | Iron(II) sulfate heptahydate, technical | 7782-63-0 | 1kg |
| GK8990-5kg | Iron(II) sulfate heptahydate, technical | 7782-63-0 | 5kg |
| GK8990-10kg | Iron(II) sulfate heptahydate, technical | 7782-63-0 | 10kg |
| GX1941-100g | Iron(II) sulfate, dried | 7720-78-7 | 100g |
| GX1941-250g | Iron(II) sulfate, dried | 7720-78-7 | 250g |
| GX1941-500g | Iron(II) sulfate, dried | 7720-78-7 | 500g |
| GX2147-10g | Iron(II) sulfide, 99.9% | 1317-37-9 | 10g |
| GX2147-25g | Iron(II) sulfide, 99.9% | 1317-37-9 | 25g |
| GX2147-100g | Iron(II) sulfide, 99.9% | 1317-37-9 | 100g |
| GK1880-100g | Iron(III) acetylacetonate | 14024-18-1 | 100g |
| GK1880-250g | Iron(III) acetylacetonate | 14024-18-1 | 250g |
| GK1880-500g | Iron(III) acetylacetonate | 14024-18-1 | 500g |
| GK2873-100g | Iron(III) chloride hexahydrate | 10025-77-1 | 100g |
| GK2873-500g | Iron(III) chloride hexahydrate | 10025-77-1 | 500g |
| GK2873-1kg | Iron(III) chloride hexahydrate | 10025-77-1 | 1kg |
| GK2873-5kg | Iron(III) chloride hexahydrate | 10025-77-1 | 5kg |
| GK2873-10kg | Iron(III) chloride hexahydrate | 10025-77-1 | 10kg |
| GK5389-100g | Iron(III) chloride hexahydrate, 97% | 10025-77-1 | 100g |
| GK5389-500g | Iron(III) chloride hexahydrate, 97% | 10025-77-1 | 500g |
| GK5389-1kg | Iron(III) chloride hexahydrate, 97% | 10025-77-1 | 1kg |
| GK5389-5kg | Iron(III) chloride hexahydrate, 97% | 10025-77-1 | 5kg |
| GK5389-10kg | Iron(III) chloride hexahydrate, 97% | 10025-77-1 | 10kg |
| GK1773-100g | Iron(III) chloride, anhydrous | 7705-08-0 | 100g |
| GK1773-500g | Iron(III) chloride, anhydrous | 7705-08-0 | 500g |
| GK4573-100g | Iron(III) citrate hydrate | 2338-05-8 | 100g |
| GK4573-250g | Iron(III) citrate hydrate | 2338-05-8 | 250g |
| GK4573-500g | Iron(III) citrate hydrate | 2338-05-8 | 500g |
| GK4573-1kg | Iron(III) citrate hydrate | 2338-05-8 | 1kg |
| GX6381-10g | Iron(III) ethoxide, 99.9% | 5058-42-4 | 10g |
| GX2125-25g | Iron(III) fluoride, 99.5% | 7783-50-8 | 25g |
| GX2125-100g | Iron(III) fluoride, 99.5% | 7783-50-8 | 100g |
| GX4191-100g | Iron(III) nitrate nonahydrate, 98% | 7782-61-8 | 100g |
| GX4191-500g | Iron(III) nitrate nonahydrate, 98% | 7782-61-8 | 500g |
| GX4191-1kg | Iron(III) nitrate nonahydrate, 98% | 7782-61-8 | 1kg |
| GK6075-250g | Iron(III) oxide, 98% | 1309-37-1 | 250g |
| GK6075-1kg | Iron(III) oxide, 98% | 1309-37-1 | 1kg |
| GX6044-100g | Iron(III) oxide, 99.9% | 1309-37-1 | 100g |
| GX9035-100g | Iron(III) oxide, 99.9% | 1309-37-1 | 100g |
| GX9035-250g | Iron(III) oxide, 99.9% | 1309-37-1 | 250g |
| GX6461-25g | Iron(III) oxide, 99.99% | 1309-37-1 | 25g |
| GX6461-100g | Iron(III) oxide, 99.99% | 1309-37-1 | 100g |
| GK9337-100g | Iron(III) pyrophosphate hydrate | 10058-44-3 | 100g |
| GK2787-100g | Iron(III) sulfate, hydrate | 15244-10-7 | 100g |
| GK2787-250g | Iron(III) sulfate, hydrate | 15244-10-7 | 250g |
| GK2787-500g | Iron(III) sulfate, hydrate | 15244-10-7 | 500g |
| GK2787-1kg | Iron(III) sulfate, hydrate | 15244-10-7 | 1kg |
| GK2787-5kg | Iron(III) sulfate, hydrate | 15244-10-7 | 5kg |
| GK7897-25g | Isatin | 91-56-5 | 25g |
| GK7897-100g | Isatin | 91-56-5 | 100g |
| GK7897-250g | Isatin | 91-56-5 | 250g |
| GX6547-1mg | Isatropolone A | 1mg | |
| GX6547-5mg | Isatropolone A | 5mg | |
| GA5158-1g | Isepamicin sulfate | 67814-76-0 | 1g |
| GK0622-100g | Isethionic acid sodium salt | 1562-00-1 | 100g |
| GK0622-250g | Isethionic acid sodium salt | 1562-00-1 | 250g |
| GK0622-500g | Isethionic acid sodium salt | 1562-00-1 | 500g |
| GK0622-1kg | Isethionic acid sodium salt | 1562-00-1 | 1kg |
| GK0622-5kg | Isethionic acid sodium salt | 1562-00-1 | 5kg |
| GS8728-100ml | iso-Hexane 95%, GlenDry™, anhydrous | 107-83-5 | 100ml |
| GS8728-500ml | iso-Hexane 95%, GlenDry™, anhydrous | 107-83-5 | 500ml |
| GS8728-1l | iso-Hexane 95%, GlenDry™, anhydrous | 107-83-5 | 1l |
| GS8728-2500ml | iso-Hexane 95%, GlenDry™, anhydrous | 107-83-5 | 2500ml |
| GS3569-500ml | iso-Hexane 95%, GlenPure™, analytical grade | 107-83-5 | 500ml |
| GS3569-1l | iso-Hexane 95%, GlenPure™, analytical grade | 107-83-5 | 1l |
| GS3569-2500ml | iso-Hexane 95%, GlenPure™, analytical grade | 107-83-5 | 2500ml |
| GP7416-100mg | Isoalantolactone | 470-17-7 | 100mg |
| GK2830-100ml | Isoamyl acetate | 123-92-2 | 100ml |
| GK2830-500ml | Isoamyl acetate | 123-92-2 | 500ml |
| GC1362-1mg | Isobutyl β-D-glucuronide | 5391-15-1 | 1mg |
| GC1362-2mg | Isobutyl β-D-glucuronide | 5391-15-1 | 2mg |
| GC1362-5mg | Isobutyl β-D-glucuronide | 5391-15-1 | 5mg |
| GC1362-10mg | Isobutyl β-D-glucuronide | 5391-15-1 | 10mg |
| GL6777-100ml | Isobutyric acid | 79-31-2 | 100ml |
| GW7275-10g | Isocarbostyril | 491-30-5 | 10g |
| GW7275-25g | Isocarbostyril | 491-30-5 | 25g |
| GA9375-1g | Isoconazole nitrate | 24168-96-5 | 1g |
| GK8663-5g | Isocytosine | 108-53-2 | 5g |
| GX9398-250mg | Isoeugenyl acetate | 93-29-8 | 250mg |
| GX9398-500mg | Isoeugenyl acetate | 93-29-8 | 500mg |
| GP3912-1g | Isoflurane | 26675-46-7 | 1g |
| GP3912-5g | Isoflurane | 26675-46-7 | 5g |
| GL9030-1mg | Isofusidienol A | 1032392-18-9 | 1mg |
| GL9030-5mg | Isofusidienol A | 1032392-18-9 | 5mg |
| GY6221-25mg | Isoliensinine | 6817-41-0 | 25mg |
| GY1387-10mg | Isoliquiritin | 5041-81-6 | 10mg |
| GP4188-10mg | Isoliquirtigenin | 961-29-5 | 10mg |
| GP4188-50mg | Isoliquirtigenin | 961-29-5 | 50mg |
| GC6174-1g | Isomaltitol | 534-73-6 | 1g |
| GA2329-5g | Isoniazid | 54-85-3 | 5g |
| GA2329-50g | Isoniazid | 54-85-3 | 50g |
| GA2329-100g | Isoniazid | 54-85-3 | 100g |
| GA2329-250g | Isoniazid | 54-85-3 | 250g |
| GA2329-500g | Isoniazid | 54-85-3 | 500g |
| GK6108-25g | Isonicotinic acid | 55-22-1 | 25g |
| GK6108-100g | Isonicotinic acid | 55-22-1 | 100g |
| GK6108-250g | Isonicotinic acid | 55-22-1 | 250g |
| GK6108-500g | Isonicotinic acid | 55-22-1 | 500g |
| GK6108-1kg | Isonicotinic acid | 55-22-1 | 1kg |
| GL5871-1mg | Isoorientin | 4261-42-1 | 1mg |
| GL5871-5mg | Isoorientin | 4261-42-1 | 5mg |
| GL5871-10mg | Isoorientin | 4261-42-1 | 10mg |
| GC8307-1mg | Isopentyl β-D-glucuronide | 80712-92-1 | 1mg |
| GC8307-5mg | Isopentyl β-D-glucuronide | 80712-92-1 | 5mg |
| GC8307-10mg | Isopentyl β-D-glucuronide | 80712-92-1 | 10mg |
| GC8307-25mg | Isopentyl β-D-glucuronide | 80712-92-1 | 25mg |
| GC6339-1mg | Isopentyl-d11 β-D-glucuronide | 1mg | |
| GC6339-2mg | Isopentyl-d11 β-D-glucuronide | 2mg | |
| GC6339-5mg | Isopentyl-d11 β-D-glucuronide | 5mg | |
| GC6339-10mg | Isopentyl-d11 β-D-glucuronide | 10mg | |
| GK8681-25g | Isophorone diisocyanate | 4098-71-9 | 25g |
| GP0338-1g | Isoprenaline hydrochloride | 51-30-9 | 1g |
| GP0338-5g | Isoprenaline hydrochloride | 51-30-9 | 5g |
| GK9172-500ml | Isopropanol | 67-63-0 | 500ml |
| GK9172-1l | Isopropanol | 67-63-0 | 1l |
| GK9172-2500ml | Isopropanol | 67-63-0 | 2500ml |
| GK9172-5l | Isopropanol | 67-63-0 | 5l |
| GE9802-1l | Isopropanol, 70% in water | 67-63-0 | 1l |
| GE9802-2500ml | Isopropanol, 70% in water | 67-63-0 | 2500ml |
| GK9023-1l | Isopropanol, Ph. Eur. grade | 67-63-0 | 1l |
| GK9023-5l | Isopropanol, Ph. Eur. grade | 67-63-0 | 5l |
| GC2750-50mg | Isopropyl 2-acetamido-2-deoxy-α-D-glucopyranoside | 19124-40-4 | 50mg |
| GC2750-100mg | Isopropyl 2-acetamido-2-deoxy-α-D-glucopyranoside | 19124-40-4 | 100mg |
| GC2750-250mg | Isopropyl 2-acetamido-2-deoxy-α-D-glucopyranoside | 19124-40-4 | 250mg |
| GC2750-500mg | Isopropyl 2-acetamido-2-deoxy-α-D-glucopyranoside | 19124-40-4 | 500mg |
| GC2750-1g | Isopropyl 2-acetamido-2-deoxy-α-D-glucopyranoside | 19124-40-4 | 1g |
| GC9038-50mg | Isopropyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-α-D-glucopyranoside | 40592-88-9 | 50mg |
| GC9038-100mg | Isopropyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-α-D-glucopyranoside | 40592-88-9 | 100mg |
| GC9038-250mg | Isopropyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-α-D-glucopyranoside | 40592-88-9 | 250mg |
| GC9038-500mg | Isopropyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-α-D-glucopyranoside | 40592-88-9 | 500mg |
| GC9038-1g | Isopropyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-α-D-glucopyranoside | 40592-88-9 | 1g |
| GC5706-25mg | Isopropyl 2-acetamido-3,4,6-tri-O-ethyl-2-deoxy-α-D-glucopyranoside | 25mg | |
| GC5706-50mg | Isopropyl 2-acetamido-3,4,6-tri-O-ethyl-2-deoxy-α-D-glucopyranoside | 50mg | |
| GC5706-100mg | Isopropyl 2-acetamido-3,4,6-tri-O-ethyl-2-deoxy-α-D-glucopyranoside | 100mg | |
| GC5706-250mg | Isopropyl 2-acetamido-3,4,6-tri-O-ethyl-2-deoxy-α-D-glucopyranoside | 250mg | |
| GC2530-1g | Isopropyl 2,3,4,6-tetra-O-acetyl-1-thio-β-D-glucopyranoside | 55692-84-7 | 1g |
| GC2530-2g | Isopropyl 2,3,4,6-tetra-O-acetyl-1-thio-β-D-glucopyranoside | 55692-84-7 | 2g |
| GC2530-5g | Isopropyl 2,3,4,6-tetra-O-acetyl-1-thio-β-D-glucopyranoside | 55692-84-7 | 5g |
| GC2530-10g | Isopropyl 2,3,4,6-tetra-O-acetyl-1-thio-β-D-glucopyranoside | 55692-84-7 | 10g |
| GX9567-100ml | Isopropyl acetate | 108-21-4 | 100ml |
| GK0184-100ml | Isopropyl myristate | 110-27-0 | 100ml |
| GK0184-250ml | Isopropyl myristate | 110-27-0 | 250ml |
| GC4395-250mg | Isopropyl β-D-thioglucopyranoside | 19165-11-8 | 250mg |
| GC4395-500mg | Isopropyl β-D-thioglucopyranoside | 19165-11-8 | 500mg |
| GC4395-1g | Isopropyl β-D-thioglucopyranoside | 19165-11-8 | 1g |
| GC4395-2g | Isopropyl β-D-thioglucopyranoside | 19165-11-8 | 2g |
| GC4395-5g | Isopropyl β-D-thioglucopyranoside | 19165-11-8 | 5g |
| GX6711-1g | Isoproterenol sulfate dihydrate | 299-95-6 | 1g |
| GW1341-500mg | Isoprothiolane | 50512-35-1 | 500mg |
| GW1341-2500mg | Isoprothiolane | 50512-35-1 | 2500mg |
| GP5169-5mg | Isorhamnetin | 480-19-3 | 5mg |
| GP5169-25mg | Isorhamnetin | 480-19-3 | 25mg |
| GC8734-1mg | Isosorbide 5-mononitrate 2-b-D-glucuronide | 32871-20-8 | 1mg |
| GC8734-2mg | Isosorbide 5-mononitrate 2-b-D-glucuronide | 32871-20-8 | 2mg |
| GC8734-5mg | Isosorbide 5-mononitrate 2-b-D-glucuronide | 32871-20-8 | 5mg |
| GC8734-10mg | Isosorbide 5-mononitrate 2-b-D-glucuronide | 32871-20-8 | 10mg |
| GC9368-50mg | Isosorbide-2-mononitrate | 16106-20-0 | 50mg |
| GC9368-100mg | Isosorbide-2-mononitrate | 16106-20-0 | 100mg |
| GC9368-250mg | Isosorbide-2-mononitrate | 16106-20-0 | 250mg |
| GC9368-500mg | Isosorbide-2-mononitrate | 16106-20-0 | 500mg |
| GC3382-2mg | Isosorbide-2-mononitrate 5-O-β-D-glucuronide | 89576-61-4 | 2mg |
| GC3382-5mg | Isosorbide-2-mononitrate 5-O-β-D-glucuronide | 89576-61-4 | 5mg |
| GC3382-10mg | Isosorbide-2-mononitrate 5-O-β-D-glucuronide | 89576-61-4 | 10mg |
| GC3382-25mg | Isosorbide-2-mononitrate 5-O-β-D-glucuronide | 89576-61-4 | 25mg |
| GC2243-1mg | Isosorbide-5-mononitrate-1,2,3,4,5,6-13C6 | 1mg | |
| GC2243-2mg | Isosorbide-5-mononitrate-1,2,3,4,5,6-13C6 | 2mg | |
| GC2243-5mg | Isosorbide-5-mononitrate-1,2,3,4,5,6-13C6 | 5mg | |
| GP6510-100mg | Isotretinoin | 4759-48-2 | 100mg |
| GP6510-250mg | Isotretinoin | 4759-48-2 | 250mg |
| GP6510-500mg | Isotretinoin | 4759-48-2 | 500mg |
| GP6510-1g | Isotretinoin | 4759-48-2 | 1g |
| GL2536-100ml | Isovaleric acid | 503-74-2 | 100ml |
| GK6240-25g | Isovanillin | 621-59-0 | 25g |
| GK6240-100g | Isovanillin | 621-59-0 | 100g |
| GK6240-250g | Isovanillin | 621-59-0 | 250g |
| GL4384-10mg | Isovitexin | 38953-85-4 | 10mg |
| GW3469-100mg | Isoxathion | 18854-01-8 | 100mg |
| GW3469-500mg | Isoxathion | 18854-01-8 | 500mg |
| GK9099-25g | Itaconic acid | 97-65-4 | 25g |
| GK9099-100g | Itaconic acid | 97-65-4 | 100g |
| GW6546-10mg | Itaconic acid 4-octyl ester [4-Octyl itaconate] | 3133-16-2 | 10mg |
| GW6546-50mg | Itaconic acid 4-octyl ester [4-Octyl itaconate] | 3133-16-2 | 50mg |
| GK7326-25g | Itaconic anhydride | 2170-03-8 | 25g |
| GK7326-100g | Itaconic anhydride | 2170-03-8 | 100g |
| GK7326-250g | Itaconic anhydride | 2170-03-8 | 250g |
| GA0307-1g | Itraconazole | 84625-61-6 | 1g |
| GA0307-5g | Itraconazole | 84625-61-6 | 5g |
| GL4861-10mg | IU1 | 314245-33-5 | 10mg |
| GL4861-50mg | IU1 | 314245-33-5 | 50mg |
| GK8601-50mg | Ivabradine hydrochloride | 148849-67-6 | 50mg |
| GX4265-250mg | Ivacaftor | 873054-44-5 | 250mg |
| GC9403-1mg | Ivacaftor O-β-D-glucuronide | 1mg | |
| GC9403-2mg | Ivacaftor O-β-D-glucuronide | 2mg | |
| GC9403-5mg | Ivacaftor O-β-D-glucuronide | 5mg | |
| GA9725-250mg | Ivermectin | 70288-86-7 | 250mg |
| GA9725-1g | Ivermectin | 70288-86-7 | 1g |
| GW9762-5mg | IWR-1-endo | 1127442-82-3 | 5mg |
| GW9762-25mg | IWR-1-endo | 1127442-82-3 | 25mg |
| GW1595-1mg | Ixazomib [MLN2238] | 1072833-77-2 | 1mg |
| GW1595-5mg | Ixazomib [MLN2238] | 1072833-77-2 | 5mg |
| GW1595-25mg | Ixazomib [MLN2238] | 1072833-77-2 | 25mg |
| GW4808-1mg | Ixazomib citrate [MLN9708] | 1239908-20-3 | 1mg |
| GW4808-5mg | Ixazomib citrate [MLN9708] | 1239908-20-3 | 5mg |
| GW4808-25mg | Ixazomib citrate [MLN9708] | 1239908-20-3 | 25mg |
| GW5327-1mg | Jak/Src Inhibitor 1 hydrochloride | 1332329-27-7 | 1mg |
| GT0491-5g | Janus Green B (C.I. 11050) | 2869-83-2 | 5g |
| GT0491-10g | Janus Green B (C.I. 11050) | 2869-83-2 | 10g |
| GT0491-25g | Janus Green B (C.I. 11050) | 2869-83-2 | 25g |
| GL4314-50ug | Jasplakinolide | 102396-24-7 | 50ug |
| GL4314-100ug | Jasplakinolide | 102396-24-7 | 100ug |
| GT4210-1mg | JC-1 | 3520-43-2 | 1mg |
| GT4210-5mg | JC-1 | 3520-43-2 | 5mg |
| GT5545-25g | Jenner's Stain | 62851-42-7 | 25g |
| GT5545-100g | Jenner's Stain | 62851-42-7 | 100g |
| GT1148-25g | Jenner's Stain, certified | 62851-42-7 | 25g |
| GL5097-10mg | Jervine | 469-59-0 | 10mg |
| GW9904-1mg | JNJ-38158471 | 951151-97-6 | 1mg |
| GW9904-5mg | JNJ-38158471 | 951151-97-6 | 5mg |
| GW9904-10mg | JNJ-38158471 | 951151-97-6 | 10mg |
| GW6703-1mg | JNJ-38877605 | 943540-75-8 | 1mg |
| GW6703-5mg | JNJ-38877605 | 943540-75-8 | 5mg |
| GW6703-10mg | JNJ-38877605 | 943540-75-8 | 10mg |
| GW4079-1mg | JNJ-7706621 | 443797-96-4 | 1mg |
| GW4079-5mg | JNJ-7706621 | 443797-96-4 | 5mg |
| GW4079-10mg | JNJ-7706621 | 443797-96-4 | 10mg |
| GL1962-100ml | Jojoba oil | 61789-91-1 | 100ml |
| GL1962-500ml | Jojoba oil | 61789-91-1 | 500ml |
| GA0246-50mg | Josamycin | 16846-24-5 | 50mg |
| GA0246-200mg | Josamycin | 16846-24-5 | 200mg |
| GA0246-2500mg | Josamycin | 16846-24-5 | 2500mg |
| GL3770-100ug | K-252a | 99533-80-9 | 100ug |
| GL3770-1mg | K-252a | 99533-80-9 | 1mg |
| GL4832-1mg | K-252c | 85753-43-1 | 1mg |
| GL4832-5mg | K-252c | 85753-43-1 | 5mg |
| GW4409-1mg | K777 [K11777] | 233277-99-1 | 1mg |
| GW4409-5mg | K777 [K11777] | 233277-99-1 | 5mg |
| GL2059-1mg | Kaempferitrin | 482-38-2 | 1mg |
| GL2059-5mg | Kaempferitrin | 482-38-2 | 5mg |
| GP7425-25mg | Kaempferol | 520-18-3 | 25mg |
| GP7425-100mg | Kaempferol | 520-18-3 | 100mg |
| GP7425-250mg | Kaempferol | 520-18-3 | 250mg |
| GL9890-10mg | Kaempferol 3-glucoside | 480-10-4 | 10mg |
| GY4480-1mg | Kaempferol 3-glucuronide | 22688-78-4 | 1mg |
| GY4480-2mg | Kaempferol 3-glucuronide | 22688-78-4 | 2mg |
| GY4480-5mg | Kaempferol 3-glucuronide | 22688-78-4 | 5mg |
| GY4480-10mg | Kaempferol 3-glucuronide | 22688-78-4 | 10mg |
| GE2501-100ml | Kaiser's glycerol gelatine, phenol free | 100ml | |
| GP2512-250mg | Kanamycin B | 4696-76-8 | 250mg |
| GP2512-500mg | Kanamycin B | 4696-76-8 | 500mg |
| GP2512-1g | Kanamycin B | 4696-76-8 | 1g |
| GP2512-5g | Kanamycin B | 4696-76-8 | 5g |
| GA8523-1g | Kanamycin disulfate salt | 64013-70-3 | 1g |
| GA8523-5g | Kanamycin disulfate salt | 64013-70-3 | 5g |
| GA8523-25g | Kanamycin disulfate salt | 64013-70-3 | 25g |
| GA0531-5g | Kanamycin monosulfate salt | 25389-94-0 | 5g |
| GA0531-25g | Kanamycin monosulfate salt | 25389-94-0 | 25g |
| GA0531-100g | Kanamycin monosulfate salt | 25389-94-0 | 100g |
| GA9089-5g | Kanamycin monosulfate salt, EP | 5965-95-7 | 5g |
| GA9089-25g | Kanamycin monosulfate salt, EP | 5965-95-7 | 25g |
| GA9089-50g | Kanamycin monosulfate salt, EP | 5965-95-7 | 50g |
| GA9089-100g | Kanamycin monosulfate salt, EP | 5965-95-7 | 100g |
| GE4162-500g | Kaolin | 1332-58-7 | 500g |
| GE4162-1kg | Kaolin | 1332-58-7 | 1kg |
| GE4162-2500g | Kaolin | 1332-58-7 | 2500g |
| GE4162-5kg | Kaolin | 1332-58-7 | 5kg |
| GC6839-25g | kappa-Carrageenan | 11114-20-8 | 25g |
| GC6839-100g | kappa-Carrageenan | 11114-20-8 | 100g |
| GC6839-250g | kappa-Carrageenan | 11114-20-8 | 250g |
| GC6839-500g | kappa-Carrageenan | 11114-20-8 | 500g |
| GC6839-1kg | kappa-Carrageenan | 11114-20-8 | 1kg |
| GL2030-1mg | Kaurenoic acid | 6730-83-2 | 1mg |
| GW1807-1mg | KBU2046 | 1143863-69-7 | 1mg |
| GW1807-5mg | KBU2046 | 1143863-69-7 | 5mg |
| GW1807-25mg | KBU2046 | 1143863-69-7 | 25mg |
| GA5047-100ug | Kendomycin | 183202-73-5 | 100ug |
| GA5047-500ug | Kendomycin | 183202-73-5 | 500ug |
| GA5047-2500ug | Kendomycin | 183202-73-5 | 2500ug |
| GL9943-10mg | Ketanserin (+)-tartrate salt | 83846-83-7 | 10mg |
| GL9943-50mg | Ketanserin (+)-tartrate salt | 83846-83-7 | 50mg |
| GA6740-100mg | Ketoconazole | 65277-42-1 | 100mg |
| GA6740-1g | Ketoconazole | 65277-42-1 | 1g |
| GA6740-5g | Ketoconazole | 65277-42-1 | 5g |
| GA6740-10g | Ketoconazole | 65277-42-1 | 10g |
| GA6740-25g | Ketoconazole | 65277-42-1 | 25g |
| GP1294-1g | Ketoprofen | 22071-15-4 | 1g |
| GP1294-5g | Ketoprofen | 22071-15-4 | 5g |
| GP1294-10g | Ketoprofen | 22071-15-4 | 10g |
| GP1294-25g | Ketoprofen | 22071-15-4 | 25g |
| GC1924-1mg | Ketoprofen acyl-b-D-glucuronide | 76690-94-3 | 1mg |
| GC1924-2mg | Ketoprofen acyl-b-D-glucuronide | 76690-94-3 | 2mg |
| GC1924-5mg | Ketoprofen acyl-b-D-glucuronide | 76690-94-3 | 5mg |
| GC1924-10mg | Ketoprofen acyl-b-D-glucuronide | 76690-94-3 | 10mg |
| GP8482-100mg | Ketorolac tris salt | 74103-07-4 | 100mg |
| GT8694-1g | Khellin | 82-02-0 | 1g |
| GT8694-5g | Khellin | 82-02-0 | 5g |
| GW9361-1mg | Ki20227 | 623142-96-1 | 1mg |
| GW9361-5mg | Ki20227 | 623142-96-1 | 5mg |
| GW9361-10mg | Ki20227 | 623142-96-1 | 10mg |
| GC4430-5mg | Kifunensine | 109944-15-2 | 5mg |
| GC4430-10mg | Kifunensine | 109944-15-2 | 10mg |
| GC4430-25mg | Kifunensine | 109944-15-2 | 25mg |
| GC4430-50mg | Kifunensine | 109944-15-2 | 50mg |
| GE0287-10g | Kinetin | 525-79-1 | 10g |
| GE0287-25g | Kinetin | 525-79-1 | 25g |
| GE0287-100g | Kinetin | 525-79-1 | 100g |
| GK9774-5mg | Kirenol | 52659-56-0 | 5mg |
| GA9046-1mg | Kirromycin | 50935-71-2 | 1mg |
| GP7816-250mg | Kitasamycin | 1392-21-8 | 250mg |
| GX2819-5mg | KN-92 | 1135280-28-2 | 5mg |
| GK3376-1mg | KN-93 | 139298-40-1 | 1mg |
| GK3376-5mg | KN-93 | 139298-40-1 | 5mg |
| GK3376-25mg | KN-93 | 139298-40-1 | 25mg |
| GP4738-25g | Kojic acid | 501-30-4 | 25g |
| GP4738-100g | Kojic acid | 501-30-4 | 100g |
| GX0578-500g | Kolliphor EL | 61791-12-6 | 500g |
| GK2557-5g | Konjac glucomannan | 37220-17-0 | 5g |
| GK2557-10g | Konjac glucomannan | 37220-17-0 | 10g |
| GX4388-100ml | Kovacs reagent | - | 100ml |
| GW7110-1mg | KU-0063794 | 938440-64-3 | 1mg |
| GW7110-5mg | KU-0063794 | 938440-64-3 | 5mg |
| GW7110-10mg | KU-0063794 | 938440-64-3 | 10mg |
| GX0742-1l | Kupferbad 500 sauer / Copper bath 500 acidic | 1l | |
| GX3626-1l | Kupferbad 540 cyanidisch / Copper bath 540 cyanidic | 1l | |
| GW3410-1mg | KW-2449 hydrochloride | 841259-17-4 | 1mg |
| GW3410-5mg | KW-2449 hydrochloride | 841259-17-4 | 5mg |
| GW3410-10mg | KW-2449 hydrochloride | 841259-17-4 | 10mg |
| GK3380-5g | L-(-)-Bornyl acetate | 5655-61-8 | 5g |
| GK6558-5g | L-(-)-Camphor | 464-48-2 | 5g |
| GL7635-500mg | L-(-)-Camphoric acid | 560-09-8 | 500mg |
| GL7635-1g | L-(-)-Camphoric acid | 560-09-8 | 1g |
| GL7635-2500mg | L-(-)-Camphoric acid | 560-09-8 | 2500mg |
| GC7288-5g | L-(-)-Fucose | 2438-80-4 | 5g |
| GC7288-10g | L-(-)-Fucose | 2438-80-4 | 10g |
| GC7288-25g | L-(-)-Fucose | 2438-80-4 | 25g |
| GC7288-50g | L-(-)-Fucose | 2438-80-4 | 50g |
| GC7288-100g | L-(-)-Fucose | 2438-80-4 | 100g |
| GC5727-25mg | L-(-)-Galactose | 15572-79-9 | 25mg |
| GC5727-100mg | L-(-)-Galactose | 15572-79-9 | 100mg |
| GC5727-250mg | L-(-)-Galactose | 15572-79-9 | 250mg |
| GC5727-500mg | L-(-)-Galactose | 15572-79-9 | 500mg |
| GK8399-25g | L-(-)-Malic acid | 97-67-6 | 25g |
| GK8399-100g | L-(-)-Malic acid | 97-67-6 | 100g |
| GK8399-500g | L-(-)-Malic acid | 97-67-6 | 500g |
| GC8426-500mg | L-(-)-Mannose | 10030-80-5 | 500mg |
| GC8426-1g | L-(-)-Mannose | 10030-80-5 | 1g |
| GC8426-5g | L-(-)-Mannose | 10030-80-5 | 5g |
| GC0157-5g | L-(+)-Arabinose | 5328-37-0 | 5g |
| GC0157-25g | L-(+)-Arabinose | 5328-37-0 | 25g |
| GC0157-100g | L-(+)-Arabinose | 5328-37-0 | 100g |
| GC0157-250g | L-(+)-Arabinose | 5328-37-0 | 250g |
| GC0157-500g | L-(+)-Arabinose | 5328-37-0 | 500g |
| GV5017-25g | L-(+)-Ascorbic acid | 50-81-7 | 25g |
| GV5017-100g | L-(+)-Ascorbic acid | 50-81-7 | 100g |
| GV5017-500g | L-(+)-Ascorbic acid | 50-81-7 | 500g |
| GV5017-1kg | L-(+)-Ascorbic acid | 50-81-7 | 1kg |
| GV5017-5kg | L-(+)-Ascorbic acid | 50-81-7 | 5kg |
| GV9871-1kg | L-(+)-Ascorbic acid, 99.5%, BP, Ph. Eur., USP grade | 50-81-7 | 1kg |
| GP6833-5mg | L-(+)-Ergothioneine | 497-30-3 | 5mg |
| GE6812-10g | L-(+)-Lactic acid lithium salt | 27848-80-2 | 10g |
| GE6812-25g | L-(+)-Lactic acid lithium salt | 27848-80-2 | 25g |
| GE6812-50g | L-(+)-Lactic acid lithium salt | 27848-80-2 | 50g |
| GE6812-100g | L-(+)-Lactic acid lithium salt | 27848-80-2 | 100g |
| GA8192-100g | L-(+)-Lactic acid, 80% | 79-33-4 | 100g |
| GA6729-1g | L-(+)-Lactic acid, 98% | 79-33-4 | 1g |
| GA6729-5g | L-(+)-Lactic acid, 98% | 79-33-4 | 5g |
| GK6462-5g | L-(+)-Mandelic acid | 17199-29-0 | 5g |
| GK6462-25g | L-(+)-Mandelic acid | 17199-29-0 | 25g |
| GK6462-100g | L-(+)-Mandelic acid | 17199-29-0 | 100g |
| GK6462-250g | L-(+)-Mandelic acid | 17199-29-0 | 250g |
| GC9031-1g | L-(+)-Ribose | 24259-59-4 | 1g |
| GC9031-5g | L-(+)-Ribose | 24259-59-4 | 5g |
| GC9031-10g | L-(+)-Ribose | 24259-59-4 | 10g |
| GC9031-25g | L-(+)-Ribose | 24259-59-4 | 25g |
| GE2092-500mg | L-(+)-Selenomethionine | 3211-76-5 | 500mg |
| GE2092-1g | L-(+)-Selenomethionine | 3211-76-5 | 1g |
| GE2092-5g | L-(+)-Selenomethionine | 3211-76-5 | 5g |
| GM6036-1g | L-2-Aminobutyric acid | 1492-24-6 | 1g |
| GM6036-5g | L-2-Aminobutyric acid | 1492-24-6 | 5g |
| GM2424-5ml | L-2,3-Diaminopropionic acid hydrochloride | 23491-52-3 | 5ml |
| GM7206-1g | L-2,4-Diaminobutyric acid dihydrochloride | 1883-09-6 | 1g |
| GM7206-5g | L-2,4-Diaminobutyric acid dihydrochloride | 1883-09-6 | 5g |
| GL7643-5mg | L-703,606 oxalate salt hydrate | 351351-06-9 | 5mg |
| GM7668-25g | L-Alanine | 56-41-7 | 25g |
| GM7668-100g | L-Alanine | 56-41-7 | 100g |
| GM7668-500g | L-Alanine | 56-41-7 | 500g |
| GM7668-1kg | L-Alanine | 56-41-7 | 1kg |
| GM3156-1g | L-Alanine 2-naphthylamide | 720-82-1 | 1g |
| GM3770-5g | L-Alanine methyl ester hydrochloride | 2491-20-5 | 5g |
| GM3770-25g | L-Alanine methyl ester hydrochloride | 2491-20-5 | 25g |
| GM9104-1g | L-Alanine tert-butyl ester hydrochloride | 13404-22-3 | 1g |
| GM9104-5g | L-Alanine tert-butyl ester hydrochloride | 13404-22-3 | 5g |
| GM9104-10g | L-Alanine tert-butyl ester hydrochloride | 13404-22-3 | 10g |
| GM9104-25g | L-Alanine tert-butyl ester hydrochloride | 13404-22-3 | 25g |
| GC8079-50mg | L-Alanine-7-amido-4-methylcoumarin trifluoroacetic acid salt | 96594-10-4 | 50mg |
| GC8079-250mg | L-Alanine-7-amido-4-methylcoumarin trifluoroacetic acid salt | 96594-10-4 | 250mg |
| GM0361-1kg | L-Alanine, GlenCell™, suitable for cell culture | 56-41-7 | 1kg |
| GL8388-50mg | L-Alanyl-L-1-aminoethylphosphonic acid | 60668-24-8 | 50mg |
| GL8388-100mg | L-Alanyl-L-1-aminoethylphosphonic acid | 60668-24-8 | 100mg |
| GE7036-5g | L-Alanyl-L-glutamine | 39537-23-0 | 5g |
| GE7036-25g | L-Alanyl-L-glutamine | 39537-23-0 | 25g |
| GE7036-50g | L-Alanyl-L-glutamine | 39537-23-0 | 50g |
| GE7036-100g | L-Alanyl-L-glutamine | 39537-23-0 | 100g |
| GE4398-100g | L-Alanyl-L-glutamine, GlenCell™, suitable for cell culture | 39537-23-0 | 100g |
| GX3149-500U | L-alpha-Glycerophosphate oxidase | 9046-28-0 | 500U |
| GE1414-250mg | L-alpha-Phosphatidyl inositol | 97281-52-2 | 250mg |
| GE1414-500mg | L-alpha-Phosphatidyl inositol | 97281-52-2 | 500mg |
| GC8721-10g | L-Arabitol | 7643-75-6 | 10g |
| GC1947-10g | L-Arabitol, 99% | 7643-75-6 | 10g |
| GM7438-100g | L-Arginine | 74-79-3 | 100g |
| GM7438-250g | L-Arginine | 74-79-3 | 250g |
| GM7438-500g | L-Arginine | 74-79-3 | 500g |
| GM7438-1kg | L-Arginine | 74-79-3 | 1kg |
| GM1602-5g | L-Arginine ethyl ester dihydrochloride | 36589-29-4 | 5g |
| GM1602-25g | L-Arginine ethyl ester dihydrochloride | 36589-29-4 | 25g |
| GM7506-25g | L-Arginine hydrochloride | 1119-34-2 | 25g |
| GM7506-100g | L-Arginine hydrochloride | 1119-34-2 | 100g |
| GM7506-250g | L-Arginine hydrochloride | 1119-34-2 | 250g |
| GM7506-500g | L-Arginine hydrochloride | 1119-34-2 | 500g |
| GM7506-1kg | L-Arginine hydrochloride | 1119-34-2 | 1kg |
| GM1323-250g | L-Arginine hydrochloride, 99%, non-animal origin | 1119-34-2 | 250g |
| GM1323-1kg | L-Arginine hydrochloride, 99%, non-animal origin | 1119-34-2 | 1kg |
| GM1372-1kg | L-Arginine hydrochloride, GlenCell™, suitable for cell culture | 1119-34-2 | 1kg |
| GM0108-1kg | L-Arginine hydrochloride, Ph. Eur., USP grade | 1119-34-2 | 1kg |
| GH1375-100g | L-Arginine L-aspartate | 7675-83-4 | 100g |
| GH1375-250g | L-Arginine L-aspartate | 7675-83-4 | 250g |
| GH1375-500g | L-Arginine L-aspartate | 7675-83-4 | 500g |
| GH1375-1kg | L-Arginine L-aspartate | 7675-83-4 | 1kg |
| GM1092-100g | L-Arginine, GlenCell™, suitable for cell culture | 74-79-3 | 100g |
| GM1092-250g | L-Arginine, GlenCell™, suitable for cell culture | 74-79-3 | 250g |
| GM1092-500g | L-Arginine, GlenCell™, suitable for cell culture | 74-79-3 | 500g |
| GM1092-1kg | L-Arginine, GlenCell™, suitable for cell culture | 74-79-3 | 1kg |
| GY1773-10mg | L-Asarinin | 133-04-0 | 10mg |
| GY1773-25mg | L-Asarinin | 133-04-0 | 25mg |
| GV6147-25g | L-Ascorbic acid 2-phosphate sesquimagnesium salt hydrate | 113170-55-1 | 25g |
| GV6147-100g | L-Ascorbic acid 2-phosphate sesquimagnesium salt hydrate | 113170-55-1 | 100g |
| GV6147-250g | L-Ascorbic acid 2-phosphate sesquimagnesium salt hydrate | 113170-55-1 | 250g |
| GV6147-500g | L-Ascorbic acid 2-phosphate sesquimagnesium salt hydrate | 113170-55-1 | 500g |
| GX2339-500IU | L-Asparaginase | 9015-68-3 | 500IU |
| GM7827-25g | L-Asparagine monohydrate | 5794-13-8 | 25g |
| GM7827-100g | L-Asparagine monohydrate | 5794-13-8 | 100g |
| GM7827-250g | L-Asparagine monohydrate | 5794-13-8 | 250g |
| GM7827-500g | L-Asparagine monohydrate | 5794-13-8 | 500g |
| GM7827-1kg | L-Asparagine monohydrate | 5794-13-8 | 1kg |
| GM4262-1g | L-Asparagine tert-butyl ester hydrochloride | 63094-81-5 | 1g |
| GM4262-5g | L-Asparagine tert-butyl ester hydrochloride | 63094-81-5 | 5g |
| GM9590-25g | L-Asparagine, anhydrous | 70-47-3 | 25g |
| GM9590-100g | L-Asparagine, anhydrous | 70-47-3 | 100g |
| GM9590-250g | L-Asparagine, anhydrous | 70-47-3 | 250g |
| GM9590-500g | L-Asparagine, anhydrous | 70-47-3 | 500g |
| GM5992-100g | L-Aspartic acid hemimagnesium salt dihydrate | 2068-80-6 | 100g |
| GK5821-25g | L-Aspartic acid potassium salt | 1115-63-5 | 25g |
| GK5821-100g | L-Aspartic acid potassium salt | 1115-63-5 | 100g |
| GK5821-250g | L-Aspartic acid potassium salt | 1115-63-5 | 250g |
| GK5821-500g | L-Aspartic acid potassium salt | 1115-63-5 | 500g |
| GK5821-1kg | L-Aspartic acid potassium salt | 1115-63-5 | 1kg |
| GM5569-500g | L-Aspartic acid sodium salt monohydrate | 323194-76-9 | 500g |
| GM5569-1kg | L-Aspartic acid sodium salt monohydrate | 323194-76-9 | 1kg |
| GM1049-100g | L-Aspartic acid, 99% | 56-84-8 | 100g |
| GM1049-500g | L-Aspartic acid, 99% | 56-84-8 | 500g |
| GM1049-1kg | L-Aspartic acid, 99% | 56-84-8 | 1kg |
| GM1049-5kg | L-Aspartic acid, 99% | 56-84-8 | 5kg |
| GM0348-1kg | L-Aspartic acid, GlenCell™, suitable for cell culture | 56-84-8 | 1kg |
| GM3196-100g | L-Aspartic acid, Ph. Eur. grade | 56-84-8 | 100g |
| GM3196-500g | L-Aspartic acid, Ph. Eur. grade | 56-84-8 | 500g |
| GM3196-1kg | L-Aspartic acid, Ph. Eur. grade | 56-84-8 | 1kg |
| GM3196-5kg | L-Aspartic acid, Ph. Eur. grade | 56-84-8 | 5kg |
| GM0457-1g | L-beta-Leucine hydrochloride | 219310-09-5 | 1g |
| GP4736-25mg | L-Bupivacaine | 27262-47-1 | 25mg |
| GP4736-100mg | L-Bupivacaine | 27262-47-1 | 100mg |
| GX6145-100g | L-Carnitine fumarate | 90471-79-7 | 100g |
| GM4580-25g | L-Carnitine hydrochloride | 6645-46-1 | 25g |
| GM4580-100g | L-Carnitine hydrochloride | 6645-46-1 | 100g |
| GM4580-250g | L-Carnitine hydrochloride | 6645-46-1 | 250g |
| GM4580-500g | L-Carnitine hydrochloride | 6645-46-1 | 500g |
| GM4580-1kg | L-Carnitine hydrochloride | 6645-46-1 | 1kg |
| GM4342-5g | L-Carnitine tartrate | 36687-82-8 | 5g |
| GM4342-25g | L-Carnitine tartrate | 36687-82-8 | 25g |
| GM4342-100g | L-Carnitine tartrate | 36687-82-8 | 100g |
| GV3498-25g | L-Carnitine, USP grade | 541-15-1 | 25g |
| GV3498-100g | L-Carnitine, USP grade | 541-15-1 | 100g |
| GV3498-500g | L-Carnitine, USP grade | 541-15-1 | 500g |
| GV3498-1kg | L-Carnitine, USP grade | 541-15-1 | 1kg |
| GE5095-1g | L-Carnosine | 305-84-0 | 1g |
| GE5095-5g | L-Carnosine | 305-84-0 | 5g |
| GE5095-25g | L-Carnosine | 305-84-0 | 25g |
| GE5095-100g | L-Carnosine | 305-84-0 | 100g |
| GM7920-5g | L-Citrulline | 372-75-8 | 5g |
| GM7920-25g | L-Citrulline | 372-75-8 | 25g |
| GM7920-100g | L-Citrulline | 372-75-8 | 100g |
| GM7920-250g | L-Citrulline | 372-75-8 | 250g |
| GM7920-500g | L-Citrulline | 372-75-8 | 500g |
| GM7920-1kg | L-Citrulline | 372-75-8 | 1kg |
| GC0182-25mg | L-Colitose | 4221-05-0 | 25mg |
| GC0182-50mg | L-Colitose | 4221-05-0 | 50mg |
| GC0182-100mg | L-Colitose | 4221-05-0 | 100mg |
| GC0182-250mg | L-Colitose | 4221-05-0 | 250mg |
| GC0182-500mg | L-Colitose | 4221-05-0 | 500mg |
| GM3760-25g | L-Cysteine | 52-90-4 | 25g |
| GM3760-100g | L-Cysteine | 52-90-4 | 100g |
| GM3760-250g | L-Cysteine | 52-90-4 | 250g |
| GM3760-500g | L-Cysteine | 52-90-4 | 500g |
| GM3760-1kg | L-Cysteine | 52-90-4 | 1kg |
| GM3732-25g | L-Cysteine ethyl ester hydrochloride | 868-59-7 | 25g |
| GM3732-100g | L-Cysteine ethyl ester hydrochloride | 868-59-7 | 100g |
| GM4222-100g | L-Cysteine hydrochloride monohydrate | 7048-04-6 | 100g |
| GM4222-250g | L-Cysteine hydrochloride monohydrate | 7048-04-6 | 250g |
| GM4222-500g | L-Cysteine hydrochloride monohydrate | 7048-04-6 | 500g |
| GM4222-1kg | L-Cysteine hydrochloride monohydrate | 7048-04-6 | 1kg |
| GM0119-100g | L-Cysteine hydrochloride monohydrate, 99%, non-animal origin | 7048-04-6 | 100g |
| GM0119-250g | L-Cysteine hydrochloride monohydrate, 99%, non-animal origin | 7048-04-6 | 250g |
| GM0119-1kg | L-Cysteine hydrochloride monohydrate, 99%, non-animal origin | 7048-04-6 | 1kg |
| GM2919-100g | L-Cysteine hydrochloride monohydrate, Ph. Eur., USP grade | 7048-04-6 | 100g |
| GM2919-1kg | L-Cysteine hydrochloride monohydrate, Ph. Eur., USP grade | 7048-04-6 | 1kg |
| GM1539-100g | L-Cysteine hydrochloride, anhydrous | 52-89-1 | 100g |
| GM1539-250g | L-Cysteine hydrochloride, anhydrous | 52-89-1 | 250g |
| GM1539-500g | L-Cysteine hydrochloride, anhydrous | 52-89-1 | 500g |
| GM1539-1kg | L-Cysteine hydrochloride, anhydrous | 52-89-1 | 1kg |
| GM9033-25g | L-Cysteine hydrochloride, anhydrous, 99% | 52-89-1 | 25g |
| GM9033-100g | L-Cysteine hydrochloride, anhydrous, 99% | 52-89-1 | 100g |
| GM9033-250g | L-Cysteine hydrochloride, anhydrous, 99% | 52-89-1 | 250g |
| GM9033-500g | L-Cysteine hydrochloride, anhydrous, 99% | 52-89-1 | 500g |
| GM9033-1kg | L-Cysteine hydrochloride, anhydrous, 99% | 52-89-1 | 1kg |
| GM4396-5g | L-Cysteine methyl ester hydrochloride | 18598-63-5 | 5g |
| GM4396-25g | L-Cysteine methyl ester hydrochloride | 18598-63-5 | 25g |
| GM8797-25g | L-Cysteine, 99%, non-animal origin | 52-90-4 | 25g |
| GM8797-100g | L-Cysteine, 99%, non-animal origin | 52-90-4 | 100g |
| GM8797-250g | L-Cysteine, 99%, non-animal origin | 52-90-4 | 250g |
| GM8797-500g | L-Cysteine, 99%, non-animal origin | 52-90-4 | 500g |
| GM8797-1kg | L-Cysteine, 99%, non-animal origin | 52-90-4 | 1kg |
| GM4173-100g | L-Cystine | 56-89-3 | 100g |
| GM4173-250g | L-Cystine | 56-89-3 | 250g |
| GM4173-500g | L-Cystine | 56-89-3 | 500g |
| GM4173-1kg | L-Cystine | 56-89-3 | 1kg |
| GE0295-25g | L-Cystine dihydrochloride | 30925-07-6 | 25g |
| GE0295-100g | L-Cystine dihydrochloride | 30925-07-6 | 100g |
| GE0295-250g | L-Cystine dihydrochloride | 30925-07-6 | 250g |
| GE0295-500g | L-Cystine dihydrochloride | 30925-07-6 | 500g |
| GE0295-1kg | L-Cystine dihydrochloride | 30925-07-6 | 1kg |
| GM7327-25g | L-Cystine dimethyl ester dihydrochloride | 32854-09-4 | 25g |
| GE3746-100g | L-Cystine disodium salt | 64704-23-0 | 100g |
| GM2911-100g | L-Cystine, non-animal origin | 56-89-3 | 100g |
| GM2911-250g | L-Cystine, non-animal origin | 56-89-3 | 250g |
| GM2911-500g | L-Cystine, non-animal origin | 56-89-3 | 500g |
| GM2911-1kg | L-Cystine, non-animal origin | 56-89-3 | 1kg |
| GP5151-100mg | L-Deoxyalliin | 21593-77-1 | 100mg |
| GP5151-250mg | L-Deoxyalliin | 21593-77-1 | 250mg |
| GP5151-500mg | L-Deoxyalliin | 21593-77-1 | 500mg |
| GP5151-1g | L-Deoxyalliin | 21593-77-1 | 1g |
| GC1019-100mg | L-Erythrose | 533-49-3 | 100mg |
| GC4559-25g | L-Erythrulose | 533-50-6 | 25g |
| GC5724-50mg | L-Fructose | 7776-48-9 | 50mg |
| GC5081-250mg | L-Fucitol | 13074-06-1 | 250mg |
| GC5081-500mg | L-Fucitol | 13074-06-1 | 500mg |
| GC5081-1g | L-Fucitol | 13074-06-1 | 1g |
| GC5081-2g | L-Fucitol | 13074-06-1 | 2g |
| GC6718-250mg | L-Glucose | 921-60-8 | 250mg |
| GC6718-1g | L-Glucose | 921-60-8 | 1g |
| GM3277-100g | L-Glutamic acid | 56-86-0 | 100g |
| GM3277-500g | L-Glutamic acid | 56-86-0 | 500g |
| GM3277-1kg | L-Glutamic acid | 56-86-0 | 1kg |
| GM3277-5kg | L-Glutamic acid | 56-86-0 | 5kg |
| GM4234-1g | L-Glutamic acid ammonium salt | 7558-63-6 | 1g |
| GM4212-1g | L-Glutamic acid gamma-benzyl ester | 1676-73-9 | 1g |
| GM4212-5g | L-Glutamic acid gamma-benzyl ester | 1676-73-9 | 5g |
| GM4212-10g | L-Glutamic acid gamma-benzyl ester | 1676-73-9 | 10g |
| GM4212-25g | L-Glutamic acid gamma-benzyl ester | 1676-73-9 | 25g |
| GM4841-25g | L-Glutamic acid gamma-ethyl ester | 1119-33-1 | 25g |
| GE1700-100g | L-Glutamic acid hydrochloride | 138-15-8 | 100g |
| GE1700-250g | L-Glutamic acid hydrochloride | 138-15-8 | 250g |
| GE1700-500g | L-Glutamic acid hydrochloride | 138-15-8 | 500g |
| GE1700-1kg | L-Glutamic acid hydrochloride | 138-15-8 | 1kg |
| GM5912-100g | L-Glutamic acid monosodium salt monohydrate | 6106-04-3 | 100g |
| GM5912-250g | L-Glutamic acid monosodium salt monohydrate | 6106-04-3 | 250g |
| GM5912-500g | L-Glutamic acid monosodium salt monohydrate | 6106-04-3 | 500g |
| GM5912-1kg | L-Glutamic acid monosodium salt monohydrate | 6106-04-3 | 1kg |
| GM5912-5kg | L-Glutamic acid monosodium salt monohydrate | 6106-04-3 | 5kg |
| GL2267-100g | L-Glutamic acid potassium salt monohydrate | 6382-01-0 | 100g |
| GM8976-1kg | L-Glutamic acid, GlenCell™, suitable for cell culture | 56-86-0 | 1kg |
| GM6582-25g | L-Glutamine | 56-85-9 | 25g |
| GM6582-100g | L-Glutamine | 56-85-9 | 100g |
| GM6582-250g | L-Glutamine | 56-85-9 | 250g |
| GM6582-500g | L-Glutamine | 56-85-9 | 500g |
| GM6582-1kg | L-Glutamine | 56-85-9 | 1kg |
| GM8887-500g | L-Glutamine, GlenCell™, suitable for cell culture | 56-85-9 | 500g |
| GM8887-1kg | L-Glutamine, GlenCell™, suitable for cell culture | 56-85-9 | 1kg |
| GM2001-250g | L-Glutamine, USP grade, non-animal origin | 56-85-9 | 250g |
| GM2001-1kg | L-Glutamine, USP grade, non-animal origin | 56-85-9 | 1kg |
| GM8655-1g | L-Glutathione oxidised, 98% | 27025-41-8 | 1g |
| GM8655-5g | L-Glutathione oxidised, 98% | 27025-41-8 | 5g |
| GM8655-10g | L-Glutathione oxidised, 98% | 27025-41-8 | 10g |
| GC5865-5mg | L-Gulurono-6,3-lactone | 14474-04-5 | 5mg |
| GC5865-10mg | L-Gulurono-6,3-lactone | 14474-04-5 | 10mg |
| GC5865-25mg | L-Gulurono-6,3-lactone | 14474-04-5 | 25mg |
| GC5865-50mg | L-Gulurono-6,3-lactone | 14474-04-5 | 50mg |
| GM0900-25g | L-Histidine monohydrochloride monohydrate, 99%, non-animal origin | 5934-29-2 | 25g |
| GM0900-100g | L-Histidine monohydrochloride monohydrate, 99%, non-animal origin | 5934-29-2 | 100g |
| GM0900-250g | L-Histidine monohydrochloride monohydrate, 99%, non-animal origin | 5934-29-2 | 250g |
| GM0900-500g | L-Histidine monohydrochloride monohydrate, 99%, non-animal origin | 5934-29-2 | 500g |
| GM0900-1kg | L-Histidine monohydrochloride monohydrate, 99%, non-animal origin | 5934-29-2 | 1kg |
| GM1189-25g | L-Histidine monohydrochloride monohydrate, EP grade | 5934-29-2 | 25g |
| GM1189-100g | L-Histidine monohydrochloride monohydrate, EP grade | 5934-29-2 | 100g |
| GM1189-250g | L-Histidine monohydrochloride monohydrate, EP grade | 5934-29-2 | 250g |
| GM1189-500g | L-Histidine monohydrochloride monohydrate, EP grade | 5934-29-2 | 500g |
| GM1189-1kg | L-Histidine monohydrochloride monohydrate, EP grade | 5934-29-2 | 1kg |
| GM2021-1kg | L-Histidine monohydrochloride monohydrate, GlenCell™, suitable for cell culture | 5934-29-2 | 1kg |
| GM5566-25g | L-Histidine, 99% | 71-00-1 | 25g |
| GM5566-100g | L-Histidine, 99% | 71-00-1 | 100g |
| GM5566-250g | L-Histidine, 99% | 71-00-1 | 250g |
| GM5566-500g | L-Histidine, 99% | 71-00-1 | 500g |
| GM5566-1kg | L-Histidine, 99% | 71-00-1 | 1kg |
| GM1595-25g | L-Histidine, Ph. Eur., USP grade | 71-00-1 | 25g |
| GM1595-100g | L-Histidine, Ph. Eur., USP grade | 71-00-1 | 100g |
| GM1595-250g | L-Histidine, Ph. Eur., USP grade | 71-00-1 | 250g |
| GM1595-500g | L-Histidine, Ph. Eur., USP grade | 71-00-1 | 500g |
| GM1595-1kg | L-Histidine, Ph. Eur., USP grade | 71-00-1 | 1kg |
| GE7144-1g | L-Histidinol dihydrochloride | 1596-64-1 | 1g |
| GW5330-5g | L-Homoserine lactone hydrobromide | 15295-77-9 | 5g |
| GC4237-10mg | L-Iduronic acid sodium salt | 2073-35-0 | 10mg |
| GC4237-25mg | L-Iduronic acid sodium salt | 2073-35-0 | 25mg |
| GC4237-50mg | L-Iduronic acid sodium salt | 2073-35-0 | 50mg |
| GC4237-100mg | L-Iduronic acid sodium salt | 2073-35-0 | 100mg |
| GC0609-1mg | L-Iduronic acid-1,6-13C2 | 1mg | |
| GC0609-2mg | L-Iduronic acid-1,6-13C2 | 2mg | |
| GC0609-5mg | L-Iduronic acid-1,6-13C2 | 5mg | |
| GC0609-10mg | L-Iduronic acid-1,6-13C2 | 10mg | |
| GM6591-25g | L-Isoleucine | 73-32-5 | 25g |
| GM6591-100g | L-Isoleucine | 73-32-5 | 100g |
| GM6591-250g | L-Isoleucine | 73-32-5 | 250g |
| GM6591-500g | L-Isoleucine | 73-32-5 | 500g |
| GM4168-1g | L-Isoleucine methyl ester hydrochloride | 18598-74-8 | 1g |
| GM4168-5g | L-Isoleucine methyl ester hydrochloride | 18598-74-8 | 5g |
| GM4168-25g | L-Isoleucine methyl ester hydrochloride | 18598-74-8 | 25g |
| GM8967-1kg | L-Isoleucine, GlenCell™, suitable for cell culture | 73-32-5 | 1kg |
| GK1495-25g | L-Lactide | 4511-42-6 | 25g |
| GK1495-100g | L-Lactide | 4511-42-6 | 100g |
| GM6205-25g | L-Leucine | 61-90-5 | 25g |
| GM6205-100g | L-Leucine | 61-90-5 | 100g |
| GM6205-250g | L-Leucine | 61-90-5 | 250g |
| GM6205-500g | L-Leucine | 61-90-5 | 500g |
| GM6205-1kg | L-Leucine | 61-90-5 | 1kg |
| GC8248-25mg | L-Leucine 7-amido-4-methylcoumarin hydrochloride salt | 62480-44-8 | 25mg |
| GC8248-100mg | L-Leucine 7-amido-4-methylcoumarin hydrochloride salt | 62480-44-8 | 100mg |
| GM6647-10g | L-Leucine methyl ester hydrochloride | 7517-19-3 | 10g |
| GM6647-25g | L-Leucine methyl ester hydrochloride | 7517-19-3 | 25g |
| GM6647-100g | L-Leucine methyl ester hydrochloride | 7517-19-3 | 100g |
| GM0001-1kg | L-Leucine, GlenCell™, suitable for cell culture | 61-90-5 | 1kg |
| GM5722-100g | L-Lysine | 56-87-1 | 100g |
| GM5722-250g | L-Lysine | 56-87-1 | 250g |
| GM5722-500g | L-Lysine | 56-87-1 | 500g |
| GM5722-1kg | L-Lysine | 56-87-1 | 1kg |
| GM2435-25g | L-Lysine dihydrochloride | 657-26-1 | 25g |
| GM2435-100g | L-Lysine dihydrochloride | 657-26-1 | 100g |
| GM2935-25g | L-Lysine ethyl ester dihydrochloride | 3844-53-9 | 25g |
| GM2935-50g | L-Lysine ethyl ester dihydrochloride | 3844-53-9 | 50g |
| GM2935-100g | L-Lysine ethyl ester dihydrochloride | 3844-53-9 | 100g |
| GM4839-5g | L-Lysine methyl ester dihydrochloride | 26348-70-9 | 5g |
| GM4839-25g | L-Lysine methyl ester dihydrochloride | 26348-70-9 | 25g |
| GM0350-25g | L-Lysine monohydrate | 39665-12-8 | 25g |
| GM0350-100g | L-Lysine monohydrate | 39665-12-8 | 100g |
| GM0350-250g | L-Lysine monohydrate | 39665-12-8 | 250g |
| GM0350-500g | L-Lysine monohydrate | 39665-12-8 | 500g |
| GM0350-1kg | L-Lysine monohydrate | 39665-12-8 | 1kg |
| GM7532-100g | L-Lysine monohydrochloride | 657-27-2 | 100g |
| GM7532-250g | L-Lysine monohydrochloride | 657-27-2 | 250g |
| GM7532-500g | L-Lysine monohydrochloride | 657-27-2 | 500g |
| GM7532-1kg | L-Lysine monohydrochloride | 657-27-2 | 1kg |
| GM7532-5kg | L-Lysine monohydrochloride | 657-27-2 | 5kg |
| GM9011-1kg | L-Lysine monohydrochloride, GlenCell™, suitable for cell culture | 657-27-2 | 1kg |
| GC8121-10g | L-Malic acid diethyl ester | 691-84-9 | 10g |
| GC8121-25g | L-Malic acid diethyl ester | 691-84-9 | 25g |
| GC8121-50g | L-Malic acid diethyl ester | 691-84-9 | 50g |
| GC8121-100g | L-Malic acid diethyl ester | 691-84-9 | 100g |
| GK4093-100g | L-Menthol | 2216-51-5 | 100g |
| GK4093-250g | L-Menthol | 2216-51-5 | 250g |
| GK4093-1kg | L-Menthol | 2216-51-5 | 1kg |
| GC9565-10mg | L-Menthyl β-D-glucopyranoside | 16203-27-3 | 10mg |
| GC9565-25mg | L-Menthyl β-D-glucopyranoside | 16203-27-3 | 25mg |
| GC9565-50mg | L-Menthyl β-D-glucopyranoside | 16203-27-3 | 50mg |
| GC9565-100mg | L-Menthyl β-D-glucopyranoside | 16203-27-3 | 100mg |
| GM0532-5g | L-Methionine | 63-68-3 | 5g |
| GM0532-25g | L-Methionine | 63-68-3 | 25g |
| GM0532-100g | L-Methionine | 63-68-3 | 100g |
| GM0532-250g | L-Methionine | 63-68-3 | 250g |
| GM0532-500g | L-Methionine | 63-68-3 | 500g |
| GM0532-1kg | L-Methionine | 63-68-3 | 1kg |
| GM9348-100g | L-Methionine, 99%, GlenCell™, suitable for cell culture, Ph. Eur., USP grade | 63-68-3 | 100g |
| GM9348-1kg | L-Methionine, 99%, GlenCell™, suitable for cell culture, Ph. Eur., USP grade | 63-68-3 | 1kg |
| GM7307-1g | L-NAME hydrochloride | 51298-62-5 | 1g |
| GM7307-5g | L-NAME hydrochloride | 51298-62-5 | 5g |
| GM7307-25g | L-NAME hydrochloride | 51298-62-5 | 25g |
| GK0019-1g | L-Noradrenaline | 51-41-2 | 1g |
| GM4908-1g | L-Ornithine dihydrochloride | 6211-16-1 | 1g |
| GM2431-25g | L-Ornithine monohydrochloride | 3184-13-2 | 25g |
| GM2431-100g | L-Ornithine monohydrochloride | 3184-13-2 | 100g |
| GM2431-250g | L-Ornithine monohydrochloride | 3184-13-2 | 250g |
| GM2431-500g | L-Ornithine monohydrochloride | 3184-13-2 | 500g |
| GM2431-1kg | L-Ornithine monohydrochloride | 3184-13-2 | 1kg |
| GE6926-25g | L-Ornithine-L-aspartate | 3230-94-2 | 25g |
| GE6926-100g | L-Ornithine-L-aspartate | 3230-94-2 | 100g |
| GM3245-1g | L-Penicillamine | 1113-41-3 | 1g |
| GM3245-5g | L-Penicillamine | 1113-41-3 | 5g |
| GM4385-25g | L-Phenylalanine | 63-91-2 | 25g |
| GM4385-100g | L-Phenylalanine | 63-91-2 | 100g |
| GM4385-500g | L-Phenylalanine | 63-91-2 | 500g |
| GM4385-1kg | L-Phenylalanine | 63-91-2 | 1kg |
| GM0968-5g | L-Phenylalanine benzyl ester hydrochloride | 2462-32-0 | 5g |
| GM0968-10g | L-Phenylalanine benzyl ester hydrochloride | 2462-32-0 | 10g |
| GM0968-25g | L-Phenylalanine benzyl ester hydrochloride | 2462-32-0 | 25g |
| GM3785-5g | L-Phenylalanine ethyl ester hydrochloride | 3182-93-2 | 5g |
| GM3785-10g | L-Phenylalanine ethyl ester hydrochloride | 3182-93-2 | 10g |
| GM3785-25g | L-Phenylalanine ethyl ester hydrochloride | 3182-93-2 | 25g |
| GM3785-50g | L-Phenylalanine ethyl ester hydrochloride | 3182-93-2 | 50g |
| GM3785-100g | L-Phenylalanine ethyl ester hydrochloride | 3182-93-2 | 100g |
| GM0002-10g | L-Phenylalanine methyl ester hydrochloride | 7524-50-7 | 10g |
| GM0002-25g | L-Phenylalanine methyl ester hydrochloride | 7524-50-7 | 25g |
| GM0002-50g | L-Phenylalanine methyl ester hydrochloride | 7524-50-7 | 50g |
| GM7895-100g | L-Phenylalanine, GlenCell™, suitable for cell culture | 63-91-2 | 100g |
| GM7895-1kg | L-Phenylalanine, GlenCell™, suitable for cell culture | 63-91-2 | 1kg |
| GP5595-5g | L-Phenylephrine | 59-42-7 | 5g |
| GP5595-10g | L-Phenylephrine | 59-42-7 | 10g |
| GP5595-25g | L-Phenylephrine | 59-42-7 | 25g |
| GM1129-100g | L-Proline | 147-85-3 | 100g |
| GM1129-250g | L-Proline | 147-85-3 | 250g |
| GM1129-500g | L-Proline | 147-85-3 | 500g |
| GM1129-1kg | L-Proline | 147-85-3 | 1kg |
| GM6324-5g | L-Proline benzyl ester hydrochloride | 16652-71-4 | 5g |
| GM6324-10g | L-Proline benzyl ester hydrochloride | 16652-71-4 | 10g |
| GM6324-25g | L-Proline benzyl ester hydrochloride | 16652-71-4 | 25g |
| GM3370-1g | L-Proline methyl ester hydrochloride | 2133-40-6 | 1g |
| GM3370-5g | L-Proline methyl ester hydrochloride | 2133-40-6 | 5g |
| GM3370-25g | L-Proline methyl ester hydrochloride | 2133-40-6 | 25g |
| GM7977-5g | L-Proline tert-butyl ester | 2812-46-6 | 5g |
| GM9897-100g | L-Proline, GlenCell™, suitable for cell culture | 147-85-3 | 100g |
| GM9897-1kg | L-Proline, GlenCell™, suitable for cell culture | 147-85-3 | 1kg |
| GM2961-25g | L-Pyroglutamic acid | 98-79-3 | 25g |
| GM2961-100g | L-Pyroglutamic acid | 98-79-3 | 100g |
| GM2961-500g | L-Pyroglutamic acid | 98-79-3 | 500g |
| GM2961-1kg | L-Pyroglutamic acid | 98-79-3 | 1kg |
| GM6959-250mg | L-Pyroglutamic acid beta-naphthylamide | 22155-91-5 | 250mg |
| GM6959-1g | L-Pyroglutamic acid beta-naphthylamide | 22155-91-5 | 1g |
| GE3158-250mg | L-Quebrachitol | 642-38-6 | 250mg |
| GE3158-1g | L-Quebrachitol | 642-38-6 | 1g |
| GC1712-25g | L-Rhamnose monohydrate | 10030-85-0 | 25g |
| GC1712-50g | L-Rhamnose monohydrate | 10030-85-0 | 50g |
| GC1712-100g | L-Rhamnose monohydrate | 10030-85-0 | 100g |
| GC1712-250g | L-Rhamnose monohydrate | 10030-85-0 | 250g |
| GM1114-25g | L-Serine | 56-45-1 | 25g |
| GM1114-100g | L-Serine | 56-45-1 | 100g |
| GM1114-250g | L-Serine | 56-45-1 | 250g |
| GM1114-500g | L-Serine | 56-45-1 | 500g |
| GM1114-1kg | L-Serine | 56-45-1 | 1kg |
| GM9860-5g | L-Serine ethyl ester hydrochloride | 26348-61-8 | 5g |
| GM9860-25g | L-Serine ethyl ester hydrochloride | 26348-61-8 | 25g |
| GM9860-100g | L-Serine ethyl ester hydrochloride | 26348-61-8 | 100g |
| GM2197-5g | L-Serine methyl ester hydrochloride | 5680-80-8 | 5g |
| GM2197-25g | L-Serine methyl ester hydrochloride | 5680-80-8 | 25g |
| GM7000-100g | L-Serine, GlenCell™, suitable for cell culture | 56-45-1 | 100g |
| GM7000-1kg | L-Serine, GlenCell™, suitable for cell culture | 56-45-1 | 1kg |
| GC3235-25g | L-Sorbose | 87-79-6 | 25g |
| GC3235-50g | L-Sorbose | 87-79-6 | 50g |
| GC3235-100g | L-Sorbose | 87-79-6 | 100g |
| GK7799-100g | L-Tartaric acid | 87-69-4 | 100g |
| GK7799-250g | L-Tartaric acid | 87-69-4 | 250g |
| GK7799-500g | L-Tartaric acid | 87-69-4 | 500g |
| GK7799-1kg | L-Tartaric acid | 87-69-4 | 1kg |
| GK7799-5kg | L-Tartaric acid | 87-69-4 | 5kg |
| GM4241-1g | L-tert-Leucine | 20859-02-3 | 1g |
| GM4241-5g | L-tert-Leucine | 20859-02-3 | 5g |
| GM4241-25g | L-tert-Leucine | 20859-02-3 | 25g |
| GM8477-5g | L-Theanine | 3081-61-6 | 5g |
| GM8477-10g | L-Theanine | 3081-61-6 | 10g |
| GM8477-25g | L-Theanine | 3081-61-6 | 25g |
| GM8477-50g | L-Theanine | 3081-61-6 | 50g |
| GM8477-100g | L-Theanine | 3081-61-6 | 100g |
| GM4509-25g | L-Threonine | 72-19-5 | 25g |
| GM4509-100g | L-Threonine | 72-19-5 | 100g |
| GM4509-250g | L-Threonine | 72-19-5 | 250g |
| GM4509-500g | L-Threonine | 72-19-5 | 500g |
| GM4509-1kg | L-Threonine | 72-19-5 | 1kg |
| GM2600-5g | L-Threonine methyl ester hydrochloride | 39994-75-7 | 5g |
| GM2600-25g | L-Threonine methyl ester hydrochloride | 39994-75-7 | 25g |
| GM4012-1kg | L-Threonine, GlenCell™, suitable for cell culture | 72-19-5 | 1kg |
| GP9966-1g | L-Thyroxine | 51-48-9 | 1g |
| GP5241-1g | L-Thyroxine sodium pentahydrate | 6106-07-6 | 1g |
| GP5241-5g | L-Thyroxine sodium pentahydrate | 6106-07-6 | 5g |
| GM0674-25g | L-Tryptophan | 73-22-3 | 25g |
| GM0674-100g | L-Tryptophan | 73-22-3 | 100g |
| GM0674-250g | L-Tryptophan | 73-22-3 | 250g |
| GM0674-500g | L-Tryptophan | 73-22-3 | 500g |
| GM0674-1kg | L-Tryptophan | 73-22-3 | 1kg |
| GM4833-5g | L-Tryptophan ethyl ester hydrochloride | 2899-28-7 | 5g |
| GM5869-5g | L-Tryptophan methyl ester hydrochloride | 7524-52-9 | 5g |
| GM5869-25g | L-Tryptophan methyl ester hydrochloride | 7524-52-9 | 25g |
| GM0192-100g | L-Tryptophan, GlenCell™, suitable for cell culture | 73-22-3 | 100g |
| GM0192-500g | L-Tryptophan, GlenCell™, suitable for cell culture | 73-22-3 | 500g |
| GM0192-1kg | L-Tryptophan, GlenCell™, suitable for cell culture | 73-22-3 | 1kg |
| GM8690-25g | L-Tyrosine | 60-18-4 | 25g |
| GM8690-100g | L-Tyrosine | 60-18-4 | 100g |
| GM8690-500g | L-Tyrosine | 60-18-4 | 500g |
| GM8690-1kg | L-Tyrosine | 60-18-4 | 1kg |
| GE4061-25g | L-Tyrosine disodium salt hydrate | 69847-45-6 | 25g |
| GE4061-50g | L-Tyrosine disodium salt hydrate | 69847-45-6 | 50g |
| GE4061-100g | L-Tyrosine disodium salt hydrate | 69847-45-6 | 100g |
| GM1285-10g | L-Tyrosine ethyl ester hydrochloride | 4089-07-0 | 10g |
| GM1285-25g | L-Tyrosine ethyl ester hydrochloride | 4089-07-0 | 25g |
| GM1285-100g | L-Tyrosine ethyl ester hydrochloride | 4089-07-0 | 100g |
| GM6239-25g | L-Tyrosine methyl ester | 1080-06-4 | 25g |
| GM6239-100g | L-Tyrosine methyl ester | 1080-06-4 | 100g |
| GM3836-25g | L-Tyrosine methyl ester hydrochloride | 3417-91-2 | 25g |
| GM3836-100g | L-Tyrosine methyl ester hydrochloride | 3417-91-2 | 100g |
| GM9358-5g | L-Tyrosine tert-butyl ester | 16874-12-7 | 5g |
| GM9358-10g | L-Tyrosine tert-butyl ester | 16874-12-7 | 10g |
| GM9358-25g | L-Tyrosine tert-butyl ester | 16874-12-7 | 25g |
| GM1911-100g | L-Tyrosine, USP grade, non-animal origin | 60-18-4 | 100g |
| GM1911-500g | L-Tyrosine, USP grade, non-animal origin | 60-18-4 | 500g |
| GM1911-1kg | L-Tyrosine, USP grade, non-animal origin | 60-18-4 | 1kg |
| GM6473-25g | L-Valine | 72-18-4 | 25g |
| GM6473-100g | L-Valine | 72-18-4 | 100g |
| GM6473-250g | L-Valine | 72-18-4 | 250g |
| GM6473-500g | L-Valine | 72-18-4 | 500g |
| GM6473-1kg | L-Valine | 72-18-4 | 1kg |
| GM7880-10g | L-Valine methyl ester hydrochloride | 6306-52-1 | 10g |
| GM7880-25g | L-Valine methyl ester hydrochloride | 6306-52-1 | 25g |
| GM7880-50g | L-Valine methyl ester hydrochloride | 6306-52-1 | 50g |
| GM3894-1kg | L-Valine, GlenCell™, suitable for cell culture | 72-18-4 | 1kg |
| GM8064-5g | L-Valinol | 2026-48-4 | 5g |
| GM8064-25g | L-Valinol | 2026-48-4 | 25g |
| GM8064-100g | L-Valinol | 2026-48-4 | 100g |
| GC6785-5g | L-Xylose | 609-06-3 | 5g |
| GC6785-10g | L-Xylose | 609-06-3 | 10g |
| GC6785-25g | L-Xylose | 609-06-3 | 25g |
| GC6785-100g | L-Xylose | 609-06-3 | 100g |
| GP7675-1g | Labetalol hydrochloride | 32780-64-6 | 1g |
| GP7675-5g | Labetalol hydrochloride | 32780-64-6 | 5g |
| GP7675-10g | Labetalol hydrochloride | 32780-64-6 | 10g |
| GP9532-250mg | Lacidipine | 103890-78-4 | 250mg |
| GP9532-1g | Lacidipine | 103890-78-4 | 1g |
| GT5015-10g | Lacmoid (C.I. 51400) | 33869-21-5 | 10g |
| GT5015-25g | Lacmoid (C.I. 51400) | 33869-21-5 | 25g |
| GK3911-100ug | Lactacystin | 133343-34-7 | 100ug |
| GK3911-200ug | Lactacystin | 133343-34-7 | 200ug |
| GK3911-500ug | Lactacystin | 133343-34-7 | 500ug |
| GK3911-1mg | Lactacystin | 133343-34-7 | 1mg |
| GE1311-100g | Lactalbumin | 9013-90-5 | 100g |
| GC9869-250ml | Lactic acid, 30% solution | 50-21-5 | 250ml |
| GC9869-1l | Lactic acid, 30% solution | 50-21-5 | 1l |
| GC2172-250ml | Lactic acid, 40% solution | 50-21-5 | 250ml |
| GC2172-1l | Lactic acid, 40% solution | 50-21-5 | 1l |
| GC9491-250ml | Lactic acid, 90% solution | 50-21-5 | 250ml |
| GC9491-1l | Lactic acid, 90% solution | 50-21-5 | 1l |
| GC3782-10g | Lactobionic acid | 96-82-2 | 10g |
| GC3782-25g | Lactobionic acid | 96-82-2 | 25g |
| GC3782-100g | Lactobionic acid | 96-82-2 | 100g |
| GC3782-250g | Lactobionic acid | 96-82-2 | 250g |
| GW1152-100mg | Lactofen | 77501-63-4 | 100mg |
| GW1152-500mg | Lactofen | 77501-63-4 | 500mg |
| GW1152-5g | Lactofen | 77501-63-4 | 5g |
| GZ1173-5mg | Lactoperoxidase, from bovine milk | 9003-99-0 | 5mg |
| GT5339-100ml | Lactophenol Blue solution | 100ml | |
| GC3204-1g | Lactose octaacetate | 6291-42-5 | 1g |
| GC3204-2g | Lactose octaacetate | 6291-42-5 | 2g |
| GC3204-5g | Lactose octaacetate | 6291-42-5 | 5g |
| GC3204-10g | Lactose octaacetate | 6291-42-5 | 10g |
| GC3204-25g | Lactose octaacetate | 6291-42-5 | 25g |
| GC4307-100g | Lactose, anhydrous | 63-42-3 | 100g |
| GC4307-250g | Lactose, anhydrous | 63-42-3 | 250g |
| GC4307-1kg | Lactose, anhydrous | 63-42-3 | 1kg |
| GC4307-5kg | Lactose, anhydrous | 63-42-3 | 5kg |
| GC1111-1kg | Lactose, anhydrous, Ph. Eur., USP grade | 63-42-3 | 1kg |
| GC9831-5g | Lactulose, 98% | 4618-18-2 | 5g |
| GC9831-25g | Lactulose, 98% | 4618-18-2 | 25g |
| GC9831-100g | Lactulose, 98% | 4618-18-2 | 100g |
| GC9831-250g | Lactulose, 98% | 4618-18-2 | 250g |
| GC9831-500g | Lactulose, 98% | 4618-18-2 | 500g |
| GC1952-25g | Lactulose, Ph. Eur. grade | 4618-18-2 | 25g |
| GC1952-50g | Lactulose, Ph. Eur. grade | 4618-18-2 | 50g |
| GC1952-100g | Lactulose, Ph. Eur. grade | 4618-18-2 | 100g |
| GC1952-250g | Lactulose, Ph. Eur. grade | 4618-18-2 | 250g |
| GC1952-500g | Lactulose, Ph. Eur. grade | 4618-18-2 | 500g |
| GE1836-25ml | Laemmli Sample Buffer 4X (without 2-Mercaptoethanol) | - | 25ml |
| GE1836-100ml | Laemmli Sample Buffer 4X (without 2-Mercaptoethanol) | - | 100ml |
| GE1836-250ml | Laemmli Sample Buffer 4X (without 2-Mercaptoethanol) | - | 250ml |
| GC6852-10mg | Laminaribiose | 34980-39-7 | 10mg |
| GC2662-1g | Laminarin, from Eisenia Bicyclis | 9008-22-4 | 1g |
| GC2662-5g | Laminarin, from Eisenia Bicyclis | 9008-22-4 | 5g |
| GC6459-10mg | Laminaripentaose | 23743-55-7 | 10mg |
| GC0886-10mg | Laminaritetraose | 26212-72-6 | 10mg |
| GC6869-25mg | Laminaritriose | 3256-04-0 | 25mg |
| GP6029-100mg | Lamivudine | 134678-17-4 | 100mg |
| GP6029-250mg | Lamivudine | 134678-17-4 | 250mg |
| GP6029-1g | Lamivudine | 134678-17-4 | 1g |
| GP8797-1g | Lamotrigine | 84057-84-1 | 1g |
| GP8797-5g | Lamotrigine | 84057-84-1 | 5g |
| GE3627-250g | Lanolin | 8006-54-0 | 250g |
| GE3627-1kg | Lanolin | 8006-54-0 | 1kg |
| GP3911-1g | Lanosterol, 50% | 79-63-0 | 1g |
| GP5308-1g | Lansoprazole | 103577-45-3 | 1g |
| GX6085-100g | Lanthanum acetate hydrate, 99.9% | 25721-92-0 | 100g |
| GX6085-250g | Lanthanum acetate hydrate, 99.9% | 25721-92-0 | 250g |
| GX6085-500g | Lanthanum acetate hydrate, 99.9% | 25721-92-0 | 500g |
| GX4963-100g | Lanthanum acetate hydrate, 99.999% | 25721-92-0 | 100g |
| GX1012-10g | Lanthanum boride, 98% | 12008-21-8 | 10g |
| GX1012-50g | Lanthanum boride, 98% | 12008-21-8 | 50g |
| GX0970-100g | Lanthanum carbonate hydrate, 99.9% | 54451-24-0 | 100g |
| GX0970-500g | Lanthanum carbonate hydrate, 99.9% | 54451-24-0 | 500g |
| GX1674-100g | Lanthanum carbonate hydrate, 99.99% | 54451-24-0 | 100g |
| GX1674-250g | Lanthanum carbonate hydrate, 99.99% | 54451-24-0 | 250g |
| GX1674-500g | Lanthanum carbonate hydrate, 99.99% | 54451-24-0 | 500g |
| GX1698-100g | Lanthanum carbonate hydrate, 99.999% | 54451-24-0 | 100g |
| GX3350-25g | Lanthanum Chips, 99.9% | 7439-91-0 | 25g |
| GX3350-100g | Lanthanum Chips, 99.9% | 7439-91-0 | 100g |
| GK5624-100g | Lanthanum chloride heptahydrate | 10025-84-0 | 100g |
| GK5624-250g | Lanthanum chloride heptahydrate | 10025-84-0 | 250g |
| GK5624-500g | Lanthanum chloride heptahydrate | 10025-84-0 | 500g |
| GX3448-250g | Lanthanum chloride hydrate, 99.9% | 20211-76-1 | 250g |
| GX3448-1kg | Lanthanum chloride hydrate, 99.9% | 20211-76-1 | 1kg |
| GX4194-100g | Lanthanum chloride hydrate, 99.99% | 20211-76-1 | 100g |
| GX8850-25g | Lanthanum chloride, anhydrous | 10099-58-8 | 25g |
| GX8850-100g | Lanthanum chloride, anhydrous | 10099-58-8 | 100g |
| GX4994-100g | Lanthanum fluoride, anhydrous, 99.9% | 13709-38-1 | 100g |
| GX4994-500g | Lanthanum fluoride, anhydrous, 99.9% | 13709-38-1 | 500g |
| GX2605-100g | Lanthanum fluoride, anhydrous, 99.99% | 13709-38-1 | 100g |
| GX2605-500g | Lanthanum fluoride, anhydrous, 99.99% | 13709-38-1 | 500g |
| GX1050-50g | Lanthanum fluoride, anhydrous, 99.999% | 13709-38-1 | 50g |
| GX1050-250g | Lanthanum fluoride, anhydrous, 99.999% | 13709-38-1 | 250g |
| GX4636-25x50mm | Lanthanum Foil 0.25mm, 99.9% | 7439-91-0 | 25x50mm |
| GX5525-100g | Lanthanum nitrate hexahydrate, 99.99% | 10277-43-7 | 100g |
| GX5525-250g | Lanthanum nitrate hexahydrate, 99.99% | 10277-43-7 | 250g |
| GX5525-500g | Lanthanum nitrate hexahydrate, 99.99% | 10277-43-7 | 500g |
| GX7969-100g | Lanthanum nitrate hexahydrate, 99% | 10277-43-7 | 100g |
| GX7969-250g | Lanthanum nitrate hexahydrate, 99% | 10277-43-7 | 250g |
| GX7969-500g | Lanthanum nitrate hexahydrate, 99% | 10277-43-7 | 500g |
| GX7969-1kg | Lanthanum nitrate hexahydrate, 99% | 10277-43-7 | 1kg |
| GX1997-250g | Lanthanum oxalate hydrate, 99.9% | 537-03-1 | 250g |
| GX6132-100g | Lanthanum oxalate hydrate, 99.999% | 537-03-1 | 100g |
| GX6132-250g | Lanthanum oxalate hydrate, 99.999% | 537-03-1 | 250g |
| GX0653-250g | Lanthanum oxide, 99.9% | 1312-81-8 | 250g |
| GX0653-500g | Lanthanum oxide, 99.9% | 1312-81-8 | 500g |
| GX0653-1kg | Lanthanum oxide, 99.9% | 1312-81-8 | 1kg |
| GX9038-100g | Lanthanum oxide, 99.99% | 1312-81-8 | 100g |
| GX9038-250g | Lanthanum oxide, 99.99% | 1312-81-8 | 250g |
| GX9038-1kg | Lanthanum oxide, 99.99% | 1312-81-8 | 1kg |
| GX9729-10g | Lanthanum oxide, 99.999% | 1312-81-8 | 10g |
| GX9729-50g | Lanthanum oxide, 99.999% | 1312-81-8 | 50g |
| GX4998-25g | Lanthanum oxide, 99.999% | 1312-81-8 | 25g |
| GX9729-250g | Lanthanum oxide, 99.999% | 1312-81-8 | 250g |
| GX8840-10g | Lanthanum oxide, 99.9999% | 1312-81-8 | 10g |
| GX8840-50g | Lanthanum oxide, 99.9999% | 1312-81-8 | 50g |
| GX4914-25g | Lanthanum Pieces max. 10 mm, 99.9% | 7439-91-0 | 25g |
| GX4914-100g | Lanthanum Pieces max. 10 mm, 99.9% | 7439-91-0 | 100g |
| GX6829-10g | Lanthanum Powder, 99.9% | 7439-91-0 | 10g |
| GX6829-50g | Lanthanum Powder, 99.9% | 7439-91-0 | 50g |
| GX4327-50mm | Lanthanum Rod 6.35 mm diameter, 99.9% | 7439-91-0 | 50mm |
| GX4327-100mm | Lanthanum Rod 6.35 mm diameter, 99.9% | 7439-91-0 | 100mm |
| GX6096-50g | Lanthanum sulfate hydrate, 99.9% | 10099-60-2 | 50g |
| GX6096-100g | Lanthanum sulfate hydrate, 99.9% | 10099-60-2 | 100g |
| GX6096-250g | Lanthanum sulfate hydrate, 99.9% | 10099-60-2 | 250g |
| GX9924-25cm | Lanthanum Wire 1 mm diameter, 99.9% | 7439-91-0 | 25cm |
| GX9924-50cm | Lanthanum Wire 1 mm diameter, 99.9% | 7439-91-0 | 50cm |
| GX9811-1g | Lanthanum-fod, 99% | 19106-89-9 | 1g |
| GX1361-25g | Lanthanum-Nickel alloy (LaNi5, pieces max. 12 mm); 99.9% | 7439-91-0 | 25g |
| GX1361-50g | Lanthanum-Nickel alloy (LaNi5, pieces max. 12 mm); 99.9% | 7439-91-0 | 50g |
| GX9124-1g | Lanthanum-thd | 14319-13-2 | 1g |
| GX9124-5g | Lanthanum-thd | 14319-13-2 | 5g |
| GP6924-250mg | Lapatinib | 231277-92-2 | 250mg |
| GP6924-500mg | Lapatinib | 231277-92-2 | 500mg |
| GP6924-1g | Lapatinib | 231277-92-2 | 1g |
| GP0452-100mg | Lapatinib tosylate | 388082-78-8 | 100mg |
| GL6572-250ug | Lariatin A | 732286-09-8 | 250ug |
| GL6572-1mg | Lariatin A | 732286-09-8 | 1mg |
| GW9729-50mg | Lasalocid A sodium salt | 25999-20-6 | 50mg |
| GW9729-250mg | Lasalocid A sodium salt | 25999-20-6 | 250mg |
| GW0266-1ml | Lasalocid A sodium salt Solution, ~100 µg/ml in acetonitrile | 25999-20-6 | 1ml |
| GW0266-2500ug | Lasalocid A sodium salt Solution, ~100 µg/ml in acetonitrile | 25999-20-6 | 2500ug |
| GP3013-10mg | Latanoprost | 130209-82-4 | 10mg |
| GP3013-25mg | Latanoprost | 130209-82-4 | 25mg |
| GL4689-100ug | Latrunculin A | 76343-93-6 | 100ug |
| GL4689-500ug | Latrunculin A | 76343-93-6 | 500ug |
| GL0565-500ug | Latrunculin B | 76343-94-7 | 500ug |
| GL0565-1mg | Latrunculin B | 76343-94-7 | 1mg |
| GW3779-50mg | Laurdan | 74515-25-6 | 50mg |
| GW3779-250mg | Laurdan | 74515-25-6 | 250mg |
| GK3297-100g | Lauric acid | 143-07-7 | 100g |
| GK3297-500g | Lauric acid | 143-07-7 | 500g |
| GK3297-1kg | Lauric acid | 143-07-7 | 1kg |
| GK7277-25g | Lawesson reagent | 19172-47-5 | 25g |
| GW0546-1mg | LDK378 | 1032900-25-6 | 1mg |
| GW0546-5mg | LDK378 | 1032900-25-6 | 5mg |
| GW0546-10mg | LDK378 | 1032900-25-6 | 10mg |
| GX3165-100g | Lead carbonate basic, 99.9% | 1319-46-6 | 100g |
| GX3165-500g | Lead carbonate basic, 99.9% | 1319-46-6 | 500g |
| GX7022-100x100mm | Lead Foil 0.125mm, 99.99% | 7439-92-1 | 100x100mm |
| GX7022-150x150mm | Lead Foil 0.125mm, 99.99% | 7439-92-1 | 150x150mm |
| GX3900-100x100mm | Lead Foil 0.25 mm, 99.95+% | 7439-92-1 | 100x100mm |
| GX6473-50x50mm | Lead Foil 0.25mm, 99.999% | 7439-92-1 | 50x50mm |
| GX6473-100x100mm | Lead Foil 0.25mm, 99.999% | 7439-92-1 | 100x100mm |
| GX6473-100x200mm | Lead Foil 0.25mm, 99.999% | 7439-92-1 | 100x200mm |
| GX1826-50x50mm | Lead Foil 0.5 mm, 99.95+% | 7439-92-1 | 50x50mm |
| GX1826-100x100mm | Lead Foil 0.5 mm, 99.95+% | 7439-92-1 | 100x100mm |
| GX4682-100x200mm | Lead Foil 0.5mm, 99.999% | 7439-92-1 | 100x200mm |
| GX0645-50x50mm | Lead Foil 1.0 mm, 99.99% | 7439-92-1 | 50x50mm |
| GX0645-100x100mm | Lead Foil 1.0 mm, 99.99% | 7439-92-1 | 100x100mm |
| GX1368-50x50mm | Lead Foil 2.0 mm, 99.8% | 7439-92-1 | 50x50mm |
| GX1368-100x100mm | Lead Foil 2.0 mm, 99.8% | 7439-92-1 | 100x100mm |
| GX9068-25g | Lead Granules 1-5 mm, 99.999% | 7439-92-1 | 25g |
| GX9068-100g | Lead Granules 1-5 mm, 99.999% | 7439-92-1 | 100g |
| GX9068-250g | Lead Granules 1-5 mm, 99.999% | 7439-92-1 | 250g |
| GX8107-100g | Lead Granules 1-5 mm, 99.9995% | 7439-92-1 | 100g |
| GX3133-500g | Lead Granules 3 mm, 99.9+% | 7439-92-1 | 500g |
| GX3133-1kg | Lead Granules 3 mm, 99.9+% | 7439-92-1 | 1kg |
| GX9614-100g | Lead Pellets 6 x 6 mm, 99.9+% | 7439-92-1 | 100g |
| GX1060-1kg | Lead Powder | 7439-92-1 | 1kg |
| GX9983-150mm | Lead Rod 10 mm, 99.999% | 7439-92-1 | 150mm |
| GX1656-100mm | Lead Rod 6 mm diameter, 99.99% | 7439-92-1 | 100mm |
| GX1656-250mm | Lead Rod 6 mm diameter, 99.99% | 7439-92-1 | 250mm |
| GX3646-200mm | Lead Rod 8 mm, 99.999% | 7439-92-1 | 200mm |
| GX2757-500g | Lead Shot 0.4-0.8 mm, 99.9+% | 7439-92-1 | 500g |
| GX2757-1kg | Lead Shot 0.4-0.8 mm, 99.9+% | 7439-92-1 | 1kg |
| GX9735-100g | Lead titanate, 99.9% | 12060-00-3 | 100g |
| GX7052-25g | Lead tungstate, 99.9% | 7759-01-5 | 25g |
| GX7052-100g | Lead tungstate, 99.9% | 7759-01-5 | 100g |
| GX6889-5m | Lead Wire 0.5 mm diameter, 99% | 7439-92-1 | 5m |
| GX6889-25m | Lead Wire 0.5 mm diameter, 99% | 7439-92-1 | 25m |
| GX2458-5m | Lead Wire 1.0 mm diameter, 99.9+% | 7439-92-1 | 5m |
| GX2458-25m | Lead Wire 1.0 mm diameter, 99.9+% | 7439-92-1 | 25m |
| GX6765-2m | Lead Wire 1.0 mm diameter, 99.99% | 7439-92-1 | 2m |
| GX6765-5m | Lead Wire 1.0 mm diameter, 99.99% | 7439-92-1 | 5m |
| GX9548-1m | Lead Wire 1.0 mm diameter, 99.999% | 7439-92-1 | 1m |
| GX9548-5m | Lead Wire 1.0 mm diameter, 99.999% | 7439-92-1 | 5m |
| GX4054-1m | Lead Wire 1.6 mm diameter, 99.99% | 7439-92-1 | 1m |
| GX3985-5m | Lead Wire 2.0 mm diameter, 99.9+% | 7439-92-1 | 5m |
| GX3985-10m | Lead Wire 2.0 mm diameter, 99.9+% | 7439-92-1 | 10m |
| GX3985-25m | Lead Wire 2.0 mm diameter, 99.9+% | 7439-92-1 | 25m |
| GX3985-50m | Lead Wire 2.0 mm diameter, 99.9+% | 7439-92-1 | 50m |
| GX7021-1m | Lead Wire 2.0 mm diameter, 99.99% | 7439-92-1 | 1m |
| GX6713-25cm | Lead Wire 2.0 mm diameter, 99.999% | 7439-92-1 | 25cm |
| GX6713-1m | Lead Wire 2.0 mm diameter, 99.999% | 7439-92-1 | 1m |
| GX1998-1m | Lead Wire 3.0 mm diameter, 99.999% | 7439-92-1 | 1m |
| GX5440-100g | Lead zirconate, 99.7% | 12060-01-4 | 100g |
| GX9319-500g | Lead, Antimony alloy, 2.5-3.5% Sb, shot 2-3 mm | 7439-92-1 | 500g |
| GX9319-1kg | Lead, Antimony alloy, 2.5-3.5% Sb, shot 2-3 mm | 7439-92-1 | 1kg |
| GX5771-50g | Lead(II) acetate hydrate, 99.999% | 6080-56-4 | 50g |
| GX8891-1kg | Lead(II) acetate trihydrate, 99.5+% | 6080-56-4 | 1kg |
| GX2019-25g | Lead(II) fluoride, 99.9% | 7783-46-2 | 25g |
| GX2019-100g | Lead(II) fluoride, 99.9% | 7783-46-2 | 100g |
| GX9701-25g | Lead(II) fluoride, 99.99% | 7783-46-2 | 25g |
| GX4360-50g | Lead(II) iodide, 98% | 10101-63-0 | 50g |
| GX4360-250g | Lead(II) iodide, 98% | 10101-63-0 | 250g |
| GX5822-50g | Lead(II) iodide, 99.999% | 10101-63-0 | 50g |
| GX2548-100g | Lead(II) molybdate, 99.9% | 10190-55-3 | 100g |
| GX1570-50g | Lead(II) niobate, 99.9% | 12034-88-7 | 50g |
| GX5568-25g | Lead(II) oxide, 99.999% | 1317-36-8 | 25g |
| GX5568-100g | Lead(II) oxide, 99.999% | 1317-36-8 | 100g |
| GX3757-500g | Lead(II) oxide, 99% | 1317-36-8 | 500g |
| GX3979-10g | Lead(II) selenide, 99% | 12069-00-0 | 10g |
| GX3979-50g | Lead(II) selenide, 99% | 12069-00-0 | 50g |
| GX4153-250g | Lead(II) sulfate, 98% | 7446-14-2 | 250g |
| GX2788-50g | Lead(II) sulfate, 99.999% | 7446-14-2 | 50g |
| GX1891-10g | Lead(II) telluride, 99.999% | 1314-91-6 | 10g |
| GX1891-25g | Lead(II) telluride, 99.999% | 1314-91-6 | 25g |
| GX0028-1l | Lead(II) tetrafluoroborate solution, 50% | 13814-96-5 | 1l |
| GX2437-100g | Lead(II) thiocyanate, 98+% | 592-87-0 | 100g |
| GL7758-500mg | Ledol | 577-27-5 | 500mg |
| GL7758-1g | Ledol | 577-27-5 | 1g |
| GW0606-1mg | LEE011 | 1211441-98-3 | 1mg |
| GW0606-5mg | LEE011 | 1211441-98-3 | 5mg |
| GW0606-10mg | LEE011 | 1211441-98-3 | 10mg |
| GP6125-100mg | Leflunomide | 75706-12-6 | 100mg |
| GT6256-25g | Leishman''s stain | 12627-53-1 | 25g |
| GT6256-100g | Leishman''s stain | 12627-53-1 | 100g |
| GP6222-250mg | Lenalidomide | 191732-72-6 | 250mg |
| GP6222-1g | Lenalidomide | 191732-72-6 | 1g |
| GP2959-1g | Lentinan | 37339-90-5 | 1g |
| GL0192-1mg | Leptomycin B | 87081-35-4 | 1mg |
| GP3608-250mg | Lercanidipine hydrochloride | 132866-11-6 | 250mg |
| GP3608-1g | Lercanidipine hydrochloride | 132866-11-6 | 1g |
| GP1426-100mg | Letrozole | 112809-51-5 | 100mg |
| GP1426-1g | Letrozole | 112809-51-5 | 1g |
| GM9870-1g | Leu-Ala hydrate | 7298-84-2 | 1g |
| GL8276-1mg | Leucettine L41 | 1112978-84-3 | 1mg |
| GL8276-5mg | Leucettine L41 | 1112978-84-3 | 5mg |
| GL8276-25mg | Leucettine L41 | 1112978-84-3 | 25mg |
| GT6330-5g | Leucocrystal Violet | 603-48-5 | 5g |
| GT6330-25g | Leucocrystal Violet | 603-48-5 | 25g |
| GT7606-5g | Leucomalachite Green | 129-73-7 | 5g |
| GT7606-10g | Leucomalachite Green | 129-73-7 | 10g |
| GT7606-25g | Leucomalachite Green | 129-73-7 | 25g |
| GE7125-5mg | Leupeptin hemisulfate | 103476-89-7 | 5mg |
| GE7125-25mg | Leupeptin hemisulfate | 103476-89-7 | 25mg |
| GE7125-100mg | Leupeptin hemisulfate | 103476-89-7 | 100mg |
| GP2433-5mg | Leuprolide acetate | 74381-53-6 | 5mg |
| GP2433-25mg | Leuprolide acetate | 74381-53-6 | 25mg |
| GA3670-5g | Levamisol hydrochloride | 16595-80-5 | 5g |
| GA3670-10g | Levamisol hydrochloride | 16595-80-5 | 10g |
| GA3670-25g | Levamisol hydrochloride | 16595-80-5 | 25g |
| GP1133-500mg | Levetiracetam | 102767-28-2 | 500mg |
| GP1133-1g | Levetiracetam | 102767-28-2 | 1g |
| GP1133-5g | Levetiracetam | 102767-28-2 | 5g |
| GP7550-10mg | Levocetirizine dihydrochloride | 130018-87-0 | 10mg |
| GP7550-50mg | Levocetirizine dihydrochloride | 130018-87-0 | 50mg |
| GA6417-1g | Levofloxacin | 100986-85-4 | 1g |
| GA6417-5g | Levofloxacin | 100986-85-4 | 5g |
| GA6417-10g | Levofloxacin | 100986-85-4 | 10g |
| GA6417-25g | Levofloxacin | 100986-85-4 | 25g |
| GA2496-1g | Levofloxacin hydrochloride | 177325-13-2 | 1g |
| GC7426-250mg | Levoglucosenone | 37112-31-5 | 250mg |
| GC7426-500mg | Levoglucosenone | 37112-31-5 | 500mg |
| GC7426-1g | Levoglucosenone | 37112-31-5 | 1g |
| GC7426-2g | Levoglucosenone | 37112-31-5 | 2g |
| GP7196-25mg | Levosimendan | 141505-33-1 | 25mg |
| GP7196-50mg | Levosimendan | 141505-33-1 | 50mg |
| GP2472-5g | Levosulpiride | 23672-07-3 | 5g |
| GP2472-25g | Levosulpiride | 23672-07-3 | 25g |
| GC3263-1g | Lichenan | 1402-10-4 | 1g |
| GY3744-25mg | Licochalcone A | 58749-22-7 | 25mg |
| GK6463-25g | Lidocaine | 137-58-6 | 25g |
| GK6463-100g | Lidocaine | 137-58-6 | 100g |
| GK6463-250g | Lidocaine | 137-58-6 | 250g |
| GP7771-5g | Lidocaine hydrochloride monohydrate, 98% | 6108-05-0 | 5g |
| GP7771-10g | Lidocaine hydrochloride monohydrate, 98% | 6108-05-0 | 10g |
| GP7771-25g | Lidocaine hydrochloride monohydrate, 98% | 6108-05-0 | 25g |
| GP7771-100g | Lidocaine hydrochloride monohydrate, 98% | 6108-05-0 | 100g |
| GP3932-100g | Lidocaine hydrochloride monohydrate, EP grade | 6108-05-0 | 100g |
| GT6845-10g | Light Green SF Yellowish (C.I. 42095) | 5141-20-8 | 10g |
| GT6845-25g | Light Green SF Yellowish (C.I. 42095) | 5141-20-8 | 25g |
| GX1374-100g | Lignosulfonic acid calcium salt | 8061-52-7 | 100g |
| GX8328-100g | Lignosulfonic acid potassium salt | 37314-65-1 | 100g |
| GX2755-500g | Lignosulfonic acid sodium salt | 8061-51-6 | 500g |
| GK0995-5ml | Lilial | 80-54-6 | 5ml |
| GP4085-100mg | Limonin | 1180-71-8 | 100mg |
| GP4085-1g | Limonin | 1180-71-8 | 1g |
| GP5216-50mg | Linagliptin | 668270-12-0 | 50mg |
| GP5216-250mg | Linagliptin | 668270-12-0 | 250mg |
| GP5216-1g | Linagliptin | 668270-12-0 | 1g |
| GP6851-100ml | Linalool | 78-70-6 | 100ml |
| GP6851-250ml | Linalool | 78-70-6 | 250ml |
| GP6851-500ml | Linalool | 78-70-6 | 500ml |
| GC5398-25mg | Linamarin | 554-35-8 | 25mg |
| GC5398-50mg | Linamarin | 554-35-8 | 50mg |
| GC5398-100mg | Linamarin | 554-35-8 | 100mg |
| GC5398-250mg | Linamarin | 554-35-8 | 250mg |
| GC6460-5mg | Linarin | 480-36-4 | 5mg |
| GC6460-10mg | Linarin | 480-36-4 | 10mg |
| GA3892-1g | Lincomycin hydrochloride | 859-18-7 | 1g |
| GA3892-5g | Lincomycin hydrochloride | 859-18-7 | 5g |
| GA3892-10g | Lincomycin hydrochloride | 859-18-7 | 10g |
| GA3892-25g | Lincomycin hydrochloride | 859-18-7 | 25g |
| GA2609-50mg | Linezolid | 165800-03-3 | 50mg |
| GA2609-1g | Linezolid | 165800-03-3 | 1g |
| GW0425-1mg | Linifanib | 796967-16-3 | 1mg |
| GW0425-5mg | Linifanib | 796967-16-3 | 5mg |
| GW0425-10mg | Linifanib | 796967-16-3 | 10mg |
| GK5161-25g | Linoleic acid | 60-33-3 | 25g |
| GK5161-100g | Linoleic acid | 60-33-3 | 100g |
| GK5161-250g | Linoleic acid | 60-33-3 | 250g |
| GK5161-1kg | Linoleic acid | 60-33-3 | 1kg |
| GK5074-10g | Linoleic acid, 99% | 60-33-3 | 10g |
| GK5074-25g | Linoleic acid, 99% | 60-33-3 | 25g |
| GL9596-5ml | Linolenic acid | 463-40-1 | 5ml |
| GL9596-25ml | Linolenic acid | 463-40-1 | 25ml |
| GL9796-250ml | Linseed oil | 8001-26-1 | 250ml |
| GW4278-10mg | Lipofermata | 297180-15-5 | 10mg |
| GW4278-50mg | Lipofermata | 297180-15-5 | 50mg |
| GC1330-10mg | Liquiritin | 551-15-5 | 10mg |
| GC1330-50mg | Liquiritin | 551-15-5 | 50mg |
| GY2358-2mg | Liquiritin apioside | 74639-14-8 | 2mg |
| GY2358-10mg | Liquiritin apioside | 74639-14-8 | 10mg |
| GX3695-1mg | Liraglutide | 204656-20-2 | 1mg |
| GX3695-5mg | Liraglutide | 204656-20-2 | 5mg |
| GX3695-25mg | Liraglutide | 204656-20-2 | 25mg |
| GP1712-1g | Lisinopril | 83915-83-7 | 1g |
| GP1712-5g | Lisinopril | 83915-83-7 | 5g |
| GX6845-500g | Lithium acetate 99+% | 546-89-4 | 500g |
| GX6845-1kg | Lithium acetate 99+% | 546-89-4 | 1kg |
| GK2943-25g | Lithium acetate dihydrate | 6108-17-4 | 25g |
| GK2943-100g | Lithium acetate dihydrate | 6108-17-4 | 100g |
| GK2943-250g | Lithium acetate dihydrate | 6108-17-4 | 250g |
| GK2943-500g | Lithium acetate dihydrate | 6108-17-4 | 500g |
| GK2943-1kg | Lithium acetate dihydrate | 6108-17-4 | 1kg |
| GX0577-250g | Lithium benzoate, 99% | 553-54-8 | 250g |
| GX0577-1kg | Lithium benzoate, 99% | 553-54-8 | 1kg |
| GX7315-500g | Lithium bromide, anhydrous, 99% | 7550-35-8 | 500g |
| GX7315-1kg | Lithium bromide, anhydrous, 99% | 7550-35-8 | 1kg |
| GX7417-1kg | Lithium bromide, anhydrous, 99+% | 7550-35-8 | 1kg |
| GX7417-2kg | Lithium bromide, anhydrous, 99+% | 7550-35-8 | 2kg |
| GX5986-10g | Lithium bromide, hydrate, 99.95% | 85017-82-9 | 10g |
| GX5986-50g | Lithium bromide, hydrate, 99.95% | 85017-82-9 | 50g |
| GK3300-100g | Lithium carbonate | 554-13-2 | 100g |
| GK3300-500g | Lithium carbonate | 554-13-2 | 500g |
| GX5892-25g | Lithium carbonate, 99.99% | 554-13-2 | 25g |
| GE1934-100g | Lithium chloride | 7447-41-8 | 100g |
| GE1934-500g | Lithium chloride | 7447-41-8 | 500g |
| GX8309-50g | Lithium chloride hydrate, 99.9+% | 16712-20-2 | 50g |
| GX2369-10g | Lithium chloride, 99.9+% | 7447-41-8 | 10g |
| GX0243-500g | Lithium citrate tetrahydrate, 99+% | 6080-58-6 | 500g |
| GX0522-500g | Lithium dihydrogen phosphate, 97% | 13453-80-0 | 500g |
| GD2271-5g | Lithium dodecyl sulfate | 2044-56-6 | 5g |
| GD2271-25g | Lithium dodecyl sulfate | 2044-56-6 | 25g |
| GD2271-100g | Lithium dodecyl sulfate | 2044-56-6 | 100g |
| GD2271-250g | Lithium dodecyl sulfate | 2044-56-6 | 250g |
| GD3001-25g | Lithium dodecyl sulfate, 99% | 2044-56-6 | 25g |
| GD3001-100g | Lithium dodecyl sulfate, 99% | 2044-56-6 | 100g |
| GX1571-1g | Lithium hexafluorophosphate(V); 98% | 21324-40-3 | 1g |
| GX1571-5g | Lithium hexafluorophosphate(V); 98% | 21324-40-3 | 5g |
| GX1571-10g | Lithium hexafluorophosphate(V); 98% | 21324-40-3 | 10g |
| GX1571-25g | Lithium hexafluorophosphate(V); 98% | 21324-40-3 | 25g |
| GK9443-100g | Lithium hydroxide monohydrate | 1310-66-3 | 100g |
| GK9443-500g | Lithium hydroxide monohydrate | 1310-66-3 | 500g |
| GK9443-1kg | Lithium hydroxide monohydrate | 1310-66-3 | 1kg |
| GK9443-5kg | Lithium hydroxide monohydrate | 1310-66-3 | 5kg |
| GX0545-1kg | Lithium hydroxide, anhydrous, 99% | 1310-65-2 | 1kg |
| GX0487-1kg | Lithium hydroxide, monohydrate, 98+% | 1310-66-3 | 1kg |
| GX0436-50g | Lithium metaborate, 99.995+% | 13453-69-5 | 50g |
| GX7565-250g | Lithium metaborate, anhydrous | 13453-69-5 | 250g |
| GX7565-1kg | Lithium metaborate, anhydrous | 13453-69-5 | 1kg |
| GX1194-100g | Lithium metaborate, anhydrous, 99.9% | 13453-69-5 | 100g |
| GX4591-50g | Lithium niobate, 99.9% | 12031-63-9 | 50g |
| GX9077-10g | Lithium nitrate, anhydrous, 99.995% | 7790-69-4 | 10g |
| GX9077-50g | Lithium nitrate, anhydrous, 99.995% | 7790-69-4 | 50g |
| GX9077-250g | Lithium nitrate, anhydrous, 99.995% | 7790-69-4 | 250g |
| GX8798-100g | Lithium nitrate, anhydrous, 99% | 7790-69-4 | 100g |
| GX8798-250g | Lithium nitrate, anhydrous, 99% | 7790-69-4 | 250g |
| GX8798-500g | Lithium nitrate, anhydrous, 99% | 7790-69-4 | 500g |
| GX8798-1kg | Lithium nitrate, anhydrous, 99% | 7790-69-4 | 1kg |
| GX9030-10g | Lithium perchlorate, anhydrous | 7791-03-9 | 10g |
| GX8112-500mg | Lithium phenyl-2,4,6-trimethylbenzoylphosphinate | 85073-19-4 | 500mg |
| GX8112-1g | Lithium phenyl-2,4,6-trimethylbenzoylphosphinate | 85073-19-4 | 1g |
| GX3466-500g | Lithium phosphate | 10377-52-3 | 500g |
| GX3466-1kg | Lithium phosphate | 10377-52-3 | 1kg |
| GX2584-100g | Lithium sulfate monohydrate, 99% | 10102-25-7 | 100g |
| GX2584-500g | Lithium sulfate monohydrate, 99% | 10102-25-7 | 500g |
| GX2584-1kg | Lithium sulfate monohydrate, 99% | 10102-25-7 | 1kg |
| GX9097-100g | Lithium sulfate, anhydrous, 99% | 10377-48-7 | 100g |
| GX9097-250g | Lithium sulfate, anhydrous, 99% | 10377-48-7 | 250g |
| GX9097-1kg | Lithium sulfate, anhydrous, 99% | 10377-48-7 | 1kg |
| GX7464-50g | Lithium sulfate, monohydrate, 99.9+% | 10102-25-7 | 50g |
| GX7269-10g | Lithium tantalate, 99.9% | 12031-66-2 | 10g |
| GX7269-25g | Lithium tantalate, 99.9% | 12031-66-2 | 25g |
| GX0594-100g | Lithium tetraborate, 99.95+% | 12007-60-2 | 100g |
| GX0594-250g | Lithium tetraborate, 99.95+% | 12007-60-2 | 250g |
| GX0594-1kg | Lithium tetraborate, 99.95+% | 12007-60-2 | 1kg |
| GX3587-500g | Lithium tetraborate, 99% | 12007-60-2 | 500g |
| GX3587-1kg | Lithium tetraborate, 99% | 12007-60-2 | 1kg |
| GW7003-100mg | Lithium tetrakis(pentafluorophenyl)borate ethyl etherate | 371162-53-7 | 100mg |
| GW7003-1g | Lithium tetrakis(pentafluorophenyl)borate ethyl etherate | 371162-53-7 | 1g |
| GW7003-10g | Lithium tetrakis(pentafluorophenyl)borate ethyl etherate | 371162-53-7 | 10g |
| GX5534-25g | Lithium tungstate, 99.9% | 13568-45-1 | 25g |
| GX5534-100g | Lithium tungstate, 99.9% | 13568-45-1 | 100g |
| GX8731-25g | Lithium vanadate, 99.9% | 15060-59-0 | 25g |
| GX8731-100g | Lithium vanadate, 99.9% | 15060-59-0 | 100g |
| GX9730-50g | Lithium zirconate, 99% | 12031-83-3 | 50g |
| GX9730-250g | Lithium zirconate, 99% | 12031-83-3 | 250g |
| GW7435-50mg | Litihium ionophore III | 99281-50-2 | 50mg |
| GT7868-25g | Litmus | 1393-92-6 | 25g |
| GT7868-100g | Litmus | 1393-92-6 | 100g |
| GP3753-100mg | Lobenzarit disodium salt | 64808-48-6 | 100mg |
| GC1233-100g | Locust bean gum | 9000-40-2 | 100g |
| GC1233-250g | Locust bean gum | 9000-40-2 | 250g |
| GC1233-500g | Locust bean gum | 9000-40-2 | 500g |
| GC1233-1kg | Locust bean gum | 9000-40-2 | 1kg |
| GC0918-1kg | Locust bean gum, pure, 2400 - 2800 cps | 9000-40-2 | 1kg |
| GL2325-5mg | Loganic acid | 22255-40-9 | 5mg |
| GA6534-1g | Lomefloxacin hydrochloride | 98079-52-8 | 1g |
| GA6534-10g | Lomefloxacin hydrochloride | 98079-52-8 | 10g |
| GA6534-25g | Lomefloxacin hydrochloride | 98079-52-8 | 25g |
| GP1101-5g | Loperamide hydrochloride | 34552-83-5 | 5g |
| GP1101-25g | Loperamide hydrochloride | 34552-83-5 | 25g |
| GP6351-10mg | Lopinavir | 192725-17-0 | 10mg |
| GP6351-50mg | Lopinavir | 192725-17-0 | 50mg |
| GP6351-100mg | Lopinavir | 192725-17-0 | 100mg |
| GP6351-250mg | Lopinavir | 192725-17-0 | 250mg |
| GP7681-1g | Loratadine | 79794-75-5 | 1g |
| GC8253-1mg | Lorcaserin carbamoyl-β-D-glucuronide | 1361544-50-4 | 1mg |
| GC8253-2mg | Lorcaserin carbamoyl-β-D-glucuronide | 1361544-50-4 | 2mg |
| GC8253-5mg | Lorcaserin carbamoyl-β-D-glucuronide | 1361544-50-4 | 5mg |
| GC8253-10mg | Lorcaserin carbamoyl-β-D-glucuronide | 1361544-50-4 | 10mg |
| GP4427-250mg | Lorcaserin hydrochloride hemihydrate | 856681-05-5 | 250mg |
| GP4427-1g | Lorcaserin hydrochloride hemihydrate | 856681-05-5 | 1g |
| GP9841-100mg | Lornoxicam | 70374-39-9 | 100mg |
| GP6564-25mg | Losartan | 114798-26-4 | 25mg |
| GP6564-100mg | Losartan | 114798-26-4 | 100mg |
| GP5105-1g | Loteprednol etabonate | 82034-46-6 | 1g |
| GP5105-5g | Loteprednol etabonate | 82034-46-6 | 5g |
| GP4839-5g | Lovastatin | 75330-75-5 | 5g |
| GP4839-10g | Lovastatin | 75330-75-5 | 10g |
| GP4839-25g | Lovastatin | 75330-75-5 | 25g |
| GP5830-100mg | Loxapine succinate salt | 27833-64-3 | 100mg |
| GP5830-500mg | Loxapine succinate salt | 27833-64-3 | 500mg |
| GL5446-1mg | Luisol A | 225110-59-8 | 1mg |
| GL5446-5mg | Luisol A | 225110-59-8 | 5mg |
| GC4054-1mg | Lumacaftor acyl-β-D-glucuronide | 1mg | |
| GC4054-2mg | Lumacaftor acyl-β-D-glucuronide | 2mg | |
| GC4054-5mg | Lumacaftor acyl-β-D-glucuronide | 5mg | |
| GC4054-10mg | Lumacaftor acyl-β-D-glucuronide | 10mg | |
| GC4054-25mg | Lumacaftor acyl-β-D-glucuronide | 25mg | |
| GP5101-1g | Lumefantrine | 82186-77-4 | 1g |
| GP5101-5g | Lumefantrine | 82186-77-4 | 5g |
| GP8383-1g | Luminol | 521-31-3 | 1g |
| GP8383-5g | Luminol | 521-31-3 | 5g |
| GP8383-25g | Luminol | 521-31-3 | 25g |
| GP8383-100g | Luminol | 521-31-3 | 100g |
| GC0838-1mg | Lumiracoxib acyl-b-D-glucuronide | 697287-17-5 | 1mg |
| GC0838-2mg | Lumiracoxib acyl-b-D-glucuronide | 697287-17-5 | 2mg |
| GC0838-5mg | Lumiracoxib acyl-b-D-glucuronide | 697287-17-5 | 5mg |
| GT0556-100mg | Lumogallion | 4386-25-8 | 100mg |
| GL2733-25mg | Lupeol | 545-47-1 | 25mg |
| GL2733-100mg | Lupeol | 545-47-1 | 100mg |
| GP5376-100mg | Luteolin | 491-70-3 | 100mg |
| GP5376-500mg | Luteolin | 491-70-3 | 500mg |
| GP5376-1g | Luteolin | 491-70-3 | 1g |
| GP5376-5g | Luteolin | 491-70-3 | 5g |
| GK3885-1mg | Luteolin 7-rutinoside | 20633-84-5 | 1mg |
| GC0559-10mg | Luteolin-7-O-D-glucopyranoside | 5373-11-5 | 10mg |
| GW6055-500ug | Luteoreticulin | 22388-89-2 | 500ug |
| GW6055-1mg | Luteoreticulin | 22388-89-2 | 1mg |
| GX7889-2g | Lutetium acetate hydrate, 99.9% | 18779-08-3 | 2g |
| GX7889-5g | Lutetium acetate hydrate, 99.9% | 18779-08-3 | 5g |
| GX2224-2g | Lutetium acetate hydrate, 99.999% | 18779-08-3 | 2g |
| GX2224-5g | Lutetium acetate hydrate, 99.999% | 18779-08-3 | 5g |
| GX9080-2g | Lutetium carbonate hydrate, 99.9% | 64360-99-2 | 2g |
| GX9080-5g | Lutetium carbonate hydrate, 99.9% | 64360-99-2 | 5g |
| GX1554-2g | Lutetium carbonate hydrate, 99.999% | 64360-99-2 | 2g |
| GX1554-5g | Lutetium carbonate hydrate, 99.999% | 64360-99-2 | 5g |
| GX2950-2g | Lutetium Chips, 99.9% | 7439-94-3 | 2g |
| GX7959-1g | Lutetium chloride anhydrous, 99.9% | 10099-66-8 | 1g |
| GX7959-5g | Lutetium chloride anhydrous, 99.9% | 10099-66-8 | 5g |
| GX3720-2g | Lutetium chloride hydrate, 99.9% | 15230-79-2 | 2g |
| GX3720-10g | Lutetium chloride hydrate, 99.9% | 15230-79-2 | 10g |
| GX4754-1g | Lutetium fluoride anhydrous, 99.9% | 13760-81-1 | 1g |
| GX4754-5g | Lutetium fluoride anhydrous, 99.9% | 13760-81-1 | 5g |
| GX4704-25x50mm | Lutetium Foil 0.25mm, 99.9% | 7439-94-3 | 25x50mm |
| GX8216-1g | Lutetium hydroxide hydrate, 99.99% | 16469-21-9 | 1g |
| GX8216-5g | Lutetium hydroxide hydrate, 99.99% | 16469-21-9 | 5g |
| GX8216-25g | Lutetium hydroxide hydrate, 99.99% | 16469-21-9 | 25g |
| GX3667-1g | Lutetium nitrate hydrate, 99.9% | 100641-16-5 | 1g |
| GX3667-2g | Lutetium nitrate hydrate, 99.9% | 100641-16-5 | 2g |
| GX3667-10g | Lutetium nitrate hydrate, 99.9% | 100641-16-5 | 10g |
| GX3667-25g | Lutetium nitrate hydrate, 99.9% | 100641-16-5 | 25g |
| GX0687-2g | Lutetium oxalate hydrate, 99.9% | 51373-64-9 | 2g |
| GX0687-5g | Lutetium oxalate hydrate, 99.9% | 51373-64-9 | 5g |
| GX3917-2g | Lutetium oxalate hydrate, 99.999% | 51373-64-9 | 2g |
| GX3917-5g | Lutetium oxalate hydrate, 99.999% | 51373-64-9 | 5g |
| GX3675-2g | Lutetium oxide, 99.9% | 12032-20-1 | 2g |
| GX3675-10g | Lutetium oxide, 99.9% | 12032-20-1 | 10g |
| GX3675-50g | Lutetium oxide, 99.9% | 12032-20-1 | 50g |
| GX4879-1g | Lutetium oxide, 99.99% | 12032-20-1 | 1g |
| GX4879-5g | Lutetium oxide, 99.99% | 12032-20-1 | 5g |
| GX4879-25g | Lutetium oxide, 99.99% | 12032-20-1 | 25g |
| GX2559-1g | Lutetium oxide, 99.999% | 12032-20-1 | 1g |
| GX2559-5g | Lutetium oxide, 99.999% | 12032-20-1 | 5g |
| GX2559-25g | Lutetium oxide, 99.999% | 12032-20-1 | 25g |
| GX6774-1g | Lutetium oxide, 99.9999% | 12032-20-1 | 1g |
| GX3800-1g | Lutetium oxide, 99.9999% | 12032-20-1 | 1g |
| GX6774-5g | Lutetium oxide, 99.9999% | 12032-20-1 | 5g |
| GX3800-5g | Lutetium oxide, 99.9999% | 12032-20-1 | 5g |
| GX1068-2g | Lutetium Pieces, 99.9% | 7439-94-3 | 2g |
| GX1068-5g | Lutetium Pieces, 99.9% | 7439-94-3 | 5g |
| GX9538-5g | Lutetium Pieces, 99.99% | 7439-94-3 | 5g |
| GX3553-2g | Lutetium Powder, 99.9% | 7439-94-3 | 2g |
| GX1411-2g | Lutetium sulfate hydrate, 99.9% | 13473-77-3 | 2g |
| GX1411-10g | Lutetium sulfate hydrate, 99.9% | 13473-77-3 | 10g |
| GX4039-2g | Lutetium sulfate hydrate, 99.999% | 13473-77-3 | 2g |
| GX4039-10g | Lutetium sulfate hydrate, 99.999% | 13473-77-3 | 10g |
| GL4623-1mg | LY-294,002 | 154447-36-6 | 1mg |
| GL4623-5mg | LY-294,002 | 154447-36-6 | 5mg |
| GL4623-25mg | LY-294,002 | 154447-36-6 | 25mg |
| GL4623-100mg | LY-294,002 | 154447-36-6 | 100mg |
| GL8919-1mg | LY-333,531 hydrochloride | 169939-93-9 | 1mg |
| GL8919-5mg | LY-333,531 hydrochloride | 169939-93-9 | 5mg |
| GW5071-1mg | LY2784544 | 1229236-86-5 | 1mg |
| GW5071-5mg | LY2784544 | 1229236-86-5 | 5mg |
| GW5071-10mg | LY2784544 | 1229236-86-5 | 10mg |
| GW3922-1mg | LY2801653 | 1206799-15-6 | 1mg |
| GW3922-5mg | LY2801653 | 1206799-15-6 | 5mg |
| GW3922-10mg | LY2801653 | 1206799-15-6 | 10mg |
| GW8945-100mg | LY2835219 | 1231930-82-7 | 100mg |
| GW8945-250mg | LY2835219 | 1231930-82-7 | 250mg |
| GK5538-25mg | LY311727 | 164083-84-5 | 25mg |
| GP3363-1mg | Lycopene | 502-65-8 | 1mg |
| GP3363-5mg | Lycopene | 502-65-8 | 5mg |
| GK0766-20mg | Lycorine hydrochloride | 2188-68-3 | 20mg |
| GP3340-1g | Lynestrenol | 52-76-6 | 1g |
| GA1731-500ug | Lysolipin I | 59113-57-4 | 500ug |
| GA1731-1mg | Lysolipin I | 59113-57-4 | 1mg |
| GA2846-1mg | Lysostaphin | 9011-93-2 | 1mg |
| GE8228-5g | Lysozyme, from chicken egg white | 12650-88-3 | 5g |
| GE8228-25g | Lysozyme, from chicken egg white | 12650-88-3 | 25g |
| GE8228-100g | Lysozyme, from chicken egg white | 12650-88-3 | 100g |
| GX9002-25g | m-Cresol | 108-39-4 | 25g |
| GX9002-100g | m-Cresol | 108-39-4 | 100g |
| GT6972-1g | m-Cresol Purple | 2303-01-7 | 1g |
| GT6972-5g | m-Cresol Purple | 2303-01-7 | 5g |
| GT6972-10g | m-Cresol Purple | 2303-01-7 | 10g |
| GT6972-25g | m-Cresol Purple | 2303-01-7 | 25g |
| GT4965-5g | m-Cresol Purple sodium salt | 62625-31-4 | 5g |
| GT4965-25g | m-Cresol Purple sodium salt | 62625-31-4 | 25g |
| GK3515-25g | m-Phenylenediamine | 108-45-2 | 25g |
| GW2119-100mg | M-Phisyl-chloride | 126565-42-2 | 100mg |
| GW2119-500mg | M-Phisyl-chloride | 126565-42-2 | 500mg |
| GK8406-5g | m-Tolualdehyde | 620-23-5 | 5g |
| GK8406-25g | m-Tolualdehyde | 620-23-5 | 25g |
| GK1312-25ml | m-Xylene | 108-38-3 | 25ml |
| GK1312-100ml | m-Xylene | 108-38-3 | 100ml |
| GS6320-500ml | m-Xylene, GlenPure™, analytical grade | 108-38-3 | 500ml |
| GW2168-1mg | MAC-545496 | 838810-96-1 | 1mg |
| GW2168-5mg | MAC-545496 | 838810-96-1 | 5mg |
| GW2168-25mg | MAC-545496 | 838810-96-1 | 25mg |
| GA1224-1mg | Macrosphelide A | 172923-77-2 | 1mg |
| GA1224-5mg | Macrosphelide A | 172923-77-2 | 5mg |
| GP8236-100mg | Mafenamide acetate | 13009-99-9 | 100mg |
| GP8236-250mg | Mafenamide acetate | 13009-99-9 | 250mg |
| GP8236-1g | Mafenamide acetate | 13009-99-9 | 1g |
| GX2500-100g | Magnesium 2,4-pentanedionate, 98% | 14024-56-7 | 100g |
| GK4886-250g | Magnesium acetate tetrahydrate | 16674-78-5 | 250g |
| GK4886-500g | Magnesium acetate tetrahydrate | 16674-78-5 | 500g |
| GK4886-1kg | Magnesium acetate tetrahydrate | 16674-78-5 | 1kg |
| GX7832-25g | Magnesium boride, 96+% | 12007-25-9 | 25g |
| GX3683-100g | Magnesium bromide hexahydrate | 13446-53-2 | 100g |
| GX3683-250g | Magnesium bromide hexahydrate | 13446-53-2 | 250g |
| GX3683-500g | Magnesium bromide hexahydrate | 13446-53-2 | 500g |
| GX3683-1kg | Magnesium bromide hexahydrate | 13446-53-2 | 1kg |
| GX3287-500g | Magnesium carbonate, basic, chemical pure | 39409-82-0 | 500g |
| GX3287-1kg | Magnesium carbonate, basic, chemical pure | 39409-82-0 | 1kg |
| GR8170-500g | Magnesium carbonate, basic, light, Ph. Eur grade | 39409-82-0 | 500g |
| GR8170-1kg | Magnesium carbonate, basic, light, Ph. Eur grade | 39409-82-0 | 1kg |
| GX8370-25g | Magnesium chloride anhydrous, 99.9% | 7786-30-3 | 25g |
| GX8370-100g | Magnesium chloride anhydrous, 99.9% | 7786-30-3 | 100g |
| GK8228-500g | Magnesium chloride hexahydrate | 7791-18-6 | 500g |
| GK8228-1kg | Magnesium chloride hexahydrate | 7791-18-6 | 1kg |
| GK8228-5kg | Magnesium chloride hexahydrate | 7791-18-6 | 5kg |
| GK0382-100g | Magnesium chloride hexahydrate, BP, Ph. Eur. grade | 7791-18-6 | 100g |
| GK0382-250g | Magnesium chloride hexahydrate, BP, Ph. Eur. grade | 7791-18-6 | 250g |
| GK0382-500g | Magnesium chloride hexahydrate, BP, Ph. Eur. grade | 7791-18-6 | 500g |
| GK0382-1kg | Magnesium chloride hexahydrate, BP, Ph. Eur. grade | 7791-18-6 | 1kg |
| GK0382-5kg | Magnesium chloride hexahydrate, BP, Ph. Eur. grade | 7791-18-6 | 5kg |
| GK5046-100g | Magnesium chloride, anhydrous | 7786-30-3 | 100g |
| GK5046-500g | Magnesium chloride, anhydrous | 7786-30-3 | 500g |
| GK5046-1kg | Magnesium chloride, anhydrous | 7786-30-3 | 1kg |
| GK5046-5kg | Magnesium chloride, anhydrous | 7786-30-3 | 5kg |
| GX9805-25g | Magnesium chloride, hexahydrate, 99.995% | 7791-18-6 | 25g |
| GK3304-500g | Magnesium citrate tribasic hydrate | 3344-18-1 | 500g |
| GK3304-1kg | Magnesium citrate tribasic hydrate | 3344-18-1 | 1kg |
| GX8266-100g | Magnesium citrate tribasic, anhydrous | 3344-18-1 | 100g |
| GX8266-500g | Magnesium citrate tribasic, anhydrous | 3344-18-1 | 500g |
| GC8065-25g | Magnesium D-gluconate hydrate | 3632-91-5 | 25g |
| GC8065-100g | Magnesium D-gluconate hydrate | 3632-91-5 | 100g |
| GC8065-250g | Magnesium D-gluconate hydrate | 3632-91-5 | 250g |
| GC8065-500g | Magnesium D-gluconate hydrate | 3632-91-5 | 500g |
| GX3844-50g | Magnesium fluoride, 99.9% | 7783-40-6 | 50g |
| GX3844-250g | Magnesium fluoride, 99.9% | 7783-40-6 | 250g |
| GX9551-50g | Magnesium fluoride, 99.99% | 7783-40-6 | 50g |
| GX9551-250g | Magnesium fluoride, 99.99% | 7783-40-6 | 250g |
| GX7432-500g | Magnesium fluoride, tech. | 7783-40-6 | 500g |
| GX2130-25x25mm | Magnesium Foil 0.25 mm, 98% | 7439-95-4 | 25x25mm |
| GX2130-50x50mm | Magnesium Foil 0.25 mm, 98% | 7439-95-4 | 50x50mm |
| GX1938-25x25mm | Magnesium Foil 0.5 mm, 98% | 7439-95-4 | 25x25mm |
| GX1938-50x50mm | Magnesium Foil 0.5 mm, 98% | 7439-95-4 | 50x50mm |
| GX4157-100g | Magnesium gluconate, USP grade | 3632-91-5 | 100g |
| GX4157-500g | Magnesium gluconate, USP grade | 3632-91-5 | 500g |
| GX9719-1kg | Magnesium hexafluorosilicate, hexahydrate, 99% | 18972-56-0 | 1kg |
| GX7640-250g | Magnesium hydroxide, 95.0% | 1309-42-8 | 250g |
| GX7640-1kg | Magnesium hydroxide, 95.0% | 1309-42-8 | 1kg |
| GK3533-250g | Magnesium L-lactate hydrate, Ph. Eur. grade | 18917-93-6 | 250g |
| GK3533-1kg | Magnesium L-lactate hydrate, Ph. Eur. grade | 18917-93-6 | 1kg |
| GX1101-25g | Magnesium molybdate, 99.9% | 13767-03-8 | 25g |
| GX1101-100g | Magnesium molybdate, 99.9% | 13767-03-8 | 100g |
| GK0164-250g | Magnesium nitrate hexahydrate | 13446-18-9 | 250g |
| GK0164-500g | Magnesium nitrate hexahydrate | 13446-18-9 | 500g |
| GK0164-1kg | Magnesium nitrate hexahydrate | 13446-18-9 | 1kg |
| GK0164-5kg | Magnesium nitrate hexahydrate | 13446-18-9 | 5kg |
| GX1786-500g | Magnesium nitrate, hexahydrate, 99+%, ACS | 13446-18-9 | 500g |
| GV8592-100g | Magnesium orotate dihydrate | 34717-03-8 | 100g |
| GK6094-1kg | Magnesium oxide | 1309-48-4 | 1kg |
| GK6094-5kg | Magnesium oxide | 1309-48-4 | 5kg |
| GX8585-25g | Magnesium oxide Nanopowder + Stearic Acid, 99,9 % | 1309-48-4 | 25g |
| GX8585-50g | Magnesium oxide Nanopowder + Stearic Acid, 99,9 % | 1309-48-4 | 50g |
| GX8585-250g | Magnesium oxide Nanopowder + Stearic Acid, 99,9 % | 1309-48-4 | 250g |
| GX8585-1kg | Magnesium oxide Nanopowder + Stearic Acid, 99,9 % | 1309-48-4 | 1kg |
| GX1655-50g | Magnesium oxide Nanopowder, 99.9% [APS 35 nm/ SSA g.t.50 m2/g] | 1309-48-4 | 50g |
| GX1655-100g | Magnesium oxide Nanopowder, 99.9% [APS 35 nm/ SSA g.t.50 m2/g] | 1309-48-4 | 100g |
| GX1655-250g | Magnesium oxide Nanopowder, 99.9% [APS 35 nm/ SSA g.t.50 m2/g] | 1309-48-4 | 250g |
| GX1655-1kg | Magnesium oxide Nanopowder, 99.9% [APS 35 nm/ SSA g.t.50 m2/g] | 1309-48-4 | 1kg |
| GX9231-25g | Magnesium oxide-Nano Powder, 99+% | 1309-48-4 | 25g |
| GX9231-100g | Magnesium oxide-Nano Powder, 99+% | 1309-48-4 | 100g |
| GX1357-1kg | Magnesium oxide, 98+% | 1309-48-4 | 1kg |
| GX5258-25g | Magnesium oxide, 99.9% | 1309-48-4 | 25g |
| GX5258-100g | Magnesium oxide, 99.9% | 1309-48-4 | 100g |
| GX1148-10g | Magnesium oxide, 99.99% | 1309-48-4 | 10g |
| GX1148-50g | Magnesium oxide, 99.99% | 1309-48-4 | 50g |
| GX1148-250g | Magnesium oxide, 99.99% | 1309-48-4 | 250g |
| GX0575-100g | Magnesium Pellets 4x4 mm, 99.99% | 7439-95-4 | 100g |
| GX0575-250g | Magnesium Pellets 4x4 mm, 99.99% | 7439-95-4 | 250g |
| GX2611-100g | Magnesium perchlorate | 10034-81-8 | 100g |
| GX3181-1kg | Magnesium phosphate hydrate | 10233-87-1 | 1kg |
| GX3181-2kg | Magnesium phosphate hydrate | 10233-87-1 | 2kg |
| GX3181-5kg | Magnesium phosphate hydrate | 10233-87-1 | 5kg |
| GX7837-1kg | Magnesium Powder 315-630 micron, 99% | 7439-95-4 | 1kg |
| GK9627-25g | Magnesium ribbon | 7439-95-4 | 25g |
| GX4432-100mm | Magnesium Rod 25.4 mm diameter, 99.9% | 7439-95-4 | 100mm |
| GX4432-200mm | Magnesium Rod 25.4 mm diameter, 99.9% | 7439-95-4 | 200mm |
| GX0894-100mm | Magnesium Rod 6.35 mm diameter, 99.9+% | 7439-95-4 | 100mm |
| GX0894-300mm | Magnesium Rod 6.35 mm diameter, 99.9+% | 7439-95-4 | 300mm |
| GX2592-300mm | Magnesium Rod 9.5 mm diameter, 99.9+% | 7439-95-4 | 300mm |
| GX2119-25x25mm | Magnesium Sheet 1 mm, 98% | 7439-95-4 | 25x25mm |
| GX2119-50x50mm | Magnesium Sheet 1 mm, 98% | 7439-95-4 | 50x50mm |
| GX4358-25x25mm | Magnesium Sheet 2 mm, 98% | 7439-95-4 | 25x25mm |
| GX4358-50x50mm | Magnesium Sheet 2 mm, 98% | 7439-95-4 | 50x50mm |
| GE2971-250g | Magnesium silicate | 1343-88-0 | 250g |
| GE2971-500g | Magnesium silicate | 1343-88-0 | 500g |
| GE2971-1kg | Magnesium silicate | 1343-88-0 | 1kg |
| GX8335-100g | Magnesium stearate | 557-04-0 | 100g |
| GX8335-250g | Magnesium stearate | 557-04-0 | 250g |
| GX8335-500g | Magnesium stearate | 557-04-0 | 500g |
| GX8335-1kg | Magnesium stearate | 557-04-0 | 1kg |
| GX1421-1kg | Magnesium stearate, EP, USP grade | 557-04-0 | 1kg |
| GK8109-250g | Magnesium sulfate heptahydrate | 10034-99-8 | 250g |
| GK8109-500g | Magnesium sulfate heptahydrate | 10034-99-8 | 500g |
| GK8109-1kg | Magnesium sulfate heptahydrate | 10034-99-8 | 1kg |
| GK8109-5kg | Magnesium sulfate heptahydrate | 10034-99-8 | 5kg |
| GK9094-100g | Magnesium sulfate, anhydrous | 7487-88-9 | 100g |
| GK9094-250g | Magnesium sulfate, anhydrous | 7487-88-9 | 250g |
| GK9094-500g | Magnesium sulfate, anhydrous | 7487-88-9 | 500g |
| GK9094-1kg | Magnesium sulfate, anhydrous | 7487-88-9 | 1kg |
| GK9094-5kg | Magnesium sulfate, anhydrous | 7487-88-9 | 5kg |
| GX5872-1kg | Magnesium sulfate, dried, BP grade | 7487-88-9 | 1kg |
| GX5872-5kg | Magnesium sulfate, dried, BP grade | 7487-88-9 | 5kg |
| GK9199-1kg | Magnesium sulfate, dried, USP grade | 7487-88-9 | 1kg |
| GK9199-5kg | Magnesium sulfate, dried, USP grade | 7487-88-9 | 5kg |
| GX5447-500g | Magnesium thiosulfate, hexahydrate | 13446-30-5 | 500g |
| GX3912-25g | Magnesium tungstate, 99.9% | 13573-11-0 | 25g |
| GX3912-100g | Magnesium tungstate, 99.9% | 13573-11-0 | 100g |
| GX3323-250g | Magnesium Turnings 2-5 mm, 99.5% | 7439-95-4 | 250g |
| GX3323-1kg | Magnesium Turnings 2-5 mm, 99.5% | 7439-95-4 | 1kg |
| GX0005-25g | Magnesium vanadate, 99.9% | 13573-13-2 | 25g |
| GX0005-100g | Magnesium vanadate, 99.9% | 13573-13-2 | 100g |
| GX9156-10g | Magnesium-thd, 99.9% | 21361-35-3 | 10g |
| GX0342-100g | Magnesium, powder, 150 - 350 mesh | 7439-95-4 | 100g |
| GY6402-10mg | Magnoflorine | 2141-09-5 | 10mg |
| GA6326-250mg | Magnolol | 528-43-8 | 250mg |
| GA6326-500mg | Magnolol | 528-43-8 | 500mg |
| GA6326-1g | Magnolol | 528-43-8 | 1g |
| GL5069-250ug | Makisterone A | 20137-14-8 | 250ug |
| GL5069-1mg | Makisterone A | 20137-14-8 | 1mg |
| GL5069-5mg | Makisterone A | 20137-14-8 | 5mg |
| GT7477-100g | Malachite green carbinol base | 510-13-4 | 100g |
| GT8088-25g | Malachite Green carbinol hydrochloride | 123333-61-9 | 25g |
| GT8088-100g | Malachite Green carbinol hydrochloride | 123333-61-9 | 100g |
| GT6969-25g | Malachite Green hydrochloride | 569-64-2 | 25g |
| GT6969-100g | Malachite Green hydrochloride | 569-64-2 | 100g |
| GT8926-25g | Malachite Green oxalate salt (C.I. 42000) | 2437-29-8 | 25g |
| GT8926-100g | Malachite Green oxalate salt (C.I. 42000) | 2437-29-8 | 100g |
| GT8926-250g | Malachite Green oxalate salt (C.I. 42000) | 2437-29-8 | 250g |
| GE7108-500ml | Malachite Green solution, 1% in water | 2437-29-8 | 500ml |
| GE7108-1l | Malachite Green solution, 1% in water | 2437-29-8 | 1l |
| GK3899-100g | Maleic acid | 110-16-7 | 100g |
| GK3899-250g | Maleic acid | 110-16-7 | 250g |
| GK3899-1kg | Maleic acid | 110-16-7 | 1kg |
| GK3899-5kg | Maleic acid | 110-16-7 | 5kg |
| GK2279-25g | Maleic anhydride | 108-31-6 | 25g |
| GK2279-100g | Maleic anhydride | 108-31-6 | 100g |
| GK2279-250g | Maleic anhydride | 108-31-6 | 250g |
| GK2279-500g | Maleic anhydride | 108-31-6 | 500g |
| GK6384-5g | Maleimide | 541-59-3 | 5g |
| GK6384-25g | Maleimide | 541-59-3 | 25g |
| GL8069-250ug | Malformin A1 | 3022-92-2 | 250ug |
| GL8069-1mg | Malformin A1 | 3022-92-2 | 1mg |
| GA2351-250ug | Malformin C | 59926-78-2 | 250ug |
| GA2351-1mg | Malformin C | 59926-78-2 | 1mg |
| GK0631-100g | Malonic acid | 141-82-2 | 100g |
| GK0631-250g | Malonic acid | 141-82-2 | 250g |
| GK0631-500g | Malonic acid | 141-82-2 | 500g |
| GK0631-1kg | Malonic acid | 141-82-2 | 1kg |
| GK9243-5g | Malononitrile | 109-77-3 | 5g |
| GK9243-25g | Malononitrile | 109-77-3 | 25g |
| GC3977-25g | Maltitol | 585-88-6 | 25g |
| GC3977-100g | Maltitol | 585-88-6 | 100g |
| GC3977-500g | Maltitol | 585-88-6 | 500g |
| GC8744-100g | Maltodextrin (DE 17.0 - 20.0) | 9050-36-6 | 100g |
| GC8744-500g | Maltodextrin (DE 17.0 - 20.0) | 9050-36-6 | 500g |
| GC8744-1kg | Maltodextrin (DE 17.0 - 20.0) | 9050-36-6 | 1kg |
| GC5959-25mg | Maltooctaose | 66567-45-1 | 25mg |
| GC6488-10mg | Maltotetraitol | 66767-99-5 | 10mg |
| GC6488-25mg | Maltotetraitol | 66767-99-5 | 25mg |
| GC6488-50mg | Maltotetraitol | 66767-99-5 | 50mg |
| GC6488-100mg | Maltotetraitol | 66767-99-5 | 100mg |
| GC2513-10mg | Maltotetraose | 34612-38-9 | 10mg |
| GC0323-250mg | Maltotriitol | 32860-62-1 | 250mg |
| GC0323-500mg | Maltotriitol | 32860-62-1 | 500mg |
| GC0323-1g | Maltotriitol | 32860-62-1 | 1g |
| GC0323-2g | Maltotriitol | 32860-62-1 | 2g |
| GC9153-1g | Maltotriose | 1109-28-0 | 1g |
| GC9153-5g | Maltotriose | 1109-28-0 | 5g |
| GW7662-500mg | Mancozeb | 8018-01-7 | 500mg |
| GX6480-100g | Manganese carbonate, 99.9+% | 598-62-9 | 100g |
| GX5474-250g | Manganese Flakes max. 4 mm, 99.8% | 7439-96-5 | 250g |
| GX5474-1kg | Manganese Flakes max. 4 mm, 99.8% | 7439-96-5 | 1kg |
| GX0468-25x25mm | Manganese Foil 1 mm, casted, 99.9% | 7439-96-5 | 25x25mm |
| GX4003-25x25mm | Manganese Foil 2 mm, casted, 99.9+% | 7439-96-5 | 25x25mm |
| GX0978-50g | Manganese Pieces, irregular, 3-12 mm, 99.99% | 7439-96-5 | 50g |
| GX0978-250g | Manganese Pieces, irregular, 3-12 mm, 99.99% | 7439-96-5 | 250g |
| GX7475-250g | Manganese Pieces, irregular, 99.9% | 7439-96-5 | 250g |
| GX7475-1kg | Manganese Pieces, irregular, 99.9% | 7439-96-5 | 1kg |
| GX5828-500g | Manganese Powder -325 mesh, 99.6% | 7439-96-5 | 500g |
| GX4231-50g | Manganese Powder -60 mesh, 99.98% | 7439-96-5 | 50g |
| GX1283-100g | Manganese Powder 125-500 micron, low oxygen, 99.8+% | 7439-96-5 | 100g |
| GX1283-250g | Manganese Powder 125-500 micron, low oxygen, 99.8+% | 7439-96-5 | 250g |
| GX9611-25g | Manganese silicide, 99.5% | 12032-86-9 | 25g |
| GX9611-100g | Manganese silicide, 99.5% | 12032-86-9 | 100g |
| GX1823-25g | Manganese titanate, 99+% | 12032-74-5 | 25g |
| GX1823-100g | Manganese titanate, 99+% | 12032-74-5 | 100g |
| GX4905-25g | Manganese tungstate, 99.9% | 14177-46-9 | 25g |
| GX4905-100g | Manganese tungstate, 99.9% | 14177-46-9 | 100g |
| GX9457-1kg | Manganese(II) acetate tetrahydrate, 99% | 6156-78-1 | 1kg |
| GX4047-50g | Manganese(II) acetate, tetrahydrate, 99.99% | 6156-78-1 | 50g |
| GX3940-50g | Manganese(II) bromide, tetrahydrate, 98% | 10031-20-6 | 50g |
| GX2705-2kg | Manganese(II) carbonate, tech. | 598-62-9 | 2kg |
| GK2508-25g | Manganese(II) chloride tetrahydrate | 13446-34-9 | 25g |
| GK2508-100g | Manganese(II) chloride tetrahydrate | 13446-34-9 | 100g |
| GK2508-250g | Manganese(II) chloride tetrahydrate | 13446-34-9 | 250g |
| GK2508-500g | Manganese(II) chloride tetrahydrate | 13446-34-9 | 500g |
| GX4690-10g | Manganese(II) chloride, tetrahydrate, 99.99% | 13446-34-9 | 10g |
| GX4690-25g | Manganese(II) chloride, tetrahydrate, 99.99% | 13446-34-9 | 25g |
| GX2034-50g | Manganese(II) fluoride, 99% | 7782-64-1 | 50g |
| GX7077-500g | Manganese(II) hypophosphite hydrate, 98+% | 7783-16-6 | 500g |
| GX8825-1kg | Manganese(II) nitrate tetrahydrate, 97.5% | 20694-39-7 | 1kg |
| GX6886-25g | Manganese(II) nitrate, hydrate, 99.99% | 15710-66-4 | 25g |
| GX5655-250g | Manganese(II) oxide, 99% | 1344-43-0 | 250g |
| GK7776-100g | Manganese(II) sulfate monohydrate | 10034-96-5 | 100g |
| GK7776-250g | Manganese(II) sulfate monohydrate | 10034-96-5 | 250g |
| GK7776-500g | Manganese(II) sulfate monohydrate | 10034-96-5 | 500g |
| GK7776-1kg | Manganese(II) sulfate monohydrate | 10034-96-5 | 1kg |
| GK7776-5kg | Manganese(II) sulfate monohydrate | 10034-96-5 | 5kg |
| GK2450-1kg | Manganese(II) sulfate monohydrate, EP, USP grade | 10034-96-5 | 1kg |
| GX5773-50g | Manganese(III) 2,4-pentanedionate | 14284-89-0 | 50g |
| GX2857-10g | Manganese(III) fluoride, 99.5% | 7783-53-1 | 10g |
| GX2857-25g | Manganese(III) fluoride, 99.5% | 7783-53-1 | 25g |
| GX1319-10g | Manganese(III) oxide Nanopowder, 98+ % | 1317-34-6 | 10g |
| GX1319-50g | Manganese(III) oxide Nanopowder, 98+ % | 1317-34-6 | 50g |
| GX1319-100g | Manganese(III) oxide Nanopowder, 98+ % | 1317-34-6 | 100g |
| GK4401-25g | Manganese(IV) oxide, 99.9% | 1313-13-9 | 25g |
| GK4401-100g | Manganese(IV) oxide, 99.9% | 1313-13-9 | 100g |
| GP1065-250mg | Manidipine dihydrochloride | 89226-75-5 | 250mg |
| GP1065-1g | Manidipine dihydrochloride | 89226-75-5 | 1g |
| GC9010-25g | Mannide monooleate, plant origin | 9049-98-3 | 25g |
| GC9010-100g | Mannide monooleate, plant origin | 9049-98-3 | 100g |
| GC9067-5mg | Manninotriose | 13382-86-0 | 5mg |
| GC1530-100mg | Mannose triflate | 92051-23-5 | 100mg |
| GC1530-1g | Mannose triflate | 92051-23-5 | 1g |
| GK1762-25mg | Manool | 596-85-0 | 25mg |
| GK1762-100mg | Manool | 596-85-0 | 100mg |
| GL8712-1mg | Manumycin A | 52665-74-4 | 1mg |
| GL8712-5mg | Manumycin A | 52665-74-4 | 5mg |
| GL8712-10mg | Manumycin A | 52665-74-4 | 10mg |
| GA7050-1mg | Manumycin B | 139023-58-8 | 1mg |
| GA7050-5mg | Manumycin B | 139023-58-8 | 5mg |
| GL9994-500ug | Manzamine A | 104196-68-1 | 500ug |
| GW9765-10mg | MAPTAM | 147504-94-7 | 10mg |
| GW9765-25mg | MAPTAM | 147504-94-7 | 25mg |
| GP7878-5mg | Maraviroc | 376348-65-1 | 5mg |
| GP7878-25mg | Maraviroc | 376348-65-1 | 25mg |
| GA7058-100mg | Marbofloxacin | 115550-35-1 | 100mg |
| GA7058-1g | Marbofloxacin | 115550-35-1 | 1g |
| GA7058-5g | Marbofloxacin | 115550-35-1 | 5g |
| GL7951-1mg | Martinomycin | 160791-16-2 | 1mg |
| GL7951-5mg | Martinomycin | 160791-16-2 | 5mg |
| GL3107-25g | Martius Yellow (C.I. 10315) | 605-69-6 | 25g |
| GL3107-100g | Martius Yellow (C.I. 10315) | 605-69-6 | 100g |
| GW8580-1mg | Masatinib | 790299-79-5 | 1mg |
| GW8580-5mg | Masatinib | 790299-79-5 | 5mg |
| GW8580-10mg | Masatinib | 790299-79-5 | 10mg |
| GL6116-25mg | Maslinic acid | 4373-41-5 | 25mg |
| GP0925-100mg | Matrine | 519-02-8 | 100mg |
| GP0925-250mg | Matrine | 519-02-8 | 250mg |
| GP0925-500mg | Matrine | 519-02-8 | 500mg |
| GT5626-25g | May-Grunwald Stain (powder) | - | 25g |
| GW2485-1mg | MBIMPH | 1392835-53-8 | 1mg |
| GW2485-5mg | MBIMPH | 1392835-53-8 | 5mg |
| GW9422-1mg | MBIMPH F-Analog 1 . hydrochloride | 1mg | |
| GW9422-5mg | MBIMPH F-Analog 1 . hydrochloride | 5mg | |
| GW5526-1mg | MBIMPH F-Analog 2 | 1mg | |
| GW5526-5mg | MBIMPH F-Analog 2 | 5mg | |
| GW9082-1mg | MBP146-78 | 188343-77-3 | 1mg |
| GW9082-5mg | MBP146-78 | 188343-77-3 | 5mg |
| GW9082-10mg | MBP146-78 | 188343-77-3 | 10mg |
| GL1674-1mg | MCC950 sodium salt | 256373-96-3 | 1mg |
| GL1674-5mg | MCC950 sodium salt | 256373-96-3 | 5mg |
| GL1674-10mg | MCC950 sodium salt | 256373-96-3 | 10mg |
| GL1674-50mg | MCC950 sodium salt | 256373-96-3 | 50mg |
| GW0130-50mg | MCPA-thioethyl | 25319-90-8 | 50mg |
| GW0130-500mg | MCPA-thioethyl | 25319-90-8 | 500mg |
| GL0946-10mg | MDL 72527 | 93565-01-6 | 10mg |
| GL4627-5mg | Me6BIO | 667463-95-8 | 5mg |
| GL4627-25mg | Me6BIO | 667463-95-8 | 25mg |
| GL5857-5mg | Me7BIO | 916440-98-7 | 5mg |
| GL5857-25mg | Me7BIO | 916440-98-7 | 25mg |
| GA6625-5g | Mebendazole | 31431-39-7 | 5g |
| GA6625-25g | Mebendazole | 31431-39-7 | 25g |
| GA6807-25mg | Mecillinam | 32887-01-7 | 25mg |
| GA6807-100mg | Mecillinam | 32887-01-7 | 100mg |
| GP5911-500mg | Meclofenamate sodium, USP grade | 6385-02-0 | 500mg |
| GP5911-1g | Meclofenamate sodium, USP grade | 6385-02-0 | 1g |
| GP5911-5g | Meclofenamate sodium, USP grade | 6385-02-0 | 5g |
| GP5911-10g | Meclofenamate sodium, USP grade | 6385-02-0 | 10g |
| GL0681-1g | Meclofenamic acid sodium salt | 6385-02-0 | 1g |
| GL0681-5g | Meclofenamic acid sodium salt | 6385-02-0 | 5g |
| GL0681-10g | Meclofenamic acid sodium salt | 6385-02-0 | 10g |
| GW3464-10mg | Medetomidine HCl | 86347-15-1 | 10mg |
| GW3464-50mg | Medetomidine HCl | 86347-15-1 | 50mg |
| GP1772-1g | Medroxyprogesterone-17-acetate | 71-58-9 | 1g |
| GP1772-5g | Medroxyprogesterone-17-acetate | 71-58-9 | 5g |
| GP1772-10g | Medroxyprogesterone-17-acetate | 71-58-9 | 10g |
| GP1772-25g | Medroxyprogesterone-17-acetate | 71-58-9 | 25g |
| GP6603-100g | Mefenamic acid | 61-68-7 | 100g |
| GP6603-250g | Mefenamic acid | 61-68-7 | 250g |
| GC0454-1mg | Mefenamic acid acyl-β-D-glucuronide | 102623-18-7 | 1mg |
| GC0454-2mg | Mefenamic acid acyl-β-D-glucuronide | 102623-18-7 | 2mg |
| GC0454-5mg | Mefenamic acid acyl-β-D-glucuronide | 102623-18-7 | 5mg |
| GC0454-10mg | Mefenamic acid acyl-β-D-glucuronide | 102623-18-7 | 10mg |
| GP7880-100mg | Mefloquine hydrochloride | 51773-92-3 | 100mg |
| GP7880-250mg | Mefloquine hydrochloride | 51773-92-3 | 250mg |
| GP7880-1g | Mefloquine hydrochloride | 51773-92-3 | 1g |
| GP0681-1g | Mefloquine hydrochloride, BP, Ph. Eur., USP grade | 51773-92-3 | 1g |
| GW8894-50mg | Mefluidide | 53780-34-0 | 50mg |
| GW8894-500mg | Mefluidide | 53780-34-0 | 500mg |
| GP9359-1g | Megestrol acetate | 595-33-5 | 1g |
| GP9359-5g | Megestrol acetate | 595-33-5 | 5g |
| GK4761-250mg | Melanin | 8049-97-6 | 250mg |
| GK4761-1g | Melanin | 8049-97-6 | 1g |
| GP8408-250mg | Melatonin | 73-31-4 | 250mg |
| GP8408-1g | Melatonin | 73-31-4 | 1g |
| GT0259-10g | Meldola's blue | 7057-57-0 | 10g |
| GT0259-25g | Meldola's blue | 7057-57-0 | 25g |
| GT0259-50g | Meldola's blue | 7057-57-0 | 50g |
| GA3853-1mg | Meleagrin | 71751-77-4 | 1mg |
| GK3910-1mg | Melittin | 20449-79-0 | 1mg |
| GK3910-5mg | Melittin | 20449-79-0 | 5mg |
| GP4959-5g | Meloxicam | 71125-38-7 | 5g |
| GP4959-25g | Meloxicam | 71125-38-7 | 25g |
| GP0943-50mg | Melphalan | 148-82-3 | 50mg |
| GP0943-100mg | Melphalan | 148-82-3 | 100mg |
| GP0943-250mg | Melphalan | 148-82-3 | 250mg |
| GP0943-500mg | Melphalan | 148-82-3 | 500mg |
| GP0943-1g | Melphalan | 148-82-3 | 1g |
| GP3789-100mg | Melphalan, USP grade | 148-82-3 | 100mg |
| GP3789-250mg | Melphalan, USP grade | 148-82-3 | 250mg |
| GP3789-1g | Melphalan, USP grade | 148-82-3 | 1g |
| GP8214-25mg | Memantine hydrochloride | 41100-52-1 | 25mg |
| GP8214-100mg | Memantine hydrochloride | 41100-52-1 | 100mg |
| GC5534-5mg | Memantine lactose adduct | 1159637-28-1 | 5mg |
| GC5534-10mg | Memantine lactose adduct | 1159637-28-1 | 10mg |
| GC5534-25mg | Memantine lactose adduct | 1159637-28-1 | 25mg |
| GC5534-50mg | Memantine lactose adduct | 1159637-28-1 | 50mg |
| GC5534-100mg | Memantine lactose adduct | 1159637-28-1 | 100mg |
| GC4334-5mg | Memantine N-β-D-glucuronide | 1809031-06-8 | 5mg |
| GC4334-25mg | Memantine N-β-D-glucuronide | 1809031-06-8 | 25mg |
| GC4334-10mg | Memantine N-β-D-glucuronide | 1809031-06-8 | 10mg |
| GC4334-50mg | Memantine N-β-D-glucuronide | 1809031-06-8 | 50mg |
| GK8847-1mg | MEN-10,376 | 135306-85-3 | 1mg |
| GA0934-25g | Menadione sodium bisulfite | 130-37-0 | 25g |
| GA0934-100g | Menadione sodium bisulfite | 130-37-0 | 100g |
| GL6920-1mg | Mensacarcin | 808750-39-2 | 1mg |
| GL6920-5mg | Mensacarcin | 808750-39-2 | 5mg |
| GL1129-50mg | Mephenytoin | 50-12-4 | 50mg |
| GL1129-250mg | Mephenytoin | 50-12-4 | 250mg |
| GP8247-1g | Mepivacaine hydrochloride | 1722-62-9 | 1g |
| GP8247-5g | Mepivacaine hydrochloride | 1722-62-9 | 5g |
| GW4610-25mg | Meptyldinocap | 131-72-6 | 25mg |
| GP4255-1g | Mequitazine | 29216-28-2 | 1g |
| GP4255-5g | Mequitazine | 29216-28-2 | 5g |
| GW6872-5mg | Merafloxacin | 91188-00-0 | 5mg |
| GW6872-25mg | Merafloxacin | 91188-00-0 | 25mg |
| GY5847-1mg | Meranzin | 23971-42-8 | 1mg |
| GL6500-1mg | Meranzin hydrate | 5875-49-0 | 1mg |
| GK8337-25g | Mercaptosuccinic acid | 70-49-5 | 25g |
| GK8337-100g | Mercaptosuccinic acid | 70-49-5 | 100g |
| GK8337-250g | Mercaptosuccinic acid | 70-49-5 | 250g |
| GK8337-500g | Mercaptosuccinic acid | 70-49-5 | 500g |
| GW2210-1mg | Merck-5 | 457081-03-7 | 1mg |
| GW2210-5mg | Merck-5 | 457081-03-7 | 5mg |
| GW2210-10mg | Merck-5 | 457081-03-7 | 10mg |
| GX3557-100g | Mercury(II) acetate, 98.5+% | 1600-27-7 | 100g |
| GX7412-100g | Mercury(II) oxide, yellow, 99+% | 21908-53-2 | 100g |
| GW5978-100mg | Merocyanin 540 | 62796-23-0 | 100mg |
| GW5978-500mg | Merocyanin 540 | 62796-23-0 | 500mg |
| GP7412-100mg | Meropenem trihydrate | 119478-56-7 | 100mg |
| GP7412-500mg | Meropenem trihydrate | 119478-56-7 | 500mg |
| GP7412-1g | Meropenem trihydrate | 119478-56-7 | 1g |
| GB1243-25g | MES | 4432-31-9 | 25g |
| GB1243-100g | MES | 4432-31-9 | 100g |
| GB1243-250g | MES | 4432-31-9 | 250g |
| GB1243-500g | MES | 4432-31-9 | 500g |
| GB1243-1kg | MES | 4432-31-9 | 1kg |
| GB7345-25g | MES hemisodium salt | 117961-21-4 | 25g |
| GB7345-100g | MES hemisodium salt | 117961-21-4 | 100g |
| GB1307-10g | MES monohydrate | 145224-94-8 | 10g |
| GB1307-25g | MES monohydrate | 145224-94-8 | 25g |
| GB1307-100g | MES monohydrate | 145224-94-8 | 100g |
| GB1307-250g | MES monohydrate | 145224-94-8 | 250g |
| GB1307-500g | MES monohydrate | 145224-94-8 | 500g |
| GB6040-25g | MES potassium salt | 39946-25-3 | 25g |
| GB6040-100g | MES potassium salt | 39946-25-3 | 100g |
| GB1926-10g | MES sodium salt | 71119-23-8 | 10g |
| GB1926-25g | MES sodium salt | 71119-23-8 | 25g |
| GB1926-100g | MES sodium salt | 71119-23-8 | 100g |
| GB1926-250g | MES sodium salt | 71119-23-8 | 250g |
| GB1926-500g | MES sodium salt | 71119-23-8 | 500g |
| GE5702-250ml | MES, 1M solution | 4432-31-9 | 250ml |
| GE5702-1l | MES, 1M solution | 4432-31-9 | 1l |
| GP4428-10g | Mesna | 19767-45-4 | 10g |
| GP4428-25g | Mesna | 19767-45-4 | 25g |
| GC1722-25g | meso-Erythritol | 149-32-6 | 25g |
| GC1722-100g | meso-Erythritol | 149-32-6 | 100g |
| GC1722-250g | meso-Erythritol | 149-32-6 | 250g |
| GC1722-500g | meso-Erythritol | 149-32-6 | 500g |
| GW5398-25mg | meso-Tetraphenyl-tetrabenzoporphine palladium complex | 119654-64-7 | 25mg |
| GW5398-250mg | meso-Tetraphenyl-tetrabenzoporphine palladium complex | 119654-64-7 | 250mg |
| GL5207-10mg | Mesoridazine benzenesulfonate | 32672-69-8 | 10mg |
| GW3908-50mg | Mesuximide | 77-41-8 | 50mg |
| GW3908-100mg | Mesuximide | 77-41-8 | 100mg |
| GE4337-250mg | meta-Topolin | 75737-38-1 | 250mg |
| GE4337-1g | meta-Topolin | 75737-38-1 | 1g |
| GE4311-1g | meta-Topolin riboside | 110505-76-5 | 1g |
| GK9681-1g | Metamifop | 256412-89-2 | 1g |
| GW9256-100mg | Metamitron | 41394-05-2 | 100mg |
| GT1665-50g | Metanil Yellow (C.I. 13065) | 587-98-4 | 50g |
| GT1665-100g | Metanil Yellow (C.I. 13065) | 587-98-4 | 100g |
| GT1665-250g | Metanil Yellow (C.I. 13065) | 587-98-4 | 250g |
| GP2747-5g | Metformin hydrochloride | 1115-70-4 | 5g |
| GP2747-25g | Metformin hydrochloride | 1115-70-4 | 25g |
| GK8835-25g | Methanesulfonic acid | 75-75-2 | 25g |
| GX5097-500ml | Methanol | 67-56-1 | 500ml |
| GX5097-1l | Methanol | 67-56-1 | 1l |
| GS3517-500ml | Methanol 205, GlenPure™, analytical grade gradient quality | 67-56-1 | 500ml |
| GS3517-1l | Methanol 205, GlenPure™, analytical grade gradient quality | 67-56-1 | 1l |
| GS3517-2500ml | Methanol 205, GlenPure™, analytical grade gradient quality | 67-56-1 | 2500ml |
| GS8324-500ml | Methanol 215, GlenPure™, analytical grade | 67-56-1 | 500ml |
| GS8324-1l | Methanol 215, GlenPure™, analytical grade | 67-56-1 | 1l |
| GS8324-2500ml | Methanol 215, GlenPure™, analytical grade | 67-56-1 | 2500ml |
| GS3434-500ml | Methanol 225, GlenPure™, analytical grade | 67-56-1 | 500ml |
| GS3434-1l | Methanol 225, GlenPure™, analytical grade | 67-56-1 | 1l |
| GS3434-2500ml | Methanol 225, GlenPure™, analytical grade | 67-56-1 | 2500ml |
| GS7398-500ml | Methanol, for HPLC, gradient grade, 99.9% | 67-56-1 | 500ml |
| GS7398-1l | Methanol, for HPLC, gradient grade, 99.9% | 67-56-1 | 1l |
| GS7398-2500ml | Methanol, for HPLC, gradient grade, 99.9% | 67-56-1 | 2500ml |
| GS1617-100ml | Methanol, GlenDry™, anhydrous | 67-56-1 | 100ml |
| GS1617-500ml | Methanol, GlenDry™, anhydrous | 67-56-1 | 500ml |
| GS1617-1l | Methanol, GlenDry™, anhydrous | 67-56-1 | 1l |
| GS1617-2500ml | Methanol, GlenDry™, anhydrous | 67-56-1 | 2500ml |
| GS1114-100ml | Methanol, GlenDry™, anhydrous over molecular sieve | 67-56-1 | 100ml |
| GS1114-500ml | Methanol, GlenDry™, anhydrous over molecular sieve | 67-56-1 | 500ml |
| GS1114-1l | Methanol, GlenDry™, anhydrous over molecular sieve | 67-56-1 | 1l |
| GS1114-2500ml | Methanol, GlenDry™, anhydrous over molecular sieve | 67-56-1 | 2500ml |
| GS0087-2500ml | Methanol, GlenUltra™, analytical grade, for GC | 67-56-1 | 2500ml |
| GS0625-1l | Methanol, GlenUltra™, analytical grade, for LC | 67-56-1 | 1l |
| GS0625-2500ml | Methanol, GlenUltra™, analytical grade, for LC | 67-56-1 | 2500ml |
| GW8008-25mg | Methasulfocarb | 66952-49-6 | 25mg |
| GP2312-5g | Methimazole | 60-56-0 | 5g |
| GP2312-25g | Methimazole | 60-56-0 | 25g |
| GP1945-25g | Methocarbamol | 532-03-6 | 25g |
| GA6211-1g | Methotrexate hydrate | 133073-73-1 | 1g |
| GA6211-5g | Methotrexate hydrate | 133073-73-1 | 5g |
| GW4017-100mg | Methoxyfenozide | 161050-58-4 | 100mg |
| GW4017-1g | Methoxyfenozide | 161050-58-4 | 1g |
| GK7979-25g | Methoxymethyl triphenylphosphonium chloride | 4009-98-7 | 25g |
| GD3605-100g | Methoxypolyethylene glycol 500 | 9004-74-4 | 100g |
| GD3605-500g | Methoxypolyethylene glycol 500 | 9004-74-4 | 500g |
| GC7370-25mg | Methyl 1,2,3,4-Tetra-O-acetyl-α-L-idopyranuronate | 108032-41-3 | 25mg |
| GC7370-50mg | Methyl 1,2,3,4-Tetra-O-acetyl-α-L-idopyranuronate | 108032-41-3 | 50mg |
| GC7370-100mg | Methyl 1,2,3,4-Tetra-O-acetyl-α-L-idopyranuronate | 108032-41-3 | 100mg |
| GC7370-250mg | Methyl 1,2,3,4-Tetra-O-acetyl-α-L-idopyranuronate | 108032-41-3 | 250mg |
| GC6266-10g | Methyl 1,2,3,4-tetra-O-acetyl-β-D-glucuronate | 7355-18-2 | 10g |
| GC6266-25g | Methyl 1,2,3,4-tetra-O-acetyl-β-D-glucuronate | 7355-18-2 | 25g |
| GC6266-50g | Methyl 1,2,3,4-tetra-O-acetyl-β-D-glucuronate | 7355-18-2 | 50g |
| GC6266-100g | Methyl 1,2,3,4-tetra-O-acetyl-β-D-glucuronate | 7355-18-2 | 100g |
| GC1352-500mg | Methyl 2-acetamido-3-O-acetyl-4,6-O-benzylidene-2-deoxy-α-D-glucopyranoside | 6748-94-3 | 500mg |
| GC1352-1g | Methyl 2-acetamido-3-O-acetyl-4,6-O-benzylidene-2-deoxy-α-D-glucopyranoside | 6748-94-3 | 1g |
| GC1352-2g | Methyl 2-acetamido-3-O-acetyl-4,6-O-benzylidene-2-deoxy-α-D-glucopyranoside | 6748-94-3 | 2g |
| GC1352-5g | Methyl 2-acetamido-3-O-acetyl-4,6-O-benzylidene-2-deoxy-α-D-glucopyranoside | 6748-94-3 | 5g |
| GC8983-100mg | Methyl 2-acetamido-3-O-benzyl-2-deoxy-α-D-glucopyranoside | 69892-44-0 | 100mg |
| GC8983-250mg | Methyl 2-acetamido-3-O-benzyl-2-deoxy-α-D-glucopyranoside | 69892-44-0 | 250mg |
| GC8983-500mg | Methyl 2-acetamido-3-O-benzyl-2-deoxy-α-D-glucopyranoside | 69892-44-0 | 500mg |
| GC8983-1g | Methyl 2-acetamido-3-O-benzyl-2-deoxy-α-D-glucopyranoside | 69892-44-0 | 1g |
| GC8446-1g | Methyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-α-D-glucopyranoside | 2595-39-3 | 1g |
| GC8446-2g | Methyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-α-D-glucopyranoside | 2595-39-3 | 2g |
| GC8446-5g | Methyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-α-D-glucopyranoside | 2595-39-3 | 5g |
| GC8446-10g | Methyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-α-D-glucopyranoside | 2595-39-3 | 10g |
| GC1837-250mg | Methyl 2-acetamido-3,6-di-O-acetyl-2-deoxy-α-D-glucopyranoside | 73139-57-8 | 250mg |
| GC1837-500mg | Methyl 2-acetamido-3,6-di-O-acetyl-2-deoxy-α-D-glucopyranoside | 73139-57-8 | 500mg |
| GC1837-1g | Methyl 2-acetamido-3,6-di-O-acetyl-2-deoxy-α-D-glucopyranoside | 73139-57-8 | 1g |
| GC1837-2g | Methyl 2-acetamido-3,6-di-O-acetyl-2-deoxy-α-D-glucopyranoside | 73139-57-8 | 2g |
| GC7980-1g | Methyl 2-acetamido-4,6-O-benzylidene-2-deoxy-α-D-glucopyranoside | 6619-04-1 | 1g |
| GC7980-2g | Methyl 2-acetamido-4,6-O-benzylidene-2-deoxy-α-D-glucopyranoside | 6619-04-1 | 2g |
| GC7980-5g | Methyl 2-acetamido-4,6-O-benzylidene-2-deoxy-α-D-glucopyranoside | 6619-04-1 | 5g |
| GC7980-10g | Methyl 2-acetamido-4,6-O-benzylidene-2-deoxy-α-D-glucopyranoside | 6619-04-1 | 10g |
| GK7282-25g | Methyl 2-aminobenzoate | 134-20-3 | 25g |
| GC4706-50mg | Methyl 2-deoxy-2-fluoro-L-arabinofuranoside | 442514-57-0 | 50mg |
| GC4706-100mg | Methyl 2-deoxy-2-fluoro-L-arabinofuranoside | 442514-57-0 | 100mg |
| GC4706-250mg | Methyl 2-deoxy-2-fluoro-L-arabinofuranoside | 442514-57-0 | 250mg |
| GC4706-500mg | Methyl 2-deoxy-2-fluoro-L-arabinofuranoside | 442514-57-0 | 500mg |
| GC6148-1g | Methyl 2-deoxy-3,5-di-O-benzoyl-D-ribofuranoside | 108647-88-7 | 1g |
| GC6148-2g | Methyl 2-deoxy-3,5-di-O-benzoyl-D-ribofuranoside | 108647-88-7 | 2g |
| GC6148-5g | Methyl 2-deoxy-3,5-di-O-benzoyl-D-ribofuranoside | 108647-88-7 | 5g |
| GC6148-10g | Methyl 2-deoxy-3,5-di-O-benzoyl-D-ribofuranoside | 108647-88-7 | 10g |
| GC9261-1mg | Methyl 2,2'',2'''',3,3'',3''''-hexa-O-acetyl-6,6'',6''''-trideoxy-6,6'',6''''-triiodo-β-D-cellotrioside | 1mg | |
| GC9261-2mg | Methyl 2,2'',2'''',3,3'',3''''-hexa-O-acetyl-6,6'',6''''-trideoxy-6,6'',6''''-triiodo-β-D-cellotrioside | 2mg | |
| GC9261-5mg | Methyl 2,2'',2'''',3,3'',3''''-hexa-O-acetyl-6,6'',6''''-trideoxy-6,6'',6''''-triiodo-β-D-cellotrioside | 5mg | |
| GC9261-10mg | Methyl 2,2'',2'''',3,3'',3''''-hexa-O-acetyl-6,6'',6''''-trideoxy-6,6'',6''''-triiodo-β-D-cellotrioside | 10mg | |
| GC2948-500mg | Methyl 2,2'',3,3'',4'',6,6''-hepta-O-acetyl-β-D-maltoside | 13223-83-1 | 500mg |
| GC2948-1g | Methyl 2,2'',3,3'',4'',6,6''-hepta-O-acetyl-β-D-maltoside | 13223-83-1 | 1g |
| GC2948-2g | Methyl 2,2'',3,3'',4'',6,6''-hepta-O-acetyl-β-D-maltoside | 13223-83-1 | 2g |
| GC2948-5g | Methyl 2,2'',3,3'',4'',6,6''-hepta-O-acetyl-β-D-maltoside | 13223-83-1 | 5g |
| GC6876-1g | Methyl 2,2'',3,3'',4'',6,6''-hepta-O-benzyl-α-D-maltoside | 64694-18-4 | 1g |
| GC6876-2g | Methyl 2,2'',3,3'',4'',6,6''-hepta-O-benzyl-α-D-maltoside | 64694-18-4 | 2g |
| GC6876-5g | Methyl 2,2'',3,3'',4'',6,6''-hepta-O-benzyl-α-D-maltoside | 64694-18-4 | 5g |
| GC6876-10g | Methyl 2,2'',3,3'',4'',6,6''-hepta-O-benzyl-α-D-maltoside | 64694-18-4 | 10g |
| GC2265-50mg | Methyl 2,2'',3,3'',4'',6''-hexa-O-acetyl-6-O-benzyl-β-D-cellobioside | 50mg | |
| GC2265-100mg | Methyl 2,2'',3,3'',4'',6''-hexa-O-acetyl-6-O-benzyl-β-D-cellobioside | 100mg | |
| GC2265-250mg | Methyl 2,2'',3,3'',4'',6''-hexa-O-acetyl-6-O-benzyl-β-D-cellobioside | 250mg | |
| GC2265-500mg | Methyl 2,2'',3,3'',4'',6''-hexa-O-acetyl-6-O-benzyl-β-D-cellobioside | 500mg | |
| GC3853-50mg | Methyl 2,3-anhydro-b-D-ribopyranoside | 3150-13-8 | 50mg |
| GC3853-100mg | Methyl 2,3-anhydro-b-D-ribopyranoside | 3150-13-8 | 100mg |
| GC3853-250mg | Methyl 2,3-anhydro-b-D-ribopyranoside | 3150-13-8 | 250mg |
| GC3853-500mg | Methyl 2,3-anhydro-b-D-ribopyranoside | 3150-13-8 | 500mg |
| GC5077-1g | Methyl 2,3-di-O-acetyl-4,6-O-benzylidene-a-D-glucopyranoside | 4141-45-1 | 1g |
| GC5077-2g | Methyl 2,3-di-O-acetyl-4,6-O-benzylidene-a-D-glucopyranoside | 4141-45-1 | 2g |
| GC5077-5g | Methyl 2,3-di-O-acetyl-4,6-O-benzylidene-a-D-glucopyranoside | 4141-45-1 | 5g |
| GC5077-10g | Methyl 2,3-di-O-acetyl-4,6-O-benzylidene-a-D-glucopyranoside | 4141-45-1 | 10g |
| GC8840-1g | Methyl 2,3-di-O-acetyl-4,6-O-benzylidene-β-D-glucopyranoside | 20750-01-0 | 1g |
| GC8840-2g | Methyl 2,3-di-O-acetyl-4,6-O-benzylidene-β-D-glucopyranoside | 20750-01-0 | 2g |
| GC8840-5g | Methyl 2,3-di-O-acetyl-4,6-O-benzylidene-β-D-glucopyranoside | 20750-01-0 | 5g |
| GC8840-10g | Methyl 2,3-di-O-acetyl-4,6-O-benzylidene-β-D-glucopyranoside | 20750-01-0 | 10g |
| GC7059-1g | Methyl 2,3-di-O-acetyl-α-D-glucopyranoside | 29868-42-6 | 1g |
| GC7059-2g | Methyl 2,3-di-O-acetyl-α-D-glucopyranoside | 29868-42-6 | 2g |
| GC7059-5g | Methyl 2,3-di-O-acetyl-α-D-glucopyranoside | 29868-42-6 | 5g |
| GC7059-10g | Methyl 2,3-di-O-acetyl-α-D-glucopyranoside | 29868-42-6 | 10g |
| GC8809-1g | Methyl 2,3-di-O-benzyl-4,6-O-benzylidene-β-D-glucopyranoside | 13035-24-0 | 1g |
| GC8809-2g | Methyl 2,3-di-O-benzyl-4,6-O-benzylidene-β-D-glucopyranoside | 13035-24-0 | 2g |
| GC8809-5g | Methyl 2,3-di-O-benzyl-4,6-O-benzylidene-β-D-glucopyranoside | 13035-24-0 | 5g |
| GC8809-10g | Methyl 2,3-di-O-benzyl-4,6-O-benzylidene-β-D-glucopyranoside | 13035-24-0 | 10g |
| GC8809-25g | Methyl 2,3-di-O-benzyl-4,6-O-benzylidene-β-D-glucopyranoside | 13035-24-0 | 25g |
| GC2185-250mg | Methyl 2,3-di-O-benzyl-a-D-glucopyranoside | 17791-36-5 | 250mg |
| GC2185-500mg | Methyl 2,3-di-O-benzyl-a-D-glucopyranoside | 17791-36-5 | 500mg |
| GC2185-1g | Methyl 2,3-di-O-benzyl-a-D-glucopyranoside | 17791-36-5 | 1g |
| GC2185-2g | Methyl 2,3-di-O-benzyl-a-D-glucopyranoside | 17791-36-5 | 2g |
| GC2559-2g | Methyl 2,3-O-isopropylidene-5-O-(p-tolylsulfonyl)-β-D-ribofuranoside | 4137-56-8 | 2g |
| GC2559-5g | Methyl 2,3-O-isopropylidene-5-O-(p-tolylsulfonyl)-β-D-ribofuranoside | 4137-56-8 | 5g |
| GC2559-10g | Methyl 2,3-O-isopropylidene-5-O-(p-tolylsulfonyl)-β-D-ribofuranoside | 4137-56-8 | 10g |
| GC2559-25g | Methyl 2,3-O-isopropylidene-5-O-(p-tolylsulfonyl)-β-D-ribofuranoside | 4137-56-8 | 25g |
| GC4596-100mg | Methyl 2,3-O-isopropylidene-6-O-tosyl-α-D-mannofuranoside | 40789-24-0 | 100mg |
| GC4596-250mg | Methyl 2,3-O-isopropylidene-6-O-tosyl-α-D-mannofuranoside | 40789-24-0 | 250mg |
| GC4596-500mg | Methyl 2,3-O-isopropylidene-6-O-tosyl-α-D-mannofuranoside | 40789-24-0 | 500mg |
| GC4596-1g | Methyl 2,3-O-isopropylidene-6-O-tosyl-α-D-mannofuranoside | 40789-24-0 | 1g |
| GC1216-100mg | Methyl 2,3-O-isopropylidene-α-L-lyxofuranoside | 5531-21-5 | 100mg |
| GC1216-250mg | Methyl 2,3-O-isopropylidene-α-L-lyxofuranoside | 5531-21-5 | 250mg |
| GC1216-500mg | Methyl 2,3-O-isopropylidene-α-L-lyxofuranoside | 5531-21-5 | 500mg |
| GC1216-1g | Methyl 2,3-O-isopropylidene-α-L-lyxofuranoside | 5531-21-5 | 1g |
| GC3492-10g | Methyl 2,3-O-Isopropylidene-β-D-ribofuranoside | 4099-85-8 | 10g |
| GC3492-25g | Methyl 2,3-O-Isopropylidene-β-D-ribofuranoside | 4099-85-8 | 25g |
| GC3492-50g | Methyl 2,3-O-Isopropylidene-β-D-ribofuranoside | 4099-85-8 | 50g |
| GC3492-100g | Methyl 2,3-O-Isopropylidene-β-D-ribofuranoside | 4099-85-8 | 100g |
| GC3555-500mg | Methyl 2,3,4-tri-O-acetyl-6-azido-6-deoxy-α-D-glucopyranoside | 21893-05-0 | 500mg |
| GC3555-1g | Methyl 2,3,4-tri-O-acetyl-6-azido-6-deoxy-α-D-glucopyranoside | 21893-05-0 | 1g |
| GC3555-2g | Methyl 2,3,4-tri-O-acetyl-6-azido-6-deoxy-α-D-glucopyranoside | 21893-05-0 | 2g |
| GC3555-5g | Methyl 2,3,4-tri-O-acetyl-6-azido-6-deoxy-α-D-glucopyranoside | 21893-05-0 | 5g |
| GC5177-1g | Methyl 2,3,4-tri-O-acetyl-6-deoxy-6-iodo-α-D-glucopyranoside | 6304-96-7 | 1g |
| GC5177-2g | Methyl 2,3,4-tri-O-acetyl-6-deoxy-6-iodo-α-D-glucopyranoside | 6304-96-7 | 2g |
| GC5177-5g | Methyl 2,3,4-tri-O-acetyl-6-deoxy-6-iodo-α-D-glucopyranoside | 6304-96-7 | 5g |
| GC5177-10g | Methyl 2,3,4-tri-O-acetyl-6-deoxy-6-iodo-α-D-glucopyranoside | 6304-96-7 | 10g |
| GC8150-500mg | Methyl 2,3,4-tri-O-acetyl-6-deoxy-6-iodo-β-D-glucopyranoside | 7511-38-8 | 500mg |
| GC8150-1g | Methyl 2,3,4-tri-O-acetyl-6-deoxy-6-iodo-β-D-glucopyranoside | 7511-38-8 | 1g |
| GC8150-2g | Methyl 2,3,4-tri-O-acetyl-6-deoxy-6-iodo-β-D-glucopyranoside | 7511-38-8 | 2g |
| GC8150-5g | Methyl 2,3,4-tri-O-acetyl-6-deoxy-6-iodo-β-D-glucopyranoside | 7511-38-8 | 5g |
| GC6280-1g | Methyl 2,3,4-tri-O-acetyl-6-deoxy-α-D-glucopyranoside | 19940-17-1 | 1g |
| GC6280-2g | Methyl 2,3,4-tri-O-acetyl-6-deoxy-α-D-glucopyranoside | 19940-17-1 | 2g |
| GC6280-5g | Methyl 2,3,4-tri-O-acetyl-6-deoxy-α-D-glucopyranoside | 19940-17-1 | 5g |
| GC6280-10g | Methyl 2,3,4-tri-O-acetyl-6-deoxy-α-D-glucopyranoside | 19940-17-1 | 10g |
| GC6447-100mg | Methyl 2,3,4-tri-O-acetyl-b-D-glucopyranuronosyl azide | 67776-38-9 | 100mg |
| GC6447-250mg | Methyl 2,3,4-tri-O-acetyl-b-D-glucopyranuronosyl azide | 67776-38-9 | 250mg |
| GC6447-500mg | Methyl 2,3,4-tri-O-acetyl-b-D-glucopyranuronosyl azide | 67776-38-9 | 500mg |
| GC6447-1g | Methyl 2,3,4-tri-O-acetyl-b-D-glucopyranuronosyl azide | 67776-38-9 | 1g |
| GC6447-2g | Methyl 2,3,4-tri-O-acetyl-b-D-glucopyranuronosyl azide | 67776-38-9 | 2g |
| GC6267-250mg | Methyl 2,3,4-tri-O-acetyl-β-D-galactopyranoside | 38982-58-0 | 250mg |
| GC6267-500mg | Methyl 2,3,4-tri-O-acetyl-β-D-galactopyranoside | 38982-58-0 | 500mg |
| GC6267-1g | Methyl 2,3,4-tri-O-acetyl-β-D-galactopyranoside | 38982-58-0 | 1g |
| GC6267-2g | Methyl 2,3,4-tri-O-acetyl-β-D-galactopyranoside | 38982-58-0 | 2g |
| GC7322-50mg | Methyl 2,3,4-tri-O-benzyl-α-D-glucuronide benzyl ester | 142797-33-9 | 50mg |
| GC7322-100mg | Methyl 2,3,4-tri-O-benzyl-α-D-glucuronide benzyl ester | 142797-33-9 | 100mg |
| GC7322-250mg | Methyl 2,3,4-tri-O-benzyl-α-D-glucuronide benzyl ester | 142797-33-9 | 250mg |
| GC7322-500mg | Methyl 2,3,4-tri-O-benzyl-α-D-glucuronide benzyl ester | 142797-33-9 | 500mg |
| GC5294-250mg | Methyl 2,3,4-Tri-O-benzyl-β-D-xylopyranoside | 20787-15-9 | 250mg |
| GC5294-500mg | Methyl 2,3,4-Tri-O-benzyl-β-D-xylopyranoside | 20787-15-9 | 500mg |
| GC5294-1g | Methyl 2,3,4-Tri-O-benzyl-β-D-xylopyranoside | 20787-15-9 | 1g |
| GC5294-2g | Methyl 2,3,4-Tri-O-benzyl-β-D-xylopyranoside | 20787-15-9 | 2g |
| GC5294-5g | Methyl 2,3,4-Tri-O-benzyl-β-D-xylopyranoside | 20787-15-9 | 5g |
| GC4282-100mg | Methyl 2,3,4-Tri-O-isobutyryl-1-O-trichloroacetimidoyl-α-D-glucopyranuronate | 150607-96-8 | 100mg |
| GC4282-250mg | Methyl 2,3,4-Tri-O-isobutyryl-1-O-trichloroacetimidoyl-α-D-glucopyranuronate | 150607-96-8 | 250mg |
| GC4282-500mg | Methyl 2,3,4-Tri-O-isobutyryl-1-O-trichloroacetimidoyl-α-D-glucopyranuronate | 150607-96-8 | 500mg |
| GC4282-1g | Methyl 2,3,4-Tri-O-isobutyryl-1-O-trichloroacetimidoyl-α-D-glucopyranuronate | 150607-96-8 | 1g |
| GC8388-2g | Methyl 2,3,4,6-Tetra-O-benzyl-α-D-glucopyranoside | 17791-37-6 | 2g |
| GC8388-5g | Methyl 2,3,4,6-Tetra-O-benzyl-α-D-glucopyranoside | 17791-37-6 | 5g |
| GC8388-10g | Methyl 2,3,4,6-Tetra-O-benzyl-α-D-glucopyranoside | 17791-37-6 | 10g |
| GC8388-25g | Methyl 2,3,4,6-Tetra-O-benzyl-α-D-glucopyranoside | 17791-37-6 | 25g |
| GC8388-50g | Methyl 2,3,4,6-Tetra-O-benzyl-α-D-glucopyranoside | 17791-37-6 | 50g |
| GC5444-1g | Methyl 2,3,4,6-Tetra-O-benzyl-α-D-mannopyranoside | 61330-62-9 | 1g |
| GC5444-2g | Methyl 2,3,4,6-Tetra-O-benzyl-α-D-mannopyranoside | 61330-62-9 | 2g |
| GC5444-5g | Methyl 2,3,4,6-Tetra-O-benzyl-α-D-mannopyranoside | 61330-62-9 | 5g |
| GC5444-10g | Methyl 2,3,4,6-Tetra-O-benzyl-α-D-mannopyranoside | 61330-62-9 | 10g |
| GC5444-25g | Methyl 2,3,4,6-Tetra-O-benzyl-α-D-mannopyranoside | 61330-62-9 | 25g |
| GC7271-250mg | Methyl 2,3,6-tri-O-acetyl-a-D-glucopyranoside | 18031-51-1 | 250mg |
| GC7271-500mg | Methyl 2,3,6-tri-O-acetyl-a-D-glucopyranoside | 18031-51-1 | 500mg |
| GC7271-1g | Methyl 2,3,6-tri-O-acetyl-a-D-glucopyranoside | 18031-51-1 | 1g |
| GC7271-2g | Methyl 2,3,6-tri-O-acetyl-a-D-glucopyranoside | 18031-51-1 | 2g |
| GC6980-500mg | Methyl 2,3,6-tri-O-acetyl-β-D-glucopyranoside | 31873-37-7 | 500mg |
| GC6980-1g | Methyl 2,3,6-tri-O-acetyl-β-D-glucopyranoside | 31873-37-7 | 1g |
| GC6980-2g | Methyl 2,3,6-tri-O-acetyl-β-D-glucopyranoside | 31873-37-7 | 2g |
| GC6980-5g | Methyl 2,3,6-tri-O-acetyl-β-D-glucopyranoside | 31873-37-7 | 5g |
| GC3052-10g | Methyl 2,3,6-Tri-O-benzoyl-α-D-galactopyranoside | 3601-36-3 | 10g |
| GC3052-25g | Methyl 2,3,6-Tri-O-benzoyl-α-D-galactopyranoside | 3601-36-3 | 25g |
| GC3052-50g | Methyl 2,3,6-Tri-O-benzoyl-α-D-galactopyranoside | 3601-36-3 | 50g |
| GC3052-100g | Methyl 2,3,6-Tri-O-benzoyl-α-D-galactopyranoside | 3601-36-3 | 100g |
| GC9026-250mg | Methyl 2,3,6-tri-O-benzyl-b-D-glucopyranoside | 19488-49-4 | 250mg |
| GC9026-500mg | Methyl 2,3,6-tri-O-benzyl-b-D-glucopyranoside | 19488-49-4 | 500mg |
| GC9026-1g | Methyl 2,3,6-tri-O-benzyl-b-D-glucopyranoside | 19488-49-4 | 1g |
| GC9026-2g | Methyl 2,3,6-tri-O-benzyl-b-D-glucopyranoside | 19488-49-4 | 2g |
| GC9026-5g | Methyl 2,3,6-tri-O-benzyl-b-D-glucopyranoside | 19488-49-4 | 5g |
| GC9612-500mg | Methyl 2,3:4,6-di-O-isopropylidene-α-D-mannopyranoside | 50705-56-1 | 500mg |
| GC9612-1g | Methyl 2,3:4,6-di-O-isopropylidene-α-D-mannopyranoside | 50705-56-1 | 1g |
| GC9612-2g | Methyl 2,3:4,6-di-O-isopropylidene-α-D-mannopyranoside | 50705-56-1 | 2g |
| GC9612-5g | Methyl 2,3:4,6-di-O-isopropylidene-α-D-mannopyranoside | 50705-56-1 | 5g |
| GC7559-500mg | Methyl 2,3:5,6-di-O-isopropylidene-α-D-mannofuranoside | 26255-73-2 | 500mg |
| GC7559-1g | Methyl 2,3:5,6-di-O-isopropylidene-α-D-mannofuranoside | 26255-73-2 | 1g |
| GC7559-2g | Methyl 2,3:5,6-di-O-isopropylidene-α-D-mannofuranoside | 26255-73-2 | 2g |
| GC7559-5g | Methyl 2,3:5,6-di-O-isopropylidene-α-D-mannofuranoside | 26255-73-2 | 5g |
| GC0083-100mg | Methyl 2,4-di-O-acetyl-3,6-anhydro-α-D-glucopyranoside | 13059-08-0 | 100mg |
| GC0083-250mg | Methyl 2,4-di-O-acetyl-3,6-anhydro-α-D-glucopyranoside | 13059-08-0 | 250mg |
| GC0083-500mg | Methyl 2,4-di-O-acetyl-3,6-anhydro-α-D-glucopyranoside | 13059-08-0 | 500mg |
| GC0083-1g | Methyl 2,4-di-O-acetyl-3,6-anhydro-α-D-glucopyranoside | 13059-08-0 | 1g |
| GC8615-100mg | Methyl 2,4-di-O-acetyl-3,6-anhydro-β-D-glucopyranoside | 1195522-63-4 | 100mg |
| GC8615-250mg | Methyl 2,4-di-O-acetyl-3,6-anhydro-β-D-glucopyranoside | 1195522-63-4 | 250mg |
| GC8615-500mg | Methyl 2,4-di-O-acetyl-3,6-anhydro-β-D-glucopyranoside | 1195522-63-4 | 500mg |
| GC8615-1g | Methyl 2,4-di-O-acetyl-3,6-anhydro-β-D-glucopyranoside | 1195522-63-4 | 1g |
| GC0680-5mg | Methyl 2,4,6-tri-O-acetyl-3-O-(2,3,4,6-tetra-O-acetyl-α-D-galactopyranosyl)-α-D-galactopyranoside | 145251-15-6 | 5mg |
| GC0680-10mg | Methyl 2,4,6-tri-O-acetyl-3-O-(2,3,4,6-tetra-O-acetyl-α-D-galactopyranosyl)-α-D-galactopyranoside | 145251-15-6 | 10mg |
| GC0680-25mg | Methyl 2,4,6-tri-O-acetyl-3-O-(2,3,4,6-tetra-O-acetyl-α-D-galactopyranosyl)-α-D-galactopyranoside | 145251-15-6 | 25mg |
| GC0680-50mg | Methyl 2,4,6-tri-O-acetyl-3-O-(2,3,4,6-tetra-O-acetyl-α-D-galactopyranosyl)-α-D-galactopyranoside | 145251-15-6 | 50mg |
| GC1329-250mg | Methyl 2,4,6-tri-O-acetyl-3-O-benzyl-β-D-galactopyranoside | 81348-24-5 | 250mg |
| GC1329-500mg | Methyl 2,4,6-tri-O-acetyl-3-O-benzyl-β-D-galactopyranoside | 81348-24-5 | 500mg |
| GC1329-1g | Methyl 2,4,6-tri-O-acetyl-3-O-benzyl-β-D-galactopyranoside | 81348-24-5 | 1g |
| GC1329-2g | Methyl 2,4,6-tri-O-acetyl-3-O-benzyl-β-D-galactopyranoside | 81348-24-5 | 2g |
| GC3864-500mg | Methyl 2,6-di-O-benzyl-β-D-galactopyranoside | 51842-27-4 | 500mg |
| GC3864-1g | Methyl 2,6-di-O-benzyl-β-D-galactopyranoside | 51842-27-4 | 1g |
| GC3864-2g | Methyl 2,6-di-O-benzyl-β-D-galactopyranoside | 51842-27-4 | 2g |
| GC3864-5g | Methyl 2,6-di-O-benzyl-β-D-galactopyranoside | 51842-27-4 | 5g |
| GC9950-500mg | Methyl 3-amino-3-deoxy-α-D-mannopyranoside hydrochloride | 14133-35-8 | 500mg |
| GC9950-1g | Methyl 3-amino-3-deoxy-α-D-mannopyranoside hydrochloride | 14133-35-8 | 1g |
| GC9950-2g | Methyl 3-amino-3-deoxy-α-D-mannopyranoside hydrochloride | 14133-35-8 | 2g |
| GC9950-5g | Methyl 3-amino-3-deoxy-α-D-mannopyranoside hydrochloride | 14133-35-8 | 5g |
| GC9971-1mg | Methyl 3-O-(2-acetamido-2-deoxy-b-D-glucopyranosyl)-b-D-galactopyranoside | 93253-17-9 | 1mg |
| GC9971-2mg | Methyl 3-O-(2-acetamido-2-deoxy-b-D-glucopyranosyl)-b-D-galactopyranoside | 93253-17-9 | 2mg |
| GC9971-5mg | Methyl 3-O-(2-acetamido-2-deoxy-b-D-glucopyranosyl)-b-D-galactopyranoside | 93253-17-9 | 5mg |
| GC9971-10mg | Methyl 3-O-(2-acetamido-2-deoxy-b-D-glucopyranosyl)-b-D-galactopyranoside | 93253-17-9 | 10mg |
| GC9971-25mg | Methyl 3-O-(2-acetamido-2-deoxy-b-D-glucopyranosyl)-b-D-galactopyranoside | 93253-17-9 | 25mg |
| GC8274-1mg | Methyl 3-O-(2-acetamido-2-deoxy-α-D-galactopyranosyl)-α-D-galactopyranoside | 130234-67-2 | 1mg |
| GC8274-2mg | Methyl 3-O-(2-acetamido-2-deoxy-α-D-galactopyranosyl)-α-D-galactopyranoside | 130234-67-2 | 2mg |
| GC8274-5mg | Methyl 3-O-(2-acetamido-2-deoxy-α-D-galactopyranosyl)-α-D-galactopyranoside | 130234-67-2 | 5mg |
| GC8274-10mg | Methyl 3-O-(2-acetamido-2-deoxy-α-D-galactopyranosyl)-α-D-galactopyranoside | 130234-67-2 | 10mg |
| GC8857-1mg | Methyl 3-O-(2-acetamido-2-deoxy-α-D-galactopyranosyl)-β-D-galactopyranoside | 128396-53-2 | 1mg |
| GC8857-2mg | Methyl 3-O-(2-acetamido-2-deoxy-α-D-galactopyranosyl)-β-D-galactopyranoside | 128396-53-2 | 2mg |
| GC8857-5mg | Methyl 3-O-(2-acetamido-2-deoxy-α-D-galactopyranosyl)-β-D-galactopyranoside | 128396-53-2 | 5mg |
| GC8857-10mg | Methyl 3-O-(2-acetamido-2-deoxy-α-D-galactopyranosyl)-β-D-galactopyranoside | 128396-53-2 | 10mg |
| GC7414-5mg | Methyl 3-O-(2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-glucopyranosyl)-2,4,6-tri-O-acetyl-β-D-galactopyranoside | 93253-18-0 | 5mg |
| GC7414-10mg | Methyl 3-O-(2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-glucopyranosyl)-2,4,6-tri-O-acetyl-β-D-galactopyranoside | 93253-18-0 | 10mg |
| GC7414-25mg | Methyl 3-O-(2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-glucopyranosyl)-2,4,6-tri-O-acetyl-β-D-galactopyranoside | 93253-18-0 | 25mg |
| GC7414-50mg | Methyl 3-O-(2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-β-D-glucopyranosyl)-2,4,6-tri-O-acetyl-β-D-galactopyranoside | 93253-18-0 | 50mg |
| GC3830-10mg | Methyl 3-O-(3,4,6-tri-O-acetyl-2-deoxy-2-phthalimido-β-D-glucopyranosyl)-2,4,6-tri-O-acetyl-β-D-galactopyranoside | 210472-13-2 | 10mg |
| GC3830-25mg | Methyl 3-O-(3,4,6-tri-O-acetyl-2-deoxy-2-phthalimido-β-D-glucopyranosyl)-2,4,6-tri-O-acetyl-β-D-galactopyranoside | 210472-13-2 | 25mg |
| GC3830-50mg | Methyl 3-O-(3,4,6-tri-O-acetyl-2-deoxy-2-phthalimido-β-D-glucopyranosyl)-2,4,6-tri-O-acetyl-β-D-galactopyranoside | 210472-13-2 | 50mg |
| GC3830-100mg | Methyl 3-O-(3,4,6-tri-O-acetyl-2-deoxy-2-phthalimido-β-D-glucopyranosyl)-2,4,6-tri-O-acetyl-β-D-galactopyranoside | 210472-13-2 | 100mg |
| GC1161-25mg | Methyl 3-O-acetyl-4-O-benzyl-β-D-xylopyranoside | 80973-66-6 | 25mg |
| GC1161-50mg | Methyl 3-O-acetyl-4-O-benzyl-β-D-xylopyranoside | 80973-66-6 | 50mg |
| GC1161-100mg | Methyl 3-O-acetyl-4-O-benzyl-β-D-xylopyranoside | 80973-66-6 | 100mg |
| GC1161-250mg | Methyl 3-O-acetyl-4-O-benzyl-β-D-xylopyranoside | 80973-66-6 | 250mg |
| GC4564-250mg | Methyl 3-O-benzoyl-4,6-O-benzylidene-α-D-mannopyranoside | 50710-80-0 | 250mg |
| GC4564-500mg | Methyl 3-O-benzoyl-4,6-O-benzylidene-α-D-mannopyranoside | 50710-80-0 | 500mg |
| GC4564-1g | Methyl 3-O-benzoyl-4,6-O-benzylidene-α-D-mannopyranoside | 50710-80-0 | 1g |
| GC4564-2g | Methyl 3-O-benzoyl-4,6-O-benzylidene-α-D-mannopyranoside | 50710-80-0 | 2g |
| GC7791-250mg | Methyl 3-O-benzyl-4,6-O-benzylidene-N-Cbz-α-D-glucopyranosaminide | 87907-34-4 | 250mg |
| GC7791-500mg | Methyl 3-O-benzyl-4,6-O-benzylidene-N-Cbz-α-D-glucopyranosaminide | 87907-34-4 | 500mg |
| GC7791-1g | Methyl 3-O-benzyl-4,6-O-benzylidene-N-Cbz-α-D-glucopyranosaminide | 87907-34-4 | 1g |
| GC6669-250mg | Methyl 3-O-benzyl-4,6-O-benzylidene-β-D-galactopyranoside | 94062-87-0 | 250mg |
| GC6669-500mg | Methyl 3-O-benzyl-4,6-O-benzylidene-β-D-galactopyranoside | 94062-87-0 | 500mg |
| GC6669-1g | Methyl 3-O-benzyl-4,6-O-benzylidene-β-D-galactopyranoside | 94062-87-0 | 1g |
| GC6669-2g | Methyl 3-O-benzyl-4,6-O-benzylidene-β-D-galactopyranoside | 94062-87-0 | 2g |
| GC4389-100mg | Methyl 3-O-benzyl-N-Cbz-α-D-glucopyranosaminide | 87907-35-5 | 100mg |
| GC4389-250mg | Methyl 3-O-benzyl-N-Cbz-α-D-glucopyranosaminide | 87907-35-5 | 250mg |
| GC4389-500mg | Methyl 3-O-benzyl-N-Cbz-α-D-glucopyranosaminide | 87907-35-5 | 500mg |
| GC5033-500mg | Methyl 3-O-benzyl-β-D-galactopyranoside | 81371-53-1 | 500mg |
| GC5033-1g | Methyl 3-O-benzyl-β-D-galactopyranoside | 81371-53-1 | 1g |
| GC8146-1mg | Methyl 3-O-α-D-galactopyranosyl-β-D-galactopyranoside | 18449-79-1 | 1mg |
| GC8146-5mg | Methyl 3-O-α-D-galactopyranosyl-β-D-galactopyranoside | 18449-79-1 | 5mg |
| GC8146-10mg | Methyl 3-O-α-D-galactopyranosyl-β-D-galactopyranoside | 18449-79-1 | 10mg |
| GC8146-25mg | Methyl 3-O-α-D-galactopyranosyl-β-D-galactopyranoside | 18449-79-1 | 25mg |
| GK2306-10g | Methyl 3,3-dimethoxypropionate | 7424-91-1 | 10g |
| GK2306-25g | Methyl 3,3-dimethoxypropionate | 7424-91-1 | 25g |
| GK2306-50g | Methyl 3,3-dimethoxypropionate | 7424-91-1 | 50g |
| GC6903-10mg | Methyl 3,4-di-O-acetyl-2-deoxy-2-fluoro-β-D-xylopyranoside | 616234-51-6 | 10mg |
| GC6903-25mg | Methyl 3,4-di-O-acetyl-2-deoxy-2-fluoro-β-D-xylopyranoside | 616234-51-6 | 25mg |
| GC6903-50mg | Methyl 3,4-di-O-acetyl-2-deoxy-2-fluoro-β-D-xylopyranoside | 616234-51-6 | 50mg |
| GC6903-100mg | Methyl 3,4-di-O-acetyl-2-deoxy-2-fluoro-β-D-xylopyranoside | 616234-51-6 | 100mg |
| GC1471-250mg | Methyl 3,4-di-O-acetyl-D-glucuronal | 57690-62-7 | 250mg |
| GC1471-500mg | Methyl 3,4-di-O-acetyl-D-glucuronal | 57690-62-7 | 500mg |
| GC1471-1g | Methyl 3,4-di-O-acetyl-D-glucuronal | 57690-62-7 | 1g |
| GC1471-2g | Methyl 3,4-di-O-acetyl-D-glucuronal | 57690-62-7 | 2g |
| GC7854-1g | Methyl 3,4-O-isopropylidene-2-O-tosyl-β-D-arabinopyranoside | 79549-20-5 | 1g |
| GC7854-2g | Methyl 3,4-O-isopropylidene-2-O-tosyl-β-D-arabinopyranoside | 79549-20-5 | 2g |
| GC7854-5g | Methyl 3,4-O-isopropylidene-2-O-tosyl-β-D-arabinopyranoside | 79549-20-5 | 5g |
| GC7854-10g | Methyl 3,4-O-isopropylidene-2-O-tosyl-β-D-arabinopyranoside | 79549-20-5 | 10g |
| GC3241-500mg | Methyl 3,4-O-isopropylidene-β-D-galactopyranoside | 14897-47-3 | 500mg |
| GC3241-1g | Methyl 3,4-O-isopropylidene-β-D-galactopyranoside | 14897-47-3 | 1g |
| GC3241-2g | Methyl 3,4-O-isopropylidene-β-D-galactopyranoside | 14897-47-3 | 2g |
| GC3241-5g | Methyl 3,4-O-isopropylidene-β-D-galactopyranoside | 14897-47-3 | 5g |
| GC5929-500mg | Methyl 3,4:5,6-di-O-isopropylidene-D-gluconate | 114743-85-0 | 500mg |
| GC5929-1g | Methyl 3,4:5,6-di-O-isopropylidene-D-gluconate | 114743-85-0 | 1g |
| GC5929-2g | Methyl 3,4:5,6-di-O-isopropylidene-D-gluconate | 114743-85-0 | 2g |
| GC5929-5g | Methyl 3,4:5,6-di-O-isopropylidene-D-gluconate | 114743-85-0 | 5g |
| GC5929-10g | Methyl 3,4:5,6-di-O-isopropylidene-D-gluconate | 114743-85-0 | 10g |
| GC8080-1g | Methyl 3,5-di-O-benzyl-D-xylofuranoside | 132487-16-2 | 1g |
| GC8080-2g | Methyl 3,5-di-O-benzyl-D-xylofuranoside | 132487-16-2 | 2g |
| GC8080-5g | Methyl 3,5-di-O-benzyl-D-xylofuranoside | 132487-16-2 | 5g |
| GC8080-10g | Methyl 3,5-di-O-benzyl-D-xylofuranoside | 132487-16-2 | 10g |
| GC8080-25g | Methyl 3,5-di-O-benzyl-D-xylofuranoside | 132487-16-2 | 25g |
| GC1967-100mg | Methyl 4-Deoxy-4-fluoro-α-D-glucose Tribenzoate | 84065-98-5 | 100mg |
| GC1967-250mg | Methyl 4-Deoxy-4-fluoro-α-D-glucose Tribenzoate | 84065-98-5 | 250mg |
| GC1967-500mg | Methyl 4-Deoxy-4-fluoro-α-D-glucose Tribenzoate | 84065-98-5 | 500mg |
| GC1967-1g | Methyl 4-Deoxy-4-fluoro-α-D-glucose Tribenzoate | 84065-98-5 | 1g |
| GC0716-25mg | Methyl 4-deoxy-4-fluoro-β-D-glucopyranoside | 141990-24-1 | 25mg |
| GC0716-50mg | Methyl 4-deoxy-4-fluoro-β-D-glucopyranoside | 141990-24-1 | 50mg |
| GC0716-100mg | Methyl 4-deoxy-4-fluoro-β-D-glucopyranoside | 141990-24-1 | 100mg |
| GC0716-250mg | Methyl 4-deoxy-4-fluoro-β-D-glucopyranoside | 141990-24-1 | 250mg |
| GK8191-25g | Methyl 4-hydroxybenzoate sodium salt | 5026-62-0 | 25g |
| GK8191-100g | Methyl 4-hydroxybenzoate sodium salt | 5026-62-0 | 100g |
| GK8191-250g | Methyl 4-hydroxybenzoate sodium salt | 5026-62-0 | 250g |
| GK8191-500g | Methyl 4-hydroxybenzoate sodium salt | 5026-62-0 | 500g |
| GK8191-1kg | Methyl 4-hydroxybenzoate sodium salt | 5026-62-0 | 1kg |
| GE2869-100g | Methyl 4-hydroxybenzoate, Ph. Eur. grade | 99-76-3 | 100g |
| GE2869-250g | Methyl 4-hydroxybenzoate, Ph. Eur. grade | 99-76-3 | 250g |
| GE2869-500g | Methyl 4-hydroxybenzoate, Ph. Eur. grade | 99-76-3 | 500g |
| GE2869-1kg | Methyl 4-hydroxybenzoate, Ph. Eur. grade | 99-76-3 | 1kg |
| GC2115-1mg | Methyl 4-O-(2-acetamido-2-deoxy-β-D-glucopyranosyl)-β-D-galactopyranoside | 95795-77-0 | 1mg |
| GC2115-2mg | Methyl 4-O-(2-acetamido-2-deoxy-β-D-glucopyranosyl)-β-D-galactopyranoside | 95795-77-0 | 2mg |
| GC2115-5mg | Methyl 4-O-(2-acetamido-2-deoxy-β-D-glucopyranosyl)-β-D-galactopyranoside | 95795-77-0 | 5mg |
| GC2115-10mg | Methyl 4-O-(2-acetamido-2-deoxy-β-D-glucopyranosyl)-β-D-galactopyranoside | 95795-77-0 | 10mg |
| GC1502-5mg | Methyl 4-O-(a-D-galactopyranosyl)-a-D-galactopyranoside | 67145-39-5 | 5mg |
| GC1502-10mg | Methyl 4-O-(a-D-galactopyranosyl)-a-D-galactopyranoside | 67145-39-5 | 10mg |
| GC1502-25mg | Methyl 4-O-(a-D-galactopyranosyl)-a-D-galactopyranoside | 67145-39-5 | 25mg |
| GC1502-50mg | Methyl 4-O-(a-D-galactopyranosyl)-a-D-galactopyranoside | 67145-39-5 | 50mg |
| GC5419-250mg | Methyl 4,6-dichloro-4,6-dideoxy-α-D-galactopyranoside | 4990-82-3 | 250mg |
| GC5419-500mg | Methyl 4,6-dichloro-4,6-dideoxy-α-D-galactopyranoside | 4990-82-3 | 500mg |
| GC5419-1g | Methyl 4,6-dichloro-4,6-dideoxy-α-D-galactopyranoside | 4990-82-3 | 1g |
| GC5419-2g | Methyl 4,6-dichloro-4,6-dideoxy-α-D-galactopyranoside | 4990-82-3 | 2g |
| GC0775-1g | Methyl 4,6-O-((R,S)-4-nitrobenzylidene)-α-D-galactopyranoside | 1g | |
| GC0775-2g | Methyl 4,6-O-((R,S)-4-nitrobenzylidene)-α-D-galactopyranoside | 2g | |
| GC0775-5g | Methyl 4,6-O-((R,S)-4-nitrobenzylidene)-α-D-galactopyranoside | 5g | |
| GC0775-10g | Methyl 4,6-O-((R,S)-4-nitrobenzylidene)-α-D-galactopyranoside | 10g | |
| GC8957-500mg | Methyl 4,6-O-((S)-4-nitrobenzylidene)-α-D-galactopyranoside | 849366-08-1 | 500mg |
| GC8957-1g | Methyl 4,6-O-((S)-4-nitrobenzylidene)-α-D-galactopyranoside | 849366-08-1 | 1g |
| GC8957-2g | Methyl 4,6-O-((S)-4-nitrobenzylidene)-α-D-galactopyranoside | 849366-08-1 | 2g |
| GC8957-5g | Methyl 4,6-O-((S)-4-nitrobenzylidene)-α-D-galactopyranoside | 849366-08-1 | 5g |
| GC1134-5g | Methyl 4,6-O-benzylidene-2,3-di-O-benzyl-a-D-glucopyranoside | 13225-19-9 | 5g |
| GC1134-10g | Methyl 4,6-O-benzylidene-2,3-di-O-benzyl-a-D-glucopyranoside | 13225-19-9 | 10g |
| GC1134-25g | Methyl 4,6-O-benzylidene-2,3-di-O-benzyl-a-D-glucopyranoside | 13225-19-9 | 25g |
| GC1134-50g | Methyl 4,6-O-benzylidene-2,3-di-O-benzyl-a-D-glucopyranoside | 13225-19-9 | 50g |
| GC9854-5g | Methyl 4,6-O-benzylidene-a-D-glucopyranoside | 3162-96-7 | 5g |
| GC9854-25g | Methyl 4,6-O-benzylidene-a-D-glucopyranoside | 3162-96-7 | 25g |
| GC9854-100g | Methyl 4,6-O-benzylidene-a-D-glucopyranoside | 3162-96-7 | 100g |
| GC3351-1g | Methyl 4,6-O-benzylidene-b-D-galactopyranoside | 6988-39-2 | 1g |
| GC3351-2g | Methyl 4,6-O-benzylidene-b-D-galactopyranoside | 6988-39-2 | 2g |
| GC3351-5g | Methyl 4,6-O-benzylidene-b-D-galactopyranoside | 6988-39-2 | 5g |
| GC3351-10g | Methyl 4,6-O-benzylidene-b-D-galactopyranoside | 6988-39-2 | 10g |
| GC0277-250mg | Methyl 4,6-O-benzylidene-N-Cbz-2-deoxy-α-D-glucopyranosaminide | 60076-41-7 | 250mg |
| GC0277-500mg | Methyl 4,6-O-benzylidene-N-Cbz-2-deoxy-α-D-glucopyranosaminide | 60076-41-7 | 500mg |
| GC0277-1g | Methyl 4,6-O-benzylidene-N-Cbz-2-deoxy-α-D-glucopyranosaminide | 60076-41-7 | 1g |
| GC0636-5g | Methyl 4,6-O-Benzylidene-α-D-glucopyranoside | 14155-23-8 | 5g |
| GC0636-10g | Methyl 4,6-O-Benzylidene-α-D-glucopyranoside | 14155-23-8 | 10g |
| GC0636-25g | Methyl 4,6-O-Benzylidene-α-D-glucopyranoside | 14155-23-8 | 25g |
| GW0383-1g | Methyl 5-aminopyridine-3-carboxylate | 36052-25-2 | 1g |
| GW0383-2500mg | Methyl 5-aminopyridine-3-carboxylate | 36052-25-2 | 2500mg |
| GW0383-10g | Methyl 5-aminopyridine-3-carboxylate | 36052-25-2 | 10g |
| GC8132-50mg | Methyl 5-deoxy-5-iodo-2,3-O-isopropylidene-α-L-lyxofuranoside | 5531-23-7 | 50mg |
| GC8132-100mg | Methyl 5-deoxy-5-iodo-2,3-O-isopropylidene-α-L-lyxofuranoside | 5531-23-7 | 100mg |
| GC8132-250mg | Methyl 5-deoxy-5-iodo-2,3-O-isopropylidene-α-L-lyxofuranoside | 5531-23-7 | 250mg |
| GC8132-500mg | Methyl 5-deoxy-5-iodo-2,3-O-isopropylidene-α-L-lyxofuranoside | 5531-23-7 | 500mg |
| GW3545-1g | Methyl 5-hydroxy-3-pyridinecarboxylate | 30766-22-4 | 1g |
| GW3545-2500mg | Methyl 5-hydroxy-3-pyridinecarboxylate | 30766-22-4 | 2500mg |
| GW3545-10g | Methyl 5-hydroxy-3-pyridinecarboxylate | 30766-22-4 | 10g |
| GC3991-500mg | Methyl 6-deoxy-6-iodo-α-D-glucopyranoside | 5155-46-4 | 500mg |
| GC3991-1g | Methyl 6-deoxy-6-iodo-α-D-glucopyranoside | 5155-46-4 | 1g |
| GC3991-2g | Methyl 6-deoxy-6-iodo-α-D-glucopyranoside | 5155-46-4 | 2g |
| GC3991-5g | Methyl 6-deoxy-6-iodo-α-D-glucopyranoside | 5155-46-4 | 5g |
| GC3503-250mg | Methyl 6-deoxy-6-iodo-β-D-glucopyranoside | 291542-65-9 | 250mg |
| GC3503-500mg | Methyl 6-deoxy-6-iodo-β-D-glucopyranoside | 291542-65-9 | 500mg |
| GC3503-1g | Methyl 6-deoxy-6-iodo-β-D-glucopyranoside | 291542-65-9 | 1g |
| GC3503-2g | Methyl 6-deoxy-6-iodo-β-D-glucopyranoside | 291542-65-9 | 2g |
| GC6357-1g | Methyl 6-deoxy-a-D-glucopyranoside | 5155-43-1 | 1g |
| GC6357-2g | Methyl 6-deoxy-a-D-glucopyranoside | 5155-43-1 | 2g |
| GC6357-5g | Methyl 6-deoxy-a-D-glucopyranoside | 5155-43-1 | 5g |
| GC6357-10g | Methyl 6-deoxy-a-D-glucopyranoside | 5155-43-1 | 10g |
| GC9921-50mg | Methyl 6-deoxy-β-D-glucopyranoside | 6340-52-9 | 50mg |
| GC9921-100mg | Methyl 6-deoxy-β-D-glucopyranoside | 6340-52-9 | 100mg |
| GC9921-250mg | Methyl 6-deoxy-β-D-glucopyranoside | 6340-52-9 | 250mg |
| GC9921-500mg | Methyl 6-deoxy-β-D-glucopyranoside | 6340-52-9 | 500mg |
| GW1291-1g | Methyl 6-hydroxy-5-nitropyridine-3-carboxylate | 222970-61-8 | 1g |
| GW1291-10g | Methyl 6-hydroxy-5-nitropyridine-3-carboxylate | 222970-61-8 | 10g |
| GC9611-1g | Methyl 6-O-(N-heptylcarbamoyl)-a-D-glucopyranoside | 115457-83-5 | 1g |
| GC8781-25mg | Methyl 6-O-acetyl-3-O-benzyl-2-benzyloxycarbonylamino-2-deoxy-a-D-glucopyranose | 114869-95-3 | 25mg |
| GC8781-50mg | Methyl 6-O-acetyl-3-O-benzyl-2-benzyloxycarbonylamino-2-deoxy-a-D-glucopyranose | 114869-95-3 | 50mg |
| GC8781-100mg | Methyl 6-O-acetyl-3-O-benzyl-2-benzyloxycarbonylamino-2-deoxy-a-D-glucopyranose | 114869-95-3 | 100mg |
| GC8781-250mg | Methyl 6-O-acetyl-3-O-benzyl-2-benzyloxycarbonylamino-2-deoxy-a-D-glucopyranose | 114869-95-3 | 250mg |
| GC2561-25mg | Methyl 6-O-acetyl-3-O-benzyl-N-Cbz-2-deoxy-4-O-(methyl 2-O-acetyl-3-O-benzyl-α-L-idopyranuronosyl)-α-D-glucopyranosaminide | 114869-97-5 | 25mg |
| GC2561-50mg | Methyl 6-O-acetyl-3-O-benzyl-N-Cbz-2-deoxy-4-O-(methyl 2-O-acetyl-3-O-benzyl-α-L-idopyranuronosyl)-α-D-glucopyranosaminide | 114869-97-5 | 50mg |
| GC2561-100mg | Methyl 6-O-acetyl-3-O-benzyl-N-Cbz-2-deoxy-4-O-(methyl 2-O-acetyl-3-O-benzyl-α-L-idopyranuronosyl)-α-D-glucopyranosaminide | 114869-97-5 | 100mg |
| GC7747-500mg | Methyl 6-O-tosyl-β-D-galactopyranoside | 57817-52-4 | 500mg |
| GC7747-1g | Methyl 6-O-tosyl-β-D-galactopyranoside | 57817-52-4 | 1g |
| GC7747-2g | Methyl 6-O-tosyl-β-D-galactopyranoside | 57817-52-4 | 2g |
| GC7747-5g | Methyl 6-O-tosyl-β-D-galactopyranoside | 57817-52-4 | 5g |
| GC7495-1g | Methyl 6-O-trityl-α-D-mannopyranoside | 20231-36-1 | 1g |
| GC7495-2g | Methyl 6-O-trityl-α-D-mannopyranoside | 20231-36-1 | 2g |
| GC7495-5g | Methyl 6-O-trityl-α-D-mannopyranoside | 20231-36-1 | 5g |
| GC7495-10g | Methyl 6-O-trityl-α-D-mannopyranoside | 20231-36-1 | 10g |
| GC7023-1g | Methyl 6-O-trityl-β-D-galactopyranoside | 35780-80-4 | 1g |
| GC7023-2g | Methyl 6-O-trityl-β-D-galactopyranoside | 35780-80-4 | 2g |
| GC7023-5g | Methyl 6-O-trityl-β-D-galactopyranoside | 35780-80-4 | 5g |
| GC7023-10g | Methyl 6-O-trityl-β-D-galactopyranoside | 35780-80-4 | 10g |
| GC3568-1mg | Methyl 6,6'',6''''-trideoxy-6,6'',6''''-triiodo-β-D-cellohexaoside | 1mg | |
| GC3568-2mg | Methyl 6,6'',6''''-trideoxy-6,6'',6''''-triiodo-β-D-cellohexaoside | 2mg | |
| GC3568-5mg | Methyl 6,6'',6''''-trideoxy-6,6'',6''''-triiodo-β-D-cellohexaoside | 5mg | |
| GC4378-1mg | Methyl 6,6'',6''''-trideoxy-6,6'',6''''-triiodo-β-D-cellotrioside | 1mg | |
| GC4378-2mg | Methyl 6,6'',6''''-trideoxy-6,6'',6''''-triiodo-β-D-cellotrioside | 2mg | |
| GC4378-5mg | Methyl 6,6'',6''''-trideoxy-6,6'',6''''-triiodo-β-D-cellotrioside | 5mg | |
| GC4378-10mg | Methyl 6,6'',6''''-trideoxy-6,6'',6''''-triiodo-β-D-cellotrioside | 10mg | |
| GX8432-100ml | Methyl acetate | 79-20-9 | 100ml |
| GC6741-5g | Methyl alpha-D-galactopyranoside | 3396-99-4 | 5g |
| GC6741-10g | Methyl alpha-D-galactopyranoside | 3396-99-4 | 10g |
| GC6741-25g | Methyl alpha-D-galactopyranoside | 3396-99-4 | 25g |
| GC6741-100g | Methyl alpha-D-galactopyranoside | 3396-99-4 | 100g |
| GC8691-100g | Methyl alpha-D-glucopyranoside | 97-30-3 | 100g |
| GC8691-250g | Methyl alpha-D-glucopyranoside | 97-30-3 | 250g |
| GC8691-500g | Methyl alpha-D-glucopyranoside | 97-30-3 | 500g |
| GC7658-100mg | Methyl b-D-arabinopyranoside | 5328-63-2 | 100mg |
| GC7658-250mg | Methyl b-D-arabinopyranoside | 5328-63-2 | 250mg |
| GC6893-2g | Methyl b-D-xylopyranoside | 612-05-5 | 2g |
| GC6893-5g | Methyl b-D-xylopyranoside | 612-05-5 | 5g |
| GC6893-10g | Methyl b-D-xylopyranoside | 612-05-5 | 10g |
| GC6893-25g | Methyl b-D-xylopyranoside | 612-05-5 | 25g |
| GL2503-100g | Methyl benzoate | 93-58-3 | 100g |
| GL2503-250g | Methyl benzoate | 93-58-3 | 250g |
| GL2503-500g | Methyl benzoate | 93-58-3 | 500g |
| GL2503-1kg | Methyl benzoate | 93-58-3 | 1kg |
| GL2503-5kg | Methyl benzoate | 93-58-3 | 5kg |
| GC7084-1g | Methyl beta-D-glucopyranoside | 709-50-2 | 1g |
| GC7084-5g | Methyl beta-D-glucopyranoside | 709-50-2 | 5g |
| GC7084-10g | Methyl beta-D-glucopyranoside | 709-50-2 | 10g |
| GT6506-5g | Methyl Blue (C.I. 42780) | 28983-56-4 | 5g |
| GT6506-25g | Methyl Blue (C.I. 42780) | 28983-56-4 | 25g |
| GT6506-100g | Methyl Blue (C.I. 42780) | 28983-56-4 | 100g |
| GL0200-100ml | Methyl butyrate | 623-42-7 | 100ml |
| GL0200-500ml | Methyl butyrate | 623-42-7 | 500ml |
| GC0717-100g | Methyl cellulose | 9004-67-5 | 100g |
| GC0717-250g | Methyl cellulose | 9004-67-5 | 250g |
| GC0717-500g | Methyl cellulose | 9004-67-5 | 500g |
| GC0717-1kg | Methyl cellulose | 9004-67-5 | 1kg |
| GC4606-50mg | Methyl D-galactofuranoside | 153831-23-3 | 50mg |
| GC4606-100mg | Methyl D-galactofuranoside | 153831-23-3 | 100mg |
| GC4606-250mg | Methyl D-galactofuranoside | 153831-23-3 | 250mg |
| GC4606-500mg | Methyl D-galactofuranoside | 153831-23-3 | 500mg |
| GC1699-50mg | Methyl D-glucofuranoside | 138052-46-7 | 50mg |
| GC1699-100mg | Methyl D-glucofuranoside | 138052-46-7 | 100mg |
| GC1699-250mg | Methyl D-glucofuranoside | 138052-46-7 | 250mg |
| GC1699-500mg | Methyl D-glucofuranoside | 138052-46-7 | 500mg |
| GX7351-5ml | Methyl DL-lactate | 547-64-8 | 5ml |
| GS2497-100ml | Methyl Ethyl Ketone, GlenDry™, anhydrous | 78-93-3 | 100ml |
| GS2497-500ml | Methyl Ethyl Ketone, GlenDry™, anhydrous | 78-93-3 | 500ml |
| GS2497-1l | Methyl Ethyl Ketone, GlenDry™, anhydrous | 78-93-3 | 1l |
| GS2497-2500ml | Methyl Ethyl Ketone, GlenDry™, anhydrous | 78-93-3 | 2500ml |
| GS6653-500ml | Methyl Ethyl Ketone, GlenPure™, analytical grade | 78-93-3 | 500ml |
| GS6653-1l | Methyl Ethyl Ketone, GlenPure™, analytical grade | 78-93-3 | 1l |
| GS6653-2500ml | Methyl Ethyl Ketone, GlenPure™, analytical grade | 78-93-3 | 2500ml |
| GY0948-100g | Methyl gallate | 99-24-1 | 100g |
| GT7495-5g | Methyl Green (C.I. 42585) | 14855-76-6 | 5g |
| GT7495-25g | Methyl Green (C.I. 42585) | 14855-76-6 | 25g |
| GT7495-100g | Methyl Green (C.I. 42585) | 14855-76-6 | 100g |
| GT9540-5g | Methyl Green zinc chloride salt (C.I. 42590) | 7114-03-6 | 5g |
| GT9540-10g | Methyl Green zinc chloride salt (C.I. 42590) | 7114-03-6 | 10g |
| GT9540-25g | Methyl Green zinc chloride salt (C.I. 42590) | 7114-03-6 | 25g |
| GT9540-50g | Methyl Green zinc chloride salt (C.I. 42590) | 7114-03-6 | 50g |
| GT9160-100ml | Methyl Green-Pyronin solution | 100ml | |
| GT9160-250ml | Methyl Green-Pyronin solution | 250ml | |
| GT9160-500ml | Methyl Green-Pyronin solution | 500ml | |
| GK5147-1g | Methyl heptadecanoate | 1731-92-6 | 1g |
| GK5147-5g | Methyl heptadecanoate | 1731-92-6 | 5g |
| GK5973-1g | Methyl linoleate, 95% | 112-63-0 | 1g |
| GC2856-50mg | Methyl N-acetyl-alpha-D-glucosaminide | 6082-04-8 | 50mg |
| GC2856-100mg | Methyl N-acetyl-alpha-D-glucosaminide | 6082-04-8 | 100mg |
| GC8314-250mg | Methyl N-Cbz-α-D-glucopyranosaminide | 4704-15-8 | 250mg |
| GC8314-500mg | Methyl N-Cbz-α-D-glucopyranosaminide | 4704-15-8 | 500mg |
| GC8314-1g | Methyl N-Cbz-α-D-glucopyranosaminide | 4704-15-8 | 1g |
| GC8314-2g | Methyl N-Cbz-α-D-glucopyranosaminide | 4704-15-8 | 2g |
| GK8409-25g | Methyl nicotinate | 93-60-7 | 25g |
| GK9785-5g | Methyl nonadecanoate | 1731-94-8 | 5g |
| GT1067-25g | Methyl Orange (C.I. 13025) | 547-58-0 | 25g |
| GT1067-100g | Methyl Orange (C.I. 13025) | 547-58-0 | 100g |
| GT1067-250g | Methyl Orange (C.I. 13025) | 547-58-0 | 250g |
| GT1067-500g | Methyl Orange (C.I. 13025) | 547-58-0 | 500g |
| GK1777-25g | Methyl palmitate | 112-39-0 | 25g |
| GW8412-1g | Methyl phthaloyl chloride | 4397-55-1 | 1g |
| GW8412-2500mg | Methyl phthaloyl chloride | 4397-55-1 | 2500mg |
| GW8412-10g | Methyl phthaloyl chloride | 4397-55-1 | 10g |
| GL9842-100ml | Methyl propionate | 554-12-1 | 100ml |
| GL9842-500ml | Methyl propionate | 554-12-1 | 500ml |
| GL9842-1l | Methyl propionate | 554-12-1 | 1l |
| GT1411-25g | Methyl Red (C.I. 13020) | 493-52-7 | 25g |
| GT1411-100g | Methyl Red (C.I. 13020) | 493-52-7 | 100g |
| GT1411-250g | Methyl Red (C.I. 13020) | 493-52-7 | 250g |
| GT3952-25g | Methyl Red sodium salt (C.I. 13020) | 845-10-3 | 25g |
| GT3952-100g | Methyl Red sodium salt (C.I. 13020) | 845-10-3 | 100g |
| GT3952-250g | Methyl Red sodium salt (C.I. 13020) | 845-10-3 | 250g |
| GT3952-500g | Methyl Red sodium salt (C.I. 13020) | 845-10-3 | 500g |
| GK9357-100g | Methyl salicylate | 119-36-8 | 100g |
| GK9357-500g | Methyl salicylate | 119-36-8 | 500g |
| GK6996-25g | Methyl stearate | 112-61-8 | 25g |
| GS9559-100ml | Methyl tert-Butyl Ether, GlenDry™, anhydrous | 1634-04-4 | 100ml |
| GS9559-500ml | Methyl tert-Butyl Ether, GlenDry™, anhydrous | 1634-04-4 | 500ml |
| GS9559-1l | Methyl tert-Butyl Ether, GlenDry™, anhydrous | 1634-04-4 | 1l |
| GS9559-2500ml | Methyl tert-Butyl Ether, GlenDry™, anhydrous | 1634-04-4 | 2500ml |
| GS6316-500ml | Methyl tert-Butyl Ether, GlenPure™, analytical grade | 1634-04-4 | 500ml |
| GS6316-1l | Methyl tert-Butyl Ether, GlenPure™, analytical grade | 1634-04-4 | 1l |
| GS6316-2500ml | Methyl tert-Butyl Ether, GlenPure™, analytical grade | 1634-04-4 | 2500ml |
| GK0547-1g | Methyl tridecanoate | 1731-88-0 | 1g |
| GK1205-10g | Methyl undecanoate | 1731-86-8 | 10g |
| GK1205-25g | Methyl undecanoate | 1731-86-8 | 25g |
| GT4491-25g | Methyl Violet 2B (C.I. 42535) | 8004-87-3 | 25g |
| GT4491-100g | Methyl Violet 2B (C.I. 42535) | 8004-87-3 | 100g |
| GC2898-50mg | Methyl α-D-lactoside | 21973-65-9 | 50mg |
| GC2898-100mg | Methyl α-D-lactoside | 21973-65-9 | 100mg |
| GC2898-250mg | Methyl α-D-lactoside | 21973-65-9 | 250mg |
| GC2898-500mg | Methyl α-D-lactoside | 21973-65-9 | 500mg |
| GC1172-50mg | Methyl α-D-maltoside | 4198-49-6 | 50mg |
| GC1172-100mg | Methyl α-D-maltoside | 4198-49-6 | 100mg |
| GC1172-250mg | Methyl α-D-maltoside | 4198-49-6 | 250mg |
| GC1172-500mg | Methyl α-D-maltoside | 4198-49-6 | 500mg |
| GC1172-1g | Methyl α-D-maltoside | 4198-49-6 | 1g |
| GC2632-50mg | Methyl α-D-mannofuranoside | 4097-91-0 | 50mg |
| GC2632-100mg | Methyl α-D-mannofuranoside | 4097-91-0 | 100mg |
| GC2632-250mg | Methyl α-D-mannofuranoside | 4097-91-0 | 250mg |
| GC2632-500mg | Methyl α-D-mannofuranoside | 4097-91-0 | 500mg |
| GC4594-1g | Methyl β-D-cellobioside heptaacetate | 30021-60-4 | 1g |
| GC4594-5g | Methyl β-D-cellobioside heptaacetate | 30021-60-4 | 5g |
| GC4594-10g | Methyl β-D-cellobioside heptaacetate | 30021-60-4 | 10g |
| GC4594-25g | Methyl β-D-cellobioside heptaacetate | 30021-60-4 | 25g |
| GC8035-10mg | Methyl β-D-fructopyranoside | 4208-77-9 | 10mg |
| GC8035-25mg | Methyl β-D-fructopyranoside | 4208-77-9 | 25mg |
| GC8035-50mg | Methyl β-D-fructopyranoside | 4208-77-9 | 50mg |
| GC8035-100mg | Methyl β-D-fructopyranoside | 4208-77-9 | 100mg |
| GC2228-500mg | Methyl β-D-maltoside | 744-05-8 | 500mg |
| GC2228-1g | Methyl β-D-maltoside | 744-05-8 | 1g |
| GC2228-2g | Methyl β-D-maltoside | 744-05-8 | 2g |
| GC2228-5g | Methyl β-D-maltoside | 744-05-8 | 5g |
| GC7204-100mg | Methyl β-D-Mannopyranoside Isopropylate | 911673-07-9 | 100mg |
| GC7204-250mg | Methyl β-D-Mannopyranoside Isopropylate | 911673-07-9 | 250mg |
| GC7204-500mg | Methyl β-D-Mannopyranoside Isopropylate | 911673-07-9 | 500mg |
| GC7204-1g | Methyl β-D-Mannopyranoside Isopropylate | 911673-07-9 | 1g |
| GC3075-1g | Methyl β-L-arabinopyranoside | 1825-00-9 | 1g |
| GC3075-2g | Methyl β-L-arabinopyranoside | 1825-00-9 | 2g |
| GC3075-5g | Methyl β-L-arabinopyranoside | 1825-00-9 | 5g |
| GC3075-10g | Methyl β-L-arabinopyranoside | 1825-00-9 | 10g |
| GC3614-5g | Methyl-beta-cyclodextrin | 128446-36-6 | 5g |
| GC3614-25g | Methyl-beta-cyclodextrin | 128446-36-6 | 25g |
| GC3614-50g | Methyl-beta-cyclodextrin | 128446-36-6 | 50g |
| GC3614-100g | Methyl-beta-cyclodextrin | 128446-36-6 | 100g |
| GL3979-1g | Methylbenzethonium chloride | 25155-18-4 | 1g |
| GL3979-5g | Methylbenzethonium chloride | 25155-18-4 | 5g |
| GL3979-10g | Methylbenzethonium chloride | 25155-18-4 | 10g |
| GV9033-250mg | Methylcobalamin hydrate | 13422-55-4 | 250mg |
| GV9033-1g | Methylcobalamin hydrate | 13422-55-4 | 1g |
| GV9033-5g | Methylcobalamin hydrate | 13422-55-4 | 5g |
| GS2668-100ml | Methylcyclohexane, GlenDry™, anhydrous | 108-87-2 | 100ml |
| GS2668-500ml | Methylcyclohexane, GlenDry™, anhydrous | 108-87-2 | 500ml |
| GS1672-500ml | Methylcyclohexane, GlenPure™, analytical grade | 108-87-2 | 500ml |
| GS1672-1l | Methylcyclohexane, GlenPure™, analytical grade | 108-87-2 | 1l |
| GW7537-50mg | Methyldymron | 42609-73-4 | 50mg |
| GW7537-500mg | Methyldymron | 42609-73-4 | 500mg |
| GE9796-100g | Methylene Blue hydrate (C.I. 52015) | 122965-43-9 | 100g |
| GE9796-500g | Methylene Blue hydrate (C.I. 52015) | 122965-43-9 | 500g |
| GT8594-100ml | Methylene Blue solution, 0.5% in water | 61-73-4 | 100ml |
| GT8594-500ml | Methylene Blue solution, 0.5% in water | 61-73-4 | 500ml |
| GT8594-1l | Methylene Blue solution, 0.5% in water | 61-73-4 | 1l |
| GT0850-500ml | Methylene Blue solution, 1% in water | 61-73-4 | 500ml |
| GT0850-1l | Methylene Blue solution, 1% in water | 61-73-4 | 1l |
| GT0735-25g | Methylene Blue trihydrate (C.I. 52015) | 7220-79-3 | 25g |
| GT0735-100g | Methylene Blue trihydrate (C.I. 52015) | 7220-79-3 | 100g |
| GT0735-250g | Methylene Blue trihydrate (C.I. 52015) | 7220-79-3 | 250g |
| GT1060-25g | Methylene Blue, anhydrous (C.I. 52015) | 61-73-4 | 25g |
| GT1060-100g | Methylene Blue, anhydrous (C.I. 52015) | 61-73-4 | 100g |
| GL0650-1g | Methylene Violet 3RAX | 4569-86-2 | 1g |
| GL0650-5g | Methylene Violet 3RAX | 4569-86-2 | 5g |
| GL9346-100ml | Methylglyoxal solution 40% in water | 78-98-8 | 100ml |
| GL9346-500ml | Methylglyoxal solution 40% in water | 78-98-8 | 500ml |
| GT5950-1g | Methylthymol Blue sodium salt | 1945-77-3 | 1g |
| GT5950-5g | Methylthymol Blue sodium salt | 1945-77-3 | 5g |
| GT5950-25g | Methylthymol Blue sodium salt | 1945-77-3 | 25g |
| GW2944-5g | Methyltrioctadecylammonium bromide | 18262-86-7 | 5g |
| GW2944-25g | Methyltrioctadecylammonium bromide | 18262-86-7 | 25g |
| GK6262-25g | Methyltriphenylphosphonium bromide | 1779-49-3 | 25g |
| GK6262-100g | Methyltriphenylphosphonium bromide | 1779-49-3 | 100g |
| GP2886-10mg | Methysergide maleate salt | 129-49-7 | 10mg |
| GP2886-50mg | Methysergide maleate salt | 129-49-7 | 50mg |
| GP5892-25g | Metoclopramide hydrochloride | 54143-57-6 | 25g |
| GP5935-25mg | Metolazone | 17560-51-9 | 25mg |
| GP5935-100mg | Metolazone | 17560-51-9 | 100mg |
| GX8301-250mg | Metoprolol succinate, USP grade | 98418-47-4 | 250mg |
| GX8301-1g | Metoprolol succinate, USP grade | 98418-47-4 | 1g |
| GP2424-5g | Metoprolol tartrate | 56392-17-7 | 5g |
| GA3859-5g | Metronidazole | 443-48-1 | 5g |
| GA3859-25g | Metronidazole | 443-48-1 | 25g |
| GA3859-100g | Metronidazole | 443-48-1 | 100g |
| GP6954-1g | Metronidazole benzoate | 13182-89-3 | 1g |
| GC6083-1mg | Metronidazole O-β-D-glucuronide | 100495-98-5 | 1mg |
| GC6083-2mg | Metronidazole O-β-D-glucuronide | 100495-98-5 | 2mg |
| GC6083-5mg | Metronidazole O-β-D-glucuronide | 100495-98-5 | 5mg |
| GC6083-10mg | Metronidazole O-β-D-glucuronide | 100495-98-5 | 10mg |
| GP8770-10mg | Metyrapone | 54-36-4 | 10mg |
| GP8770-50mg | Metyrapone | 54-36-4 | 50mg |
| GA8933-5mg | Mevastatin | 73573-88-3 | 5mg |
| GA8933-10mg | Mevastatin | 73573-88-3 | 10mg |
| GA8933-25mg | Mevastatin | 73573-88-3 | 25mg |
| GP5333-1g | Mexiletine hydrochloride | 5370-01-4 | 1g |
| GP5333-5g | Mexiletine hydrochloride | 5370-01-4 | 5g |
| GA3267-100mg | Mezlocillin sodum salt | 42057-22-7 | 100mg |
| GA3267-500mg | Mezlocillin sodum salt | 42057-22-7 | 500mg |
| GW0254-5mg | MI-2 [MALT1 Inhibitor] | 1047953-91-2 | 5mg |
| GW0254-25mg | MI-2 [MALT1 Inhibitor] | 1047953-91-2 | 25mg |
| GX5973-25mg | Micafungin sodium | 208538-73-2 | 25mg |
| GX5973-100mg | Micafungin sodium | 208538-73-2 | 100mg |
| GA8311-1g | Miconazole | 22916-47-8 | 1g |
| GA8311-5g | Miconazole | 22916-47-8 | 5g |
| GA8311-25g | Miconazole | 22916-47-8 | 25g |
| GA3642-1g | Miconazole nitrate salt | 22832-87-7 | 1g |
| GA3642-5g | Miconazole nitrate salt | 22832-87-7 | 5g |
| GA3642-25g | Miconazole nitrate salt | 22832-87-7 | 25g |
| GP7563-1g | Midodrine hydrochloride | 43218-56-0 | 1g |
| GP8226-100mg | Mifepristone | 84371-65-3 | 100mg |
| GP8226-1g | Mifepristone | 84371-65-3 | 1g |
| GW2470-10mg | Mildronate dihydrate | 86426-17-7 | 10mg |
| GW2470-25mg | Mildronate dihydrate | 86426-17-7 | 25mg |
| GL2721-100mg | Miltefosine | 58066-85-6 | 100mg |
| GL2721-1g | Miltefosine | 58066-85-6 | 1g |
| GL2721-5g | Miltefosine | 58066-85-6 | 5g |
| GX1229-250ml | Mineral oil | 8042-47-5 | 250ml |
| GX1229-500ml | Mineral oil | 8042-47-5 | 500ml |
| GX1229-1l | Mineral oil | 8042-47-5 | 1l |
| GX1229-5l | Mineral oil | 8042-47-5 | 5l |
| GA7395-25mg | Minocycline hydrochloride | 13614-98-7 | 25mg |
| GA7395-100mg | Minocycline hydrochloride | 13614-98-7 | 100mg |
| GA7395-250mg | Minocycline hydrochloride | 13614-98-7 | 250mg |
| GA7395-1g | Minocycline hydrochloride | 13614-98-7 | 1g |
| GP5950-1g | Minoxidil | 38304-91-5 | 1g |
| GP5950-5g | Minoxidil | 38304-91-5 | 5g |
| GP5950-25g | Minoxidil | 38304-91-5 | 25g |
| GP8215-100mg | Minoxidil sulfate salt | 83701-22-8 | 100mg |
| GP8215-1g | Minoxidil sulfate salt | 83701-22-8 | 1g |
| GC3808-1mg | Mirabegron carbamoyl-β-D-glucuronide | 1365244-67-2 | 1mg |
| GC3808-2mg | Mirabegron carbamoyl-β-D-glucuronide | 1365244-67-2 | 2mg |
| GC3808-5mg | Mirabegron carbamoyl-β-D-glucuronide | 1365244-67-2 | 5mg |
| GP8422-100mg | Mirtazapine | 85650-52-8 | 100mg |
| GP8422-500mg | Mirtazapine | 85650-52-8 | 500mg |
| GP8422-1g | Mirtazapine | 85650-52-8 | 1g |
| GA1050-5mg | Mithramycin A | 18378-89-7 | 5mg |
| GA1050-10mg | Mithramycin A | 18378-89-7 | 10mg |
| GA1050-25mg | Mithramycin A | 18378-89-7 | 25mg |
| GC2356-1mg | Mitiglinide acyl-β-D-glucuronide | 1mg | |
| GC2356-2mg | Mitiglinide acyl-β-D-glucuronide | 2mg | |
| GC2356-5mg | Mitiglinide acyl-β-D-glucuronide | 5mg | |
| GC2356-10mg | Mitiglinide acyl-β-D-glucuronide | 10mg | |
| GA9147-1mg | Mitomycin C | 50-07-7 | 1mg |
| GA9147-5mg | Mitomycin C | 50-07-7 | 5mg |
| GA9147-10mg | Mitomycin C | 50-07-7 | 10mg |
| GA9147-50mg | Mitomycin C | 50-07-7 | 50mg |
| GP2417-100mg | Mitoxantrone | 65271-80-9 | 100mg |
| GP2417-1g | Mitoxantrone | 65271-80-9 | 1g |
| GE4193-5mg | MK-2206 dihydrochloride | 1032350-13-2 | 5mg |
| GW5073-1mg | MK-2461 | 917879-39-1 | 1mg |
| GW5073-5mg | MK-2461 | 917879-39-1 | 5mg |
| GW5073-10mg | MK-2461 | 917879-39-1 | 10mg |
| GW7013-10mg | MK-4827 tosylate | 1038915-73-9 | 10mg |
| GW7013-50mg | MK-4827 tosylate | 1038915-73-9 | 50mg |
| GL9206-5mg | MK-571 sodium salt | 115103-85-0 | 5mg |
| GL9206-25mg | MK-571 sodium salt | 115103-85-0 | 25mg |
| GC3946-5mg | MLN 4924 | 905579-51-3 | 5mg |
| GW9035-1mg | MLN0128 | 1224844-38-5 | 1mg |
| GW9035-5mg | MLN0128 | 1224844-38-5 | 5mg |
| GW9035-10mg | MLN0128 | 1224844-38-5 | 10mg |
| GL5377-10mg | MnTBAP chloride | 55266-18-7 | 10mg |
| GL5377-50mg | MnTBAP chloride | 55266-18-7 | 50mg |
| GL8780-10mg | MnTMPyP pentachloride | 125565-45-9 | 10mg |
| GL8780-50mg | MnTMPyP pentachloride | 125565-45-9 | 50mg |
| GX8738-500g | Molecular sieve 13X, 0.4-0.8 mm beads (8.5 Angstrom pore size) | 63231-69-6 | 500g |
| GX7122-500g | Molecular sieve 13X, 3-5 mm beads (8.5 Angstrom pore size) | 63231-69-6 | 500g |
| GX7122-5kg | Molecular sieve 13X, 3-5 mm beads (8.5 Angstrom pore size) | 63231-69-6 | 5kg |
| GX1569-500g | Molecular sieve 13X, powder (8.5 Angstrom pore size) | 63231-69-6 | 500g |
| GX1358-500g | Molecular sieve 3A, 0.4-0.8 mm beads (3 Angstrom pore size) | 500g | |
| GX1505-500g | Molecular sieve 3A, 3 - 5 mm, beads | 308080-99-1 | 500g |
| GX1505-1kg | Molecular sieve 3A, 3 - 5 mm, beads | 308080-99-1 | 1kg |
| GX5452-1kg | Molecular sieve 3A, powder (3 Angstrom pore size) | 1kg | |
| GX8202-500g | Molecular sieve 4A, 2-3 mm beads (4 Angstrom pore size) | 500g | |
| GX7674-500g | Molecular sieve 4A, 3-5 mm beads (4 Angstrom pore size) | 500g | |
| GX7863-500g | Molecular sieve 4A, 3-5 mm beads (4 Angstrom pore size) | 70955-01-0 | 500g |
| GX7863-1kg | Molecular sieve 4A, 3-5 mm beads (4 Angstrom pore size) | 70955-01-0 | 1kg |
| GX7674-1kg | Molecular sieve 4A, 3-5 mm beads (4 Angstrom pore size) | 1kg | |
| GX2780-500g | Molecular sieve 4A, powder (4 Angstrom pore size) | 500g | |
| GX2780-1kg | Molecular sieve 4A, powder (4 Angstrom pore size) | 1kg | |
| GX7192-500g | Molecular sieve 5A, 1.6 - 2.5 mm beads (5 Angstrom pore size) | 69912-79-4 | 500g |
| GX4420-500g | Molecular sieve 5A, 3-5 mm beads (5 Angstrom pore size) | 500g | |
| GX1049-500g | Molecular sieve, 3A, 1.6 - 2.5 mm, beads | 308080-99-1 | 500g |
| GX1049-1kg | Molecular sieve, 3A, 1.6 - 2.5 mm, beads | 308080-99-1 | 1kg |
| GX1049-5kg | Molecular sieve, 3A, 1.6 - 2.5 mm, beads | 308080-99-1 | 5kg |
| GL1846-1g | Molsidomine | 25717-80-0 | 1g |
| GX5774-25g | Molybdenum boride, 98+% | 12006-98-3 | 25g |
| GX5774-100g | Molybdenum boride, 98+% | 12006-98-3 | 100g |
| GX2434-50g | Molybdenum boride, 99% | 12006-99-4 | 50g |
| GX5267-10g | Molybdenum boride, 99+% | 12007-97-5 | 10g |
| GX5267-50g | Molybdenum boride, 99+% | 12007-97-5 | 50g |
| GX9911-50x50mm | Molybdenum Foil 0.025mm, 99.9+% | 7439-98-7 | 50x50mm |
| GX9911-100x100mm | Molybdenum Foil 0.025mm, 99.9+% | 7439-98-7 | 100x100mm |
| GX9911-150x150mm | Molybdenum Foil 0.025mm, 99.9+% | 7439-98-7 | 150x150mm |
| GX4593-100x200mm | Molybdenum Foil 0.1 mm, plane, shiny, 99.95% | 7439-98-7 | 100x200mm |
| GX4416-100x100mm | Molybdenum Foil 0.15mm, 99.95% | 7439-98-7 | 100x100mm |
| GX4416-100x200mm | Molybdenum Foil 0.15mm, 99.95% | 7439-98-7 | 100x200mm |
| GX2552-100x100mm | Molybdenum Foil 0.1mm, 99.95% | 7439-98-7 | 100x100mm |
| GX2552-100x200mm | Molybdenum Foil 0.1mm, 99.95% | 7439-98-7 | 100x200mm |
| GX8943-50x50mm | Molybdenum Foil 0.25mm, 99.9+% | 7439-98-7 | 50x50mm |
| GX8943-100x100mm | Molybdenum Foil 0.25mm, 99.9+% | 7439-98-7 | 100x100mm |
| GX8943-150x150mm | Molybdenum Foil 0.25mm, 99.9+% | 7439-98-7 | 150x150mm |
| GX1246-100x100mm | Molybdenum Foil 0.2mm, 99.95% | 7439-98-7 | 100x100mm |
| GX1246-100x200mm | Molybdenum Foil 0.2mm, 99.95% | 7439-98-7 | 100x200mm |
| GX1962-100x200mm | Molybdenum Foil 0.3mm, 99.95% | 7439-98-7 | 100x200mm |
| GX9163-100x200mm | Molybdenum Foil 0.5mm, 99.95% | 7439-98-7 | 100x200mm |
| GX9760-100x100mm | Molybdenum Foil 1.0mm, 99.9+% | 7439-98-7 | 100x100mm |
| GX9760-100x200mm | Molybdenum Foil 1.0mm, 99.9+% | 7439-98-7 | 100x200mm |
| GX9760-150x150mm | Molybdenum Foil 1.0mm, 99.9+% | 7439-98-7 | 150x150mm |
| GX5354-100x100mm | Molybdenum Foil0.05mm, 99.9+% | 7439-98-7 | 100x100mm |
| GX5354-150x150mm | Molybdenum Foil0.05mm, 99.9+% | 7439-98-7 | 150x150mm |
| GX2699-25g | Molybdenum Pellets 6 x 12 mm, 99.9+% | 7439-98-7 | 25g |
| GX2699-100g | Molybdenum Pellets 6 x 12 mm, 99.9+% | 7439-98-7 | 100g |
| GX9003-25g | Molybdenum Pellets‚6.35 x 6.35 mm, vacuum melted, 99.98% | 7439-98-7 | 25g |
| GX9003-100g | Molybdenum Pellets‚6.35 x 6.35 mm, vacuum melted, 99.98% | 7439-98-7 | 100g |
| GX3538-100g | Molybdenum Powder max. 100 micron, 99.9% | 7439-98-7 | 100g |
| GX3538-500g | Molybdenum Powder max. 100 micron, 99.9% | 7439-98-7 | 500g |
| GX4223-100g | Molybdenum Powder, 2-5 micron, 99.95+% | 7439-98-7 | 100g |
| GX4223-500g | Molybdenum Powder, 2-5 micron, 99.95+% | 7439-98-7 | 500g |
| GX7974-1m | Molybdenum Rod 1 mm diameter, 99.95% | 7439-98-7 | 1m |
| GX9336-1m | Molybdenum Rod 1.5 mm diameter, 99.95% | 7439-98-7 | 1m |
| GX8980-100mm | Molybdenum Rod 10 mm diameter, 99.95% | 7439-98-7 | 100mm |
| GX8980-250mm | Molybdenum Rod 10 mm diameter, 99.95% | 7439-98-7 | 250mm |
| GX0906-100mm | Molybdenum Rod 12 mm diameter, 99.9+% | 7439-98-7 | 100mm |
| GX8666-500mm | Molybdenum Rod 2.0 mm diameter, 99.9+% | 7439-98-7 | 500mm |
| GX8666-1m | Molybdenum Rod 2.0 mm diameter, 99.9+% | 7439-98-7 | 1m |
| GX3152-500mm | Molybdenum Rod 2.5 mm diameter, 99.9+% | 7439-98-7 | 500mm |
| GX2933-100mm | Molybdenum Rod 20 mm diameter, 99.9+% | 7439-98-7 | 100mm |
| GX2933-500mm | Molybdenum Rod 20 mm diameter, 99.9+% | 7439-98-7 | 500mm |
| GX6474-500mm | Molybdenum Rod 3.0 mm diameter, 99.9+% | 7439-98-7 | 500mm |
| GX9467-100mm | Molybdenum Rod 30 mm diameter, 99.9+% | 7439-98-7 | 100mm |
| GX5235-250mm | Molybdenum Rod 4.0 mm diameter, 99.9+% | 7439-98-7 | 250mm |
| GX5235-500mm | Molybdenum Rod 4.0 mm diameter, 99.9+% | 7439-98-7 | 500mm |
| GX1673-100mm | Molybdenum Rod 5.0 mm diameter, 99.95% | 7439-98-7 | 100mm |
| GX1673-250mm | Molybdenum Rod 5.0 mm diameter, 99.95% | 7439-98-7 | 250mm |
| GX1673-500mm | Molybdenum Rod 5.0 mm diameter, 99.95% | 7439-98-7 | 500mm |
| GX4022-250mm | Molybdenum Rod 6.0 mm diameter, 99.9+% | 7439-98-7 | 250mm |
| GX3370-250mm | Molybdenum Rod 8.0 mm diameter, 99.9+% | 7439-98-7 | 250mm |
| GX9615-100x100mm | Molybdenum Sheet 1.5mm, 99.9+% | 7439-98-7 | 100x100mm |
| GX3862-100x100mm | Molybdenum Sheet 2.5mm, 99.9+% | 7439-98-7 | 100x100mm |
| GX9338-100x100mm | Molybdenum Sheet 2mm, 99.9+% | 7439-98-7 | 100x100mm |
| GX6521-100x100mm | Molybdenum Sheet 3mm, 99.9+% | 7439-98-7 | 100x100mm |
| GX2864-100g | Molybdenum silicide, 99.5% | 12136-78-6 | 100g |
| GX2864-250g | Molybdenum silicide, 99.5% | 12136-78-6 | 250g |
| GX7396-50m | Molybdenum Wire 0.1 mm diameter, 99.95% | 7439-98-7 | 50m |
| GX7396-100m | Molybdenum Wire 0.1 mm diameter, 99.95% | 7439-98-7 | 100m |
| GX7146-25m | Molybdenum Wire 0.25 mm diameter, 99.95% | 7439-98-7 | 25m |
| GX7146-100m | Molybdenum Wire 0.25 mm diameter, 99.95% | 7439-98-7 | 100m |
| GX7025-25m | Molybdenum Wire 0.3 mm diameter, 99.95% | 7439-98-7 | 25m |
| GX7025-100m | Molybdenum Wire 0.3 mm diameter, 99.95% | 7439-98-7 | 100m |
| GX3073-25m | Molybdenum Wire 0.5 mm diameter, 99.95% | 7439-98-7 | 25m |
| GX3073-100m | Molybdenum Wire 0.5 mm diameter, 99.95% | 7439-98-7 | 100m |
| GX7237-10m | Molybdenum Wire 0.7 mm diameter, 99.95% | 7439-98-7 | 10m |
| GX7237-25m | Molybdenum Wire 0.7 mm diameter, 99.95% | 7439-98-7 | 25m |
| GX4703-5m | Molybdenum Wire 1.0 mm diameter, 99.95% | 7439-98-7 | 5m |
| GX4703-25m | Molybdenum Wire 1.0 mm diameter, 99.95% | 7439-98-7 | 25m |
| GX0574-1m | Molybdenum Wire 1.5 mm diameter, 99.95% | 7439-98-7 | 1m |
| GX0574-5m | Molybdenum Wire 1.5 mm diameter, 99.95% | 7439-98-7 | 5m |
| GX0175-1m | Molybdenum Wire 2.0 mm diameter, 99.95% | 7439-98-7 | 1m |
| GX0175-5m | Molybdenum Wire 2.0 mm diameter, 99.95% | 7439-98-7 | 5m |
| GX1923-100g | Molybdenum(II) carbide, 99.5+% | 12069-89-5 | 100g |
| GX1923-250g | Molybdenum(II) carbide, 99.5+% | 12069-89-5 | 250g |
| GX4987-10g | Molybdenum(IV) disulfide Nanopowder, 99 % | 1317-33-5 | 10g |
| GX4987-25g | Molybdenum(IV) disulfide Nanopowder, 99 % | 1317-33-5 | 25g |
| GX0932-25g | Molybdenum(IV) oxide, 99+% | 18868-43-4 | 25g |
| GX0932-100g | Molybdenum(IV) oxide, 99+% | 18868-43-4 | 100g |
| GX2871-250g | Molybdenum(IV) sulfide, 98+% | 1317-33-5 | 250g |
| GX2871-500g | Molybdenum(IV) sulfide, 98+% | 1317-33-5 | 500g |
| GX2871-1kg | Molybdenum(IV) sulfide, 98+% | 1317-33-5 | 1kg |
| GX6266-250g | Molybdenum(VI) oxide, 99.0% | 1313-27-5 | 250g |
| GX6266-500g | Molybdenum(VI) oxide, 99.0% | 1313-27-5 | 500g |
| GX8007-100g | Molybdenum(VI) oxide, 99.9% | 1313-27-5 | 100g |
| GX8007-250g | Molybdenum(VI) oxide, 99.9% | 1313-27-5 | 250g |
| GX8007-1kg | Molybdenum(VI) oxide, 99.9% | 1313-27-5 | 1kg |
| GK8458-100g | Molybdic acid, 85% | 7782-91-4 | 100g |
| GK8458-250g | Molybdic acid, 85% | 7782-91-4 | 250g |
| GK8458-500g | Molybdic acid, 85% | 7782-91-4 | 500g |
| GK9021-100g | Molybdic acid, 85%, ACS grade | 7782-91-4 | 100g |
| GK9021-500g | Molybdic acid, 85%, ACS grade | 7782-91-4 | 500g |
| GW7607-1mg | Momelotinib | 1056634-68-4 | 1mg |
| GW7607-5mg | Momelotinib | 1056634-68-4 | 5mg |
| GW7607-10mg | Momelotinib | 1056634-68-4 | 10mg |
| GP3167-1g | Mometasone furoate | 83919-23-7 | 1g |
| GP3167-5g | Mometasone furoate | 83919-23-7 | 5g |
| GA4916-500mg | Monensin sodium salt | 22373-78-0 | 500mg |
| GA4916-1g | Monensin sodium salt | 22373-78-0 | 1g |
| GA4916-5g | Monensin sodium salt | 22373-78-0 | 5g |
| GW3578-100mg | Monosultap | 29547-00-0 | 100mg |
| GW3578-250mg | Monosultap | 29547-00-0 | 250mg |
| GX0261-250mg | Montelukast sodium salt | 151767-02-1 | 250mg |
| GX0261-1g | Montelukast sodium salt | 151767-02-1 | 1g |
| GB2811-100g | MOPS | 1132-61-2 | 100g |
| GB2811-500g | MOPS | 1132-61-2 | 500g |
| GB2811-1kg | MOPS | 1132-61-2 | 1kg |
| GB5755-100g | MOPS hemisodium salt | 117961-20-3 | 100g |
| GB5755-250g | MOPS hemisodium salt | 117961-20-3 | 250g |
| GB8397-25g | MOPS sodium salt | 71119-22-7 | 25g |
| GB8397-100g | MOPS sodium salt | 71119-22-7 | 100g |
| GB8397-250g | MOPS sodium salt | 71119-22-7 | 250g |
| GB8397-500g | MOPS sodium salt | 71119-22-7 | 500g |
| GB8397-1kg | MOPS sodium salt | 71119-22-7 | 1kg |
| GE4590-250ml | MOPS, 1M solution | 1132-61-2 | 250ml |
| GE4590-1l | MOPS, 1M solution | 1132-61-2 | 1l |
| GB3672-25g | MOPS, 99.5% | 1132-61-2 | 25g |
| GB3672-100g | MOPS, 99.5% | 1132-61-2 | 100g |
| GB3672-250g | MOPS, 99.5% | 1132-61-2 | 250g |
| GB3672-500g | MOPS, 99.5% | 1132-61-2 | 500g |
| GB3672-1kg | MOPS, 99.5% | 1132-61-2 | 1kg |
| GB6742-10g | MOPSO | 68399-77-9 | 10g |
| GB6742-25g | MOPSO | 68399-77-9 | 25g |
| GB6742-100g | MOPSO | 68399-77-9 | 100g |
| GB6742-250g | MOPSO | 68399-77-9 | 250g |
| GB6742-500g | MOPSO | 68399-77-9 | 500g |
| GB3228-25g | MOPSO sodium salt | 79803-73-9 | 25g |
| GB3228-100g | MOPSO sodium salt | 79803-73-9 | 100g |
| GB3228-250g | MOPSO sodium salt | 79803-73-9 | 250g |
| GB3228-500g | MOPSO sodium salt | 79803-73-9 | 500g |
| GA4442-100mg | Morantel citrate salt | 69525-81-1 | 100mg |
| GT3894-5g | Mordant Blue 13 (C.I. 16680) | 1058-92-0 | 5g |
| GT7206-25g | Mordant Orange 1 | 2243-76-7 | 25g |
| GT7206-100g | Mordant Orange 1 | 2243-76-7 | 100g |
| GL8475-1g | Morin hydrate | 654055-01-3 | 1g |
| GL8475-5g | Morin hydrate | 654055-01-3 | 5g |
| GL8475-25g | Morin hydrate | 654055-01-3 | 25g |
| GP7040-5g | Moroxydine hydrochloride | 3160-91-6 | 5g |
| GP7040-25g | Moroxydine hydrochloride | 3160-91-6 | 25g |
| GP7199-10mg | Mosapride citrate salt dihydrate | 636582-62-2 | 10mg |
| GW4075-1mg | Motesanib | 453562-69-1 | 1mg |
| GW4075-5mg | Motesanib | 453562-69-1 | 5mg |
| GW4075-10mg | Motesanib | 453562-69-1 | 10mg |
| GL3071-1mg | MOTS-c (human) | 1627580-64-6 | 1mg |
| GL3071-5mg | MOTS-c (human) | 1627580-64-6 | 5mg |
| GW2548-1mg | MOTS-c (K14Q Mutant) (human) | 1mg | |
| GW2548-5mg | MOTS-c (K14Q Mutant) (human) | 5mg | |
| GA5791-250mg | Moxalactam sodium salt | 64953-12-4 | 250mg |
| GA5791-1g | Moxalactam sodium salt | 64953-12-4 | 1g |
| GA5791-5g | Moxalactam sodium salt | 64953-12-4 | 5g |
| GW5324-25mg | Moxidectin | 113507-06-5 | 25mg |
| GA9781-50mg | Moxifloxacin hydrochloride | 186826-86-8 | 50mg |
| GA9781-100mg | Moxifloxacin hydrochloride | 186826-86-8 | 100mg |
| GA9781-250mg | Moxifloxacin hydrochloride | 186826-86-8 | 250mg |
| GA9781-500mg | Moxifloxacin hydrochloride | 186826-86-8 | 500mg |
| GA9781-1g | Moxifloxacin hydrochloride | 186826-86-8 | 1g |
| GW4614-10mg | MPAC-Br | 177093-58-2 | 10mg |
| GW4614-50mg | MPAC-Br | 177093-58-2 | 50mg |
| GW4614-250mg | MPAC-Br | 177093-58-2 | 250mg |
| GW0372-1mg | MPI_5a | 1259296-46-2 | 1mg |
| GW0372-5mg | MPI_5a | 1259296-46-2 | 5mg |
| GW0372-10mg | MPI_5a | 1259296-46-2 | 10mg |
| GW6520-1mg | MPI-0479605 hydrochloride | 1246529-32-7 | 1mg |
| GW6520-5mg | MPI-0479605 hydrochloride | 1246529-32-7 | 5mg |
| GW6520-10mg | MPI-0479605 hydrochloride | 1246529-32-7 | 10mg |
| GL5031-1mg | MS-1020 | 1255516-86-9 | 1mg |
| GW4082-1mg | MSA-2 | 129425-81-6 | 1mg |
| GW4082-5mg | MSA-2 | 129425-81-6 | 5mg |
| GW4082-10mg | MSA-2 | 129425-81-6 | 10mg |
| GL7225-5mg | MTEP | 329205-68-7 | 5mg |
| GL7225-25mg | MTEP | 329205-68-7 | 25mg |
| GL1695-10mg | MTSSL | 81213-52-7 | 10mg |
| GL1695-50mg | MTSSL | 81213-52-7 | 50mg |
| GT1121-250ml | Mucicarmine stock solution | 250ml | |
| GT1121-1l | Mucicarmine stock solution | 1l | |
| GC2824-1mg | muco-inositol | 488-55-1 | 1mg |
| GC2824-2mg | muco-inositol | 488-55-1 | 2mg |
| GC2824-5mg | muco-inositol | 488-55-1 | 5mg |
| GC2824-10mg | muco-inositol | 488-55-1 | 10mg |
| GC2824-25mg | muco-inositol | 488-55-1 | 25mg |
| GA2184-50mg | Mupirocin | 12650-69-0 | 50mg |
| GA2184-100mg | Mupirocin | 12650-69-0 | 100mg |
| GA2184-1g | Mupirocin | 12650-69-0 | 1g |
| GA7711-100mg | Mupirocin calcium salt | 115074-43-6 | 100mg |
| GA7711-250mg | Mupirocin calcium salt | 115074-43-6 | 250mg |
| GA7711-500mg | Mupirocin calcium salt | 115074-43-6 | 500mg |
| GA7711-1g | Mupirocin calcium salt | 115074-43-6 | 1g |
| GA8651-100mg | Mupirocin lithium salt | 73346-79-9 | 100mg |
| GA8651-500mg | Mupirocin lithium salt | 73346-79-9 | 500mg |
| GA8651-1g | Mupirocin lithium salt | 73346-79-9 | 1g |
| GT8960-5g | Murexide (C.I. 56085) | 3051-09-0 | 5g |
| GT8960-10g | Murexide (C.I. 56085) | 3051-09-0 | 10g |
| GT8960-25g | Murexide (C.I. 56085) | 3051-09-0 | 25g |
| GT8960-50g | Murexide (C.I. 56085) | 3051-09-0 | 50g |
| GT8960-100g | Murexide (C.I. 56085) | 3051-09-0 | 100g |
| GL9489-250ug | Muristerone A | 38778-30-2 | 250ug |
| GL9489-1mg | Muristerone A | 38778-30-2 | 1mg |
| GA8908-1mg | Mutolide | 277749-34-5 | 1mg |
| GA8908-5mg | Mutolide | 277749-34-5 | 5mg |
| GA2175-5g | Myclobutanil | 88671-89-0 | 5g |
| GA2175-10g | Myclobutanil | 88671-89-0 | 10g |
| GA8210-100mg | Mycophenolic acid | 24280-93-1 | 100mg |
| GA8210-500mg | Mycophenolic acid | 24280-93-1 | 500mg |
| GC5220-1mg | Mycophenolic acid acyl-b-D-glucuronide | 99043-04-6 | 1mg |
| GC5220-2mg | Mycophenolic acid acyl-b-D-glucuronide | 99043-04-6 | 2mg |
| GC5220-5mg | Mycophenolic acid acyl-b-D-glucuronide | 99043-04-6 | 5mg |
| GC5220-10mg | Mycophenolic acid acyl-b-D-glucuronide | 99043-04-6 | 10mg |
| GC3927-1mg | Mycophenolic acid b-D-glucuronide | 31528-44-6 | 1mg |
| GC3927-2mg | Mycophenolic acid b-D-glucuronide | 31528-44-6 | 2mg |
| GC3927-5mg | Mycophenolic acid b-D-glucuronide | 31528-44-6 | 5mg |
| GC3927-10mg | Mycophenolic acid b-D-glucuronide | 31528-44-6 | 10mg |
| GC3274-1mg | Mycophenolic acid phenolic b-D-glucoside | 55533-52-3 | 1mg |
| GC3274-2mg | Mycophenolic acid phenolic b-D-glucoside | 55533-52-3 | 2mg |
| GC3274-5mg | Mycophenolic acid phenolic b-D-glucoside | 55533-52-3 | 5mg |
| GC3274-10mg | Mycophenolic acid phenolic b-D-glucoside | 55533-52-3 | 10mg |
| GC4902-25g | myo-Inositol | 87-89-8 | 25g |
| GC4902-100g | myo-Inositol | 87-89-8 | 100g |
| GC4902-250g | myo-Inositol | 87-89-8 | 250g |
| GC4902-500g | myo-Inositol | 87-89-8 | 500g |
| GC4902-1kg | myo-Inositol | 87-89-8 | 1kg |
| GL5441-100mg | Myricetin | 529-44-2 | 100mg |
| GL5441-250mg | Myricetin | 529-44-2 | 250mg |
| GL5441-1g | Myricetin | 529-44-2 | 1g |
| GL9729-5mg | Myriocin | 35891-70-4 | 5mg |
| GL9729-25mg | Myriocin | 35891-70-4 | 25mg |
| GL7804-25g | Myristic acid | 544-63-8 | 25g |
| GK3652-100ml | Myristoyl chloride | 112-64-1 | 100ml |
| GK3652-500ml | Myristoyl chloride | 112-64-1 | 500ml |
| GP0735-25g | Myristyltrimethylammonium bromide | 1119-97-7 | 25g |
| GP0735-100g | Myristyltrimethylammonium bromide | 1119-97-7 | 100g |
| GP0735-250g | Myristyltrimethylammonium bromide | 1119-97-7 | 250g |
| GP0735-500g | Myristyltrimethylammonium bromide | 1119-97-7 | 500g |
| GP0735-1kg | Myristyltrimethylammonium bromide | 1119-97-7 | 1kg |
| GW8199-100ug | Myxochelin A | 120243-02-9 | 100ug |
| GW8199-1mg | Myxochelin A | 120243-02-9 | 1mg |
| GL8860-100mg | N-(+)-Biotinyl-6-aminohexanoic acid | 72040-64-3 | 100mg |
| GL8860-500mg | N-(+)-Biotinyl-6-aminohexanoic acid | 72040-64-3 | 500mg |
| GK9342-5g | N-(1-Naphthyl)ethylenediamine dihydrochloride | 1465-25-4 | 5g |
| GK9342-25g | N-(1-Naphthyl)ethylenediamine dihydrochloride | 1465-25-4 | 25g |
| GK9342-100g | N-(1-Naphthyl)ethylenediamine dihydrochloride | 1465-25-4 | 100g |
| GW9929-50mg | N-(2-Aminoethyl)biotinamide hydrochloride | 111822-45-8 | 50mg |
| GW9929-1g | N-(2-Aminoethyl)biotinamide hydrochloride | 111822-45-8 | 1g |
| GM1937-1g | N-(2-Aminoethyl)glycine | 24123-14-6 | 1g |
| GE4065-1g | N-(2-Chloro-4-pyridyl)-N''-phenylurea | 68157-60-8 | 1g |
| GE5415-1g | N-(2-Hydroxy-3-sulfopropyl)- 3,5-dimethoxyaniline sodium salt | 82692-88-4 | 1g |
| GM8952-5g | N-(2-Hydroxyethyl)iminodiacetic acid | 93-62-9 | 5g |
| GM8952-25g | N-(2-Hydroxyethyl)iminodiacetic acid | 93-62-9 | 25g |
| GW4617-100mg | N-(3-Bromopropyl)-7-nitro-2,1,3-benzoxadiazol-4-amine | 1246965-49-0 | 100mg |
| GW4617-500mg | N-(3-Bromopropyl)-7-nitro-2,1,3-benzoxadiazol-4-amine | 1246965-49-0 | 500mg |
| GW9845-5mg | N-(3-Hydroxydecanoyl)-L-homoserine lactone | 192883-12-8 | 5mg |
| GW9845-25mg | N-(3-Hydroxydecanoyl)-L-homoserine lactone | 192883-12-8 | 25mg |
| GW1310-25mg | N-(3-Hydroxydecenoyl)-DL-homoserine lactone | 929222-14-0 | 25mg |
| GW1310-250mg | N-(3-Hydroxydecenoyl)-DL-homoserine lactone | 929222-14-0 | 250mg |
| GW6140-25mg | N-(3-Hydroxydodecanoyl)-DL-homoserine lactone | 182359-60-0 | 25mg |
| GW6140-250mg | N-(3-Hydroxydodecanoyl)-DL-homoserine lactone | 182359-60-0 | 250mg |
| GW2810-25mg | N-(3-Hydroxyoctanoyl)-DL-homoserine lactone | 853799-77-6 | 25mg |
| GW2810-250mg | N-(3-Hydroxyoctanoyl)-DL-homoserine lactone | 853799-77-6 | 250mg |
| GW6930-10mg | N-(3-Hydroxyoctanoyl)-L-homoserine lactone | 192883-14-0 | 10mg |
| GW6930-25mg | N-(3-Hydroxyoctanoyl)-L-homoserine lactone | 192883-14-0 | 25mg |
| GW6859-20mg | N-(3-Hydroxytetradecanoyl)-DL-homoserine lactone | 172670-99-4 | 20mg |
| GW6859-250mg | N-(3-Hydroxytetradecanoyl)-DL-homoserine lactone | 172670-99-4 | 250mg |
| GW1628-20mg | N-(3-Hydroxytetradecanoyl)-L-homoserine lactone | 364749-99-5 | 20mg |
| GW1628-250mg | N-(3-Hydroxytetradecanoyl)-L-homoserine lactone | 364749-99-5 | 250mg |
| GW4695-50mg | N-(3-Isothiocyanatobenzyl)-4-[5-(4-methoxyphenyl)-2-oxazolyl]pyridinium bromide | 155862-89-8 | 50mg |
| GW4695-250mg | N-(3-Isothiocyanatobenzyl)-4-[5-(4-methoxyphenyl)-2-oxazolyl]pyridinium bromide | 155862-89-8 | 250mg |
| GW1888-50mg | N-(3-Isothiocyanatopropyl)-4-(5''-(4''''-methoxyphenyl)-2''-oxazolyl) pyridinium bromide | 1034443-41-8 | 50mg |
| GW1888-250mg | N-(3-Isothiocyanatopropyl)-4-(5''-(4''''-methoxyphenyl)-2''-oxazolyl) pyridinium bromide | 1034443-41-8 | 250mg |
| GW4930-10mg | N-(3-Oxobutanoyl)-DL-homoserine lactone | 106983-29-3 | 10mg |
| GW4930-50mg | N-(3-Oxobutanoyl)-DL-homoserine lactone | 106983-29-3 | 50mg |
| GW5328-10mg | N-(3-Oxobutanoyl)-L-homoserine lactone | 148433-27-6 | 10mg |
| GW5328-100mg | N-(3-Oxobutanoyl)-L-homoserine lactone | 148433-27-6 | 100mg |
| GW8862-10mg | N-(3-Oxodecanoyl)-DL-homoserine lactone | 913697-62-8 | 10mg |
| GW8862-50mg | N-(3-Oxodecanoyl)-DL-homoserine lactone | 913697-62-8 | 50mg |
| GW4561-10mg | N-(3-Oxodecanoyl)-L-homoserine lactone | 147795-40-2 | 10mg |
| GW4561-100mg | N-(3-Oxodecanoyl)-L-homoserine lactone | 147795-40-2 | 100mg |
| GW4581-10mg | N-(3-Oxododecanoyl)-L-homoserine lactone | 168982-69-2 | 10mg |
| GW4581-20mg | N-(3-Oxododecanoyl)-L-homoserine lactone | 168982-69-2 | 20mg |
| GW4581-100mg | N-(3-Oxododecanoyl)-L-homoserine lactone | 168982-69-2 | 100mg |
| GW1711-10mg | N-(3-Oxohexadecanoyl)-DL-homoserine lactone | 1071479-82-7 | 10mg |
| GW1711-100mg | N-(3-Oxohexadecanoyl)-DL-homoserine lactone | 1071479-82-7 | 100mg |
| GW6157-10mg | N-(3-Oxohexadecanoyl)-L-homoserine lactone | 925448-37-9 | 10mg |
| GW6157-50mg | N-(3-Oxohexadecanoyl)-L-homoserine lactone | 925448-37-9 | 50mg |
| GW3102-10mg | N-(3-Oxononanoyl)-L-homoserine lactone | 441350-70-5 | 10mg |
| GW3102-50mg | N-(3-Oxononanoyl)-L-homoserine lactone | 441350-70-5 | 50mg |
| GW3536-25mg | N-(3-Oxooctanoyl)-DL-homoserine lactone | 106983-27-1 | 25mg |
| GW3536-100mg | N-(3-Oxooctanoyl)-DL-homoserine lactone | 106983-27-1 | 100mg |
| GK8784-10mg | N-(3-Oxooctanoyl)-L-homoserine lactone | 147795-39-9 | 10mg |
| GK8784-100mg | N-(3-Oxooctanoyl)-L-homoserine lactone | 147795-39-9 | 100mg |
| GW8446-10mg | N-(3-Oxopentanoyl)-L-homoserine lactone | 148433-21-0 | 10mg |
| GW8446-50mg | N-(3-Oxopentanoyl)-L-homoserine lactone | 148433-21-0 | 50mg |
| GW7992-10mg | N-(3-Oxotetradecanoyl)-DL-homoserine lactone | 503610-29-5 | 10mg |
| GW7992-100mg | N-(3-Oxotetradecanoyl)-DL-homoserine lactone | 503610-29-5 | 100mg |
| GW6025-10mg | N-(3-Oxotetradecanoyl)-L-homoserine lactone | 177158-19-9 | 10mg |
| GW6025-50mg | N-(3-Oxotetradecanoyl)-L-homoserine lactone | 177158-19-9 | 50mg |
| GW3519-10mg | N-(3-Oxoundecanoyl)-L-homoserine lactone | 216596-70-2 | 10mg |
| GW3519-50mg | N-(3-Oxoundecanoyl)-L-homoserine lactone | 216596-70-2 | 50mg |
| GW1179-5mg | N-(3-Succinimidyloxy-carbonyl-phenyl)-methyl-4-(2-(6-(3,4-dihydro-2H-1-benzopyranyl))-5-oxazolyl)-pyridinium bromide | 155863-03-9 | 5mg |
| GW1179-50mg | N-(3-Succinimidyloxy-carbonyl-phenyl)-methyl-4-(2-(6-(3,4-dihydro-2H-1-benzopyranyl))-5-oxazolyl)-pyridinium bromide | 155863-03-9 | 50mg |
| GW1179-250mg | N-(3-Succinimidyloxy-carbonyl-phenyl)-methyl-4-(2-(6-(3,4-dihydro-2H-1-benzopyranyl))-5-oxazolyl)-pyridinium bromide | 155863-03-9 | 250mg |
| GW5624-5mg | N-(3-Succinimidyloxy-carbonyl-phenyl)-methyl-4-(5''-(4''''-methoxy-phenyl)-2''-oxazolyl)-pyridinium bromide | 155862-95-6 | 5mg |
| GW5624-50mg | N-(3-Succinimidyloxy-carbonyl-phenyl)-methyl-4-(5''-(4''''-methoxy-phenyl)-2''-oxazolyl)-pyridinium bromide | 155862-95-6 | 50mg |
| GW5624-250mg | N-(3-Succinimidyloxy-carbonyl-phenyl)-methyl-4-(5''-(4''''-methoxy-phenyl)-2''-oxazolyl)-pyridinium bromide | 155862-95-6 | 250mg |
| GM4964-1g | N-(4-Aminobenzoyl)-L-glutamic acid | 4271-30-1 | 1g |
| GM4964-5g | N-(4-Aminobenzoyl)-L-glutamic acid | 4271-30-1 | 5g |
| GX7638-25g | N-(4-Chlorophenyl)-1,2-phenylenediamine | 68817-71-0 | 25g |
| GW4908-25mg | N-(4-Isothiocyanatobenzyl)-4-[5-(4-methoxyphenyl)-2-oxazolyl]pyridinium bromide | 155862-90-1 | 25mg |
| GW4908-50mg | N-(4-Isothiocyanatobenzyl)-4-[5-(4-methoxyphenyl)-2-oxazolyl]pyridinium bromide | 155862-90-1 | 50mg |
| GW4908-250mg | N-(4-Isothiocyanatobenzyl)-4-[5-(4-methoxyphenyl)-2-oxazolyl]pyridinium bromide | 155862-90-1 | 250mg |
| GW6967-50mg | N-(4-Methylumbelliferyl)-maleinimide | 211565-47-8 | 50mg |
| GW6967-250mg | N-(4-Methylumbelliferyl)-maleinimide | 211565-47-8 | 250mg |
| GW3829-50mg | N-(5-Fluoresceinyl)-maleinimide | 75350-46-8 | 50mg |
| GW3829-500mg | N-(5-Fluoresceinyl)-maleinimide | 75350-46-8 | 500mg |
| GW7025-10mg | N-(6-Aminohexyl)rhodamine 6G-amide bis(trifluoroacetate) | 1140505-40-3 | 10mg |
| GW7025-50mg | N-(6-Aminohexyl)rhodamine 6G-amide bis(trifluoroacetate) | 1140505-40-3 | 50mg |
| GC9049-100mg | N-(b-Hydroxyethyl)-1-deoxynojirimycin | 72432-03-2 | 100mg |
| GC9049-250mg | N-(b-Hydroxyethyl)-1-deoxynojirimycin | 72432-03-2 | 250mg |
| GC9049-500mg | N-(b-Hydroxyethyl)-1-deoxynojirimycin | 72432-03-2 | 500mg |
| GC9049-1g | N-(b-Hydroxyethyl)-1-deoxynojirimycin | 72432-03-2 | 1g |
| GK5402-100g | N-(Hydroxymethyl)phthalimide | 118-29-6 | 100g |
| GK5402-250g | N-(Hydroxymethyl)phthalimide | 118-29-6 | 250g |
| GK5402-500g | N-(Hydroxymethyl)phthalimide | 118-29-6 | 500g |
| GM7775-10mg | N-(Ketocaproyl)-L-homoserine lactone | 76924-95-3 | 10mg |
| GM7775-50mg | N-(Ketocaproyl)-L-homoserine lactone | 76924-95-3 | 50mg |
| GW5146-5mg | N-(N''-Maleinimidyl-2-ethyl)-4-(2-(6-(3,4-dihydro-2H-1-benzopyranyl))-5-oxyzolyl) pyridinium triflate | 155863-05-1 | 5mg |
| GW5146-50mg | N-(N''-Maleinimidyl-2-ethyl)-4-(2-(6-(3,4-dihydro-2H-1-benzopyranyl))-5-oxyzolyl) pyridinium triflate | 155863-05-1 | 50mg |
| GW5146-250mg | N-(N''-Maleinimidyl-2-ethyl)-4-(2-(6-(3,4-dihydro-2H-1-benzopyranyl))-5-oxyzolyl) pyridinium triflate | 155863-05-1 | 250mg |
| GM3149-5g | N-(Phosphonomethyl)glycine | 1071-83-6 | 5g |
| GM3149-25g | N-(Phosphonomethyl)glycine | 1071-83-6 | 25g |
| GM3149-100g | N-(Phosphonomethyl)glycine | 1071-83-6 | 100g |
| GM8987-5g | N-(tert-Butoxycarbonyl)-3-iodo-L-alanine methyl ester | 93267-04-0 | 5g |
| GK4999-5g | N-(tert-Butyldimethylsilyl)-N-methyl trifluoroacetamide | 77377-52-7 | 5g |
| GK4999-10g | N-(tert-Butyldimethylsilyl)-N-methyl trifluoroacetamide | 77377-52-7 | 10g |
| GK4999-25g | N-(tert-Butyldimethylsilyl)-N-methyl trifluoroacetamide | 77377-52-7 | 25g |
| GM4380-10mg | N-(β-Ketocaproyl)-L-homoserine lactone | 143537-62-6 | 10mg |
| GM4380-50mg | N-(β-Ketocaproyl)-L-homoserine lactone | 143537-62-6 | 50mg |
| GC0082-5mg | N-(ε-Aminocaproyl)-β-L-fucopyranosylamine | 35978-97-3 | 5mg |
| GC0082-10mg | N-(ε-Aminocaproyl)-β-L-fucopyranosylamine | 35978-97-3 | 10mg |
| GC0082-25mg | N-(ε-Aminocaproyl)-β-L-fucopyranosylamine | 35978-97-3 | 25mg |
| GC0082-50mg | N-(ε-Aminocaproyl)-β-L-fucopyranosylamine | 35978-97-3 | 50mg |
| GL0609-5g | N-[(3-(Anilinomethylene)-2-chloro-1-cyclohexen-1-yl)methylene]aniline monohydrochloride | 63857-00-1 | 5g |
| GL0193-1g | N-[3-(2-Furyl)acryloyl]-Phe-Gly-Gly, 97% | 64967-39-1 | 1g |
| GL4411-1g | N-[3-(2-Furyl)acryloyl]-Phe-Gly-Gly, 99% | 64967-39-1 | 1g |
| GC6997-5mg | N-5-Carboxypentyl-1-deoxygalactonojirimycin | 1240479-07-5 | 5mg |
| GC6997-10mg | N-5-Carboxypentyl-1-deoxygalactonojirimycin | 1240479-07-5 | 10mg |
| GC6997-25mg | N-5-Carboxypentyl-1-deoxygalactonojirimycin | 1240479-07-5 | 25mg |
| GC6997-50mg | N-5-Carboxypentyl-1-deoxygalactonojirimycin | 1240479-07-5 | 50mg |
| GC7526-5mg | N-Acetyl-9-azido-9-deoxy-neuraminic acid | 76487-51-9 | 5mg |
| GC7526-10mg | N-Acetyl-9-azido-9-deoxy-neuraminic acid | 76487-51-9 | 10mg |
| GC7526-25mg | N-Acetyl-9-azido-9-deoxy-neuraminic acid | 76487-51-9 | 25mg |
| GC7526-50mg | N-Acetyl-9-azido-9-deoxy-neuraminic acid | 76487-51-9 | 50mg |
| GC7526-100mg | N-Acetyl-9-azido-9-deoxy-neuraminic acid | 76487-51-9 | 100mg |
| GM2947-1g | N-Acetyl-D-alanine | 19436-52-3 | 1g |
| GM2947-5g | N-Acetyl-D-alanine | 19436-52-3 | 5g |
| GK3532-100mg | N-Acetyl-D-galactosamine | 14215-68-0 | 100mg |
| GK3532-500mg | N-Acetyl-D-galactosamine | 14215-68-0 | 500mg |
| GK3532-1g | N-Acetyl-D-galactosamine | 14215-68-0 | 1g |
| GC7987-5g | N-Acetyl-D-glucosamine | 7512-17-6 | 5g |
| GC7987-25g | N-Acetyl-D-glucosamine | 7512-17-6 | 25g |
| GC7987-100g | N-Acetyl-D-glucosamine | 7512-17-6 | 100g |
| GC7987-250g | N-Acetyl-D-glucosamine | 7512-17-6 | 250g |
| GC7987-500g | N-Acetyl-D-glucosamine | 7512-17-6 | 500g |
| GC7366-10mg | N-Acetyl-D-glucosamine 6-phosphate disodium salt | 102029-88-9 | 10mg |
| GC7366-25mg | N-Acetyl-D-glucosamine 6-phosphate disodium salt | 102029-88-9 | 25mg |
| GC4097-250g | N-Acetyl-D-glucosamine, USP grade | 7512-17-6 | 250g |
| GE3308-1g | N-Acetyl-D-leucine | 19764-30-8 | 1g |
| GE3308-5g | N-Acetyl-D-leucine | 19764-30-8 | 5g |
| GK3319-1g | N-Acetyl-D-mannosamine | 7772-94-3 | 1g |
| GK3319-5g | N-Acetyl-D-mannosamine | 7772-94-3 | 5g |
| GK3319-10g | N-Acetyl-D-mannosamine | 7772-94-3 | 10g |
| GM3168-5g | N-Acetyl-D-methionine | 1509-92-8 | 5g |
| GC5873-5mg | N-Acetyl-D-quinovosamine | 200272-62-4 | 5mg |
| GC5873-10mg | N-Acetyl-D-quinovosamine | 200272-62-4 | 10mg |
| GC5873-25mg | N-Acetyl-D-quinovosamine | 200272-62-4 | 25mg |
| GC5873-50mg | N-Acetyl-D-quinovosamine | 200272-62-4 | 50mg |
| GC5873-100mg | N-Acetyl-D-quinovosamine | 200272-62-4 | 100mg |
| GM6415-25g | N-Acetyl-DL-methionine | 1115-47-5 | 25g |
| GM6415-100g | N-Acetyl-DL-methionine | 1115-47-5 | 100g |
| GM4354-5g | N-Acetyl-DL-tryptophan | 87-32-1 | 5g |
| GM4354-25g | N-Acetyl-DL-tryptophan | 87-32-1 | 25g |
| GM4354-100g | N-Acetyl-DL-tryptophan | 87-32-1 | 100g |
| GM4354-250g | N-Acetyl-DL-tryptophan | 87-32-1 | 250g |
| GM7740-25g | N-Acetyl-DL-valine | 3067-19-4 | 25g |
| GM8485-1g | N-Acetyl-L-aspartic acid | 997-55-7 | 1g |
| GM8692-1g | N-Acetyl-L-carnosine | 56353-15-2 | 1g |
| GM8692-5g | N-Acetyl-L-carnosine | 56353-15-2 | 5g |
| GM8803-25g | N-Acetyl-L-cysteine | 616-91-1 | 25g |
| GM8803-100g | N-Acetyl-L-cysteine | 616-91-1 | 100g |
| GM8803-250g | N-Acetyl-L-cysteine | 616-91-1 | 250g |
| GM8803-500g | N-Acetyl-L-cysteine | 616-91-1 | 500g |
| GM2975-25g | N-Acetyl-L-glutamic acid | 1188-37-0 | 25g |
| GM2975-100g | N-Acetyl-L-glutamic acid | 1188-37-0 | 100g |
| GM6577-25g | N-Acetyl-L-methionine | 65-82-7 | 25g |
| GM0143-5g | N-Acetyl-L-phenylalanine | 2018-61-3 | 5g |
| GM0143-25g | N-Acetyl-L-phenylalanine | 2018-61-3 | 25g |
| GM0143-100g | N-Acetyl-L-phenylalanine | 2018-61-3 | 100g |
| GM7304-5g | N-Acetyl-L-tryptophan | 1218-34-4 | 5g |
| GM7304-10g | N-Acetyl-L-tryptophan | 1218-34-4 | 10g |
| GM7304-25g | N-Acetyl-L-tryptophan | 1218-34-4 | 25g |
| GM7304-50g | N-Acetyl-L-tryptophan | 1218-34-4 | 50g |
| GM7304-100g | N-Acetyl-L-tryptophan | 1218-34-4 | 100g |
| GM0216-25g | N-Acetyl-L-tyrosine | 537-55-3 | 25g |
| GM0216-100g | N-Acetyl-L-tyrosine | 537-55-3 | 100g |
| GM0216-250g | N-Acetyl-L-tyrosine | 537-55-3 | 250g |
| GM0216-500g | N-Acetyl-L-tyrosine | 537-55-3 | 500g |
| GM0216-1kg | N-Acetyl-L-tyrosine | 537-55-3 | 1kg |
| GM5614-5g | N-Acetyl-L-tyrosine ethyl ester monohydrate | 36546-50-6 | 5g |
| GM5614-10g | N-Acetyl-L-tyrosine ethyl ester monohydrate | 36546-50-6 | 10g |
| GM3549-10mg | N-Acetyl-S-phenyl-L-cysteine | 4775-80-8 | 10mg |
| GC8355-5mg | N-Acetyl-α-D-galactosamine 1-phosphate, disodium salt | 102029-78-7 | 5mg |
| GC8355-10mg | N-Acetyl-α-D-galactosamine 1-phosphate, disodium salt | 102029-78-7 | 10mg |
| GC8355-25mg | N-Acetyl-α-D-galactosamine 1-phosphate, disodium salt | 102029-78-7 | 25mg |
| GC8355-50mg | N-Acetyl-α-D-galactosamine 1-phosphate, disodium salt | 102029-78-7 | 50mg |
| GC6851-5mg | N-Acetyladenosine | 16265-37-5 | 5mg |
| GC6851-10mg | N-Acetyladenosine | 16265-37-5 | 10mg |
| GC6851-25mg | N-Acetyladenosine | 16265-37-5 | 25mg |
| GC6851-50mg | N-Acetyladenosine | 16265-37-5 | 50mg |
| GC6851-100mg | N-Acetyladenosine | 16265-37-5 | 100mg |
| GM1310-100g | N-Acetylglycine | 543-24-8 | 100g |
| GM1310-500g | N-Acetylglycine | 543-24-8 | 500g |
| GC7214-25mg | N-Acetylneuraminic acid | 131-48-6 | 25mg |
| GC7214-100mg | N-Acetylneuraminic acid | 131-48-6 | 100mg |
| GC7214-250mg | N-Acetylneuraminic acid | 131-48-6 | 250mg |
| GC7214-1g | N-Acetylneuraminic acid | 131-48-6 | 1g |
| GC7214-5g | N-Acetylneuraminic acid | 131-48-6 | 5g |
| GC4738-1g | N-Acetylneuraminic acid methyl ester | 22900-11-4 | 1g |
| GC4738-2g | N-Acetylneuraminic acid methyl ester | 22900-11-4 | 2g |
| GC4738-5g | N-Acetylneuraminic acid methyl ester | 22900-11-4 | 5g |
| GC4738-10g | N-Acetylneuraminic acid methyl ester | 22900-11-4 | 10g |
| GC4268-5mg | N-Azidoacetyl-D-glucosamine | 92659-90-0 | 5mg |
| GC4268-10mg | N-Azidoacetyl-D-glucosamine | 92659-90-0 | 10mg |
| GC4268-25mg | N-Azidoacetyl-D-glucosamine | 92659-90-0 | 25mg |
| GC4268-50mg | N-Azidoacetyl-D-glucosamine | 92659-90-0 | 50mg |
| GC8072-25mg | N-Azidoacetyl-β-D-glucosamine tetraacetate | 857677-98-6 | 25mg |
| GC8072-50mg | N-Azidoacetyl-β-D-glucosamine tetraacetate | 857677-98-6 | 50mg |
| GC8072-100mg | N-Azidoacetyl-β-D-glucosamine tetraacetate | 857677-98-6 | 100mg |
| GC8072-250mg | N-Azidoacetyl-β-D-glucosamine tetraacetate | 857677-98-6 | 250mg |
| GM3301-25g | N-Benzylglycine ethyl ester | 6436-90-4 | 25g |
| GM3301-100g | N-Benzylglycine ethyl ester | 6436-90-4 | 100g |
| GW7460-50mg | N-Biotinyl-NH-(PEG)2-COOH . DIPEA | 1205744-09-7 | 50mg |
| GW7460-250mg | N-Biotinyl-NH-(PEG)2-COOH . DIPEA | 1205744-09-7 | 250mg |
| GK3623-10g | N-BOC-3-pyrrolidinone | 101385-93-7 | 10g |
| GM9500-5g | N-Boc-D-proline | 37784-17-1 | 5g |
| GM9500-25g | N-Boc-D-proline | 37784-17-1 | 25g |
| GW9682-2500mg | N-Boc-N′-succinyl-4,7,10-trioxa-1,13-tridecanediamine | 250612-31-8 | 2500mg |
| GW9682-25g | N-Boc-N′-succinyl-4,7,10-trioxa-1,13-tridecanediamine | 250612-31-8 | 25g |
| GK2411-25g | N-Bromosuccinimide | 128-08-5 | 25g |
| GK2411-100g | N-Bromosuccinimide | 128-08-5 | 100g |
| GK2411-250g | N-Bromosuccinimide | 128-08-5 | 250g |
| GK2411-500g | N-Bromosuccinimide | 128-08-5 | 500g |
| GK2411-1kg | N-Bromosuccinimide | 128-08-5 | 1kg |
| GW9000-5mg | N-Butanoyl-DL-homoserine lactone | 98426-48-3 | 5mg |
| GW9000-25mg | N-Butanoyl-DL-homoserine lactone | 98426-48-3 | 25mg |
| GW8563-10mg | N-Butanoyl-L-homoserine lactone | 67605-85-0 | 10mg |
| GW8563-50mg | N-Butanoyl-L-homoserine lactone | 67605-85-0 | 50mg |
| GS0744-100ml | n-Butyl Acetate, GlenDry™, anhydrous | 123-86-4 | 100ml |
| GS0744-500ml | n-Butyl Acetate, GlenDry™, anhydrous | 123-86-4 | 500ml |
| GS0744-1l | n-Butyl Acetate, GlenDry™, anhydrous | 123-86-4 | 1l |
| GS0744-2500ml | n-Butyl Acetate, GlenDry™, anhydrous | 123-86-4 | 2500ml |
| GS8505-500ml | n-Butyl Acetate, GlenPure™, analytical grade | 123-86-4 | 500ml |
| GS8505-1l | n-Butyl Acetate, GlenPure™, analytical grade | 123-86-4 | 1l |
| GS8505-2500ml | n-Butyl Acetate, GlenPure™, analytical grade | 123-86-4 | 2500ml |
| GC5657-5mg | N-Butyldeoxynojirimycin | 72599-27-0 | 5mg |
| GC5657-10mg | N-Butyldeoxynojirimycin | 72599-27-0 | 10mg |
| GC5657-25mg | N-Butyldeoxynojirimycin | 72599-27-0 | 25mg |
| GC5657-50mg | N-Butyldeoxynojirimycin | 72599-27-0 | 50mg |
| GC5657-100mg | N-Butyldeoxynojirimycin | 72599-27-0 | 100mg |
| GC0520-5mg | N-Butyldeoxynojirimycin hydrochloride | 210110-90-0 | 5mg |
| GC0520-10mg | N-Butyldeoxynojirimycin hydrochloride | 210110-90-0 | 10mg |
| GC0520-25mg | N-Butyldeoxynojirimycin hydrochloride | 210110-90-0 | 25mg |
| GC0520-50mg | N-Butyldeoxynojirimycin hydrochloride | 210110-90-0 | 50mg |
| GC0520-100mg | N-Butyldeoxynojirimycin hydrochloride | 210110-90-0 | 100mg |
| GM6326-5g | N-Carbobenzyloxy-L-glutamic acid O-benzyl ester | 3705-42-8 | 5g |
| GM6326-25g | N-Carbobenzyloxy-L-glutamic acid O-benzyl ester | 3705-42-8 | 25g |
| GK4705-100g | N-Chlorosuccinimide | 128-09-6 | 100g |
| GK4705-250g | N-Chlorosuccinimide | 128-09-6 | 250g |
| GK4705-1kg | N-Chlorosuccinimide | 128-09-6 | 1kg |
| GC3438-1mg | N-D-Glucopyranosyl-5-aminosalicylic acid | 123135-21-7 | 1mg |
| GC3438-2mg | N-D-Glucopyranosyl-5-aminosalicylic acid | 123135-21-7 | 2mg |
| GC3438-5mg | N-D-Glucopyranosyl-5-aminosalicylic acid | 123135-21-7 | 5mg |
| GW6346-500mg | N-Dansyldiethyleneamine | 35060-08-3 | 500mg |
| GW6346-1g | N-Dansyldiethyleneamine | 35060-08-3 | 1g |
| GW4895-10mg | N-Decanoyl-DL-homoserine lactone | 106983-36-2 | 10mg |
| GW4895-50mg | N-Decanoyl-DL-homoserine lactone | 106983-36-2 | 50mg |
| GW7530-5mg | N-Decanoyl-L-homoserine lactone | 177315-87-6 | 5mg |
| GW7530-50mg | N-Decanoyl-L-homoserine lactone | 177315-87-6 | 50mg |
| GC4712-500mg | N-Decanoyl-N-methylglucamine | 85261-20-7 | 500mg |
| GC4712-1g | N-Decanoyl-N-methylglucamine | 85261-20-7 | 1g |
| GC4712-5g | N-Decanoyl-N-methylglucamine | 85261-20-7 | 5g |
| GE2259-5g | N-Decyl-N,N-dimethyl-3-ammonio-1-propanesulfonate | 15163-36-7 | 5g |
| GE2259-25g | N-Decyl-N,N-dimethyl-3-ammonio-1-propanesulfonate | 15163-36-7 | 25g |
| GW9638-50mg | N-Desmethylthiamethoxam | 171103-04-1 | 50mg |
| GW9638-250mg | N-Desmethylthiamethoxam | 171103-04-1 | 250mg |
| GW7676-10mg | N-Dodecanoyl-DL-homoserine lactone | 18627-38-8 | 10mg |
| GW7676-50mg | N-Dodecanoyl-DL-homoserine lactone | 18627-38-8 | 50mg |
| GW1498-5mg | N-Dodecanoyl-L-homoserine lactone | 137173-46-7 | 5mg |
| GW1498-50mg | N-Dodecanoyl-L-homoserine lactone | 137173-46-7 | 50mg |
| GC8874-1g | n-Dodecyl beta-D-glucopyranoside | 59122-55-3 | 1g |
| GC8874-5g | n-Dodecyl beta-D-glucopyranoside | 59122-55-3 | 5g |
| GD1033-5g | N-Dodecyl-N,N-dimethyl-3-ammonio-1-propanesulfonate | 14933-08-5 | 5g |
| GD1033-25g | N-Dodecyl-N,N-dimethyl-3-ammonio-1-propanesulfonate | 14933-08-5 | 25g |
| GX3225-100mg | n-Dodecyl-phosphocholine | 29557-51-5 | 100mg |
| GW8607-5mg | N-Ethanoyl-DL-homoserine lactone | 114375-78-9 | 5mg |
| GW8607-25mg | N-Ethanoyl-DL-homoserine lactone | 114375-78-9 | 25mg |
| GW6620-5mg | N-Ethanoyl-L-homoserine lactone | 51524-71-1 | 5mg |
| GW6620-25mg | N-Ethanoyl-L-homoserine lactone | 51524-71-1 | 25mg |
| GK0313-25g | N-Ethyl-p-menthane-3-carboxamide | 39711-79-0 | 25g |
| GK7362-1g | N-Ethylmaleimide | 128-53-0 | 1g |
| GK7362-5g | N-Ethylmaleimide | 128-53-0 | 5g |
| GW5852-1g | N-Fmoc-N-succinyl-4,7,10-trioxa-1,13-tridecanediamine | 172089-14-4 | 1g |
| GW5852-5g | N-Fmoc-N-succinyl-4,7,10-trioxa-1,13-tridecanediamine | 172089-14-4 | 5g |
| GC2820-10mg | N-Glycolylneuraminic acid | 1113-83-3 | 10mg |
| GW9945-1g | N-Heptafluorobutyrylimidazole | 32477-35-3 | 1g |
| GW9945-5g | N-Heptafluorobutyrylimidazole | 32477-35-3 | 5g |
| GW9945-25g | N-Heptafluorobutyrylimidazole | 32477-35-3 | 25g |
| GS7532-100ml | n-Heptane 95%, GlenDry™, anhydrous | 142-82-5 | 100ml |
| GS7532-500ml | n-Heptane 95%, GlenDry™, anhydrous | 142-82-5 | 500ml |
| GS7532-1l | n-Heptane 95%, GlenDry™, anhydrous | 142-82-5 | 1l |
| GS7532-2500ml | n-Heptane 95%, GlenDry™, anhydrous | 142-82-5 | 2500ml |
| GS0594-100ml | n-Heptane 95%, GlenDry™, anhydrous over molecular sieve | 142-82-5 | 100ml |
| GS0594-500ml | n-Heptane 95%, GlenDry™, anhydrous over molecular sieve | 142-82-5 | 500ml |
| GS0594-1l | n-Heptane 95%, GlenDry™, anhydrous over molecular sieve | 142-82-5 | 1l |
| GS0594-2500ml | n-Heptane 95%, GlenDry™, anhydrous over molecular sieve | 142-82-5 | 2500ml |
| GS9561-500ml | n-Heptane 95%, GlenPure™, analytical grade | 142-82-5 | 500ml |
| GS9561-1l | n-Heptane 95%, GlenPure™, analytical grade | 142-82-5 | 1l |
| GS9561-2500ml | n-Heptane 95%, GlenPure™, analytical grade | 142-82-5 | 2500ml |
| GS3303-100ml | n-Heptane 99%, GlenDry™, anhydrous | 142-82-5 | 100ml |
| GS3303-500ml | n-Heptane 99%, GlenDry™, anhydrous | 142-82-5 | 500ml |
| GS3303-1l | n-Heptane 99%, GlenDry™, anhydrous | 142-82-5 | 1l |
| GS3303-2500ml | n-Heptane 99%, GlenDry™, anhydrous | 142-82-5 | 2500ml |
| GS4505-500ml | n-Heptane 99%, GlenPure™, analytical grade | 142-82-5 | 500ml |
| GS4505-1l | n-Heptane 99%, GlenPure™, analytical grade | 142-82-5 | 1l |
| GS4505-2500ml | n-Heptane 99%, GlenPure™, analytical grade | 142-82-5 | 2500ml |
| GS9305-2500ml | n-Heptane 99%, GlenUltra™, analytical grade, for GC | 142-82-5 | 2500ml |
| GS8674-1l | n-Heptane 99%, GlenUltra™, analytical grade, for LC | 142-82-5 | 1l |
| GS8674-2500ml | n-Heptane 99%, GlenUltra™, analytical grade, for LC | 142-82-5 | 2500ml |
| GW4963-10mg | N-Heptanoyl-DL-homoserine lactone | 106983-26-0 | 10mg |
| GW4963-50mg | N-Heptanoyl-DL-homoserine lactone | 106983-26-0 | 50mg |
| GW2959-5mg | N-Heptanoyl-L-homoserine lactone | 177158-20-2 | 5mg |
| GW2959-50mg | N-Heptanoyl-L-homoserine lactone | 177158-20-2 | 50mg |
| GW8686-10mg | N-Hexadecanoyl-DL-homoserine lactone | 98206-81-6 | 10mg |
| GW8686-50mg | N-Hexadecanoyl-DL-homoserine lactone | 98206-81-6 | 50mg |
| GW6247-10mg | N-Hexadecanoyl-L-homoserine lactone | 87206-01-7 | 10mg |
| GW6247-50mg | N-Hexadecanoyl-L-homoserine lactone | 87206-01-7 | 50mg |
| GD7014-5g | N-Hexadecyl-N,N-dimethyl-3-ammonio-1-propanesulfonate | 2281-11-0 | 5g |
| GD7014-10g | N-Hexadecyl-N,N-dimethyl-3-ammonio-1-propanesulfonate | 2281-11-0 | 10g |
| GD7014-25g | N-Hexadecyl-N,N-dimethyl-3-ammonio-1-propanesulfonate | 2281-11-0 | 25g |
| GW9901-25mg | N-Hexadecylpyrene-1-sulfonamide | 351002-71-6 | 25mg |
| GS9069-100ml | n-Hexane 95%, GlenDry™, anhydrous | 110-54-3 | 100ml |
| GS9069-500ml | n-Hexane 95%, GlenDry™, anhydrous | 110-54-3 | 500ml |
| GS9069-1l | n-Hexane 95%, GlenDry™, anhydrous | 110-54-3 | 1l |
| GS9069-2500ml | n-Hexane 95%, GlenDry™, anhydrous | 110-54-3 | 2500ml |
| GS8756-100ml | n-Hexane 95%, GlenDry™, anhydrous over molecular sieve | 110-54-3 | 100ml |
| GS8756-500ml | n-Hexane 95%, GlenDry™, anhydrous over molecular sieve | 110-54-3 | 500ml |
| GS8756-1l | n-Hexane 95%, GlenDry™, anhydrous over molecular sieve | 110-54-3 | 1l |
| GS8756-2500ml | n-Hexane 95%, GlenDry™, anhydrous over molecular sieve | 110-54-3 | 2500ml |
| GS6914-500ml | n-Hexane 95%, GlenPure™, analytical grade | 110-54-3 | 500ml |
| GS6914-1l | n-Hexane 95%, GlenPure™, analytical grade | 110-54-3 | 1l |
| GS6914-2500ml | n-Hexane 95%, GlenPure™, analytical grade | 110-54-3 | 2500ml |
| GS4390-2500ml | n-Hexane 95%, GlenUltra™, analytical grade, for LC | 110-54-3 | 2500ml |
| GS1284-500ml | n-Hexane 99%, GlenPure™, analytical grade | 110-54-3 | 500ml |
| GS1284-1l | n-Hexane 99%, GlenPure™, analytical grade | 110-54-3 | 1l |
| GS1284-2500ml | n-Hexane 99%, GlenPure™, analytical grade | 110-54-3 | 2500ml |
| GS6028-2500ml | n-Hexane 99%, GlenUltra™, analytical grade, for GC | 110-54-3 | 2500ml |
| GS9516-1l | n-Hexane 99%, GlenUltra™, analytical grade, for LC | 110-54-3 | 1l |
| GS9516-2500ml | n-Hexane 99%, GlenUltra™, analytical grade, for LC | 110-54-3 | 2500ml |
| GW7698-25mg | N-Hexanoyl-DL-homoserine lactone | 106983-28-2 | 25mg |
| GW7698-50mg | N-Hexanoyl-DL-homoserine lactone | 106983-28-2 | 50mg |
| GW7553-10mg | N-Hexanoyl-L-homoserine lactone | 147852-83-3 | 10mg |
| GW7553-50mg | N-Hexanoyl-L-homoserine lactone | 147852-83-3 | 50mg |
| GE3858-100g | N-Hydroxysuccinimide | 6066-82-6 | 100g |
| GE3858-250g | N-Hydroxysuccinimide | 6066-82-6 | 250g |
| GE3858-1kg | N-Hydroxysuccinimide | 6066-82-6 | 1kg |
| GE9186-1g | N-Hydroxysulfosuccinimide sodium salt | 106627-54-7 | 1g |
| GC9601-50mg | N-Iodoacetylglucosamine tetraacetate | 1141846-81-2 | 50mg |
| GC9601-100mg | N-Iodoacetylglucosamine tetraacetate | 1141846-81-2 | 100mg |
| GC9601-250mg | N-Iodoacetylglucosamine tetraacetate | 1141846-81-2 | 250mg |
| GC9601-500mg | N-Iodoacetylglucosamine tetraacetate | 1141846-81-2 | 500mg |
| GK8008-5g | N-Iodosuccinimide | 516-12-1 | 5g |
| GK8008-25g | N-Iodosuccinimide | 516-12-1 | 25g |
| GK8008-100g | N-Iodosuccinimide | 516-12-1 | 100g |
| GL6437-25g | N-Lauroylsarcosine | 97-78-9 | 25g |
| GL6437-100g | N-Lauroylsarcosine | 97-78-9 | 100g |
| GM9986-25g | N-Lauroylsarcosine sodium salt | 137-16-6 | 25g |
| GM9986-100g | N-Lauroylsarcosine sodium salt | 137-16-6 | 100g |
| GM9986-250g | N-Lauroylsarcosine sodium salt | 137-16-6 | 250g |
| GM9986-500g | N-Lauroylsarcosine sodium salt | 137-16-6 | 500g |
| GW7686-2500mg | N-Methyl bis[(trifluoromethyl)sulfonyl]imide | 537031-78-0 | 2500mg |
| GW7686-5g | N-Methyl bis[(trifluoromethyl)sulfonyl]imide | 537031-78-0 | 5g |
| GW7686-25g | N-Methyl bis[(trifluoromethyl)sulfonyl]imide | 537031-78-0 | 25g |
| GA2093-1mg | N-Methyl-1-deoxynojirimycin | 69567-10-8 | 1mg |
| GS5724-2500ml | N-Methyl-2-pyrrolidone, GlenBiol™, suitable for molecular biology | 872-50-4 | 2500ml |
| GS1826-100ml | N-Methyl-2-pyrrolidone, GlenDry™, anhydrous | 872-50-4 | 100ml |
| GS1826-500ml | N-Methyl-2-pyrrolidone, GlenDry™, anhydrous | 872-50-4 | 500ml |
| GS1826-1l | N-Methyl-2-pyrrolidone, GlenDry™, anhydrous | 872-50-4 | 1l |
| GS1826-2500ml | N-Methyl-2-pyrrolidone, GlenDry™, anhydrous | 872-50-4 | 2500ml |
| GS4330-100ml | N-Methyl-2-pyrrolidone, GlenDry™, anhydrous over molecular sieve | 872-50-4 | 100ml |
| GS4330-500ml | N-Methyl-2-pyrrolidone, GlenDry™, anhydrous over molecular sieve | 872-50-4 | 500ml |
| GS4330-1l | N-Methyl-2-pyrrolidone, GlenDry™, anhydrous over molecular sieve | 872-50-4 | 1l |
| GS4330-2500ml | N-Methyl-2-pyrrolidone, GlenDry™, anhydrous over molecular sieve | 872-50-4 | 2500ml |
| GS3413-500ml | N-Methyl-2-pyrrolidone, GlenPure™, analytical grade | 872-50-4 | 500ml |
| GS3413-1l | N-Methyl-2-pyrrolidone, GlenPure™, analytical grade | 872-50-4 | 1l |
| GS3413-2500ml | N-Methyl-2-pyrrolidone, GlenPure™, analytical grade | 872-50-4 | 2500ml |
| GK0882-100ml | N-Methyl-3-oxodihydroisothiazole, 50% in water | 2682-20-4 | 100ml |
| GK0882-500ml | N-Methyl-3-oxodihydroisothiazole, 50% in water | 2682-20-4 | 500ml |
| GK0882-1l | N-Methyl-3-oxodihydroisothiazole, 50% in water | 2682-20-4 | 1l |
| GL9947-100mg | N-Methyl-D-aspartic acid | 6384-92-5 | 100mg |
| GL9947-250mg | N-Methyl-D-aspartic acid | 6384-92-5 | 250mg |
| GL9947-1g | N-Methyl-D-aspartic acid | 6384-92-5 | 1g |
| GA1092-100g | N-Methyl-D-glucamine | 6284-40-8 | 100g |
| GA1092-250g | N-Methyl-D-glucamine | 6284-40-8 | 250g |
| GA1092-500g | N-Methyl-D-glucamine | 6284-40-8 | 500g |
| GA1092-1kg | N-Methyl-D-glucamine | 6284-40-8 | 1kg |
| GC5765-1g | N-Methyl-D-glucamine hydrochloride | 35564-86-4 | 1g |
| GA0865-100g | N-Methyl-D-glucamine, USP grade | 6284-40-8 | 100g |
| GA0865-500g | N-Methyl-D-glucamine, USP grade | 6284-40-8 | 500g |
| GK6777-5ml | N-Methyl-N-(trimethylsilyl)trifluoroacetamide | 24589-78-4 | 5ml |
| GK6777-25ml | N-Methyl-N-(trimethylsilyl)trifluoroacetamide | 24589-78-4 | 25ml |
| GK6777-100ml | N-Methyl-N-(trimethylsilyl)trifluoroacetamide | 24589-78-4 | 100ml |
| GW5462-5ml | N-Methyl-tert-butylamine | 14610-37-8 | 5ml |
| GC4667-25mg | N-Methyl-Topiramate | 97240-80-7 | 25mg |
| GC4667-50mg | N-Methyl-Topiramate | 97240-80-7 | 50mg |
| GC4667-100mg | N-Methyl-Topiramate | 97240-80-7 | 100mg |
| GC4667-250mg | N-Methyl-Topiramate | 97240-80-7 | 250mg |
| GX7429-1g | N-Methyltetrahydrofolic acid | 134-35-0 | 1g |
| GX7429-5g | N-Methyltetrahydrofolic acid | 134-35-0 | 5g |
| GS5545-100ml | n-Nonane 95%, GlenDry™, anhydrous | 111-84-2 | 100ml |
| GS5545-500ml | n-Nonane 95%, GlenDry™, anhydrous | 111-84-2 | 500ml |
| GS5545-1l | n-Nonane 95%, GlenDry™, anhydrous | 111-84-2 | 1l |
| GS5545-2500ml | n-Nonane 95%, GlenDry™, anhydrous | 111-84-2 | 2500ml |
| GS0826-500ml | n-Nonane 95%, GlenPure™, analytical grade | 111-84-2 | 500ml |
| GS0826-1l | n-Nonane 95%, GlenPure™, analytical grade | 111-84-2 | 1l |
| GS0826-2500ml | n-Nonane 95%, GlenPure™, analytical grade | 111-84-2 | 2500ml |
| GD6177-500mg | N-Nonanoyl-N-methylglucamine | 85261-19-4 | 500mg |
| GD6177-1g | N-Nonanoyl-N-methylglucamine | 85261-19-4 | 1g |
| GD6177-5g | N-Nonanoyl-N-methylglucamine | 85261-19-4 | 5g |
| GC6918-5mg | N-Nonyldeoxynojirimycin | 81117-35-3 | 5mg |
| GC6918-10mg | N-Nonyldeoxynojirimycin | 81117-35-3 | 10mg |
| GC6918-25mg | N-Nonyldeoxynojirimycin | 81117-35-3 | 25mg |
| GC6918-50mg | N-Nonyldeoxynojirimycin | 81117-35-3 | 50mg |
| GW9075-10mg | N-Octadecanoyl-L-homoserine lactone | 479050-96-9 | 10mg |
| GW9075-50mg | N-Octadecanoyl-L-homoserine lactone | 479050-96-9 | 50mg |
| GE6613-250g | N-Octadecyl-N,N-dimethyl-3-ammonio-1- propanesulfonate (SB-18) | 13177-41-8 | 250g |
| GW3295-5mg | N-Octanoyl-L-homoserine lactone | 147852-84-4 | 5mg |
| GW3295-50mg | N-Octanoyl-L-homoserine lactone | 147852-84-4 | 50mg |
| GC4276-1g | N-Octanoyl-N-methylglucamine | 85316-98-9 | 1g |
| GC4276-5g | N-Octanoyl-N-methylglucamine | 85316-98-9 | 5g |
| GW7747-10mg | N-Octanyol-DL-homoserine lactone | 106983-30-6 | 10mg |
| GW7747-50mg | N-Octanyol-DL-homoserine lactone | 106983-30-6 | 50mg |
| GL8823-500mg | N-p-Tosyl-L-phenylalanine chloromethyl ketone | 402-71-1 | 500mg |
| GX9474-1g | n-Pentadecyl-phosphocholine | 146801-07-2 | 1g |
| GS5448-100ml | n-Pentane 95%, GlenDry™, anhydrous | 109-66-0 | 100ml |
| GS5448-500ml | n-Pentane 95%, GlenDry™, anhydrous | 109-66-0 | 500ml |
| GS5448-1l | n-Pentane 95%, GlenDry™, anhydrous | 109-66-0 | 1l |
| GS5448-2500ml | n-Pentane 95%, GlenDry™, anhydrous | 109-66-0 | 2500ml |
| GS6352-500ml | n-Pentane 95%, GlenPure™, analytical grade | 109-66-0 | 500ml |
| GS6352-1l | n-Pentane 95%, GlenPure™, analytical grade | 109-66-0 | 1l |
| GS6352-2500ml | n-Pentane 95%, GlenPure™, analytical grade | 109-66-0 | 2500ml |
| GS2796-2500ml | n-Pentane 99%, GlenUltra™, analytical grade, for GC | 109-66-0 | 2500ml |
| GW7329-10mg | N-Pentanoyl-L-homoserine lactone | 148497-11-4 | 10mg |
| GW7329-50mg | N-Pentanoyl-L-homoserine lactone | 148497-11-4 | 50mg |
| GW0308-1g | N-Phenyl-benzimidoyl chloride | 4903-36-0 | 1g |
| GW0308-2500mg | N-Phenyl-benzimidoyl chloride | 4903-36-0 | 2500mg |
| GW0308-25g | N-Phenyl-benzimidoyl chloride | 4903-36-0 | 25g |
| GX3512-5g | N-Phenyl-bis(trifluoromethanesulfonimide) | 37595-74-7 | 5g |
| GM3079-25g | N-Phenylanthranilic acid | 91-40-7 | 25g |
| GM3079-100g | N-Phenylanthranilic acid | 91-40-7 | 100g |
| GM2111-100g | N-Phenylglycine | 103-01-5 | 100g |
| GM2111-250g | N-Phenylglycine | 103-01-5 | 250g |
| GW4638-1g | N-Phenylhydroxylamine | 100-65-2 | 1g |
| GW4638-5g | N-Phenylhydroxylamine | 100-65-2 | 5g |
| GW4638-25g | N-Phenylhydroxylamine | 100-65-2 | 25g |
| GK1293-5mg | n-Propionyl coenzyme A lithium salt | 108321-21-7 | 5mg |
| GK1293-25mg | n-Propionyl coenzyme A lithium salt | 108321-21-7 | 25mg |
| GL1880-1mg | N-Succinyl-Leu-Leu-Val-Tyr-7-Amido-4-Methylcoumarin | 94367-21-2 | 1mg |
| GL1880-5mg | N-Succinyl-Leu-Leu-Val-Tyr-7-Amido-4-Methylcoumarin | 94367-21-2 | 5mg |
| GK3410-1g | N-tert-Butyl-alpha-phenylnitrone | 3376-24-7 | 1g |
| GK3410-5g | N-tert-Butyl-alpha-phenylnitrone | 3376-24-7 | 5g |
| GW2349-10mg | N-Tetradecanoyl-DL-homoserine lactone | 98206-80-5 | 10mg |
| GW2349-50mg | N-Tetradecanoyl-DL-homoserine lactone | 98206-80-5 | 50mg |
| GW3072-10mg | N-Tetradecanoyl-L-homoserine lactone | 202284-87-5 | 10mg |
| GW3072-50mg | N-Tetradecanoyl-L-homoserine lactone | 202284-87-5 | 50mg |
| GX4756-1g | n-Tetradecyl-phosphocholine | 77733-28-9 | 1g |
| GW3401-10mg | N-Undecanoyl-L-homoserine lactone | 216596-71-3 | 10mg |
| GW3401-50mg | N-Undecanoyl-L-homoserine lactone | 216596-71-3 | 50mg |
| GK1118-10g | N-Vanillylnonanamide | 2444-46-4 | 10g |
| GK2331-1g | N-Vanillylnonanamide, 98% | 2444-46-4 | 1g |
| GK2331-10g | N-Vanillylnonanamide, 98% | 2444-46-4 | 10g |
| GK5139-25g | N-Vinyl-2-pyrrolidone | 88-12-0 | 25g |
| GK5139-100g | N-Vinyl-2-pyrrolidone | 88-12-0 | 100g |
| GK5139-500g | N-Vinyl-2-pyrrolidone | 88-12-0 | 500g |
| GW5627-100g | N,N-Bis(carboxymethyl)-DL-alanine trisodium salt | 164462-16-2 | 100g |
| GW5627-500g | N,N-Bis(carboxymethyl)-DL-alanine trisodium salt | 164462-16-2 | 500g |
| GW6185-10g | N,N-Bis(phosphonomethyl)glycine | 2439-99-8 | 10g |
| GW6185-50g | N,N-Bis(phosphonomethyl)glycine | 2439-99-8 | 50g |
| GK4504-100g | N,N-Diethyl-m-toluamide | 134-62-3 | 100g |
| GK9307-25g | N,N-Diethyl-p-phenylenediamine oxalate salt | 142439-89-2 | 25g |
| GK6622-25g | N,N-Diethyl-p-phenylenediamine sulfate | 6283-63-2 | 25g |
| GK6622-100g | N,N-Diethyl-p-phenylenediamine sulfate | 6283-63-2 | 100g |
| GW0894-25mg | N,N-Dimethyl-6-propionyl-2-naphthylamine | 70504-01-7 | 25mg |
| GW0894-50mg | N,N-Dimethyl-6-propionyl-2-naphthylamine | 70504-01-7 | 50mg |
| GW0894-500mg | N,N-Dimethyl-6-propionyl-2-naphthylamine | 70504-01-7 | 500mg |
| GT9517-10g | N,N-Dimethyl-p-phenylenediamine dihydrochloride | 536-46-9 | 10g |
| GT9517-25g | N,N-Dimethyl-p-phenylenediamine dihydrochloride | 536-46-9 | 25g |
| GT9517-100g | N,N-Dimethyl-p-phenylenediamine dihydrochloride | 536-46-9 | 100g |
| GK5529-100ml | N,N-Dimethylacetamide, 99.5% | 127-19-5 | 100ml |
| GK5529-500ml | N,N-Dimethylacetamide, 99.5% | 127-19-5 | 500ml |
| GW2629-250mg | N,N-Dimethylamino-7-nitrobenzofurazan | 1455-87-4 | 250mg |
| GL4652-5g | N,N-Dimethyldecylamine N-oxide | 2605-79-0 | 5g |
| GC9735-250ml | N,N-Dimethyldodecylamine N-oxide, 30% solution in water | 1643-20-5 | 250ml |
| GC9190-1g | N,N-Dimethyldodecylamine N-oxide, 98% | 1643-20-5 | 1g |
| GC9190-5g | N,N-Dimethyldodecylamine N-oxide, 98% | 1643-20-5 | 5g |
| GC9190-25g | N,N-Dimethyldodecylamine N-oxide, 98% | 1643-20-5 | 25g |
| GK6337-100ml | N,N-Dimethylethanolamine | 108-01-0 | 100ml |
| GK0667-100ml | N,N-Dimethylformamide dimethyl acetal | 4637-24-5 | 100ml |
| GK0667-500ml | N,N-Dimethylformamide dimethyl acetal | 4637-24-5 | 500ml |
| GM9748-1g | N,N-Dimethylglycine | 1118-68-9 | 1g |
| GM9748-5g | N,N-Dimethylglycine | 1118-68-9 | 5g |
| GM9748-25g | N,N-Dimethylglycine | 1118-68-9 | 25g |
| GM9056-25g | N,N-Dimethylglycine hydrochloride | 2491-06-7 | 25g |
| GM9056-100g | N,N-Dimethylglycine hydrochloride | 2491-06-7 | 100g |
| GK7327-100ml | N,N,Dimethylformamide, 99.5% | 68-12-2 | 100ml |
| GK7327-500ml | N,N,Dimethylformamide, 99.5% | 68-12-2 | 500ml |
| GK7327-1l | N,N,Dimethylformamide, 99.5% | 68-12-2 | 1l |
| GK2289-50mg | N,N,N'',N''-Tetrakis(2-pyridylmethyl)ethylenediamine | 16858-02-9 | 50mg |
| GK2289-100mg | N,N,N'',N''-Tetrakis(2-pyridylmethyl)ethylenediamine | 16858-02-9 | 100mg |
| GK2289-250mg | N,N,N'',N''-Tetrakis(2-pyridylmethyl)ethylenediamine | 16858-02-9 | 250mg |
| GK6593-5g | N,N,N'',N''-Tetramethyl-p-phenylenediamine dihydrochloride | 637-01-4 | 5g |
| GK6593-25g | N,N,N'',N''-Tetramethyl-p-phenylenediamine dihydrochloride | 637-01-4 | 25g |
| GK6593-50g | N,N,N'',N''-Tetramethyl-p-phenylenediamine dihydrochloride | 637-01-4 | 50g |
| GK6593-100g | N,N,N'',N''-Tetramethyl-p-phenylenediamine dihydrochloride | 637-01-4 | 100g |
| GE3482-25ml | N,N,N'',N''-Tetramethylethylendiamine | 110-18-9 | 25ml |
| GE3482-100ml | N,N,N'',N''-Tetramethylethylendiamine | 110-18-9 | 100ml |
| GM5053-1g | N,N''-Bis(benzyloxycarbonyl)-1H-pyrazole-1-carboxamidine | 152120-55-3 | 1g |
| GM5053-5g | N,N''-Bis(benzyloxycarbonyl)-1H-pyrazole-1-carboxamidine | 152120-55-3 | 5g |
| GM5053-10g | N,N''-Bis(benzyloxycarbonyl)-1H-pyrazole-1-carboxamidine | 152120-55-3 | 10g |
| GE9348-25g | N,N''-Carbonyldiimidazole | 530-62-1 | 25g |
| GE9348-100g | N,N''-Carbonyldiimidazole | 530-62-1 | 100g |
| GE9348-250g | N,N''-Carbonyldiimidazole | 530-62-1 | 250g |
| GE9348-1kg | N,N''-Carbonyldiimidazole | 530-62-1 | 1kg |
| GM7379-1g | N,N''-Di-Boc-1H-pyrazole-1-carboxamidine | 152120-54-2 | 1g |
| GM7379-5g | N,N''-Di-Boc-1H-pyrazole-1-carboxamidine | 152120-54-2 | 5g |
| GM7379-25g | N,N''-Di-Boc-1H-pyrazole-1-carboxamidine | 152120-54-2 | 25g |
| GL8106-5g | N,N''-Di-tert-butylcarbodiimide | 691-24-7 | 5g |
| GL8106-10g | N,N''-Di-tert-butylcarbodiimide | 691-24-7 | 10g |
| GL8106-25g | N,N''-Di-tert-butylcarbodiimide | 691-24-7 | 25g |
| GW6661-10g | N,N''-Di-tert-butylthiourea | 4041-95-6 | 10g |
| GW6661-50g | N,N''-Di-tert-butylthiourea | 4041-95-6 | 50g |
| GE7579-25g | N,N''-Dibutylthiourea | 109-46-6 | 25g |
| GE7579-100g | N,N''-Dibutylthiourea | 109-46-6 | 100g |
| GE7579-250g | N,N''-Dibutylthiourea | 109-46-6 | 250g |
| GE7579-500g | N,N''-Dibutylthiourea | 109-46-6 | 500g |
| GE6064-25g | N,N''-Dicyclohexylcarbodiimide | 538-75-0 | 25g |
| GL3093-100g | N,N''-Dimethylurea | 96-31-1 | 100g |
| GK5177-25g | N,N''-Diphenylthiourea | 102-08-9 | 25g |
| GK5177-100g | N,N''-Diphenylthiourea | 102-08-9 | 100g |
| GK2739-25g | N,N''-Ethylenethiourea | 96-45-7 | 25g |
| GK2739-100g | N,N''-Ethylenethiourea | 96-45-7 | 100g |
| GK2739-500g | N,N''-Ethylenethiourea | 96-45-7 | 500g |
| GK2739-1kg | N,N''-Ethylenethiourea | 96-45-7 | 1kg |
| GE8737-25g | N,N''-Methylene-bis-acrylamide | 110-26-9 | 25g |
| GE8737-100g | N,N''-Methylene-bis-acrylamide | 110-26-9 | 100g |
| GE8737-250g | N,N''-Methylene-bis-acrylamide | 110-26-9 | 250g |
| GE8737-500g | N,N''-Methylene-bis-acrylamide | 110-26-9 | 500g |
| GE8737-1kg | N,N''-Methylene-bis-acrylamide | 110-26-9 | 1kg |
| GE0658-1l | N,N''-Methylene-bis-acrylamide 2X solution | 110-26-9 | 1l |
| GL0221-2g | N,N′-Dimethyl-9,9′-biacridinium dinitrate | 2315-97-1 | 2g |
| GL0221-10g | N,N′-Dimethyl-9,9′-biacridinium dinitrate | 2315-97-1 | 10g |
| GK9308-5g | N,O-Dimethylhydroxylamine hydrochloride | 6638-79-5 | 5g |
| GK9308-25g | N,O-Dimethylhydroxylamine hydrochloride | 6638-79-5 | 25g |
| GK9308-100g | N,O-Dimethylhydroxylamine hydrochloride | 6638-79-5 | 100g |
| GW1353-25mg | N1-Acetylsulfamethoxazol | 18607-98-2 | 25mg |
| GW1353-100mg | N1-Acetylsulfamethoxazol | 18607-98-2 | 100mg |
| GW8839-10mg | N1-Guanyl-1,7-diaminoheptane [GC7] | 150333-69-0 | 10mg |
| GW8839-50mg | N1-Guanyl-1,7-diaminoheptane [GC7] | 150333-69-0 | 50mg |
| GN7727-10mg | N1-Methyladenosine | 15763-06-1 | 10mg |
| GN7727-50mg | N1-Methyladenosine | 15763-06-1 | 50mg |
| GW2158-1mg | N2-(4-(Aminomethyl)phenyl)-5-fluoro-N4-phenylpyrimidine-2,4-diamine | 916603-07-1 | 1mg |
| GW2158-5mg | N2-(4-(Aminomethyl)phenyl)-5-fluoro-N4-phenylpyrimidine-2,4-diamine | 916603-07-1 | 5mg |
| GW2158-10mg | N2-(4-(Aminomethyl)phenyl)-5-fluoro-N4-phenylpyrimidine-2,4-diamine | 916603-07-1 | 10mg |
| GN6762-1mg | N2,N2,7-Trimethylguanosine | 40027-70-1 | 1mg |
| GN7133-500mg | N3-Methyluridine | 2140-69-4 | 500mg |
| GN5260-10g | N4-Acetyl-2''-deoxy-5''-O-DMT-cytidine 3''-CE phosphoramidite | 154110-40-4 | 10g |
| GN3264-10g | N4-Acetyl-2''-deoxycytidine | 32909-05-0 | 10g |
| GN3264-25g | N4-Acetyl-2''-deoxycytidine | 32909-05-0 | 25g |
| GN8258-10mg | N4-Acetyl-2''-O-methylcytidine | 113886-71-8 | 10mg |
| GN8258-25mg | N4-Acetyl-2''-O-methylcytidine | 113886-71-8 | 25mg |
| GW8421-25mg | N4-Acetylsulfadimethoxine | 555-25-9 | 25mg |
| GW8421-100mg | N4-Acetylsulfadimethoxine | 555-25-9 | 100mg |
| GW4238-10mg | N4-Acetylsulfamethoxazole | 21312-10-7 | 10mg |
| GW4238-50mg | N4-Acetylsulfamethoxazole | 21312-10-7 | 50mg |
| GC6677-1mg | N6-(1-Deoxy-D-fructos-1-yl)-L-lysine | 21291-40-7 | 1mg |
| GC6677-5mg | N6-(1-Deoxy-D-fructos-1-yl)-L-lysine | 21291-40-7 | 5mg |
| GC6677-10mg | N6-(1-Deoxy-D-fructos-1-yl)-L-lysine | 21291-40-7 | 10mg |
| GC6677-25mg | N6-(1-Deoxy-D-fructos-1-yl)-L-lysine | 21291-40-7 | 25mg |
| GC0617-1mg | N6-(2-Deoxy-D-glucos-2-yl)-L-lysine | 112793-01-8 | 1mg |
| GC0617-5mg | N6-(2-Deoxy-D-glucos-2-yl)-L-lysine | 112793-01-8 | 5mg |
| GC0617-10mg | N6-(2-Deoxy-D-glucos-2-yl)-L-lysine | 112793-01-8 | 10mg |
| GC0617-25mg | N6-(2-Deoxy-D-glucos-2-yl)-L-lysine | 112793-01-8 | 25mg |
| GY5065-500mg | N6-(2-Isopentenyl)adenine | 2365-40-4 | 500mg |
| GY5065-1g | N6-(2-Isopentenyl)adenine | 2365-40-4 | 1g |
| GY5065-5g | N6-(2-Isopentenyl)adenine | 2365-40-4 | 5g |
| GC7916-100mg | N6-[(1,1-Dimethylethoxy)carbonyl]-N2-[(phenylmethoxy)carbonyl]-L-lysine phenylmethyl ester | 128972-27-0 | 100mg |
| GC7916-250mg | N6-[(1,1-Dimethylethoxy)carbonyl]-N2-[(phenylmethoxy)carbonyl]-L-lysine phenylmethyl ester | 128972-27-0 | 250mg |
| GC7916-500mg | N6-[(1,1-Dimethylethoxy)carbonyl]-N2-[(phenylmethoxy)carbonyl]-L-lysine phenylmethyl ester | 128972-27-0 | 500mg |
| GC7916-1g | N6-[(1,1-Dimethylethoxy)carbonyl]-N2-[(phenylmethoxy)carbonyl]-L-lysine phenylmethyl ester | 128972-27-0 | 1g |
| GC7916-2g | N6-[(1,1-Dimethylethoxy)carbonyl]-N2-[(phenylmethoxy)carbonyl]-L-lysine phenylmethyl ester | 128972-27-0 | 2g |
| GN5101-5mg | N6-Etheno 2''-deoxyadenosine | 68498-25-9 | 5mg |
| GN5101-10mg | N6-Etheno 2''-deoxyadenosine | 68498-25-9 | 10mg |
| GN5101-25mg | N6-Etheno 2''-deoxyadenosine | 68498-25-9 | 25mg |
| GP6800-1g | Nabumetone | 42924-53-8 | 1g |
| GP6800-5g | Nabumetone | 42924-53-8 | 5g |
| GP6800-10g | Nabumetone | 42924-53-8 | 10g |
| GP9735-1g | Nadolol | 42200-33-9 | 1g |
| GP9735-5g | Nadolol | 42200-33-9 | 5g |
| GP5144-10mg | Nafamostat mesylate | 82956-11-4 | 10mg |
| GP5144-50mg | Nafamostat mesylate | 82956-11-4 | 50mg |
| GA3972-1g | Nafcillin sodium salt monohydrate | 7177-50-6 | 1g |
| GA6545-25g | Naftifine hydrochloride | 65473-14-5 | 25g |
| GP5180-1g | Naftopidil | 57149-07-2 | 1g |
| GA8450-5g | Nalidixic acid | 389-08-2 | 5g |
| GA8450-25g | Nalidixic acid | 389-08-2 | 25g |
| GA8450-100g | Nalidixic acid | 389-08-2 | 100g |
| GA8450-250g | Nalidixic acid | 389-08-2 | 250g |
| GA0875-1g | Nalidixic acid sodium salt | 3374-05-8 | 1g |
| GA0875-5g | Nalidixic acid sodium salt | 3374-05-8 | 5g |
| GA0875-25g | Nalidixic acid sodium salt | 3374-05-8 | 25g |
| GA0875-100g | Nalidixic acid sodium salt | 3374-05-8 | 100g |
| GA0875-250g | Nalidixic acid sodium salt | 3374-05-8 | 250g |
| GA0875-500g | Nalidixic acid sodium salt | 3374-05-8 | 500g |
| GP4112-50mg | Nalmefene hydrochloride | 58895-64-0 | 50mg |
| GP1662-100mg | Naloxone hydrochloride dihydrate | 51481-60-8 | 100mg |
| GP1662-250mg | Naloxone hydrochloride dihydrate | 51481-60-8 | 250mg |
| GC6127-1mg | Naloxone-1,2,7,7-d4 | 1mg | |
| GC6127-2mg | Naloxone-1,2,7,7-d4 | 2mg | |
| GC6127-5mg | Naloxone-1,2,7,7-d4 | 5mg | |
| GP0896-1mg | Naloxone-3-glucuronide | 22135-79-1 | 1mg |
| GP0896-2mg | Naloxone-3-glucuronide | 22135-79-1 | 2mg |
| GP0896-5mg | Naloxone-3-glucuronide | 22135-79-1 | 5mg |
| GP0896-10mg | Naloxone-3-glucuronide | 22135-79-1 | 10mg |
| GC2061-1mg | Naloxone-d5 3-O-β-D-glucuronide | 1mg | |
| GC2061-2mg | Naloxone-d5 3-O-β-D-glucuronide | 2mg | |
| GM3935-5g | Nalpha,Nalpha-Bis-Fmoc-L-cystine (disulfide bond) | 135273-01-7 | 5g |
| GP4647-50mg | Naltrexone | 16590-41-3 | 50mg |
| GP1243-100mg | Naltrexone hydrochloride, 98% | 16676-29-2 | 100mg |
| GP1243-250mg | Naltrexone hydrochloride, 98% | 16676-29-2 | 250mg |
| GP1243-1g | Naltrexone hydrochloride, 98% | 16676-29-2 | 1g |
| GP1217-100mg | Naltrexone hydrochloride, Ph. Eur. grade | 16676-29-2 | 100mg |
| GP1217-1g | Naltrexone hydrochloride, Ph. Eur. grade | 16676-29-2 | 1g |
| GK1007-10g | Naphazoline nitrate, Ph. Eur. grade | 5144-52-5 | 10g |
| GK1891-25g | Naphthalene | 91-20-3 | 25g |
| GK1891-100g | Naphthalene | 91-20-3 | 100g |
| GK1891-500g | Naphthalene | 91-20-3 | 500g |
| GK4917-25g | Naphthalene-1-acetic acid | 86-87-3 | 25g |
| GK4917-100g | Naphthalene-1-acetic acid | 86-87-3 | 100g |
| GK4917-250g | Naphthalene-1-acetic acid | 86-87-3 | 250g |
| GT9165-25g | Naphthol AS | 92-77-3 | 25g |
| GW0166-500mg | Naphthol AS-E phosphate | 18228-17-6 | 500mg |
| GW0166-1g | Naphthol AS-E phosphate | 18228-17-6 | 1g |
| GT8368-25g | Naphthol Green B (C.I. 10020) | 19381-50-1 | 25g |
| GT8368-100g | Naphthol Green B (C.I. 10020) | 19381-50-1 | 100g |
| GT8368-250g | Naphthol Green B (C.I. 10020) | 19381-50-1 | 250g |
| GT8368-500g | Naphthol Green B (C.I. 10020) | 19381-50-1 | 500g |
| GT8368-1kg | Naphthol Green B (C.I. 10020) | 19381-50-1 | 1kg |
| GT6579-5g | Naphthol Yellow S | 846-70-8 | 5g |
| GT6579-25g | Naphthol Yellow S | 846-70-8 | 25g |
| GT6579-100g | Naphthol Yellow S | 846-70-8 | 100g |
| GA8617-1mg | Naphthomycin B | 86825-88-9 | 1mg |
| GP1072-5g | Naproxen sodium salt | 26159-34-2 | 5g |
| GP1072-25g | Naproxen sodium salt | 26159-34-2 | 25g |
| GP2313-5g | Naproxen sodium salt, USP grade | 26159-34-2 | 5g |
| GP2313-25g | Naproxen sodium salt, USP grade | 26159-34-2 | 25g |
| GC6440-1mg | Naproxen-d6 acyl-β-D-glucuronide | 1mg | |
| GC6440-2mg | Naproxen-d6 acyl-β-D-glucuronide | 2mg | |
| GP1103-1g | Naproxen, 98% | 22204-53-1 | 1g |
| GP1103-5g | Naproxen, 98% | 22204-53-1 | 5g |
| GP1103-10g | Naproxen, 98% | 22204-53-1 | 10g |
| GP1103-25g | Naproxen, 98% | 22204-53-1 | 25g |
| GP6640-25g | Naproxen, BP grade | 22204-53-1 | 25g |
| GL5624-500ug | Narciclasine | 29477-83-6 | 500ug |
| GL5624-1mg | Narciclasine | 29477-83-6 | 1mg |
| GY3726-5mg | Narcissoside | 604-80-8 | 5mg |
| GY3726-10mg | Narcissoside | 604-80-8 | 10mg |
| GW9057-1mg | Nargenicin A1 | 70695-02-2 | 1mg |
| GW9057-5mg | Nargenicin A1 | 70695-02-2 | 5mg |
| GP4824-5g | Naringenin | 67604-48-2 | 5g |
| GP4824-10g | Naringenin | 67604-48-2 | 10g |
| GP4824-25g | Naringenin | 67604-48-2 | 25g |
| GC8747-1mg | Naringenin-7-O-b-D-glucuronide | 158196-34-0 | 1mg |
| GC8747-2mg | Naringenin-7-O-b-D-glucuronide | 158196-34-0 | 2mg |
| GC8747-5mg | Naringenin-7-O-b-D-glucuronide | 158196-34-0 | 5mg |
| GC8747-10mg | Naringenin-7-O-b-D-glucuronide | 158196-34-0 | 10mg |
| GC7515-100mg | Naringin dihydrochalcone | 18916-17-1 | 100mg |
| GC2272-25g | Naringin hydrate | 10236-47-2 | 25g |
| GC2272-100g | Naringin hydrate | 10236-47-2 | 100g |
| GC2272-250g | Naringin hydrate | 10236-47-2 | 250g |
| GP5047-1g | Nateglinide | 105816-04-4 | 1g |
| GP5047-5g | Nateglinide | 105816-04-4 | 5g |
| GW9533-25mg | NBD dodecanoic acid N-succinimidyl ester | 689263-76-1 | 25mg |
| GW4810-1g | NBD-Cl | 10199-89-0 | 1g |
| GW4810-10g | NBD-Cl | 10199-89-0 | 10g |
| GW4663-100mg | NBD-dodecanoic acid | 96801-39-7 | 100mg |
| GW4663-500mg | NBD-dodecanoic acid | 96801-39-7 | 500mg |
| GW6497-25mg | NBD-F | 29270-56-2 | 25mg |
| GW6497-250mg | NBD-F | 29270-56-2 | 250mg |
| GW0641-50mg | NBD-methylhydrazine | 214147-22-5 | 50mg |
| GW0641-500mg | NBD-methylhydrazine | 214147-22-5 | 500mg |
| GW9907-200mg | NBD-PZ | 139332-66-4 | 200mg |
| GW9907-1g | NBD-PZ | 139332-66-4 | 1g |
| GW7445-100mg | NBD-undecanoic acid | 351002-77-2 | 100mg |
| GW7445-1g | NBD-undecanoic acid | 351002-77-2 | 1g |
| GW1491-200mg | NBD-X | 88235-25-0 | 200mg |
| GW1491-1g | NBD-X | 88235-25-0 | 1g |
| GW4450-25mg | NBD-X SE | 145195-58-0 | 25mg |
| GC2347-50mg | Neamine hydrochloride | 15446-43-2 | 50mg |
| GP6004-25mg | Nebivolol hydrochloride | 152520-56-4 | 25mg |
| GP6004-100mg | Nebivolol hydrochloride | 152520-56-4 | 100mg |
| GC7574-1mg | Nebivolol-5,5'',7,7'',8,8''-d6 | 1mg | |
| GC7574-2mg | Nebivolol-5,5'',7,7'',8,8''-d6 | 2mg | |
| GC7574-5mg | Nebivolol-5,5'',7,7'',8,8''-d6 | 5mg | |
| GL2538-5mg | Necrostatin-1 | 4311-88-0 | 5mg |
| GL2538-25mg | Necrostatin-1 | 4311-88-0 | 25mg |
| GL6416-5mg | Necrostatin-5 | 337349-54-9 | 5mg |
| GL6416-25mg | Necrostatin-5 | 337349-54-9 | 25mg |
| GL1197-5mg | Necrostatin-7 | 351062-08-3 | 5mg |
| GL1197-25mg | Necrostatin-7 | 351062-08-3 | 25mg |
| GW8903-5mg | Necrosulfonamide | 1360614-48-7 | 5mg |
| GW8903-25mg | Necrosulfonamide | 1360614-48-7 | 25mg |
| GP9613-10mg | Nefopam hydrochloride | 23327-57-3 | 10mg |
| GP7332-10mg | Nelfinavir mesylate | 159989-65-8 | 10mg |
| GP7332-50mg | Nelfinavir mesylate | 159989-65-8 | 50mg |
| GC1727-10mg | neo-Inositol | 488-54-0 | 10mg |
| GC1727-25mg | neo-Inositol | 488-54-0 | 25mg |
| GC1727-50mg | neo-Inositol | 488-54-0 | 50mg |
| GC1727-100mg | neo-Inositol | 488-54-0 | 100mg |
| GC7430-1mg | Neocarrabiose | 6215-96-9 | 1mg |
| GC7430-2mg | Neocarrabiose | 6215-96-9 | 2mg |
| GC7430-5mg | Neocarrabiose | 6215-96-9 | 5mg |
| GC7430-10mg | Neocarrabiose | 6215-96-9 | 10mg |
| GL4410-10mg | Neochlorogenic acid | 906-33-2 | 10mg |
| GX0392-1g | Neocuproine hemihydrate | 34302-69-7 | 1g |
| GX0392-5g | Neocuproine hemihydrate | 34302-69-7 | 5g |
| GX2428-50g | Neodymium acetate hydrate, 99.9% | 6192-13-8 | 50g |
| GX2428-250g | Neodymium acetate hydrate, 99.9% | 6192-13-8 | 250g |
| GX0780-5g | Neodymium boride, 99.9% | 12008-23-9 | 5g |
| GX9481-5g | Neodymium bromide, anhydrous, 99.9% | 13536-80-6 | 5g |
| GX2772-50g | Neodymium carbonate hydrate, 99.9% | 38245-38-4 | 50g |
| GX2772-250g | Neodymium carbonate hydrate, 99.9% | 38245-38-4 | 250g |
| GX6511-50g | Neodymium carbonate hydrate, 99.999% | 38245-38-4 | 50g |
| GX8391-10g | Neodymium Chips, 99.9% | 7440-00-8 | 10g |
| GX8391-50g | Neodymium Chips, 99.9% | 7440-00-8 | 50g |
| GX7707-50g | Neodymium chloride hydrate, 99.9% | 13477-89-9 | 50g |
| GX7707-250g | Neodymium chloride hydrate, 99.9% | 13477-89-9 | 250g |
| GX3146-10g | Neodymium chloride hydrate, 99.99% | 13477-89-9 | 10g |
| GX3146-50g | Neodymium chloride hydrate, 99.99% | 13477-89-9 | 50g |
| GX3146-100g | Neodymium chloride hydrate, 99.99% | 13477-89-9 | 100g |
| GX7585-50g | Neodymium chloride hydrate, 99.999% | 13477-89-9 | 50g |
| GX5886-10g | Neodymium chloride, anhydrous, 99.9% | 10024-93-8 | 10g |
| GX5886-25g | Neodymium chloride, anhydrous, 99.9% | 10024-93-8 | 25g |
| GX0756-50g | Neodymium fluoride, anhydrous, 99.9% | 13709-42-7 | 50g |
| GX0756-250g | Neodymium fluoride, anhydrous, 99.9% | 13709-42-7 | 250g |
| GX9408-50g | Neodymium fluoride, anhydrous, 99.999% | 13709-42-7 | 50g |
| GX9408-100g | Neodymium fluoride, anhydrous, 99.999% | 13709-42-7 | 100g |
| GX1802-25x50mm | Neodymium Foil 0.25mm, 99.9% | 7440-00-8 | 25x50mm |
| GX7363-25x50mm | Neodymium Foil 0.5mm, 99.9% | 7440-00-8 | 25x50mm |
| GX8095-10g | Neodymium hydroxide hydrate, 99.9% | 16469-17-3 | 10g |
| GX8095-50g | Neodymium hydroxide hydrate, 99.9% | 16469-17-3 | 50g |
| GX8095-100g | Neodymium hydroxide hydrate, 99.9% | 16469-17-3 | 100g |
| GX5670-50g | Neodymium nitrate hydrate, 99.9% | 13746-96-8 | 50g |
| GX5670-250g | Neodymium nitrate hydrate, 99.9% | 13746-96-8 | 250g |
| GX5291-25g | Neodymium nitrate hydrate, 99.99% | 13746-96-8 | 25g |
| GX5291-100g | Neodymium nitrate hydrate, 99.99% | 13746-96-8 | 100g |
| GX2706-100g | Neodymium oxalate hydrate, 99.9% | 28877-87-4 | 100g |
| GX2706-500g | Neodymium oxalate hydrate, 99.9% | 28877-87-4 | 500g |
| GX8883-50g | Neodymium oxalate hydrate, 99.999% | 28877-87-4 | 50g |
| GX4576-50g | Neodymium oxide, 99.9% | 1313-97-9 | 50g |
| GX4576-250g | Neodymium oxide, 99.9% | 1313-97-9 | 250g |
| GX2164-10g | Neodymium oxide, 99.99% | 1313-97-9 | 10g |
| GX2164-25g | Neodymium oxide, 99.99% | 1313-97-9 | 25g |
| GX7950-10g | Neodymium oxide, 99.999% | 1313-97-9 | 10g |
| GX7950-50g | Neodymium oxide, 99.999% | 1313-97-9 | 50g |
| GX6770-25g | Neodymium Pieces, 99.9% | 7440-00-8 | 25g |
| GX6770-100g | Neodymium Pieces, 99.9% | 7440-00-8 | 100g |
| GX2519-25mm | Neodymium Rod 12.5 mm diameter, 99.9% | 7440-00-8 | 25mm |
| GX2519-100mm | Neodymium Rod 12.5 mm diameter, 99.9% | 7440-00-8 | 100mm |
| GX7625-25mm | Neodymium Rod 6.35 mm diameter, 99.9% | 7440-00-8 | 25mm |
| GX7625-100mm | Neodymium Rod 6.35 mm diameter, 99.9% | 7440-00-8 | 100mm |
| GX8283-50g | Neodymium sulfate hydrate, 99.9% | 13477-91-3 | 50g |
| GX8283-250g | Neodymium sulfate hydrate, 99.9% | 13477-91-3 | 250g |
| GX7321-50g | Neodymium sulfate hydrate, 99.999% | 13477-91-3 | 50g |
| GX7678-5g | Neodymium sulfide, 99.9% | 12035-32-4 | 5g |
| GX7678-25g | Neodymium sulfide, 99.9% | 12035-32-4 | 25g |
| GX6967-10cm | Neodymium Wire 1 mm diameter, 99.9% | 7440-00-8 | 10cm |
| GX9680-1g | Neodymium-thd, 99% | 15492-47-4 | 1g |
| GX5515-100g | Neodymium(III) oxide Nanopowder, 99,9 % | 1313-97-9 | 100g |
| GC3166-1g | Neohesperidin dihydrochalcone | 20702-77-6 | 1g |
| GC3166-5g | Neohesperidin dihydrochalcone | 20702-77-6 | 5g |
| GC3166-10g | Neohesperidin dihydrochalcone | 20702-77-6 | 10g |
| GC3166-25g | Neohesperidin dihydrochalcone | 20702-77-6 | 25g |
| GA6251-5g | Neomycin sulfate | 1405-10-3 | 5g |
| GA6251-25g | Neomycin sulfate | 1405-10-3 | 25g |
| GA6251-100g | Neomycin sulfate | 1405-10-3 | 100g |
| GA8887-25g | Neomycin sulfate, USP grade | 1405-10-3 | 25g |
| GX9266-25ml | Neopentyl glycol diglycidyl ether | 17557-23-2 | 25ml |
| GX9266-100ml | Neopentyl glycol diglycidyl ether | 17557-23-2 | 100ml |
| GX9266-500ml | Neopentyl glycol diglycidyl ether | 17557-23-2 | 500ml |
| GX9266-1l | Neopentyl glycol diglycidyl ether | 17557-23-2 | 1l |
| GK7491-5g | Neostigmine bromide | 114-80-7 | 5g |
| GE9022-1g | Neotame | 165450-17-9 | 1g |
| GE9022-5g | Neotame | 165450-17-9 | 5g |
| GE9022-25g | Neotame | 165450-17-9 | 25g |
| GA1670-1mg | Neoxaline | 909900-78-3 | 1mg |
| GA1670-5mg | Neoxaline | 909900-78-3 | 5mg |
| GL2997-25mg | Nepafenac | 78281-72-8 | 25mg |
| GL2997-100mg | Nepafenac | 78281-72-8 | 100mg |
| GL2997-250mg | Nepafenac | 78281-72-8 | 250mg |
| GP9212-5mg | Neratinib | 698387-09-6 | 5mg |
| GP9212-10mg | Neratinib | 698387-09-6 | 10mg |
| GA1999-100mg | Netilmicin sulfate salt | 56391-57-2 | 100mg |
| GA1999-250mg | Netilmicin sulfate salt | 56391-57-2 | 250mg |
| GA1999-1g | Netilmicin sulfate salt | 56391-57-2 | 1g |
| GC1361-1mg | Neu5Ac-α-4MU | 76204-02-9 | 1mg |
| GC1361-5mg | Neu5Ac-α-4MU | 76204-02-9 | 5mg |
| GC1361-25mg | Neu5Ac-α-4MU | 76204-02-9 | 25mg |
| GW9580-1mg | Neuromedin U-25 (human) | 312306-89-1 | 1mg |
| GW9580-5mg | Neuromedin U-25 (human) | 312306-89-1 | 5mg |
| GT0890-100g | Neutral Red (C.I. 50040); 50% | 553-24-2 | 100g |
| GT0890-250g | Neutral Red (C.I. 50040); 50% | 553-24-2 | 250g |
| GT1293-1g | Neutral Red (C.I. 50040); 90% | 553-24-2 | 1g |
| GT1293-5g | Neutral Red (C.I. 50040); 90% | 553-24-2 | 5g |
| GT1293-25g | Neutral Red (C.I. 50040); 90% | 553-24-2 | 25g |
| GT1293-50g | Neutral Red (C.I. 50040); 90% | 553-24-2 | 50g |
| GT1293-100g | Neutral Red (C.I. 50040); 90% | 553-24-2 | 100g |
| GP9839-100mg | Nevirapine | 129618-40-2 | 100mg |
| GP9839-250mg | Nevirapine | 129618-40-2 | 250mg |
| GT3530-1g | New Methylene Blue (C.I. 52030) | 1934-16-3 | 1g |
| GT3530-10g | New Methylene Blue (C.I. 52030) | 1934-16-3 | 10g |
| GW3505-1mg | Nexturastat A | 1403783-31-2 | 1mg |
| GW3505-5mg | Nexturastat A | 1403783-31-2 | 5mg |
| GW2061-1mg | Nexturastat B | 1648893-33-7 | 1mg |
| GW2061-5mg | Nexturastat B | 1648893-33-7 | 5mg |
| GW7799-1mg | NG 011 | 141731-75-1 | 1mg |
| GW7799-5mg | NG 011 | 141731-75-1 | 5mg |
| GL9289-1mg | NG 012 | 141731-76-2 | 1mg |
| GL9289-5mg | NG 012 | 141731-76-2 | 5mg |
| GL3981-5mg | NG-Methyl-L-arginine acetate salt | 53308-83-1 | 5mg |
| GL3981-25mg | NG-Methyl-L-arginine acetate salt | 53308-83-1 | 25mg |
| GL3981-100mg | NG-Methyl-L-arginine acetate salt | 53308-83-1 | 100mg |
| GL3981-1g | NG-Methyl-L-arginine acetate salt | 53308-83-1 | 1g |
| GW0681-1mg | NIBR-17 | 944396-88-7 | 1mg |
| GW0681-5mg | NIBR-17 | 944396-88-7 | 5mg |
| GW0681-10mg | NIBR-17 | 944396-88-7 | 10mg |
| GP0799-100mg | Nicardipine | 55985-32-5 | 100mg |
| GW7865-100mg | Nickamine | 1033772-47-2 | 100mg |
| GW7865-500mg | Nickamine | 1033772-47-2 | 500mg |
| GX5806-25g | Nickel boride, 99% | 12007-00-0 | 25g |
| GX5806-50g | Nickel boride, 99% | 12007-00-0 | 50g |
| GX9344-10g | Nickel chloride hydrate, 99.999+% | 7791-20-0 | 10g |
| GX9344-25g | Nickel chloride hydrate, 99.999+% | 7791-20-0 | 25g |
| GX0109-50x50mm | Nickel Foil 0.125mm, 99.9+% | 7440-02-0 | 50x50mm |
| GX0109-100x100mm | Nickel Foil 0.125mm, 99.9+% | 7440-02-0 | 100x100mm |
| GX1422-100x100mm | Nickel Foil 0.25mm, 99.7% | 7440-02-0 | 100x100mm |
| GX1422-100x200mm | Nickel Foil 0.25mm, 99.7% | 7440-02-0 | 100x200mm |
| GX4470-50x50mm | Nickel Foil 0.25mm, 99.99% | 7440-02-0 | 50x50mm |
| GX4470-100x100mm | Nickel Foil 0.25mm, 99.99% | 7440-02-0 | 100x100mm |
| GX0516-100x100mm | Nickel Foil 0.5mm, 99.9% | 7440-02-0 | 100x100mm |
| GX0516-100x200mm | Nickel Foil 0.5mm, 99.9% | 7440-02-0 | 100x200mm |
| GX4137-50x50mm | Nickel Foil 0.5mm, 99.99% | 7440-02-0 | 50x50mm |
| GX4137-100x100mm | Nickel Foil 0.5mm, 99.99% | 7440-02-0 | 100x100mm |
| GX9700-100x100mm | Nickel Foil 1.0mm, 99.8% | 7440-02-0 | 100x100mm |
| GX8146-50x50mm | Nickel Foil 1.0mm, 99.99% | 7440-02-0 | 50x50mm |
| GX8146-100x100mm | Nickel Foil 1.0mm, 99.99% | 7440-02-0 | 100x100mm |
| GX7603-50x50mm | Nickel Gauze 130 mesh,25,4 mm, 0.080 mm wire diameter, 99.6% | 7440-02-0 | 50x50mm |
| GX7603-100x100mm | Nickel Gauze 130 mesh,25,4 mm, 0.080 mm wire diameter, 99.6% | 7440-02-0 | 100x100mm |
| GX0127-10g | Nickel Nanopowder, 99.8%, APS 20nm | 7440-02-0 | 10g |
| GX6859-250g | Nickel oxide, black | 1313-99-1 | 250g |
| GX6859-1kg | Nickel oxide, black | 1313-99-1 | 1kg |
| GX6859-5kg | Nickel oxide, black | 1313-99-1 | 5kg |
| GX7200-10g | Nickel Pellets 6 x 6 mm (Co max. 10 ppm); 99.995% | 7440-02-0 | 10g |
| GX7200-50g | Nickel Pellets 6 x 6 mm (Co max. 10 ppm); 99.995% | 7440-02-0 | 50g |
| GX1740-25g | Nickel Pellets 6 x 6 mm (Co max. 15 ppm); 99.97% | 7440-02-0 | 25g |
| GX1740-100g | Nickel Pellets 6 x 6 mm (Co max. 15 ppm); 99.97% | 7440-02-0 | 100g |
| GX8113-500g | Nickel Pellets 6-12 mm, 99.97% | 7440-02-0 | 500g |
| GX8113-1kg | Nickel Pellets 6-12 mm, 99.97% | 7440-02-0 | 1kg |
| GX4149-10g | Nickel peroxide (oxidizing agent, appr. 30% active peroxide) | 12035-36-8 | 10g |
| GX4149-25g | Nickel peroxide (oxidizing agent, appr. 30% active peroxide) | 12035-36-8 | 25g |
| GX6574-25g | Nickel Powder - 100 mesh, 99.99% | 7440-02-0 | 25g |
| GX6574-100g | Nickel Powder - 100 mesh, 99.99% | 7440-02-0 | 100g |
| GX8743-100g | Nickel Powder max. 10 micron, 99.9% | 7440-02-0 | 100g |
| GX8743-500g | Nickel Powder max. 10 micron, 99.9% | 7440-02-0 | 500g |
| GX2302-100mm | Nickel Rod 12.7 mm diameter, 99.98% | 7440-02-0 | 100mm |
| GX1331-100mm | Nickel Rod 3.0 mm diameter, 99.9+% | 7440-02-0 | 100mm |
| GX1331-200mm | Nickel Rod 3.0 mm diameter, 99.9+% | 7440-02-0 | 200mm |
| GX8249-100mm | Nickel Rod 3.0 mm diameter, 99.995% | 7440-02-0 | 100mm |
| GX8249-200mm | Nickel Rod 3.0 mm diameter, 99.995% | 7440-02-0 | 200mm |
| GX1584-100mm | Nickel Rod 5.0 mm diameter, 99.9% | 7440-02-0 | 100mm |
| GX1584-150mm | Nickel Rod 5.0 mm diameter, 99.9% | 7440-02-0 | 150mm |
| GX0053-100mm | Nickel Rod 5.0 mm diameter, 99.99% | 7440-02-0 | 100mm |
| GX0053-150mm | Nickel Rod 5.0 mm diameter, 99.99% | 7440-02-0 | 150mm |
| GX9010-150mm | Nickel Rod 6.25 mm diameter, 99.9% | 7440-02-0 | 150mm |
| GX4569-150mm | Nickel Rod 6.25 mm diameter, 99.99% | 7440-02-0 | 150mm |
| GX7042-50g | Nickel selenide, 99.9% | 1314-05-2 | 50g |
| GX7936-50x100mm | Nickel Sheet 3 mm, 99.98% | 7440-02-0 | 50x100mm |
| GX2425-25g | Nickel silicide, 99% | 12059-14-2 | 25g |
| GX5979-25g | Nickel silicide, 99% | 12201-89-7 | 25g |
| GX2425-100g | Nickel silicide, 99% | 12059-14-2 | 100g |
| GX5979-100g | Nickel silicide, 99% | 12201-89-7 | 100g |
| GX5905-100g | Nickel sulfamate hydrate | 13770-89-3 | 100g |
| GX5905-250g | Nickel sulfamate hydrate | 13770-89-3 | 250g |
| GX9294-10g | Nickel sulfate hexahydrate, 99.999% | 10101-97-0 | 10g |
| GX9294-25g | Nickel sulfate hexahydrate, 99.999% | 10101-97-0 | 25g |
| GX9294-100g | Nickel sulfate hexahydrate, 99.999% | 10101-97-0 | 100g |
| GX8778-100g | Nickel sulfate hexahydrate, 99% | 10101-97-0 | 100g |
| GX8778-500g | Nickel sulfate hexahydrate, 99% | 10101-97-0 | 500g |
| GX8778-1kg | Nickel sulfate hexahydrate, 99% | 10101-97-0 | 1kg |
| GX8778-2500g | Nickel sulfate hexahydrate, 99% | 10101-97-0 | 2500g |
| GX0308-10g | Nickel sulfide, 99.9% | 16812-54-7 | 10g |
| GX6525-25g | Nickel telluride, 99.9% | 12142-88-0 | 25g |
| GX1683-50m | Nickel Thermocouple Wire 0,1 mm diameter (non insulated) | 7440-02-0 | 50m |
| GX5228-50m | Nickel Thermocouple Wire 0,2 mm diameter (non insulated) | 7440-02-0 | 50m |
| GX6183-50m | Nickel Thermocouple Wire 0,3 mm diameter (non insulated) | 7440-02-0 | 50m |
| GX9886-50m | Nickel Thermocouple Wire 0,5 mm diameter (non insulated) | 7440-02-0 | 50m |
| GX8035-10m | Nickel Wire 0.1 mm diameter, 99.99% | 7440-02-0 | 10m |
| GX4556-25m | Nickel Wire 0.25 mm diameter, 99.9+% | 7440-02-0 | 25m |
| GX4556-100m | Nickel Wire 0.25 mm diameter, 99.9+% | 7440-02-0 | 100m |
| GX8315-1m | Nickel Wire 0.5 mm diameter, 99.99% | 7440-02-0 | 1m |
| GX8315-5m | Nickel Wire 0.5 mm diameter, 99.99% | 7440-02-0 | 5m |
| GX3412-25m | Nickel Wire 0.5 mm diameter, 99+% | 7440-02-0 | 25m |
| GX3412-100m | Nickel Wire 0.5 mm diameter, 99+% | 7440-02-0 | 100m |
| GX7591-25m | Nickel Wire 0.5 mm diameter, annealed, 99+% | 7440-02-0 | 25m |
| GX7591-100m | Nickel Wire 0.5 mm diameter, annealed, 99+% | 7440-02-0 | 100m |
| GX8665-10m | Nickel Wire 1.0 mm diameter, 99.98% | 7440-02-0 | 10m |
| GX5295-10m | Nickel Wire 1.0 mm diameter, 99+% | 7440-02-0 | 10m |
| GX5295-25m | Nickel Wire 1.0 mm diameter, 99+% | 7440-02-0 | 25m |
| GX5295-100m | Nickel Wire 1.0 mm diameter, 99+% | 7440-02-0 | 100m |
| GX3789-1m | Nickel Wire 2.0 mm diameter, 99.98% | 7440-02-0 | 1m |
| GX7670-10g | Nickel-thd, 99.9% | 14481-08-4 | 10g |
| GX9276-250g | Nickel(II) 2,4-pentanedionate hydrate, 98+% | 3264-82-2 | 250g |
| GX9017-100g | Nickel(II) acetate tetrahydrate | 6018-89-9 | 100g |
| GX9017-250g | Nickel(II) acetate tetrahydrate | 6018-89-9 | 250g |
| GX9017-500g | Nickel(II) acetate tetrahydrate | 6018-89-9 | 500g |
| GX5968-1kg | Nickel(II) acetate tetrahydrate, 99% | 6018-89-9 | 1kg |
| GX5968-5kg | Nickel(II) acetate tetrahydrate, 99% | 6018-89-9 | 5kg |
| GX0241-250g | Nickel(II) chloride hexahydrate | 7791-20-0 | 250g |
| GX0241-500g | Nickel(II) chloride hexahydrate | 7791-20-0 | 500g |
| GX0241-1kg | Nickel(II) chloride hexahydrate | 7791-20-0 | 1kg |
| GX3007-100g | Nickel(II) nitrate hexahydrate | 13478-00-7 | 100g |
| GX3007-250g | Nickel(II) nitrate hexahydrate | 13478-00-7 | 250g |
| GX3007-500g | Nickel(II) nitrate hexahydrate | 13478-00-7 | 500g |
| GX3007-1kg | Nickel(II) nitrate hexahydrate | 13478-00-7 | 1kg |
| GX3641-50g | Nickel(II) oxide nanopowder, 99.5%, APS approx. 20nm | 1313-99-1 | 50g |
| GX3641-100g | Nickel(II) oxide nanopowder, 99.5%, APS approx. 20nm | 1313-99-1 | 100g |
| GX3641-250g | Nickel(II) oxide nanopowder, 99.5%, APS approx. 20nm | 1313-99-1 | 250g |
| GX5877-100g | Nickel(II) oxide, green, 99% | 1313-99-1 | 100g |
| GX5877-250g | Nickel(II) oxide, green, 99% | 1313-99-1 | 250g |
| GX3227-50m | Nickel/Chromium Thermocouple Wire 0,1 mm diameter (non insulated) | 50m | |
| GX1237-50m | Nickel/Chromium Thermocouple Wire 0,2 mm diameter (non insulated) | 50m | |
| GX3686-50m | Nickel/Chromium Thermocouple Wire 0,3 mm diameter (non insulated) | 50m | |
| GX6656-50m | Nickel/Chromium Thermocouple Wire 0,5 mm diameter (non insulated) | 50m | |
| GX2843-50m | Nickel/Chromium-Nickel Thermocouple Wire (glass silk insulated) | 50m | |
| GX9897-50m | Nickel/Chromium-Nickel Thermocouple Wire (glass silk insulated) | 50m | |
| GX9827-50m | Nickel/Chromium-Nickel Thermocouple Wire (glass silk insulated) | 50m | |
| GX3715-1l | Nickelbad 216 H / Nickel bath 216 H | 1l | |
| GX4457-1l | Nickelbad 218 HG / Nickel bath 218 HG | 1l | |
| GX7794-1l | Nickelbad 219 G / Nickel bath 219 G | 1l | |
| GA5338-50g | Niclosamide | 50-65-7 | 50g |
| GW0866-25mg | Niclosamide ethanolamine | 1420-04-8 | 25mg |
| GW0866-100mg | Niclosamide ethanolamine | 1420-04-8 | 100mg |
| GP5693-250mg | Nicorandil | 65141-46-0 | 250mg |
| GP5693-1g | Nicorandil | 65141-46-0 | 1g |
| GX3566-1g | Nicosulfuron | 111991-09-4 | 1g |
| GP9346-25g | Nicotinamide, 99% | 98-92-0 | 25g |
| GP9346-100g | Nicotinamide, 99% | 98-92-0 | 100g |
| GP9346-250g | Nicotinamide, 99% | 98-92-0 | 250g |
| GP9346-500g | Nicotinamide, 99% | 98-92-0 | 500g |
| GP9346-1kg | Nicotinamide, 99% | 98-92-0 | 1kg |
| GP9253-25g | Nicotinamide, 99%, Ph. Eur. grade | 98-92-0 | 25g |
| GP9253-100g | Nicotinamide, 99%, Ph. Eur. grade | 98-92-0 | 100g |
| GP9253-250g | Nicotinamide, 99%, Ph. Eur. grade | 98-92-0 | 250g |
| GP9253-500g | Nicotinamide, 99%, Ph. Eur. grade | 98-92-0 | 500g |
| GP9253-1kg | Nicotinamide, 99%, Ph. Eur. grade | 98-92-0 | 1kg |
| GV8911-100g | Nicotinic acid | 59-67-6 | 100g |
| GV8911-250g | Nicotinic acid | 59-67-6 | 250g |
| GV8911-500g | Nicotinic acid | 59-67-6 | 500g |
| GV8911-1kg | Nicotinic acid | 59-67-6 | 1kg |
| GC9654-1mg | Nicotinic acid acyl-b-D-glucuronide | 24719-73-1 | 1mg |
| GC9654-2mg | Nicotinic acid acyl-b-D-glucuronide | 24719-73-1 | 2mg |
| GC9654-5mg | Nicotinic acid acyl-b-D-glucuronide | 24719-73-1 | 5mg |
| GC9654-10mg | Nicotinic acid acyl-b-D-glucuronide | 24719-73-1 | 10mg |
| GP5212-1g | Nifedipine | 21829-25-4 | 1g |
| GP5212-5g | Nifedipine | 21829-25-4 | 5g |
| GP5212-10g | Nifedipine | 21829-25-4 | 10g |
| GP5212-25g | Nifedipine | 21829-25-4 | 25g |
| GA6233-5mg | Nigericin sodium salt | 28643-80-3 | 5mg |
| GA6233-10mg | Nigericin sodium salt | 28643-80-3 | 10mg |
| GA6233-25mg | Nigericin sodium salt | 28643-80-3 | 25mg |
| GT3707-25g | Nigrosine (C.I. 50420) | 8005-03-6 | 25g |
| GT3707-100g | Nigrosine (C.I. 50420) | 8005-03-6 | 100g |
| GT2809-500ml | Nigrosine (C.I. 51180); 5% aqueous solution | 8005-03-6 | 500ml |
| GP1304-25g | Nikethamide | 59-26-7 | 25g |
| GP1304-100g | Nikethamide | 59-26-7 | 100g |
| GP1304-250g | Nikethamide | 59-26-7 | 250g |
| GP1304-500g | Nikethamide | 59-26-7 | 500g |
| GT3036-25g | Nile Blue A (C.I. 51180) | 3625-57-8 | 25g |
| GT2331-250mg | Nile Red | 7385-67-3 | 250mg |
| GT2331-1g | Nile Red | 7385-67-3 | 1g |
| GP5854-100mg | Nilotinib | 641571-10-0 | 100mg |
| GP5854-500mg | Nilotinib | 641571-10-0 | 500mg |
| GP5854-1g | Nilotinib | 641571-10-0 | 1g |
| GP2955-100mg | Nimodipine | 66085-59-4 | 100mg |
| GP5132-1g | Nimustine hydrochloride | 55661-38-6 | 1g |
| GT1068-10g | Ninhydrin | 485-47-2 | 10g |
| GT1068-25g | Ninhydrin | 485-47-2 | 25g |
| GT1068-100g | Ninhydrin | 485-47-2 | 100g |
| GT1068-250g | Ninhydrin | 485-47-2 | 250g |
| GE9702-100g | Ninhydrin, ACS grade | 485-47-2 | 100g |
| GW5215-25mg | Nintedanib (free base) | 656247-17-5 | 25mg |
| GW5215-100mg | Nintedanib (free base) | 656247-17-5 | 100mg |
| GX9388-10g | Niobium boride, 99.5% | 12045-19-1 | 10g |
| GX7258-10g | Niobium boride, 99.5% | 12007-29-3 | 10g |
| GX9388-50g | Niobium boride, 99.5% | 12045-19-1 | 50g |
| GX7258-50g | Niobium boride, 99.5% | 12007-29-3 | 50g |
| GX9412-25g | Niobium carbide, 99+% | 12069-94-2 | 25g |
| GX9412-100g | Niobium carbide, 99+% | 12069-94-2 | 100g |
| GX3113-100x200mm | Niobium Foil 0.025mm, 99.9% | 7440-03-1 | 100x200mm |
| GX0065-50x100mm | Niobium Foil 0.05mm, 99.8% | 7440-03-1 | 50x100mm |
| GX0065-100x100mm | Niobium Foil 0.05mm, 99.8% | 7440-03-1 | 100x100mm |
| GX8010-100x200mm | Niobium Foil 0.1mm, 99.9% | 7440-03-1 | 100x200mm |
| GX8010-150x150mm | Niobium Foil 0.1mm, 99.9% | 7440-03-1 | 150x150mm |
| GX2237-100x100mm | Niobium Foil 0.25mm, 99.9% | 7440-03-1 | 100x100mm |
| GX2237-100x200mm | Niobium Foil 0.25mm, 99.9% | 7440-03-1 | 100x200mm |
| GX0113-100x200mm | Niobium Foil 0.5mm, 99.9% | 7440-03-1 | 100x200mm |
| GX9628-50g | Niobium Granules 2-10 mm, 99.9% | 7440-03-1 | 50g |
| GX9628-250g | Niobium Granules 2-10 mm, 99.9% | 7440-03-1 | 250g |
| GX4846-10g | Niobium nitride | 24621-21-4 | 10g |
| GX4846-25g | Niobium nitride | 24621-21-4 | 25g |
| GX5739-50g | Niobium Pellets 6 x 6 mm, 99.9% | 7440-03-1 | 50g |
| GX7280-50g | Niobium Powder 70-180 micron, 99.9% | 7440-03-1 | 50g |
| GX7280-250g | Niobium Powder 70-180 micron, 99.9% | 7440-03-1 | 250g |
| GX6797-100mm | Niobium Rod 10 mm diameter, 99.9% | 7440-03-1 | 100mm |
| GX9816-100mm | Niobium Rod 12 mm diameter, 99.9% | 7440-03-1 | 100mm |
| GX5947-100mm | Niobium Rod 2.0 mm diameter, 99.9% | 7440-03-1 | 100mm |
| GX5947-200mm | Niobium Rod 2.0 mm diameter, 99.9% | 7440-03-1 | 200mm |
| GX2832-100mm | Niobium Rod 3.0 mm diameter, 99.9% | 7440-03-1 | 100mm |
| GX2832-250mm | Niobium Rod 3.0 mm diameter, 99.9% | 7440-03-1 | 250mm |
| GX4023-100mm | Niobium Rod 5.0 mm diameter, 99.9% | 7440-03-1 | 100mm |
| GX4023-250mm | Niobium Rod 5.0 mm diameter, 99.9% | 7440-03-1 | 250mm |
| GX8284-250mm | Niobium Rod 6 mm diameter, 99.9% | 7440-03-1 | 250mm |
| GX6556-100x200mm | Niobium Sheet 1.0mm, 99.8% | 7440-03-1 | 100x200mm |
| GX4934-25g | Niobium silicide, 99% | 12034-80-9 | 25g |
| GX4934-50g | Niobium silicide, 99% | 12034-80-9 | 50g |
| GX4934-100g | Niobium silicide, 99% | 12034-80-9 | 100g |
| GX4870-1m | Niobium Tube 8.0 mm diameter, 0.4 mm wall thickness, 99.9% | 7440-03-1 | 1m |
| GX3819-10m | Niobium Wire 0.25 mm diameter, 99.9% | 7440-03-1 | 10m |
| GX3819-25m | Niobium Wire 0.25 mm diameter, 99.9% | 7440-03-1 | 25m |
| GX3819-100m | Niobium Wire 0.25 mm diameter, 99.9% | 7440-03-1 | 100m |
| GX0634-10m | Niobium Wire 0.5 mm diameter, 99.9% | 7440-03-1 | 10m |
| GX0634-50m | Niobium Wire 0.5 mm diameter, 99.9% | 7440-03-1 | 50m |
| GX6534-5m | Niobium Wire 1.0 mm diameter, 99.9% | 7440-03-1 | 5m |
| GX6534-25m | Niobium Wire 1.0 mm diameter, 99.9% | 7440-03-1 | 25m |
| GX2365-1m | Niobium Wire 2.0 mm diameter, 99.9% | 7440-03-1 | 1m |
| GX2365-5m | Niobium Wire 2.0 mm diameter, 99.9% | 7440-03-1 | 5m |
| GX6040-1m | Niobium,Zirconium-99,1 Wire 0.5 mm diameter | 7440-03-1 | 1m |
| GX6040-10m | Niobium,Zirconium-99,1 Wire 0.5 mm diameter | 7440-03-1 | 10m |
| GX6040-50m | Niobium,Zirconium-99,1 Wire 0.5 mm diameter | 7440-03-1 | 50m |
| GX7497-1m | Niobium,Zirconium-99,1 Wire 0.8 mm diameter | 7440-03-1 | 1m |
| GX7497-10m | Niobium,Zirconium-99,1 Wire 0.8 mm diameter | 7440-03-1 | 10m |
| GX7497-25m | Niobium,Zirconium-99,1 Wire 0.8 mm diameter | 7440-03-1 | 25m |
| GX9698-5m | Niobium,Zirconium-99,1 Wire 1 mm diameter | 7440-03-1 | 5m |
| GX9698-25m | Niobium,Zirconium-99,1 Wire 1 mm diameter | 7440-03-1 | 25m |
| GX5159-1m | Niobium,Zirconium-99,1 Wire 2 mm diameter | 7440-03-1 | 1m |
| GX5159-5m | Niobium,Zirconium-99,1 Wire 2 mm diameter | 7440-03-1 | 5m |
| GX2625-50g | Niobium(V) chloride, 99+% | 10026-12-7 | 50g |
| GX2625-250g | Niobium(V) chloride, 99+% | 10026-12-7 | 250g |
| GX2415-10g | Niobium(V) n-butoxide | 51030-47-8 | 10g |
| GX0622-100g | Niobium(V) oxide, 99.5% | 1313-96-8 | 100g |
| GX0622-250g | Niobium(V) oxide, 99.5% | 1313-96-8 | 250g |
| GX1176-100g | Niobium(V) oxide, 99.9% | 1313-96-8 | 100g |
| GX1176-500g | Niobium(V) oxide, 99.9% | 1313-96-8 | 500g |
| GX2316-25g | Niobium(V) oxide, 99.98+% | 1313-96-8 | 25g |
| GX2316-100g | Niobium(V) oxide, 99.98+% | 1313-96-8 | 100g |
| GX2316-500g | Niobium(V) oxide, 99.98+% | 1313-96-8 | 500g |
| GX6706-25g | Niobium(V) oxide, 99.99% | 1313-96-8 | 25g |
| GX6706-100g | Niobium(V) oxide, 99.99% | 1313-96-8 | 100g |
| GK5500-1g | Nipecotic acid | 498-95-3 | 1g |
| GK5500-5g | Nipecotic acid | 498-95-3 | 5g |
| GK5500-25g | Nipecotic acid | 498-95-3 | 25g |
| GW0149-10mg | NIR 4d | 162411-22-5 | 10mg |
| GW0149-50mg | NIR 4d | 162411-22-5 | 50mg |
| GW0618-5mg | NIR-797-isothiocyanate | 152111-91-6 | 5mg |
| GW0618-25mg | NIR-797-isothiocyanate | 152111-91-6 | 25mg |
| GA1106-1g | Nisin | 1414-45-5 | 1g |
| GA1106-5g | Nisin | 1414-45-5 | 5g |
| GP4494-1g | Nisoldipine | 63675-72-9 | 1g |
| GP4494-5g | Nisoldipine | 63675-72-9 | 5g |
| GP0229-10mg | Nitazoxanide | 55981-09-4 | 10mg |
| GP0229-50mg | Nitazoxanide | 55981-09-4 | 50mg |
| GW4832-10mg | Nitrate Ionophore VI | 1196157-85-3 | 10mg |
| GW4832-100mg | Nitrate Ionophore VI | 1196157-85-3 | 100mg |
| GT9637-5g | Nitrazine Yellow (C.I. 14890) | 5423-07-4 | 5g |
| GT9637-25g | Nitrazine Yellow (C.I. 14890) | 5423-07-4 | 25g |
| GP6940-25mg | Nitrendipine | 39562-70-4 | 25mg |
| GP6940-100mg | Nitrendipine | 39562-70-4 | 100mg |
| GP6940-250mg | Nitrendipine | 39562-70-4 | 250mg |
| GP6940-500mg | Nitrendipine | 39562-70-4 | 500mg |
| GP6940-1g | Nitrendipine | 39562-70-4 | 1g |
| GK7834-500ml | Nitric acid | 7697-37-2 | 500ml |
| GK7834-1l | Nitric acid | 7697-37-2 | 1l |
| GW7295-10g | Nitrilotri(methylphosphonic acid) | 6419-19-8 | 10g |
| GW7295-50g | Nitrilotri(methylphosphonic acid) | 6419-19-8 | 50g |
| GK5732-25g | Nitrilotriacetic acid | 139-13-9 | 25g |
| GK5732-100g | Nitrilotriacetic acid | 139-13-9 | 100g |
| GK5732-250g | Nitrilotriacetic acid | 139-13-9 | 250g |
| GK5732-500g | Nitrilotriacetic acid | 139-13-9 | 500g |
| GK5732-1kg | Nitrilotriacetic acid | 139-13-9 | 1kg |
| GK5732-5kg | Nitrilotriacetic acid | 139-13-9 | 5kg |
| GC4263-500mg | Nitroblue tetrazolium chloride | 298-83-9 | 500mg |
| GC4263-1g | Nitroblue tetrazolium chloride | 298-83-9 | 1g |
| GC4263-5g | Nitroblue tetrazolium chloride | 298-83-9 | 5g |
| GA7337-5mg | Nitrocefin | 41906-86-9 | 5mg |
| GA7337-25mg | Nitrocefin | 41906-86-9 | 25mg |
| GA7337-100mg | Nitrocefin | 41906-86-9 | 100mg |
| GA0512-10g | Nitrofurantoin | 67-20-9 | 10g |
| GA0512-25g | Nitrofurantoin | 67-20-9 | 25g |
| GA0512-100g | Nitrofurantoin | 67-20-9 | 100g |
| GA0512-250g | Nitrofurantoin | 67-20-9 | 250g |
| GP8719-100mg | Nobiletin, 95% | 478-01-3 | 100mg |
| GP8339-5mg | Nobiletin, 98% | 478-01-3 | 5mg |
| GP8339-25mg | Nobiletin, 98% | 478-01-3 | 25mg |
| GA4846-1mg | Nocardamine | 26605-16-3 | 1mg |
| GA4846-5mg | Nocardamine | 26605-16-3 | 5mg |
| GP8428-5mg | Nocodazole | 31430-18-9 | 5mg |
| GP8428-10mg | Nocodazole | 31430-18-9 | 10mg |
| GP8428-25mg | Nocodazole | 31430-18-9 | 25mg |
| GP8428-50mg | Nocodazole | 31430-18-9 | 50mg |
| GP7069-5mg | Nolatrexed dihydrochloride | 152946-68-4 | 5mg |
| GP7069-25mg | Nolatrexed dihydrochloride | 152946-68-4 | 25mg |
| GL3975-1g | Nonadecanoic acid | 646-30-0 | 1g |
| GK7344-100ml | Nonanal | 124-19-6 | 100ml |
| GK9878-100ml | Nonanoic acid | 112-05-0 | 100ml |
| GD7153-100ml | Nonidet P40 (Substitute) | 9016-45-9 | 100ml |
| GC1498-1g | Nonyl beta-D-glucopyranoside | 69984-73-2 | 1g |
| GL3842-25ml | Nonylphenol, mixture of isomers | 84852-15-3 | 25ml |
| GP1234-1g | Norcantharidin | 29745-04-8 | 1g |
| GW0276-25mg | Nordihydrocapsiate | 220012-53-3 | 25mg |
| GW0276-100mg | Nordihydrocapsiate | 220012-53-3 | 100mg |
| GE5483-1g | Nordihydroguaiaretic acid | 500-38-9 | 1g |
| GP7483-100mg | Norepinephrine bitartrate monohydrate | 108341-18-0 | 100mg |
| GP7483-1g | Norepinephrine bitartrate monohydrate | 108341-18-0 | 1g |
| GC8232-1mg | Norethindrone b-D-glucuronide | 64701-11-7 | 1mg |
| GC8232-2mg | Norethindrone b-D-glucuronide | 64701-11-7 | 2mg |
| GC8232-5mg | Norethindrone b-D-glucuronide | 64701-11-7 | 5mg |
| GC8232-10mg | Norethindrone b-D-glucuronide | 64701-11-7 | 10mg |
| GA8833-1g | Norfloxacin | 70458-96-7 | 1g |
| GA8833-5g | Norfloxacin | 70458-96-7 | 5g |
| GA8833-25g | Norfloxacin | 70458-96-7 | 25g |
| GL5532-2mg | Norfluoxetine hydrochloride | 57226-68-3 | 2mg |
| GL5091-1g | Norharmane | 244-63-3 | 1g |
| GX6488-500g | NorPro(TM) Aluminium oxide catalyst support | 1344-28-1 | 500g |
| GX3361-1kg | NorPro(TM) Aluminium oxide catalyst support | 1344-28-1 | 1kg |
| GX6488-1kg | NorPro(TM) Aluminium oxide catalyst support | 1344-28-1 | 1kg |
| GX7787-1kg | NorPro(TM) Aluminium oxide catalyst support | 1344-28-1 | 1kg |
| GX8659-1kg | NorPro(TM) Aluminium oxide catalyst support | 1344-28-1 | 1kg |
| GX4269-1kg | NorPro(TM) Aluminium oxide catalyst support | 1344-28-1 | 1kg |
| GX2311-500g | NorPro(TM) Titanium(IV) oxide catalyst support | 13463-67-7 | 500g |
| GX2311-1kg | NorPro(TM) Titanium(IV) oxide catalyst support | 13463-67-7 | 1kg |
| GX4074-1kg | NorPro(TM) Zirconium silicate catalyst support | 10101-52-7 | 1kg |
| GP6230-1g | Nortriptyline hydrochloride | 894-71-3 | 1g |
| GY4385-1g | Noscapine hydrochloride hydrate | 912-60-7 | 1g |
| GA3364-10mg | Nourseothricin sulfate | 96736-11-7 | 10mg |
| GA3364-25mg | Nourseothricin sulfate | 96736-11-7 | 25mg |
| GA3364-100mg | Nourseothricin sulfate | 96736-11-7 | 100mg |
| GW5490-100mg | Novaluron | 116714-46-6 | 100mg |
| GW5490-500mg | Novaluron | 116714-46-6 | 500mg |
| GA5711-1g | Novobiocin sodium salt | 1476-53-5 | 1g |
| GA5711-5g | Novobiocin sodium salt | 1476-53-5 | 5g |
| GL9671-1mg | NSC697923 | 343351-67-7 | 1mg |
| GL9671-5mg | NSC697923 | 343351-67-7 | 5mg |
| GL9671-25mg | NSC697923 | 343351-67-7 | 25mg |
| GL7670-1mg | NU6102 | 444722-95-6 | 1mg |
| GL7670-5mg | NU6102 | 444722-95-6 | 5mg |
| GT3172-1g | Nuclear Fast Red (C.I. 60760) | 6409-77-4 | 1g |
| GT3172-5g | Nuclear Fast Red (C.I. 60760) | 6409-77-4 | 5g |
| GE1658-100ml | Nuclear Fast Red solution | 6409-77-4 | 100ml |
| GE1658-250ml | Nuclear Fast Red solution | 6409-77-4 | 250ml |
| GW9334-5mg | NVP-BEZ235 | 915019-65-7 | 5mg |
| GW9334-25mg | NVP-BEZ235 | 915019-65-7 | 25mg |
| GW3341-1mg | NVP-BGJ398 | 872511-34-7 | 1mg |
| GW3341-5mg | NVP-BGJ398 | 872511-34-7 | 5mg |
| GW3341-10mg | NVP-BGJ398 | 872511-34-7 | 10mg |
| GW0088-1mg | NVP-BSK805 dihydrochloride | 1092499-93-8 | 1mg |
| GW0088-5mg | NVP-BSK805 dihydrochloride | 1092499-93-8 | 5mg |
| GW0088-10mg | NVP-BSK805 dihydrochloride | 1092499-93-8 | 10mg |
| GA3995-1g | Nystatin hydrate | 1400-61-9 | 1g |
| GA3995-5g | Nystatin hydrate | 1400-61-9 | 5g |
| GA3995-10g | Nystatin hydrate | 1400-61-9 | 10g |
| GP7660-5MIU | Nystatin hydrate, 4400 U/mg, USP grade | 1400-61-9 | 5MIU |
| GP7660-25MIU | Nystatin hydrate, 4400 U/mg, USP grade | 1400-61-9 | 25MIU |
| GC7871-100mg | Nystose | 13133-07-8 | 100mg |
| GL3915-50mg | Nα-Tosyl-L-lysine chloromethyl ketone hydrochloride | 4272-74-6 | 50mg |
| GL3915-250mg | Nα-Tosyl-L-lysine chloromethyl ketone hydrochloride | 4272-74-6 | 250mg |
| GE2187-5g | O-(1H-6-Chlorobenzotriazol-1-yl)-1,1,3,3-tetramethyluronium hexafluorophosphate | 330645-87-9 | 5g |
| GE2187-25g | O-(1H-6-Chlorobenzotriazol-1-yl)-1,1,3,3-tetramethyluronium hexafluorophosphate | 330645-87-9 | 25g |
| GE2187-100g | O-(1H-6-Chlorobenzotriazol-1-yl)-1,1,3,3-tetramethyluronium hexafluorophosphate | 330645-87-9 | 100g |
| GC4687-5mg | O-(2-Acetamido-2-deoxy-D-glucopyranosylidene)amino N-phenyl carbamate | 132489-69-1 | 5mg |
| GC4687-10mg | O-(2-Acetamido-2-deoxy-D-glucopyranosylidene)amino N-phenyl carbamate | 132489-69-1 | 10mg |
| GC4687-25mg | O-(2-Acetamido-2-deoxy-D-glucopyranosylidene)amino N-phenyl carbamate | 132489-69-1 | 25mg |
| GC4687-50mg | O-(2-Acetamido-2-deoxy-D-glucopyranosylidene)amino N-phenyl carbamate | 132489-69-1 | 50mg |
| GM9905-25g | O-(Carboxymethyl)hydroxylamine hemihydrochloride | 2921-14-4 | 25g |
| GT9187-10g | o-Cresolphthalein | 596-27-0 | 10g |
| GT9187-25g | o-Cresolphthalein | 596-27-0 | 25g |
| GT9187-50g | o-Cresolphthalein | 596-27-0 | 50g |
| GT9187-100g | o-Cresolphthalein | 596-27-0 | 100g |
| GT0978-1g | o-Cresolphthalein complexone | 2411-89-4 | 1g |
| GT0978-5g | o-Cresolphthalein complexone | 2411-89-4 | 5g |
| GT0978-10g | o-Cresolphthalein complexone | 2411-89-4 | 10g |
| GT0978-25g | o-Cresolphthalein complexone | 2411-89-4 | 25g |
| GT0978-100g | o-Cresolphthalein complexone | 2411-89-4 | 100g |
| GL6106-10mg | O-Desmethylnaproxen | 52079-10-4 | 10mg |
| GL6106-50mg | O-Desmethylnaproxen | 52079-10-4 | 50mg |
| GW4397-25g | o-Dianisidine | 119-90-4 | 25g |
| GT5099-5g | o-Dianisidine dihydrochloride | 20325-40-0 | 5g |
| GT5099-25g | o-Dianisidine dihydrochloride | 20325-40-0 | 25g |
| GL8260-25g | O-Methylisourea hemisulfate salt | 52328-05-9 | 25g |
| GL8260-100g | O-Methylisourea hemisulfate salt | 52328-05-9 | 100g |
| GL8260-250g | O-Methylisourea hemisulfate salt | 52328-05-9 | 250g |
| GK5598-25g | o-Phenylenediamine | 95-54-5 | 25g |
| GK5598-100g | o-Phenylenediamine | 95-54-5 | 100g |
| GV2342-5g | O-Phosphorylethanolamine | 1071-23-4 | 5g |
| GV2342-25g | O-Phosphorylethanolamine | 1071-23-4 | 25g |
| GK7409-1g | o-Phthaldialdehyde | 643-79-8 | 1g |
| GK7409-5g | o-Phthaldialdehyde | 643-79-8 | 5g |
| GK7409-25g | o-Phthaldialdehyde | 643-79-8 | 25g |
| GK7409-50g | o-Phthaldialdehyde | 643-79-8 | 50g |
| GK7409-100g | o-Phthaldialdehyde | 643-79-8 | 100g |
| GW4379-25g | o-Phthaldialdehyde, 99% | 643-79-8 | 25g |
| GW4379-100g | o-Phthaldialdehyde, 99% | 643-79-8 | 100g |
| GT1956-25g | o-Tolidine | 119-93-7 | 25g |
| GT1956-100g | o-Tolidine | 119-93-7 | 100g |
| GT5901-25g | o-Toluidine | 95-53-4 | 25g |
| GK6646-25g | o-Vanillin | 148-53-8 | 25g |
| GK6646-100g | o-Vanillin | 148-53-8 | 100g |
| GK6646-500g | o-Vanillin | 148-53-8 | 500g |
| GL9542-100ml | o-Xylene | 95-47-6 | 100ml |
| GS7536-500ml | o-Xylene, GlenPure™, analytical grade | 95-47-6 | 500ml |
| GC6430-1mg | O-β-D-Galactopyranosyl-(1-4)-O-β-D-glucopyranosyl-(1-4)-D-glucose | 90025-36-8 | 1mg |
| GC6430-2mg | O-β-D-Galactopyranosyl-(1-4)-O-β-D-glucopyranosyl-(1-4)-D-glucose | 90025-36-8 | 2mg |
| GC6430-5mg | O-β-D-Galactopyranosyl-(1-4)-O-β-D-glucopyranosyl-(1-4)-D-glucose | 90025-36-8 | 5mg |
| GW3817-10mg | O''-(Carboxymethyl)fluoresceinamide | 442151-50-0 | 10mg |
| GW3817-125mg | O''-(Carboxymethyl)fluoresceinamide | 442151-50-0 | 125mg |
| GC9805-1mg | Obeticholic acid 3-O-β-D-glucuronide | 2270232-93-2 | 1mg |
| GC9805-2mg | Obeticholic acid 3-O-β-D-glucuronide | 2270232-93-2 | 2mg |
| GC9805-5mg | Obeticholic acid 3-O-β-D-glucuronide | 2270232-93-2 | 5mg |
| GC9805-10mg | Obeticholic acid 3-O-β-D-glucuronide | 2270232-93-2 | 10mg |
| GC5072-1mg | Obeticholic acid acyl-β-D-glucuronide | 1mg | |
| GC5072-2mg | Obeticholic acid acyl-β-D-glucuronide | 2mg | |
| GC5072-5mg | Obeticholic acid acyl-β-D-glucuronide | 5mg | |
| GC5072-10mg | Obeticholic acid acyl-β-D-glucuronide | 10mg | |
| GL8155-1mg | Obscurolide A1 | 144397-99-9 | 1mg |
| GL8155-5mg | Obscurolide A1 | 144397-99-9 | 5mg |
| GL6509-250ug | OCH | 383187-82-4 | 250ug |
| GL6509-1mg | OCH | 383187-82-4 | 1mg |
| GA6945-1mg | Ochratoxin A | 303-47-9 | 1mg |
| GK5605-50g | Octadecyl isocyanate | 112-96-9 | 50g |
| GW8934-5g | Octafluoronaphthalene | 313-72-4 | 5g |
| GW8934-25g | Octafluoronaphthalene | 313-72-4 | 25g |
| GK5959-25ml | Octane | 111-65-9 | 25ml |
| GK5959-100ml | Octane | 111-65-9 | 100ml |
| GK2275-25ml | Octanoic acid | 124-07-2 | 25ml |
| GK2275-100ml | Octanoic acid | 124-07-2 | 100ml |
| GC7259-1g | Octanoyl D-glucopyranoside | 60415-65-8 | 1g |
| GC7259-2g | Octanoyl D-glucopyranoside | 60415-65-8 | 2g |
| GC7259-5g | Octanoyl D-glucopyranoside | 60415-65-8 | 5g |
| GC7259-10g | Octanoyl D-glucopyranoside | 60415-65-8 | 10g |
| GP2536-1g | Octenidine dihydrochloride | 70775-75-6 | 1g |
| GP2536-5g | Octenidine dihydrochloride | 70775-75-6 | 5g |
| GP2536-10g | Octenidine dihydrochloride | 70775-75-6 | 10g |
| GP4360-25mg | Octreotide acetate | 79517-01-4 | 25mg |
| GP4360-100mg | Octreotide acetate | 79517-01-4 | 100mg |
| GC0507-1g | Octyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside | 38954-67-5 | 1g |
| GC1611-100mg | Octyl alpha-D-glucopyranoside | 29781-80-4 | 100mg |
| GC1611-250mg | Octyl alpha-D-glucopyranoside | 29781-80-4 | 250mg |
| GC1611-500mg | Octyl alpha-D-glucopyranoside | 29781-80-4 | 500mg |
| GC1611-1g | Octyl alpha-D-glucopyranoside | 29781-80-4 | 1g |
| GC9098-100mg | Octyl b-D-glucopyranoside | 29836-26-8 | 100mg |
| GC9098-250mg | Octyl b-D-glucopyranoside | 29836-26-8 | 250mg |
| GC9098-500mg | Octyl b-D-glucopyranoside | 29836-26-8 | 500mg |
| GC9098-1g | Octyl b-D-glucopyranoside | 29836-26-8 | 1g |
| GC9098-5g | Octyl b-D-glucopyranoside | 29836-26-8 | 5g |
| GC7634-1g | Octyl b-D-thioglucopyranoside | 85618-21-9 | 1g |
| GC7634-5g | Octyl b-D-thioglucopyranoside | 85618-21-9 | 5g |
| GC7634-10g | Octyl b-D-thioglucopyranoside | 85618-21-9 | 10g |
| GC5159-1g | Octyl beta-D-galactopyranoside | 40427-75-6 | 1g |
| GW3561-50mg | Oenanthacid-4-(trifluormethyl)-umbelliferone | 351002-79-4 | 50mg |
| GW3561-500mg | Oenanthacid-4-(trifluormethyl)-umbelliferone | 351002-79-4 | 500mg |
| GA7752-1g | Ofloxacin | 82419-36-1 | 1g |
| GA7752-5g | Ofloxacin | 82419-36-1 | 5g |
| GA7752-10g | Ofloxacin | 82419-36-1 | 10g |
| GA7752-25g | Ofloxacin | 82419-36-1 | 25g |
| GW0498-1g | Ohira-Bestmann Reagent | 90965-06-3 | 1g |
| GW0498-5g | Ohira-Bestmann Reagent | 90965-06-3 | 5g |
| GW2761-10ml | Ohira-Bestmann Reagent Solution | 90965-06-3 | 10ml |
| GW2761-50ml | Ohira-Bestmann Reagent Solution | 90965-06-3 | 50ml |
| GT6537-25g | Oil Red O (C.I. 26125) | 1320-06-5 | 25g |
| GT6537-100g | Oil Red O (C.I. 26125) | 1320-06-5 | 100g |
| GT0932-250ml | Oil Red O (C.I. 26125); 0.5% in isopropanol | 1320-06-5 | 250ml |
| GT0932-500ml | Oil Red O (C.I. 26125); 0.5% in isopropanol | 1320-06-5 | 500ml |
| GT8113-100ml | Oil Red O (C.I. 26125); 0.5% in propylene glycol | 1320-06-5 | 100ml |
| GT8113-250ml | Oil Red O (C.I. 26125); 0.5% in propylene glycol | 1320-06-5 | 250ml |
| GL7691-25ug | Okadaic acid | 78111-17-8 | 25ug |
| GL7691-100ug | Okadaic acid | 78111-17-8 | 100ug |
| GL6524-25ug | Okadaic acid ammonium salt | 155716-06-6 | 25ug |
| GL6524-100ug | Okadaic acid ammonium salt | 155716-06-6 | 100ug |
| GK0698-100ug | Okadaic acid potassium salt | 155751-72-7 | 100ug |
| GK2362-25ug | Okadaic acid sodium salt | 209266-80-8 | 25ug |
| GK2362-100ug | Okadaic acid sodium salt | 209266-80-8 | 100ug |
| GP8311-100mg | Olanzapine | 132539-06-1 | 100mg |
| GP8311-250mg | Olanzapine | 132539-06-1 | 250mg |
| GP8311-1g | Olanzapine | 132539-06-1 | 1g |
| GP8012-1g | Olanzapine, USP grade | 132539-06-1 | 1g |
| GP0126-100mg | Olaparib | 763113-22-0 | 100mg |
| GP0126-250mg | Olaparib | 763113-22-0 | 250mg |
| GP0126-1g | Olaparib | 763113-22-0 | 1g |
| GX5532-100mg | Olaquindox | 23696-28-8 | 100mg |
| GX5532-250mg | Olaquindox | 23696-28-8 | 250mg |
| GW8900-5mg | Oleacein | 149183-75-5 | 5mg |
| GX9499-5g | Oleamidopropyl dimethylamine | 109-28-4 | 5g |
| GX9499-25g | Oleamidopropyl dimethylamine | 109-28-4 | 25g |
| GK1669-100mg | Oleanolic acid, 97% | 508-02-1 | 100mg |
| GK1669-250mg | Oleanolic acid, 97% | 508-02-1 | 250mg |
| GK1669-500mg | Oleanolic acid, 97% | 508-02-1 | 500mg |
| GY4261-10mg | Oleanonic acid | 17990-42-0 | 10mg |
| GK1568-5g | Oleic acid, 99% | 112-80-1 | 5g |
| GK1568-25g | Oleic acid, 99% | 112-80-1 | 25g |
| GW3064-5mg | Oleocanthal | 289030-99-5 | 5mg |
| GL3237-25mg | Oleuropein | 32619-42-4 | 25mg |
| GL3237-100mg | Oleuropein | 32619-42-4 | 100mg |
| GL2102-1g | Oleyl acetate | 693-80-1 | 1g |
| GA0390-5mg | Oligomycin A | 579-13-5 | 5mg |
| GL2132-100ml | Olive oil | 8001-25-0 | 100ml |
| GL2132-500ml | Olive oil | 8001-25-0 | 500ml |
| GL3812-100ml | Olive oil, extra virgin, EP grade | 8001-25-0 | 100ml |
| GL3812-500ml | Olive oil, extra virgin, EP grade | 8001-25-0 | 500ml |
| GL3812-1l | Olive oil, extra virgin, EP grade | 8001-25-0 | 1l |
| GP5497-100mg | Olmesartan | 144689-24-7 | 100mg |
| GP5497-250mg | Olmesartan | 144689-24-7 | 250mg |
| GP3934-50mg | Olmesartan medoxomil | 144689-63-4 | 50mg |
| GP3934-100mg | Olmesartan medoxomil | 144689-63-4 | 100mg |
| GP3934-250mg | Olmesartan medoxomil | 144689-63-4 | 250mg |
| GL1318-1mg | OM173-alphaA | 58286-56-9 | 1mg |
| GL1318-5mg | OM173-alphaA | 58286-56-9 | 5mg |
| GP2190-1g | Omeprazole | 73590-58-6 | 1g |
| GP2190-5g | Omeprazole | 73590-58-6 | 5g |
| GP2190-10g | Omeprazole | 73590-58-6 | 10g |
| GP2190-25g | Omeprazole | 73590-58-6 | 25g |
| GW9967-25mg | Omeprazole sulfide | 73590-85-9 | 25mg |
| GW9967-250mg | Omeprazole sulfide | 73590-85-9 | 250mg |
| GP5610-5g | Omeprazole, EP grade | 73590-58-6 | 5g |
| GP5672-1g | Ondansetron hydrochloride dihydrate | 103639-04-9 | 1g |
| GP5672-5g | Ondansetron hydrochloride dihydrate | 103639-04-9 | 5g |
| GC0066-1mg | Ononin | 486-62-4 | 1mg |
| GW4334-1mg | ONX 0914 | 960374-59-8 | 1mg |
| GW4334-5mg | ONX 0914 | 960374-59-8 | 5mg |
| GW4334-25mg | ONX 0914 | 960374-59-8 | 25mg |
| GY5087-1mg | Oosporein | 475-54-7 | 1mg |
| GW1080-5mg | Opaganib | 915385-81-8 | 5mg |
| GW1080-25mg | Opaganib | 915385-81-8 | 25mg |
| GW1080-100mg | Opaganib | 915385-81-8 | 100mg |
| GA7678-100ug | Ophiobolin A | 4611-05-6 | 100ug |
| GA7678-1mg | Ophiobolin A | 4611-05-6 | 1mg |
| GL3703-5mg | Opiorphin | 864084-88-8 | 5mg |
| GW5115-10mg | Opipramol | 315-72-0 | 10mg |
| GW5115-50mg | Opipramol | 315-72-0 | 50mg |
| GL4485-100mg | Opipramol dihydrochloride | 909-39-7 | 100mg |
| GL4485-1g | Opipramol dihydrochloride | 909-39-7 | 1g |
| GW2060-1mg | Oprozomib [ONX 0912] | 935888-69-0 | 1mg |
| GW2060-5mg | Oprozomib [ONX 0912] | 935888-69-0 | 5mg |
| GW2060-25mg | Oprozomib [ONX 0912] | 935888-69-0 | 25mg |
| GT5052-1g | Oracet blue 2R (C.I. 61110) | 4395-65-7 | 1g |
| GT7194-5g | Orange G (C.I. 16230) | 1936-15-8 | 5g |
| GT7194-25g | Orange G (C.I. 16230) | 1936-15-8 | 25g |
| GT7194-100g | Orange G (C.I. 16230) | 1936-15-8 | 100g |
| GT2987-25g | Orange II sodium salt | 633-96-5 | 25g |
| GT2987-100g | Orange II sodium salt | 633-96-5 | 100g |
| GT2987-500g | Orange II sodium salt | 633-96-5 | 500g |
| GT8334-1g | Orange OT (C.I. 12100) | 2646-17-5 | 1g |
| GT8334-5g | Orange OT (C.I. 12100) | 2646-17-5 | 5g |
| GW2996-25mg | Orantinib | 252916-29-3 | 25mg |
| GW2996-100mg | Orantinib | 252916-29-3 | 100mg |
| GA8562-100mg | Orbifloxacin | 113617-63-3 | 100mg |
| GA8562-1g | Orbifloxacin | 113617-63-3 | 1g |
| GT0012-1g | Orcein | 1400-62-0 | 1g |
| GT0012-5g | Orcein | 1400-62-0 | 5g |
| GT0012-10g | Orcein | 1400-62-0 | 10g |
| GT0012-25g | Orcein | 1400-62-0 | 25g |
| GE8094-5g | Orcinol anhydrous | 504-15-4 | 5g |
| GE8094-25g | Orcinol anhydrous | 504-15-4 | 25g |
| GT3752-25g | Orcinol monohydrate | 6153-39-5 | 25g |
| GT3752-100g | Orcinol monohydrate | 6153-39-5 | 100g |
| GC4819-1mg | Orientin | 28608-75-5 | 1mg |
| GC4819-5mg | Orientin | 28608-75-5 | 5mg |
| GP9255-50mg | Orlistat | 96829-58-2 | 50mg |
| GP9255-250mg | Orlistat | 96829-58-2 | 250mg |
| GA0397-5g | Ornidazole | 16773-42-5 | 5g |
| GA0397-25g | Ornidazole | 16773-42-5 | 25g |
| GL6913-10mg | Oroxylin A | 480-11-5 | 10mg |
| GP9944-25mg | Oseltamivir phosphate | 204255-11-8 | 25mg |
| GP9944-100mg | Oseltamivir phosphate | 204255-11-8 | 100mg |
| GP3791-10mg | Osimertinib | 1421373-65-0 | 10mg |
| GT4710-1g | Osmium tetroxide | 20816-12-0 | 1g |
| GX9093-5ml | Osmium(VIII) oxide solution, 4% OsO4 | 20816-12-0 | 5ml |
| GX5054-1g | Osmium(VIII) oxide, 99.9% | 20816-12-0 | 1g |
| GP0976-100mg | Osthol | 484-12-8 | 100mg |
| GP0976-250mg | Osthol | 484-12-8 | 250mg |
| GP0976-500mg | Osthol | 484-12-8 | 500mg |
| GP0976-1g | Osthol | 484-12-8 | 1g |
| GC9310-100mg | Ouabain octahydrate, 95% | 11018-89-6 | 100mg |
| GC9218-100mg | Ouabain octahydrate, EP grade | 11018-89-6 | 100mg |
| GA9839-1g | Oxacillin sodium salt monohydrate | 7240-38-2 | 1g |
| GA9839-5g | Oxacillin sodium salt monohydrate | 7240-38-2 | 5g |
| GK7172-250g | Oxalic acid dihydrate | 6153-56-6 | 250g |
| GK7172-500g | Oxalic acid dihydrate | 6153-56-6 | 500g |
| GK7172-1kg | Oxalic acid dihydrate | 6153-56-6 | 1kg |
| GK3343-25g | Oxalic acid, anhydrous | 144-62-7 | 25g |
| GP0792-25mg | Oxaliplatin | 61825-94-3 | 25mg |
| GP0792-100mg | Oxaliplatin | 61825-94-3 | 100mg |
| GP0792-250mg | Oxaliplatin | 61825-94-3 | 250mg |
| GC4262-1mg | Oxaprozin acyl-β-D-glucuronide | 90283-09-3 | 1mg |
| GC4262-2mg | Oxaprozin acyl-β-D-glucuronide | 90283-09-3 | 2mg |
| GC4262-5mg | Oxaprozin acyl-β-D-glucuronide | 90283-09-3 | 5mg |
| GC4262-10mg | Oxaprozin acyl-β-D-glucuronide | 90283-09-3 | 10mg |
| GP6085-25mg | Oxibendazole | 20559-55-1 | 25mg |
| GP6085-100mg | Oxibendazole | 20559-55-1 | 100mg |
| GP6085-250mg | Oxibendazole | 20559-55-1 | 250mg |
| GP6085-500mg | Oxibendazole | 20559-55-1 | 500mg |
| GK4423-5g | Oxindole | 59-48-3 | 5g |
| GK4423-25g | Oxindole | 59-48-3 | 25g |
| GA2313-1g | Oxolinic acid | 14698-29-4 | 1g |
| GA2313-5g | Oxolinic acid | 14698-29-4 | 5g |
| GA2313-25g | Oxolinic acid | 14698-29-4 | 25g |
| GW6216-50mg | Oxonol V | 61389-30-8 | 50mg |
| GW6216-500mg | Oxonol V | 61389-30-8 | 500mg |
| GP3654-50mg | Oxyclozanide | 2277-92-1 | 50mg |
| GP8666-100mg | Oxymatrine | 16837-52-8 | 100mg |
| GP8666-500mg | Oxymatrine | 16837-52-8 | 500mg |
| GP5903-1g | Oxymetazoline hydrochloride | 2315-02-8 | 1g |
| GP5903-5g | Oxymetazoline hydrochloride | 2315-02-8 | 5g |
| GP5903-10g | Oxymetazoline hydrochloride | 2315-02-8 | 10g |
| GP5903-25g | Oxymetazoline hydrochloride | 2315-02-8 | 25g |
| GX5694-1mg | Oxyplicacetin | 100108-92-7 | 1mg |
| GP2898-100mg | Oxyresveratrol | 29700-22-9 | 100mg |
| GP2898-1g | Oxyresveratrol | 29700-22-9 | 1g |
| GA7172-5g | Oxytetracycline dihydrate | 6153-64-6 | 5g |
| GA7172-10g | Oxytetracycline dihydrate | 6153-64-6 | 10g |
| GA7172-25g | Oxytetracycline dihydrate | 6153-64-6 | 25g |
| GA7172-50g | Oxytetracycline dihydrate | 6153-64-6 | 50g |
| GA7172-100g | Oxytetracycline dihydrate | 6153-64-6 | 100g |
| GA3147-10g | Oxytetracycline hydrochloride | 2058-46-0 | 10g |
| GA3147-25g | Oxytetracycline hydrochloride | 2058-46-0 | 25g |
| GA3147-50g | Oxytetracycline hydrochloride | 2058-46-0 | 50g |
| GA3147-100g | Oxytetracycline hydrochloride | 2058-46-0 | 100g |
| GV2536-1g | Oxythiamine chloride hydrochloride | 614-05-1 | 1g |
| GV2536-5g | Oxythiamine chloride hydrochloride | 614-05-1 | 5g |
| GP7270-50mg | Ozagrel | 82571-53-7 | 50mg |
| GP7270-100mg | Ozagrel | 82571-53-7 | 100mg |
| GC9506-25mg | p-Acetamidophenyl β-D-glucuronide sodium salt | 120595-80-4 | 25mg |
| GC9506-50mg | p-Acetamidophenyl β-D-glucuronide sodium salt | 120595-80-4 | 50mg |
| GC9506-100mg | p-Acetamidophenyl β-D-glucuronide sodium salt | 120595-80-4 | 100mg |
| GC9506-250mg | p-Acetamidophenyl β-D-glucuronide sodium salt | 120595-80-4 | 250mg |
| GK9270-5g | p-Anisaldehyde | 123-11-5 | 5g |
| GK0396-5g | p-Benzoquinone | 106-51-4 | 5g |
| GK0396-25g | p-Benzoquinone | 106-51-4 | 25g |
| GK7861-25g | p-Cresol | 106-44-5 | 25g |
| GK7861-100g | p-Cresol | 106-44-5 | 100g |
| GL5941-25ml | p-Cymene | 99-87-6 | 25ml |
| GT5664-5g | p-Nitroaniline | 100-01-6 | 5g |
| GT5664-25g | p-Nitroaniline | 100-01-6 | 25g |
| GC8584-1g | p-Nitrophenyl 2,3,4,6-Tetra-O-acetyl-α-D-galactopyranoside | 17042-39-6 | 1g |
| GC8584-2g | p-Nitrophenyl 2,3,4,6-Tetra-O-acetyl-α-D-galactopyranoside | 17042-39-6 | 2g |
| GC8584-5g | p-Nitrophenyl 2,3,4,6-Tetra-O-acetyl-α-D-galactopyranoside | 17042-39-6 | 5g |
| GC8584-10g | p-Nitrophenyl 2,3,4,6-Tetra-O-acetyl-α-D-galactopyranoside | 17042-39-6 | 10g |
| GK3873-25g | p-Phenylenediamine | 106-50-3 | 25g |
| GK3873-100g | p-Phenylenediamine | 106-50-3 | 100g |
| GT4761-25g | p-Rosolic acid (C.I. 43800) | 603-45-2 | 25g |
| GT4761-100g | p-Rosolic acid (C.I. 43800) | 603-45-2 | 100g |
| GX7984-25g | p-Tolualdehyde | 104-87-0 | 25g |
| GX7984-100g | p-Tolualdehyde | 104-87-0 | 100g |
| GX7984-500g | p-Tolualdehyde | 104-87-0 | 500g |
| GK6346-25g | p-Toluenesulfonamide | 70-55-3 | 25g |
| GK6346-100g | p-Toluenesulfonamide | 70-55-3 | 100g |
| GK9853-100g | p-Toluenesulfonic acid monohydrate | 6192-52-5 | 100g |
| GK9853-250g | p-Toluenesulfonic acid monohydrate | 6192-52-5 | 250g |
| GK9853-1kg | p-Toluenesulfonic acid monohydrate | 6192-52-5 | 1kg |
| GK9853-5kg | p-Toluenesulfonic acid monohydrate | 6192-52-5 | 5kg |
| GK4222-25g | p-Toluenesulfonyl chloride | 98-59-9 | 25g |
| GK4222-100g | p-Toluenesulfonyl chloride | 98-59-9 | 100g |
| GK5816-25g | p-Toluenesulfonylmethyl isocyanide | 36635-61-7 | 25g |
| GS9800-500ml | p-Xylene, GlenPure™, analytical grade | 106-42-3 | 500ml |
| GA4564-25mg | Paclitaxel | 33069-62-4 | 25mg |
| GA4564-100mg | Paclitaxel | 33069-62-4 | 100mg |
| GA4564-250mg | Paclitaxel | 33069-62-4 | 250mg |
| GA4564-500mg | Paclitaxel | 33069-62-4 | 500mg |
| GK1979-250mg | Paclobutrazol | 76738-62-0 | 250mg |
| GK1979-1g | Paclobutrazol | 76738-62-0 | 1g |
| GK1979-5g | Paclobutrazol | 76738-62-0 | 5g |
| GC2063-25mg | Paeoniflorin | 23180-57-6 | 25mg |
| GC2063-100mg | Paeoniflorin | 23180-57-6 | 100mg |
| GC2063-250mg | Paeoniflorin | 23180-57-6 | 250mg |
| GP6253-1g | Paeonol | 552-41-0 | 1g |
| GP6253-5g | Paeonol | 552-41-0 | 5g |
| GP6253-10g | Paeonol | 552-41-0 | 10g |
| GP6253-25g | Paeonol | 552-41-0 | 25g |
| GP4250-250mg | Palatinitol | 64519-82-0 | 250mg |
| GP4250-1g | Palatinitol | 64519-82-0 | 1g |
| GP4250-5g | Palatinitol | 64519-82-0 | 5g |
| GP6134-5g | Palatinose | 13718-94-0 | 5g |
| GP6134-25g | Palatinose | 13718-94-0 | 25g |
| GX0330-5mg | Palbociclib | 571190-30-2 | 5mg |
| GX0330-25mg | Palbociclib | 571190-30-2 | 25mg |
| GP3914-250mg | Paliperidone | 144598-75-4 | 250mg |
| GP3914-1g | Paliperidone | 144598-75-4 | 1g |
| GL0442-1mg | Palitantin | 15265-28-8 | 1mg |
| GX4473-10g | Palladium 5% on Calcium carbonate 5% Pd/CaCO3 (Lindlar) (Heraeus-Type K-0233) | 7440-05-3 | 10g |
| GX4473-50g | Palladium 5% on Calcium carbonate 5% Pd/CaCO3 (Lindlar) (Heraeus-Type K-0233) | 7440-05-3 | 50g |
| GX4473-100g | Palladium 5% on Calcium carbonate 5% Pd/CaCO3 (Lindlar) (Heraeus-Type K-0233) | 7440-05-3 | 100g |
| GX4843-25x25mm | Palladium Foil 0.025mm, 99.9% | 7440-05-3 | 25x25mm |
| GX8101-25x25mm | Palladium Foil 0.5mm, 99.9% | 7440-05-3 | 25x25mm |
| GX3157-25x25mm | Palladium Foil 0.5mm, 99.95% | 7440-05-3 | 25x25mm |
| GX1879-25x25mm | Palladium Foil 1.0mm, 99.9% | 7440-05-3 | 25x25mm |
| GX4532-10g | Palladium on Activated Carbon 1% Pd/C (Heraeus-Type K-0236) | 7440-05-3 | 10g |
| GX4532-50g | Palladium on Activated Carbon 1% Pd/C (Heraeus-Type K-0236) | 7440-05-3 | 50g |
| GX6197-10g | Palladium on Activated Carbon 3% Pd/C (Heraeus-Type K-0224) | 7440-05-3 | 10g |
| GX6197-50g | Palladium on Activated Carbon 3% Pd/C (Heraeus-Type K-0224) | 7440-05-3 | 50g |
| GX6197-100g | Palladium on Activated Carbon 3% Pd/C (Heraeus-Type K-0224) | 7440-05-3 | 100g |
| GX0791-10g | Palladium on Activated Carbon 3% Pd/C (Heraeus-Type K-0255) | 7440-05-3 | 10g |
| GX0791-50g | Palladium on Activated Carbon 3% Pd/C (Heraeus-Type K-0255) | 7440-05-3 | 50g |
| GX0791-100g | Palladium on Activated Carbon 3% Pd/C (Heraeus-Type K-0255) | 7440-05-3 | 100g |
| GX2409-50g | Palladium on Activated Carbon 3% Pd/C (Heraeus-Type K-0257) | 7440-05-3 | 50g |
| GX2409-100g | Palladium on Activated Carbon 3% Pd/C (Heraeus-Type K-0257) | 7440-05-3 | 100g |
| GX0299-50g | Palladium on Activated Carbon 3% Pd/C (Heraeus-Type K-0258) | 7440-05-3 | 50g |
| GX0299-100g | Palladium on Activated Carbon 3% Pd/C (Heraeus-Type K-0258) | 7440-05-3 | 100g |
| GX6502-50g | Palladium on Activated Carbon 3% Pd/C (Heraeus-Type K-0259) | 7440-05-3 | 50g |
| GX6502-100g | Palladium on Activated Carbon 3% Pd/C (Heraeus-Type K-0259) | 7440-05-3 | 100g |
| GX7259-50g | Palladium on Activated Carbon 3% Pd/C (Heraeus-Type K-0261) | 7440-05-3 | 50g |
| GX0043-50g | Palladium on Activated Carbon 3% Pd/C (Heraeus-Type K-0261) | 7440-05-3 | 50g |
| GX7259-100g | Palladium on Activated Carbon 3% Pd/C (Heraeus-Type K-0261) | 7440-05-3 | 100g |
| GX0043-100g | Palladium on Activated Carbon 3% Pd/C (Heraeus-Type K-0261) | 7440-05-3 | 100g |
| GX5239-10g | Palladium on Activated Carbon 4% Pd, 1% Rh/C (Heraeus-Type K-0234) | 7440-05-3 | 10g |
| GX8667-10g | Palladium on Activated Carbon 5% Pd/C (Heraeus-Type K-0201) | 7440-05-3 | 10g |
| GX3964-5g | Palladium on Activated Carbon 5% Pd/C (Heraeus-Type K-0201S) | 7440-05-3 | 5g |
| GX5650-10g | Palladium on Activated Carbon 5% Pd/C (Heraeus-Type K-0209) | 7440-05-3 | 10g |
| GX5650-50g | Palladium on Activated Carbon 5% Pd/C (Heraeus-Type K-0209) | 7440-05-3 | 50g |
| GX0848-5g | Palladium on Activated Carbon 5% Pd/C (Heraeus-Type K-0219) | 7440-05-3 | 5g |
| GX0848-10g | Palladium on Activated Carbon 5% Pd/C (Heraeus-Type K-0219) | 7440-05-3 | 10g |
| GX0848-50g | Palladium on Activated Carbon 5% Pd/C (Heraeus-Type K-0219) | 7440-05-3 | 50g |
| GX8277-5g | Palladium on Activated Carbon 5% Pd/C (Heraeus-Type K-0227) | 7440-05-3 | 5g |
| GX8277-10g | Palladium on Activated Carbon 5% Pd/C (Heraeus-Type K-0227) | 7440-05-3 | 10g |
| GX8277-50g | Palladium on Activated Carbon 5% Pd/C (Heraeus-Type K-0227) | 7440-05-3 | 50g |
| GX9106-50g | Palladium on Alumina 0,1% Pd/Al2O3 (Heraeus-Type K-0243) | 7440-05-3 | 50g |
| GX9106-100g | Palladium on Alumina 0,1% Pd/Al2O3 (Heraeus-Type K-0243) | 7440-05-3 | 100g |
| GX2378-50g | Palladium on Alumina 0,5% Pd/g-Al2O3 (Heraeus-Type K-0270) | 7440-05-3 | 50g |
| GX2378-100g | Palladium on Alumina 0,5% Pd/g-Al2O3 (Heraeus-Type K-0270) | 7440-05-3 | 100g |
| GX7714-5g | Palladium on Alumina 5% Pd/Al2O3 (Heraeus-Type K-050) | 7440-05-3 | 5g |
| GX7714-10g | Palladium on Alumina 5% Pd/Al2O3 (Heraeus-Type K-050) | 7440-05-3 | 10g |
| GX7714-50g | Palladium on Alumina 5% Pd/Al2O3 (Heraeus-Type K-050) | 7440-05-3 | 50g |
| GX1737-10g | Palladium on Barium sulfate 10% Pd/BaSO4 (Heraeus-Type K-0206) | 7440-05-3 | 10g |
| GX1737-50g | Palladium on Barium sulfate 10% Pd/BaSO4 (Heraeus-Type K-0206) | 7440-05-3 | 50g |
| GX3621-10g | Palladium on Barium sulfate 5% Pd/BaSO4 (Heraeus-Type K-0205) | 7440-05-3 | 10g |
| GX3621-50g | Palladium on Barium sulfate 5% Pd/BaSO4 (Heraeus-Type K-0205) | 7440-05-3 | 50g |
| GX5725-10g | Palladium on Calcium carbonate 10% Pd/CaCO3 (Heraeus-Type K-0208) | 7440-05-3 | 10g |
| GX5725-50g | Palladium on Calcium carbonate 10% Pd/CaCO3 (Heraeus-Type K-0208) | 7440-05-3 | 50g |
| GX5725-100g | Palladium on Calcium carbonate 10% Pd/CaCO3 (Heraeus-Type K-0208) | 7440-05-3 | 100g |
| GX5766-1g | Palladium Powder 1.2-2.5 micron, 99.9+% | 7440-05-3 | 1g |
| GX9581-25mm | Palladium Rod 3 mm diameter, 99.95% | 7440-05-3 | 25mm |
| GX9581-100mm | Palladium Rod 3 mm diameter, 99.95% | 7440-05-3 | 100mm |
| GX8541-5g | Palladium Sponge, 99.9+% | 7440-05-3 | 5g |
| GX7473-25m | Palladium Wire 0.025 mm diameter, 99.9% | 7440-05-3 | 25m |
| GX3082-5m | Palladium Wire 0.1 mm diameter, 99.9% | 7440-05-3 | 5m |
| GX6695-5m | Palladium Wire 0.1 mm diameter, 99.95% | 7440-05-3 | 5m |
| GX3209-5m | Palladium Wire 0.125 mm diameter, 99.9% | 7440-05-3 | 5m |
| GX3209-25m | Palladium Wire 0.125 mm diameter, 99.9% | 7440-05-3 | 25m |
| GX3044-1m | Palladium Wire 0.25 mm diameter, 99.9% | 7440-05-3 | 1m |
| GX3044-5m | Palladium Wire 0.25 mm diameter, 99.9% | 7440-05-3 | 5m |
| GX5321-50cm | Palladium Wire 0.25 mm diameter, 99.95% | 7440-05-3 | 50cm |
| GX5321-150cm | Palladium Wire 0.25 mm diameter, 99.95% | 7440-05-3 | 150cm |
| GX5321-5m | Palladium Wire 0.25 mm diameter, 99.95% | 7440-05-3 | 5m |
| GX8261-1m | Palladium Wire 0.3 mm diameter, 99.9% | 7440-05-3 | 1m |
| GX1922-10cm | Palladium Wire 0.5 mm diameter, 99.9% | 7440-05-3 | 10cm |
| GX1922-50cm | Palladium Wire 0.5 mm diameter, 99.9% | 7440-05-3 | 50cm |
| GX2387-10cm | Palladium Wire 0.5 mm diameter, 99.95% | 7440-05-3 | 10cm |
| GX2387-50cm | Palladium Wire 0.5 mm diameter, 99.95% | 7440-05-3 | 50cm |
| GX2424-2cm | Palladium Wire 2.0 mm, 99.9% | 7440-05-3 | 2cm |
| GX2424-10cm | Palladium Wire 2.0 mm, 99.9% | 7440-05-3 | 10cm |
| GX2424-50cm | Palladium Wire 2.0 mm, 99.9% | 7440-05-3 | 50cm |
| GX6280-50g | Palladium-Gaspurification Catalyst 0.1% Pd/Al2O3 | 7440-05-3 | 50g |
| GX6280-100g | Palladium-Gaspurification Catalyst 0.1% Pd/Al2O3 | 7440-05-3 | 100g |
| GX2141-50g | Palladium-Gaspurification Catalyst 0.5% Pd/Al2O3 | 7440-05-3 | 50g |
| GX9203-50g | Palladium-Gaspurification Catalyst 0.5% Pd/Al2O3 | 7440-05-3 | 50g |
| GX2141-100g | Palladium-Gaspurification Catalyst 0.5% Pd/Al2O3 | 7440-05-3 | 100g |
| GX9203-100g | Palladium-Gaspurification Catalyst 0.5% Pd/Al2O3 | 7440-05-3 | 100g |
| GX2954-1g | Palladium(II) 2,4-pentanedionate, 99.95% (metals basis) | 14024-61-4 | 1g |
| GX2954-5g | Palladium(II) 2,4-pentanedionate, 99.95% (metals basis) | 14024-61-4 | 5g |
| GX5704-5g | Palladium(II) chloride solution, approx. 20.0% | 7647-10-1 | 5g |
| GX7071-2g | Palladium(II) chloride, 99.9% (metals basis) | 7647-10-1 | 2g |
| GX7071-5g | Palladium(II) chloride, 99.9% (metals basis) | 7647-10-1 | 5g |
| GX4464-1g | Palladium(II) cyanide | 2035-66-7 | 1g |
| GX4464-5g | Palladium(II) cyanide | 2035-66-7 | 5g |
| GX6709-5g | Palladium(II) decanoate | 5g | |
| GX6709-25g | Palladium(II) decanoate | 25g | |
| GX6464-2g | Palladium(II) iodide | 7790-38-7 | 2g |
| GX6464-10g | Palladium(II) iodide | 7790-38-7 | 10g |
| GX2060-5g | Palladium(II) nitrate solution | 10102-05-3 | 5g |
| GX2060-25g | Palladium(II) nitrate solution | 10102-05-3 | 25g |
| GX0824-1g | Palladium(II) oxide, hydrate | 64109-12-2 | 1g |
| GX0824-2g | Palladium(II) oxide, hydrate | 64109-12-2 | 2g |
| GX0824-10g | Palladium(II) oxide, hydrate | 64109-12-2 | 10g |
| GX9747-10g | Palladium(II) sulfate solution | 13566-03-5 | 10g |
| GX6904-1g | Palladium(II) sulfide | 12125-22-3 | 1g |
| GX6904-5g | Palladium(II) sulfide | 12125-22-3 | 5g |
| GA0743-1mg | Palmarumycin C3 | 159934-11-9 | 1mg |
| GA0743-5mg | Palmarumycin C3 | 159934-11-9 | 5mg |
| GL3161-1mg | Palmarumycin C3-5,8-quinone | 1mg | |
| GL3161-5mg | Palmarumycin C3-5,8-quinone | 5mg | |
| GP2867-25mg | Palmatine hydrochloride hydrate | 171869-95-7 | 25mg |
| GP2867-100mg | Palmatine hydrochloride hydrate | 171869-95-7 | 100mg |
| GP2867-250mg | Palmatine hydrochloride hydrate | 171869-95-7 | 250mg |
| GP2867-500mg | Palmatine hydrochloride hydrate | 171869-95-7 | 500mg |
| GX8678-100g | Palmitic acid | 57-10-3 | 100g |
| GL4626-1g | Palmitic anhydride | 623-65-4 | 1g |
| GK4003-100ml | Palmitoyl chloride | 112-67-4 | 100ml |
| GK4003-250ml | Palmitoyl chloride | 112-67-4 | 250ml |
| GK4003-500ml | Palmitoyl chloride | 112-67-4 | 500ml |
| GK6072-25mg | Palmitoyl-L-carnitine chloride | 18877-64-0 | 25mg |
| GK6226-100mg | Palmitoylethanolamide | 544-31-0 | 100mg |
| GK6226-250mg | Palmitoylethanolamide | 544-31-0 | 250mg |
| GP2375-250mg | Palonosetron hydrochloride | 135729-62-3 | 250mg |
| GP2375-1g | Palonosetron hydrochloride | 135729-62-3 | 1g |
| GL9146-2mg | Pam3Cys-Ser-(Lys)4 trihydrochloride | 112208-04-5 | 2mg |
| GK3917-250g | Pamoic acid | 130-85-8 | 250g |
| GK6564-25g | Pamoic acid disodium salt | 6640-22-8 | 25g |
| GK6564-100g | Pamoic acid disodium salt | 6640-22-8 | 100g |
| GK6564-250g | Pamoic acid disodium salt | 6640-22-8 | 250g |
| GP1463-10mg | Pancuronium bromide | 15500-66-0 | 10mg |
| GP1463-50mg | Pancuronium bromide | 15500-66-0 | 50mg |
| GP1463-100mg | Pancuronium bromide | 15500-66-0 | 100mg |
| GK4022-250mg | Pantoprazole sodium hydrate | 718635-09-7 | 250mg |
| GK4022-500mg | Pantoprazole sodium hydrate | 718635-09-7 | 500mg |
| GK4022-1g | Pantoprazole sodium hydrate | 718635-09-7 | 1g |
| GE7465-25g | Papain | 9001-73-4 | 25g |
| GE7465-100g | Papain | 9001-73-4 | 100g |
| GT5904-250ml | Papanicolaou Stain, EA 50 | - | 250ml |
| GT5904-1l | Papanicolaou Stain, EA 50 | - | 1l |
| GT4787-250ml | Papanicolaou Stain, EA 65 | 250ml | |
| GT4787-1l | Papanicolaou Stain, EA 65 | 1l | |
| GT9653-1l | Papanicolaou Stain, OG-6 | 1l | |
| GT9653-2500ml | Papanicolaou Stain, OG-6 | 2500ml | |
| GP4713-5g | Papaverine hydrochloride | 61-25-6 | 5g |
| GL1297-1mg | Paprotrain | 57046-73-8 | 1mg |
| GL4870-500ug | Papyracillic acid A | 960148-59-8 | 500ug |
| GL4870-1mg | Papyracillic acid A | 960148-59-8 | 1mg |
| GT6578-25g | Para Red | 6410-10-2 | 25g |
| GT6578-100g | Para Red | 6410-10-2 | 100g |
| GL4141-1l | Paraffin oil, BP, Ph. Eur. grade | 8012-95-1 | 1l |
| GL4141-2500ml | Paraffin oil, BP, Ph. Eur. grade | 8012-95-1 | 2500ml |
| GL4115-1kg | Paraffin wax, granular (56 - 60) | 8002-74-2 | 1kg |
| GL4115-5kg | Paraffin wax, granular (56 - 60) | 8002-74-2 | 5kg |
| GT3052-5g | Pararosaniline acetate | 6035-94-5 | 5g |
| GT3052-25g | Pararosaniline acetate | 6035-94-5 | 25g |
| GT4290-5g | Pararosaniline Base | 467-62-9 | 5g |
| GT4290-10g | Pararosaniline Base | 467-62-9 | 10g |
| GT4290-25g | Pararosaniline Base | 467-62-9 | 25g |
| GT9522-5g | Pararosaniline hydrochloride (C.I. 42500) | 569-61-9 | 5g |
| GT9522-25g | Pararosaniline hydrochloride (C.I. 42500) | 569-61-9 | 25g |
| GT9522-100g | Pararosaniline hydrochloride (C.I. 42500) | 569-61-9 | 100g |
| GT9522-250g | Pararosaniline hydrochloride (C.I. 42500) | 569-61-9 | 250g |
| GW9069-25mg | Parecoxib | 198470-84-7 | 25mg |
| GW4388-1mg | PARG Inhibitor PDD00017273 | 1945950-21-9 | 1mg |
| GW4388-5mg | PARG Inhibitor PDD00017273 | 1945950-21-9 | 5mg |
| GA4947-1g | Paromomycin sulfate salt | 1263-89-4 | 1g |
| GA4947-5g | Paromomycin sulfate salt | 1263-89-4 | 5g |
| GA4947-25g | Paromomycin sulfate salt | 1263-89-4 | 25g |
| GP8602-1g | Paroxetine hydrochloride | 110429-35-1 | 1g |
| GP8602-5g | Paroxetine hydrochloride | 110429-35-1 | 5g |
| GP2300-100mg | Parthenolide | 20554-84-1 | 100mg |
| GP2300-250mg | Parthenolide | 20554-84-1 | 250mg |
| GP2300-500mg | Parthenolide | 20554-84-1 | 500mg |
| GT2789-25g | Patent Blue V calcium salt (C.I. 42051) | 3536-49-0 | 25g |
| GT2789-100g | Patent Blue V calcium salt (C.I. 42051) | 3536-49-0 | 100g |
| GT9524-25g | Patent blue V sodium salt (C.I. 42051) | 20262-76-4 | 25g |
| GT0175-25g | Patent Blue VF (C.I. 42045) | 129-17-9 | 25g |
| GT0175-100g | Patent Blue VF (C.I. 42045) | 129-17-9 | 100g |
| GL8865-1mg | Paxilline | 57186-25-1 | 1mg |
| GL8865-5mg | Paxilline | 57186-25-1 | 5mg |
| GP3530-100mg | Pazopanib | 444731-52-6 | 100mg |
| GP3530-250mg | Pazopanib | 444731-52-6 | 250mg |
| GP3530-1g | Pazopanib | 444731-52-6 | 1g |
| GX4287-25mg | Pazopanib hydrochloride | 635702-64-6 | 25mg |
| GA7060-25mg | Pazufloxacin mesylate | 163680-77-1 | 25mg |
| GA7060-1g | Pazufloxacin mesylate | 163680-77-1 | 1g |
| GT6761-1mg | PBFI-AM | 124549-23-1 | 1mg |
| GB4924-500ml | PBS 10X, pH 7.4 solution | - | 500ml |
| GB4924-1l | PBS 10X, pH 7.4 solution | - | 1l |
| GB4757-500ml | PBS 1X, pH 7.4 solution | - | 500ml |
| GB4757-1l | PBS 1X, pH 7.4 solution | - | 1l |
| GL5463-1mg | PD 0325901 | 391210-10-9 | 1mg |
| GL5463-5mg | PD 0325901 | 391210-10-9 | 5mg |
| GL5463-25mg | PD 0325901 | 391210-10-9 | 25mg |
| GL2543-5mg | PD 150,606 | 426821-41-2 | 5mg |
| GL2543-25mg | PD 150,606 | 426821-41-2 | 25mg |
| GK2140-1mg | PD 98,059 | 167869-21-8 | 1mg |
| GK2140-5mg | PD 98,059 | 167869-21-8 | 5mg |
| GK2140-10mg | PD 98,059 | 167869-21-8 | 10mg |
| GK2140-50mg | PD 98,059 | 167869-21-8 | 50mg |
| GW0583-1mg | PD-173955 | 260415-63-2 | 1mg |
| GW0583-5mg | PD-173955 | 260415-63-2 | 5mg |
| GW0583-10mg | PD-173955 | 260415-63-2 | 10mg |
| GW8987-1mg | PD-173955-Analog1 | 185039-99-0 | 1mg |
| GW8987-5mg | PD-173955-Analog1 | 185039-99-0 | 5mg |
| GW8987-10mg | PD-173955-Analog1 | 185039-99-0 | 10mg |
| GK9965-1mg | PD184352 | 212631-79-3 | 1mg |
| GK9965-5mg | PD184352 | 212631-79-3 | 5mg |
| GW1383-5g | PDITC | 4044-65-9 | 5g |
| GW1383-20g | PDITC | 4044-65-9 | 20g |
| GK9829-100ml | Peanut oil | 8002-03-7 | 100ml |
| GK9829-250ml | Peanut oil | 8002-03-7 | 250ml |
| GK9829-500ml | Peanut oil | 8002-03-7 | 500ml |
| GK9829-1l | Peanut oil | 8002-03-7 | 1l |
| GL7149-500g | Peanut oil, hardened | 68425-36-5 | 500g |
| GL7149-1kg | Peanut oil, hardened | 68425-36-5 | 1kg |
| GC7250-100g | Pectin, amidated, low ester | 9000-69-5 | 100g |
| GC7250-250g | Pectin, amidated, low ester | 9000-69-5 | 250g |
| GC7250-500g | Pectin, amidated, low ester | 9000-69-5 | 500g |
| GC0736-100g | Pectin, from apple | 9000-69-5 | 100g |
| GC0736-250g | Pectin, from apple | 9000-69-5 | 250g |
| GC0736-500g | Pectin, from apple | 9000-69-5 | 500g |
| GC0736-1kg | Pectin, from apple | 9000-69-5 | 1kg |
| GA7231-5g | Pefloxacin mesylate dihydrate | 149676-40-4 | 5g |
| GA7231-25g | Pefloxacin mesylate dihydrate | 149676-40-4 | 25g |
| GP5214-25mg | Pelitinib | 257933-82-7 | 25mg |
| GL4065-1mg | Pellitorine | 18836-52-7 | 1mg |
| GL4065-5mg | Pellitorine | 18836-52-7 | 5mg |
| GL4065-25mg | Pellitorine | 18836-52-7 | 25mg |
| GP1390-500mg | Pemetrexed disodium salt hydrate | 357166-30-4 | 500mg |
| GP7304-250mg | Penciclovir | 39809-25-1 | 250mg |
| GP7304-1g | Penciclovir | 39809-25-1 | 1g |
| GX1578-1g | Pendimethalin | 40487-42-1 | 1g |
| GL8408-250ug | Penicillide | 55303-92-9 | 250ug |
| GL8408-1mg | Penicillide | 55303-92-9 | 1mg |
| GA2106-5g | Penicillin G potassium salt | 113-98-4 | 5g |
| GA2106-25g | Penicillin G potassium salt | 113-98-4 | 25g |
| GA2106-100g | Penicillin G potassium salt | 113-98-4 | 100g |
| GA2106-250g | Penicillin G potassium salt | 113-98-4 | 250g |
| GA6076-1g | Penicillin G procaine | 6130-64-9 | 1g |
| GA9328-5g | Penicillin G sodium salt | 69-57-8 | 5g |
| GA9328-25g | Penicillin G sodium salt | 69-57-8 | 25g |
| GA9328-100g | Penicillin G sodium salt | 69-57-8 | 100g |
| GA9328-250g | Penicillin G sodium salt | 69-57-8 | 250g |
| GA5943-1g | Penicillin V potassium salt | 132-98-9 | 1g |
| GA5943-5g | Penicillin V potassium salt | 132-98-9 | 5g |
| GA5943-10g | Penicillin V potassium salt | 132-98-9 | 10g |
| GA5943-25g | Penicillin V potassium salt | 132-98-9 | 25g |
| GA5943-100g | Penicillin V potassium salt | 132-98-9 | 100g |
| GL9391-500ug | Pentabromopseudilin | 10245-81-5 | 500ug |
| GL9391-1mg | Pentabromopseudilin | 10245-81-5 | 1mg |
| GX0474-100g | Pentaerythritol | 115-77-5 | 100g |
| GX0474-250g | Pentaerythritol | 115-77-5 | 250g |
| GX0474-1kg | Pentaerythritol | 115-77-5 | 1kg |
| GX0474-5kg | Pentaerythritol | 115-77-5 | 5kg |
| GK0008-250mg | Pentamidine isethionate salt | 140-64-7 | 250mg |
| GK0008-1g | Pentamidine isethionate salt | 140-64-7 | 1g |
| GK5648-25mg | Penthiopyrad | 183675-82-3 | 25mg |
| GL7581-1l | Pentyl acetate | 628-63-7 | 1l |
| GC9580-500mg | Pentyl β-D-glucopyranoside | 66957-71-9 | 500mg |
| GC9580-1g | Pentyl β-D-glucopyranoside | 66957-71-9 | 1g |
| GC9580-2g | Pentyl β-D-glucopyranoside | 66957-71-9 | 2g |
| GC9580-5g | Pentyl β-D-glucopyranoside | 66957-71-9 | 5g |
| GE5559-5g | Pepsin | 9001-75-6 | 5g |
| GE5559-25g | Pepsin | 9001-75-6 | 25g |
| GE5559-100g | Pepsin | 9001-75-6 | 100g |
| GE3524-5mg | Pepstatin A | 26305-03-3 | 5mg |
| GE3524-25mg | Pepstatin A | 26305-03-3 | 25mg |
| GE3524-100mg | Pepstatin A | 26305-03-3 | 100mg |
| GW2134-1mg | Pepstatin A methyl ester | 1mg | |
| GW2134-5mg | Pepstatin A methyl ester | 5mg | |
| GW5123-10g | Perfluorhexane (mixed isomers) | 355-42-0 | 10g |
| GW5123-25g | Perfluorhexane (mixed isomers) | 355-42-0 | 25g |
| GW5123-100g | Perfluorhexane (mixed isomers) | 355-42-0 | 100g |
| GC8547-1mg | Perindopril acyl-b-D-glucuronide | 120398-66-5 | 1mg |
| GC8547-2mg | Perindopril acyl-b-D-glucuronide | 120398-66-5 | 2mg |
| GC8547-5mg | Perindopril acyl-b-D-glucuronide | 120398-66-5 | 5mg |
| GC8547-10mg | Perindopril acyl-b-D-glucuronide | 120398-66-5 | 10mg |
| GP1522-10mg | Perindopril erbumine | 107133-36-8 | 10mg |
| GP1522-50mg | Perindopril erbumine | 107133-36-8 | 50mg |
| GT7361-25g | Periodic acid | 10450-60-9 | 25g |
| GT2912-100ml | Periodic acid, 0.1% solution in water | 10450-60-9 | 100ml |
| GT2912-250ml | Periodic acid, 0.1% solution in water | 10450-60-9 | 250ml |
| GT2912-1l | Periodic acid, 0.1% solution in water | 10450-60-9 | 1l |
| GP2606-1g | Permethrin | 52645-53-1 | 1g |
| GL1218-25mg | Peroxidase | 9003-99-0 | 25mg |
| GL1218-100mg | Peroxidase | 9003-99-0 | 100mg |
| GL1218-250mg | Peroxidase | 9003-99-0 | 250mg |
| GL1218-500mg | Peroxidase | 9003-99-0 | 500mg |
| GL1218-1g | Peroxidase | 9003-99-0 | 1g |
| GZ9372-100mg | Peroxidase, from horseradish, approx. 200 U/mg | 9003-99-0 | 100mg |
| GZ9372-500mg | Peroxidase, from horseradish, approx. 200 U/mg | 9003-99-0 | 500mg |
| GX3680-5g | Perrhenic acid, solution (Hydroxotrioxorhenium(VII) solution) | 13768-11-1 | 5g |
| GX3680-25g | Perrhenic acid, solution (Hydroxotrioxorhenium(VII) solution) | 13768-11-1 | 25g |
| GX8828-1mg | Petasol | 64236-38-0 | 1mg |
| GS5534-1l | Petroleum Ether 100-120°C | 64742-49-0 | 1l |
| GS5534-2500ml | Petroleum Ether 100-120°C | 64742-49-0 | 2500ml |
| GS3158-100ml | Petroleum Ether 30-40°C, GlenDry™, anhydrous | 109-66-0 | 100ml |
| GS3158-500ml | Petroleum Ether 30-40°C, GlenDry™, anhydrous | 109-66-0 | 500ml |
| GS3158-1l | Petroleum Ether 30-40°C, GlenDry™, anhydrous | 109-66-0 | 1l |
| GS3158-2500ml | Petroleum Ether 30-40°C, GlenDry™, anhydrous | 109-66-0 | 2500ml |
| GS7254-500ml | Petroleum Ether 30-40°C, GlenPure™, analytical grade | 109-66-0 | 500ml |
| GS7254-1l | Petroleum Ether 30-40°C, GlenPure™, analytical grade | 109-66-0 | 1l |
| GS7254-2500ml | Petroleum Ether 30-40°C, GlenPure™, analytical grade | 109-66-0 | 2500ml |
| GS3913-100ml | Petroleum Ether 40-60°C, GlenDry™, anhydrous | 8032-32-4 | 100ml |
| GS3913-500ml | Petroleum Ether 40-60°C, GlenDry™, anhydrous | 8032-32-4 | 500ml |
| GS3913-1l | Petroleum Ether 40-60°C, GlenDry™, anhydrous | 8032-32-4 | 1l |
| GS3913-2500ml | Petroleum Ether 40-60°C, GlenDry™, anhydrous | 8032-32-4 | 2500ml |
| GS4502-500ml | Petroleum Ether 40-60°C, GlenPure™, analytical grade | 8032-32-4 | 500ml |
| GS4502-1l | Petroleum Ether 40-60°C, GlenPure™, analytical grade | 8032-32-4 | 1l |
| GS4502-2500ml | Petroleum Ether 40-60°C, GlenPure™, analytical grade | 8032-32-4 | 2500ml |
| GS6258-100ml | Petroleum Ether 60-80 deg C, GlenDry™, anhydrous | 101316-46-5 | 100ml |
| GS6258-500ml | Petroleum Ether 60-80 deg C, GlenDry™, anhydrous | 101316-46-5 | 500ml |
| GS6258-1l | Petroleum Ether 60-80 deg C, GlenDry™, anhydrous | 101316-46-5 | 1l |
| GS6258-2500ml | Petroleum Ether 60-80 deg C, GlenDry™, anhydrous | 101316-46-5 | 2500ml |
| GS1837-500ml | Petroleum Ether 60-80 deg C, GlenPure™, analytical grade | 101316-46-5 | 500ml |
| GS1837-1l | Petroleum Ether 60-80 deg C, GlenPure™, analytical grade | 101316-46-5 | 1l |
| GS1837-2500ml | Petroleum Ether 60-80 deg C, GlenPure™, analytical grade | 101316-46-5 | 2500ml |
| GS9314-100ml | Petroleum Ether 80-100°C, GlenDry™, anhydrous | 64742-49-0 | 100ml |
| GS9314-500ml | Petroleum Ether 80-100°C, GlenDry™, anhydrous | 64742-49-0 | 500ml |
| GS9314-1l | Petroleum Ether 80-100°C, GlenDry™, anhydrous | 64742-49-0 | 1l |
| GS9314-2500ml | Petroleum Ether 80-100°C, GlenDry™, anhydrous | 64742-49-0 | 2500ml |
| GS1349-500ml | Petroleum Ether 80-100°C, GlenPure™, analytical grade | 64742-49-0 | 500ml |
| GS1349-1l | Petroleum Ether 80-100°C, GlenPure™, analytical grade | 64742-49-0 | 1l |
| GS1349-2500ml | Petroleum Ether 80-100°C, GlenPure™, analytical grade | 64742-49-0 | 2500ml |
| GX7846-500g | Petroleum Jelly | 8009-03-8 | 500g |
| GX7846-1kg | Petroleum Jelly | 8009-03-8 | 1kg |
| GW7535-1mg | PF-04217903 | 956905-27-4 | 1mg |
| GW7535-5mg | PF-04217903 | 956905-27-4 | 5mg |
| GW7535-10mg | PF-04217903 | 956905-27-4 | 10mg |
| GW3787-1mg | PF-04979064 | 1220699-06-8 | 1mg |
| GW3787-5mg | PF-04979064 | 1220699-06-8 | 5mg |
| GW3787-10mg | PF-04979064 | 1220699-06-8 | 10mg |
| GW7086-1mg | PF-2545920 | 898562-94-2 | 1mg |
| GW7086-5mg | PF-2545920 | 898562-94-2 | 5mg |
| GW7086-25mg | PF-2545920 | 898562-94-2 | 25mg |
| GW6826-1mg | PF-4618433 | 1166393-85-6 | 1mg |
| GW6826-5mg | PF-4618433 | 1166393-85-6 | 5mg |
| GW6826-10mg | PF-4618433 | 1166393-85-6 | 10mg |
| GL0230-5mg | PF-477736 | 952021-60-2 | 5mg |
| GL0230-10mg | PF-477736 | 952021-60-2 | 10mg |
| GL0230-50mg | PF-477736 | 952021-60-2 | 50mg |
| GW4240-1mg | PF-562271 | 717907-75-0 | 1mg |
| GW4240-5mg | PF-562271 | 717907-75-0 | 5mg |
| GW4240-10mg | PF-562271 | 717907-75-0 | 10mg |
| GW5834-1mg | PFI-4 | 900305-37-5 | 1mg |
| GW5834-5mg | PFI-4 | 900305-37-5 | 5mg |
| GW5834-10mg | PFI-4 | 900305-37-5 | 10mg |
| GH5926-1g | Phe-Phe-OH | 2577-40-4 | 1g |
| GH5926-5g | Phe-Phe-OH | 2577-40-4 | 5g |
| GK3477-100g | Phenacetin | 62-44-2 | 100g |
| GK3477-250g | Phenacetin | 62-44-2 | 250g |
| GK3477-500g | Phenacetin | 62-44-2 | 500g |
| GK3477-1kg | Phenacetin | 62-44-2 | 1kg |
| GK2087-10g | Phenazine | 92-82-0 | 10g |
| GK2087-25g | Phenazine | 92-82-0 | 25g |
| GT3779-100mg | Phenazine ethosulfate | 10510-77-7 | 100mg |
| GA5685-1g | Phenazine methosulfate | 299-11-6 | 1g |
| GA5685-5g | Phenazine methosulfate | 299-11-6 | 5g |
| GA5685-10g | Phenazine methosulfate | 299-11-6 | 10g |
| GA5685-25g | Phenazine methosulfate | 299-11-6 | 25g |
| GT9844-5g | Phenol Red | 143-74-8 | 5g |
| GT9844-25g | Phenol Red | 143-74-8 | 25g |
| GT9844-100g | Phenol Red | 143-74-8 | 100g |
| GT9844-250g | Phenol Red | 143-74-8 | 250g |
| GT6682-5g | Phenol Red sodium salt | 34487-61-1 | 5g |
| GT6682-25g | Phenol Red sodium salt | 34487-61-1 | 25g |
| GT6682-100g | Phenol Red sodium salt | 34487-61-1 | 100g |
| GE3590-1l | Phenol, 80% aqueous solution | 108-95-2 | 1l |
| GK0672-500g | Phenol, 99.5%, detached crystals, BP, Ph. Eur., USP grade | 108-95-2 | 500g |
| GK0672-1kg | Phenol, 99.5%, detached crystals, BP, Ph. Eur., USP grade | 108-95-2 | 1kg |
| GK6990-100g | Phenol, 99% | 108-95-2 | 100g |
| GK6990-500g | Phenol, 99% | 108-95-2 | 500g |
| GK6990-1kg | Phenol, 99% | 108-95-2 | 1kg |
| GK2423-1l | Phenol, BP grade 80% aqueous solution | 108-95-2 | 1l |
| GS8703-500ml | Phenol:Chloroform:Isoamyl alcohol (25:24:1), GlenBiol™, suitable for molecular biology | - | 500ml |
| GC6187-50mg | Phenolphthalein 4''-O-β-D-glucuronide | 15265-26-6 | 50mg |
| GC6187-100mg | Phenolphthalein 4''-O-β-D-glucuronide | 15265-26-6 | 100mg |
| GC6187-250mg | Phenolphthalein 4''-O-β-D-glucuronide | 15265-26-6 | 250mg |
| GC6187-500mg | Phenolphthalein 4''-O-β-D-glucuronide | 15265-26-6 | 500mg |
| GC6187-1g | Phenolphthalein 4''-O-β-D-glucuronide | 15265-26-6 | 1g |
| GT3980-1g | Phenolphthalein diphosphate tetrasodium salt | 68807-90-9 | 1g |
| GT3980-5g | Phenolphthalein diphosphate tetrasodium salt | 68807-90-9 | 5g |
| GT3980-25g | Phenolphthalein diphosphate tetrasodium salt | 68807-90-9 | 25g |
| GE0553-50g | Phenolphthalein, 98% | 77-09-8 | 50g |
| GE0553-100g | Phenolphthalein, 98% | 77-09-8 | 100g |
| GE0553-250g | Phenolphthalein, 98% | 77-09-8 | 250g |
| GE0553-500g | Phenolphthalein, 98% | 77-09-8 | 500g |
| GE0553-1kg | Phenolphthalein, 98% | 77-09-8 | 1kg |
| GE8089-100g | Phenolphthalein, ACS grade | 77-09-8 | 100g |
| GE8089-500g | Phenolphthalein, ACS grade | 77-09-8 | 500g |
| GT9951-25g | Phenolphthalein, BP, Ph. Eur. grade | 77-09-8 | 25g |
| GT9951-100g | Phenolphthalein, BP, Ph. Eur. grade | 77-09-8 | 100g |
| GT9951-500g | Phenolphthalein, BP, Ph. Eur. grade | 77-09-8 | 500g |
| GT7280-5g | Phenolphthalin | 81-90-3 | 5g |
| GC7684-100mg | Phenophthalein glucuronide sodium salt | 6820-54-8 | 100mg |
| GC7684-250mg | Phenophthalein glucuronide sodium salt | 6820-54-8 | 250mg |
| GC7684-500mg | Phenophthalein glucuronide sodium salt | 6820-54-8 | 500mg |
| GC7684-1g | Phenophthalein glucuronide sodium salt | 6820-54-8 | 1g |
| GP7407-1g | Phentolamine mesylate | 65-28-1 | 1g |
| GC8370-100mg | Phenyl 2-azido-2-deoxy-1-seleno-α-D-galactopyranoside | 862851-12-5 | 100mg |
| GC8370-250mg | Phenyl 2-azido-2-deoxy-1-seleno-α-D-galactopyranoside | 862851-12-5 | 250mg |
| GC8370-500mg | Phenyl 2-azido-2-deoxy-1-seleno-α-D-galactopyranoside | 862851-12-5 | 500mg |
| GC8370-1g | Phenyl 2-azido-2-deoxy-1-seleno-α-D-galactopyranoside | 862851-12-5 | 1g |
| GC8302-100mg | Phenyl 2-azido-2,6-dideoxy-1-seleno-α-D-galactopyranoside | 2055251-36-8 | 100mg |
| GC8302-250mg | Phenyl 2-azido-2,6-dideoxy-1-seleno-α-D-galactopyranoside | 2055251-36-8 | 250mg |
| GC8302-500mg | Phenyl 2-azido-2,6-dideoxy-1-seleno-α-D-galactopyranoside | 2055251-36-8 | 500mg |
| GC8302-1g | Phenyl 2-azido-2,6-dideoxy-1-seleno-α-D-galactopyranoside | 2055251-36-8 | 1g |
| GC2400-250mg | Phenyl 3,4,6-tri-O-acetyl-2-azido-2-deoxy-1-seleno-α-D-galactopyranoside | 150809-76-0 | 250mg |
| GC2400-500mg | Phenyl 3,4,6-tri-O-acetyl-2-azido-2-deoxy-1-seleno-α-D-galactopyranoside | 150809-76-0 | 500mg |
| GC2400-1g | Phenyl 3,4,6-tri-O-acetyl-2-azido-2-deoxy-1-seleno-α-D-galactopyranoside | 150809-76-0 | 1g |
| GC2400-2g | Phenyl 3,4,6-tri-O-acetyl-2-azido-2-deoxy-1-seleno-α-D-galactopyranoside | 150809-76-0 | 2g |
| GC0148-50mg | Phenyl 3,6-di-O-acetyl-2-azido-2-deoxy-1-seleno-α-D-galactopyranoside | 50mg | |
| GC0148-100mg | Phenyl 3,6-di-O-acetyl-2-azido-2-deoxy-1-seleno-α-D-galactopyranoside | 100mg | |
| GC0148-250mg | Phenyl 3,6-di-O-acetyl-2-azido-2-deoxy-1-seleno-α-D-galactopyranoside | 250mg | |
| GC0148-500mg | Phenyl 3,6-di-O-acetyl-2-azido-2-deoxy-1-seleno-α-D-galactopyranoside | 500mg | |
| GC4595-2g | Phenyl 4,6-O-benzylidene-b-D-glucopyranoside | 75829-66-2 | 2g |
| GC4595-5g | Phenyl 4,6-O-benzylidene-b-D-glucopyranoside | 75829-66-2 | 5g |
| GC4595-10g | Phenyl 4,6-O-benzylidene-b-D-glucopyranoside | 75829-66-2 | 10g |
| GC4595-25g | Phenyl 4,6-O-benzylidene-b-D-glucopyranoside | 75829-66-2 | 25g |
| GC6682-5g | Phenyl b-D-glucopyranoside | 1464-44-4 | 5g |
| GC6682-25g | Phenyl b-D-glucopyranoside | 1464-44-4 | 25g |
| GC0722-50mg | Phenyl b-D-thioglucopyranoside | 2936-70-1 | 50mg |
| GC0722-100mg | Phenyl b-D-thioglucopyranoside | 2936-70-1 | 100mg |
| GC0722-250mg | Phenyl b-D-thioglucopyranoside | 2936-70-1 | 250mg |
| GC0722-500mg | Phenyl b-D-thioglucopyranoside | 2936-70-1 | 500mg |
| GC0722-1g | Phenyl b-D-thioglucopyranoside | 2936-70-1 | 1g |
| GF7913-5g | Phenyl isothiocyanate | 103-72-0 | 5g |
| GX7854-5ml | Phenyl isothiocyanate, 99% | 103-72-0 | 5ml |
| GE1672-10g | Phenyl phosphate disodium salt dihydrate | 66778-08-3 | 10g |
| GE1672-25g | Phenyl phosphate disodium salt dihydrate | 66778-08-3 | 25g |
| GE1672-50g | Phenyl phosphate disodium salt dihydrate | 66778-08-3 | 50g |
| GE1672-100g | Phenyl phosphate disodium salt dihydrate | 66778-08-3 | 100g |
| GK3262-500g | Phenyl salicylate | 118-55-8 | 500g |
| GK3830-5g | Phenylbis(2,4,6-trimethylbenzoyl)phosphine oxide | 162881-26-7 | 5g |
| GK3830-25g | Phenylbis(2,4,6-trimethylbenzoyl)phosphine oxide | 162881-26-7 | 25g |
| GK1609-1g | Phenylboronic acid | 98-80-6 | 1g |
| GK1609-5g | Phenylboronic acid | 98-80-6 | 5g |
| GK1609-10g | Phenylboronic acid | 98-80-6 | 10g |
| GK1609-50g | Phenylboronic acid | 98-80-6 | 50g |
| GP0458-25g | Phenylbutazone | 50-33-9 | 25g |
| GT7091-25g | Phenylhydrazine hydrochloride | 59-88-1 | 25g |
| GT7091-100g | Phenylhydrazine hydrochloride | 59-88-1 | 100g |
| GE4342-5g | Phenylmethanesulfonyl fluoride | 329-98-6 | 5g |
| GE4342-25g | Phenylmethanesulfonyl fluoride | 329-98-6 | 25g |
| GL0352-1mg | Phenylmethylene hydantoin | 80171-33-1 | 1mg |
| GW4355-1g | Phenylpropargyl ether | 13610-02-1 | 1g |
| GW4355-5g | Phenylpropargyl ether | 13610-02-1 | 5g |
| GK7310-25g | Phenylsuccinic acid | 635-51-8 | 25g |
| GK7310-100g | Phenylsuccinic acid | 635-51-8 | 100g |
| GK7310-250g | Phenylsuccinic acid | 635-51-8 | 250g |
| GK7310-500g | Phenylsuccinic acid | 635-51-8 | 500g |
| GA6020-5mg | Phleomycin | 11006-33-0 | 5mg |
| GA6020-25mg | Phleomycin | 11006-33-0 | 25mg |
| GA6020-50mg | Phleomycin | 11006-33-0 | 50mg |
| GA6020-100mg | Phleomycin | 11006-33-0 | 100mg |
| GA6020-250mg | Phleomycin | 11006-33-0 | 250mg |
| GE3120-1g | Phloretin | 60-82-2 | 1g |
| GE3120-5g | Phloretin | 60-82-2 | 5g |
| GC6883-250mg | Phloridzin | 60-81-1 | 250mg |
| GC6883-1g | Phloridzin | 60-81-1 | 1g |
| GT4554-25g | Phloroglucinol, anhydrous | 108-73-6 | 25g |
| GT4554-100g | Phloroglucinol, anhydrous | 108-73-6 | 100g |
| GT4554-250g | Phloroglucinol, anhydrous | 108-73-6 | 250g |
| GT5211-25g | Phloxine B (C.I. 45410) | 18472-87-2 | 25g |
| GT5211-100g | Phloxine B (C.I. 45410) | 18472-87-2 | 100g |
| GW8143-1mg | Phomopsin A | 64925-80-0 | 1mg |
| GL6612-1mg | Phomoxanthone A | 359844-69-2 | 1mg |
| GL6612-5mg | Phomoxanthone A | 359844-69-2 | 5mg |
| GK8317-1mg | Phorbol 12-myristate 13-acetate | 16561-29-8 | 1mg |
| GK8317-5mg | Phorbol 12-myristate 13-acetate | 16561-29-8 | 5mg |
| GK8317-10mg | Phorbol 12-myristate 13-acetate | 16561-29-8 | 10mg |
| GK8317-25mg | Phorbol 12-myristate 13-acetate | 16561-29-8 | 25mg |
| GB1588-100ml | Phosphate buffer, 0.1M solution | 100ml | |
| GB1588-250ml | Phosphate buffer, 0.1M solution | 250ml | |
| GX8368-50EA | Phosphate buffered saline tablets, pH 7.2 (100ml/tablet) | - | 50EA |
| GX4240-100mg | Phosphatidylserine, 50% powder | 8002-43-5 | 100mg |
| GX4240-250mg | Phosphatidylserine, 50% powder | 8002-43-5 | 250mg |
| GX4240-500mg | Phosphatidylserine, 50% powder | 8002-43-5 | 500mg |
| GW8277-1g | Phosphazenium tetrafluoroborate P2-BF4 | 137334-98-6 | 1g |
| GW8277-5g | Phosphazenium tetrafluoroborate P2-BF4 | 137334-98-6 | 5g |
| GW8277-25g | Phosphazenium tetrafluoroborate P2-BF4 | 137334-98-6 | 25g |
| GE4574-1g | Phosphoenolpyruvate trisodium salt | 5541-93-5 | 1g |
| GX3459-1g | Phosphoenolpyruvic acid monocyclohexylammonium salt | 10526-80-4 | 1g |
| GT2049-25g | Phosphomolybdic acid hydrate | 51429-74-4 | 25g |
| GT2049-100g | Phosphomolybdic acid hydrate | 51429-74-4 | 100g |
| GT0715-250ml | Phosphomolybdic acid solution | 12026-57-2 | 250ml |
| GT0715-500ml | Phosphomolybdic acid solution | 12026-57-2 | 500ml |
| GA9549-1g | Phosphomycin calcium salt | 26016-98-8 | 1g |
| GA9549-5g | Phosphomycin calcium salt | 26016-98-8 | 5g |
| GA9549-10g | Phosphomycin calcium salt | 26016-98-8 | 10g |
| GA9549-50g | Phosphomycin calcium salt | 26016-98-8 | 50g |
| GA7173-1g | Phosphomycin disodium salt | 26016-99-9 | 1g |
| GA7173-5g | Phosphomycin disodium salt | 26016-99-9 | 5g |
| GA7173-25g | Phosphomycin disodium salt | 26016-99-9 | 25g |
| GK5910-5mg | Phosphoramidon disodium salt | 119942-99-3 | 5mg |
| GK5910-25mg | Phosphoramidon disodium salt | 119942-99-3 | 25mg |
| GK4212-1kg | Phosphoric acid 85% | 7664-38-2 | 1kg |
| GK4212-5kg | Phosphoric acid 85% | 7664-38-2 | 5kg |
| GK4212-10kg | Phosphoric acid 85% | 7664-38-2 | 10kg |
| GX0083-100mg | Phosphorus Black, pieces max. 4mm 99.9+% | 7723-14-0 | 100mg |
| GX0083-500mg | Phosphorus Black, pieces max. 4mm 99.9+% | 7723-14-0 | 500mg |
| GX9963-500g | Phosphorus(V) oxide | 1314-56-3 | 500g |
| GE1564-25g | Phosphotungstic acid hydrate | 12501-23-4 | 25g |
| GE1564-100g | Phosphotungstic acid hydrate | 12501-23-4 | 100g |
| GE1564-250g | Phosphotungstic acid hydrate | 12501-23-4 | 250g |
| GE0157-100g | Phosphotungstic acid hydrate, 98% | 12501-23-4 | 100g |
| GK7570-25g | Phthalic acid | 88-99-3 | 25g |
| GK7570-100g | Phthalic acid | 88-99-3 | 100g |
| GK7570-250g | Phthalic acid | 88-99-3 | 250g |
| GK7570-500g | Phthalic acid | 88-99-3 | 500g |
| GK7570-1kg | Phthalic acid | 88-99-3 | 1kg |
| GK7570-5kg | Phthalic acid | 88-99-3 | 5kg |
| GK8794-100g | Phthalic anhydride | 85-44-9 | 100g |
| GK8794-250g | Phthalic anhydride | 85-44-9 | 250g |
| GP2076-10mg | Physcion | 521-61-9 | 10mg |
| GW3825-50mg | Physil chloride | 114341-14-9 | 50mg |
| GW3825-250mg | Physil chloride | 114341-14-9 | 250mg |
| GW7873-25mg | Phytane | 638-36-8 | 25mg |
| GK0311-1g | Phytic acid | 83-86-3 | 1g |
| GK0311-5g | Phytic acid | 83-86-3 | 5g |
| GK0311-25g | Phytic acid | 83-86-3 | 25g |
| GK0311-50g | Phytic acid | 83-86-3 | 50g |
| GC4746-5g | Phytic acid dipotassium salt | 129832-03-7 | 5g |
| GC4746-10g | Phytic acid dipotassium salt | 129832-03-7 | 10g |
| GC4746-25g | Phytic acid dipotassium salt | 129832-03-7 | 25g |
| GW0859-25mg | Phytic acid sodium salt hydrate, 98% | 14306-25-3 | 25mg |
| GW0859-100mg | Phytic acid sodium salt hydrate, 98% | 14306-25-3 | 100mg |
| GK9311-25g | Phytic acid, 50% (w/w) in water | 83-86-3 | 25g |
| GK9311-100g | Phytic acid, 50% (w/w) in water | 83-86-3 | 100g |
| GK9311-500g | Phytic acid, 50% (w/w) in water | 83-86-3 | 500g |
| GX3009-1g | Phytic acid, sodium salt (technical) | 83-86-3 (free acid) | 1g |
| GX3009-5g | Phytic acid, sodium salt (technical) | 83-86-3 (free acid) | 5g |
| GX3009-25g | Phytic acid, sodium salt (technical) | 83-86-3 (free acid) | 25g |
| GX3009-50g | Phytic acid, sodium salt (technical) | 83-86-3 (free acid) | 50g |
| GL1777-10g | Phytol | 7541-49-3 | 10g |
| GL1777-50g | Phytol | 7541-49-3 | 50g |
| GW0508-1mg | PI-1840 [Proteasome Inhibitor] | 1401223-22-0 | 1mg |
| GW0508-5mg | PI-1840 [Proteasome Inhibitor] | 1401223-22-0 | 5mg |
| GW0508-25mg | PI-1840 [Proteasome Inhibitor] | 1401223-22-0 | 25mg |
| GW6652-1mg | PI103 | 371935-74-9 | 1mg |
| GW6652-5mg | PI103 | 371935-74-9 | 5mg |
| GW6652-10mg | PI103 | 371935-74-9 | 10mg |
| GP2416-100mg | Piceatannol | 10083-24-6 | 100mg |
| GP2416-250mg | Piceatannol | 10083-24-6 | 250mg |
| GY1409-250mg | Picloram | 1918-02-1 | 250mg |
| GY1409-1g | Picloram | 1918-02-1 | 1g |
| GY1409-5g | Picloram | 1918-02-1 | 5g |
| GY1409-25g | Picloram | 1918-02-1 | 25g |
| GL1509-10mg | Picropodophyllotoxin | 477-47-4 | 10mg |
| GC2669-10mg | Picroside 2 | 39012-20-9 | 10mg |
| GC2669-25mg | Picroside 2 | 39012-20-9 | 25mg |
| GL2129-5mg | Pifithrin-alpha | 63208-82-2 | 5mg |
| GL2129-10mg | Pifithrin-alpha | 63208-82-2 | 10mg |
| GL2129-25mg | Pifithrin-alpha | 63208-82-2 | 25mg |
| GW3375-1mg | PIK-294 | 900185-02-6 | 1mg |
| GW3375-5mg | PIK-294 | 900185-02-6 | 5mg |
| GW3375-10mg | PIK-294 | 900185-02-6 | 10mg |
| GW8870-1mg | PIK-75 | 372196-67-3 | 1mg |
| GW8870-5mg | PIK-75 | 372196-67-3 | 5mg |
| GW8870-10mg | PIK-75 | 372196-67-3 | 10mg |
| GW0576-1mg | PIK-90 | 677338-12-4 | 1mg |
| GW0576-5mg | PIK-90 | 677338-12-4 | 5mg |
| GW0576-10mg | PIK-90 | 677338-12-4 | 10mg |
| GW1942-1mg | PIK-93 | 593960-11-3 | 1mg |
| GW1942-5mg | PIK-93 | 593960-11-3 | 5mg |
| GW1942-10mg | PIK-93 | 593960-11-3 | 10mg |
| GL7360-1mg | Pikromycin | 19721-56-3 | 1mg |
| GL7360-5mg | Pikromycin | 19721-56-3 | 5mg |
| GA5100-50mg | Pimaricin | 7681-93-8 | 50mg |
| GA5100-100mg | Pimaricin | 7681-93-8 | 100mg |
| GA5100-500mg | Pimaricin | 7681-93-8 | 500mg |
| GA5100-1g | Pimaricin | 7681-93-8 | 1g |
| GA5100-5g | Pimaricin | 7681-93-8 | 5g |
| GW2192-10mg | Pimecrolimus | 137071-32-0 | 10mg |
| GW2192-50mg | Pimecrolimus | 137071-32-0 | 50mg |
| GL3504-1mg | Pimprinine | 13640-26-1 | 1mg |
| GL3504-5mg | Pimprinine | 13640-26-1 | 5mg |
| GP0968-25mg | Pinacidil monohydrate | 85371-64-8 | 25mg |
| GP0968-100mg | Pinacidil monohydrate | 85371-64-8 | 100mg |
| GP3150-10mg | Pinoresinol diglucoside | 63902-38-5 | 10mg |
| GP3150-25mg | Pinoresinol diglucoside | 63902-38-5 | 25mg |
| GP3150-100mg | Pinoresinol diglucoside | 63902-38-5 | 100mg |
| GP2624-1mg | Pioglitazone | 111025-46-8 | 1mg |
| GP2624-5mg | Pioglitazone | 111025-46-8 | 5mg |
| GP2624-25mg | Pioglitazone | 111025-46-8 | 25mg |
| GP3582-1g | Pioglitazone hydrochloride | 112529-15-4 | 1g |
| GA4134-1g | Piperacillin sodium salt | 59703-84-3 | 1g |
| GA4134-5g | Piperacillin sodium salt | 59703-84-3 | 5g |
| GL7244-500ug | Piperafizine B | 1233-98-3 | 500ug |
| GW5458-500ug | Piperafizine B | 74720-33-5 | 500ug |
| GL7244-1mg | Piperafizine B | 1233-98-3 | 1mg |
| GW5458-1mg | Piperafizine B | 74720-33-5 | 1mg |
| GL3741-1g | Piperaquine tetraphosphate tetrahydrate | 915967-82-7 | 1g |
| GL3741-5g | Piperaquine tetraphosphate tetrahydrate | 915967-82-7 | 5g |
| GK6010-100g | Piperazine | 110-85-0 | 100g |
| GK2644-25g | Piperazine hexahydrate | 142-63-2 | 25g |
| GK2644-100g | Piperazine hexahydrate | 142-63-2 | 100g |
| GK2644-250g | Piperazine hexahydrate | 142-63-2 | 250g |
| GK2644-500g | Piperazine hexahydrate | 142-63-2 | 500g |
| GK2644-1kg | Piperazine hexahydrate | 142-63-2 | 1kg |
| GK8547-10mg | Piperlongumine | 20069-09-4 | 10mg |
| GK8547-50mg | Piperlongumine | 20069-09-4 | 50mg |
| GB1808-25g | PIPES | 5625-37-6 | 25g |
| GB1808-100g | PIPES | 5625-37-6 | 100g |
| GB1808-250g | PIPES | 5625-37-6 | 250g |
| GB1808-500g | PIPES | 5625-37-6 | 500g |
| GB2841-25g | PIPES dipotassium salt | 108321-27-3 | 25g |
| GB2841-100g | PIPES dipotassium salt | 108321-27-3 | 100g |
| GB2841-500g | PIPES dipotassium salt | 108321-27-3 | 500g |
| GB1799-25g | PIPES disodium salt | 76836-02-7 | 25g |
| GB1799-100g | PIPES disodium salt | 76836-02-7 | 100g |
| GB1799-250g | PIPES disodium salt | 76836-02-7 | 250g |
| GB1799-500g | PIPES disodium salt | 76836-02-7 | 500g |
| GB9761-25g | PIPES monosodium salt | 10010-67-0 | 25g |
| GB9761-100g | PIPES monosodium salt | 10010-67-0 | 100g |
| GB9761-500g | PIPES monosodium salt | 10010-67-0 | 500g |
| GB6809-25g | PIPES sesquisodium salt | 100037-69-2 | 25g |
| GB6809-100g | PIPES sesquisodium salt | 100037-69-2 | 100g |
| GB6809-500g | PIPES sesquisodium salt | 100037-69-2 | 500g |
| GP1309-5g | Piracetam | 7491-74-9 | 5g |
| GP1309-25g | Piracetam | 7491-74-9 | 25g |
| GP1309-100g | Piracetam | 7491-74-9 | 100g |
| GA1643-10mg | Pirarubicin | 72496-41-4 | 10mg |
| GA1643-25mg | Pirarubicin | 72496-41-4 | 25mg |
| GP0823-250mg | Pirenzepine dihydrochloride | 29868-97-1 | 250mg |
| GP0823-500mg | Pirenzepine dihydrochloride | 29868-97-1 | 500mg |
| GP0823-1g | Pirenzepine dihydrochloride | 29868-97-1 | 1g |
| GP4948-250mg | Pirfenidone | 53179-13-8 | 250mg |
| GP4948-1g | Pirfenidone | 53179-13-8 | 1g |
| GP9213-250mg | Piribedil | 3605-01-4 | 250mg |
| GW8012-100mg | Piroctone olamine | 68890-66-4 | 100mg |
| GW8012-500mg | Piroctone olamine | 68890-66-4 | 500mg |
| GP9136-1g | Piroxicam | 36322-90-4 | 1g |
| GP9136-5g | Piroxicam | 36322-90-4 | 5g |
| GP9136-25g | Piroxicam | 36322-90-4 | 25g |
| GP8116-5mg | Pitavastatin calcium salt | 147526-32-7 | 5mg |
| GA9689-25mg | Pivmecillinam | 32886-97-8 | 25mg |
| GP0632-1g | Pizotifen maleate | 5189-11-7 | 1g |
| GL7437-1mg | PJ-34 hydrochloride hydrate | 344458-15-7 | 1mg |
| GL7437-5mg | PJ-34 hydrochloride hydrate | 344458-15-7 | 5mg |
| GL7437-25mg | PJ-34 hydrochloride hydrate | 344458-15-7 | 25mg |
| GL4857-10mg | PK 11195 | 85532-75-8 | 10mg |
| GL4857-50mg | PK 11195 | 85532-75-8 | 50mg |
| GW6750-1mg | PK150 (Sorafenib Analog) | 2165324-62-7 | 1mg |
| GW6750-5mg | PK150 (Sorafenib Analog) | 2165324-62-7 | 5mg |
| GW6750-25mg | PK150 (Sorafenib Analog) | 2165324-62-7 | 25mg |
| GX6304-1g | Platinum 2,4-pentanedionate | 15170-57-7 | 1g |
| GX6304-5g | Platinum 2,4-pentanedionate | 15170-57-7 | 5g |
| GX9608-500mg | Platinum black 10-20 m²,g | 7440-06-4 | 500mg |
| GX9608-1g | Platinum black 10-20 m²,g | 7440-06-4 | 1g |
| GX9608-5g | Platinum black 10-20 m²,g | 7440-06-4 | 5g |
| GX7851-500mg | Platinum black 20-40 m2/g | 7440-06-4 | 500mg |
| GX7851-1g | Platinum black 20-40 m2/g | 7440-06-4 | 1g |
| GX7851-5g | Platinum black 20-40 m2/g | 7440-06-4 | 5g |
| GX6248-5g | Platinum conducting paste for brush application 71% Pt | 7440-06-4 | 5g |
| GX6248-10g | Platinum conducting paste for brush application 71% Pt | 7440-06-4 | 10g |
| GX6475-25x25mm | Platinum Foil 0.025mm, 99.9% | 7440-06-4 | 25x25mm |
| GX6475-50x50mm | Platinum Foil 0.025mm, 99.9% | 7440-06-4 | 50x50mm |
| GX7231-25x25mm | Platinum Foil 0.05mm, 99.9% | 7440-06-4 | 25x25mm |
| GX7231-50x50mm | Platinum Foil 0.05mm, 99.9% | 7440-06-4 | 50x50mm |
| GX7698-25x25mm | Platinum Foil 0.125mm, 99.9% | 7440-06-4 | 25x25mm |
| GX7698-50x50mm | Platinum Foil 0.125mm, 99.9% | 7440-06-4 | 50x50mm |
| GX4997-25x25mm | Platinum Foil 0.1mm, 99.9% | 7440-06-4 | 25x25mm |
| GX4997-50x50mm | Platinum Foil 0.1mm, 99.9% | 7440-06-4 | 50x50mm |
| GX2917-25x25mm | Platinum Foil 0.1mm, 99.99% | 7440-06-4 | 25x25mm |
| GX2917-50x50mm | Platinum Foil 0.1mm, 99.99% | 7440-06-4 | 50x50mm |
| GX5455-25x25mm | Platinum Foil 0.25mm, 99.9% | 7440-06-4 | 25x25mm |
| GX1775-10x10mm | Platinum Foil 0.5mm, 99.9% | 7440-06-4 | 10x10mm |
| GX1775-25x25mm | Platinum Foil 0.5mm, 99.9% | 7440-06-4 | 25x25mm |
| GX1775-50x50mm | Platinum Foil 0.5mm, 99.9% | 7440-06-4 | 50x50mm |
| GX1914-25x25mm | Platinum Foil 0.5mm, 99.99% | 7440-06-4 | 25x25mm |
| GX0039-25x25mm | Platinum Foil 0.635mm, 99.9% | 7440-06-4 | 25x25mm |
| GX0239-10x10mm | Platinum Foil 1.0mm, 99.9% | 7440-06-4 | 10x10mm |
| GX0239-25x25mm | Platinum Foil 1.0mm, 99.9% | 7440-06-4 | 25x25mm |
| GX1073-25x25mm | Platinum Foil 1.0mm, 99.99% | 7440-06-4 | 25x25mm |
| GX5372-50x50mm | Platinum Gauze 1024 mesh/cm², 0.06 mm wire diameter, 99.9% | 7440-06-4 | 50x50mm |
| GX7278-50x100mm | Platinum Gauze 3600 mesh,cm2, 0.04 mm wire diameter, stabilized, 99.9% | 7440-06-4 | 50x100mm |
| GX7278-90x90mm | Platinum Gauze 3600 mesh,cm2, 0.04 mm wire diameter, stabilized, 99.9% | 7440-06-4 | 90x90mm |
| GX9800-50x50mm | Platinum Gauze 3600 mesh/cm2, 0.04 mm wire diameter, 99.9% | 7440-06-4 | 50x50mm |
| GX9800-100x100mm | Platinum Gauze 3600 mesh/cm2, 0.04 mm wire diameter, 99.9% | 7440-06-4 | 100x100mm |
| GX7808-1g | Platinum Granules 1-6 mm (evaporation grade); 99.99% | 7440-06-4 | 1g |
| GX7808-5g | Platinum Granules 1-6 mm (evaporation grade); 99.99% | 7440-06-4 | 5g |
| GX7808-10g | Platinum Granules 1-6 mm (evaporation grade); 99.99% | 7440-06-4 | 10g |
| GX8702-50g | Platinum on Activated Carbon 1% Pt/C (Heraeus-Type K-0114) | 7440-06-4 | 50g |
| GX8702-100g | Platinum on Activated Carbon 1% Pt/C (Heraeus-Type K-0114) | 7440-06-4 | 100g |
| GX6364-10g | Platinum on Activated Carbon 1% Pt/C (Heraeus-Type K-0117) | 7440-06-4 | 10g |
| GX6364-50g | Platinum on Activated Carbon 1% Pt/C (Heraeus-Type K-0117) | 7440-06-4 | 50g |
| GX6364-100g | Platinum on Activated Carbon 1% Pt/C (Heraeus-Type K-0117) | 7440-06-4 | 100g |
| GX5558-10g | Platinum on Activated Carbon 10% Pt/C (Heraeus-Type K-0119) | 7440-06-4 | 10g |
| GX7784-5g | Platinum on Activated Carbon 2% Pt/C (Heraeus-Type K-0130) | 7440-06-4 | 5g |
| GX7784-10g | Platinum on Activated Carbon 2% Pt/C (Heraeus-Type K-0130) | 7440-06-4 | 10g |
| GX7784-50g | Platinum on Activated Carbon 2% Pt/C (Heraeus-Type K-0130) | 7440-06-4 | 50g |
| GX2396-5g | Platinum on Activated Carbon 2% Pt/C (Heraeus-Type K-0131) | 7440-06-4 | 5g |
| GX2396-10g | Platinum on Activated Carbon 2% Pt/C (Heraeus-Type K-0131) | 7440-06-4 | 10g |
| GX2396-50g | Platinum on Activated Carbon 2% Pt/C (Heraeus-Type K-0131) | 7440-06-4 | 50g |
| GX2268-5g | Platinum on Activated Carbon 2% Pt/C (Heraeus-Type K-0132) | 7440-06-4 | 5g |
| GX2268-10g | Platinum on Activated Carbon 2% Pt/C (Heraeus-Type K-0132) | 7440-06-4 | 10g |
| GX2268-50g | Platinum on Activated Carbon 2% Pt/C (Heraeus-Type K-0132) | 7440-06-4 | 50g |
| GX4727-10g | Platinum on Activated Carbon 5% Pt/C (Heraeus-Type K-0124) | 7440-06-4 | 10g |
| GX4727-50g | Platinum on Activated Carbon 5% Pt/C (Heraeus-Type K-0124) | 7440-06-4 | 50g |
| GX6563-10g | Platinum on Activated Carbon 5% Pt/C (Heraeus-Type K-0125) | 7440-06-4 | 10g |
| GX6563-50g | Platinum on Activated Carbon 5% Pt/C (Heraeus-Type K-0125) | 7440-06-4 | 50g |
| GX5652-5g | Platinum on Activated Carbon 5% Pt/C (Heraeus-Type K-0127) | 7440-06-4 | 5g |
| GX5652-10g | Platinum on Activated Carbon 5% Pt/C (Heraeus-Type K-0127) | 7440-06-4 | 10g |
| GX8533-10g | Platinum on Activated Carbon 5% Pt/C (Heraeus-Type K-0129) | 7440-06-4 | 10g |
| GX8533-50g | Platinum on Activated Carbon 5% Pt/C (Heraeus-Type K-0129) | 7440-06-4 | 50g |
| GX4950-50g | Platinum on Alumina 0,1% Pt/Al2O3 (Heraeus-Type K-0144) | 7440-06-4 | 50g |
| GX4950-100g | Platinum on Alumina 0,1% Pt/Al2O3 (Heraeus-Type K-0144) | 7440-06-4 | 100g |
| GX2714-500mg | Platinum Powder 0.2-1.8 micron, 99.95+% | 7440-06-4 | 500mg |
| GX2714-1g | Platinum Powder 0.2-1.8 micron, 99.95+% | 7440-06-4 | 1g |
| GX2714-5g | Platinum Powder 0.2-1.8 micron, 99.95+% | 7440-06-4 | 5g |
| GX0230-1g | Platinum Ruthenium Granules ≤ 1mm 50:50, 99.9% (metals basis) | 7440-06-4 | 1g |
| GX3851-1g | Platinum Sponge, 99.9% | 7440-06-4 | 1g |
| GX3851-2g | Platinum Sponge, 99.9% | 7440-06-4 | 2g |
| GX3851-5g | Platinum Sponge, 99.9% | 7440-06-4 | 5g |
| GX3679-1g | Platinum tetrammine hydrogencarbonate | 123439-82-7 | 1g |
| GX3679-5g | Platinum tetrammine hydrogencarbonate | 123439-82-7 | 5g |
| GX9652-1m | Platinum Wire 0.018 mm diameter, 99.9% | 7440-06-4 | 1m |
| GX4772-1m | Platinum Wire 0.02 mm diameter, 99.9% | 7440-06-4 | 1m |
| GX7728-5m | Platinum Wire 0.025 mm diameter, 99.9% | 7440-06-4 | 5m |
| GX1892-10m | Platinum Wire 0.1 mm diameter, 99.9% | 7440-06-4 | 10m |
| GX8639-1m | Platinum Wire 0.1 mm diameter, 99.99% | 7440-06-4 | 1m |
| GX8639-5m | Platinum Wire 0.1 mm diameter, 99.99% | 7440-06-4 | 5m |
| GX2773-1m | Platinum Wire 0.125 mm diameter, 99.9% | 7440-06-4 | 1m |
| GX2773-5m | Platinum Wire 0.125 mm diameter, 99.9% | 7440-06-4 | 5m |
| GX6665-25cm | Platinum Wire 0.2 mm diameter, 99.9% | 7440-06-4 | 25cm |
| GX6665-1m | Platinum Wire 0.2 mm diameter, 99.9% | 7440-06-4 | 1m |
| GX6052-50cm | Platinum Wire 0.25 mm diameter, 99.9% | 7440-06-4 | 50cm |
| GX8324-25cm | Platinum Wire 0.25 mm diameter, 99.99% | 7440-06-4 | 25cm |
| GX8324-1m | Platinum Wire 0.25 mm diameter, 99.99% | 7440-06-4 | 1m |
| GX1042-25cm | Platinum Wire 0.3 mm diameter, 99.9% | 7440-06-4 | 25cm |
| GX1042-1m | Platinum Wire 0.3 mm diameter, 99.9% | 7440-06-4 | 1m |
| GX1234-25cm | Platinum Wire 0.3 mm diameter, 99.99% | 7440-06-4 | 25cm |
| GX1234-1m | Platinum Wire 0.3 mm diameter, 99.99% | 7440-06-4 | 1m |
| GX2962-10cm | Platinum Wire 0.4 mm diameter, 99.9% | 7440-06-4 | 10cm |
| GX2962-50cm | Platinum Wire 0.4 mm diameter, 99.9% | 7440-06-4 | 50cm |
| GX2962-1m | Platinum Wire 0.4 mm diameter, 99.9% | 7440-06-4 | 1m |
| GX9532-5cm | Platinum Wire 0.5 mm diameter, 99.9% | 7440-06-4 | 5cm |
| GX9532-10cm | Platinum Wire 0.5 mm diameter, 99.9% | 7440-06-4 | 10cm |
| GX9532-25cm | Platinum Wire 0.5 mm diameter, 99.9% | 7440-06-4 | 25cm |
| GX9532-1m | Platinum Wire 0.5 mm diameter, 99.9% | 7440-06-4 | 1m |
| GX0325-5cm | Platinum Wire 0.5 mm diameter, 99.99% | 7440-06-4 | 5cm |
| GX0325-10cm | Platinum Wire 0.5 mm diameter, 99.99% | 7440-06-4 | 10cm |
| GX0325-50cm | Platinum Wire 0.5 mm diameter, 99.99% | 7440-06-4 | 50cm |
| GX0325-1m | Platinum Wire 0.5 mm diameter, 99.99% | 7440-06-4 | 1m |
| GX5374-10cm | Platinum Wire 0.6 mm diameter, 99.9% | 7440-06-4 | 10cm |
| GX5374-25cm | Platinum Wire 0.6 mm diameter, 99.9% | 7440-06-4 | 25cm |
| GX5374-1m | Platinum Wire 0.6 mm diameter, 99.9% | 7440-06-4 | 1m |
| GX4099-5cm | Platinum Wire 0.7 mm diameter, 99.9% | 7440-06-4 | 5cm |
| GX4099-10cm | Platinum Wire 0.7 mm diameter, 99.9% | 7440-06-4 | 10cm |
| GX4099-25cm | Platinum Wire 0.7 mm diameter, 99.9% | 7440-06-4 | 25cm |
| GX4099-50cm | Platinum Wire 0.7 mm diameter, 99.9% | 7440-06-4 | 50cm |
| GX3975-5cm | Platinum Wire 0.8 mm diameter, 99.9% | 7440-06-4 | 5cm |
| GX3975-10cm | Platinum Wire 0.8 mm diameter, 99.9% | 7440-06-4 | 10cm |
| GX3975-25cm | Platinum Wire 0.8 mm diameter, 99.9% | 7440-06-4 | 25cm |
| GX3975-50cm | Platinum Wire 0.8 mm diameter, 99.9% | 7440-06-4 | 50cm |
| GX1866-5cm | Platinum Wire 1.0 mm diameter, 99.9% | 7440-06-4 | 5cm |
| GX1866-10cm | Platinum Wire 1.0 mm diameter, 99.9% | 7440-06-4 | 10cm |
| GX1866-25cm | Platinum Wire 1.0 mm diameter, 99.9% | 7440-06-4 | 25cm |
| GX1866-50cm | Platinum Wire 1.0 mm diameter, 99.9% | 7440-06-4 | 50cm |
| GX3111-2cm | Platinum Wire 1.0 mm diameter, 99.99% | 7440-06-4 | 2cm |
| GX3111-5cm | Platinum Wire 1.0 mm diameter, 99.99% | 7440-06-4 | 5cm |
| GX3111-10cm | Platinum Wire 1.0 mm diameter, 99.99% | 7440-06-4 | 10cm |
| GX3111-25cm | Platinum Wire 1.0 mm diameter, 99.99% | 7440-06-4 | 25cm |
| GX8936-1cm | Platinum Wire 2.0 mm diameter, 99.9% | 7440-06-4 | 1cm |
| GX8936-5cm | Platinum Wire 2.0 mm diameter, 99.9% | 7440-06-4 | 5cm |
| GX0456-1cm | Platinum Wire 2.0 mm diameter, 99.99% | 7440-06-4 | 1cm |
| GX0456-5cm | Platinum Wire 2.0 mm diameter, 99.99% | 7440-06-4 | 5cm |
| GX4943-1g | Platinum Wool, 0.05 mm wire thickness, 99.9% | 7440-06-4 | 1g |
| GX4943-5g | Platinum Wool, 0.05 mm wire thickness, 99.9% | 7440-06-4 | 5g |
| GX9304-25cm | Platinum,Iridium 70,30 wire 0.25 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 25cm |
| GX9304-1m | Platinum,Iridium 70,30 wire 0.25 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 1m |
| GX9896-10cm | Platinum,Iridium 80,20 wire 0.25 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 10cm |
| GX9896-50cm | Platinum,Iridium 80,20 wire 0.25 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 50cm |
| GX9896-1m | Platinum,Iridium 80,20 wire 0.25 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 1m |
| GX6603-10cm | Platinum,Iridium 80,20 wire 0.5 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 10cm |
| GX6603-50cm | Platinum,Iridium 80,20 wire 0.5 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 50cm |
| GX1247-5cm | Platinum,Iridium 90,10 rod 2 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 5cm |
| GX1247-25cm | Platinum,Iridium 90,10 rod 2 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 25cm |
| GX4811-15m | Platinum,Iridium 90,10 wire 0.015 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 15m |
| GX0547-1m | Platinum,Iridium 90,10 wire 0.1 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 1m |
| GX0547-10m | Platinum,Iridium 90,10 wire 0.1 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 10m |
| GX5738-25cm | Platinum,Iridium 90,10 wire 0.2 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 25cm |
| GX5738-1m | Platinum,Iridium 90,10 wire 0.2 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 1m |
| GX2372-25cm | Platinum,Iridium 90,10 wire 0.25 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 25cm |
| GX2372-1m | Platinum,Iridium 90,10 wire 0.25 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 1m |
| GX3804-25cm | Platinum,Iridium 90,10 wire 0.25 mm diameter, aligned, 99.9+% (metals basis) | 7440-06-4 | 25cm |
| GX8346-10cm | Platinum,Iridium 90,10 wire 0.5 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 10cm |
| GX8346-25cm | Platinum,Iridium 90,10 wire 0.5 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 25cm |
| GX8346-1m | Platinum,Iridium 90,10 wire 0.5 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 1m |
| GX5933-10cm | Platinum,Iridium 90,10 wire 0.6 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 10cm |
| GX5933-25cm | Platinum,Iridium 90,10 wire 0.6 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 25cm |
| GX5933-1m | Platinum,Iridium 90,10 wire 0.6 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 1m |
| GX6744-5cm | Platinum,Iridium 90,10 wire 1.0 mm diameter (99.9+% metals basis) | 7440-06-4 | 5cm |
| GX6744-25cm | Platinum,Iridium 90,10 wire 1.0 mm diameter (99.9+% metals basis) | 7440-06-4 | 25cm |
| GX5623-10cm | Platinum,Rhodium 90,10 wire 0.5 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 10cm |
| GX5623-25cm | Platinum,Rhodium 90,10 wire 0.5 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 25cm |
| GX5623-1m | Platinum,Rhodium 90,10 wire 0.5 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 1m |
| GX5698-25cm | Platinum,Tungsten 92,8 wire 0.225 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 25cm |
| GX5698-1m | Platinum,Tungsten 92,8 wire 0.225 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 1m |
| GX2408-1m | Platinum:Iridium (70:30) wire, 0.1 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 1m |
| GX2408-5m | Platinum:Iridium (70:30) wire, 0.1 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 5m |
| GX2454-25cm | Platinum:Iridium (90:10) wire, 0.3 mm diameter, 99.9% (metals basis) | 7440-06-4 | 25cm |
| GX2454-1m | Platinum:Iridium (90:10) wire, 0.3 mm diameter, 99.9% (metals basis) | 7440-06-4 | 1m |
| GX6181-25cm | Platinum:Rhodium wire, 90:10, 0.25 mm diameter, 99.9+% (metals basis) | 7440-06-4 | 25cm |
| GX2976-1g | Platinum(II) bromide | 13455-12-4 | 1g |
| GX5987-1g | Platinum(II) chloride, 99.9% | 10025-65-7 | 1g |
| GX5987-5g | Platinum(II) chloride, 99.9% | 10025-65-7 | 5g |
| GX5537-250mg | Platinum(II) diammine cyclobutane dicarboxylate, 99.95% (metals basis) | 41575-94-4 | 250mg |
| GX5537-1g | Platinum(II) diammine cyclobutane dicarboxylate, 99.95% (metals basis) | 41575-94-4 | 1g |
| GX8565-1g | Platinum(II) iodide, 99.95% (metals basis) | 7790-39-8 | 1g |
| GX8565-5g | Platinum(II) iodide, 99.95% (metals basis) | 7790-39-8 | 5g |
| GX0417-1g | Platinum(II) nitrate, 99.95% (metals basis) | 18496-40-7 | 1g |
| GX0417-5g | Platinum(II) nitrate, 99.95% (metals basis) | 18496-40-7 | 5g |
| GX7338-1g | Platinum(IV) chloride, 99.9% (metals basis) | 13454-96-1 | 1g |
| GX7338-5g | Platinum(IV) chloride, 99.9% (metals basis) | 13454-96-1 | 5g |
| GX0662-1g | Platinum(IV) oxide hydrate | 52785-06-5 | 1g |
| GX0662-5g | Platinum(IV) oxide hydrate | 52785-06-5 | 5g |
| GP0472-100mg | Plerixafor | 110078-46-1 | 100mg |
| GD9243-100g | Pluronic F-68 | 9003-11-6 | 100g |
| GD9243-250g | Pluronic F-68 | 9003-11-6 | 250g |
| GD9243-500g | Pluronic F-68 | 9003-11-6 | 500g |
| GW1682-1mg | PLX4032 | 918504-65-1 | 1mg |
| GW1682-5mg | PLX4032 | 918504-65-1 | 5mg |
| GW1682-10mg | PLX4032 | 918504-65-1 | 10mg |
| GL9916-5mg | PLX4720 | 918505-84-7 | 5mg |
| GL9916-25mg | PLX4720 | 918505-84-7 | 25mg |
| GW6333-1mg | PMPH | 1392835-64-1 | 1mg |
| GW6333-5mg | PMPH | 1392835-64-1 | 5mg |
| GX9577-5g | PNPP sodium salt | 333338-18-4 | 5g |
| GX9577-25g | PNPP sodium salt | 333338-18-4 | 25g |
| GX3711-100EA | PNPP sodium salt, 5mg tablets | 333338-18-4 | 100EA |
| GE0412-100mg | Podophyllotoxin | 518-28-5 | 100mg |
| GP8912-250mg | Polaprezinc | 107667-60-7 | 250mg |
| GP8912-1g | Polaprezinc | 107667-60-7 | 1g |
| GX7310-100g | Poly(acrylic acid); 35% solution in water | 9003-01-4 | 100g |
| GX7310-250g | Poly(acrylic acid); 35% solution in water | 9003-01-4 | 250g |
| GX4029-100mg | Poly(D-lactide) | 106989-11-1 | 100mg |
| GX4029-250mg | Poly(D-lactide) | 106989-11-1 | 250mg |
| GX4029-2500mg | Poly(D-lactide) | 106989-11-1 | 2500mg |
| GX8223-5g | Poly(hexamethylenebiguanide) hydrochloride | 32289-58-0 | 5g |
| GX8223-10g | Poly(hexamethylenebiguanide) hydrochloride | 32289-58-0 | 10g |
| GW3125-10g | Poly(L-lactide) 1.0 dl/g | 26161-42-2 | 10g |
| GW3125-50g | Poly(L-lactide) 1.0 dl/g | 26161-42-2 | 50g |
| GW1677-10g | Poly(L-lactide) 2.0 dl/g | 26161-42-2 | 10g |
| GW1677-50g | Poly(L-lactide) 2.0 dl/g | 26161-42-2 | 50g |
| GW3343-10g | Poly(L-lactide) 4.0 dl/g | 26161-42-2 | 10g |
| GW3343-50g | Poly(L-lactide) 4.0 dl/g | 26161-42-2 | 50g |
| GM4452-100g | Poly(sucrose-co-epichlorhydrin) | 26873-85-8 | 100g |
| GW9186-10g | Poly[(R)-3-hydroxybutyric acid] (natural origin) | 29435-48-1 | 10g |
| GW9186-100g | Poly[(R)-3-hydroxybutyric acid] (natural origin) | 29435-48-1 | 100g |
| GK2612-100g | Polyacrylonitrile, m.w. approx. 150,000 | 25014-41-9 | 100g |
| GL7541-5g | Polyanetholesulfonic acid sodium salt | 55963-78-5 | 5g |
| GL7541-25g | Polyanetholesulfonic acid sodium salt | 55963-78-5 | 25g |
| GC0081-100g | Polyethylene glycol 1000 | 25322-68-3 | 100g |
| GK2627-100g | Polyethylene glycol 1500 | 25322-68-3 | 100g |
| GK2627-500g | Polyethylene glycol 1500 | 25322-68-3 | 500g |
| GK2627-1kg | Polyethylene glycol 1500 | 25322-68-3 | 1kg |
| GC1353-1kg | Polyethylene glycol 1500, BP, Ph. Eur., USP/NF grade | 25322-68-3 | 1kg |
| GC1353-5kg | Polyethylene glycol 1500, BP, Ph. Eur., USP/NF grade | 25322-68-3 | 5kg |
| GC3410-100g | Polyethylene glycol 200 | 25322-68-3 | 100g |
| GC3410-500g | Polyethylene glycol 200 | 25322-68-3 | 500g |
| GC3410-1kg | Polyethylene glycol 200 | 25322-68-3 | 1kg |
| GC3410-5kg | Polyethylene glycol 200 | 25322-68-3 | 5kg |
| GC9998-100g | Polyethylene glycol 300 | 25322-68-3 | 100g |
| GC9998-250g | Polyethylene glycol 300 | 25322-68-3 | 250g |
| GC9998-500g | Polyethylene glycol 300 | 25322-68-3 | 500g |
| GC9998-1kg | Polyethylene glycol 300 | 25322-68-3 | 1kg |
| GC9998-5kg | Polyethylene glycol 300 | 25322-68-3 | 5kg |
| GC0220-1l | Polyethylene glycol 300, BP, Ph. Eur., USP/NF grade | 25322-68-3 | 1l |
| GC3481-100g | Polyethylene glycol 400 | 25322-68-3 | 100g |
| GC3481-250g | Polyethylene glycol 400 | 25322-68-3 | 250g |
| GC3481-500g | Polyethylene glycol 400 | 25322-68-3 | 500g |
| GC3481-1kg | Polyethylene glycol 400 | 25322-68-3 | 1kg |
| GC3481-5kg | Polyethylene glycol 400 | 25322-68-3 | 5kg |
| GC0231-1l | Polyethylene glycol 400, BP, Ph. Eur., USP/NF grade | 25322-68-3 | 1l |
| GC0231-5l | Polyethylene glycol 400, BP, Ph. Eur., USP/NF grade | 25322-68-3 | 5l |
| GX6931-100g | Polyethylene glycol 4000 | 25322-68-3 | 100g |
| GX6931-500g | Polyethylene glycol 4000 | 25322-68-3 | 500g |
| GX6931-1kg | Polyethylene glycol 4000 | 25322-68-3 | 1kg |
| GC0009-1kg | Polyethylene glycol 4000, BP, Ph. Eur., USP/NF grade | 25322-68-3 | 1kg |
| GC2342-100g | Polyethylene glycol 6000 | 25322-68-3 | 100g |
| GC2342-500g | Polyethylene glycol 6000 | 25322-68-3 | 500g |
| GC2342-1kg | Polyethylene glycol 6000 | 25322-68-3 | 1kg |
| GC0902-100g | Polyethylene glycol 8000 | 25322-68-3 | 100g |
| GC0902-500g | Polyethylene glycol 8000 | 25322-68-3 | 500g |
| GC0902-1kg | Polyethylene glycol 8000 | 25322-68-3 | 1kg |
| GC2100-1kg | Polyethylene glycol 8000, BP, Ph. Eur., USP/NF grade | 25322-68-3 | 1kg |
| GC8195-5g | Polygalacturonic acid | 25990-10-7 | 5g |
| GC8195-25g | Polygalacturonic acid | 25990-10-7 | 25g |
| GC8195-100g | Polygalacturonic acid | 25990-10-7 | 100g |
| GA4028-1mg | Polyketomycin | 200625-47-4 | 1mg |
| GA4910-1g | Polymixin B sulfate salt | 1405-20-5 | 1g |
| GA4910-5g | Polymixin B sulfate salt | 1405-20-5 | 5g |
| GA4910-10g | Polymixin B sulfate salt | 1405-20-5 | 10g |
| GD1579-100g | Polyoxyethylene (10) cetyl ether | 9004-95-9 | 100g |
| GD1579-500g | Polyoxyethylene (10) cetyl ether | 9004-95-9 | 500g |
| GD1579-1kg | Polyoxyethylene (10) cetyl ether | 9004-95-9 | 1kg |
| GX0442-100g | Polyoxyethylene (100) stearate | 9004-99-3 | 100g |
| GX0442-500g | Polyoxyethylene (100) stearate | 9004-99-3 | 500g |
| GD2457-100g | Polyoxyethylene (20) cetyl ether | 9004-95-9 | 100g |
| GD2457-500g | Polyoxyethylene (20) cetyl ether | 9004-95-9 | 500g |
| GD2457-1kg | Polyoxyethylene (20) cetyl ether | 9004-95-9 | 1kg |
| GL5918-100g | Polyoxyethylene (40) stearate | 9004-99-3 | 100g |
| GL5918-250g | Polyoxyethylene (40) stearate | 9004-99-3 | 250g |
| GX7347-100g | Polyoxyl 15 Hydroxystearate USP, Ph. Eur. grade | 70142-34-6 | 100g |
| GX7347-500g | Polyoxyl 15 Hydroxystearate USP, Ph. Eur. grade | 70142-34-6 | 500g |
| GX7347-1kg | Polyoxyl 15 Hydroxystearate USP, Ph. Eur. grade | 70142-34-6 | 1kg |
| GD4801-500ml | Polysorbate 80 | 9005-65-6 | 500ml |
| GD4801-1l | Polysorbate 80 | 9005-65-6 | 1l |
| GD4801-5l | Polysorbate 80 | 9005-65-6 | 5l |
| GC7257-25g | Polysucrose 400 | 26873-85-8 | 25g |
| GC7257-100g | Polysucrose 400 | 26873-85-8 | 100g |
| GC7257-250g | Polysucrose 400 | 26873-85-8 | 250g |
| GX7780-250g | Polyvinyl acetate | 9003-20-7 | 250g |
| GX7780-1kg | Polyvinyl acetate | 9003-20-7 | 1kg |
| GP0062-1g | Pomalidomide | 19171-19-8 | 1g |
| GK7972-1mg | Ponasterone A | 13408-56-5 | 1mg |
| GK7972-5mg | Ponasterone A | 13408-56-5 | 5mg |
| GK7972-25mg | Ponasterone A | 13408-56-5 | 25mg |
| GP1345-10mg | Ponatinib | 943319-70-8 | 10mg |
| GT7227-25g | Ponceau 4R (C.I. 16255) | 2611-82-7 | 25g |
| GT7227-100g | Ponceau 4R (C.I. 16255) | 2611-82-7 | 100g |
| GT7227-250g | Ponceau 4R (C.I. 16255) | 2611-82-7 | 250g |
| GT7227-500g | Ponceau 4R (C.I. 16255) | 2611-82-7 | 500g |
| GT2882-10g | Ponceau S (C.I. 27195) | 6226-79-5 | 10g |
| GT2882-25g | Ponceau S (C.I. 27195) | 6226-79-5 | 25g |
| GT2882-50g | Ponceau S (C.I. 27195) | 6226-79-5 | 50g |
| GT2882-100g | Ponceau S (C.I. 27195) | 6226-79-5 | 100g |
| GT6288-1l | Ponceau S, 0.1% (w/v) in 5% acetic acid | 6226-79-5 | 1l |
| GB0334-25g | POPSO | 68189-43-5 | 25g |
| GB0334-100g | POPSO | 68189-43-5 | 100g |
| GB0334-500g | POPSO | 68189-43-5 | 500g |
| GB6170-25g | POPSO disodium salt | 108321-07-9 | 25g |
| GB6170-100g | POPSO disodium salt | 108321-07-9 | 100g |
| GP2766-250mg | Posaconazole | 171228-49-2 | 250mg |
| GP2766-1g | Posaconazole | 171228-49-2 | 1g |
| GX7641-100g | Potassium acetate, 98% | 127-08-2 | 100g |
| GX7641-250g | Potassium acetate, 98% | 127-08-2 | 250g |
| GX7641-500g | Potassium acetate, 98% | 127-08-2 | 500g |
| GX7641-1kg | Potassium acetate, 98% | 127-08-2 | 1kg |
| GX7641-5kg | Potassium acetate, 98% | 127-08-2 | 5kg |
| GX5463-25g | Potassium acetate, 99.99+% | 127-08-2 | 25g |
| GX5463-100g | Potassium acetate, 99.99+% | 127-08-2 | 100g |
| GX0998-100g | Potassium antimonyl tartrate trihydrate, 99.5+% | 28300-74-5 | 100g |
| GX0998-500g | Potassium antimonyl tartrate trihydrate, 99.5+% | 28300-74-5 | 500g |
| GX2928-250g | Potassium benzoate | 582-25-2 | 250g |
| GX2928-500g | Potassium benzoate | 582-25-2 | 500g |
| GX2928-1kg | Potassium benzoate | 582-25-2 | 1kg |
| GK4148-100g | Potassium bromate | 7758-01-2 | 100g |
| GK4148-500g | Potassium bromate | 7758-01-2 | 500g |
| GK4148-1kg | Potassium bromate | 7758-01-2 | 1kg |
| GK0242-100g | Potassium bromide | 7758-02-3 | 100g |
| GK0242-250g | Potassium bromide | 7758-02-3 | 250g |
| GK0242-1kg | Potassium bromide | 7758-02-3 | 1kg |
| GX4889-10g | Potassium bromide, 99.999% | 7758-02-3 | 10g |
| GX4889-50g | Potassium bromide, 99.999% | 7758-02-3 | 50g |
| GX6012-1kg | Potassium bromide, BP, Ph. Eur. grade | 7758-02-3 | 1kg |
| GK4171-500g | Potassium carbonate, anhydrous | 584-08-7 | 500g |
| GK4171-1kg | Potassium carbonate, anhydrous | 584-08-7 | 1kg |
| GK4171-5kg | Potassium carbonate, anhydrous | 584-08-7 | 5kg |
| GX3831-25g | Potassium carbonate, anhydrous, 99.99% | 584-08-7 | 25g |
| GX3831-100g | Potassium carbonate, anhydrous, 99.99% | 584-08-7 | 100g |
| GK0300-1kg | Potassium carbonate, anhydrous, granular | 584-08-7 | 1kg |
| GK0300-5kg | Potassium carbonate, anhydrous, granular | 584-08-7 | 5kg |
| GK8545-250g | Potassium chlorate | 3811-04-9 | 250g |
| GK8545-1kg | Potassium chlorate | 3811-04-9 | 1kg |
| GK8545-5kg | Potassium chlorate | 3811-04-9 | 5kg |
| GX1094-50g | Potassium chloride, 99.99+% | 7447-40-7 | 50g |
| GE5369-1kg | Potassium chloride, 99% | 7447-40-7 | 1kg |
| GE5369-5kg | Potassium chloride, 99% | 7447-40-7 | 5kg |
| GE4711-100g | Potassium chloride, BP, Ph. Eur. grade | 7447-40-7 | 100g |
| GE4711-250g | Potassium chloride, BP, Ph. Eur. grade | 7447-40-7 | 250g |
| GE4711-500g | Potassium chloride, BP, Ph. Eur. grade | 7447-40-7 | 500g |
| GE4711-1kg | Potassium chloride, BP, Ph. Eur. grade | 7447-40-7 | 1kg |
| GE4711-5kg | Potassium chloride, BP, Ph. Eur. grade | 7447-40-7 | 5kg |
| GE8357-250g | Potassium chloride, FCC grade | 7447-40-7 | 250g |
| GE8357-500g | Potassium chloride, FCC grade | 7447-40-7 | 500g |
| GE8357-1kg | Potassium chloride, FCC grade | 7447-40-7 | 1kg |
| GE8357-5kg | Potassium chloride, FCC grade | 7447-40-7 | 5kg |
| GA1260-1g | Potassium clavulanate with microcrystalline cellulose | 61177-45-5 | 1g |
| GA1260-5g | Potassium clavulanate with microcrystalline cellulose | 61177-45-5 | 5g |
| GA1260-10g | Potassium clavulanate with microcrystalline cellulose | 61177-45-5 | 10g |
| GX4200-5g | Potassium dihydrogen phosphate, 99.99+% | 7778-77-0 | 5g |
| GX4090-25g | Potassium disulfate | 7790-62-7 | 25g |
| GX4090-100g | Potassium disulfate | 7790-62-7 | 100g |
| GK7805-100g | Potassium ferricyanide | 13746-66-2 | 100g |
| GK7805-250g | Potassium ferricyanide | 13746-66-2 | 250g |
| GK7805-500g | Potassium ferricyanide | 13746-66-2 | 500g |
| GK7805-1kg | Potassium ferricyanide | 13746-66-2 | 1kg |
| GK7805-5kg | Potassium ferricyanide | 13746-66-2 | 5kg |
| GK0288-100g | Potassium ferrocyanide trihydrate | 14459-95-1 | 100g |
| GK0288-250g | Potassium ferrocyanide trihydrate | 14459-95-1 | 250g |
| GK0288-500g | Potassium ferrocyanide trihydrate | 14459-95-1 | 500g |
| GK0288-1kg | Potassium ferrocyanide trihydrate | 14459-95-1 | 1kg |
| GK0754-250g | Potassium formate | 590-29-4 | 250g |
| GK0754-1kg | Potassium formate | 590-29-4 | 1kg |
| GC3383-25g | Potassium gluconate, USP grade, anhydrous | 299-27-4 | 25g |
| GC3383-100g | Potassium gluconate, USP grade, anhydrous | 299-27-4 | 100g |
| GC3383-250g | Potassium gluconate, USP grade, anhydrous | 299-27-4 | 250g |
| GC3383-500g | Potassium gluconate, USP grade, anhydrous | 299-27-4 | 500g |
| GC3383-1kg | Potassium gluconate, USP grade, anhydrous | 299-27-4 | 1kg |
| GX0840-1g | Potassium hexabromoplatinate(IV) | 16920-93-7 | 1g |
| GX0840-5g | Potassium hexabromoplatinate(IV) | 16920-93-7 | 5g |
| GX0623-1g | Potassium hexachloroiridate(III) hydrate | 14024-41-0 | 1g |
| GX0623-5g | Potassium hexachloroiridate(III) hydrate | 14024-41-0 | 5g |
| GX1058-1g | Potassium hexachloroiridate(IV); 99.95% (metals basis) | 16920-56-2 | 1g |
| GX1058-5g | Potassium hexachloroiridate(IV); 99.95% (metals basis) | 16920-56-2 | 5g |
| GX5756-1g | Potassium hexachloroiridate(IV); 99.99% | 16920-56-2 | 1g |
| GX5756-5g | Potassium hexachloroiridate(IV); 99.99% | 16920-56-2 | 5g |
| GX1808-1g | Potassium hexachloroosmate(IV); 99.9% (metals basis) | 16871-60-6 | 1g |
| GX1808-5g | Potassium hexachloroosmate(IV); 99.9% (metals basis) | 16871-60-6 | 5g |
| GX0120-2g | Potassium hexachloropalladate(IV); 99.95% (metals basis) | 16919-73-6 | 2g |
| GX0120-10g | Potassium hexachloropalladate(IV); 99.95% (metals basis) | 16919-73-6 | 10g |
| GK0541-250mg | Potassium hexachloroplatinate(IV) | 16921-30-5 | 250mg |
| GK0541-1g | Potassium hexachloroplatinate(IV) | 16921-30-5 | 1g |
| GX3794-1g | Potassium hexachloroplatinate(IV); 99.95% (metals basis) | 16921-30-5 | 1g |
| GX3794-5g | Potassium hexachloroplatinate(IV); 99.95% (metals basis) | 16921-30-5 | 5g |
| GX8871-1g | Potassium hexachlororhenate(IV); 99.95% (metals basis) | 16940-97-9 | 1g |
| GX8871-5g | Potassium hexachlororhenate(IV); 99.95% (metals basis) | 16940-97-9 | 5g |
| GX7690-1g | Potassium hexachlororhodate(III) hydrate, 99.95% (metals basis) | 13845-07-3 | 1g |
| GX7690-5g | Potassium hexachlororhodate(III) hydrate, 99.95% (metals basis) | 13845-07-3 | 5g |
| GX2746-100g | Potassium hexacyanocobaltate(III); 95% | 13963-58-1 | 100g |
| GX4161-25g | Potassium hexacyanoferrate(III); ACS grade | 13746-66-2 | 25g |
| GX4161-100g | Potassium hexacyanoferrate(III); ACS grade | 13746-66-2 | 100g |
| GX4161-500g | Potassium hexacyanoferrate(III); ACS grade | 13746-66-2 | 500g |
| GX4600-10g | Potassium hexafluoroarsenate(V) | 17029-22-0 | 10g |
| GX4600-50g | Potassium hexafluoroarsenate(V) | 17029-22-0 | 50g |
| GX2465-100g | Potassium hexafluorophosphate(V) | 17084-13-8 | 100g |
| GX2465-250g | Potassium hexafluorophosphate(V) | 17084-13-8 | 250g |
| GX8687-500g | Potassium hexafluorosilicate, 99% | 16871-90-2 | 500g |
| GX3355-500g | Potassium hexafluorotitanate, 98% | 16919-27-0 | 500g |
| GX5063-1kg | Potassium hexafluorozirconate | 16923-95-8 | 1kg |
| GX0101-5g | Potassium hexahydroxoantimonate(V) | 12208-13-8 | 5g |
| GX0101-25g | Potassium hexahydroxoantimonate(V) | 12208-13-8 | 25g |
| GX3916-1g | Potassium hexaiodoplatinate(IV); 99.9% | 16905-14-9 | 1g |
| GX3916-5g | Potassium hexaiodoplatinate(IV); 99.9% | 16905-14-9 | 5g |
| GK1196-100g | Potassium hydrogen carbonate | 298-14-6 | 100g |
| GK1196-250g | Potassium hydrogen carbonate | 298-14-6 | 250g |
| GK1196-500g | Potassium hydrogen carbonate | 298-14-6 | 500g |
| GK1196-1kg | Potassium hydrogen carbonate | 298-14-6 | 1kg |
| GK1196-5kg | Potassium hydrogen carbonate | 298-14-6 | 5kg |
| GK2355-100g | Potassium hydrogen phthalate | 877-24-7 | 100g |
| GK2355-250g | Potassium hydrogen phthalate | 877-24-7 | 250g |
| GK2355-500g | Potassium hydrogen phthalate | 877-24-7 | 500g |
| GK2355-1kg | Potassium hydrogen phthalate | 877-24-7 | 1kg |
| GK6425-100g | Potassium hydrogen sulfate | 7646-93-7 | 100g |
| GK6425-250g | Potassium hydrogen sulfate | 7646-93-7 | 250g |
| GK6425-500g | Potassium hydrogen sulfate | 7646-93-7 | 500g |
| GK6425-1kg | Potassium hydrogen sulfate | 7646-93-7 | 1kg |
| GX4333-100g | Potassium hydrogen sulfate, 99.9+% | 7646-93-7 | 100g |
| GX6150-100g | Potassium hydrogen tartrate | 868-14-4 | 100g |
| GX6150-250g | Potassium hydrogen tartrate | 868-14-4 | 250g |
| GX6150-500g | Potassium hydrogen tartrate | 868-14-4 | 500g |
| GX6150-1kg | Potassium hydrogen tartrate | 868-14-4 | 1kg |
| GX6150-2500g | Potassium hydrogen tartrate | 868-14-4 | 2500g |
| GK0650-250g | Potassium hydroxide | 1310-58-3 | 250g |
| GK0650-500g | Potassium hydroxide | 1310-58-3 | 500g |
| GK0650-1kg | Potassium hydroxide | 1310-58-3 | 1kg |
| GK4467-100g | Potassium iodate | 7758-05-6 | 100g |
| GK4467-500g | Potassium iodate | 7758-05-6 | 500g |
| GK4467-1kg | Potassium iodate | 7758-05-6 | 1kg |
| GX2298-25g | Potassium iodide, 99.9+% | 7681-11-0 | 25g |
| GX7535-100g | Potassium iodide, 99% | 7681-11-0 | 100g |
| GX7535-250g | Potassium iodide, 99% | 7681-11-0 | 250g |
| GX7535-500g | Potassium iodide, 99% | 7681-11-0 | 500g |
| GX7535-1kg | Potassium iodide, 99% | 7681-11-0 | 1kg |
| GP9984-250g | Potassium iodide, 99%, Ph. Eur., BP, USP grade | 7681-11-0 | 250g |
| GP9984-1kg | Potassium iodide, 99%, Ph. Eur., BP, USP grade | 7681-11-0 | 1kg |
| GP9540-25g | Potassium iodide, BP, Ph. Eur. grade | 7681-11-0 | 25g |
| GP9540-100g | Potassium iodide, BP, Ph. Eur. grade | 7681-11-0 | 100g |
| GP9540-250g | Potassium iodide, BP, Ph. Eur. grade | 7681-11-0 | 250g |
| GP9540-500g | Potassium iodide, BP, Ph. Eur. grade | 7681-11-0 | 500g |
| GP9540-1kg | Potassium iodide, BP, Ph. Eur. grade | 7681-11-0 | 1kg |
| GX0303-100g | Potassium metabisulfite | 16731-55-8 | 100g |
| GX0303-250g | Potassium metabisulfite | 16731-55-8 | 250g |
| GX0303-500g | Potassium metabisulfite | 16731-55-8 | 500g |
| GX0303-1kg | Potassium metabisulfite | 16731-55-8 | 1kg |
| GX0303-5kg | Potassium metabisulfite | 16731-55-8 | 5kg |
| GX3502-500g | Potassium metabisulfite, 98% | 16731-55-8 | 500g |
| GX3502-1kg | Potassium metabisulfite, 98% | 16731-55-8 | 1kg |
| GX6323-100g | Potassium metaborate | 13709-94-9 | 100g |
| GX6323-250g | Potassium metaborate | 13709-94-9 | 250g |
| GX6323-500g | Potassium metaborate | 13709-94-9 | 500g |
| GX6323-1kg | Potassium metaborate | 13709-94-9 | 1kg |
| GX6911-100g | Potassium metaperiodate, 99+% | 7790-21-8 | 100g |
| GX1648-100g | Potassium metaphosphate | 7790-53-6 | 100g |
| GX2091-25g | Potassium metavanadate, 99.0% | 13769-43-2 | 25g |
| GX2091-100g | Potassium metavanadate, 99.0% | 13769-43-2 | 100g |
| GX2091-250g | Potassium metavanadate, 99.0% | 13769-43-2 | 250g |
| GX0194-5g | Potassium methoxide | 865-33-8 | 5g |
| GX9390-10g | Potassium molybdate | 13446-49-6 | 10g |
| GX5713-25g | Potassium molybdate, 99.9% | 13446-49-6 | 25g |
| GX5713-50g | Potassium molybdate, 99.9% | 13446-49-6 | 50g |
| GX3865-10g | Potassium niobate, 99.999% | 12030-85-2 | 10g |
| GX3865-25g | Potassium niobate, 99.999% | 12030-85-2 | 25g |
| GX5250-50g | Potassium nitrate, 99.99+% | 7757-79-1 | 50g |
| GK1121-250g | Potassium nitrate, 99% | 7757-79-1 | 250g |
| GK1121-500g | Potassium nitrate, 99% | 7757-79-1 | 500g |
| GK1121-1kg | Potassium nitrate, 99% | 7757-79-1 | 1kg |
| GK1121-5kg | Potassium nitrate, 99% | 7757-79-1 | 5kg |
| GX7850-1kg | Potassium nitrate, EP, USP grade | 7757-79-1 | 1kg |
| GK2712-1kg | Potassium nitrate, with ACA | 7757-79-1 | 1kg |
| GK2712-5kg | Potassium nitrate, with ACA | 7757-79-1 | 5kg |
| GK7746-100g | Potassium nitrite | 7758-09-0 | 100g |
| GK8503-100g | Potassium oxalate monohydrate | 6487-48-5 | 100g |
| GK8503-1kg | Potassium oxalate monohydrate | 6487-48-5 | 1kg |
| GK8503-5kg | Potassium oxalate monohydrate | 6487-48-5 | 5kg |
| GX8126-1kg | Potassium oxalate monohydrate, 99.0% | 6487-48-5 | 1kg |
| GX4937-2g | Potassium perrhenate, 99.95+% | 10466-65-6 | 2g |
| GX4937-5g | Potassium perrhenate, 99.95+% | 10466-65-6 | 5g |
| GX1747-2g | Potassium perrhenate, 99+% | 10466-65-6 | 2g |
| GX1747-5g | Potassium perrhenate, 99+% | 10466-65-6 | 5g |
| GX1747-10g | Potassium perrhenate, 99+% | 10466-65-6 | 10g |
| GK0579-100g | Potassium persulfate | 7727-21-1 | 100g |
| GX9771-500g | Potassium phosphate hydrate, 98+% | 7778-53-2 | 500g |
| GX9771-1kg | Potassium phosphate hydrate, 98+% | 7778-53-2 | 1kg |
| GX9771-5kg | Potassium phosphate hydrate, 98+% | 7778-53-2 | 5kg |
| GK8538-100g | Potassium phosphate monobasic | 7778-77-0 | 100g |
| GK8538-250g | Potassium phosphate monobasic | 7778-77-0 | 250g |
| GK8538-500g | Potassium phosphate monobasic | 7778-77-0 | 500g |
| GK8538-1kg | Potassium phosphate monobasic | 7778-77-0 | 1kg |
| GB8521-1l | Potassium phosphate monobasic, 1M solution | 7778-77-0 | 1l |
| GX7212-1kg | Potassium phosphate monobasic, Ph. Eur. grade | 7778-77-0 | 1kg |
| GX7212-5kg | Potassium phosphate monobasic, Ph. Eur. grade | 7778-77-0 | 5kg |
| GE0638-250g | Potassium phosphate tribasic monohydrate | 27176-10-9 | 250g |
| GE0638-500g | Potassium phosphate tribasic monohydrate | 27176-10-9 | 500g |
| GE0638-1kg | Potassium phosphate tribasic monohydrate | 27176-10-9 | 1kg |
| GL8076-500g | Potassium phosphate tribasic, anhydrous | 7778-53-2 | 500g |
| GL8076-1kg | Potassium phosphate tribasic, anhydrous | 7778-53-2 | 1kg |
| GK4932-100g | Potassium pyrophosphate | 7320-34-5 | 100g |
| GK4932-500g | Potassium pyrophosphate | 7320-34-5 | 500g |
| GK4932-1kg | Potassium pyrophosphate | 7320-34-5 | 1kg |
| GK4932-5kg | Potassium pyrophosphate | 7320-34-5 | 5kg |
| GK0360-25g | Potassium sodium tartrate tetrahydrate | 6381-59-5 | 25g |
| GK0360-100g | Potassium sodium tartrate tetrahydrate | 6381-59-5 | 100g |
| GK0360-500g | Potassium sodium tartrate tetrahydrate | 6381-59-5 | 500g |
| GK0360-1kg | Potassium sodium tartrate tetrahydrate | 6381-59-5 | 1kg |
| GK0360-5kg | Potassium sodium tartrate tetrahydrate | 6381-59-5 | 5kg |
| GK8826-25g | Potassium sorbate | 24634-61-5 | 25g |
| GK8826-100g | Potassium sorbate | 24634-61-5 | 100g |
| GK8826-500g | Potassium sorbate | 24634-61-5 | 500g |
| GK8826-1kg | Potassium sorbate | 24634-61-5 | 1kg |
| GK5815-500g | Potassium sorbate, granular, BP, Ph. Eur., USP, FCC grade | 24634-61-5 | 500g |
| GK5815-1kg | Potassium sorbate, granular, BP, Ph. Eur., USP, FCC grade | 24634-61-5 | 1kg |
| GK5956-100g | Potassium sulfate | 7778-80-5 | 100g |
| GK5956-250g | Potassium sulfate | 7778-80-5 | 250g |
| GK5956-500g | Potassium sulfate | 7778-80-5 | 500g |
| GK5956-1kg | Potassium sulfate | 7778-80-5 | 1kg |
| GK5956-5kg | Potassium sulfate | 7778-80-5 | 5kg |
| GX7768-50g | Potassium sulfate, 99.9% | 7778-80-5 | 50g |
| GX5997-25g | Potassium sulfate, 99.999% | 7778-80-5 | 25g |
| GX5997-100g | Potassium sulfate, 99.999% | 7778-80-5 | 100g |
| GX0055-250g | Potassium sulfite | 10117-38-1 | 250g |
| GX0055-1kg | Potassium sulfite | 10117-38-1 | 1kg |
| GE4642-10g | Potassium tellurite | 7790-58-1 | 10g |
| GE4642-25g | Potassium tellurite | 7790-58-1 | 25g |
| GK6322-5g | Potassium tert-butoxide, 99% | 865-47-4 | 5g |
| GK6322-25g | Potassium tert-butoxide, 99% | 865-47-4 | 25g |
| GX6800-100g | Potassium tetraborate tetrahydrate | 12045-78-2 | 100g |
| GX6800-250g | Potassium tetraborate tetrahydrate | 12045-78-2 | 250g |
| GX6800-500g | Potassium tetraborate tetrahydrate | 12045-78-2 | 500g |
| GX6800-1kg | Potassium tetraborate tetrahydrate | 12045-78-2 | 1kg |
| GX7268-1g | Potassium tetrabromoaurate(III) | 14323-32-1 | 1g |
| GX7268-5g | Potassium tetrabromoaurate(III) | 14323-32-1 | 5g |
| GX1391-1g | Potassium tetrachloroaurate(III); 99.95% (metals basis) | 13682-61-6 | 1g |
| GX1391-5g | Potassium tetrachloroaurate(III); 99.95% (metals basis) | 13682-61-6 | 5g |
| GX2269-1g | Potassium tetrachloroplatinate(II); 99.95% (metals basis) | 10025-99-7 | 1g |
| GX2269-5g | Potassium tetrachloroplatinate(II); 99.95% (metals basis) | 10025-99-7 | 5g |
| GX4552-2g | Potassium tetracyanoaurate(III); 99.95% (metals basis) | 14263-59-3 | 2g |
| GX4552-5g | Potassium tetracyanoaurate(III); 99.95% (metals basis) | 14263-59-3 | 5g |
| GX3065-1g | Potassium tetracyanopalladate(II) hydrate, 99.95% (metals basis) | 14516-46-2 | 1g |
| GX3065-5g | Potassium tetracyanopalladate(II) hydrate, 99.95% (metals basis) | 14516-46-2 | 5g |
| GX3837-1g | Potassium tetracyanoplatinate(II) hydrate | 14323-36-5 | 1g |
| GX3837-5g | Potassium tetracyanoplatinate(II) hydrate | 14323-36-5 | 5g |
| GX7369-1kg | Potassium tetrafluoroborate, 99% | 14075-53-7 | 1kg |
| GX1756-1g | Potassium tetrakis (4-chlorophenyl) borate, 98+% | 14680-77-4 | 1g |
| GX1756-5g | Potassium tetrakis (4-chlorophenyl) borate, 98+% | 14680-77-4 | 5g |
| GX4422-1g | Potassium tetranitritoplatinate(II) | 13815-39-9 | 1g |
| GX4422-5g | Potassium tetranitritoplatinate(II) | 13815-39-9 | 5g |
| GK4099-25g | Potassium tetrathionate | 13932-13-3 | 25g |
| GK4099-100g | Potassium tetrathionate | 13932-13-3 | 100g |
| GK0170-25g | Potassium thioacetate | 10387-40-3 | 25g |
| GK0170-100g | Potassium thioacetate | 10387-40-3 | 100g |
| GK0170-250g | Potassium thioacetate | 10387-40-3 | 250g |
| GK0170-500g | Potassium thioacetate | 10387-40-3 | 500g |
| GK0170-1kg | Potassium thioacetate | 10387-40-3 | 1kg |
| GE7344-100g | Potassium thiocyanate | 333-20-0 | 100g |
| GE7344-250g | Potassium thiocyanate | 333-20-0 | 250g |
| GE7344-500g | Potassium thiocyanate | 333-20-0 | 500g |
| GE7344-1kg | Potassium thiocyanate | 333-20-0 | 1kg |
| GE7344-5kg | Potassium thiocyanate | 333-20-0 | 5kg |
| GX0991-250g | Potassium thiocyanate, 99+%, ACS | 333-20-0 | 250g |
| GK6938-100g | Potassium-8-hydroxyquinoline sulfate | 15077-57-3 | 100g |
| GA7905-25g | Povidone iodine | 25655-41-8 | 25g |
| GA7905-100g | Povidone iodine | 25655-41-8 | 100g |
| GA7905-250g | Povidone iodine | 25655-41-8 | 250g |
| GA7905-500g | Povidone iodine | 25655-41-8 | 500g |
| GP2389-100g | Povidone K12 | 9003-39-8 | 100g |
| GP2389-500g | Povidone K12 | 9003-39-8 | 500g |
| GP2389-1kg | Povidone K12 | 9003-39-8 | 1kg |
| GP9886-100g | Povidone K15 | 9003-39-8 | 100g |
| GP9886-250g | Povidone K15 | 9003-39-8 | 250g |
| GP9886-500g | Povidone K15 | 9003-39-8 | 500g |
| GP9886-1kg | Povidone K15 | 9003-39-8 | 1kg |
| GP6526-25g | Povidone K30 | 9003-39-8 | 25g |
| GP6526-100g | Povidone K30 | 9003-39-8 | 100g |
| GP6526-250g | Povidone K30 | 9003-39-8 | 250g |
| GP6526-500g | Povidone K30 | 9003-39-8 | 500g |
| GP6526-1kg | Povidone K30 | 9003-39-8 | 1kg |
| GP3291-250g | Povidone K90 | 9003-39-8 | 250g |
| GP3291-1kg | Povidone K90 | 9003-39-8 | 1kg |
| GK9287-1mg | PP1 | 172889-26-8 | 1mg |
| GK9287-5mg | PP1 | 172889-26-8 | 5mg |
| GL5082-1mg | PP2 | 172889-27-9 | 1mg |
| GL5082-5mg | PP2 | 172889-27-9 | 5mg |
| GW9275-1mg | PP242 | 1092351-67-1 | 1mg |
| GW9275-5mg | PP242 | 1092351-67-1 | 5mg |
| GW9275-10mg | PP242 | 1092351-67-1 | 10mg |
| GP7944-250mg | Pramiracetam | 68497-62-1 | 250mg |
| GP7944-1g | Pramiracetam | 68497-62-1 | 1g |
| GP8160-25mg | Pranlukast hydrate | 150821-03-7 | 25mg |
| GP8160-50mg | Pranlukast hydrate | 150821-03-7 | 50mg |
| GP8160-250mg | Pranlukast hydrate | 150821-03-7 | 250mg |
| GX7262-25g | Praseodymium acetate hydrate, 99.9% | 6192-12-7 | 25g |
| GX7262-100g | Praseodymium acetate hydrate, 99.9% | 6192-12-7 | 100g |
| GX6790-100g | Praseodymium acetate hydrate, 99.999% | 6192-12-7 | 100g |
| GX4821-100g | Praseodymium carbonate hydrate, 98+% | 14948-62-0 | 100g |
| GX4821-250g | Praseodymium carbonate hydrate, 98+% | 14948-62-0 | 250g |
| GX4821-1kg | Praseodymium carbonate hydrate, 98+% | 14948-62-0 | 1kg |
| GX6372-25g | Praseodymium carbonate hydrate, 99.9% | 14948-62-0 | 25g |
| GX6372-100g | Praseodymium carbonate hydrate, 99.9% | 14948-62-0 | 100g |
| GX4713-25g | Praseodymium carbonate hydrate, 99.999% | 14948-62-0 | 25g |
| GX4713-100g | Praseodymium carbonate hydrate, 99.999% | 14948-62-0 | 100g |
| GX8272-10g | Praseodymium Chips, 99.9% | 7440-10-0 | 10g |
| GX8272-50g | Praseodymium Chips, 99.9% | 7440-10-0 | 50g |
| GX3759-10g | Praseodymium chloride anhydrous, 99.9% | 10361-79-2 | 10g |
| GX3759-50g | Praseodymium chloride anhydrous, 99.9% | 10361-79-2 | 50g |
| GX9104-25g | Praseodymium chloride hydrate, 99.9% | 19423-77-9 | 25g |
| GX9104-100g | Praseodymium chloride hydrate, 99.9% | 19423-77-9 | 100g |
| GX0383-10g | Praseodymium chloride hydrate, 99.99% | 19423-77-9 | 10g |
| GX0383-25g | Praseodymium chloride hydrate, 99.99% | 19423-77-9 | 25g |
| GX0383-100g | Praseodymium chloride hydrate, 99.99% | 19423-77-9 | 100g |
| GX9649-25g | Praseodymium chloride hydrate, 99.999% | 19423-77-9 | 25g |
| GX9649-100g | Praseodymium chloride hydrate, 99.999% | 19423-77-9 | 100g |
| GX7131-1g | Praseodymium D-3-heptafluorobutyrylcamphorate, 99% | 38832-94-9 | 1g |
| GX8348-10g | Praseodymium fluoride, 99.9% | 13709-46-1 | 10g |
| GX8348-50g | Praseodymium fluoride, 99.9% | 13709-46-1 | 50g |
| GX8348-250g | Praseodymium fluoride, 99.9% | 13709-46-1 | 250g |
| GX6124-100g | Praseodymium fluoride, 99.9% [pieces 1-5mm] | 13709-46-1 | 100g |
| GX3039-25x50mm | Praseodymium Foil 0.25mm, 99.9% | 7440-10-0 | 25x50mm |
| GX0812-10g | Praseodymium hydroxide hydrate, 99.9% | 16469-16-2 | 10g |
| GX0812-50g | Praseodymium hydroxide hydrate, 99.9% | 16469-16-2 | 50g |
| GX6282-25g | Praseodymium nitrate hydrate, 99.9% | 14483-17-1 | 25g |
| GX6282-100g | Praseodymium nitrate hydrate, 99.9% | 14483-17-1 | 100g |
| GX6282-250g | Praseodymium nitrate hydrate, 99.9% | 14483-17-1 | 250g |
| GX8581-25g | Praseodymium nitrate hydrate, 99.99% | 14483-17-1 | 25g |
| GX8581-100g | Praseodymium nitrate hydrate, 99.99% | 14483-17-1 | 100g |
| GX9670-50g | Praseodymium oxalate, 99.999% | 24992-60-7 | 50g |
| GX2155-250g | Praseodymium oxide, 96% | 12037-29-5 | 250g |
| GX2155-1kg | Praseodymium oxide, 96% | 12037-29-5 | 1kg |
| GX5794-100g | Praseodymium oxide, 99.9% | 12037-29-5 | 100g |
| GX5794-250g | Praseodymium oxide, 99.9% | 12037-29-5 | 250g |
| GX5475-5g | Praseodymium oxide, 99.99% | 12037-29-5 | 5g |
| GX5475-25g | Praseodymium oxide, 99.99% | 12037-29-5 | 25g |
| GX5475-100g | Praseodymium oxide, 99.99% | 12037-29-5 | 100g |
| GX5633-10g | Praseodymium Pieces, 99.9% | 7440-10-0 | 10g |
| GX5633-50g | Praseodymium Pieces, 99.9% | 7440-10-0 | 50g |
| GX5790-5g | Praseodymium Powder, 99.9% | 7440-10-0 | 5g |
| GX5790-25g | Praseodymium Powder, 99.9% | 7440-10-0 | 25g |
| GX7806-25cm | Praseodymium Rod 5 mm diameter, 99.9% | 7440-10-0 | 25cm |
| GX2758-50g | Praseodymium sulfate hydrate, 99.9% | 13510-41-3 | 50g |
| GX2758-100g | Praseodymium sulfate hydrate, 99.9% | 13510-41-3 | 100g |
| GX4907-50g | Praseodymium sulfate hydrate, 99.999% | 13510-41-3 | 50g |
| GX6796-1g | Praseodymium-fod, 99% | 17978-77-7 | 1g |
| GX3527-10g | Praseodymium(III) oxide, 99.9% | 12036-32-7 | 10g |
| GX3527-25g | Praseodymium(III) oxide, 99.9% | 12036-32-7 | 25g |
| GX3527-100g | Praseodymium(III) oxide, 99.9% | 12036-32-7 | 100g |
| GP8415-250mg | Prasugrel hydrochloride | 389574-19-0 | 250mg |
| GP8415-1g | Prasugrel hydrochloride | 389574-19-0 | 1g |
| GK3699-50mg | Pravastatin sodium salt | 81131-70-6 | 50mg |
| GA8950-1g | Praziquantel | 55268-74-1 | 1g |
| GA8950-5g | Praziquantel | 55268-74-1 | 5g |
| GA8950-25g | Praziquantel | 55268-74-1 | 25g |
| GP4454-250mg | Prazosin hydrochloride | 19237-84-4 | 250mg |
| GP4454-1g | Prazosin hydrochloride | 19237-84-4 | 1g |
| GP0011-1g | Prednisolone | 50-24-8 | 1g |
| GP0011-5g | Prednisolone | 50-24-8 | 5g |
| GP0011-25g | Prednisolone | 50-24-8 | 25g |
| GP5622-5g | Prednisone | 53-03-2 | 5g |
| GP5622-10g | Prednisone | 53-03-2 | 10g |
| GP5622-25g | Prednisone | 53-03-2 | 25g |
| GK1748-5g | Pregnenolone | 145-13-1 | 5g |
| GK1748-25g | Pregnenolone | 145-13-1 | 25g |
| GP9589-1g | Prilocaine | 721-50-6 | 1g |
| GP9589-5g | Prilocaine | 721-50-6 | 5g |
| GP9589-10g | Prilocaine | 721-50-6 | 10g |
| GP0348-1g | Prilocaine hydrochloride | 1786-81-8 | 1g |
| GP0348-5g | Prilocaine hydrochloride | 1786-81-8 | 5g |
| GP0348-10g | Prilocaine hydrochloride | 1786-81-8 | 10g |
| GC0622-1mg | Primaquine carbamoyl-β-D-glucuronide | 2189731-58-4 | 1mg |
| GC0622-2mg | Primaquine carbamoyl-β-D-glucuronide | 2189731-58-4 | 2mg |
| GC0622-5mg | Primaquine carbamoyl-β-D-glucuronide | 2189731-58-4 | 5mg |
| GC0622-10mg | Primaquine carbamoyl-β-D-glucuronide | 2189731-58-4 | 10mg |
| GK4808-25ml | Pristane | 1921-70-6 | 25ml |
| GK4808-100ml | Pristane | 1921-70-6 | 100ml |
| GK4808-250ml | Pristane | 1921-70-6 | 250ml |
| GP0312-5mg | Pristimerin | 1258-84-0 | 5mg |
| GK4509-10mg | Pristinamycin | 270076-60-3 | 10mg |
| GW0719-100mg | Probenazole | 27605-76-1 | 100mg |
| GP9170-25g | Probenecid | 57-66-9 | 25g |
| GP9170-100g | Probenecid | 57-66-9 | 100g |
| GC3751-1mg | Probenecid acyl b-D-glucuronide | 34017-15-7 | 1mg |
| GC3751-2mg | Probenecid acyl b-D-glucuronide | 34017-15-7 | 2mg |
| GC3751-5mg | Probenecid acyl b-D-glucuronide | 34017-15-7 | 5mg |
| GC3751-10mg | Probenecid acyl b-D-glucuronide | 34017-15-7 | 10mg |
| GL7337-250mg | Procainamide hydrochloride | 614-39-1 | 250mg |
| GP5551-25g | Procaine hydrochloride | 51-05-8 | 25g |
| GP5551-100g | Procaine hydrochloride | 51-05-8 | 100g |
| GP5551-250g | Procaine hydrochloride | 51-05-8 | 250g |
| GP0917-100mg | Procarbazine hydrochloride | 366-70-1 | 100mg |
| GP0917-250mg | Procarbazine hydrochloride | 366-70-1 | 250mg |
| GP0917-500mg | Procarbazine hydrochloride | 366-70-1 | 500mg |
| GP0917-1g | Procarbazine hydrochloride | 366-70-1 | 1g |
| GY2840-1mg | Procyanidin A2 | 41743-41-3 | 1mg |
| GY2840-5mg | Procyanidin A2 | 41743-41-3 | 5mg |
| GY2840-25mg | Procyanidin A2 | 41743-41-3 | 25mg |
| GL5110-1mg | Procyanidin B2 | 29106-49-8 | 1mg |
| GL5110-5mg | Procyanidin B2 | 29106-49-8 | 5mg |
| GL5110-10mg | Procyanidin B2 | 29106-49-8 | 10mg |
| GW3228-1g | Procyclidine hydrochloride | 1508-76-5 | 1g |
| GW3228-5g | Procyclidine hydrochloride | 1508-76-5 | 5g |
| GL3187-250ug | Prodigiosin | 82-89-3 | 250ug |
| GL3187-1mg | Prodigiosin | 82-89-3 | 1mg |
| GT1397-1g | Proflavine hemisulfate salt hydrate | 1811-28-5 | 1g |
| GT1397-5g | Proflavine hemisulfate salt hydrate | 1811-28-5 | 5g |
| GT1397-25g | Proflavine hemisulfate salt hydrate | 1811-28-5 | 25g |
| GP3663-5g | Progesterone | 57-83-0 | 5g |
| GP3663-25g | Progesterone | 57-83-0 | 25g |
| GL3057-10mg | Proguanil hydrochloride | 637-32-1 | 10mg |
| GP6310-5g | Promethazine hydrochloride | 58-33-3 | 5g |
| GP6310-25g | Promethazine hydrochloride | 58-33-3 | 25g |
| GP6310-100g | Promethazine hydrochloride | 58-33-3 | 100g |
| GP3270-1g | Propafenone hydrochloride | 34183-22-7 | 1g |
| GP3270-5g | Propafenone hydrochloride | 34183-22-7 | 5g |
| GP3270-25g | Propafenone hydrochloride | 34183-22-7 | 25g |
| GS5841-100ml | Propan-1-ol, GlenDry™, anhydrous | 71-23-8 | 100ml |
| GS5841-500ml | Propan-1-ol, GlenDry™, anhydrous | 71-23-8 | 500ml |
| GS5841-1l | Propan-1-ol, GlenDry™, anhydrous | 71-23-8 | 1l |
| GS5841-2500ml | Propan-1-ol, GlenDry™, anhydrous | 71-23-8 | 2500ml |
| GS5208-500ml | Propan-1-ol, GlenPure™, analytical grade | 71-23-8 | 500ml |
| GS5208-1l | Propan-1-ol, GlenPure™, analytical grade | 71-23-8 | 1l |
| GS5208-2500ml | Propan-1-ol, GlenPure™, analytical grade | 71-23-8 | 2500ml |
| GS5968-500ml | Propan-1,2-diol, GlenPure™, analytical grade | 57-55-6 | 500ml |
| GS5968-1l | Propan-1,2-diol, GlenPure™, analytical grade | 57-55-6 | 1l |
| GS5968-2500ml | Propan-1,2-diol, GlenPure™, analytical grade | 57-55-6 | 2500ml |
| GS9888-100ml | Propan-2-ol, GlenDry™, anhydrous | 67-63-0 | 100ml |
| GS9888-500ml | Propan-2-ol, GlenDry™, anhydrous | 67-63-0 | 500ml |
| GS9888-1l | Propan-2-ol, GlenDry™, anhydrous | 67-63-0 | 1l |
| GS9888-2500ml | Propan-2-ol, GlenDry™, anhydrous | 67-63-0 | 2500ml |
| GS1309-100ml | Propan-2-ol, GlenDry™, anhydrous over molecular sieve | 67-63-0 | 100ml |
| GS1309-500ml | Propan-2-ol, GlenDry™, anhydrous over molecular sieve | 67-63-0 | 500ml |
| GS1309-1l | Propan-2-ol, GlenDry™, anhydrous over molecular sieve | 67-63-0 | 1l |
| GS1309-2500ml | Propan-2-ol, GlenDry™, anhydrous over molecular sieve | 67-63-0 | 2500ml |
| GS4309-500ml | Propan-2-ol, GlenPure™, analytical grade | 67-63-0 | 500ml |
| GS4309-1l | Propan-2-ol, GlenPure™, analytical grade | 67-63-0 | 1l |
| GS4309-2500ml | Propan-2-ol, GlenPure™, analytical grade | 67-63-0 | 2500ml |
| GS3897-1l | Propan-2-ol, GlenUltra™, analytical grade, for LC | 67-63-0 | 1l |
| GS3897-2500ml | Propan-2-ol, GlenUltra™, analytical grade, for LC | 67-63-0 | 2500ml |
| GP8426-100mg | Proparacaine hydrochloride | 5875-06-9 | 100mg |
| GC2385-100mg | Propargyl 2,3,4-tri-O-acetyl-α-L-fucopyranoside | 912343-81-8 | 100mg |
| GC2385-250mg | Propargyl 2,3,4-tri-O-acetyl-α-L-fucopyranoside | 912343-81-8 | 250mg |
| GC2385-500mg | Propargyl 2,3,4-tri-O-acetyl-α-L-fucopyranoside | 912343-81-8 | 500mg |
| GC2385-1g | Propargyl 2,3,4-tri-O-acetyl-α-L-fucopyranoside | 912343-81-8 | 1g |
| GC7531-100mg | Propargyl 2,3,4,6-tetra-O-acetyl-α-D-galactopyranoside | 943859-73-2 | 100mg |
| GC7531-250mg | Propargyl 2,3,4,6-tetra-O-acetyl-α-D-galactopyranoside | 943859-73-2 | 250mg |
| GC7531-500mg | Propargyl 2,3,4,6-tetra-O-acetyl-α-D-galactopyranoside | 943859-73-2 | 500mg |
| GC7531-1g | Propargyl 2,3,4,6-tetra-O-acetyl-α-D-galactopyranoside | 943859-73-2 | 1g |
| GC7531-2g | Propargyl 2,3,4,6-tetra-O-acetyl-α-D-galactopyranoside | 943859-73-2 | 2g |
| GC0899-100mg | Propargyl α-D-Galactopyranoside | 913074-13-2 | 100mg |
| GC0899-250mg | Propargyl α-D-Galactopyranoside | 913074-13-2 | 250mg |
| GC0899-500mg | Propargyl α-D-Galactopyranoside | 913074-13-2 | 500mg |
| GC0899-1g | Propargyl α-D-Galactopyranoside | 913074-13-2 | 1g |
| GC9641-100mg | Propargyl α-D-mannopyranoside | 854262-01-4 | 100mg |
| GC9641-250mg | Propargyl α-D-mannopyranoside | 854262-01-4 | 250mg |
| GC9641-500mg | Propargyl α-D-mannopyranoside | 854262-01-4 | 500mg |
| GC9641-1g | Propargyl α-D-mannopyranoside | 854262-01-4 | 1g |
| GC5800-50mg | Propargyl α-L-fucopyranoside | 882168-36-7 | 50mg |
| GC5800-100mg | Propargyl α-L-fucopyranoside | 882168-36-7 | 100mg |
| GC5800-250mg | Propargyl α-L-fucopyranoside | 882168-36-7 | 250mg |
| GC5800-500mg | Propargyl α-L-fucopyranoside | 882168-36-7 | 500mg |
| GC5800-1g | Propargyl α-L-fucopyranoside | 882168-36-7 | 1g |
| GC9653-25mg | Propargyl β-D-lactoside | 857642-16-1 | 25mg |
| GC9653-50mg | Propargyl β-D-lactoside | 857642-16-1 | 50mg |
| GC9653-100mg | Propargyl β-D-lactoside | 857642-16-1 | 100mg |
| GC9653-250mg | Propargyl β-D-lactoside | 857642-16-1 | 250mg |
| GC0453-50mg | Propargyl β-D-lactoside heptaacetate | 211688-85-6 | 50mg |
| GC0453-100mg | Propargyl β-D-lactoside heptaacetate | 211688-85-6 | 100mg |
| GC0453-250mg | Propargyl β-D-lactoside heptaacetate | 211688-85-6 | 250mg |
| GC0453-500mg | Propargyl β-D-lactoside heptaacetate | 211688-85-6 | 500mg |
| GC8834-10mg | Propargyl β-D-maltoside | 182688-46-6 | 10mg |
| GC8834-25mg | Propargyl β-D-maltoside | 182688-46-6 | 25mg |
| GC8834-50mg | Propargyl β-D-maltoside | 182688-46-6 | 50mg |
| GC8834-100mg | Propargyl β-D-maltoside | 182688-46-6 | 100mg |
| GC8834-250mg | Propargyl β-D-maltoside | 182688-46-6 | 250mg |
| GC2212-25mg | Propargyl β-D-xylopyranoside | 1195960-77-0 | 25mg |
| GC2212-50mg | Propargyl β-D-xylopyranoside | 1195960-77-0 | 50mg |
| GC2212-100mg | Propargyl β-D-xylopyranoside | 1195960-77-0 | 100mg |
| GC2212-250mg | Propargyl β-D-xylopyranoside | 1195960-77-0 | 250mg |
| GX3577-1g | Propiconazole | 60207-90-1 | 1g |
| GP2610-10mg | Propidium iodide | 25535-16-4 | 10mg |
| GP2610-25mg | Propidium iodide | 25535-16-4 | 25mg |
| GP2610-100mg | Propidium iodide | 25535-16-4 | 100mg |
| GK5236-500ml | Propionaldehyde | 123-38-6 | 500ml |
| GK5236-1l | Propionaldehyde | 123-38-6 | 1l |
| GW7817-500mg | Propionaldehyde oxime | 627-39-4 | 500mg |
| GW7817-2500mg | Propionaldehyde oxime | 627-39-4 | 2500mg |
| GW7817-10g | Propionaldehyde oxime | 627-39-4 | 10g |
| GK9394-100ml | Propionic acid | 79-09-4 | 100ml |
| GK9394-1l | Propionic acid | 79-09-4 | 1l |
| GP3231-5g | Propofol | 2078-54-8 | 5g |
| GP3553-5g | Propranolol hydrochloride | 318-98-9 | 5g |
| GP3553-25g | Propranolol hydrochloride | 318-98-9 | 25g |
| GC9550-1mg | Propranolol-2-O-b-D-glucuronide | 66322-66-5 | 1mg |
| GC9550-2mg | Propranolol-2-O-b-D-glucuronide | 66322-66-5 | 2mg |
| GC9550-5mg | Propranolol-2-O-b-D-glucuronide | 66322-66-5 | 5mg |
| GC9550-10mg | Propranolol-2-O-b-D-glucuronide | 66322-66-5 | 10mg |
| GC5796-100mg | Propyl 2-acetamido-2-deoxy-b-D-glucopyranoside | 70832-36-9 | 100mg |
| GC5796-250mg | Propyl 2-acetamido-2-deoxy-b-D-glucopyranoside | 70832-36-9 | 250mg |
| GC5796-500mg | Propyl 2-acetamido-2-deoxy-b-D-glucopyranoside | 70832-36-9 | 500mg |
| GC5796-1g | Propyl 2-acetamido-2-deoxy-b-D-glucopyranoside | 70832-36-9 | 1g |
| GK2194-100g | Propyl 4-hydroxybenzoate | 94-13-3 | 100g |
| GK2194-500g | Propyl 4-hydroxybenzoate | 94-13-3 | 500g |
| GX7720-25g | Propyl 4-hydroxybenzoate sodium salt | 35285-69-9 | 25g |
| GX7720-100g | Propyl 4-hydroxybenzoate sodium salt | 35285-69-9 | 100g |
| GX7720-250g | Propyl 4-hydroxybenzoate sodium salt | 35285-69-9 | 250g |
| GX7720-500g | Propyl 4-hydroxybenzoate sodium salt | 35285-69-9 | 500g |
| GX7720-1kg | Propyl 4-hydroxybenzoate sodium salt | 35285-69-9 | 1kg |
| GK7583-500g | Propyl 4-hydroxybenzoate, Ph. Eur. grade | 94-13-3 | 500g |
| GK7583-1kg | Propyl 4-hydroxybenzoate, Ph. Eur. grade | 94-13-3 | 1kg |
| GK8474-5g | Propyl gallate | 121-79-9 | 5g |
| GK8474-25g | Propyl gallate | 121-79-9 | 25g |
| GK8474-100g | Propyl gallate | 121-79-9 | 100g |
| GC0501-50mg | Propyl β-D-lactoside | 115075-17-7 | 50mg |
| GC0501-100mg | Propyl β-D-lactoside | 115075-17-7 | 100mg |
| GC0501-250mg | Propyl β-D-lactoside | 115075-17-7 | 250mg |
| GC0501-500mg | Propyl β-D-lactoside | 115075-17-7 | 500mg |
| GS2468-100ml | Propylene carbonate, GlenDry™, anhydrous | 108-32-7 | 100ml |
| GS2468-500ml | Propylene carbonate, GlenDry™, anhydrous | 108-32-7 | 500ml |
| GS2468-1l | Propylene carbonate, GlenDry™, anhydrous | 108-32-7 | 1l |
| GS2424-500ml | Propylene carbonate, GlenPure™, analytical grade | 108-32-7 | 500ml |
| GS2424-1l | Propylene carbonate, GlenPure™, analytical grade | 108-32-7 | 1l |
| GK2951-100ml | Propylene glycol monomethyl ether acetate | 108-65-6 | 100ml |
| GK2653-100ml | Propylene glycol, 99% | 57-55-6 | 100ml |
| GK2653-250ml | Propylene glycol, 99% | 57-55-6 | 250ml |
| GK2653-500ml | Propylene glycol, 99% | 57-55-6 | 500ml |
| GK2653-1l | Propylene glycol, 99% | 57-55-6 | 1l |
| GK2653-2500ml | Propylene glycol, 99% | 57-55-6 | 2500ml |
| GK2653-5l | Propylene glycol, 99% | 57-55-6 | 5l |
| GK3409-500ml | Propylene glycol, Ultrapure, 99.5%, BP, Ph. Eur., USP grade | 57-55-6 | 500ml |
| GK3409-1l | Propylene glycol, Ultrapure, 99.5%, BP, Ph. Eur., USP grade | 57-55-6 | 1l |
| GK3409-5l | Propylene glycol, Ultrapure, 99.5%, BP, Ph. Eur., USP grade | 57-55-6 | 5l |
| GW5272-100mg | Propyphenazone | 479-92-5 | 100mg |
| GW5272-1g | Propyphenazone | 479-92-5 | 1g |
| GW2313-50mg | Proquinazid | 189278-12-4 | 50mg |
| GW2313-250mg | Proquinazid | 189278-12-4 | 250mg |
| GW2313-1g | Proquinazid | 189278-12-4 | 1g |
| GL2480-5mg | Prostaglandin E2 | 363-24-6 | 5mg |
| GL2480-10mg | Prostaglandin E2 | 363-24-6 | 10mg |
| GL2480-25mg | Prostaglandin E2 | 363-24-6 | 25mg |
| GW9252-500mg | Prosulfocarb | 52888-80-9 | 500mg |
| GW9252-1g | Prosulfocarb | 52888-80-9 | 1g |
| GW6219-5mg | Prosulfocarb sulfoxide | 51954-81-5 | 5mg |
| GW6219-25mg | Prosulfocarb sulfoxide | 51954-81-5 | 25mg |
| GW6219-50mg | Prosulfocarb sulfoxide | 51954-81-5 | 50mg |
| GX8506-100mg | Protease from Streptomyces griseus | 9036-06-0 | 100mg |
| GX8506-250mg | Protease from Streptomyces griseus | 9036-06-0 | 250mg |
| GE0990-25mg | Proteinase K | 39450-01-6 | 25mg |
| GE0990-100mg | Proteinase K | 39450-01-6 | 100mg |
| GE0990-250mg | Proteinase K | 39450-01-6 | 250mg |
| GE0990-500mg | Proteinase K | 39450-01-6 | 500mg |
| GE0990-1g | Proteinase K | 39450-01-6 | 1g |
| GZ5904-25ml | Proteinase K solution | 39450-01-6 | 25ml |
| GZ5904-100ml | Proteinase K solution | 39450-01-6 | 100ml |
| GX3245-1g | Prothioconazole | 178928-70-6 | 1g |
| GA2625-1g | Prothionamide | 14222-60-7 | 1g |
| GC2583-10mg | Protodioscin | 55056-80-9 | 10mg |
| GY5620-5mg | Protopine | 130-86-9 | 5mg |
| GY5620-25mg | Protopine | 130-86-9 | 25mg |
| GW1561-1mg | PRT-060318 | 1194961-19-7 | 1mg |
| GW1561-5mg | PRT-060318 | 1194961-19-7 | 5mg |
| GW1561-10mg | PRT-060318 | 1194961-19-7 | 10mg |
| GA7347-500ug | Pseudoanguillosporin A | 1159392-22-9 | 500ug |
| GA7347-1mg | Pseudoanguillosporin A | 1159392-22-9 | 1mg |
| GL2612-100ug | Pseudolaric Acid B | 82508-31-4 | 100ug |
| GL2612-1mg | Pseudolaric Acid B | 82508-31-4 | 1mg |
| GL2612-10mg | Pseudolaric Acid B | 82508-31-4 | 10mg |
| GN9104-10mg | Pseudouridine | 1445-07-4 | 10mg |
| GN9104-25mg | Pseudouridine | 1445-07-4 | 25mg |
| GN9104-50mg | Pseudouridine | 1445-07-4 | 50mg |
| GN9104-100mg | Pseudouridine | 1445-07-4 | 100mg |
| GL7387-1mg | Pseurotin A | 58523-30-1 | 1mg |
| GL7387-5mg | Pseurotin A | 58523-30-1 | 5mg |
| GL7731-1mg | Pseurotin D | 77409-68-8 | 1mg |
| GL7731-5mg | Pseurotin D | 77409-68-8 | 5mg |
| GA7357-1mg | Psicofuranine | 1874-54-0 | 1mg |
| GA7357-5mg | Psicofuranine | 1874-54-0 | 5mg |
| GL6155-10mg | Psoralen | 66-97-7 | 10mg |
| GL6155-25mg | Psoralen | 66-97-7 | 25mg |
| GL6155-100mg | Psoralen | 66-97-7 | 100mg |
| GL6760-5mg | PTACH | 848354-66-5 | 5mg |
| GL6760-25mg | PTACH | 848354-66-5 | 25mg |
| GP6169-250mg | Pterostilbene | 537-42-8 | 250mg |
| GP6169-1g | Pterostilbene | 537-42-8 | 1g |
| GC0175-25mg | Puerarin | 3681-99-0 | 25mg |
| GC2572-5g | Pullulan | 9057-02-7 | 5g |
| GC2572-10g | Pullulan | 9057-02-7 | 10g |
| GC2572-25g | Pullulan | 9057-02-7 | 25g |
| GC6579-10g | Pullulan, technical | 9057-02-7 | 10g |
| GC6579-25g | Pullulan, technical | 9057-02-7 | 25g |
| GL4211-1mg | Punicalagin | 65995-63-3 | 1mg |
| GL4211-10mg | Punicalagin | 65995-63-3 | 10mg |
| GK3203-1g | Purine | 120-73-0 | 1g |
| GA1940-10mg | Puromycin dihydrochloride | 58-58-2 | 10mg |
| GA1940-25mg | Puromycin dihydrochloride | 58-58-2 | 25mg |
| GA1940-100mg | Puromycin dihydrochloride | 58-58-2 | 100mg |
| GA1940-250mg | Puromycin dihydrochloride | 58-58-2 | 250mg |
| GA1940-500mg | Puromycin dihydrochloride | 58-58-2 | 500mg |
| GT4917-5g | Purpurin (C.I. 58205) | 81-54-9 | 5g |
| GT4917-25g | Purpurin (C.I. 58205) | 81-54-9 | 25g |
| GW8852-5mg | Purpuromycin | 53969-01-0 | 5mg |
| GW8852-25mg | Purpuromycin | 53969-01-0 | 25mg |
| GK0611-1mg | Purvalanol A | 212844-53-6 | 1mg |
| GK0611-5mg | Purvalanol A | 212844-53-6 | 5mg |
| GK0611-25mg | Purvalanol A | 212844-53-6 | 25mg |
| GK1731-1mg | Purvalanol B | 212844-54-7 | 1mg |
| GK1731-5mg | Purvalanol B | 212844-54-7 | 5mg |
| GK1731-10mg | Purvalanol B | 212844-54-7 | 10mg |
| GP9873-1g | Putrescine dihydrochloride | 333-93-7 | 1g |
| GP9873-10g | Putrescine dihydrochloride | 333-93-7 | 10g |
| GP9873-25g | Putrescine dihydrochloride | 333-93-7 | 25g |
| GP9873-100g | Putrescine dihydrochloride | 333-93-7 | 100g |
| GW4130-1mg | PX-12 | 141400-58-0 | 1mg |
| GW4130-5mg | PX-12 | 141400-58-0 | 5mg |
| GW4130-25mg | PX-12 | 141400-58-0 | 25mg |
| GW3775-5mg | Pyraclonil | 158353-15-2 | 5mg |
| GW3775-10mg | Pyraclonil | 158353-15-2 | 10mg |
| GW5777-10mg | Pyraflufen-ethyl | 129630-19-9 | 10mg |
| GW5777-25mg | Pyraflufen-ethyl | 129630-19-9 | 25mg |
| GL6921-250ug | Pyranonigrin A | 773855-65-5 | 250ug |
| GL6921-1mg | Pyranonigrin A | 773855-65-5 | 1mg |
| GA1140-10g | Pyrazinecarboxamide | 98-96-4 | 10g |
| GA1140-25g | Pyrazinecarboxamide | 98-96-4 | 25g |
| GA1140-100g | Pyrazinecarboxamide | 98-96-4 | 100g |
| GA3511-1g | Pyrazinecarboxamide, BP, Ph. Eur., USP grade | 98-96-4 | 1g |
| GK1764-100g | Pyrazole | 288-13-1 | 100g |
| GK6516-1g | Pyrene | 129-00-0 | 1g |
| GA1524-500ug | Pyrenophorol | 22248-41-5 | 500ug |
| GA1524-1mg | Pyrenophorol | 22248-41-5 | 1mg |
| GW6153-100mg | Pyribenzoxim | 168088-61-7 | 100mg |
| GW6153-500mg | Pyribenzoxim | 168088-61-7 | 500mg |
| GW9371-100mg | Pyributicarb | 88678-67-5 | 100mg |
| GW9371-250mg | Pyributicarb | 88678-67-5 | 250mg |
| GW9819-25mg | Pyridafol | 40020-01-7 | 25mg |
| GW9819-100mg | Pyridafol | 40020-01-7 | 100mg |
| GW7960-25mg | Pyridalyl | 179101-81-6 | 25mg |
| GK4192-100ml | Pyridine | 110-86-1 | 100ml |
| GK4192-250ml | Pyridine | 110-86-1 | 250ml |
| GK4192-500ml | Pyridine | 110-86-1 | 500ml |
| GK4192-1l | Pyridine | 110-86-1 | 1l |
| GK4798-25g | Pyridine hydrobromide perbromide | 39416-48-3 | 25g |
| GK4798-100g | Pyridine hydrobromide perbromide | 39416-48-3 | 100g |
| GE1467-25g | Pyridine-2-aldoxime methochloride | 51-15-0 | 25g |
| GS6659-500ml | Pyridine, GlenBiol™, suitable for molecular biology | 110-86-1 | 500ml |
| GS6659-2500ml | Pyridine, GlenBiol™, suitable for molecular biology | 110-86-1 | 2500ml |
| GS8780-2500ml | Pyridine, GlenBiol™, suitable for molecular biology with molecular sieve | 110-86-1 | 2500ml |
| GS9957-100ml | Pyridine, GlenDry™, anhydrous over molecular sieve | 110-86-1 | 100ml |
| GS9957-500ml | Pyridine, GlenDry™, anhydrous over molecular sieve | 110-86-1 | 500ml |
| GS9957-1l | Pyridine, GlenDry™, anhydrous over molecular sieve | 110-86-1 | 1l |
| GS9957-2500ml | Pyridine, GlenDry™, anhydrous over molecular sieve | 110-86-1 | 2500ml |
| GS2076-500ml | Pyridine, GlenPure™, analytical grade | 110-86-1 | 500ml |
| GS2076-1l | Pyridine, GlenPure™, analytical grade | 110-86-1 | 1l |
| GS2076-2500ml | Pyridine, GlenPure™, analytical grade | 110-86-1 | 2500ml |
| GK7546-25g | Pyridinium p-toluenesulfonate | 24057-28-1 | 25g |
| GK7546-100g | Pyridinium p-toluenesulfonate | 24057-28-1 | 100g |
| GK7546-250g | Pyridinium p-toluenesulfonate | 24057-28-1 | 250g |
| GK7546-500g | Pyridinium p-toluenesulfonate | 24057-28-1 | 500g |
| GW5019-1mg | Pyridomycin | 18791-21-4 | 1mg |
| GP7135-1g | Pyridostigmine bromide | 101-26-8 | 1g |
| GP7135-5g | Pyridostigmine bromide | 101-26-8 | 5g |
| GP7135-25g | Pyridostigmine bromide | 101-26-8 | 25g |
| GW4288-5g | Pyridoxal 5''-phosphate monohydrate | 41468-25-1 | 5g |
| GW4288-25g | Pyridoxal 5''-phosphate monohydrate | 41468-25-1 | 25g |
| GV5416-5g | Pyridoxal hydrochloride | 65-22-5 | 5g |
| GV5416-10g | Pyridoxal hydrochloride | 65-22-5 | 10g |
| GV5416-25g | Pyridoxal hydrochloride | 65-22-5 | 25g |
| GV5416-100g | Pyridoxal hydrochloride | 65-22-5 | 100g |
| GV7807-1g | Pyridoxal-5'-phosphate hydrate | 853645-22-4 | 1g |
| GV7807-5g | Pyridoxal-5'-phosphate hydrate | 853645-22-4 | 5g |
| GV7807-25g | Pyridoxal-5'-phosphate hydrate | 853645-22-4 | 25g |
| GV7807-100g | Pyridoxal-5'-phosphate hydrate | 853645-22-4 | 100g |
| GP8560-1g | Pyridoxamine dihydrochloride | 524-36-7 | 1g |
| GL1150-250ug | Pyridoxatin | 135529-30-5 | 250ug |
| GL1150-1mg | Pyridoxatin | 135529-30-5 | 1mg |
| GE2109-1g | Pyridoxine hydrochloride, 98% | 58-56-0 | 1g |
| GE7948-25g | Pyridoxine hydrochloride, EP, USP grade | 58-56-0 | 25g |
| GE7948-100g | Pyridoxine hydrochloride, EP, USP grade | 58-56-0 | 100g |
| GE7948-250g | Pyridoxine hydrochloride, EP, USP grade | 58-56-0 | 250g |
| GE7948-500g | Pyridoxine hydrochloride, EP, USP grade | 58-56-0 | 500g |
| GE7948-1kg | Pyridoxine hydrochloride, EP, USP grade | 58-56-0 | 1kg |
| GL7612-250ug | Pyripyropene A | 147444-03-9 | 250ug |
| GL7612-1mg | Pyripyropene A | 147444-03-9 | 1mg |
| GW3092-100mg | Pyrithiobac | 123342-93-8 | 100mg |
| GW3092-250mg | Pyrithiobac | 123342-93-8 | 250mg |
| GT7600-5g | Pyrocatechol Violet | 115-41-3 | 5g |
| GT7600-25g | Pyrocatechol Violet | 115-41-3 | 25g |
| GE8401-25g | Pyrogallol | 87-66-1 | 25g |
| GE8401-100g | Pyrogallol | 87-66-1 | 100g |
| GE8401-250g | Pyrogallol | 87-66-1 | 250g |
| GE8401-500g | Pyrogallol | 87-66-1 | 500g |
| GT7202-1g | Pyrogallol Red | 32638-88-3 | 1g |
| GT7202-5g | Pyrogallol Red | 32638-88-3 | 5g |
| GT7202-10g | Pyrogallol Red | 32638-88-3 | 10g |
| GA4930-250mg | Pyronaridine tetraphosphate | 76748-86-2 | 250mg |
| GT6834-1g | Pyronin Y (C.I. 45005) | 92-32-0 | 1g |
| GT6834-5g | Pyronin Y (C.I. 45005) | 92-32-0 | 5g |
| GT6834-10g | Pyronin Y (C.I. 45005) | 92-32-0 | 10g |
| GL6798-1mg | Pyrrolcarbonyltaloside | 912539-02-7 | 1mg |
| GL6798-5mg | Pyrrolcarbonyltaloside | 912539-02-7 | 5mg |
| GK9750-25g | Pyrrole | 109-97-7 | 25g |
| GK9750-100g | Pyrrole | 109-97-7 | 100g |
| GK9750-250g | Pyrrole | 109-97-7 | 250g |
| GK9750-500g | Pyrrole | 109-97-7 | 500g |
| GK4804-1g | Pyrrole-2-carboxylic acid | 634-97-9 | 1g |
| GK4804-5g | Pyrrole-2-carboxylic acid | 634-97-9 | 5g |
| GZ6634-25KU | Pyruvate Kinase | 9001-59-6 | 25KU |
| GZ4747-100U | Pyruvate Oxidase | 9001-96-1 | 100U |
| GK4217-25g | Pyruvic acid | 127-17-3 | 25g |
| GW9955-100mg | PyTC2 | 3224-36-0 | 100mg |
| GW9955-1g | PyTC2 | 3224-36-0 | 1g |
| GL5302-1mg | Q-VD-Oph | 1135695-98-5 (anhydrous) | 1mg |
| GK2336-1mg | Q-VD-OPh hydrate | 1135695-98-5 | 1mg |
| GK2336-5mg | Q-VD-OPh hydrate | 1135695-98-5 | 5mg |
| GW8990-1mg | Q-VE-OPh (Negative Control for Q-VD-OPh) | 1mg | |
| GC2615-25mg | Quercetin 3-a-L-rhamnoside | 522-12-3 | 25mg |
| GC9523-5mg | Quercetin 3-b-D-galactoside | 482-36-0 | 5mg |
| GC9523-25mg | Quercetin 3-b-D-galactoside | 482-36-0 | 25mg |
| GC9169-10mg | Quercetin 3-b-D-glucoside | 21637-25-2 | 10mg |
| GC9169-50mg | Quercetin 3-b-D-glucoside | 21637-25-2 | 50mg |
| GC3343-1mg | Quercetin 3-D-glucuronide | 22688-79-5 | 1mg |
| GL8454-1mg | Quercetin 3-O-alpha-L-arabinopyranoside | 22255-13-6 | 1mg |
| GL8454-5mg | Quercetin 3-O-alpha-L-arabinopyranoside | 22255-13-6 | 5mg |
| GP1387-25g | Quercetin dihydrate | 6151-25-3 | 25g |
| GP1387-100g | Quercetin dihydrate | 6151-25-3 | 100g |
| GP1387-250g | Quercetin dihydrate | 6151-25-3 | 250g |
| GP1387-500g | Quercetin dihydrate | 6151-25-3 | 500g |
| GT8084-1mg | Quercetin-3-D-xyloside | 549-32-6 | 1mg |
| GP9232-10g | Quercetin, anhydrous | 117-39-5 | 10g |
| GP9232-25g | Quercetin, anhydrous | 117-39-5 | 25g |
| GP9232-100g | Quercetin, anhydrous | 117-39-5 | 100g |
| GP9577-500mg | Quetiapine fumarate | 111974-72-2 | 500mg |
| GP9577-5g | Quetiapine fumarate | 111974-72-2 | 5g |
| GP9577-25g | Quetiapine fumarate | 111974-72-2 | 25g |
| GW1871-10mg | Quinacrine mustard dihydrochloride | 4213-45-0 | 10mg |
| GW1871-25mg | Quinacrine mustard dihydrochloride | 4213-45-0 | 25mg |
| GW1871-100mg | Quinacrine mustard dihydrochloride | 4213-45-0 | 100mg |
| GK8424-25g | Quinaldic acid | 93-10-7 | 25g |
| GT7977-5g | Quinaldine Red | 117-92-0 | 5g |
| GT7977-25g | Quinaldine Red | 117-92-0 | 25g |
| GE1634-5g | Quinidine | 56-54-2 | 5g |
| GE1634-25g | Quinidine | 56-54-2 | 25g |
| GA8217-25g | Quinine hydrochloride dihydrate | 6119-47-7 | 25g |
| GA8217-100g | Quinine hydrochloride dihydrate | 6119-47-7 | 100g |
| GE0921-5g | Quinine sulfate hydrate | 6119-70-6 | 5g |
| GE0921-25g | Quinine sulfate hydrate | 6119-70-6 | 25g |
| GE0921-50g | Quinine sulfate hydrate | 6119-70-6 | 50g |
| GE0921-100g | Quinine sulfate hydrate | 6119-70-6 | 100g |
| GE0921-250g | Quinine sulfate hydrate | 6119-70-6 | 250g |
| GE6508-5g | Quinine, anhydrous | 130-95-0 | 5g |
| GE6508-10g | Quinine, anhydrous | 130-95-0 | 10g |
| GE6508-25g | Quinine, anhydrous | 130-95-0 | 25g |
| GL5418-1mg | Quinolactacin A | 386211-68-3 / 386211-69-4 | 1mg |
| GL5418-5mg | Quinolactacin A | 386211-68-3 / 386211-69-4 | 5mg |
| GX5932-25g | Quinoline | 91-22-5 | 25g |
| GX5932-100g | Quinoline | 91-22-5 | 100g |
| GT7040-25g | Quinoline Yellow (C.I. 47000) | 8003-22-3 | 25g |
| GT7040-100g | Quinoline Yellow (C.I. 47000) | 8003-22-3 | 100g |
| GT7040-250g | Quinoline Yellow (C.I. 47000) | 8003-22-3 | 250g |
| GL4704-25g | Quinoline Yellow (mono- and disulfonic acids) (C.I. 47005) | 8004-92-0 | 25g |
| GL4704-100g | Quinoline Yellow (mono- and disulfonic acids) (C.I. 47005) | 8004-92-0 | 100g |
| GK9557-10g | Quinoline-8-sulfonyl chloride | 18704-37-5 | 10g |
| GK9557-25g | Quinoline-8-sulfonyl chloride | 18704-37-5 | 25g |
| GA8422-1mg | Quinomycin A | 512-64-1 | 1mg |
| GA8422-5mg | Quinomycin A | 512-64-1 | 5mg |
| GK3472-1g | Quinuclidine | 100-76-5 | 1g |
| GK3472-5g | Quinuclidine | 100-76-5 | 5g |
| GW1499-1mg | Quisinostat | 875320-29-9 | 1mg |
| GW1499-5mg | Quisinostat | 875320-29-9 | 5mg |
| GW1499-10mg | Quisinostat | 875320-29-9 | 10mg |
| GW8608-100mg | Quizalofop-p | 94051-08-8 | 100mg |
| GW8608-1g | Quizalofop-p | 94051-08-8 | 1g |
| GW2178-1mg | Quizartinib | 950769-58-1 | 1mg |
| GW2178-5mg | Quizartinib | 950769-58-1 | 5mg |
| GW2178-10mg | Quizartinib | 950769-58-1 | 10mg |
| GK7084-5g | R-(-)-1,2-Propanediol | 4254-14-2 | 5g |
| GK5164-1g | R-(-)-1,3-Butanediol | 6290-03-5 | 1g |
| GW3313-100mg | R-3-Hydroxyisobutyric acid sodium salt | 1228078-57-6 | 100mg |
| GW6084-100mg | R-BAIBA | 2140-95-6 | 100mg |
| GW6084-500mg | R-BAIBA | 2140-95-6 | 500mg |
| GW6986-1mg | R406 | 841290-80-0 | 1mg |
| GW6986-5mg | R406 | 841290-80-0 | 5mg |
| GW6986-10mg | R406 | 841290-80-0 | 10mg |
| GW4897-1mg | R428 | 1037624-75-1 | 1mg |
| GW4897-5mg | R428 | 1037624-75-1 | 5mg |
| GW4897-10mg | R428 | 1037624-75-1 | 10mg |
| GW0002-1mg | R788 disodium salt | 1025687-58-4 | 1mg |
| GW0002-5mg | R788 disodium salt | 1025687-58-4 | 5mg |
| GW0002-10mg | R788 disodium salt | 1025687-58-4 | 10mg |
| GC7253-1mg | rac etodolac acyl-b-D-glucuronide | 79541-43-8 | 1mg |
| GC7253-2mg | rac etodolac acyl-b-D-glucuronide | 79541-43-8 | 2mg |
| GC7253-5mg | rac etodolac acyl-b-D-glucuronide | 79541-43-8 | 5mg |
| GC7253-10mg | rac etodolac acyl-b-D-glucuronide | 79541-43-8 | 10mg |
| GK4790-5g | Rac-2,2''-bis(diphenylphosphino)-1,1''-binaphthyl | 98327-87-8 | 5g |
| GK4790-25g | Rac-2,2''-bis(diphenylphosphino)-1,1''-binaphthyl | 98327-87-8 | 25g |
| GA5957-1mg | Radicicol | 12772-57-5 | 1mg |
| GA5957-5mg | Radicicol | 12772-57-5 | 5mg |
| GP7762-1g | Rafoxanide | 22662-39-1 | 1g |
| GC0911-1mg | Raloxifene 6,4''-bis-b-D-glucuronide | 182507-20-6 | 1mg |
| GC0911-2mg | Raloxifene 6,4''-bis-b-D-glucuronide | 182507-20-6 | 2mg |
| GC0911-5mg | Raloxifene 6,4''-bis-b-D-glucuronide | 182507-20-6 | 5mg |
| GC0911-10mg | Raloxifene 6,4''-bis-b-D-glucuronide | 182507-20-6 | 10mg |
| GP9444-500mg | Raloxifene hydrochloride | 82640-04-8 | 500mg |
| GP9444-1g | Raloxifene hydrochloride | 82640-04-8 | 1g |
| GC8389-1mg | Raloxifene-4''-D-glucuronide lithium salt | 182507-22-8 | 1mg |
| GC8389-2mg | Raloxifene-4''-D-glucuronide lithium salt | 182507-22-8 | 2mg |
| GC8389-5mg | Raloxifene-4''-D-glucuronide lithium salt | 182507-22-8 | 5mg |
| GC8389-10mg | Raloxifene-4''-D-glucuronide lithium salt | 182507-22-8 | 10mg |
| GC1964-1mg | Raloxifene-6-D-glucuronide lithium salt | 174264-50-7 | 1mg |
| GC1964-2mg | Raloxifene-6-D-glucuronide lithium salt | 174264-50-7 | 2mg |
| GC1964-5mg | Raloxifene-6-D-glucuronide lithium salt | 174264-50-7 | 5mg |
| GC1964-10mg | Raloxifene-6-D-glucuronide lithium salt | 174264-50-7 | 10mg |
| GP5721-25mg | Raltegravir potassium salt | 871038-72-1 | 25mg |
| GC5462-1mg | Raltegravir-d4 | 1mg | |
| GC5462-2mg | Raltegravir-d4 | 2mg | |
| GC5462-5mg | Raltegravir-d4 | 5mg | |
| GP4045-100mg | Ramipril | 87333-19-5 | 100mg |
| GP4045-500mg | Ramipril | 87333-19-5 | 500mg |
| GP4580-5g | Ranitidine hydrochloride | 66357-59-3 | 5g |
| GA7417-5mg | Rapamycin | 53123-88-9 | 5mg |
| GA7417-25mg | Rapamycin | 53123-88-9 | 25mg |
| GA7417-50mg | Rapamycin | 53123-88-9 | 50mg |
| GA7417-100mg | Rapamycin | 53123-88-9 | 100mg |
| GE7112-1l | Rapid decalcifier solution for histology | 1l | |
| GE7112-2500ml | Rapid decalcifier solution for histology | 2500ml | |
| GW6507-1mg | Raptinal | 1176-09-6 | 1mg |
| GW6507-5mg | Raptinal | 1176-09-6 | 5mg |
| GW6507-25mg | Raptinal | 1176-09-6 | 25mg |
| GP5365-250mg | Rasagiline | 136236-51-6 | 250mg |
| GW6554-500ug | Rasfonin | 303156-68-5 | 500ug |
| GY7168-25g | Raspberry Ketone | 5471-51-2 | 25g |
| GY7168-100g | Raspberry Ketone | 5471-51-2 | 100g |
| GT6783-5g | Reactive Green 5 | 12225-74-0 | 5g |
| GT6783-25g | Reactive Green 5 | 12225-74-0 | 25g |
| GP6330-1g | Rebamipide hydrate | 90098-04-7 | 1g |
| GP6330-5g | Rebamipide hydrate | 90098-04-7 | 5g |
| GY7743-5g | Rebaudioside A | 58543-16-1 | 5g |
| GY7743-25g | Rebaudioside A | 58543-16-1 | 25g |
| GY7743-50g | Rebaudioside A | 58543-16-1 | 50g |
| GA2054-250ug | Rebeccamycin solid | 93908-02-2 | 250ug |
| GA2054-1mg | Rebeccamycin solid | 93908-02-2 | 1mg |
| GM1906-25mg | Reboxetine mesylate | 98769-84-7 | 25mg |
| GM1906-100mg | Reboxetine mesylate | 98769-84-7 | 100mg |
| GW3119-500mg | Red Arabinan | 500mg | |
| GW3119-1g | Red Arabinan | 1g | |
| GW6562-1mg | Red C2-dichlorotriazine | 1mg | |
| GW6562-5mg | Red C2-dichlorotriazine | 5mg | |
| GW6473-1g | Red Starch | 1g | |
| GW6473-5g | Red Starch | 5g | |
| GA7036-1mg | Reductiomycin | 68748-55-0 | 1mg |
| GA7036-5mg | Reductiomycin | 68748-55-0 | 5mg |
| GP6787-25mg | Regorafenib | 755037-03-7 | 25mg |
| GP6787-100mg | Regorafenib | 755037-03-7 | 100mg |
| GW2614-1mg | Regorafenib | 835621-08-4 | 1mg |
| GW2614-5mg | Regorafenib | 835621-08-4 | 5mg |
| GP6787-250mg | Regorafenib | 755037-03-7 | 250mg |
| GW2614-10mg | Regorafenib | 835621-08-4 | 10mg |
| GK8738-25g | Reinecke salt | 13573-16-5 | 25g |
| GK8738-100g | Reinecke salt | 13573-16-5 | 100g |
| GT9632-5g | Remazol Brilliant Blue R (C.I. 61200) | 2580-78-1 | 5g |
| GT9632-25g | Remazol Brilliant Blue R (C.I. 61200) | 2580-78-1 | 25g |
| GP1071-1mg | Remdesivir | 1809249-37-3 | 1mg |
| GP1071-5mg | Remdesivir | 1809249-37-3 | 5mg |
| GP1071-25mg | Remdesivir | 1809249-37-3 | 25mg |
| GC7445-1mg | Remdesivir-d5 | 1mg | |
| GC7445-2mg | Remdesivir-d5 | 2mg | |
| GW6687-1mg | Remisporine B | 571194-06-4 | 1mg |
| GW6687-2500ug | Remisporine B | 571194-06-4 | 2500ug |
| GP2014-50mg | Repaglinide | 135062-02-1 | 50mg |
| GP2014-250mg | Repaglinide | 135062-02-1 | 250mg |
| GC0888-1mg | Repaglinide acyl-β-D-glucuronide | 1309112-13-7 | 1mg |
| GC0888-2mg | Repaglinide acyl-β-D-glucuronide | 1309112-13-7 | 2mg |
| GC0888-5mg | Repaglinide acyl-β-D-glucuronide | 1309112-13-7 | 5mg |
| GC0888-10mg | Repaglinide acyl-β-D-glucuronide | 1309112-13-7 | 10mg |
| GP5198-1g | Resazurin sodium salt | 62758-13-8 | 1g |
| GP5198-5g | Resazurin sodium salt | 62758-13-8 | 5g |
| GK0296-5mg | Resiquimod | 144875-48-9 | 5mg |
| GK0296-25mg | Resiquimod | 144875-48-9 | 25mg |
| GA9580-1mg | Resistomycin | 20004-62-0 | 1mg |
| GK4611-25g | Resorcinol | 108-46-3 | 25g |
| GK4611-100g | Resorcinol | 108-46-3 | 100g |
| GK4611-250g | Resorcinol | 108-46-3 | 250g |
| GK4611-500g | Resorcinol | 108-46-3 | 500g |
| GK4611-1kg | Resorcinol | 108-46-3 | 1kg |
| GC1738-1mg | Resorufin 7-O-methyl ether | 5725-89-3 | 1mg |
| GC1738-10mg | Resorufin 7-O-methyl ether | 5725-89-3 | 10mg |
| GC1738-100mg | Resorufin 7-O-methyl ether | 5725-89-3 | 100mg |
| GL6291-1mg | Resorufin ethyl ether | 5725-91-7 | 1mg |
| GL6291-10mg | Resorufin ethyl ether | 5725-91-7 | 10mg |
| GL6291-100mg | Resorufin ethyl ether | 5725-91-7 | 100mg |
| GC3390-1mg | Resorufin β-D-cellotrioside | 1mg | |
| GC3390-2mg | Resorufin β-D-cellotrioside | 2mg | |
| GC3390-5mg | Resorufin β-D-cellotrioside | 5mg | |
| GC7466-10mg | Resorufin β-D-lactoside | 10mg | |
| GC7466-25mg | Resorufin β-D-lactoside | 25mg | |
| GC7466-50mg | Resorufin β-D-lactoside | 50mg | |
| GC9633-1mg | Resorufin β-D-xylobioside | 1mg | |
| GC9633-2mg | Resorufin β-D-xylobioside | 2mg | |
| GC9633-5mg | Resorufin β-D-xylobioside | 5mg | |
| GC9633-10mg | Resorufin β-D-xylobioside | 10mg | |
| GW9246-1mg | Resorufin-isobutyrate | 251292-24-7 | 1mg |
| GW9246-5mg | Resorufin-isobutyrate | 251292-24-7 | 5mg |
| GW9246-25mg | Resorufin-isobutyrate | 251292-24-7 | 25mg |
| GY6194-1mg | Resveratrol 4''-Glucoside | 38963-95-0 | 1mg |
| GY6194-2mg | Resveratrol 4''-Glucoside | 38963-95-0 | 2mg |
| GY6194-5mg | Resveratrol 4''-Glucoside | 38963-95-0 | 5mg |
| GY6194-10mg | Resveratrol 4''-Glucoside | 38963-95-0 | 10mg |
| GY6194-25mg | Resveratrol 4''-Glucoside | 38963-95-0 | 25mg |
| GP2549-100mg | Resveratrol, natural | 501-36-0 | 100mg |
| GP2549-250mg | Resveratrol, natural | 501-36-0 | 250mg |
| GP2549-1g | Resveratrol, natural | 501-36-0 | 1g |
| GP5884-100mg | Resveratrol, synthetic | 501-36-0 | 100mg |
| GP5884-250mg | Resveratrol, synthetic | 501-36-0 | 250mg |
| GP5884-1g | Resveratrol, synthetic | 501-36-0 | 1g |
| GA4340-25mg | Retapamulin | 224452-66-8 | 25mg |
| GA5775-250ug | Reticulol | 26246-41-3 | 250ug |
| GA5775-1mg | Reticulol | 26246-41-3 | 1mg |
| GP5601-10mg | Retigabine | 150812-12-7 | 10mg |
| GP5601-25mg | Retigabine | 150812-12-7 | 25mg |
| GP5601-100mg | Retigabine | 150812-12-7 | 100mg |
| GP0386-100mg | Retigabine dihydrochloride | 150812-13-8 | 100mg |
| GP0386-250mg | Retigabine dihydrochloride | 150812-13-8 | 250mg |
| GP4026-100mg | Retinoic acid | 302-79-4 | 100mg |
| GP4026-500mg | Retinoic acid | 302-79-4 | 500mg |
| GP4026-1g | Retinoic acid | 302-79-4 | 1g |
| GP4026-5g | Retinoic acid | 302-79-4 | 5g |
| GP9313-5g | Retinyl palmitate | 79-81-2 | 5g |
| GP9313-25g | Retinyl palmitate | 79-81-2 | 25g |
| GP9313-100g | Retinyl palmitate | 79-81-2 | 100g |
| GZ8080-10KIU | Reverse Transcriptase, expressed in E. coli | 9068-38-6 | 10KIU |
| GZ8080-25KIU | Reverse Transcriptase, expressed in E. coli | 9068-38-6 | 25KIU |
| GL5363-1mg | Reversine | 656820-32-5 | 1mg |
| GW6146-2mg | RF-22c [5-Lipoxygenase Inhibitor] | 1680206-61-4 | 2mg |
| GW1302-1mg | RG7422 | 1032754-93-0 | 1mg |
| GW1302-5mg | RG7422 | 1032754-93-0 | 5mg |
| GW1302-10mg | RG7422 | 1032754-93-0 | 10mg |
| GP8350-50mg | Rhein | 478-43-3 | 50mg |
| GP8350-100mg | Rhein | 478-43-3 | 100mg |
| GC8882-1mg | Rhein acyl-b-D-glucuronide | 190605-03-9 | 1mg |
| GC8882-2mg | Rhein acyl-b-D-glucuronide | 190605-03-9 | 2mg |
| GC8882-5mg | Rhein acyl-b-D-glucuronide | 190605-03-9 | 5mg |
| GX3338-25x25mm | Rhenium Foil 0.025mm, 99.97% | 7440-15-5 | 25x25mm |
| GX3338-50x50mm | Rhenium Foil 0.025mm, 99.97% | 7440-15-5 | 50x50mm |
| GX9025-25x25mm | Rhenium Foil 0.05mm, 99.97% | 7440-15-5 | 25x25mm |
| GX2782-25x25mm | Rhenium Foil 0.125mm, 99.97% | 7440-15-5 | 25x25mm |
| GX3201-25x25mm | Rhenium Foil 0.1mm, 99.9+% | 7440-15-5 | 25x25mm |
| GX3201-50x50mm | Rhenium Foil 0.1mm, 99.9+% | 7440-15-5 | 50x50mm |
| GX5737-25x25mm | Rhenium Foil 0.25mm, 99.97% | 7440-15-5 | 25x25mm |
| GX5462-5g | Rhenium Powder max. 10 micron, 99.99% | 7440-15-5 | 5g |
| GX5462-25g | Rhenium Powder max. 10 micron, 99.99% | 7440-15-5 | 25g |
| GX8357-5g | Rhenium Powder max. 10 micron, 99+% | 7440-15-5 | 5g |
| GX8357-25g | Rhenium Powder max. 10 micron, 99+% | 7440-15-5 | 25g |
| GX7039-1m | Rhenium Wire 0.25 mm diameter, 99.99% | 7440-15-5 | 1m |
| GW4199-1mg | Rhod 2-AM | 145037-81-6 | 1mg |
| GT9154-250mg | Rhodamine 110 chloride | 13558-31-1 | 250mg |
| GT9154-1g | Rhodamine 110 chloride | 13558-31-1 | 1g |
| GT5023-5g | Rhodamine 6G (C.I. 45160) | 989-38-8 | 5g |
| GT5023-25g | Rhodamine 6G (C.I. 45160) | 989-38-8 | 25g |
| GT5023-100g | Rhodamine 6G (C.I. 45160) | 989-38-8 | 100g |
| GW3542-50mg | Rhodamine 6G bis(aminoethyl)amine amide bis (trifluoroacetate) | 1173097-37-4 | 50mg |
| GW3542-250mg | Rhodamine 6G bis(aminoethyl)amine amide bis (trifluoroacetate) | 1173097-37-4 | 250mg |
| GW0572-50mg | Rhodamine 6G bis(oxyethylamino)ethane amide bis (trifluoroacetate) | 1173097-69-2 | 50mg |
| GW0572-250mg | Rhodamine 6G bis(oxyethylamino)ethane amide bis (trifluoroacetate) | 1173097-69-2 | 250mg |
| GW3583-10mg | Rhodamine 6G ethylenediamine amide bis (trifluoroacetate) | 591742-74-4 | 10mg |
| GW3583-50mg | Rhodamine 6G ethylenediamine amide bis (trifluoroacetate) | 591742-74-4 | 50mg |
| GW3287-50mg | Rhodamine 6G p-diaminoxylene amide bis (trifluoroacetate) | 591742-78-8 | 50mg |
| GW3287-250mg | Rhodamine 6G p-diaminoxylene amide bis (trifluoroacetate) | 591742-78-8 | 250mg |
| GT7006-25g | Rhodamine B (C.I. 45170) | 81-88-9 | 25g |
| GT7006-100g | Rhodamine B (C.I. 45170) | 81-88-9 | 100g |
| GT7006-250g | Rhodamine B (C.I. 45170) | 81-88-9 | 250g |
| GT5360-10g | Rhodamine B base | 509-34-2 | 10g |
| GT5360-25g | Rhodamine B base | 509-34-2 | 25g |
| GT5360-50g | Rhodamine B base | 509-34-2 | 50g |
| GT5360-100g | Rhodamine B base | 509-34-2 | 100g |
| GW0490-20mg | Rhodamine B octadecyl ester perchlorate | 142179-00-8 | 20mg |
| GW0490-100mg | Rhodamine B octadecyl ester perchlorate | 142179-00-8 | 100mg |
| GT1789-100ml | Rhodamine B solution, 0.2% in isopropanol | 81-88-9 | 100ml |
| GT1789-500ml | Rhodamine B solution, 0.2% in isopropanol | 81-88-9 | 500ml |
| GX8669-5g | Rhodium 2-ethylhexanoate solution | 20845-92-5 | 5g |
| GX4044-1g | Rhodium acetate, 99.95% (metals basis) | 42204-14-8 | 1g |
| GX2960-1g | Rhodium nonanoate | 1g | |
| GX2960-5g | Rhodium nonanoate | 5g | |
| GX4664-5g | Rhodium on Activated Carbon 5% Rh/C (Heraeus-Type K-0312) | 7440-16-6 | 5g |
| GX8515-10cm | Rhodium Wire 0.125 mm diameter, 99.9% | 7440-16-6 | 10cm |
| GX8515-25cm | Rhodium Wire 0.125 mm diameter, 99.9% | 7440-16-6 | 25cm |
| GX8515-1m | Rhodium Wire 0.125 mm diameter, 99.9% | 7440-16-6 | 1m |
| GX9469-5cm | Rhodium Wire 0.25 mm diameter, 99.9% | 7440-16-6 | 5cm |
| GX9469-25cm | Rhodium Wire 0.25 mm diameter, 99.9% | 7440-16-6 | 25cm |
| GX9469-1m | Rhodium Wire 0.25 mm diameter, 99.9% | 7440-16-6 | 1m |
| GX1354-2cm | Rhodium Wire 0.5 mm diameter, 99.9% | 7440-16-6 | 2cm |
| GX1354-10cm | Rhodium Wire 0.5 mm diameter, 99.9% | 7440-16-6 | 10cm |
| GX1354-25cm | Rhodium Wire 0.5 mm diameter, 99.9% | 7440-16-6 | 25cm |
| GX2999-1g | Rhodium(III) 2,4-pentanedionate, 99.95% (metals basis) | 14284-92-5 | 1g |
| GX2999-5g | Rhodium(III) 2,4-pentanedionate, 99.95% (metals basis) | 14284-92-5 | 5g |
| GX8671-1g | Rhodium(III) bromide hydrate | 15608-29-4 | 1g |
| GX8671-5g | Rhodium(III) bromide hydrate | 15608-29-4 | 5g |
| GX2360-1g | Rhodium(III) chloride, 99.95% (metals basis) | 10049-07-7 | 1g |
| GX2360-5g | Rhodium(III) chloride, 99.95% (metals basis) | 10049-07-7 | 5g |
| GX1988-1g | Rhodium(III) iodide, 99.95% (metals basis) | 15492-38-3 | 1g |
| GX1988-5g | Rhodium(III) iodide, 99.95% (metals basis) | 15492-38-3 | 5g |
| GX1215-1g | Rhodium(III) nitrate hydrate, 99.95% (metals basis) | 13465-43-5 | 1g |
| GX1339-5g | Rhodium(III) nitrate solution | 10139-58-9 | 5g |
| GX2407-500mg | Rhodium(III) oxide hydrate, 99.95% (metals basis) | 39373-27-8 | 500mg |
| GX2407-1g | Rhodium(III) oxide hydrate, 99.95% (metals basis) | 39373-27-8 | 1g |
| GX8384-1g | Rhodium(III) sulfate solution | 10489-46-0 | 1g |
| GX8384-5g | Rhodium(III) sulfate solution | 10489-46-0 | 5g |
| GX8384-25g | Rhodium(III) sulfate solution | 10489-46-0 | 25g |
| GA5462-50mg | Ribavirin | 36791-04-5 | 50mg |
| GA5462-250mg | Ribavirin | 36791-04-5 | 250mg |
| GC5301-25g | Ribitol | 488-81-3 | 25g |
| GC5301-100g | Ribitol | 488-81-3 | 100g |
| GP6544-5g | Riboflavin-5''-phosphate monosodium salt hydrate | 130-40-5 | 5g |
| GP6544-25g | Riboflavin-5''-phosphate monosodium salt hydrate | 130-40-5 | 25g |
| GP6544-100g | Riboflavin-5''-phosphate monosodium salt hydrate | 130-40-5 | 100g |
| GP6544-250g | Riboflavin-5''-phosphate monosodium salt hydrate | 130-40-5 | 250g |
| GP0364-10g | Riboflavin-5''-phosphate monosodium salt hydrate, USP grade | 130-40-5 | 10g |
| GP0364-25g | Riboflavin-5''-phosphate monosodium salt hydrate, USP grade | 130-40-5 | 25g |
| GV3670-5g | Riboflavin-5''-phosphate sodium salt dihydrate | 6184-17-4 | 5g |
| GV3670-25g | Riboflavin-5''-phosphate sodium salt dihydrate | 6184-17-4 | 25g |
| GP0758-5g | Riboflavin, USP grade | 83-88-5 | 5g |
| GP0758-25g | Riboflavin, USP grade | 83-88-5 | 25g |
| GP0758-100g | Riboflavin, USP grade | 83-88-5 | 100g |
| GP0758-250g | Riboflavin, USP grade | 83-88-5 | 250g |
| GE6228-25mg | Ribonuclease A | 9001-99-4 | 25mg |
| GE6228-100mg | Ribonuclease A | 9001-99-4 | 100mg |
| GE6228-250mg | Ribonuclease A | 9001-99-4 | 250mg |
| GE6228-500mg | Ribonuclease A | 9001-99-4 | 500mg |
| GE6228-1g | Ribonuclease A | 9001-99-4 | 1g |
| GE9871-10mg | Ribonuclease A, DNase free | 9001-99-4 | 10mg |
| GE9871-50mg | Ribonuclease A, DNase free | 9001-99-4 | 50mg |
| GE9871-100mg | Ribonuclease A, DNase free | 9001-99-4 | 100mg |
| GE9871-250mg | Ribonuclease A, DNase free | 9001-99-4 | 250mg |
| GE9871-1g | Ribonuclease A, DNase free | 9001-99-4 | 1g |
| GZ5072-250U | Ribonuclease H, expressed in E. coli | 9050-76-4 | 250U |
| GZ5072-1KU | Ribonuclease H, expressed in E. coli | 9050-76-4 | 1KU |
| GA7826-250mg | Ribostamycin sulfate salt | 53797-35-6 | 250mg |
| GA7826-1g | Ribostamycin sulfate salt | 53797-35-6 | 1g |
| GA1484-100mg | Rifabutin | 72559-06-9 | 100mg |
| GA1484-250mg | Rifabutin | 72559-06-9 | 250mg |
| GA1484-500mg | Rifabutin | 72559-06-9 | 500mg |
| GA1484-1g | Rifabutin | 72559-06-9 | 1g |
| GA1853-250mg | Rifampicin | 13292-46-1 | 250mg |
| GA1853-500mg | Rifampicin | 13292-46-1 | 500mg |
| GA1853-1g | Rifampicin | 13292-46-1 | 1g |
| GA1853-5g | Rifampicin | 13292-46-1 | 5g |
| GA1853-25g | Rifampicin | 13292-46-1 | 25g |
| GW6082-1g | Rifamycin AF | 13292-22-3 | 1g |
| GW6082-5g | Rifamycin AF | 13292-22-3 | 5g |
| GW6082-10g | Rifamycin AF | 13292-22-3 | 10g |
| GW7973-10mg | Rifamycin AF-API | 13292-40-5 | 10mg |
| GW7973-50mg | Rifamycin AF-API | 13292-40-5 | 50mg |
| GW0296-10mg | Rifamycin AF-DA | 16783-97-4 | 10mg |
| GW0296-50mg | Rifamycin AF-DA | 16783-97-4 | 50mg |
| GW6754-10mg | Rifamycin AF-EPTAPI | 41971-22-6 | 10mg |
| GW6754-50mg | Rifamycin AF-EPTAPI | 41971-22-6 | 50mg |
| GW8320-10mg | Rifamycin AF-K28259 | 51707-27-8 | 10mg |
| GW8320-50mg | Rifamycin AF-K28259 | 51707-27-8 | 50mg |
| GW9425-10mg | Rifamycin AF-K43033 | 57369-86-5 | 10mg |
| GW9425-50mg | Rifamycin AF-K43033 | 57369-86-5 | 50mg |
| GW2343-10mg | Rifamycin AF-K55517 | 51707-26-7 | 10mg |
| GW2343-50mg | Rifamycin AF-K55517 | 51707-26-7 | 50mg |
| GW9490-10mg | Rifamycin AF-K56035 | 39976-84-6 | 10mg |
| GW9490-50mg | Rifamycin AF-K56035 | 39976-84-6 | 50mg |
| GW2592-10mg | Rifamycin AF-K91725 | 13292-38-1 | 10mg |
| GW2592-50mg | Rifamycin AF-K91725 | 13292-38-1 | 50mg |
| GW1836-10mg | Rifamycin AF-O13 | 35225-13-9 | 10mg |
| GW1836-50mg | Rifamycin AF-O13 | 35225-13-9 | 50mg |
| GW7049-10mg | Rifamycin AF-pNFI | 39976-91-5 | 10mg |
| GW7049-50mg | Rifamycin AF-pNFI | 39976-91-5 | 50mg |
| GW3947-10mg | Rifamycin AG | 38128-51-7 | 10mg |
| GW3947-50mg | Rifamycin AG | 38128-51-7 | 50mg |
| GW6382-10mg | Rifamycin AMI-DA | 17096-02-5 | 10mg |
| GW6382-50mg | Rifamycin AMI-DA | 17096-02-5 | 50mg |
| GW9549-10mg | Rifamycin AMP-DA | 16783-99-6 | 10mg |
| GW9549-50mg | Rifamycin AMP-DA | 16783-99-6 | 50mg |
| GW6123-10mg | Rifamycin M14 | 2750-76-7 | 10mg |
| GW6123-50mg | Rifamycin M14 | 2750-76-7 | 50mg |
| GW2191-50mg | Rifamycin O | 14487-05-9 | 50mg |
| GW2191-500mg | Rifamycin O | 14487-05-9 | 500mg |
| GW2550-10mg | Rifamycin PR-14 | 21240-38-0 | 10mg |
| GW2550-50mg | Rifamycin PR-14 | 21240-38-0 | 50mg |
| GW4779-10mg | Rifamycin PR-3 | 38601-77-3 | 10mg |
| GW4779-50mg | Rifamycin PR-3 | 38601-77-3 | 50mg |
| GW6310-10mg | Rifamycin S, 8-Methyl- | 42898-13-5 | 10mg |
| GW6310-50mg | Rifamycin S, 8-Methyl- | 42898-13-5 | 50mg |
| GA6855-1g | Rifamycin sodium salt | 14897-39-3 | 1g |
| GA6855-5g | Rifamycin sodium salt | 14897-39-3 | 5g |
| GA1653-25mg | Rifapentine | 61379-65-5 | 25mg |
| GA1653-100mg | Rifapentine | 61379-65-5 | 100mg |
| GA1653-1g | Rifapentine | 61379-65-5 | 1g |
| GA5161-250mg | Rifaximin | 80621-81-4 | 250mg |
| GA5161-1g | Rifaximin | 80621-81-4 | 1g |
| GA5161-5g | Rifaximin | 80621-81-4 | 5g |
| GP3165-10mg | Rilpivirine | 500287-72-9 | 10mg |
| GP3165-50mg | Rilpivirine | 500287-72-9 | 50mg |
| GP5490-1g | Riluzole | 1744-22-5 | 1g |
| GX9120-10mg | Rimonabant base | 168273-06-1 | 10mg |
| GX9120-25mg | Rimonabant base | 168273-06-1 | 25mg |
| GP8358-25mg | Rimonabant hydrochloride | 158681-13-1 | 25mg |
| GP8358-100mg | Rimonabant hydrochloride | 158681-13-1 | 100mg |
| GE9498-5g | Rink Amide MBHA resin (100 - 200 mesh); loading 0.30 mmol/g | 431041-83-7 | 5g |
| GE2290-5g | Rink Amide MBHA resin (100 - 200 mesh); loading 0.54 mmol/g | 431041-83-7 | 5g |
| GP4398-50mg | Risedronate sodium salt | 115436-72-1 | 50mg |
| GP4398-250mg | Risedronate sodium salt | 115436-72-1 | 250mg |
| GP4398-1g | Risedronate sodium salt | 115436-72-1 | 1g |
| GP4047-25mg | Risperidone | 106266-06-2 | 25mg |
| GP4047-100mg | Risperidone | 106266-06-2 | 100mg |
| GP4047-250mg | Risperidone | 106266-06-2 | 250mg |
| GP4047-500mg | Risperidone | 106266-06-2 | 500mg |
| GP3714-50mg | Ritonavir | 155213-67-5 | 50mg |
| GP3714-100mg | Ritonavir | 155213-67-5 | 100mg |
| GP3714-250mg | Ritonavir | 155213-67-5 | 250mg |
| GP9456-5mg | Rivaroxaban | 366789-02-8 | 5mg |
| GP9456-25mg | Rivaroxaban | 366789-02-8 | 25mg |
| GP6624-250mg | Rivastigmine tartrate | 129101-54-8 | 250mg |
| GP0042-10mg | Rizatriptan benzoate | 145202-66-0 | 10mg |
| GP0042-50mg | Rizatriptan benzoate | 145202-66-0 | 50mg |
| GP0042-100mg | Rizatriptan benzoate | 145202-66-0 | 100mg |
| GP0042-250mg | Rizatriptan benzoate | 145202-66-0 | 250mg |
| GK0415-1mg | Ro 31-0432 | 145333-02-4 | 1mg |
| GK0415-5mg | Ro 31-0432 | 145333-02-4 | 5mg |
| GK6422-50mg | Ro 61-8048 | 199666-03-0 | 50mg |
| GL7789-1mg | RO-3306 | 872573-93-8 | 1mg |
| GL7789-5mg | RO-3306 | 872573-93-8 | 5mg |
| GL7789-25mg | RO-3306 | 872573-93-8 | 25mg |
| GW6503-1mg | RO495 | 1258296-60-4 | 1mg |
| GW6503-5mg | RO495 | 1258296-60-4 | 5mg |
| GW6503-10mg | RO495 | 1258296-60-4 | 10mg |
| GL2680-1mg | Robotnikinin | 1132653-79-2 | 1mg |
| GP0159-10mg | Rofecoxib | 162011-90-7 | 10mg |
| GP0159-50mg | Rofecoxib | 162011-90-7 | 50mg |
| GP0159-100mg | Rofecoxib | 162011-90-7 | 100mg |
| GP1881-25mg | Rolipram | 61413-54-5 | 25mg |
| GP1881-100mg | Rolipram | 61413-54-5 | 100mg |
| GA8206-1g | Ronidazole | 7681-76-7 | 1g |
| GP7813-100mg | Ropinirole hydrochloride | 91374-20-8 | 100mg |
| GP7588-50mg | Ropivacaine | 84057-95-4 | 50mg |
| GP7588-250mg | Ropivacaine | 84057-95-4 | 250mg |
| GP9339-50mg | Ropivacaine hydrochloride monohydrate | 132112-35-7 | 50mg |
| GP9339-250mg | Ropivacaine hydrochloride monohydrate | 132112-35-7 | 250mg |
| GL0492-500ug | Roquefortine C | 58735-64-1 | 500ug |
| GL0492-1mg | Roquefortine C | 58735-64-1 | 1mg |
| GW2731-250ug | Roridin E | 16891-85-3 | 250ug |
| GW2731-1mg | Roridin E | 16891-85-3 | 1mg |
| GY0309-100mg | Rosarin | 84954-93-8 | 100mg |
| GY9748-100mg | Rosavin | 84954-92-7 | 100mg |
| GP3424-1mg | Roscovitine | 186692-46-6 | 1mg |
| GP3424-5mg | Roscovitine | 186692-46-6 | 5mg |
| GP3424-50mg | Roscovitine | 186692-46-6 | 50mg |
| GT2559-5g | Rose Bengal (C.I. 45440) | 632-69-9 | 5g |
| GT2559-25g | Rose Bengal (C.I. 45440) | 632-69-9 | 25g |
| GT2559-100g | Rose Bengal (C.I. 45440) | 632-69-9 | 100g |
| GT2559-250g | Rose Bengal (C.I. 45440) | 632-69-9 | 250g |
| GT2559-500g | Rose Bengal (C.I. 45440) | 632-69-9 | 500g |
| GT3871-5g | Rose Bengal (C.I. 45440); 90% | 632-69-9 | 5g |
| GT3871-10g | Rose Bengal (C.I. 45440); 90% | 632-69-9 | 10g |
| GP6434-250mg | Rosiglitazone | 122320-73-4 | 250mg |
| GP6434-1g | Rosiglitazone | 122320-73-4 | 1g |
| GP8393-25mg | Rosiglitazone maleate | 155141-29-0 | 25mg |
| GP8393-100mg | Rosiglitazone maleate | 155141-29-0 | 100mg |
| GP8393-1g | Rosiglitazone maleate | 155141-29-0 | 1g |
| GP8768-1g | Rosmarinic acid | 20283-92-5 | 1g |
| GP1717-250mg | Rosuvastatin calcium salt | 147098-20-2 | 250mg |
| GP9530-1g | Rosuvastatin sodium salt | 147098-18-8 | 1g |
| GE1875-1g | Rotenone | 83-79-4 | 1g |
| GE1875-5g | Rotenone | 83-79-4 | 5g |
| GL6758-10mg | Rottlerin | 82-08-6 | 10mg |
| GL6758-50mg | Rottlerin | 82-08-6 | 50mg |
| GA4818-1g | Roxithromycin | 80214-83-1 | 1g |
| GA4818-5g | Roxithromycin | 80214-83-1 | 5g |
| GA4818-10g | Roxithromycin | 80214-83-1 | 10g |
| GW9954-1mg | Ru(bpy)2(mcbpy-O-Su-ester)(PF6)2 | 136724-73-7 | 1mg |
| GW9954-5mg | Ru(bpy)2(mcbpy-O-Su-ester)(PF6)2 | 136724-73-7 | 5mg |
| GP6560-5mg | Rubescensin | 28957-04-2 | 5mg |
| GP6560-25mg | Rubescensin | 28957-04-2 | 25mg |
| GX7425-25g | Rubidium acetate, 99.9% | 563-67-7 | 25g |
| GX7425-100g | Rubidium acetate, 99.9% | 563-67-7 | 100g |
| GX8750-25g | Rubidium bromide, 98+% | 7789-39-1 | 25g |
| GX8750-100g | Rubidium bromide, 98+% | 7789-39-1 | 100g |
| GX5160-10g | Rubidium bromide, 99+% | 7789-39-1 | 10g |
| GX5160-50g | Rubidium bromide, 99+% | 7789-39-1 | 50g |
| GX7047-25g | Rubidium carbonate, 99.9% | 584-09-8 | 25g |
| GX7047-100g | Rubidium carbonate, 99.9% | 584-09-8 | 100g |
| GX0269-25g | Rubidium carbonate, 99% | 584-09-8 | 25g |
| GX0269-100g | Rubidium carbonate, 99% | 584-09-8 | 100g |
| GX1174-10g | Rubidium chloride, 98+% | 7791-11-9 | 10g |
| GX1174-25g | Rubidium chloride, 98+% | 7791-11-9 | 25g |
| GX1174-100g | Rubidium chloride, 98+% | 7791-11-9 | 100g |
| GX5493-10g | Rubidium chloride, 99.9% | 7791-11-9 | 10g |
| GX5493-25g | Rubidium chloride, 99.9% | 7791-11-9 | 25g |
| GX5493-100g | Rubidium chloride, 99.9% | 7791-11-9 | 100g |
| GX7198-10g | Rubidium chloride, 99% | 7791-11-9 | 10g |
| GX7198-25g | Rubidium chloride, 99% | 7791-11-9 | 25g |
| GX7198-100g | Rubidium chloride, 99% | 7791-11-9 | 100g |
| GX3341-25g | Rubidium fluoride, 99.9% | 13446-74-7 | 25g |
| GX6890-25g | Rubidium iodide, 99.9% | 7790-29-6 | 25g |
| GX6890-100g | Rubidium iodide, 99.9% | 7790-29-6 | 100g |
| GX3418-1g | Rubidium Metal, ampouled, 99.5+% | 7440-17-7 | 1g |
| GX3418-5g | Rubidium Metal, ampouled, 99.5+% | 7440-17-7 | 5g |
| GX4681-25g | Rubidium molybdate, 99.5% | 13718-22-4 | 25g |
| GX1346-10g | Rubidium nitrate, 99.8% | 13126-12-0 | 10g |
| GX1346-25g | Rubidium nitrate, 99.8% | 13126-12-0 | 25g |
| GX1346-100g | Rubidium nitrate, 99.8% | 13126-12-0 | 100g |
| GX3398-1g | Rubidium nitrate, 99.99% | 13126-12-0 | 1g |
| GX3398-10g | Rubidium nitrate, 99.99% | 13126-12-0 | 10g |
| GX1977-25g | Rubidium sulfate, 99.9% | 7488-54-2 | 25g |
| GX1977-100g | Rubidium sulfate, 99.9% | 7488-54-2 | 100g |
| GX5881-10g | Rubidium tungstate, 99.9% | 13597-52-9 | 10g |
| GX5881-25g | Rubidium tungstate, 99.9% | 13597-52-9 | 25g |
| GL3432-1mg | Rubiginone A2 | 130548-09-3 | 1mg |
| GL3432-5mg | Rubiginone A2 | 130548-09-3 | 5mg |
| GL3716-1mg | Rubiginone D2 | 274913-71-2 | 1mg |
| GL3716-5mg | Rubiginone D2 | 274913-71-2 | 5mg |
| GL0712-250ug | Rubratoxin A | 22467-31-8 | 250ug |
| GL0712-500ug | Rubratoxin A | 22467-31-8 | 500ug |
| GL3024-1mg | Rubrofusarin | 3567-00-8 | 1mg |
| GL3024-5mg | Rubrofusarin | 3567-00-8 | 5mg |
| GY4727-10mg | Rubusoside | 64849-39-4 | 10mg |
| GA5877-250ug | Rugulosin | 23537-16-8 | 250ug |
| GA5877-1mg | Rugulosin | 23537-16-8 | 1mg |
| GA5877-5mg | Rugulosin | 23537-16-8 | 5mg |
| GX5847-1g | Ruthenium acetate, 99.95% (metals basis) | 55466-76-7 | 1g |
| GX5847-5g | Ruthenium acetate, 99.95% (metals basis) | 55466-76-7 | 5g |
| GX2743-2g | Ruthenium black | 7440-18-8 | 2g |
| GX6813-1g | Ruthenium nitrosyl chloride hydrate, 99.95% (metals basis) | 18902-42-6 | 1g |
| GX6813-5g | Ruthenium nitrosyl chloride hydrate, 99.95% (metals basis) | 18902-42-6 | 5g |
| GX8174-10g | Ruthenium nitrosylnitrate solution | 34513-98-9 | 10g |
| GX8174-25g | Ruthenium nitrosylnitrate solution | 34513-98-9 | 25g |
| GX2247-2g | Ruthenium Powder max. 60 micron, 99.9% | 7440-18-8 | 2g |
| GX2247-10g | Ruthenium Powder max. 60 micron, 99.9% | 7440-18-8 | 10g |
| GX6247-5g | Ruthenium Red | 11103-72-3 | 5g |
| GK8583-2g | Ruthenium Red, 85% | 11103-72-3 | 2g |
| GK8583-5g | Ruthenium Red, 85% | 11103-72-3 | 5g |
| GX5246-5g | Ruthenium Sponge, 99.95% | 7440-18-8 | 5g |
| GX5246-25g | Ruthenium Sponge, 99.95% | 7440-18-8 | 25g |
| GX7049-1g | Ruthenium(III) 2,4-pentanedionate | 14284-93-6 | 1g |
| GX7049-5g | Ruthenium(III) 2,4-pentanedionate | 14284-93-6 | 5g |
| GX1927-1g | Ruthenium(III) chloride hydrate, 99.95+% (metals basis) | 14898-67-0 | 1g |
| GX1927-5g | Ruthenium(III) chloride hydrate, 99.95+% (metals basis) | 14898-67-0 | 5g |
| GX1927-25g | Ruthenium(III) chloride hydrate, 99.95+% (metals basis) | 14898-67-0 | 25g |
| GX9865-5g | Ruthenium(III) chloride solution | 10049-08-8 | 5g |
| GX9865-25g | Ruthenium(III) chloride solution | 10049-08-8 | 25g |
| GX6148-2g | Ruthenium(III) chloride, anhydrous, 99.95% (metals basis) | 10049-08-8 | 2g |
| GX6148-10g | Ruthenium(III) chloride, anhydrous, 99.95% (metals basis) | 10049-08-8 | 10g |
| GX3574-2g | Ruthenium(IV) oxide, 99.9% | 12036-10-1 | 2g |
| GX3574-10g | Ruthenium(IV) oxide, 99.9% | 12036-10-1 | 10g |
| GX3574-25g | Ruthenium(IV) oxide, 99.9% | 12036-10-1 | 25g |
| GX3068-2g | Ruthenium(IV) oxide, 99.9+% | 12036-10-1 | 2g |
| GX3068-10g | Ruthenium(IV) oxide, 99.9+% | 12036-10-1 | 10g |
| GX6302-2g | Ruthenium(IV) oxide, hydrate | 32740-79-7 | 2g |
| GX6302-10g | Ruthenium(IV) oxide, hydrate | 32740-79-7 | 10g |
| GC4239-25g | Rutin hydrate | 207671-50-9 | 25g |
| GC4239-100g | Rutin hydrate | 207671-50-9 | 100g |
| GC4239-250g | Rutin hydrate | 207671-50-9 | 250g |
| GW5081-5g | Rutin trihydrate | 250249-75-3 | 5g |
| GW5081-100g | Rutin trihydrate | 250249-75-3 | 100g |
| GC1207-10mg | Rutinose | 90-74-4 | 10mg |
| GC1207-25mg | Rutinose | 90-74-4 | 25mg |
| GW4048-5mg | Ruxolitinib . phosphate salt | 1092939-17-7 | 5mg |
| GW4048-25mg | Ruxolitinib . phosphate salt | 1092939-17-7 | 25mg |
| GW4048-100mg | Ruxolitinib . phosphate salt | 1092939-17-7 | 100mg |
| GW2265-5mg | Ruxolitinib (free base) | 941678-49-5 | 5mg |
| GW2265-25mg | Ruxolitinib (free base) | 941678-49-5 | 25mg |
| GW2265-100mg | Ruxolitinib (free base) | 941678-49-5 | 100mg |
| GW0575-1mg | RWJ-67657 | 215303-72-3 | 1mg |
| GW0575-5mg | RWJ-67657 | 215303-72-3 | 5mg |
| GW0575-10mg | RWJ-67657 | 215303-72-3 | 10mg |
| GK9991-100g | S-(-)-Nicotine | 54-11-5 | 100g |
| GK9991-250g | S-(-)-Nicotine | 54-11-5 | 250g |
| GK9991-500g | S-(-)-Nicotine | 54-11-5 | 500g |
| GK9991-1kg | S-(-)-Nicotine | 54-11-5 | 1kg |
| GW4235-10mg | S-(5'')-Adenosyl-3-thiopropylamine | 53186-57-5 | 10mg |
| GW4235-50mg | S-(5'')-Adenosyl-3-thiopropylamine | 53186-57-5 | 50mg |
| GW5830-100mg | S-3-Hydroxyisobutyric acid sodium salt | 1893416-17-5 | 100mg |
| GW7274-1mg | S-99 | 1124381-69-6 | 1mg |
| GW7274-5mg | S-99 | 1124381-69-6 | 5mg |
| GW7274-10mg | S-99 | 1124381-69-6 | 10mg |
| GN7982-5g | S-Adenosyl-L-methionine disulfate tosylate | 97540-22-2 | 5g |
| GW4050-100mg | S-BAIBA | 4249-19-8 | 100mg |
| GW4050-500mg | S-BAIBA | 4249-19-8 | 500mg |
| GM1431-25g | S-Benzyl-L-cysteine | 3054-01-1 | 25g |
| GW1881-1mg | S-Gboxin iodide | 2101317-21-7 | 1mg |
| GW1881-5mg | S-Gboxin iodide | 2101317-21-7 | 5mg |
| GL7950-5mg | S-Nitrosoglutathione | 57564-91-7 | 5mg |
| GL7950-25mg | S-Nitrosoglutathione | 57564-91-7 | 25mg |
| GK1940-5mg | S(+)-Niguldipine hydrochloride | 113165-32-5 | 5mg |
| GK8256-5g | S(+)-Propylene glycol | 4254-15-3 | 5g |
| GK8256-25g | S(+)-Propylene glycol | 4254-15-3 | 25g |
| GL4789-1mg | S14161 | 883046-50-2 | 1mg |
| GL4789-5mg | S14161 | 883046-50-2 | 5mg |
| GW2276-1mg | S49076 hydrochloride | 1265965-19-2 | 1mg |
| GW2276-5mg | S49076 hydrochloride | 1265965-19-2 | 5mg |
| GW2276-10mg | S49076 hydrochloride | 1265965-19-2 | 10mg |
| GW5897-1mg | S6K-18 | 1265789-88-5 | 1mg |
| GW5897-5mg | S6K-18 | 1265789-88-5 | 5mg |
| GW5897-10mg | S6K-18 | 1265789-88-5 | 10mg |
| GX2610-25g | Saccharin | 81-07-2 | 25g |
| GK7761-100g | Saccharin sodium salt | 128-44-9 | 100g |
| GK7761-250g | Saccharin sodium salt | 128-44-9 | 250g |
| GK7761-500g | Saccharin sodium salt | 128-44-9 | 500g |
| GK7761-1kg | Saccharin sodium salt | 128-44-9 | 1kg |
| GC5203-1mg | Safinamide metabolite NW-1689 acyl-β-D-glucuronide | 1mg | |
| GC5203-2mg | Safinamide metabolite NW-1689 acyl-β-D-glucuronide | 2mg | |
| GC5203-5mg | Safinamide metabolite NW-1689 acyl-β-D-glucuronide | 5mg | |
| GC5203-10mg | Safinamide metabolite NW-1689 acyl-β-D-glucuronide | 10mg | |
| GT4125-10g | Safranine O (C.I. 50240) | 477-73-6 | 10g |
| GT4125-25g | Safranine O (C.I. 50240) | 477-73-6 | 25g |
| GT4125-50g | Safranine O (C.I. 50240) | 477-73-6 | 50g |
| GT4125-100g | Safranine O (C.I. 50240) | 477-73-6 | 100g |
| GE3658-500ml | Safranine O solution | 477-73-6 | 500ml |
| GL4333-1mg | SAG | 912545-86-9 | 1mg |
| GL4333-5mg | SAG | 912545-86-9 | 5mg |
| GL4333-25mg | SAG | 912545-86-9 | 25mg |
| GL3544-1mg | SAG Analog (highly active) | 1401532-77-1 | 1mg |
| GL4668-1mg | SAG Analog (LowTox) | 1401532-78-2 | 1mg |
| GL1175-1mg | SAG dihydrochloride | 364590-63-6 | 1mg |
| GL1175-5mg | SAG dihydrochloride | 364590-63-6 | 5mg |
| GL1175-25mg | SAG dihydrochloride | 364590-63-6 | 25mg |
| GP7722-100mg | Salbutamol | 18559-94-9 | 100mg |
| GP7722-250mg | Salbutamol | 18559-94-9 | 250mg |
| GP7722-1g | Salbutamol | 18559-94-9 | 1g |
| GP1722-1g | Salbutamol hemisulphate salt | 51022-70-9 | 1g |
| GP1722-5g | Salbutamol hemisulphate salt | 51022-70-9 | 5g |
| GP1722-10g | Salbutamol hemisulphate salt | 51022-70-9 | 10g |
| GP1722-25g | Salbutamol hemisulphate salt | 51022-70-9 | 25g |
| GK4505-25g | Salicylaldehyde | 90-02-8 | 25g |
| GK4505-100g | Salicylaldehyde | 90-02-8 | 100g |
| GK4505-500g | Salicylaldehyde | 90-02-8 | 500g |
| GK5951-5g | Salicylaldehyde azine | 959-36-4 | 5g |
| GK5951-25g | Salicylaldehyde azine | 959-36-4 | 25g |
| GK2541-25g | Salicylaldoxime | 94-67-7 | 25g |
| GK2541-100g | Salicylaldoxime | 94-67-7 | 100g |
| GK2541-500g | Salicylaldoxime | 94-67-7 | 500g |
| GX9131-5g | Salicylhydroxamic acid | 89-73-6 | 5g |
| GX9131-25g | Salicylhydroxamic acid | 89-73-6 | 25g |
| GC2468-1mg | Salicylic acid acyl-β-D-glucuronide | 29315-53-5 | 1mg |
| GC2468-2mg | Salicylic acid acyl-β-D-glucuronide | 29315-53-5 | 2mg |
| GC2468-5mg | Salicylic acid acyl-β-D-glucuronide | 29315-53-5 | 5mg |
| GC2468-10mg | Salicylic acid acyl-β-D-glucuronide | 29315-53-5 | 10mg |
| GC2631-5mg | Salicylic acid phenolic D-glucuronide | 7695-70-7 | 5mg |
| GC2631-10mg | Salicylic acid phenolic D-glucuronide | 7695-70-7 | 10mg |
| GC2631-25mg | Salicylic acid phenolic D-glucuronide | 7695-70-7 | 25mg |
| GC2631-50mg | Salicylic acid phenolic D-glucuronide | 7695-70-7 | 50mg |
| GK2915-100g | Salicylic acid, 99% | 69-72-7 | 100g |
| GK2915-250g | Salicylic acid, 99% | 69-72-7 | 250g |
| GK2915-500g | Salicylic acid, 99% | 69-72-7 | 500g |
| GK2915-1kg | Salicylic acid, 99% | 69-72-7 | 1kg |
| GK2915-5kg | Salicylic acid, 99% | 69-72-7 | 5kg |
| GK1093-250g | Salicylic acid, BP, Ph. Eur grade | 69-72-7 | 250g |
| GK1093-1kg | Salicylic acid, BP, Ph. Eur grade | 69-72-7 | 1kg |
| GC0027-25mg | Salidroside | 10338-51-9 | 25mg |
| GC0027-100mg | Salidroside | 10338-51-9 | 100mg |
| GC0027-500mg | Salidroside | 10338-51-9 | 500mg |
| GA5900-5mg | Salinomycin | 53003-10-4 | 5mg |
| GA5900-10mg | Salinomycin | 53003-10-4 | 10mg |
| GA5900-25mg | Salinomycin | 53003-10-4 | 25mg |
| GA1100-10mg | Salinomycin sodium salt | 55721-31-8 | 10mg |
| GW2220-100ug | Salinosporamide A | 437742-34-2 | 100ug |
| GP0706-50mg | Salmeterol xinafoate | 94749-08-3 | 50mg |
| GP0706-250mg | Salmeterol xinafoate | 94749-08-3 | 250mg |
| GL4615-1g | Salsalate | 552-94-3 | 1g |
| GL4615-5g | Salsalate | 552-94-3 | 5g |
| GY9135-10mg | Salvianolic acid B | 121521-90-2 | 10mg |
| GY9135-25mg | Salvianolic acid B | 121521-90-2 | 25mg |
| GX9664-25g | Samarium acetate hydrate, 99.9% | 17829-86-6 | 25g |
| GX9664-100g | Samarium acetate hydrate, 99.9% | 17829-86-6 | 100g |
| GX1618-10g | Samarium acetate hydrate, 99.999% | 17829-86-6 | 10g |
| GX1618-50g | Samarium acetate hydrate, 99.999% | 17829-86-6 | 50g |
| GX0464-1g | Samarium boride, 99.9% | 12008-30-9 | 1g |
| GX0464-5g | Samarium boride, 99.9% | 12008-30-9 | 5g |
| GX0464-10g | Samarium boride, 99.9% | 12008-30-9 | 10g |
| GX2799-10g | Samarium carbonate hydrate, 99.9% | 38245-37-3 | 10g |
| GX2799-50g | Samarium carbonate hydrate, 99.9% | 38245-37-3 | 50g |
| GX6156-10g | Samarium carbonate hydrate, 99.999% | 38245-37-3 | 10g |
| GX6156-50g | Samarium carbonate hydrate, 99.999% | 38245-37-3 | 50g |
| GX7267-25g | Samarium Chips, 99.9% | 7440-19-9 | 25g |
| GX7267-100g | Samarium Chips, 99.9% | 7440-19-9 | 100g |
| GX7091-10g | Samarium chloride anhydrous, 99.9% | 10361-82-7 | 10g |
| GX7091-25g | Samarium chloride anhydrous, 99.9% | 10361-82-7 | 25g |
| GX3470-50g | Samarium chloride hydrate, 99.9% | 13465-55-9 | 50g |
| GX3470-250g | Samarium chloride hydrate, 99.9% | 13465-55-9 | 250g |
| GX1744-50g | Samarium chloride hydrate, 99.99% | 13465-55-9 | 50g |
| GX1744-250g | Samarium chloride hydrate, 99.99% | 13465-55-9 | 250g |
| GX5717-50g | Samarium chloride hydrate, 99.999% | 13465-55-9 | 50g |
| GX7951-25g | Samarium fluoride, 99.9% | 13765-24-7 | 25g |
| GX7951-100g | Samarium fluoride, 99.9% | 13765-24-7 | 100g |
| GX7004-25g | Samarium fluoride, 99.999% | 13765-24-7 | 25g |
| GX7004-100g | Samarium fluoride, 99.999% | 13765-24-7 | 100g |
| GX1790-25x25mm | Samarium Foil 0.127mm, 99.9% | 7440-19-9 | 25x25mm |
| GX1688-25x50mm | Samarium Foil 0.25mm, 99.9% | 7440-19-9 | 25x50mm |
| GX8775-25g | Samarium hydroxide, 99.999% | 20403-06-9 | 25g |
| GX8775-100g | Samarium hydroxide, 99.999% | 20403-06-9 | 100g |
| GX4456-25g | Samarium nitrate hydrate, 99.9% | 13759-83-6 | 25g |
| GX4456-100g | Samarium nitrate hydrate, 99.9% | 13759-83-6 | 100g |
| GX1901-100g | Samarium oxalate hydrate, 99.9% | 14175-03-2 | 100g |
| GX6229-25g | Samarium oxalate hydrate, 99.999% | 14175-03-2 | 25g |
| GX6229-100g | Samarium oxalate hydrate, 99.999% | 14175-03-2 | 100g |
| GX7450-25g | Samarium oxide-Nano Powder, 99.9% | 12060-58-1 | 25g |
| GX7148-25g | Samarium oxide, 99.9% | 12060-58-1 | 25g |
| GX7148-100g | Samarium oxide, 99.9% | 12060-58-1 | 100g |
| GX7148-500g | Samarium oxide, 99.9% | 12060-58-1 | 500g |
| GX9205-25g | Samarium oxide, 99.99% | 12060-58-1 | 25g |
| GX9205-100g | Samarium oxide, 99.99% | 12060-58-1 | 100g |
| GX9205-500g | Samarium oxide, 99.99% | 12060-58-1 | 500g |
| GX4190-25g | Samarium oxide, granules, 99.9% | 12060-58-1 | 25g |
| GX4190-100g | Samarium oxide, granules, 99.9% | 12060-58-1 | 100g |
| GX3328-10g | Samarium Pieces distilled, 99.99% | 7440-19-9 | 10g |
| GX3328-25g | Samarium Pieces distilled, 99.99% | 7440-19-9 | 25g |
| GX9543-25g | Samarium Pieces, 99.9% | 7440-19-9 | 25g |
| GX9543-100g | Samarium Pieces, 99.9% | 7440-19-9 | 100g |
| GX0211-10g | Samarium Powder, 99.9% | 7440-19-9 | 10g |
| GX0211-50g | Samarium Powder, 99.9% | 7440-19-9 | 50g |
| GX4164-25g | Samarium sulfate anhydrous, 99.9% | 13692-98-3 | 25g |
| GX3999-25g | Samarium sulfate hydrate, 99.9% | 13465-58-2 | 25g |
| GX3999-100g | Samarium sulfate hydrate, 99.9% | 13465-58-2 | 100g |
| GX0514-50g | Samarium(III) oxide Nanopowder, 99,9 % | 12060-58-1 | 50g |
| GX0514-100g | Samarium(III) oxide Nanopowder, 99,9 % | 12060-58-1 | 100g |
| GX0514-250g | Samarium(III) oxide Nanopowder, 99,9 % | 12060-58-1 | 250g |
| GW2862-250mg | Sancycline | 808-26-4 | 250mg |
| GW2862-1g | Sancycline | 808-26-4 | 1g |
| GX1450-250g | Sand, washed | 14808-60-7 | 250g |
| GX1450-1kg | Sand, washed | 14808-60-7 | 1kg |
| GX1450-5kg | Sand, washed | 14808-60-7 | 5kg |
| GX2216-1kg | Sand, washed, coarse, 0.6 - 1.2 mm | 14808-60-7 | 1kg |
| GX2216-5kg | Sand, washed, coarse, 0.6 - 1.2 mm | 14808-60-7 | 5kg |
| GL9271-25mg | Sanguinarine chloride hydrate | 5578-73-4 | 25mg |
| GL2589-1mg | SANT-2 | 329196-48-7 | 1mg |
| GL2589-5mg | SANT-2 | 329196-48-7 | 5mg |
| GC2179-10g | Saponin | 8047-15-2 | 10g |
| GC2179-25g | Saponin | 8047-15-2 | 25g |
| GC2179-100g | Saponin | 8047-15-2 | 100g |
| GC2179-250g | Saponin | 8047-15-2 | 250g |
| GC2179-500g | Saponin | 8047-15-2 | 500g |
| GL5222-500ug | Saquayamycin B1 | 99260-68-1 | 500ug |
| GL5222-1mg | Saquayamycin B1 | 99260-68-1 | 1mg |
| GL5222-5mg | Saquayamycin B1 | 99260-68-1 | 5mg |
| GP7183-50mg | Saquinavir mesylate | 149845-06-7 | 50mg |
| GP7183-250mg | Saquinavir mesylate | 149845-06-7 | 250mg |
| GP7183-1g | Saquinavir mesylate | 149845-06-7 | 1g |
| GW6888-1mg | SAR-020106 | 1184843-57-9 | 1mg |
| GW6888-5mg | SAR-020106 | 1184843-57-9 | 5mg |
| GW6888-10mg | SAR-020106 | 1184843-57-9 | 10mg |
| GW6041-1mg | SAR-131675 | 1092539-44-0 | 1mg |
| GW6041-5mg | SAR-131675 | 1092539-44-0 | 5mg |
| GW6041-10mg | SAR-131675 | 1092539-44-0 | 10mg |
| GL3294-2mg | Sarcophine | 55038-27-2 | 2mg |
| GL3294-10mg | Sarcophine | 55038-27-2 | 10mg |
| GM2992-100g | Sarcosine | 107-97-1 | 100g |
| GM2992-500g | Sarcosine | 107-97-1 | 500g |
| GZ5382-1KU | Sarcosine Oxidase | 9029-22-5 | 1KU |
| GL5788-1mg | Sauchinone | 177931-17-8 | 1mg |
| GL5788-5mg | Sauchinone | 177931-17-8 | 5mg |
| GK2422-1mg | SB 202190 | 152121-30-7 | 1mg |
| GK2422-5mg | SB 202190 | 152121-30-7 | 5mg |
| GK2422-25mg | SB 202190 | 152121-30-7 | 25mg |
| GK9716-1mg | SB 203580 | 152121-47-6 | 1mg |
| GK9716-5mg | SB 203580 | 152121-47-6 | 5mg |
| GK9716-25mg | SB 203580 | 152121-47-6 | 25mg |
| GL9739-1mg | SB 216763 | 280744-09-4 | 1mg |
| GL9739-5mg | SB 216763 | 280744-09-4 | 5mg |
| GL9739-25mg | SB 216763 | 280744-09-4 | 25mg |
| GL2098-1mg | SB 415286 | 264218-23-7 | 1mg |
| GL2098-5mg | SB 415286 | 264218-23-7 | 5mg |
| GL2098-25mg | SB 415286 | 264218-23-7 | 25mg |
| GL2219-5mg | SB 431542 hydrate | 301836-41-9 | 5mg |
| GW7595-1mg | SB-242235 | 193746-75-7 | 1mg |
| GW7595-5mg | SB-242235 | 193746-75-7 | 5mg |
| GW7595-10mg | SB-242235 | 193746-75-7 | 10mg |
| GL6242-5mg | SB-366791 | 472981-92-3 | 5mg |
| GL6242-25mg | SB-366791 | 472981-92-3 | 25mg |
| GL1664-5mg | SB-525334 | 356559-20-1 | 5mg |
| GW4213-1mg | SB590885 | 405554-55-4 | 1mg |
| GW4213-5mg | SB590885 | 405554-55-4 | 5mg |
| GW4213-10mg | SB590885 | 405554-55-4 | 10mg |
| GK8201-1mg | SBFI-AM | 129423-53-6 | 1mg |
| GK2799-50mg | SC-560 | 188817-13-2 | 50mg |
| GX1407-1g | Scandium acetate hydrate, 99.9% | 3804-23-7 | 1g |
| GX1407-5g | Scandium acetate hydrate, 99.9% | 3804-23-7 | 5g |
| GX4514-1g | Scandium acetate hydrate, 99.99+% | 3804-23-7 | 1g |
| GX4514-5g | Scandium acetate hydrate, 99.99+% | 3804-23-7 | 5g |
| GX1474-1g | Scandium carbonate, 99.999% | 5809-49-4 | 1g |
| GX1474-5g | Scandium carbonate, 99.999% | 5809-49-4 | 5g |
| GX5232-1g | Scandium chloride anhydrous, 99.9% | 10361-84-9 | 1g |
| GX5232-5g | Scandium chloride anhydrous, 99.9% | 10361-84-9 | 5g |
| GX2862-1g | Scandium chloride hydrate, 99.9% | 25813-71-2 | 1g |
| GX2862-5g | Scandium chloride hydrate, 99.9% | 25813-71-2 | 5g |
| GX8802-1g | Scandium chloride hydrate, 99.999% | 25813-71-2 | 1g |
| GX8802-5g | Scandium chloride hydrate, 99.999% | 25813-71-2 | 5g |
| GX3576-1g | Scandium fluoride, 99.9% | 13709-47-2 | 1g |
| GX3576-5g | Scandium fluoride, 99.9% | 13709-47-2 | 5g |
| GX6028-1g | Scandium fluoride, 99.99% | 13709-47-2 | 1g |
| GX6028-5g | Scandium fluoride, 99.99% | 13709-47-2 | 5g |
| GX9576-1g | Scandium oxide, 99.9% | 12060-08-1 | 1g |
| GX9576-5g | Scandium oxide, 99.9% | 12060-08-1 | 5g |
| GX9576-25g | Scandium oxide, 99.9% | 12060-08-1 | 25g |
| GX2472-1g | Scandium oxide, 99.99% | 12060-08-1 | 1g |
| GX2472-5g | Scandium oxide, 99.99% | 12060-08-1 | 5g |
| GX2472-25g | Scandium oxide, 99.99% | 12060-08-1 | 25g |
| GX8482-1g | Scandium oxide, 99.999% | 12060-08-1 | 1g |
| GX8482-5g | Scandium oxide, 99.999% | 12060-08-1 | 5g |
| GX6171-5g | Scandium oxide, 99.999%, ampouled | 12060-08-1 | 5g |
| GX6171-10g | Scandium oxide, 99.999%, ampouled | 12060-08-1 | 10g |
| GX2769-1g | Scandium Pieces, 99.9% | 7440-20-2 | 1g |
| GX2769-5g | Scandium Pieces, 99.9% | 7440-20-2 | 5g |
| GX0690-1g | Scandium Pieces, 99.99% | 7440-20-2 | 1g |
| GX0690-5g | Scandium Pieces, 99.99% | 7440-20-2 | 5g |
| GX3289-1g | Scandium Powder -100 mesh, 99.9% | 7440-20-2 | 1g |
| GX3289-5g | Scandium Powder -100 mesh, 99.9% | 7440-20-2 | 5g |
| GX2474-1g | Scandium sulfate pentahydrate, 99.99% | 15292-44-1 | 1g |
| GX2474-5g | Scandium sulfate pentahydrate, 99.99% | 15292-44-1 | 5g |
| GW5917-1mg | SCH900776 | 891494-63-6 | 1mg |
| GW5917-5mg | SCH900776 | 891494-63-6 | 5mg |
| GW5917-10mg | SCH900776 | 891494-63-6 | 10mg |
| GT3929-100ml | Schiff's reagent | - | 100ml |
| GT3929-500ml | Schiff's reagent | - | 500ml |
| GT3929-1l | Schiff's reagent | - | 1l |
| GP9899-10mg | Schisandrin B | 61281-37-6 | 10mg |
| GP0437-1g | Sclareol | 515-03-7 | 1g |
| GP0437-5g | Sclareol | 515-03-7 | 5g |
| GL9785-500ug | Sclerotiorin | 549-23-5 | 500ug |
| GL9785-1mg | Sclerotiorin | 549-23-5 | 1mg |
| GL9785-5mg | Sclerotiorin | 549-23-5 | 5mg |
| GP5098-100mg | Scopolamine | 51-34-3 | 100mg |
| GP5098-250mg | Scopolamine | 51-34-3 | 250mg |
| GP9811-1g | Scopolamine butylbromide | 149-64-4 | 1g |
| GP9811-5g | Scopolamine butylbromide | 149-64-4 | 5g |
| GP9811-10g | Scopolamine butylbromide | 149-64-4 | 10g |
| GP9811-25g | Scopolamine butylbromide | 149-64-4 | 25g |
| GE4184-1l | Scott's Tap Water Substitute Concentrate, 10X solution | 1l | |
| GE4184-2500ml | Scott's Tap Water Substitute Concentrate, 10X solution | 2500ml | |
| GC9987-10mg | Scutellarin | 27740-01-8 | 10mg |
| GC9987-25mg | Scutellarin | 27740-01-8 | 25mg |
| GW7617-1mg | SD-06 | 271576-80-8 | 1mg |
| GW7617-5mg | SD-06 | 271576-80-8 | 5mg |
| GW7617-10mg | SD-06 | 271576-80-8 | 10mg |
| GW8497-1mg | SD-169 | 1670-87-7 | 1mg |
| GW8497-5mg | SD-169 | 1670-87-7 | 5mg |
| GW8497-10mg | SD-169 | 1670-87-7 | 10mg |
| GK2260-25g | Sebacoyl chloride | 111-19-3 | 25g |
| GP9302-100mg | Secnidazole | 3366-95-8 | 100mg |
| GP9302-500mg | Secnidazole | 3366-95-8 | 500mg |
| GC3456-10mg | Secoisolariciresinol diglucoside | 148244-82-0 | 10mg |
| GD2712-100ml | Secondary alcohol ethoxylate (41); 70% solution in water | 84133-50-6 | 100ml |
| GW3677-1mg | Sekikaic acid | 607-11-4 | 1mg |
| GW6519-25mg | Selamectin | 220119-17-5 | 25mg |
| GW6519-100mg | Selamectin | 220119-17-5 | 100mg |
| GX1661-250g | Selenium Granules 2-4 mm, 99.99% | 7782-49-2 | 250g |
| GX1661-1kg | Selenium Granules 2-4 mm, 99.99% | 7782-49-2 | 1kg |
| GX5814-100g | Selenium Granules 2-4 mm, 99.999% | 7782-49-2 | 100g |
| GX5814-250g | Selenium Granules 2-4 mm, 99.999% | 7782-49-2 | 250g |
| GX5814-1kg | Selenium Granules 2-4 mm, 99.999% | 7782-49-2 | 1kg |
| GX9113-100g | Selenium oxide, 99.8% | 7446-08-4 | 100g |
| GX9113-500g | Selenium oxide, 99.8% | 7446-08-4 | 500g |
| GX6083-10g | Selenium oxide, 99.9% | 7446-08-4 | 10g |
| GX6083-25g | Selenium oxide, 99.9% | 7446-08-4 | 25g |
| GX6083-100g | Selenium oxide, 99.9% | 7446-08-4 | 100g |
| GX8476-10g | Selenium oxide, 99.999% | 7446-08-4 | 10g |
| GX8476-25g | Selenium oxide, 99.999% | 7446-08-4 | 25g |
| GX2812-50g | Selenium Powder -160 mesh, 99.99+% | 7782-49-2 | 50g |
| GX2064-100g | Selenium Powder -200 mesh, 99.8% | 7782-49-2 | 100g |
| GX2064-500g | Selenium Powder -200 mesh, 99.8% | 7782-49-2 | 500g |
| GX2064-1kg | Selenium Powder -200 mesh, 99.8% | 7782-49-2 | 1kg |
| GX7357-500g | Selenium Powder -325 mesh, 99.6% | 7782-49-2 | 500g |
| GX7822-100g | Selenium sulfide, 94+% | 7488-56-4 | 100g |
| GK1109-25g | Selenium sulfide, USP grade, micronised | 7488-56-4 | 25g |
| GK1109-100g | Selenium sulfide, USP grade, micronised | 7488-56-4 | 100g |
| GM6908-250mg | Seleno-L-cystine | 29621-88-3 | 250mg |
| GM6908-1g | Seleno-L-cystine | 29621-88-3 | 1g |
| GX7134-50g | Selenous acid | 7783-00-8 | 50g |
| GX1905-50g | Selenous acid, 99.999% | 7783-00-8 | 50g |
| GC2229-1mg | Selexipag metabolite MRE-269 acyl-β-D-glucuronide | 1mg | |
| GC2229-2mg | Selexipag metabolite MRE-269 acyl-β-D-glucuronide | 2mg | |
| GC2229-5mg | Selexipag metabolite MRE-269 acyl-β-D-glucuronide | 5mg | |
| GC2229-10mg | Selexipag metabolite MRE-269 acyl-β-D-glucuronide | 10mg | |
| GW7307-1mg | Selonsertib | 1448428-04-3 | 1mg |
| GW7307-5mg | Selonsertib | 1448428-04-3 | 5mg |
| GW7307-10mg | Selonsertib | 1448428-04-3 | 10mg |
| GW0805-1mg | Selonsertib Hydrochloride | 1448428-05-4 | 1mg |
| GW0805-5mg | Selonsertib Hydrochloride | 1448428-05-4 | 5mg |
| GW0805-10mg | Selonsertib Hydrochloride | 1448428-05-4 | 10mg |
| GW9004-1mg | Selumetinib | 606143-52-6 | 1mg |
| GW9004-5mg | Selumetinib | 606143-52-6 | 5mg |
| GW9004-10mg | Selumetinib | 606143-52-6 | 10mg |
| GW8695-1mg | Semaglutide | 910463-68-2 | 1mg |
| GW8695-5mg | Semaglutide | 910463-68-2 | 5mg |
| GW8695-25mg | Semaglutide | 910463-68-2 | 25mg |
| GW1848-1mg | Semaglutide . AcOH | 910463-68-2 | 1mg |
| GW1848-5mg | Semaglutide . AcOH | 910463-68-2 | 5mg |
| GW1848-25mg | Semaglutide . AcOH | 910463-68-2 | 25mg |
| GC5003-5mg | Sennoside A | 81-27-6 | 5mg |
| GC5003-25mg | Sennoside A | 81-27-6 | 25mg |
| GC2469-20mg | Sennoside B | 128-57-4 | 20mg |
| GL5651-5mg | Sericic acid | 55306-03-1 | 5mg |
| GL5651-25mg | Sericic acid | 55306-03-1 | 25mg |
| GW5344-1mg | Seriniquinone | 22200-69-7 | 1mg |
| GW5344-5mg | Seriniquinone | 22200-69-7 | 5mg |
| GK3987-5g | Serinol | 534-03-2 | 5g |
| GK3987-25g | Serinol | 534-03-2 | 25g |
| GP4050-100mg | Serotonin hydrochloride | 153-98-0 | 100mg |
| GP4050-1g | Serotonin hydrochloride | 153-98-0 | 1g |
| GL0410-5mg | Serratol | 67814-27-1 | 5mg |
| GP9522-10mg | Sertindole | 106516-24-9 | 10mg |
| GC2168-1mg | Sertraline carbamoyl glucuronide | 119733-44-7 | 1mg |
| GC2168-2mg | Sertraline carbamoyl glucuronide | 119733-44-7 | 2mg |
| GC2168-5mg | Sertraline carbamoyl glucuronide | 119733-44-7 | 5mg |
| GC2168-10mg | Sertraline carbamoyl glucuronide | 119733-44-7 | 10mg |
| GP7667-5g | Sertraline hydrochloride | 79559-97-0 | 5g |
| GL9605-100ml | Sesame oil | 8008-74-0 | 100ml |
| GL9605-250ml | Sesame oil | 8008-74-0 | 250ml |
| GL9605-1l | Sesame oil | 8008-74-0 | 1l |
| GL3747-100mg | Sesamin | 607-80-7 | 100mg |
| GY7083-5mg | Sesamolin | 526-07-8 | 5mg |
| GL6392-1mg | Setomimycin (Setomimicin) | 69431-87-4 | 1mg |
| GW4211-1mg | SGI-1776 | 1025065-69-3 | 1mg |
| GW4211-5mg | SGI-1776 | 1025065-69-3 | 5mg |
| GW4211-10mg | SGI-1776 | 1025065-69-3 | 10mg |
| GW4900-1mg | SGX-523 | 1022150-57-7 | 1mg |
| GW4900-5mg | SGX-523 | 1022150-57-7 | 5mg |
| GW4900-10mg | SGX-523 | 1022150-57-7 | 10mg |
| GL3266-100g | Shellac | 9000-59-3 | 100g |
| GL3266-250g | Shellac | 9000-59-3 | 250g |
| GL3266-500g | Shellac | 9000-59-3 | 500g |
| GL3266-1kg | Shellac | 9000-59-3 | 1kg |
| GP5211-250mg | Shikimic acid | 138-59-0 | 250mg |
| GP5211-1g | Shikimic acid | 138-59-0 | 1g |
| GP5211-5g | Shikimic acid | 138-59-0 | 5g |
| GP5211-10g | Shikimic acid | 138-59-0 | 10g |
| GL5964-10mg | Shikonin | 54952-43-1 | 10mg |
| GY7466-10mg | Shikonin | 517-89-5 | 10mg |
| GL5964-50mg | Shikonin | 54952-43-1 | 50mg |
| GY7466-50mg | Shikonin | 517-89-5 | 50mg |
| GL5964-250mg | Shikonin | 54952-43-1 | 250mg |
| GY5943-10mg | Shikonofuran A | 85022-66-8 | 10mg |
| GL5333-1mg | Shz-1 | 326886-05-9 | 1mg |
| GL5333-5mg | Shz-1 | 326886-05-9 | 5mg |
| GL1634-250ug | Siamycin I | 164802-68-0 | 250ug |
| GL1634-1mg | Siamycin I | 164802-68-0 | 1mg |
| GW9434-5mg | Sibiriline | 1346526-26-8 | 5mg |
| GW9434-25mg | Sibiriline | 1346526-26-8 | 25mg |
| GP4519-1g | Sibutramine hydrochloride | 125494-59-9 | 1g |
| GP4519-5g | Sibutramine hydrochloride | 125494-59-9 | 5g |
| GP3242-1g | Sildenafil citrate | 171599-83-0 | 1g |
| GX7225-1kg | Silic acid, 99+% | 7699-41-4 | 1kg |
| GX4371-500g | Silica Gel, non-indicating, 2 - 5 mm beads | 112926-00-8 | 500g |
| GX4371-1kg | Silica Gel, non-indicating, 2 - 5 mm beads | 112926-00-8 | 1kg |
| GX4371-5kg | Silica Gel, non-indicating, 2 - 5 mm beads | 112926-00-8 | 5kg |
| GX9287-500g | Silica Gel, pore size ~25A, 1 - 3 mm beads | 112926-00-8 | 500g |
| GX9287-1kg | Silica Gel, pore size ~25A, 1 - 3 mm beads | 112926-00-8 | 1kg |
| GX9287-5kg | Silica Gel, pore size ~25A, 1 - 3 mm beads | 112926-00-8 | 5kg |
| GX6254-500g | Silica Gel, pore size ~25A, 2 - 5 mm beads | 112926-00-8 | 500g |
| GX6254-1kg | Silica Gel, pore size ~25A, 2 - 5 mm beads | 112926-00-8 | 1kg |
| GX6254-5kg | Silica Gel, pore size ~25A, 2 - 5 mm beads | 112926-00-8 | 5kg |
| GX9977-1kg | Silica gel, pore size 60A, particle size 40-63 micron | 7631-86-9 | 1kg |
| GE5162-500g | Silica Gel, self-indicating, blue to pink, 2 - 5 mm beads | 112926-00-8 | 500g |
| GE5162-1kg | Silica Gel, self-indicating, blue to pink, 2 - 5 mm beads | 112926-00-8 | 1kg |
| GE5162-5kg | Silica Gel, self-indicating, blue to pink, 2 - 5 mm beads | 112926-00-8 | 5kg |
| GE9411-500g | Silica Gel, self-indicating, orange to colourless, 4 - 8 mm beads, cobalt free | 112926-00-8 | 500g |
| GE9411-1kg | Silica Gel, self-indicating, orange to colourless, 4 - 8 mm beads, cobalt free | 112926-00-8 | 1kg |
| GE5612-500g | Silica Gel, self-indicating, orange to green, 2 - 5 mm beads | 112926-00-8 | 500g |
| GE5612-1kg | Silica Gel, self-indicating, orange to green, 2 - 5 mm beads | 112926-00-8 | 1kg |
| GE5612-5kg | Silica Gel, self-indicating, orange to green, 2 - 5 mm beads | 112926-00-8 | 5kg |
| GE0944-500g | Silica Gel, self-indicating, orange to green, 4 - 8 mm beads | 112926-00-8 | 500g |
| GE0944-1kg | Silica Gel, self-indicating, orange to green, 4 - 8 mm beads | 112926-00-8 | 1kg |
| GK6673-250g | Silica, fumed, hydrophobic | 112945-52-5 | 250g |
| GK6673-1kg | Silica, fumed, hydrophobic | 112945-52-5 | 1kg |
| GX4045-25g | Silicon boride, 98% | 12008-29-6 | 25g |
| GX8061-10g | Silicon nanopowder, 99% | 7440-21-3 | 10g |
| GX8061-25g | Silicon nanopowder, 99% | 7440-21-3 | 25g |
| GX8061-100g | Silicon nanopowder, 99% | 7440-21-3 | 100g |
| GX0657-100g | Silicon Pieces max. 10 mm, 99.99% | 7440-21-3 | 100g |
| GX0657-250g | Silicon Pieces max. 10 mm, 99.99% | 7440-21-3 | 250g |
| GX4991-100g | Silicon Pieces max. 6 mm, 99.9% | 7440-21-3 | 100g |
| GX4991-500g | Silicon Pieces max. 6 mm, 99.9% | 7440-21-3 | 500g |
| GX7651-50g | Silicon Pieces max. 6 mm, 99.99% | 7440-21-3 | 50g |
| GX7651-250g | Silicon Pieces max. 6 mm, 99.99% | 7440-21-3 | 250g |
| GX0748-100g | Silicon Pieces, polycrystalline, 99.999% | 7440-21-3 | 100g |
| GX0748-500g | Silicon Pieces, polycrystalline, 99.999% | 7440-21-3 | 500g |
| GX3061-50g | Silicon Powder -100, +325 mesh, amorphous, 99.999% | 7440-21-3 | 50g |
| GX3061-250g | Silicon Powder -100, +325 mesh, amorphous, 99.999% | 7440-21-3 | 250g |
| GX3543-250g | Silicon Powder max. 160 micron, 98.5+% | 7440-21-3 | 250g |
| GX3543-1kg | Silicon Powder max. 160 micron, 98.5+% | 7440-21-3 | 1kg |
| GX3775-50g | Silicon(II) oxide, 99.9% | 10097-28-6 | 50g |
| GX3775-250g | Silicon(II) oxide, 99.9% | 10097-28-6 | 250g |
| GX1467-50g | Silicon(II) oxide, 99.9%, 3 - 6 mm pieces | 10097-28-6 | 50g |
| GX1467-250g | Silicon(II) oxide, 99.9%, 3 - 6 mm pieces | 10097-28-6 | 250g |
| GX5045-10g | Silicon(II) oxide, 99.99% | 10097-28-6 | 10g |
| GX5045-50g | Silicon(II) oxide, 99.99% | 10097-28-6 | 50g |
| GX5045-200g | Silicon(II) oxide, 99.99% | 10097-28-6 | 200g |
| GX1131-50g | Silicon(IV) acetate | 562-90-3 | 50g |
| GX3494-10g | Silicon(IV) carbide Nanopowder (beta); 99% | 409-21-2 | 10g |
| GX3494-25g | Silicon(IV) carbide Nanopowder (beta); 99% | 409-21-2 | 25g |
| GX4646-500g | Silicon(IV) carbide, 98.8% | 409-21-2 | 500g |
| GX0849-100g | Silicon(IV) nitride | 12033-89-5 | 100g |
| GX0849-500g | Silicon(IV) nitride | 12033-89-5 | 500g |
| GX7444-25g | Silicon(IV) nitride Nanopowder (amorphous); 99 % | 12033-89-5 | 25g |
| GX3828-25g | Silicon(IV) nitride Nanopowder (amorphous); 99 % | 12033-89-5 | 25g |
| GX7444-50g | Silicon(IV) nitride Nanopowder (amorphous); 99 % | 12033-89-5 | 50g |
| GX3828-50g | Silicon(IV) nitride Nanopowder (amorphous); 99 % | 12033-89-5 | 50g |
| GX7444-100g | Silicon(IV) nitride Nanopowder (amorphous); 99 % | 12033-89-5 | 100g |
| GX3828-100g | Silicon(IV) nitride Nanopowder (amorphous); 99 % | 12033-89-5 | 100g |
| GX7444-250g | Silicon(IV) nitride Nanopowder (amorphous); 99 % | 12033-89-5 | 250g |
| GX3828-250g | Silicon(IV) nitride Nanopowder (amorphous); 99 % | 12033-89-5 | 250g |
| GX7444-500g | Silicon(IV) nitride Nanopowder (amorphous); 99 % | 12033-89-5 | 500g |
| GX3828-500g | Silicon(IV) nitride Nanopowder (amorphous); 99 % | 12033-89-5 | 500g |
| GX2563-50g | Silicon(IV) oxide + amino group (6:1) Nanopowder , 99,8 % | 7631-86-9 | 50g |
| GX2563-250g | Silicon(IV) oxide + amino group (6:1) Nanopowder , 99,8 % | 7631-86-9 | 250g |
| GX3021-50g | Silicon(IV) oxide Nanopowder non-porous, 99.5 % | 7631-86-9 | 50g |
| GX3021-100g | Silicon(IV) oxide Nanopowder non-porous, 99.5 % | 7631-86-9 | 100g |
| GX5961-50g | Silicon(IV) oxide Nanopowder, 99%+ | 7631-86-9 | 50g |
| GX5961-250g | Silicon(IV) oxide Nanopowder, 99%+ | 7631-86-9 | 250g |
| GX5961-1kg | Silicon(IV) oxide Nanopowder, 99%+ | 7631-86-9 | 1kg |
| GX4972-100g | Silicon(IV) oxide-Nano Powder, 99.5% | 7631-86-9 | 100g |
| GX3393-25g | Silicon(IV) oxide-Nano Powder, 99% | 7631-86-9 | 25g |
| GX3393-100g | Silicon(IV) oxide-Nano Powder, 99% | 7631-86-9 | 100g |
| GX6601-250g | Silicon(IV) oxide, 99.9+%, 1-5 mm | 7631-86-9 | 250g |
| GX5711-250g | Silicon(IV) oxide, 99.9+%, 3-12 mm | 7631-86-9 | 250g |
| GX8518-50g | Silicon(IV) oxide, 99.99%, -100 mesh | 7631-86-9 | 50g |
| GX8518-250g | Silicon(IV) oxide, 99.99%, -100 mesh | 7631-86-9 | 250g |
| GX5602-100g | Silicon(IV) oxide, 99.99%, 1-4 mm | 7631-86-9 | 100g |
| GX5602-250g | Silicon(IV) oxide, 99.99%, 1-4 mm | 7631-86-9 | 250g |
| GX9332-100g | Silicon(IV) oxide, 99.99%, 3-12 mm | 7631-86-9 | 100g |
| GX9332-250g | Silicon(IV) oxide, 99.99%, 3-12 mm | 7631-86-9 | 250g |
| GX0707-50g | Silicon(IV) oxide, 99.99%, LT 1 micron | 7631-86-9 | 50g |
| GX0707-250g | Silicon(IV) oxide, 99.99%, LT 1 micron | 7631-86-9 | 250g |
| GX1138-10g | Silicon(IV) oxide, 99.999% | 7631-86-9 | 10g |
| GX1138-25g | Silicon(IV) oxide, 99.999% | 7631-86-9 | 25g |
| GX1138-100g | Silicon(IV) oxide, 99.999% | 7631-86-9 | 100g |
| GX3911-1g | Silicon(IV) sulfide | 13759-10-9 | 1g |
| GX3911-5g | Silicon(IV) sulfide | 13759-10-9 | 5g |
| GK4111-100ml | Silicone oil, 350 cSt | 63148-62-9 | 100ml |
| GK4111-500ml | Silicone oil, 350 cSt | 63148-62-9 | 500ml |
| GK4111-1l | Silicone oil, 350 cSt | 63148-62-9 | 1l |
| GX5864-250ml | Silicone oil, 50 cSt | 63148-62-9 | 250ml |
| GX5864-1l | Silicone oil, 50 cSt | 63148-62-9 | 1l |
| GK1916-250ml | Silicone oil, 500 cSt | 63148-62-9 | 250ml |
| GK1916-1l | Silicone oil, 500 cSt | 63148-62-9 | 1l |
| GX2031-250ml | Silicone oil, 5000 cSt | 63148-62-9 | 250ml |
| GX2031-1l | Silicone oil, 5000 cSt | 63148-62-9 | 1l |
| GW0786-25mg | Silthiopham | 175217-20-6 | 25mg |
| GX3719-10g | Silver 4-toluenesulfonate, 99+% | 16836-95-6 | 10g |
| GX7156-10g | Silver acetate, 99.99% | 563-63-3 | 10g |
| GX7156-50g | Silver acetate, 99.99% | 563-63-3 | 50g |
| GX7316-10g | Silver acetate, 99+% | 563-63-3 | 10g |
| GX7316-25g | Silver acetate, 99+% | 563-63-3 | 25g |
| GX7316-100g | Silver acetate, 99+% | 563-63-3 | 100g |
| GK3619-5g | Silver acetate, anhydrous, 99.5% | 563-63-3 | 5g |
| GK3619-25g | Silver acetate, anhydrous, 99.5% | 563-63-3 | 25g |
| GK3619-100g | Silver acetate, anhydrous, 99.5% | 563-63-3 | 100g |
| GX4227-10g | Silver benzoate | 532-31-0 | 10g |
| GX7770-10g | Silver bromide, 99.999% | 7785-23-1 | 10g |
| GX7770-50g | Silver bromide, 99.999% | 7785-23-1 | 50g |
| GX3419-25g | Silver bromide, 99+% | 7785-23-1 | 25g |
| GX3419-100g | Silver bromide, 99+% | 7785-23-1 | 100g |
| GX5940-10g | Silver carbonate, 99.7% | 534-16-7 | 10g |
| GX5940-25g | Silver carbonate, 99.7% | 534-16-7 | 25g |
| GX5940-100g | Silver carbonate, 99.7% | 534-16-7 | 100g |
| GX7973-5g | Silver carbonate, 99.999% | 534-16-7 | 5g |
| GX7973-10g | Silver carbonate, 99.999% | 534-16-7 | 10g |
| GX7973-50g | Silver carbonate, 99.999% | 534-16-7 | 50g |
| GX8612-5g | Silver chloride, 99.999% | 7783-90-6 | 5g |
| GX2669-5g | Silver chloride, 99.9999% | 7783-90-6 | 5g |
| GX7556-25g | Silver chloride, 99+% | 7783-90-6 | 25g |
| GX7556-100g | Silver chloride, 99+% | 7783-90-6 | 100g |
| GX3259-25g | Silver citrate | 126-45-4 | 25g |
| GX3259-100g | Silver citrate | 126-45-4 | 100g |
| GX9442-10g | Silver conducting fluid | 7440-22-4 | 10g |
| GX1580-10g | Silver cyanide, 99% | 506-64-9 | 10g |
| GX1580-50g | Silver cyanide, 99% | 506-64-9 | 50g |
| GX1580-250g | Silver cyanide, 99% | 506-64-9 | 250g |
| GX7129-5g | Silver fluoride, 98+% | 7775-41-9 | 5g |
| GX7129-25g | Silver fluoride, 98+% | 7775-41-9 | 25g |
| GX3692-100x100mm | Silver Foil 0.0125 mm, 99.9+%‚ | 7440-22-4 | 100x100mm |
| GX8808-50x50mm | Silver Foil 0.025 mm, 99.99% | 7440-22-4 | 50x50mm |
| GX8808-50x100mm | Silver Foil 0.025 mm, 99.99% | 7440-22-4 | 50x100mm |
| GX8808-100x100mm | Silver Foil 0.025 mm, 99.99% | 7440-22-4 | 100x100mm |
| GX8808-200x200mm | Silver Foil 0.025 mm, 99.99% | 7440-22-4 | 200x200mm |
| GX2671-50x50mm | Silver Foil 0.05 mm, 99.95% | 7440-22-4 | 50x50mm |
| GX2671-100x100mm | Silver Foil 0.05 mm, 99.95% | 7440-22-4 | 100x100mm |
| GX0249-50x50mm | Silver Foil 0.05 mm, 99.999% | 7440-22-4 | 50x50mm |
| GX0428-150x150mm | Silver Foil 0.075 mm, 99.95+% | 7440-22-4 | 150x150mm |
| GX7405-50x50mm | Silver Foil 0.075 mm, 99.999% | 7440-22-4 | 50x50mm |
| GX6467-50x50mm | Silver Foil 0.1 mm, 99.99% | 7440-22-4 | 50x50mm |
| GX6467-150x150mm | Silver Foil 0.1 mm, 99.99% | 7440-22-4 | 150x150mm |
| GX8584-50x50mm | Silver Foil 0.1 mm, 99.995% | 7440-22-4 | 50x50mm |
| GX8584-100x100mm | Silver Foil 0.1 mm, 99.995% | 7440-22-4 | 100x100mm |
| GX6705-50x50mm | Silver Foil 0.125 mm, 99.9% | 7440-22-4 | 50x50mm |
| GX6705-100x100mm | Silver Foil 0.125 mm, 99.9% | 7440-22-4 | 100x100mm |
| GX6705-100x200mm | Silver Foil 0.125 mm, 99.9% | 7440-22-4 | 100x200mm |
| GX8127-50x50mm | Silver Foil 0.125 mm, 99.99% | 7440-22-4 | 50x50mm |
| GX8127-100x100mm | Silver Foil 0.125 mm, 99.99% | 7440-22-4 | 100x100mm |
| GX5907-50x50mm | Silver Foil 0.25 mm, 99.9% | 7440-22-4 | 50x50mm |
| GX5907-50x100mm | Silver Foil 0.25 mm, 99.9% | 7440-22-4 | 50x100mm |
| GX5907-100x100mm | Silver Foil 0.25 mm, 99.9% | 7440-22-4 | 100x100mm |
| GX5907-100x200mm | Silver Foil 0.25 mm, 99.9% | 7440-22-4 | 100x200mm |
| GX3813-25x25mm | Silver Foil 0.25 mm, 99.995% | 7440-22-4 | 25x25mm |
| GX3813-25x100mm | Silver Foil 0.25 mm, 99.995% | 7440-22-4 | 25x100mm |
| GX6836-25x25mm | Silver Foil 0.5 mm, 99.9% | 7440-22-4 | 25x25mm |
| GX6836-50x50mm | Silver Foil 0.5 mm, 99.9% | 7440-22-4 | 50x50mm |
| GX6836-100x100mm | Silver Foil 0.5 mm, 99.9% | 7440-22-4 | 100x100mm |
| GX1382-50x50mm | Silver Foil 0.5 mm, 99.995% | 7440-22-4 | 50x50mm |
| GX6646-25x25mm | Silver Foil 1.0 mm, 99.9% | 7440-22-4 | 25x25mm |
| GX6646-50x50mm | Silver Foil 1.0 mm, 99.9% | 7440-22-4 | 50x50mm |
| GX6646-100x100mm | Silver Foil 1.0 mm, 99.9% | 7440-22-4 | 100x100mm |
| GX7472-25x25mm | Silver Foil 1.0 mm, 99.995% | 7440-22-4 | 25x25mm |
| GX7472-50x50mm | Silver Foil 1.0 mm, 99.995% | 7440-22-4 | 50x50mm |
| GX8631-25x25mm | Silver Foil 2.0 mm, 99.9% | 7440-22-4 | 25x25mm |
| GX8631-50x50mm | Silver Foil 2.0 mm, 99.9% | 7440-22-4 | 50x50mm |
| GX2488-25x25mm | Silver Foil 2.0 mm, 99.995% | 7440-22-4 | 25x25mm |
| GX9289-50x50mm | Silver Gauze 1024 mesh,cm², 0.12 mm wire diameter, 99.9% | 7440-22-4 | 50x50mm |
| GX9289-100x100mm | Silver Gauze 1024 mesh,cm², 0.12 mm wire diameter, 99.9% | 7440-22-4 | 100x100mm |
| GX4288-50g | Silver Granules 2-8 mm, 99.9+% | 7440-22-4 | 50g |
| GX4288-250g | Silver Granules 2-8 mm, 99.9+% | 7440-22-4 | 250g |
| GX4288-100g | Silver Granules 2-8 mm, 99.9+% | 7440-22-4 | 100g |
| GX0138-10g | Silver Granules appr. 2x10x10 mm, 99.999% (metals basis) | 7440-22-4 | 10g |
| GX0138-50g | Silver Granules appr. 2x10x10 mm, 99.999% (metals basis) | 7440-22-4 | 50g |
| GX5040-5g | Silver hexafluoroantimonate, 95+% | 26042-64-8 | 5g |
| GX5040-25g | Silver hexafluoroantimonate, 95+% | 26042-64-8 | 25g |
| GX4691-25g | Silver iodate | 7783-97-3 | 25g |
| GX0810-25g | Silver iodide, 99+% | 7783-96-2 | 25g |
| GX0810-100g | Silver iodide, 99+% | 7783-96-2 | 100g |
| GX5020-5g | Silver methanesulfonate | 2386-52-9 | 5g |
| GX5020-25g | Silver methanesulfonate | 2386-52-9 | 25g |
| GX9825-5g | Silver Nanopowder, 99,9 % | 7440-22-4 | 5g |
| GX9825-10g | Silver Nanopowder, 99,9 % | 7440-22-4 | 10g |
| GX9825-25g | Silver Nanopowder, 99,9 % | 7440-22-4 | 25g |
| GX9825-100g | Silver Nanopowder, 99,9 % | 7440-22-4 | 100g |
| GX0585-5g | Silver Nanopowder, 99.5 % | 7440-22-4 | 5g |
| GX0585-10g | Silver Nanopowder, 99.5 % | 7440-22-4 | 10g |
| GX0585-100g | Silver Nanopowder, 99.5 % | 7440-22-4 | 100g |
| GX4085-10g | Silver Nanopowder, 99.95 % | 7440-22-4 | 10g |
| GX4085-25g | Silver Nanopowder, 99.95 % | 7440-22-4 | 25g |
| GX4085-100g | Silver Nanopowder, 99.95 % | 7440-22-4 | 100g |
| GX4779-5g | Silver Nanopowder, coated with fatty acids, 99+ % | 7440-22-4 | 5g |
| GX4779-10g | Silver Nanopowder, coated with fatty acids, 99+ % | 7440-22-4 | 10g |
| GX4779-25g | Silver Nanopowder, coated with fatty acids, 99+ % | 7440-22-4 | 25g |
| GX4779-100g | Silver Nanopowder, coated with fatty acids, 99+ % | 7440-22-4 | 100g |
| GX7986-10g | Silver Needles, 99.999% | 7440-22-4 | 10g |
| GX7986-25g | Silver Needles, 99.999% | 7440-22-4 | 25g |
| GK7224-5g | Silver nitrate | 7761-88-8 | 5g |
| GK7224-10g | Silver nitrate | 7761-88-8 | 10g |
| GK7224-25g | Silver nitrate | 7761-88-8 | 25g |
| GK7224-50g | Silver nitrate | 7761-88-8 | 50g |
| GK7224-100g | Silver nitrate | 7761-88-8 | 100g |
| GK7224-250g | Silver nitrate | 7761-88-8 | 250g |
| GX5332-50g | Silver nitrate, 99.9%, BP, Ph. Eur., USP grade | 7761-88-8 | 50g |
| GK4198-10g | Silver nitrate, 99.9%+ AR grade | 7761-88-8 | 10g |
| GK4198-25g | Silver nitrate, 99.9%+ AR grade | 7761-88-8 | 25g |
| GK4198-100g | Silver nitrate, 99.9%+ AR grade | 7761-88-8 | 100g |
| GX8949-10g | Silver nitrate, 99.999% | 7761-88-8 | 10g |
| GX9839-10g | Silver nitrate, 99.9999% | 7761-88-8 | 10g |
| GX9383-25g | Silver nitrite | 7783-99-5 | 25g |
| GX9383-100g | Silver nitrite | 7783-99-5 | 100g |
| GX1516-50g | Silver on Activated Carbon 0,3% Ag/C (Heraeus-Type K-0600) | 7440-22-4 | 50g |
| GX1516-100g | Silver on Activated Carbon 0,3% Ag/C (Heraeus-Type K-0600) | 7440-22-4 | 100g |
| GX6147-50g | Silver on Activated Carbon 0,3% Ag/C (Heraeus-Type K-0602) | 7440-22-4 | 50g |
| GX6147-100g | Silver on Activated Carbon 0,3% Ag/C (Heraeus-Type K-0602) | 7440-22-4 | 100g |
| GX6637-50g | Silver on Activated Carbon 0,3% Ag/C (Heraeus-Type K-0604) | 7440-22-4 | 50g |
| GX6637-100g | Silver on Activated Carbon 0,3% Ag/C (Heraeus-Type K-0604) | 7440-22-4 | 100g |
| GX0072-50g | Silver on Activated Carbon 0,3% Ag/C (Heraeus-Type K-0606) | 7440-22-4 | 50g |
| GX0072-100g | Silver on Activated Carbon 0,3% Ag/C (Heraeus-Type K-0606) | 7440-22-4 | 100g |
| GX3306-50g | Silver on Activated Carbon 0,3% Ag/C (Heraeus-Type K-0608) | 7440-22-4 | 50g |
| GX3306-100g | Silver on Activated Carbon 0,3% Ag/C (Heraeus-Type K-0608) | 7440-22-4 | 100g |
| GX7358-50g | Silver on Activated Carbon 0,5% Ag/C (Heraeus-Type K-0603) | 7440-22-4 | 50g |
| GX7358-100g | Silver on Activated Carbon 0,5% Ag/C (Heraeus-Type K-0603) | 7440-22-4 | 100g |
| GX7518-50g | Silver on Activated Carbon 0,5% Ag/C (Heraeus-Type K-0605) | 7440-22-4 | 50g |
| GX7518-100g | Silver on Activated Carbon 0,5% Ag/C (Heraeus-Type K-0605) | 7440-22-4 | 100g |
| GX3267-50g | Silver on Activated Carbon 0,5% Ag/C (Heraeus-Type K-0607) | 7440-22-4 | 50g |
| GX3267-100g | Silver on Activated Carbon 0,5% Ag/C (Heraeus-Type K-0607) | 7440-22-4 | 100g |
| GX9801-50g | Silver on Activated Carbon 0,5% Ag/C (Heraeus-Type K-0609) | 7440-22-4 | 50g |
| GX9801-100g | Silver on Activated Carbon 0,5% Ag/C (Heraeus-Type K-0609) | 7440-22-4 | 100g |
| GX0759-50g | Silver on Activated Carbon 0,5% Ag/C (Heraeus-Type K-601) | 7440-22-4 | 50g |
| GX0759-100g | Silver on Activated Carbon 0,5% Ag/C (Heraeus-Type K-601) | 7440-22-4 | 100g |
| GX2133-100g | Silver Pellets 6 x 6 mm, 99.9% | 7440-22-4 | 100g |
| GX2497-5g | Silver perchlorate hydrate, 99% | 14242-05-8 | 5g |
| GX2497-25g | Silver perchlorate hydrate, 99% | 14242-05-8 | 25g |
| GX5434-25g | Silver phosphate, 99+% | 7784-09-0 | 25g |
| GX4490-10g | Silver Powder 0.7-1.2 micron, 99.9% | 7440-22-4 | 10g |
| GX4490-25g | Silver Powder 0.7-1.2 micron, 99.9% | 7440-22-4 | 25g |
| GX4490-100g | Silver Powder 0.7-1.2 micron, 99.9% | 7440-22-4 | 100g |
| GX3560-25g | Silver Powder, crystalline 0.15-0.35 mm, 99.99% | 7440-22-4 | 25g |
| GX3560-100g | Silver Powder, crystalline 0.15-0.35 mm, 99.99% | 7440-22-4 | 100g |
| GX0038-10g | Silver Powder, crystalline 0.5-1 mm, 99.99% | 7440-22-4 | 10g |
| GX0038-25g | Silver Powder, crystalline 0.5-1 mm, 99.99% | 7440-22-4 | 25g |
| GX0038-100g | Silver Powder, crystalline 0.5-1 mm, 99.99% | 7440-22-4 | 100g |
| GX6877-50mm | Silver Rod 10.0 mm diameter, 99.9% | 7440-22-4 | 50mm |
| GX6877-100mm | Silver Rod 10.0 mm diameter, 99.9% | 7440-22-4 | 100mm |
| GX6877-200mm | Silver Rod 10.0 mm diameter, 99.9% | 7440-22-4 | 200mm |
| GX8788-50mm | Silver Rod 10.0 mm diameter, 99.99% | 7440-22-4 | 50mm |
| GX8788-100mm | Silver Rod 10.0 mm diameter, 99.99% | 7440-22-4 | 100mm |
| GX9544-25g | Silver Rod 12.5 mm diameter, 99.9% | 7440-22-4 | 25g |
| GX9544-100g | Silver Rod 12.5 mm diameter, 99.9% | 7440-22-4 | 100g |
| GX2957-100mm | Silver Rod 4.0 mm diameter, 99.9% | 7440-22-4 | 100mm |
| GX2098-200mm | Silver Rod 5.0 mm diameter, 99.9% | 7440-22-4 | 200mm |
| GX1179-150mm | Silver Rod 5.0 mm diameter, 99.99% | 7440-22-4 | 150mm |
| GX0397-25mm | Silver Rod 7.0 mm diameter, 99.995% | 7440-22-4 | 25mm |
| GX0397-100mm | Silver Rod 7.0 mm diameter, 99.995% | 7440-22-4 | 100mm |
| GX7814-200mm | Silver Rod 8.0 mm diameter, 99.9% | 7440-22-4 | 200mm |
| GK5303-1g | Silver stearate | 3507-99-1 | 1g |
| GK5303-5g | Silver stearate | 3507-99-1 | 5g |
| GK5303-10g | Silver stearate | 3507-99-1 | 10g |
| GK2380-5g | Silver sulfadiazine | 22199-08-2 | 5g |
| GK2380-10g | Silver sulfadiazine | 22199-08-2 | 10g |
| GK2380-25g | Silver sulfadiazine | 22199-08-2 | 25g |
| GK0139-25g | Silver sulfate | 10294-26-5 | 25g |
| GK0139-100g | Silver sulfate | 10294-26-5 | 100g |
| GX7366-10g | Silver sulfate, 99.999% | 10294-26-5 | 10g |
| GX7366-25g | Silver sulfate, 99.999% | 10294-26-5 | 25g |
| GX7366-100g | Silver sulfate, 99.999% | 10294-26-5 | 100g |
| GX7990-50g | Silver sulfate, 99+% | 10294-26-5 | 50g |
| GX7990-100g | Silver sulfate, 99+% | 10294-26-5 | 100g |
| GX6306-5g | Silver tetrafluoroborate, 95+% | 14104-20-2 | 5g |
| GX6306-10g | Silver tetrafluoroborate, 95+% | 14104-20-2 | 10g |
| GX6129-10g | Silver thiocyanate, 98% | 1701-93-5 | 10g |
| GX7211-5g | Silver trifluoroacetate, 97+% | 2966-50-9 | 5g |
| GX7211-25g | Silver trifluoroacetate, 97+% | 2966-50-9 | 25g |
| GX0215-10g | Silver trifluoromethanesulfonate, 97+% | 2923-28-6 | 10g |
| GX0215-25g | Silver trifluoromethanesulfonate, 97+% | 2923-28-6 | 25g |
| GX3012-300mm | Silver Tube 12.0 mm diameter, 1.0 mm wall thickness, 99.9% | 7440-22-4 | 300mm |
| GX4351-25m | Silver Wire 0.025 mm diameter, 99.95+% | 7440-22-4 | 25m |
| GX4351-100m | Silver Wire 0.025 mm diameter, 99.95+% | 7440-22-4 | 100m |
| GX9633-50m | Silver Wire 0.1 mm diameter, 99.9% | 7440-22-4 | 50m |
| GX4206-10m | Silver Wire 0.1 mm diameter, 99.995% | 7440-22-4 | 10m |
| GX8634-10m | Silver Wire 0.125 mm diameter, 99.9% | 7440-22-4 | 10m |
| GX8634-50m | Silver Wire 0.125 mm diameter, 99.9% | 7440-22-4 | 50m |
| GX1814-25m | Silver Wire 0.25 mm diameter, 99.9% | 7440-22-4 | 25m |
| GX1814-100m | Silver Wire 0.25 mm diameter, 99.9% | 7440-22-4 | 100m |
| GX3175-2m | Silver Wire 0.25 mm diameter, 99.995% | 7440-22-4 | 2m |
| GX3175-10m | Silver Wire 0.25 mm diameter, 99.995% | 7440-22-4 | 10m |
| GX6794-1m | Silver Wire 0.5 mm diameter , 99.99% | 7440-22-4 | 1m |
| GX6794-5m | Silver Wire 0.5 mm diameter , 99.99% | 7440-22-4 | 5m |
| GX0676-5m | Silver Wire 0.5 mm diameter, 99.9% | 7440-22-4 | 5m |
| GX0676-25m | Silver Wire 0.5 mm diameter, 99.9% | 7440-22-4 | 25m |
| GX5743-5m | Silver Wire 0.7 mm diameter, 99.9% | 7440-22-4 | 5m |
| GX1864-1m | Silver Wire 0.8 mm diameter, 99.97% | 7440-22-4 | 1m |
| GX1864-5m | Silver Wire 0.8 mm diameter, 99.97% | 7440-22-4 | 5m |
| GX0740-2m | Silver Wire 1.0 mm diameter, 99.9% | 7440-22-4 | 2m |
| GX0740-10m | Silver Wire 1.0 mm diameter, 99.9% | 7440-22-4 | 10m |
| GX2005-1m | Silver Wire 1.0 mm diameter, 99.99% | 7440-22-4 | 1m |
| GX2005-5m | Silver Wire 1.0 mm diameter, 99.99% | 7440-22-4 | 5m |
| GX1934-1m | Silver Wire 1.0 mm diameter, 99.999% | 7440-22-4 | 1m |
| GX5441-25cm | Silver Wire 2.0 mm diameter, 99.995% | 7440-22-4 | 25cm |
| GX5441-1m | Silver Wire 2.0 mm diameter, 99.995% | 7440-22-4 | 1m |
| GX3292-50cm | Silver Wire 2.0mm diameter, 99.9% | 7440-22-4 | 50cm |
| GX1897-50cm | Silver Wire 2.5 mm diameter, 99.9% | 7440-22-4 | 50cm |
| GX3195-50g | Silver Wool 0.05 mm wire thickness, 99.9% | 7440-22-4 | 50g |
| GK1310-25g | Silver(I) oxide | 20667-12-3 | 25g |
| GK1310-100g | Silver(I) oxide | 20667-12-3 | 100g |
| GX5928-25g | Silver(I) oxide, 99.99% | 20667-12-3 | 25g |
| GX6956-10g | Silver(I) sulfide, 99+% | 21548-73-2 | 10g |
| GX6956-50g | Silver(I) sulfide, 99+% | 21548-73-2 | 50g |
| GX1436-50g | Silver(I)-pinanylmercaptide | 68365-86-6 | 50g |
| GX1436-250g | Silver(I)-pinanylmercaptide | 68365-86-6 | 250g |
| GX5874-10g | Silver(II) oxide, 99+% | 1301-96-8 | 10g |
| GX5874-25g | Silver(II) oxide, 99+% | 1301-96-8 | 25g |
| GX5874-100g | Silver(II) oxide, 99+% | 1301-96-8 | 100g |
| GP4040-1g | Silybin | 22888-70-6 | 1g |
| GP4040-5g | Silybin | 22888-70-6 | 5g |
| GP4040-10g | Silybin | 22888-70-6 | 10g |
| GP4040-25g | Silybin | 22888-70-6 | 25g |
| GW7248-25g | Silymarin | 65666-07-1 | 25g |
| GW7248-50g | Silymarin | 65666-07-1 | 50g |
| GW7248-100g | Silymarin | 65666-07-1 | 100g |
| GP3135-5mg | Simeprevir | 923604-59-5 | 5mg |
| GP3135-25mg | Simeprevir | 923604-59-5 | 25mg |
| GW5914-25mg | Simetone | 673-04-1 | 25mg |
| GP4505-100mg | Simvastatin | 79902-63-9 | 100mg |
| GP4505-1g | Simvastatin | 79902-63-9 | 1g |
| GW6325-5mg | Simvastatin sodium salt | 101314-97-0 | 5mg |
| GW6325-25mg | Simvastatin sodium salt | 101314-97-0 | 25mg |
| GL5611-1g | Sinapic acid | 530-59-6 | 1g |
| GL5611-5g | Sinapic acid | 530-59-6 | 5g |
| GL5611-25g | Sinapic acid | 530-59-6 | 25g |
| GP8868-1g | Sinomenine hydrochloride | 6080-33-7 | 1g |
| GP8868-5g | Sinomenine hydrochloride | 6080-33-7 | 5g |
| GW3120-100ug | Sipholenol A | 78518-73-7 | 100ug |
| GW2180-100ug | Sipholenone A | 78518-74-8 | 100ug |
| GL5518-1mg | Sirtinol | 410536-97-9 | 1mg |
| GL5518-5mg | Sirtinol | 410536-97-9 | 5mg |
| GL5518-25mg | Sirtinol | 410536-97-9 | 25mg |
| GA7855-250mg | Sisomicin sulfate salt | 53179-09-2 | 250mg |
| GA7855-1g | Sisomicin sulfate salt | 53179-09-2 | 1g |
| GA7855-5g | Sisomicin sulfate salt | 53179-09-2 | 5g |
| GA7129-5mg | Sitafloxacin monohydrate | 163253-35-8 | 5mg |
| GA7129-25mg | Sitafloxacin monohydrate | 163253-35-8 | 25mg |
| GP8640-250mg | Sitagliptin | 486460-32-6 | 250mg |
| GP8640-1g | Sitagliptin | 486460-32-6 | 1g |
| GP3542-250mg | Sitagliptin phosphate hydrate | 654671-77-9 | 250mg |
| GP3542-1g | Sitagliptin phosphate hydrate | 654671-77-9 | 1g |
| GL2669-1mg | Skyrin | 602-06-2 | 1mg |
| GL0072-5mg | Skyrin | 602-06-2 | 5mg |
| GL6565-5mg | SMI-4a | 327033-36-3 | 5mg |
| GW7339-10mg | SNARF-DE | 135656-96-1 | 10mg |
| GW7339-50mg | SNARF-DE | 135656-96-1 | 50mg |
| GK2247-5mg | SNC80 | 156727-74-1 | 5mg |
| GK2247-25mg | SNC80 | 156727-74-1 | 25mg |
| GW0258-1mg | SNS-314 | 1057249-41-8 | 1mg |
| GW0258-5mg | SNS-314 | 1057249-41-8 | 5mg |
| GW0258-10mg | SNS-314 | 1057249-41-8 | 10mg |
| GK8013-100g | Soda lime, granular, with indicator | 8006-28-8 | 100g |
| GK8013-250g | Soda lime, granular, with indicator | 8006-28-8 | 250g |
| GK8013-500g | Soda lime, granular, with indicator | 8006-28-8 | 500g |
| GK8013-1kg | Soda lime, granular, with indicator | 8006-28-8 | 1kg |
| GK8013-5kg | Soda lime, granular, with indicator | 8006-28-8 | 5kg |
| GX9339-5g | Sodium 1-tetradecanesulfonate, 99% | 6994-45-2 | 5g |
| GX7157-25g | Sodium 2-naphthalenesulfonate | 532-02-5 | 25g |
| GX7157-100g | Sodium 2-naphthalenesulfonate | 532-02-5 | 100g |
| GM7502-25g | Sodium 4-aminosalicylate dihydrate | 6018-19-5 | 25g |
| GB8871-250ml | Sodium acetate buffer, 3M solution | 126-96-5 | 250ml |
| GB8871-1l | Sodium acetate buffer, 3M solution | 126-96-5 | 1l |
| GK0054-100g | Sodium acetate trihydrate | 6131-90-4 | 100g |
| GK0054-250g | Sodium acetate trihydrate | 6131-90-4 | 250g |
| GK0054-500g | Sodium acetate trihydrate | 6131-90-4 | 500g |
| GK0054-1kg | Sodium acetate trihydrate | 6131-90-4 | 1kg |
| GK0054-5kg | Sodium acetate trihydrate | 6131-90-4 | 5kg |
| GK0054-10kg | Sodium acetate trihydrate | 6131-90-4 | 10kg |
| GK4909-1kg | Sodium acetate trihydrate, 99.5%, BP, Ph. Eur., USP grade | 6131-90-4 | 1kg |
| GK4909-5kg | Sodium acetate trihydrate, 99.5%, BP, Ph. Eur., USP grade | 6131-90-4 | 5kg |
| GK4909-25kg | Sodium acetate trihydrate, 99.5%, BP, Ph. Eur., USP grade | 6131-90-4 | 25kg |
| GX1317-1kg | Sodium acetate trihydrate, 99%, ACS | 6131-90-4 | 1kg |
| GX1317-5kg | Sodium acetate trihydrate, 99%, ACS | 6131-90-4 | 5kg |
| GK4763-100g | Sodium acetate, anhydrous | 127-09-3 | 100g |
| GK4763-250g | Sodium acetate, anhydrous | 127-09-3 | 250g |
| GK4763-500g | Sodium acetate, anhydrous | 127-09-3 | 500g |
| GK4763-1kg | Sodium acetate, anhydrous | 127-09-3 | 1kg |
| GK4763-5kg | Sodium acetate, anhydrous | 127-09-3 | 5kg |
| GX3743-10g | Sodium acetate, anhydrous, 99.99% | 127-09-3 | 10g |
| GX3743-50g | Sodium acetate, anhydrous, 99.99% | 127-09-3 | 50g |
| GX8442-1kg | Sodium acetate, anhydrous, 99% | 127-09-3 | 1kg |
| GX3080-25g | Sodium acrylate | 7446-81-3 | 25g |
| GE6920-25g | Sodium azide | 26628-22-8 | 25g |
| GE6920-100g | Sodium azide | 26628-22-8 | 100g |
| GE6920-250g | Sodium azide | 26628-22-8 | 250g |
| GE6920-500g | Sodium azide | 26628-22-8 | 500g |
| GE4155-1l | Sodium azide, 0.005% solution | 26628-22-8 | 1l |
| GE2789-250ml | Sodium azide, 0.1M solution | 26628-22-8 | 250ml |
| GE2789-500ml | Sodium azide, 0.1M solution | 26628-22-8 | 500ml |
| GK4323-100g | Sodium benzoate, 99.5% | 532-32-1 | 100g |
| GK4323-250g | Sodium benzoate, 99.5% | 532-32-1 | 250g |
| GK4323-500g | Sodium benzoate, 99.5% | 532-32-1 | 500g |
| GK4323-1kg | Sodium benzoate, 99.5% | 532-32-1 | 1kg |
| GK4323-5kg | Sodium benzoate, 99.5% | 532-32-1 | 5kg |
| GX1300-1kg | Sodium benzoate, BP, FCC, Ph. Eur., USP grade | 532-32-1 | 1kg |
| GX3424-50g | Sodium bismuthate | 12232-99-4 | 50g |
| GK7777-100g | Sodium bisulfite | 7631-90-5 | 100g |
| GK7777-500g | Sodium bisulfite | 7631-90-5 | 500g |
| GK7777-1kg | Sodium bisulfite | 7631-90-5 | 1kg |
| GE8273-25g | Sodium borohydride | 16940-66-2 | 25g |
| GE8273-100g | Sodium borohydride | 16940-66-2 | 100g |
| GE8273-250g | Sodium borohydride | 16940-66-2 | 250g |
| GE8273-500g | Sodium borohydride | 16940-66-2 | 500g |
| GE8273-1kg | Sodium borohydride | 16940-66-2 | 1kg |
| GK0682-250g | Sodium bromide | 7647-15-6 | 250g |
| GK0682-1kg | Sodium bromide | 7647-15-6 | 1kg |
| GK0682-5kg | Sodium bromide | 7647-15-6 | 5kg |
| GX4625-100g | Sodium bromide, 99.5% | 7647-15-6 | 100g |
| GX4625-250g | Sodium bromide, 99.5% | 7647-15-6 | 250g |
| GX4625-500g | Sodium bromide, 99.5% | 7647-15-6 | 500g |
| GX4625-1kg | Sodium bromide, 99.5% | 7647-15-6 | 1kg |
| GK4939-25g | Sodium butyrate | 156-54-7 | 25g |
| GK4939-100g | Sodium butyrate | 156-54-7 | 100g |
| GK4939-250g | Sodium butyrate | 156-54-7 | 250g |
| GK4939-500g | Sodium butyrate | 156-54-7 | 500g |
| GL5070-5g | Sodium cacodylate trihydrate | 6131-99-3 | 5g |
| GL5070-10g | Sodium cacodylate trihydrate | 6131-99-3 | 10g |
| GK0913-25g | Sodium caprylate | 1984-06-1 | 25g |
| GK0913-100g | Sodium caprylate | 1984-06-1 | 100g |
| GK0913-250g | Sodium caprylate | 1984-06-1 | 250g |
| GK0913-500g | Sodium caprylate | 1984-06-1 | 500g |
| GK0913-1kg | Sodium caprylate | 1984-06-1 | 1kg |
| GE8906-250ml | Sodium carbonate-bicarbonate buffer, 0.05M solution | 250ml | |
| GE8906-1l | Sodium carbonate-bicarbonate buffer, 0.05M solution | 1l | |
| GK1081-250g | Sodium carbonate, anhydrous | 497-19-8 | 250g |
| GK1081-500g | Sodium carbonate, anhydrous | 497-19-8 | 500g |
| GK1081-1kg | Sodium carbonate, anhydrous | 497-19-8 | 1kg |
| GK1081-5kg | Sodium carbonate, anhydrous | 497-19-8 | 5kg |
| GK4950-1kg | Sodium carbonate, anhydrous, 99.5 - 100.5 %, BP, Ph. Eur., NF grade | 497-19-8 | 1kg |
| GK4950-5kg | Sodium carbonate, anhydrous, 99.5 - 100.5 %, BP, Ph. Eur., NF grade | 497-19-8 | 5kg |
| GX1219-50g | Sodium carbonate, anhydrous, 99.9% | 497-19-8 | 50g |
| GX1219-100g | Sodium carbonate, anhydrous, 99.9% | 497-19-8 | 100g |
| GX7344-25g | Sodium carbonate, anhydrous, 99.999% | 497-19-8 | 25g |
| GE8374-250g | Sodium chloride | 7647-14-5 | 250g |
| GE8374-500g | Sodium chloride | 7647-14-5 | 500g |
| GE8374-1kg | Sodium chloride | 7647-14-5 | 1kg |
| GE8374-5kg | Sodium chloride | 7647-14-5 | 5kg |
| GE8374-10kg | Sodium chloride | 7647-14-5 | 10kg |
| GE8374-25kg | Sodium chloride | 7647-14-5 | 25kg |
| GE3054-250ml | Sodium chloride solution, 5M in water | 7647-14-5 | 250ml |
| GE3054-1l | Sodium chloride solution, 5M in water | 7647-14-5 | 1l |
| GE1119-500g | Sodium chloride, Ph. Eur., USP grade | 7647-14-5 | 500g |
| GE1119-1kg | Sodium chloride, Ph. Eur., USP grade | 7647-14-5 | 1kg |
| GE1119-5kg | Sodium chloride, Ph. Eur., USP grade | 7647-14-5 | 5kg |
| GE0307-1kg | Sodium chloride, suitable for molecular biology | 7647-14-5 | 1kg |
| GL9225-100mg | Sodium cholesteryl sulfate | 2864-50-8 | 100mg |
| GL9225-250mg | Sodium cholesteryl sulfate | 2864-50-8 | 250mg |
| GL9225-500mg | Sodium cholesteryl sulfate | 2864-50-8 | 500mg |
| GL9225-1g | Sodium cholesteryl sulfate | 2864-50-8 | 1g |
| GL9225-2g | Sodium cholesteryl sulfate | 2864-50-8 | 2g |
| GK0137-100g | Sodium citrate dihydrate | 6132-04-3 | 100g |
| GK0137-250g | Sodium citrate dihydrate | 6132-04-3 | 250g |
| GK0137-500g | Sodium citrate dihydrate | 6132-04-3 | 500g |
| GK0137-1kg | Sodium citrate dihydrate | 6132-04-3 | 1kg |
| GK0137-5kg | Sodium citrate dihydrate | 6132-04-3 | 5kg |
| GK2264-100g | Sodium citrate, anhydrous | 68-04-2 | 100g |
| GK2264-250g | Sodium citrate, anhydrous | 68-04-2 | 250g |
| GK2264-500g | Sodium citrate, anhydrous | 68-04-2 | 500g |
| GK2264-1kg | Sodium citrate, anhydrous | 68-04-2 | 1kg |
| GK2264-5kg | Sodium citrate, anhydrous | 68-04-2 | 5kg |
| GB5048-1kg | Sodium citrate, anhydrous, USP grade | 68-04-2 | 1kg |
| GX4302-100g | Sodium cyanate, 98+% | 917-61-3 | 100g |
| GX4302-1kg | Sodium cyanate, 98+% | 917-61-3 | 1kg |
| GE0246-10g | Sodium cyanoborohydride | 25895-60-7 | 10g |
| GE0246-25g | Sodium cyanoborohydride | 25895-60-7 | 25g |
| GE0246-50g | Sodium cyanoborohydride | 25895-60-7 | 50g |
| GE0246-100g | Sodium cyanoborohydride | 25895-60-7 | 100g |
| GE0246-250g | Sodium cyanoborohydride | 25895-60-7 | 250g |
| GK8449-25g | Sodium decanoate | 1002-62-6 | 25g |
| GK8449-100g | Sodium decanoate | 1002-62-6 | 100g |
| GK7935-100g | Sodium diatrizoate | 737-31-5 | 100g |
| GK7935-250g | Sodium diatrizoate | 737-31-5 | 250g |
| GK2071-5g | Sodium diethyldithiocarbamate trihydrate | 20624-25-3 | 5g |
| GK2071-50g | Sodium diethyldithiocarbamate trihydrate | 20624-25-3 | 50g |
| GK4167-100g | Sodium dihydrogen citrate anhydrous | 18996-35-5 | 100g |
| GK4167-250g | Sodium dihydrogen citrate anhydrous | 18996-35-5 | 250g |
| GK4167-1kg | Sodium dihydrogen citrate anhydrous | 18996-35-5 | 1kg |
| GK4167-5kg | Sodium dihydrogen citrate anhydrous | 18996-35-5 | 5kg |
| GX9327-500g | Sodium dihydrogen diphosphate, 95% | 7758-16-9 | 500g |
| GX9327-1kg | Sodium dihydrogen diphosphate, 95% | 7758-16-9 | 1kg |
| GB1797-100g | Sodium dihydrogen phosphate dihydrate | 13472-35-0 | 100g |
| GB1797-250g | Sodium dihydrogen phosphate dihydrate | 13472-35-0 | 250g |
| GB1797-500g | Sodium dihydrogen phosphate dihydrate | 13472-35-0 | 500g |
| GB1797-1kg | Sodium dihydrogen phosphate dihydrate | 13472-35-0 | 1kg |
| GB1797-5kg | Sodium dihydrogen phosphate dihydrate | 13472-35-0 | 5kg |
| GK8728-100g | Sodium dihydrogen phosphate dihydrate, Ph. Eur., USP grade | 13472-35-0 | 100g |
| GK8728-250g | Sodium dihydrogen phosphate dihydrate, Ph. Eur., USP grade | 13472-35-0 | 250g |
| GK8728-500g | Sodium dihydrogen phosphate dihydrate, Ph. Eur., USP grade | 13472-35-0 | 500g |
| GK8728-1kg | Sodium dihydrogen phosphate dihydrate, Ph. Eur., USP grade | 13472-35-0 | 1kg |
| GK8728-5kg | Sodium dihydrogen phosphate dihydrate, Ph. Eur., USP grade | 13472-35-0 | 5kg |
| GX5813-25g | Sodium dihydrogen phosphate, 99.999% | 7558-80-7 | 25g |
| GX5813-100g | Sodium dihydrogen phosphate, 99.999% | 7558-80-7 | 100g |
| GX9427-10g | Sodium disulfito aurate(I) solution | 130206-49-4 | 10g |
| GX9427-50g | Sodium disulfito aurate(I) solution | 130206-49-4 | 50g |
| GX8950-1kg | Sodium dithionite, 85% | 7775-14-6 | 1kg |
| GL8384-100ml | Sodium DL-lactate, 60% solution | 72-17-3 | 100ml |
| GL8384-250ml | Sodium DL-lactate, 60% solution | 72-17-3 | 250ml |
| GL8384-500ml | Sodium DL-lactate, 60% solution | 72-17-3 | 500ml |
| GL8384-1l | Sodium DL-lactate, 60% solution | 72-17-3 | 1l |
| GL6866-5g | Sodium dodecanoate | 629-25-4 | 5g |
| GL6866-25g | Sodium dodecanoate | 629-25-4 | 25g |
| GL6866-100g | Sodium dodecanoate | 629-25-4 | 100g |
| GD0485-100ml | Sodium dodecyl sulfate, 10% solution in water | 151-21-3 | 100ml |
| GD0485-500ml | Sodium dodecyl sulfate, 10% solution in water | 151-21-3 | 500ml |
| GD0990-100ml | Sodium dodecyl sulfate, 20% solution in water | 151-21-3 | 100ml |
| GD0990-250ml | Sodium dodecyl sulfate, 20% solution in water | 151-21-3 | 250ml |
| GD0990-1l | Sodium dodecyl sulfate, 20% solution in water | 151-21-3 | 1l |
| GD0990-2l | Sodium dodecyl sulfate, 20% solution in water | 151-21-3 | 2l |
| GD2962-25g | Sodium dodecyl sulfate, 99% | 151-21-3 | 25g |
| GD2962-100g | Sodium dodecyl sulfate, 99% | 151-21-3 | 100g |
| GD2962-250g | Sodium dodecyl sulfate, 99% | 151-21-3 | 250g |
| GD2962-500g | Sodium dodecyl sulfate, 99% | 151-21-3 | 500g |
| GD2962-1kg | Sodium dodecyl sulfate, 99% | 151-21-3 | 1kg |
| GX5289-25g | Sodium dodecyl sulfate, for analysis | 151-21-3 | 25g |
| GX5289-100g | Sodium dodecyl sulfate, for analysis | 151-21-3 | 100g |
| GD0901-100g | Sodium dodecyl sulfate, Ph. Eur., USP grade | 151-21-3 | 100g |
| GD0901-250g | Sodium dodecyl sulfate, Ph. Eur., USP grade | 151-21-3 | 250g |
| GD0901-500g | Sodium dodecyl sulfate, Ph. Eur., USP grade | 151-21-3 | 500g |
| GD0901-1kg | Sodium dodecyl sulfate, Ph. Eur., USP grade | 151-21-3 | 1kg |
| GX5839-25g | Sodium dodecylbenzenesulfonate | 69227-09-4 | 25g |
| GX5839-100g | Sodium dodecylbenzenesulfonate | 69227-09-4 | 100g |
| GK6904-50g | Sodium fluoride | 7681-49-4 | 50g |
| GX0783-25g | Sodium fluoride, 99.9+% | 7681-49-4 | 25g |
| GX4419-250g | Sodium fluoride, 99%, BP, Ph. Eur. grade | 7681-49-4 | 250g |
| GX4419-500g | Sodium fluoride, 99%, BP, Ph. Eur. grade | 7681-49-4 | 500g |
| GX4419-1kg | Sodium fluoride, 99%, BP, Ph. Eur. grade | 7681-49-4 | 1kg |
| GX4812-100g | Sodium fluorophosphate | 10163-15-2 | 100g |
| GX5028-250g | Sodium formate | 141-53-7 | 250g |
| GX5028-1kg | Sodium formate | 141-53-7 | 1kg |
| GX5028-5kg | Sodium formate | 141-53-7 | 5kg |
| GC3360-25g | Sodium glucoheptonate | 31138-65-5 | 25g |
| GC3360-100g | Sodium glucoheptonate | 31138-65-5 | 100g |
| GC3360-250g | Sodium glucoheptonate | 31138-65-5 | 250g |
| GC3360-500g | Sodium glucoheptonate | 31138-65-5 | 500g |
| GC9014-100g | Sodium gluconate | 527-07-1 | 100g |
| GC9014-250g | Sodium gluconate | 527-07-1 | 250g |
| GC9014-500g | Sodium gluconate | 527-07-1 | 500g |
| GC9014-1kg | Sodium gluconate | 527-07-1 | 1kg |
| GC9014-5kg | Sodium gluconate | 527-07-1 | 5kg |
| GX3248-100g | Sodium gluconate, USP grade | 527-07-1 | 100g |
| GX3248-250g | Sodium gluconate, USP grade | 527-07-1 | 250g |
| GX3248-500g | Sodium gluconate, USP grade | 527-07-1 | 500g |
| GX3248-1kg | Sodium gluconate, USP grade | 527-07-1 | 1kg |
| GL1902-250mg | Sodium glycocholate hydrate | 338950-81-5 | 250mg |
| GL1902-1g | Sodium glycocholate hydrate | 338950-81-5 | 1g |
| GL1902-5g | Sodium glycocholate hydrate | 338950-81-5 | 5g |
| GL1902-10g | Sodium glycocholate hydrate | 338950-81-5 | 10g |
| GK3611-250mg | Sodium glycodeoxycholate | 16409-34-0 | 250mg |
| GK3611-1g | Sodium glycodeoxycholate | 16409-34-0 | 1g |
| GX7389-5g | Sodium hexachloroiridate(III) | 15702-05-3 | 5g |
| GX2684-1g | Sodium hexachloroiridate(IV) hydrate | 19567-78-3 | 1g |
| GX2684-5g | Sodium hexachloroiridate(IV) hydrate | 19567-78-3 | 5g |
| GX8088-1g | Sodium hexachloroplatinate(IV) hydrate, 99.95% (metals basis) | 19583-77-8 | 1g |
| GX8088-5g | Sodium hexachloroplatinate(IV) hydrate, 99.95% (metals basis) | 19583-77-8 | 5g |
| GX6620-2g | Sodium hexachlororhodate(III) hydrate, 99.95% (metals basis) | 14972-70-4 | 2g |
| GX6620-10g | Sodium hexachlororhodate(III) hydrate, 99.95% (metals basis) | 14972-70-4 | 10g |
| GX1991-10g | Sodium hexafluoroaluminate | 13775-53-6 | 10g |
| GX0407-50g | Sodium hexafluorophosphate(V); 98% | 21324-39-0 | 50g |
| GX0407-100g | Sodium hexafluorophosphate(V); 98% | 21324-39-0 | 100g |
| GX2374-500g | Sodium hexafluorosilicate | 16893-85-9 | 500g |
| GX2374-1kg | Sodium hexafluorosilicate | 16893-85-9 | 1kg |
| GX2374-5kg | Sodium hexafluorosilicate | 16893-85-9 | 5kg |
| GX5200-1g | Sodium hexahydroxyplatinate(IV); 99.95% (metals basis) | 12325-31-4 | 1g |
| GX5200-5g | Sodium hexahydroxyplatinate(IV); 99.95% (metals basis) | 12325-31-4 | 5g |
| GK9696-100g | Sodium hexametaphosphate | 68915-31-1 | 100g |
| GK9696-250g | Sodium hexametaphosphate | 68915-31-1 | 250g |
| GK9696-500g | Sodium hexametaphosphate | 68915-31-1 | 500g |
| GK9696-1kg | Sodium hexametaphosphate | 68915-31-1 | 1kg |
| GK9696-5kg | Sodium hexametaphosphate | 68915-31-1 | 5kg |
| GX0678-500g | Sodium hexametaphosphate, pure | 10124-56-8 | 500g |
| GX0678-1kg | Sodium hexametaphosphate, pure | 10124-56-8 | 1kg |
| GX2342-50g | Sodium hexanitritocobaltate(III) | 13600-98-1 | 50g |
| GX2342-100g | Sodium hexanitritocobaltate(III) | 13600-98-1 | 100g |
| GK7301-25g | Sodium hexanoate | 10051-44-2 | 25g |
| GK7301-100g | Sodium hexanoate | 10051-44-2 | 100g |
| GE8414-250g | Sodium hydrogen carbonate | 144-55-8 | 250g |
| GE8414-500g | Sodium hydrogen carbonate | 144-55-8 | 500g |
| GE8414-1kg | Sodium hydrogen carbonate | 144-55-8 | 1kg |
| GE8414-5kg | Sodium hydrogen carbonate | 144-55-8 | 5kg |
| GE8414-10kg | Sodium hydrogen carbonate | 144-55-8 | 10kg |
| GE9811-1kg | Sodium hydrogen carbonate, Ph. Eur., USP grade | 144-55-8 | 1kg |
| GX6396-1kg | Sodium hydrogen sulfate monohydrate, 99+% | 10034-88-5 | 1kg |
| GX2054-50g | Sodium hydrogen sulfate, 99.99% | 10034-88-5 | 50g |
| GK0060-100g | Sodium hydrogen sulfate, fused | 7681-38-1 | 100g |
| GE8709-100g | Sodium hydroxide pellets, EP | 1310-73-2 | 100g |
| GE8709-250g | Sodium hydroxide pellets, EP | 1310-73-2 | 250g |
| GE8709-500g | Sodium hydroxide pellets, EP | 1310-73-2 | 500g |
| GE8709-1kg | Sodium hydroxide pellets, EP | 1310-73-2 | 1kg |
| GE8709-5kg | Sodium hydroxide pellets, EP | 1310-73-2 | 5kg |
| GX0315-1l | Sodium hydroxide, 0.1M solution | 1310-73-2 | 1l |
| GX0315-2500ml | Sodium hydroxide, 0.1M solution | 1310-73-2 | 2500ml |
| GX0315-5l | Sodium hydroxide, 0.1M solution | 1310-73-2 | 5l |
| GX9247-1l | Sodium hydroxide, 0.5M solution | 1310-73-2 | 1l |
| GX9101-1l | Sodium hydroxide, 1.0M solution | 1310-73-2 | 1l |
| GX9101-5l | Sodium hydroxide, 1.0M solution | 1310-73-2 | 5l |
| GE2728-100ml | Sodium hydroxide, 10M solution | 1310-73-2 | 100ml |
| GX5276-500ml | Sodium hydroxide, 2.0M solution | 1310-73-2 | 500ml |
| GX5276-1l | Sodium hydroxide, 2.0M solution | 1310-73-2 | 1l |
| GX5276-5l | Sodium hydroxide, 2.0M solution | 1310-73-2 | 5l |
| GX2802-1l | Sodium hydroxide, 40% (w/w) solution | 1310-73-2 | 1l |
| GE0021-500g | Sodium hydroxide, micropearls | 1310-73-2 | 500g |
| GE0021-1kg | Sodium hydroxide, micropearls | 1310-73-2 | 1kg |
| GX3961-25g | Sodium hydroxymethanesulfonate | 870-72-4 | 25g |
| GX9417-500ml | Sodium hypochlorite, 14% solution | 7681-52-9 | 500ml |
| GX9417-1l | Sodium hypochlorite, 14% solution | 7681-52-9 | 1l |
| GX9417-2500ml | Sodium hypochlorite, 14% solution | 7681-52-9 | 2500ml |
| GX0223-100g | Sodium hypophosphite monohydrate | 10039-56-2 | 100g |
| GX0223-250g | Sodium hypophosphite monohydrate | 10039-56-2 | 250g |
| GX0223-500g | Sodium hypophosphite monohydrate | 10039-56-2 | 500g |
| GX0223-1kg | Sodium hypophosphite monohydrate | 10039-56-2 | 1kg |
| GX0223-5kg | Sodium hypophosphite monohydrate | 10039-56-2 | 5kg |
| GP2623-100g | Sodium iodide, 99% | 7681-82-5 | 100g |
| GP2623-250g | Sodium iodide, 99% | 7681-82-5 | 250g |
| GP2623-500g | Sodium iodide, 99% | 7681-82-5 | 500g |
| GP2623-1kg | Sodium iodide, 99% | 7681-82-5 | 1kg |
| GX6257-50g | Sodium iodide, anhydrous, 99.9+% | 7681-82-5 | 50g |
| GC1128-100g | Sodium L-ascorbate | 134-03-2 | 100g |
| GC1128-250g | Sodium L-ascorbate | 134-03-2 | 250g |
| GC1128-500g | Sodium L-ascorbate | 134-03-2 | 500g |
| GC1128-1kg | Sodium L-ascorbate | 134-03-2 | 1kg |
| GC1128-5kg | Sodium L-ascorbate | 134-03-2 | 5kg |
| GC0078-1kg | Sodium L-ascorbate, BP, Ph. Eur., USP grade | 134-03-2 | 1kg |
| GC8333-5g | Sodium L-lactate | 867-56-1 | 5g |
| GC8333-10g | Sodium L-lactate | 867-56-1 | 10g |
| GC8333-25g | Sodium L-lactate | 867-56-1 | 25g |
| GC8333-50g | Sodium L-lactate | 867-56-1 | 50g |
| GK2515-25g | Sodium lactobionate | 27297-39-8 | 25g |
| GK2515-100g | Sodium lactobionate | 27297-39-8 | 100g |
| GX6101-25g | Sodium malonate dibasic monohydrate | 26522-85-0 | 25g |
| GX6101-100g | Sodium malonate dibasic monohydrate | 26522-85-0 | 100g |
| GX6101-250g | Sodium malonate dibasic monohydrate | 26522-85-0 | 250g |
| GX6101-500g | Sodium malonate dibasic monohydrate | 26522-85-0 | 500g |
| GW6915-10g | Sodium mesoxalate monohydrate | 31635-99-1 | 10g |
| GW6915-25g | Sodium mesoxalate monohydrate | 31635-99-1 | 25g |
| GW6915-125g | Sodium mesoxalate monohydrate | 31635-99-1 | 125g |
| GK1356-500g | Sodium metabisulfite | 7681-57-4 | 500g |
| GK1356-1kg | Sodium metabisulfite | 7681-57-4 | 1kg |
| GK1356-5kg | Sodium metabisulfite | 7681-57-4 | 5kg |
| GK2800-25g | Sodium metaperiodate | 7790-28-5 | 25g |
| GK2800-100g | Sodium metaperiodate | 7790-28-5 | 100g |
| GK2800-250g | Sodium metaperiodate | 7790-28-5 | 250g |
| GK2800-500g | Sodium metaperiodate | 7790-28-5 | 500g |
| GK2800-1kg | Sodium metaperiodate | 7790-28-5 | 1kg |
| GX6056-25g | Sodium metasilicate nonahydrate | 13517-24-3 | 25g |
| GX6056-100g | Sodium metasilicate nonahydrate | 13517-24-3 | 100g |
| GX6056-500g | Sodium metasilicate nonahydrate | 13517-24-3 | 500g |
| GX6056-1kg | Sodium metasilicate nonahydrate | 13517-24-3 | 1kg |
| GK6589-250g | Sodium metasilicate, anhydrous | 6834-92-0 | 250g |
| GK6589-1kg | Sodium metasilicate, anhydrous | 6834-92-0 | 1kg |
| GK6589-5kg | Sodium metasilicate, anhydrous | 6834-92-0 | 5kg |
| GK7899-25g | Sodium metavanadate | 13718-26-8 | 25g |
| GK7899-100g | Sodium metavanadate | 13718-26-8 | 100g |
| GK7899-250g | Sodium metavanadate | 13718-26-8 | 250g |
| GK7899-500g | Sodium metavanadate | 13718-26-8 | 500g |
| GX9397-250g | Sodium metavanadate, 98+% | 13718-26-8 | 250g |
| GX9397-1kg | Sodium metavanadate, 98+% | 13718-26-8 | 1kg |
| GK7205-25g | Sodium methoxide | 124-41-4 | 25g |
| GK7205-100g | Sodium methoxide | 124-41-4 | 100g |
| GK7205-500g | Sodium methoxide | 124-41-4 | 500g |
| GK7205-1kg | Sodium methoxide | 124-41-4 | 1kg |
| GX5429-500g | Sodium molybdate dihydrate, 98% | 10102-40-6 | 500g |
| GX5429-1kg | Sodium molybdate dihydrate, 98% | 10102-40-6 | 1kg |
| GK4422-100g | Sodium molybdate dihydrate, 99.5% | 10102-40-6 | 100g |
| GK4422-250g | Sodium molybdate dihydrate, 99.5% | 10102-40-6 | 250g |
| GK4422-500g | Sodium molybdate dihydrate, 99.5% | 10102-40-6 | 500g |
| GK4422-1kg | Sodium molybdate dihydrate, 99.5% | 10102-40-6 | 1kg |
| GK1113-500g | Sodium molybdate dihydrate, EP grade | 10102-40-6 | 500g |
| GK1113-1kg | Sodium molybdate dihydrate, EP grade | 10102-40-6 | 1kg |
| GL9704-10g | Sodium myristate | 822-12-8 | 10g |
| GX9871-5g | Sodium n-decyl sulfate, 99% | 142-87-0 | 5g |
| GX7367-1g | Sodium n-tetradecyl sulfate, 99% | 68043-79-8 | 1g |
| GX4297-1g | Sodium n-undecyl sulfate, 99% | 1072-24-8 | 1g |
| GX4297-5g | Sodium n-undecyl sulfate, 99% | 1072-24-8 | 5g |
| GX6887-25g | Sodium niobate, 99.9% | 12034-09-2 | 25g |
| GK2648-100g | Sodium nitrate | 7631-99-4 | 100g |
| GX6161-50g | Sodium nitrate, 99.999% | 7631-99-4 | 50g |
| GK3284-250g | Sodium nitrite | 7632-00-0 | 250g |
| GK3284-500g | Sodium nitrite | 7632-00-0 | 500g |
| GK3284-1kg | Sodium nitrite | 7632-00-0 | 1kg |
| GT2671-25g | Sodium nitroprusside dihydrate | 13755-38-9 | 25g |
| GT2671-100g | Sodium nitroprusside dihydrate | 13755-38-9 | 100g |
| GT2671-250g | Sodium nitroprusside dihydrate | 13755-38-9 | 250g |
| GT2671-500g | Sodium nitroprusside dihydrate | 13755-38-9 | 500g |
| GX4924-25g | Sodium nitroprusside dihydrate, ACS grade | 13755-38-9 | 25g |
| GX4924-100g | Sodium nitroprusside dihydrate, ACS grade | 13755-38-9 | 100g |
| GX4924-250g | Sodium nitroprusside dihydrate, ACS grade | 13755-38-9 | 250g |
| GX3386-5g | Sodium octyl sulfate | 142-31-4 | 5g |
| GX3386-10g | Sodium octyl sulfate | 142-31-4 | 10g |
| GX3386-25g | Sodium octyl sulfate | 142-31-4 | 25g |
| GK2035-10g | Sodium oleate | 143-19-1 | 10g |
| GK2035-25g | Sodium oleate | 143-19-1 | 25g |
| GK2035-100g | Sodium oleate | 143-19-1 | 100g |
| GA6498-5g | Sodium omadine | 3811-73-2 | 5g |
| GA6498-25g | Sodium omadine | 3811-73-2 | 25g |
| GK7381-25g | Sodium orthovanadate | 13721-39-6 | 25g |
| GK7381-50g | Sodium orthovanadate | 13721-39-6 | 50g |
| GK7381-100g | Sodium orthovanadate | 13721-39-6 | 100g |
| GK7381-250g | Sodium orthovanadate | 13721-39-6 | 250g |
| GK3236-100g | Sodium oxalate | 62-76-0 | 100g |
| GK3236-500g | Sodium oxalate | 62-76-0 | 500g |
| GK3236-1kg | Sodium oxalate | 62-76-0 | 1kg |
| GX3682-500g | Sodium oxalate, 99.0% | 62-76-0 | 500g |
| GX9079-100g | Sodium oxalate, 99.5%, ACS grade | 62-76-0 | 100g |
| GX9079-500g | Sodium oxalate, 99.5%, ACS grade | 62-76-0 | 500g |
| GK7843-25g | Sodium perborate tetrahydrate | 10486-00-7 | 25g |
| GK7843-100g | Sodium perborate tetrahydrate | 10486-00-7 | 100g |
| GK9361-250g | Sodium perchlorate monohydrate | 7791-07-3 | 250g |
| GX2568-50g | Sodium periodate, ACS grade | 7790-28-5 | 50g |
| GX2568-100g | Sodium periodate, ACS grade | 7790-28-5 | 100g |
| GX2568-250g | Sodium periodate, ACS grade | 7790-28-5 | 250g |
| GX2568-500g | Sodium periodate, ACS grade | 7790-28-5 | 500g |
| GX4825-1kg | Sodium peroxodisulfate, 98% | 7775-27-1 | 1kg |
| GX2120-2g | Sodium perrhenate | 13472-33-8 | 2g |
| GX2120-10g | Sodium perrhenate | 13472-33-8 | 10g |
| GK5993-250g | Sodium persulfate | 7775-27-1 | 250g |
| GK5993-1kg | Sodium persulfate | 7775-27-1 | 1kg |
| GK5993-5kg | Sodium persulfate | 7775-27-1 | 5kg |
| GE0010-100g | Sodium phosphate monobasic monohydrate | 10049-21-5 | 100g |
| GE0010-250g | Sodium phosphate monobasic monohydrate | 10049-21-5 | 250g |
| GE0010-500g | Sodium phosphate monobasic monohydrate | 10049-21-5 | 500g |
| GE0010-1kg | Sodium phosphate monobasic monohydrate | 10049-21-5 | 1kg |
| GE0010-5kg | Sodium phosphate monobasic monohydrate | 10049-21-5 | 5kg |
| GE9539-100g | Sodium phosphate monobasic, anhydrous | 7558-80-7 | 100g |
| GE9539-250g | Sodium phosphate monobasic, anhydrous | 7558-80-7 | 250g |
| GE9539-500g | Sodium phosphate monobasic, anhydrous | 7558-80-7 | 500g |
| GE9539-1kg | Sodium phosphate monobasic, anhydrous | 7558-80-7 | 1kg |
| GE9539-5kg | Sodium phosphate monobasic, anhydrous | 7558-80-7 | 5kg |
| GK9846-500g | Sodium phosphate tribasic dodecahydrate, 98% | 10101-89-0 | 500g |
| GK9846-1kg | Sodium phosphate tribasic dodecahydrate, 98% | 10101-89-0 | 1kg |
| GK9846-5kg | Sodium phosphate tribasic dodecahydrate, 98% | 10101-89-0 | 5kg |
| GK2399-100g | Sodium phosphate, anhydrous | 7601-54-9 | 100g |
| GK2399-250g | Sodium phosphate, anhydrous | 7601-54-9 | 250g |
| GK2399-500g | Sodium phosphate, anhydrous | 7601-54-9 | 500g |
| GK2399-1kg | Sodium phosphate, anhydrous | 7601-54-9 | 1kg |
| GK2399-5kg | Sodium phosphate, anhydrous | 7601-54-9 | 5kg |
| GK1928-100g | Sodium phosphate, dibasic heptahydrate | 7782-85-6 | 100g |
| GK1928-250g | Sodium phosphate, dibasic heptahydrate | 7782-85-6 | 250g |
| GK1928-500g | Sodium phosphate, dibasic heptahydrate | 7782-85-6 | 500g |
| GK1928-1kg | Sodium phosphate, dibasic heptahydrate | 7782-85-6 | 1kg |
| GX3213-25g | Sodium polytungstate | 12141-67-2 | 25g |
| GX3213-100g | Sodium polytungstate | 12141-67-2 | 100g |
| GX3213-250g | Sodium polytungstate | 12141-67-2 | 250g |
| GK6391-100g | Sodium pyrophosphate decahydrate | 13472-36-1 | 100g |
| GK6391-250g | Sodium pyrophosphate decahydrate | 13472-36-1 | 250g |
| GK6391-500g | Sodium pyrophosphate decahydrate | 13472-36-1 | 500g |
| GK6391-1kg | Sodium pyrophosphate decahydrate | 13472-36-1 | 1kg |
| GK6391-5kg | Sodium pyrophosphate decahydrate | 13472-36-1 | 5kg |
| GX5186-1kg | Sodium pyrophosphate decahydrate, 99% | 13472-36-1 | 1kg |
| GX5186-5kg | Sodium pyrophosphate decahydrate, 99% | 13472-36-1 | 5kg |
| GK0841-250g | Sodium pyrophosphate, anhydrous | 7722-88-5 | 250g |
| GK0841-500g | Sodium pyrophosphate, anhydrous | 7722-88-5 | 500g |
| GK0841-1kg | Sodium pyrophosphate, anhydrous | 7722-88-5 | 1kg |
| GK0841-5kg | Sodium pyrophosphate, anhydrous | 7722-88-5 | 5kg |
| GE9014-25g | Sodium pyruvate | 113-24-6 | 25g |
| GE9014-100g | Sodium pyruvate | 113-24-6 | 100g |
| GE9014-250g | Sodium pyruvate | 113-24-6 | 250g |
| GE9014-500g | Sodium pyruvate | 113-24-6 | 500g |
| GE9014-1kg | Sodium pyruvate | 113-24-6 | 1kg |
| GX0590-500g | Sodium pyruvate, 99%, GlenCell™, suitable for cell culture | 113-24-6 | 500g |
| GK1651-100g | Sodium salicylate | 54-21-7 | 100g |
| GK1651-250g | Sodium salicylate | 54-21-7 | 250g |
| GK1651-500g | Sodium salicylate | 54-21-7 | 500g |
| GK1651-1kg | Sodium salicylate | 54-21-7 | 1kg |
| GK1651-5kg | Sodium salicylate | 54-21-7 | 5kg |
| GK7770-1kg | Sodium salicylate, Ph. Eur. grade | 54-21-7 | 1kg |
| GE7317-25g | Sodium selenite pentahydrate, BP, EP grade | 26970-82-1 | 25g |
| GE7317-50g | Sodium selenite pentahydrate, BP, EP grade | 26970-82-1 | 50g |
| GE7317-100g | Sodium selenite pentahydrate, BP, EP grade | 26970-82-1 | 100g |
| GE7317-250g | Sodium selenite pentahydrate, BP, EP grade | 26970-82-1 | 250g |
| GE7317-500g | Sodium selenite pentahydrate, BP, EP grade | 26970-82-1 | 500g |
| GE9041-25g | Sodium selenite, anhydrous | 10102-18-8 | 25g |
| GE9041-100g | Sodium selenite, anhydrous | 10102-18-8 | 100g |
| GE9041-500g | Sodium selenite, anhydrous | 10102-18-8 | 500g |
| GE9041-1kg | Sodium selenite, anhydrous | 10102-18-8 | 1kg |
| GK8776-100ml | Sodium silicate solution | 1344-09-8 | 100ml |
| GK8776-250ml | Sodium silicate solution | 1344-09-8 | 250ml |
| GK8776-500ml | Sodium silicate solution | 1344-09-8 | 500ml |
| GK8776-1l | Sodium silicate solution | 1344-09-8 | 1l |
| GK8776-5l | Sodium silicate solution | 1344-09-8 | 5l |
| GX4705-100g | Sodium stannate trihydrate | 12027-70-2 | 100g |
| GX4705-500g | Sodium stannate trihydrate | 12027-70-2 | 500g |
| GX4705-1kg | Sodium stannate trihydrate | 12027-70-2 | 1kg |
| GX6321-25g | Sodium stearyl fumarate | 4070-80-8 | 25g |
| GX6321-100g | Sodium stearyl fumarate | 4070-80-8 | 100g |
| GV4487-100g | Sodium succinate dibasic hexahydrate | 6106-21-4 | 100g |
| GV4487-250g | Sodium succinate dibasic hexahydrate | 6106-21-4 | 250g |
| GV4487-500g | Sodium succinate dibasic hexahydrate | 6106-21-4 | 500g |
| GV4487-1kg | Sodium succinate dibasic hexahydrate | 6106-21-4 | 1kg |
| GK6710-100g | Sodium succinate dibasic hexahydrate, 99% | 6106-21-4 | 100g |
| GK6710-250g | Sodium succinate dibasic hexahydrate, 99% | 6106-21-4 | 250g |
| GK6710-500g | Sodium succinate dibasic hexahydrate, 99% | 6106-21-4 | 500g |
| GK6710-1kg | Sodium succinate dibasic hexahydrate, 99% | 6106-21-4 | 1kg |
| GE0613-500g | Sodium sulfate decahydrate | 7727-73-3 | 500g |
| GE3563-100g | Sodium sulfate, anhydrous | 7757-82-6 | 100g |
| GE3563-500g | Sodium sulfate, anhydrous | 7757-82-6 | 500g |
| GE3563-1kg | Sodium sulfate, anhydrous | 7757-82-6 | 1kg |
| GE3563-2kg | Sodium sulfate, anhydrous | 7757-82-6 | 2kg |
| GE3563-5kg | Sodium sulfate, anhydrous | 7757-82-6 | 5kg |
| GX6055-10g | Sodium sulfate, anhydrous, 99.99+% | 7757-82-6 | 10g |
| GX6055-25g | Sodium sulfate, anhydrous, 99.99+% | 7757-82-6 | 25g |
| GE2515-250g | Sodium sulfite, anhydrous | 7757-83-7 | 250g |
| GE2515-1kg | Sodium sulfite, anhydrous | 7757-83-7 | 1kg |
| GE2515-5kg | Sodium sulfite, anhydrous | 7757-83-7 | 5kg |
| GK1687-250g | Sodium tartrate dihydrate | 6106-24-7 | 250g |
| GK1687-500g | Sodium tartrate dihydrate | 6106-24-7 | 500g |
| GK1687-1kg | Sodium tartrate dihydrate | 6106-24-7 | 1kg |
| GL4583-250mg | Sodium taurochenodeoxycholate | 6009-98-9 | 250mg |
| GL4583-1g | Sodium taurochenodeoxycholate | 6009-98-9 | 1g |
| GL4583-5g | Sodium taurochenodeoxycholate | 6009-98-9 | 5g |
| GL2114-1g | Sodium taurocholate hydrate | 345909-26-4 | 1g |
| GL2114-5g | Sodium taurocholate hydrate | 345909-26-4 | 5g |
| GL2114-10g | Sodium taurocholate hydrate | 345909-26-4 | 10g |
| GL2114-25g | Sodium taurocholate hydrate | 345909-26-4 | 25g |
| GL2114-50g | Sodium taurocholate hydrate | 345909-26-4 | 50g |
| GD6662-1g | Sodium taurodeoxycholate hydrate | 207737-97-1 | 1g |
| GD6662-5g | Sodium taurodeoxycholate hydrate | 207737-97-1 | 5g |
| GL2752-1g | Sodium taurolithocholate | 6042-32-6 | 1g |
| GK8560-1g | Sodium tauroursodeoxycholate | 14605-22-2 | 1g |
| GE4325-100g | Sodium tert-butoxide | 865-48-5 | 100g |
| GE4325-250g | Sodium tert-butoxide | 865-48-5 | 250g |
| GW3795-500mg | Sodium tetra(p-tolyl)borate | 15738-23-5 | 500mg |
| GW3795-10g | Sodium tetra(p-tolyl)borate | 15738-23-5 | 10g |
| GK8434-250g | Sodium tetraborate decahydrate | 1303-96-4 | 250g |
| GK8434-500g | Sodium tetraborate decahydrate | 1303-96-4 | 500g |
| GK8434-1kg | Sodium tetraborate decahydrate | 1303-96-4 | 1kg |
| GK8434-5kg | Sodium tetraborate decahydrate | 1303-96-4 | 5kg |
| GB8919-1kg | Sodium tetraborate decahydrate, EP grade | 1303-96-4 | 1kg |
| GX6969-100ml | Sodium tetraborate, 0.5% solution | 1330-43-4 | 100ml |
| GX6969-250ml | Sodium tetraborate, 0.5% solution | 1330-43-4 | 250ml |
| GX5662-100ml | Sodium tetraborate, 5% solution | 1330-43-4 | 100ml |
| GX5662-250ml | Sodium tetraborate, 5% solution | 1330-43-4 | 250ml |
| GK3065-25g | Sodium tetraborate, anhydrous | 1330-43-4 | 25g |
| GK3065-100g | Sodium tetraborate, anhydrous | 1330-43-4 | 100g |
| GK3065-250g | Sodium tetraborate, anhydrous | 1330-43-4 | 250g |
| GK3065-500g | Sodium tetraborate, anhydrous | 1330-43-4 | 500g |
| GK3065-1kg | Sodium tetraborate, anhydrous | 1330-43-4 | 1kg |
| GX8308-1g | Sodium tetrachloroaurate(III) hydrate, 99.95% (metals basis) | 13874-02-7 | 1g |
| GX8308-5g | Sodium tetrachloroaurate(III) hydrate, 99.95% (metals basis) | 13874-02-7 | 5g |
| GX2315-5g | Sodium tetrachloropalladate(II) solution | 13820-53-6 | 5g |
| GX2315-25g | Sodium tetrachloropalladate(II) solution | 13820-53-6 | 25g |
| GX1318-1g | Sodium tetrachloropalladate(II); 99.95% (metals basis) | 13820-53-6 | 1g |
| GX1318-5g | Sodium tetrachloropalladate(II); 99.95% (metals basis) | 13820-53-6 | 5g |
| GX0080-1g | Sodium tetrachloroplatinate(II) | 10026-00-3 | 1g |
| GX0080-5g | Sodium tetrachloroplatinate(II) | 10026-00-3 | 5g |
| GX0432-10g | Sodium tetrachloroplatinate(II) solution | 10026-00-3 | 10g |
| GX0432-50g | Sodium tetrachloroplatinate(II) solution | 10026-00-3 | 50g |
| GX1967-1g | Sodium tetraethylborate | 15523-24-7 | 1g |
| GX1082-1kg | Sodium tetrafluoroborate | 13755-29-8 | 1kg |
| GK6603-5g | Sodium tetraphenylborate | 143-66-8 | 5g |
| GK6603-25g | Sodium tetraphenylborate | 143-66-8 | 25g |
| GK6603-100g | Sodium tetraphenylborate | 143-66-8 | 100g |
| GX9787-10g | Sodium tetraphenylborate, ACS grade | 143-66-8 | 10g |
| GX9787-25g | Sodium tetraphenylborate, ACS grade | 143-66-8 | 25g |
| GK8710-100g | Sodium tetrathionate dihydrate | 13721-29-4 | 100g |
| GE7173-100g | Sodium thiocyanate | 540-72-7 | 100g |
| GE7173-250g | Sodium thiocyanate | 540-72-7 | 250g |
| GE7173-500g | Sodium thiocyanate | 540-72-7 | 500g |
| GE7173-1kg | Sodium thiocyanate | 540-72-7 | 1kg |
| GE7173-5kg | Sodium thiocyanate | 540-72-7 | 5kg |
| GC0633-25g | Sodium thioglycolate, 98% | 367-51-1 | 25g |
| GC0633-100g | Sodium thioglycolate, 98% | 367-51-1 | 100g |
| GC0633-250g | Sodium thioglycolate, 98% | 367-51-1 | 250g |
| GC0633-500g | Sodium thioglycolate, 98% | 367-51-1 | 500g |
| GC0633-1kg | Sodium thioglycolate, 98% | 367-51-1 | 1kg |
| GE5657-500g | Sodium thiosulfate pentahydrate | 10102-17-7 | 500g |
| GE5657-1kg | Sodium thiosulfate pentahydrate | 10102-17-7 | 1kg |
| GE5657-5kg | Sodium thiosulfate pentahydrate | 10102-17-7 | 5kg |
| GX3861-1kg | Sodium thiosulfate pentahydrate, Ph. Eur., USP grade | 10102-17-7 | 1kg |
| GE4439-100ml | Sodium thiosulfate solution | 7772-98-7 | 100ml |
| GE4439-250ml | Sodium thiosulfate solution | 7772-98-7 | 250ml |
| GE4280-100g | Sodium thiosulfate, anhydrous | 7772-98-7 | 100g |
| GE4280-250g | Sodium thiosulfate, anhydrous | 7772-98-7 | 250g |
| GX4946-50g | Sodium thiosulfate, pentahydrate, 99.99% | 10102-17-7 | 50g |
| GK2286-25g | Sodium triacetoxyborohydride | 56553-60-7 | 25g |
| GK2286-100g | Sodium triacetoxyborohydride | 56553-60-7 | 100g |
| GX3440-50g | Sodium trifluoroacetate, 97+% | 2923-18-4 | 50g |
| GX5430-100g | Sodium trimetaphosphate | 7785-84-4 | 100g |
| GX5430-500g | Sodium trimetaphosphate | 7785-84-4 | 500g |
| GX5430-1kg | Sodium trimetaphosphate | 7785-84-4 | 1kg |
| GX5430-5kg | Sodium trimetaphosphate | 7785-84-4 | 5kg |
| GX2065-5g | Sodium trimethylsilanolate | 18027-10-6 | 5g |
| GX0579-100g | Sodium tripolyphosphate | 7758-29-4 | 100g |
| GX0579-500g | Sodium tripolyphosphate | 7758-29-4 | 500g |
| GX0579-1kg | Sodium tripolyphosphate | 7758-29-4 | 1kg |
| GX0579-5kg | Sodium tripolyphosphate | 7758-29-4 | 5kg |
| GK6152-25g | Sodium tungstate dihydrate | 10213-10-2 | 25g |
| GK6152-100g | Sodium tungstate dihydrate | 10213-10-2 | 100g |
| GK6152-250g | Sodium tungstate dihydrate | 10213-10-2 | 250g |
| GK6152-500g | Sodium tungstate dihydrate | 10213-10-2 | 500g |
| GX9903-250g | Sodium tungstate dihydrate, 99+% | 10213-10-2 | 250g |
| GX9903-1kg | Sodium tungstate dihydrate, 99+% | 10213-10-2 | 1kg |
| GK0010-10g | Sodium valproate | 1069-66-5 | 10g |
| GK0010-25g | Sodium valproate | 1069-66-5 | 25g |
| GK0010-100g | Sodium valproate | 1069-66-5 | 100g |
| GP2923-10mg | Sofosbuvir | 1190307-88-0 | 10mg |
| GP2923-25mg | Sofosbuvir | 1190307-88-0 | 25mg |
| GP2923-50mg | Sofosbuvir | 1190307-88-0 | 50mg |
| GP3887-250mg | Solanesol | 13190-97-1 | 250mg |
| GP3887-1g | Solanesol | 13190-97-1 | 1g |
| GP5592-5mg | Solasonine | 19121-58-5 | 5mg |
| GC0834-25g | Solketal | 100-79-8 | 25g |
| GT7915-5g | Solvent yellow 7 | 1689-82-3 | 5g |
| GT7915-25g | Solvent yellow 7 | 1689-82-3 | 25g |
| GT7915-100g | Solvent yellow 7 | 1689-82-3 | 100g |
| GY8573-10mg | Sophoraflavanone G | 97938-30-2 | 10mg |
| GP6971-5mg | Sorafenib | 284461-73-0 | 5mg |
| GP6971-25mg | Sorafenib | 284461-73-0 | 25mg |
| GP6971-100mg | Sorafenib | 284461-73-0 | 100mg |
| GA6389-100g | Sorbic acid | 110-44-1 | 100g |
| GA6389-250g | Sorbic acid | 110-44-1 | 250g |
| GA6389-500g | Sorbic acid | 110-44-1 | 500g |
| GA6389-1kg | Sorbic acid | 110-44-1 | 1kg |
| GA6389-5kg | Sorbic acid | 110-44-1 | 5kg |
| GW5247-1g | Sorbic chloride | 2614-88-2 | 1g |
| GW5247-5g | Sorbic chloride | 2614-88-2 | 5g |
| GP8323-25mg | Sotalol hydrochloride | 959-24-0 | 25mg |
| GE0442-100g | Soya lecithin, powder | 8002-43-5 | 100g |
| GE0442-250g | Soya lecithin, powder | 8002-43-5 | 250g |
| GE0442-500g | Soya lecithin, powder | 8002-43-5 | 500g |
| GE0442-1kg | Soya lecithin, powder | 8002-43-5 | 1kg |
| GL3290-250ml | Soybean oil | 8001-22-7 | 250ml |
| GL3290-1l | Soybean oil | 8001-22-7 | 1l |
| GX1190-25kg | SP Brij S721 MBAL-PA-(SG) [ET80220] | - | 25kg |
| GW1707-1mg | SP2509 | 1mg | |
| GW1707-5mg | SP2509 | 5mg | |
| GW1707-10mg | SP2509 | 10mg | |
| GX5912-250ml | Span 80 | 1338-43-8 | 250ml |
| GX5912-1l | Span 80 | 1338-43-8 | 1l |
| GX5912-5l | Span 80 | 1338-43-8 | 5l |
| GA1910-100mg | Sparfloxacin | 110871-86-8 | 100mg |
| GA1910-1g | Sparfloxacin | 110871-86-8 | 1g |
| GA3375-5g | Spectinomycin dihydrochloride pentahydrate | 22189-32-8 | 5g |
| GA3375-25g | Spectinomycin dihydrochloride pentahydrate | 22189-32-8 | 25g |
| GA0510-5g | Spectinomycin sulfate | 23312-56-3 | 5g |
| GA0510-25g | Spectinomycin sulfate | 23312-56-3 | 25g |
| GE1557-1g | Spermidine | 124-20-9 | 1g |
| GE2774-100mg | Spermidine trihydrochloride | 334-50-9 | 100mg |
| GE2774-1g | Spermidine trihydrochloride | 334-50-9 | 1g |
| GE2774-5g | Spermidine trihydrochloride | 334-50-9 | 5g |
| GE2774-25g | Spermidine trihydrochloride | 334-50-9 | 25g |
| GE1335-1g | Spermine | 71-44-3 | 1g |
| GE1335-5g | Spermine | 71-44-3 | 5g |
| GL9744-1g | Spermine tetrahydrochloride | 306-67-2 | 1g |
| GL9744-5g | Spermine tetrahydrochloride | 306-67-2 | 5g |
| GK9857-100mg | Spinosad | 131929-60-7 | 100mg |
| GW1989-100mg | Spinosad | 168316-95-8 | 100mg |
| GW1989-1g | Spinosad | 168316-95-8 | 1g |
| GK9857-1g | Spinosad | 131929-60-7 | 1g |
| GE2928-10mg | Spiperone hydrochloride | 2022-29-9 | 10mg |
| GE2928-50mg | Spiperone hydrochloride | 2022-29-9 | 50mg |
| GA2410-1g | Spiramycin | 8025-81-8 | 1g |
| GA2410-5g | Spiramycin | 8025-81-8 | 5g |
| GP9788-1g | Spiramycin adipate | 68880-55-7 | 1g |
| GP9788-5g | Spiramycin adipate | 68880-55-7 | 5g |
| GA9612-1g | Spiramycin, EP grade | 8025-81-8 | 1g |
| GA9612-5g | Spiramycin, EP grade | 8025-81-8 | 5g |
| GP5407-1g | Spironolactone | 52-01-7 | 1g |
| GP5407-5g | Spironolactone | 52-01-7 | 5g |
| GP5407-10g | Spironolactone | 52-01-7 | 10g |
| GK9181-1mg | Splitomicin | 5690-03-9 | 1mg |
| GK9181-5mg | Splitomicin | 5690-03-9 | 5mg |
| GK9181-25mg | Splitomicin | 5690-03-9 | 25mg |
| GX8084-25g | SPS | 27206-35-5 | 25g |
| GX8084-100g | SPS | 27206-35-5 | 100g |
| GE0666-25g | Squalane | 111-01-3 | 25g |
| GK9974-10ml | Squalene | 111-02-4 | 10ml |
| GK1230-100ml | Squalene, from vegetal source | 111-02-4 | 100ml |
| GK1230-1l | Squalene, from vegetal source | 111-02-4 | 1l |
| GW0144-1mg | SR3677 | 1072959-67-1 | 1mg |
| GW0144-5mg | SR3677 | 1072959-67-1 | 5mg |
| GW0144-10mg | SR3677 | 1072959-67-1 | 10mg |
| GB4332-500ml | SSC buffer, 20X solution | - | 500ml |
| GB4332-1l | SSC buffer, 20X solution | - | 1l |
| GB4332-2500ml | SSC buffer, 20X solution | - | 2500ml |
| GB0798-500ml | SSPE buffer, 20X solution | 500ml | |
| GB0798-1l | SSPE buffer, 20X solution | 1l | |
| GY9308-250mg | Stachydrine hydrochloride | 4136-37-2 | 250mg |
| GY9308-1g | Stachydrine hydrochloride | 4136-37-2 | 1g |
| GC8978-25g | Stachyose hydrate | 54261-98-2 | 25g |
| GC8978-100g | Stachyose hydrate | 54261-98-2 | 100g |
| GX7816-5g | Stainless steel 316L Nanopowder, 99,9 % | 7439-89-6 | 5g |
| GX7816-10g | Stainless steel 316L Nanopowder, 99,9 % | 7439-89-6 | 10g |
| GX7816-25g | Stainless steel 316L Nanopowder, 99,9 % | 7439-89-6 | 25g |
| GX7816-100g | Stainless steel 316L Nanopowder, 99,9 % | 7439-89-6 | 100g |
| GX1949-150x150mm | Stainless steel foil 0.075 mm | 12597-68-1 | 150x150mm |
| GX8867-100x100mm | Stainless steel foil 0.1 mm | 12597-68-1 | 100x100mm |
| GX4507-150x150mm | Stainless steel foil 0.125 mm | 12597-68-1 | 150x150mm |
| GX4507-300x300mm | Stainless steel foil 0.125 mm | 12597-68-1 | 300x300mm |
| GX4077-100x100mm | Stainless steel foil 0.15 mm | 12597-68-1 | 100x100mm |
| GX4077-150x150mm | Stainless steel foil 0.15 mm | 12597-68-1 | 150x150mm |
| GX0085-100x100mm | Stainless steel foil 0.25 mm | 12597-68-1 | 100x100mm |
| GX3645-100x100mm | Stainless steel foil 0.5 mm | 12597-68-1 | 100x100mm |
| GX3658-150x150mm | Stainless steel foil 1 mm | 12597-68-1 | 150x150mm |
| GX3658-300x300mm | Stainless steel foil 1 mm | 12597-68-1 | 300x300mm |
| GX3148-100g | Stainless steel powder 150 micron | 12597-68-1 | 100g |
| GX9054-100mm | Stainless steel rod 20 mm diameter | 12597-68-1 | 100mm |
| GX9054-250mm | Stainless steel rod 20 mm diameter | 12597-68-1 | 250mm |
| GX1541-200mm | Stainless steel tube 8.0 mm diameter, 1.0 mm wall thickness | 12597-68-1 | 200mm |
| GX1541-500mm | Stainless steel tube 8.0 mm diameter, 1.0 mm wall thickness | 12597-68-1 | 500mm |
| GX0853-5m | Stainless steel wire 0.25 mm diameter | 12597-68-1 | 5m |
| GX1022-10m | Stainless steel wire 0.5 mm diameter | 12597-68-1 | 10m |
| GX1022-25m | Stainless steel wire 0.5 mm diameter | 12597-68-1 | 25m |
| GL8815-1g | Stains-All | 7423-31-6 | 1g |
| GL8815-5g | Stains-All | 7423-31-6 | 5g |
| GE6857-100g | Starch (Smithies); for electrophoresis | 9005-25-8 | 100g |
| GE6857-500g | Starch (Smithies); for electrophoresis | 9005-25-8 | 500g |
| GE6857-1kg | Starch (Smithies); for electrophoresis | 9005-25-8 | 1kg |
| GC9642-1kg | Starch, powder, from potato | 9005-25-8 | 1kg |
| GC9642-5kg | Starch, powder, from potato | 9005-25-8 | 5kg |
| GC6593-100g | Starch, soluble, ACS grade | 9005-84-9 | 100g |
| GA8507-1mg | Staurosporine | 62996-74-1 | 1mg |
| GA8507-5mg | Staurosporine | 62996-74-1 | 5mg |
| GA8507-10mg | Staurosporine | 62996-74-1 | 10mg |
| GP1591-500mg | Stavudine | 3056-17-5 | 500mg |
| GP1591-1g | Stavudine | 3056-17-5 | 1g |
| GL5425-1kg | Stearic acid 50 | 67701-03-5 | 1kg |
| GK7312-10g | Stearic acid, pure, 98% | 57-11-4 | 10g |
| GK7312-25g | Stearic acid, pure, 98% | 57-11-4 | 25g |
| GK7312-50g | Stearic acid, pure, 98% | 57-11-4 | 50g |
| GK7312-100g | Stearic acid, pure, 98% | 57-11-4 | 100g |
| GK8631-100g | Stearic acid, technical, 90% | 57-11-4 | 100g |
| GK8631-1kg | Stearic acid, technical, 90% | 57-11-4 | 1kg |
| GK8631-5kg | Stearic acid, technical, 90% | 57-11-4 | 5kg |
| GL8659-1mg | Sterigmatocystin | 10048-13-2 | 1mg |
| GL8659-5mg | Sterigmatocystin | 10048-13-2 | 5mg |
| GC3836-25g | Stevia extract, contains approx. 40% stevioside | 57817-89-7 | 25g |
| GC8724-25g | Stevioside, 85% | 57817-89-7 | 25g |
| GC8309-10mg | Stevioside, 98% | 57817-89-7 | 10mg |
| GC8309-50mg | Stevioside, 98% | 57817-89-7 | 50mg |
| GW5900-1mg | STF-31 | 724741-75-7 | 1mg |
| GW5900-5mg | STF-31 | 724741-75-7 | 5mg |
| GW5900-25mg | STF-31 | 724741-75-7 | 25mg |
| GP9119-1g | Stigmasterol, 95% | 83-48-7 | 1g |
| GP9119-5g | Stigmasterol, 95% | 83-48-7 | 5g |
| GP9119-10g | Stigmasterol, 95% | 83-48-7 | 10g |
| GP9119-25g | Stigmasterol, 95% | 83-48-7 | 25g |
| GP5909-1g | Stigmasterol, 98% | 83-48-7 | 1g |
| GP5909-5g | Stigmasterol, 98% | 83-48-7 | 5g |
| GP3535-50mg | Stiripentol | 49763-96-4 | 50mg |
| GP3535-250mg | Stiripentol | 49763-96-4 | 250mg |
| GL1351-250ug | Streptochlorin | 120191-51-7 | 250ug |
| GL1351-1mg | Streptochlorin | 120191-51-7 | 1mg |
| GA7700-5g | Streptomycin sulfate salt | 3810-74-0 | 5g |
| GA7700-25g | Streptomycin sulfate salt | 3810-74-0 | 25g |
| GA7700-50g | Streptomycin sulfate salt | 3810-74-0 | 50g |
| GA7700-100g | Streptomycin sulfate salt | 3810-74-0 | 100g |
| GP7621-5g | Streptomycin sulfate salt, Ph. Eur. grade | 3810-74-0 | 5g |
| GP7621-10g | Streptomycin sulfate salt, Ph. Eur. grade | 3810-74-0 | 10g |
| GP7621-25g | Streptomycin sulfate salt, Ph. Eur. grade | 3810-74-0 | 25g |
| GA1956-250mg | Streptozocin | 18883-66-4 | 250mg |
| GA1956-1g | Streptozocin | 18883-66-4 | 1g |
| GA1040-500ug | Strobilurin B | 65105-52-4 | 500ug |
| GA1040-1mg | Strobilurin B | 65105-52-4 | 1mg |
| GX5175-100g | Strontium acetate hydrate, 99+% | 543-94-2 | 100g |
| GX5543-10g | Strontium aluminate, 99+% | 12004-37-4 | 10g |
| GX5543-50g | Strontium aluminate, 99+% | 12004-37-4 | 50g |
| GX4255-10g | Strontium bromide, 99.99% | 10476-81-0 | 10g |
| GK8492-250g | Strontium carbonate | 1633-05-2 | 250g |
| GK8492-1kg | Strontium carbonate | 1633-05-2 | 1kg |
| GK8492-5kg | Strontium carbonate | 1633-05-2 | 5kg |
| GX5614-25g | Strontium carbonate, 99.999% | 1633-05-2 | 25g |
| GX9308-100g | Strontium carbonate, 99+% | 1633-05-2 | 100g |
| GX9308-250g | Strontium carbonate, 99+% | 1633-05-2 | 250g |
| GK3876-500g | Strontium chloride hexahydrate | 10025-70-4 | 500g |
| GK3876-1kg | Strontium chloride hexahydrate | 10025-70-4 | 1kg |
| GK3876-5kg | Strontium chloride hexahydrate | 10025-70-4 | 5kg |
| GX3549-500g | Strontium chloride hexahydrate, 99%, ACS grade | 10025-70-4 | 500g |
| GX6973-10g | Strontium chloride hydrate, 99.99+% | 10025-70-4 | 10g |
| GX8262-10g | Strontium fluoride, 99.9% | 7783-48-4 | 10g |
| GX8262-50g | Strontium fluoride, 99.9% | 7783-48-4 | 50g |
| GX7221-10g | Strontium fluoride, 99.99% | 7783-48-4 | 10g |
| GX7221-25g | Strontium fluoride, 99.99% | 7783-48-4 | 25g |
| GX7221-50g | Strontium fluoride, 99.99% | 7783-48-4 | 50g |
| GX3818-250g | Strontium fluoride, 99% | 7783-48-4 | 250g |
| GX1288-500g | Strontium hydroxide, octahydrate, 99+% | 1311-10-0 | 500g |
| GX1288-1kg | Strontium hydroxide, octahydrate, 99+% | 1311-10-0 | 1kg |
| GX0022-50g | Strontium molybdate, 99% | 13470-04-7 | 50g |
| GX1574-50g | Strontium nitrate, 99.99% | 10042-76-9 | 50g |
| GX6363-50g | Strontium nitrate, 99.999% | 10042-76-9 | 50g |
| GK5693-250g | Strontium nitrate, anhydrous, 98% | 10042-76-9 | 250g |
| GK5693-1kg | Strontium nitrate, anhydrous, 98% | 10042-76-9 | 1kg |
| GK5693-5kg | Strontium nitrate, anhydrous, 98% | 10042-76-9 | 5kg |
| GX8751-50g | Strontium oxide, 99.5% | 1314-11-0 | 50g |
| GX0588-100g | Strontium Pieces max. 20 mm, under argon, coated with oil, Ba max. 1%, 99% | 7440-24-6 | 100g |
| GX0495-25g | Strontium Pieces max. 8 mm, under oil, 99.2+% | 7440-24-6 | 25g |
| GX7135-50g | Strontium titanate Nanopowder, 99.9% | 12060-59-2 | 50g |
| GX7135-100g | Strontium titanate Nanopowder, 99.9% | 12060-59-2 | 100g |
| GX7135-250g | Strontium titanate Nanopowder, 99.9% | 12060-59-2 | 250g |
| GX7135-1kg | Strontium titanate Nanopowder, 99.9% | 12060-59-2 | 1kg |
| GX8434-50g | Strontium titanate-Nano Powder, 99.8% | 12060-59-2 | 50g |
| GX8434-100g | Strontium titanate-Nano Powder, 99.8% | 12060-59-2 | 100g |
| GX8434-250g | Strontium titanate-Nano Powder, 99.8% | 12060-59-2 | 250g |
| GX4862-25g | Strontium titanate, 99.9% | 12060-59-2 | 25g |
| GX4862-100g | Strontium titanate, 99.9% | 12060-59-2 | 100g |
| GX1727-250g | Strontium titanate, 99+% | 12060-59-2 | 250g |
| GX0472-10g | Strontium tungstate, 99.9% | 13451-05-3 | 10g |
| GX0472-50g | Strontium tungstate, 99.9% | 13451-05-3 | 50g |
| GX8495-250g | Strontium zirconate, 99+% | 12036-39-4 | 250g |
| GE5799-100mg | Strophanthidin | 66-28-4 | 100mg |
| GE5799-250mg | Strophanthidin | 66-28-4 | 250mg |
| GE5799-500mg | Strophanthidin | 66-28-4 | 500mg |
| GE5799-1g | Strophanthidin | 66-28-4 | 1g |
| GK5565-100g | Suberic acid | 505-48-6 | 100g |
| GL8974-5mg | Suc-Leu-Tyr-AMC | 94367-20-1 | 5mg |
| GK9938-100g | Succinic acid | 110-15-6 | 100g |
| GK9938-250g | Succinic acid | 110-15-6 | 250g |
| GK9938-500g | Succinic acid | 110-15-6 | 500g |
| GK9938-1kg | Succinic acid | 110-15-6 | 1kg |
| GK9938-5kg | Succinic acid | 110-15-6 | 5kg |
| GK7702-100g | Succinic acid disodium salt, anhydrous | 150-90-3 | 100g |
| GK7702-250g | Succinic acid disodium salt, anhydrous | 150-90-3 | 250g |
| GK7702-500g | Succinic acid disodium salt, anhydrous | 150-90-3 | 500g |
| GK7702-1kg | Succinic acid disodium salt, anhydrous | 150-90-3 | 1kg |
| GK7702-5kg | Succinic acid disodium salt, anhydrous | 150-90-3 | 5kg |
| GK7520-100g | Succinic anhydride | 108-30-5 | 100g |
| GK7520-250g | Succinic anhydride | 108-30-5 | 250g |
| GK7520-500g | Succinic anhydride | 108-30-5 | 500g |
| GK7520-1kg | Succinic anhydride | 108-30-5 | 1kg |
| GK7292-25g | Succinimide | 123-56-8 | 25g |
| GL8882-5g | Succinylcholine chloride dihydrate | 6101-15-1 | 5g |
| GA4716-25g | Succinylsulfathiazole | 116-43-8 | 25g |
| GA4716-100g | Succinylsulfathiazole | 116-43-8 | 100g |
| GC9213-5g | Sucralose | 56038-13-2 | 5g |
| GC9213-25g | Sucralose | 56038-13-2 | 25g |
| GC9213-100g | Sucralose | 56038-13-2 | 100g |
| GC9213-250g | Sucralose | 56038-13-2 | 250g |
| GC1410-25g | Sucralose, USP grade | 56038-13-2 | 25g |
| GC1410-100g | Sucralose, USP grade | 56038-13-2 | 100g |
| GC4473-100g | Sucrose | 57-50-1 | 100g |
| GC4473-250g | Sucrose | 57-50-1 | 250g |
| GC4473-500g | Sucrose | 57-50-1 | 500g |
| GC4473-1kg | Sucrose | 57-50-1 | 1kg |
| GC4473-2kg | Sucrose | 57-50-1 | 2kg |
| GC4473-5kg | Sucrose | 57-50-1 | 5kg |
| GC4473-10kg | Sucrose | 57-50-1 | 10kg |
| GC4185-500g | Sucrose benzoate | 12738-64-6 | 500g |
| GC4185-1kg | Sucrose benzoate | 12738-64-6 | 1kg |
| GC8949-250mg | Sucrose monodecanoate | 31835-06-0 | 250mg |
| GC6190-250g | Sucrose octaacetate | 126-14-7 | 250g |
| GC6190-500g | Sucrose octaacetate | 126-14-7 | 500g |
| GC6190-1kg | Sucrose octaacetate | 126-14-7 | 1kg |
| GC1775-1g | Sucrose octasulfate potassium salt | 73264-44-5 | 1g |
| GK4916-250mg | Sucrose octasulfate sodium salt | 74135-10-7 | 250mg |
| GK4916-1g | Sucrose octasulfate sodium salt | 74135-10-7 | 1g |
| GC0234-1g | Sucrose octasulfate-aluminum complex | 54182-58-0 | 1g |
| GC0234-5g | Sucrose octasulfate-aluminum complex | 54182-58-0 | 5g |
| GC0234-10g | Sucrose octasulfate-aluminum complex | 54182-58-0 | 10g |
| GC8364-25g | Sucrose palmitate | 26446-38-8 | 25g |
| GC8364-100g | Sucrose palmitate | 26446-38-8 | 100g |
| GC2889-5g | Sucrose stearate | 25168-73-4 | 5g |
| GC2889-25g | Sucrose stearate | 25168-73-4 | 25g |
| GC3219-100g | Sucrose, BP, EP, USP grade | 57-50-1 | 100g |
| GC3219-250g | Sucrose, BP, EP, USP grade | 57-50-1 | 250g |
| GC3219-1kg | Sucrose, BP, EP, USP grade | 57-50-1 | 1kg |
| GC3219-5kg | Sucrose, BP, EP, USP grade | 57-50-1 | 5kg |
| GC3219-10kg | Sucrose, BP, EP, USP grade | 57-50-1 | 10kg |
| GC3201-1kg | Sucrose, GlenBiol™, suitable for molecular biology | 57-50-1 | 1kg |
| GT7000-10g | Sudan Black B (C.I. 26150) | 4197-25-5 | 10g |
| GT7000-25g | Sudan Black B (C.I. 26150) | 4197-25-5 | 25g |
| GT7000-100g | Sudan Black B (C.I. 26150) | 4197-25-5 | 100g |
| GT5180-25g | Sudan Blue II (C.I. 61554) | 17354-14-2 | 25g |
| GT5180-100g | Sudan Blue II (C.I. 61554) | 17354-14-2 | 100g |
| GT5180-250g | Sudan Blue II (C.I. 61554) | 17354-14-2 | 250g |
| GT4102-25g | Sudan I (C.I. 12055) | 842-07-9 | 25g |
| GT4102-100g | Sudan I (C.I. 12055) | 842-07-9 | 100g |
| GT4102-250g | Sudan I (C.I. 12055) | 842-07-9 | 250g |
| GT4102-500g | Sudan I (C.I. 12055) | 842-07-9 | 500g |
| GT6523-25g | Sudan II (C.I. 12140) | 3118-97-6 | 25g |
| GT6523-100g | Sudan II (C.I. 12140) | 3118-97-6 | 100g |
| GT4766-25g | Sudan III (C.I. 26100) | 85-86-9 | 25g |
| GT4766-100g | Sudan III (C.I. 26100) | 85-86-9 | 100g |
| GT4766-500g | Sudan III (C.I. 26100) | 85-86-9 | 500g |
| GT6404-25g | Sudan IV (C.I. 26105) | 85-83-6 | 25g |
| GT6404-100g | Sudan IV (C.I. 26105) | 85-83-6 | 100g |
| GT6404-250g | Sudan IV (C.I. 26105) | 85-83-6 | 250g |
| GT0292-25g | Sudan IV (C.I. 26105); certified | 85-83-6 | 25g |
| GT0292-100g | Sudan IV (C.I. 26105); certified | 85-83-6 | 100g |
| GT2807-25g | Sudan Orange G (C.I. 11920) | 2051-85-6 | 25g |
| GT2807-100g | Sudan Orange G (C.I. 11920) | 2051-85-6 | 100g |
| GT0394-5g | Sudan Red 7B | 6368-72-5 | 5g |
| GT0394-10g | Sudan Red 7B | 6368-72-5 | 10g |
| GT0394-25g | Sudan Red 7B | 6368-72-5 | 25g |
| GT0394-50g | Sudan Red 7B | 6368-72-5 | 50g |
| GT7815-5g | Sudan Red G (C.I. 12150) | 1229-55-6 | 5g |
| GT7815-25g | Sudan Red G (C.I. 12150) | 1229-55-6 | 25g |
| GT7815-100g | Sudan Red G (C.I. 12150) | 1229-55-6 | 100g |
| GP5265-5g | Sulbactam | 68373-14-8 | 5g |
| GP3240-1g | Sulbactam sodium salt | 69388-84-7 | 1g |
| GP3240-5g | Sulbactam sodium salt | 69388-84-7 | 5g |
| GA6951-25g | Sulfacetamide | 144-80-9 | 25g |
| GA6951-100g | Sulfacetamide | 144-80-9 | 100g |
| GA6951-250g | Sulfacetamide | 144-80-9 | 250g |
| GA4107-25g | Sulfacetamide sodium salt hydrate | 6209-17-2 | 25g |
| GA4107-100g | Sulfacetamide sodium salt hydrate | 6209-17-2 | 100g |
| GA4107-250g | Sulfacetamide sodium salt hydrate | 6209-17-2 | 250g |
| GA4107-500g | Sulfacetamide sodium salt hydrate | 6209-17-2 | 500g |
| GA3238-25g | Sulfadiazine | 68-35-9 | 25g |
| GA3238-50g | Sulfadiazine | 68-35-9 | 50g |
| GA3238-100g | Sulfadiazine | 68-35-9 | 100g |
| GA3238-250g | Sulfadiazine | 68-35-9 | 250g |
| GA3238-1kg | Sulfadiazine | 68-35-9 | 1kg |
| GA7306-25g | Sulfadiazine sodium salt | 547-32-0 | 25g |
| GA7306-100g | Sulfadiazine sodium salt | 547-32-0 | 100g |
| GA2371-10g | Sulfadimethoxine | 122-11-2 | 10g |
| GA2371-25g | Sulfadimethoxine | 122-11-2 | 25g |
| GA2371-100g | Sulfadimethoxine | 122-11-2 | 100g |
| GP2128-5g | Sulfadoxine | 2447-57-6 | 5g |
| GP2128-25g | Sulfadoxine | 2447-57-6 | 25g |
| GA1541-25g | Sulfaguanidine | 57-67-0 | 25g |
| GA1541-100g | Sulfaguanidine | 57-67-0 | 100g |
| GA1541-500g | Sulfaguanidine | 57-67-0 | 500g |
| GA7394-5g | Sulfameter | 651-06-9 | 5g |
| GA4809-25g | Sulfamethazine | 57-68-1 | 25g |
| GA4809-100g | Sulfamethazine | 57-68-1 | 100g |
| GA1560-25g | Sulfamethazine sodium salt | 1981-58-4 | 25g |
| GA1560-100g | Sulfamethazine sodium salt | 1981-58-4 | 100g |
| GA9313-10g | Sulfamethoxazole | 723-46-6 | 10g |
| GA9313-25g | Sulfamethoxazole | 723-46-6 | 25g |
| GA9313-50g | Sulfamethoxazole | 723-46-6 | 50g |
| GA9313-100g | Sulfamethoxazole | 723-46-6 | 100g |
| GW3269-10mg | Sulfamethoxazole hydroxylamine | 114438-33-4 | 10mg |
| GW3269-25mg | Sulfamethoxazole hydroxylamine | 114438-33-4 | 25mg |
| GA2831-5g | Sulfamethoxazole sodium salt | 4563-84-2 | 5g |
| GA2831-25g | Sulfamethoxazole sodium salt | 4563-84-2 | 25g |
| GK7705-100g | Sulfamic acid | 5329-14-6 | 100g |
| GK7705-250g | Sulfamic acid | 5329-14-6 | 250g |
| GK7705-500g | Sulfamic acid | 5329-14-6 | 500g |
| GK7705-1kg | Sulfamic acid | 5329-14-6 | 1kg |
| GA0781-100g | Sulfanilamide | 63-74-1 | 100g |
| GA0781-250g | Sulfanilamide | 63-74-1 | 250g |
| GA0781-500g | Sulfanilamide | 63-74-1 | 500g |
| GT3529-5g | Sulfanilic acid azochromotrop | 23647-14-5 | 5g |
| GT3529-25g | Sulfanilic acid azochromotrop | 23647-14-5 | 25g |
| GT3529-50g | Sulfanilic acid azochromotrop | 23647-14-5 | 50g |
| GT3529-100g | Sulfanilic acid azochromotrop | 23647-14-5 | 100g |
| GK6835-100g | Sulfanilic acid, 98%, tech. | 121-57-3 | 100g |
| GK6835-250g | Sulfanilic acid, 98%, tech. | 121-57-3 | 250g |
| GK6835-500g | Sulfanilic acid, 98%, tech. | 121-57-3 | 500g |
| GK6835-1kg | Sulfanilic acid, 98%, tech. | 121-57-3 | 1kg |
| GK6835-5kg | Sulfanilic acid, 98%, tech. | 121-57-3 | 5kg |
| GK1101-100g | Sulfanilic acid, 99% | 121-57-3 | 100g |
| GK1101-250g | Sulfanilic acid, 99% | 121-57-3 | 250g |
| GK1101-500g | Sulfanilic acid, 99% | 121-57-3 | 500g |
| GK1101-1kg | Sulfanilic acid, 99% | 121-57-3 | 1kg |
| GK1101-5kg | Sulfanilic acid, 99% | 121-57-3 | 5kg |
| GA9084-5g | Sulfaquinoxaline sodium salt | 967-80-6 | 5g |
| GA4287-5g | Sulfasalazine | 599-79-1 | 5g |
| GA4287-25g | Sulfasalazine | 599-79-1 | 25g |
| GP8951-25g | Sulfathiazole | 72-14-0 | 25g |
| GP8951-100g | Sulfathiazole | 72-14-0 | 100g |
| GA2698-25g | Sulfathiazole sodium salt | 144-74-1 | 25g |
| GA2698-100g | Sulfathiazole sodium salt | 144-74-1 | 100g |
| GA1382-5g | Sulfisoxazole | 127-69-5 | 5g |
| GA1382-25g | Sulfisoxazole | 127-69-5 | 25g |
| GW4656-100mg | Sulfluramid | 4151-50-2 | 100mg |
| GW4656-250mg | Sulfluramid | 4151-50-2 | 250mg |
| GW0767-10mg | Sulfo-NHS-LC-Biotin sodium salt | 191671-46-2 | 10mg |
| GW0767-50mg | Sulfo-NHS-LC-Biotin sodium salt | 191671-46-2 | 50mg |
| GK6995-5g | Sulfobromophthalein disodium salt hydrate | 123359-42-2 | 5g |
| GK6995-25g | Sulfobromophthalein disodium salt hydrate | 123359-42-2 | 25g |
| GP8988-5g | Sulfobutyl ether beta-cyclodextrin sodium | 182410-00-0 | 5g |
| GP8988-10g | Sulfobutyl ether beta-cyclodextrin sodium | 182410-00-0 | 10g |
| GP8988-25g | Sulfobutyl ether beta-cyclodextrin sodium | 182410-00-0 | 25g |
| GK6395-1kg | Sulfolane | 126-33-0 | 1kg |
| GT6456-100mg | Sulforhodamine 101 | 60311-02-6 | 100mg |
| GT6456-500mg | Sulforhodamine 101 | 60311-02-6 | 500mg |
| GW5912-5mg | Sulforhodamine 101 acid chloride | 82354-19-6 | 5mg |
| GW5912-100mg | Sulforhodamine 101 acid chloride | 82354-19-6 | 100mg |
| GL0048-5g | Sulforhodamine B sodium salt | 3520-42-1 | 5g |
| GL0048-25g | Sulforhodamine B sodium salt | 3520-42-1 | 25g |
| GX3219-25g | Sulfur Pieces max. 12 mm, 99.999% | 7704-34-9 | 25g |
| GX3219-100g | Sulfur Pieces max. 12 mm, 99.999% | 7704-34-9 | 100g |
| GX6872-25g | Sulfur Pieces max. 7mm, 99.99% | 7704-34-9 | 25g |
| GX6872-100g | Sulfur Pieces max. 7mm, 99.99% | 7704-34-9 | 100g |
| GX9658-500g | Sulfur, refined powder, 99.5% | 7704-34-9 | 500g |
| GK4767-1l | Sulfuric acid | 7664-93-9 | 1l |
| GC2706-1mg | Sulindac acyl-β-D-glucuronide | 60018-36-2 | 1mg |
| GC2706-2mg | Sulindac acyl-β-D-glucuronide | 60018-36-2 | 2mg |
| GC2706-5mg | Sulindac acyl-β-D-glucuronide | 60018-36-2 | 5mg |
| GC2706-10mg | Sulindac acyl-β-D-glucuronide | 60018-36-2 | 10mg |
| GC1435-1mg | Sulindac sulfide acyl-β-D-glucuronide | 59973-78-3 | 1mg |
| GC1435-2mg | Sulindac sulfide acyl-β-D-glucuronide | 59973-78-3 | 2mg |
| GC1435-5mg | Sulindac sulfide acyl-β-D-glucuronide | 59973-78-3 | 5mg |
| GC1435-10mg | Sulindac sulfide acyl-β-D-glucuronide | 59973-78-3 | 10mg |
| GC3795-1mg | Sulindac sulfone acyl-β-D-glucuronide | 60018-37-3 | 1mg |
| GC3795-2mg | Sulindac sulfone acyl-β-D-glucuronide | 60018-37-3 | 2mg |
| GC3795-5mg | Sulindac sulfone acyl-β-D-glucuronide | 60018-37-3 | 5mg |
| GC3795-10mg | Sulindac sulfone acyl-β-D-glucuronide | 60018-37-3 | 10mg |
| GP7278-5g | Sulpiride | 15676-16-1 | 5g |
| GP7278-25g | Sulpiride | 15676-16-1 | 25g |
| GP7278-100g | Sulpiride | 15676-16-1 | 100g |
| GA7670-1g | Sultamicillin tosylate | 83105-70-8 | 1g |
| GP2908-100mg | Sumatriptan succinate | 103628-48-4 | 100mg |
| GP2908-250mg | Sumatriptan succinate | 103628-48-4 | 250mg |
| GP2908-1g | Sumatriptan succinate | 103628-48-4 | 1g |
| GE1230-100g | Sunflower lecithin, liquid | 8002-43-5 | 100g |
| GE1230-500g | Sunflower lecithin, liquid | 8002-43-5 | 500g |
| GE1230-1kg | Sunflower lecithin, liquid | 8002-43-5 | 1kg |
| GK2233-100ml | Sunflower seed oil | 8001-21-6 | 100ml |
| GK2233-250ml | Sunflower seed oil | 8001-21-6 | 250ml |
| GP2160-10mg | Sunitinib malate | 341031-54-7 | 10mg |
| GP2160-50mg | Sunitinib malate | 341031-54-7 | 50mg |
| GP2160-100mg | Sunitinib malate | 341031-54-7 | 100mg |
| GT7438-25g | Sunset Yellow FCF | 2783-94-0 | 25g |
| GT7438-100g | Sunset Yellow FCF | 2783-94-0 | 100g |
| GP0138-10mg | Suramin sodium salt | 129-46-4 | 10mg |
| GP0138-50mg | Suramin sodium salt | 129-46-4 | 50mg |
| GA4790-1mg | Swainsonine | 72741-87-8 | 1mg |
| GA4790-2mg | Swainsonine | 72741-87-8 | 2mg |
| GA4790-5mg | Swainsonine | 72741-87-8 | 5mg |
| GA4790-10mg | Swainsonine | 72741-87-8 | 10mg |
| GA4790-25mg | Swainsonine | 72741-87-8 | 25mg |
| GC8235-25mg | Swertiamarin | 17388-39-5 | 25mg |
| GL0219-10ug | Swinholide A | 95927-67-6 | 10ug |
| GL0219-50ug | Swinholide A | 95927-67-6 | 50ug |
| GK8261-5g | Syringic acid | 530-57-4 | 5g |
| GK8261-25g | Syringic acid | 530-57-4 | 25g |
| GK8261-100g | Syringic acid | 530-57-4 | 100g |
| GC0704-10mg | Syringin | 118-34-3 | 10mg |
| GW6303-1mg | T-2 Toxin | 21259-20-1 | 1mg |
| GW6303-5mg | T-2 Toxin | 21259-20-1 | 5mg |
| GL6126-10mg | T0901317 | 293754-55-9 | 10mg |
| GL6126-50mg | T0901317 | 293754-55-9 | 50mg |
| GZ9900-1KIU | T4 DNA Ligase, expressed in E. coli | 9015-85-4 | 1KIU |
| GZ9900-5KIU | T4 DNA Ligase, expressed in E. coli | 9015-85-4 | 5KIU |
| GP1913-10mg | Tacrine | 321-64-2 | 10mg |
| GP0380-1g | Tadalafil | 171596-29-5 | 1g |
| GP0380-5g | Tadalafil | 171596-29-5 | 5g |
| GB0692-1l | TAE Buffer (Tris-acetate-EDTA) (10X) | - | 1l |
| GB0692-2500ml | TAE Buffer (Tris-acetate-EDTA) (10X) | - | 2500ml |
| GB8437-250ml | TAE Buffer (Tris-acetate-EDTA) (50X) | - | 250ml |
| GB8437-1l | TAE Buffer (Tris-acetate-EDTA) (50X) | - | 1l |
| GB8437-2500ml | TAE Buffer (Tris-acetate-EDTA) (50X) | - | 2500ml |
| GW1397-1mg | TAE684 | 761439-42-3 | 1mg |
| GW1397-5mg | TAE684 | 761439-42-3 | 5mg |
| GW1397-10mg | TAE684 | 761439-42-3 | 10mg |
| GC0558-1mg | Tafamidis acyl-β-D-glucuronide | 1mg | |
| GC0558-2mg | Tafamidis acyl-β-D-glucuronide | 2mg | |
| GC0558-5mg | Tafamidis acyl-β-D-glucuronide | 5mg | |
| GC0558-10mg | Tafamidis acyl-β-D-glucuronide | 10mg | |
| GW3736-1mg | TAK-285 | 871026-44-7 | 1mg |
| GW3736-5mg | TAK-285 | 871026-44-7 | 5mg |
| GW3736-10mg | TAK-285 | 871026-44-7 | 10mg |
| GW3025-1mg | TAK-632 | 1228591-30-7 | 1mg |
| GW3025-5mg | TAK-632 | 1228591-30-7 | 5mg |
| GW3025-10mg | TAK-632 | 1228591-30-7 | 10mg |
| GW0519-1mg | TAK-715 | 303162-79-0 | 1mg |
| GW0519-5mg | TAK-715 | 303162-79-0 | 5mg |
| GW0519-10mg | TAK-715 | 303162-79-0 | 10mg |
| GW9168-1mg | Takeda-6d | 1125632-93-0 | 1mg |
| GW9168-5mg | Takeda-6d | 1125632-93-0 | 5mg |
| GW9168-10mg | Takeda-6d | 1125632-93-0 | 10mg |
| GW8231-10mg | Talabostat . mesylate | 150080-09-4 | 10mg |
| GW8231-50mg | Talabostat . mesylate | 150080-09-4 | 50mg |
| GK0095-100g | Talc powder | 14807-96-6 | 100g |
| GK0095-500g | Talc powder | 14807-96-6 | 500g |
| GK0095-1kg | Talc powder | 14807-96-6 | 1kg |
| GK0095-2500g | Talc powder | 14807-96-6 | 2500g |
| GM4942-5g | TAME Hydrochloride | 1784-03-8 | 5g |
| GA9513-500mg | Tamoxifen | 10540-29-1 | 500mg |
| GA9513-1g | Tamoxifen | 10540-29-1 | 1g |
| GA9513-5g | Tamoxifen | 10540-29-1 | 5g |
| GP8512-1g | Tamoxifen citrate salt | 54965-24-1 | 1g |
| GP8512-5g | Tamoxifen citrate salt | 54965-24-1 | 5g |
| GP0811-100mg | Tamsulosin hydrochloride | 106463-17-6 | 100mg |
| GP0811-250mg | Tamsulosin hydrochloride | 106463-17-6 | 250mg |
| GP0811-1g | Tamsulosin hydrochloride | 106463-17-6 | 1g |
| GP3628-1mg | Tandutinib | 387867-13-2 | 1mg |
| GP3628-5mg | Tandutinib | 387867-13-2 | 5mg |
| GP3628-10mg | Tandutinib | 387867-13-2 | 10mg |
| GA2100-5mg | Tangeretin | 481-53-8 | 5mg |
| GA2100-10mg | Tangeretin | 481-53-8 | 10mg |
| GA2100-25mg | Tangeretin | 481-53-8 | 25mg |
| GC8015-25g | Tannic acid | 1401-55-4 | 25g |
| GC8015-100g | Tannic acid | 1401-55-4 | 100g |
| GC8015-250g | Tannic acid | 1401-55-4 | 250g |
| GC8015-500g | Tannic acid | 1401-55-4 | 500g |
| GC8015-1kg | Tannic acid | 1401-55-4 | 1kg |
| GP2773-5mg | Tanshinone I | 568-73-0 | 5mg |
| GP2773-25mg | Tanshinone I | 568-73-0 | 25mg |
| GP2434-5mg | Tanshinone IIA | 568-72-9 | 5mg |
| GP2434-25mg | Tanshinone IIA | 568-72-9 | 25mg |
| GP2434-100mg | Tanshinone IIA | 568-72-9 | 100mg |
| GX0042-25g | Tantalum boride, 99% | 12007-07-7 | 25g |
| GX1518-25g | Tantalum boride, 99+% | 12007-35-1 | 25g |
| GX9092-50x50mm | Tantalum Foil 0.025 mm, 99.9+% | 7440-25-7 | 50x50mm |
| GX9092-50x100mm | Tantalum Foil 0.025 mm, 99.9+% | 7440-25-7 | 50x100mm |
| GX9092-100x100mm | Tantalum Foil 0.025 mm, 99.9+% | 7440-25-7 | 100x100mm |
| GX9092-150x150mm | Tantalum Foil 0.025 mm, 99.9+% | 7440-25-7 | 150x150mm |
| GX6275-50x50mm | Tantalum Foil 0.05 mm, 99.9% | 7440-25-7 | 50x50mm |
| GX6275-100x100mm | Tantalum Foil 0.05 mm, 99.9% | 7440-25-7 | 100x100mm |
| GX6275-150x150mm | Tantalum Foil 0.05 mm, 99.9% | 7440-25-7 | 150x150mm |
| GX1606-50x50mm | Tantalum Foil 0.1 mm, 99.9+% | 7440-25-7 | 50x50mm |
| GX1606-100x100mm | Tantalum Foil 0.1 mm, 99.9+% | 7440-25-7 | 100x100mm |
| GX1606-70x200mm | Tantalum Foil 0.1 mm, 99.9+% | 7440-25-7 | 70x200mm |
| GX1606-50x200mm | Tantalum Foil 0.1 mm, 99.9+% | 7440-25-7 | 50x200mm |
| GX1606-100x200mm | Tantalum Foil 0.1 mm, 99.9+% | 7440-25-7 | 100x200mm |
| GX1920-100x200mm | Tantalum Foil 0.2 mm, blank, 99.9% | 7440-25-7 | 100x200mm |
| GX4712-100x100mm | Tantalum Foil 0.25 mm, 99.9+% | 7440-25-7 | 100x100mm |
| GX4712-100x200mm | Tantalum Foil 0.25 mm, 99.9+% | 7440-25-7 | 100x200mm |
| GX5549-100x100mm | Tantalum Foil 0.5 mm, 99.9+% | 7440-25-7 | 100x100mm |
| GX5549-100x200mm | Tantalum Foil 0.5 mm, 99.9+% | 7440-25-7 | 100x200mm |
| GX4531-50x50mm | Tantalum Foil 0.7 mm, 99.9% | 7440-25-7 | 50x50mm |
| GX4531-50x100mm | Tantalum Foil 0.7 mm, 99.9% | 7440-25-7 | 50x100mm |
| GX4531-100x100mm | Tantalum Foil 0.7 mm, 99.9% | 7440-25-7 | 100x100mm |
| GX7306-50x100mm | Tantalum Foil 1.0 mm, 99.9+% | 7440-25-7 | 50x100mm |
| GX3093-25x50mm | Tantalum Foil 2.0 mm, 99.9% | 7440-25-7 | 25x50mm |
| GX3093-50x50mm | Tantalum Foil 2.0 mm, 99.9% | 7440-25-7 | 50x50mm |
| GX3404-10g | Tantalum Nanopowder, 99+ % | 7440-25-7 | 10g |
| GX3404-25g | Tantalum Nanopowder, 99+ % | 7440-25-7 | 25g |
| GX3404-50g | Tantalum Nanopowder, 99+ % | 7440-25-7 | 50g |
| GX7711-10g | Tantalum nitride, 99.5% | 12033-62-4 | 10g |
| GX7711-50g | Tantalum nitride, 99.5% | 12033-62-4 | 50g |
| GX2318-50g | Tantalum Pellets 5-12 mm diameter, 99.9+% | 7440-25-7 | 50g |
| GX2318-250g | Tantalum Pellets 5-12 mm diameter, 99.9+% | 7440-25-7 | 250g |
| GX7742-25g | Tantalum Pellets 6 x 6 mm, 99.9+% | 7440-25-7 | 25g |
| GX7742-100g | Tantalum Pellets 6 x 6 mm, 99.9+% | 7440-25-7 | 100g |
| GX9648-25g | Tantalum Powder max. 100 micron, 99.9+% | 7440-25-7 | 25g |
| GX9648-50g | Tantalum Powder max. 100 micron, 99.9+% | 7440-25-7 | 50g |
| GX9648-250g | Tantalum Powder max. 100 micron, 99.9+% | 7440-25-7 | 250g |
| GX6010-50mm | Tantalum Rod 10 mm diameter, 99.9+% | 7440-25-7 | 50mm |
| GX9402-100mm | Tantalum Rod 5 mm diameter, 99.9+% | 7440-25-7 | 100mm |
| GX7036-100mm | Tantalum Rod 6 mm diameter, 99.9+% | 7440-25-7 | 100mm |
| GX7894-10g | Tantalum silicide, 99.5% | 12039-79-1 | 10g |
| GX7894-25g | Tantalum silicide, 99.5% | 12039-79-1 | 25g |
| GX7894-100g | Tantalum silicide, 99.5% | 12039-79-1 | 100g |
| GX2012-1m | Tantalum Tube 8.0 mm diameter, 0.4 mm wall thickness, 99.9% | 7440-25-7 | 1m |
| GX1767-10m | Tantalum Wire 0.1 mm diameter, 99.9+% | 7440-25-7 | 10m |
| GX1767-50m | Tantalum Wire 0.1 mm diameter, 99.9+% | 7440-25-7 | 50m |
| GX1706-10m | Tantalum Wire 0.25 mm diameter, 99.9+% | 7440-25-7 | 10m |
| GX1706-50m | Tantalum Wire 0.25 mm diameter, 99.9+% | 7440-25-7 | 50m |
| GX8414-5m | Tantalum Wire 0.5 mm diameter, 99.9+% | 7440-25-7 | 5m |
| GX8414-25m | Tantalum Wire 0.5 mm diameter, 99.9+% | 7440-25-7 | 25m |
| GX1293-2m | Tantalum Wire 0.8 mm diameter, 99.9+% | 7440-25-7 | 2m |
| GX1293-10m | Tantalum Wire 0.8 mm diameter, 99.9+% | 7440-25-7 | 10m |
| GX0501-2m | Tantalum Wire 1.0 mm diameter, 99.9+% | 7440-25-7 | 2m |
| GX0501-10m | Tantalum Wire 1.0 mm diameter, 99.9+% | 7440-25-7 | 10m |
| GX5078-1m | Tantalum Wire 1.5 mm diameter, 99.9+% | 7440-25-7 | 1m |
| GX6270-50cm | Tantalum Wire 2.0 mm diameter, 99.9+% | 7440-25-7 | 50cm |
| GX5719-10cm | Tantalum Wire 3 mm diameter, 99.9+% | 7440-25-7 | 10cm |
| GX5719-50cm | Tantalum Wire 3 mm diameter, 99.9+% | 7440-25-7 | 50cm |
| GX1587-10g | Tantalum(V) fluoride, 99% | 7783-71-3 | 10g |
| GX7236-25g | Tantalum(V) iodide, 99.9% | 14693-81-3 | 25g |
| GX8872-50g | Tantalum(V) oxide tablets , 99.95% | 1314-61-0 | 50g |
| GX9831-25g | Tantalum(V) oxide, 99.9% | 1314-61-0 | 25g |
| GX9831-100g | Tantalum(V) oxide, 99.9% | 1314-61-0 | 100g |
| GX9831-500g | Tantalum(V) oxide, 99.9% | 1314-61-0 | 500g |
| GX4699-50g | Tantalum(V) oxide, 99.95% | 1314-61-0 | 50g |
| GX3730-10g | Tantalum(V) oxide, 99.99% | 1314-61-0 | 10g |
| GX3730-50g | Tantalum(V) oxide, 99.99% | 1314-61-0 | 50g |
| GX3730-250g | Tantalum(V) oxide, 99.99% | 1314-61-0 | 250g |
| GX8163-50g | Tantalum(V) oxide, 99% | 1314-61-0 | 50g |
| GX8163-100g | Tantalum(V) oxide, 99% | 1314-61-0 | 100g |
| GC1337-1mg | Tapentadol O-β-D-glucuronide | 1300037-86-8 | 1mg |
| GC1337-2mg | Tapentadol O-β-D-glucuronide | 1300037-86-8 | 2mg |
| GC1337-5mg | Tapentadol O-β-D-glucuronide | 1300037-86-8 | 5mg |
| GC1337-10mg | Tapentadol O-β-D-glucuronide | 1300037-86-8 | 10mg |
| GB2435-25g | TAPS | 29915-38-6 | 25g |
| GB2435-100g | TAPS | 29915-38-6 | 100g |
| GB2435-250g | TAPS | 29915-38-6 | 250g |
| GB2435-500g | TAPS | 29915-38-6 | 500g |
| GB2435-1kg | TAPS | 29915-38-6 | 1kg |
| GB0912-25g | TAPS sodium salt | 91000-53-2 | 25g |
| GB0912-100g | TAPS sodium salt | 91000-53-2 | 100g |
| GB0912-500g | TAPS sodium salt | 91000-53-2 | 500g |
| GB6970-25g | TAPSO | 68399-81-5 | 25g |
| GB6970-100g | TAPSO | 68399-81-5 | 100g |
| GB6970-250g | TAPSO | 68399-81-5 | 250g |
| GB6970-500g | TAPSO | 68399-81-5 | 500g |
| GB6970-1kg | TAPSO | 68399-81-5 | 1kg |
| GB1759-25g | TAPSO sodium salt | 105140-25-8 | 25g |
| GB1759-100g | TAPSO sodium salt | 105140-25-8 | 100g |
| GZ6623-1KIU | Taq Polymerase from Thermus aquaticus, expressed in E. coli | 9012-90-2 | 1KIU |
| GZ6623-5KIU | Taq Polymerase from Thermus aquaticus, expressed in E. coli | 9012-90-2 | 5KIU |
| GC1982-1mg | Tarenflurbil acyl-β-D-glucuronide | 162992-67-8 | 1mg |
| GC1982-2mg | Tarenflurbil acyl-β-D-glucuronide | 162992-67-8 | 2mg |
| GC1982-5mg | Tarenflurbil acyl-β-D-glucuronide | 162992-67-8 | 5mg |
| GC1982-10mg | Tarenflurbil acyl-β-D-glucuronide | 162992-67-8 | 10mg |
| GT5596-25g | Tartrazine (C.I. 19140) | 1934-21-0 | 25g |
| GT5596-100g | Tartrazine (C.I. 19140) | 1934-21-0 | 100g |
| GT5596-500g | Tartrazine (C.I. 19140) | 1934-21-0 | 500g |
| GE8383-100ml | Tartrazine solution | 1934-21-0 | 100ml |
| GE8383-250ml | Tartrazine solution | 1934-21-0 | 250ml |
| GW3874-1mg | TASP0415914 | 1292300-75-4 | 1mg |
| GW3874-5mg | TASP0415914 | 1292300-75-4 | 5mg |
| GW3874-10mg | TASP0415914 | 1292300-75-4 | 10mg |
| GP1188-25g | Taurine | 107-35-7 | 25g |
| GP1188-100g | Taurine | 107-35-7 | 100g |
| GP1188-250g | Taurine | 107-35-7 | 250g |
| GP1188-500g | Taurine | 107-35-7 | 500g |
| GP1188-1kg | Taurine | 107-35-7 | 1kg |
| GP1188-5kg | Taurine | 107-35-7 | 5kg |
| GA2906-1g | Taurolidine | 19388-87-5 | 1g |
| GA2906-5g | Taurolidine | 19388-87-5 | 5g |
| GL9057-100mg | Taxifolin | 480-18-2 | 100mg |
| GA7262-100mg | Tazobactam | 89786-04-9 | 100mg |
| GA7262-1g | Tazobactam | 89786-04-9 | 1g |
| GA5074-250mg | Tazobactam sodium salt | 89785-84-2 | 250mg |
| GA5074-1g | Tazobactam sodium salt | 89785-84-2 | 1g |
| GK1120-5mg | TBB | 17374-26-4 | 5mg |
| GK1120-25mg | TBB | 17374-26-4 | 25mg |
| GL9905-1mg | TBBz | 577779-57-8 | 1mg |
| GB0761-1l | TBE Buffer (Tris-Borate-EDTA) (10X) | - | 1l |
| GB0761-2500ml | TBE Buffer (Tris-Borate-EDTA) (10X) | - | 2500ml |
| GB6999-1l | TBE Buffer (Tris-Borate-EDTA) (5X) | - | 1l |
| GB6999-2500ml | TBE Buffer (Tris-Borate-EDTA) (5X) | - | 2500ml |
| GE5057-5g | TBTU | 125700-67-6 | 5g |
| GE5057-25g | TBTU | 125700-67-6 | 25g |
| GE5057-100g | TBTU | 125700-67-6 | 100g |
| GE5057-250g | TBTU | 125700-67-6 | 250g |
| GE5057-500g | TBTU | 125700-67-6 | 500g |
| GE3566-5g | TCTU | 330641-16-2 | 5g |
| GE3566-25g | TCTU | 330641-16-2 | 25g |
| GE3566-100g | TCTU | 330641-16-2 | 100g |
| GL4346-5mg | TDZD-8 | 327036-89-5 | 5mg |
| GL4346-25mg | TDZD-8 | 327036-89-5 | 25mg |
| GK8936-100ml | Tea tree oil | 68647-73-4 | 100ml |
| GK8936-1kg | Tea tree oil | 68647-73-4 | 1kg |
| GP2443-25mg | Tegaserod maleate | 189188-57-6 | 25mg |
| GP2443-100mg | Tegaserod maleate | 189188-57-6 | 100mg |
| GA8806-100mg | Teicoplanin | 61036-62-2 | 100mg |
| GA8806-250mg | Teicoplanin | 61036-62-2 | 250mg |
| GA8806-500mg | Teicoplanin | 61036-62-2 | 500mg |
| GA8806-1g | Teicoplanin | 61036-62-2 | 1g |
| GP5773-10mg | Telaprevir | 402957-28-2 | 10mg |
| GP5773-50mg | Telaprevir | 402957-28-2 | 50mg |
| GA5905-100ug | Telatinib | 75747-14-7 | 100ug |
| GA5905-1mg | Telatinib | 75747-14-7 | 1mg |
| GA5905-5mg | Telatinib | 75747-14-7 | 5mg |
| GC4386-100mg | Telbivudine | 3424-98-4 | 100mg |
| GA2425-10mg | Telithromycin | 191114-48-4 | 10mg |
| GA2425-50mg | Telithromycin | 191114-48-4 | 50mg |
| GA2425-100mg | Telithromycin | 191114-48-4 | 100mg |
| GX6241-25g | Telluric acid | 7803-68-1 | 25g |
| GX6241-100g | Telluric acid | 7803-68-1 | 100g |
| GX5929-100g | Tellurium Bar, zone refined, 99.9999% | 13494-80-9 | 100g |
| GX6413-25g | Tellurium bromide, 99.9% | 10031-27-3 | 25g |
| GX2288-25g | Tellurium chloride, 99.9% | 10026-07-0 | 25g |
| GX6776-25g | Tellurium chloride, 99% | 10026-07-0 | 25g |
| GX6960-25g | Tellurium oxide, 99.999% | 7446-07-3 | 25g |
| GX6960-100g | Tellurium oxide, 99.999% | 7446-07-3 | 100g |
| GX1730-25g | Tellurium Pieces, low oxygen, 99.999% | 13494-80-9 | 25g |
| GX1730-100g | Tellurium Pieces, low oxygen, 99.999% | 13494-80-9 | 100g |
| GX1730-250g | Tellurium Pieces, low oxygen, 99.999% | 13494-80-9 | 250g |
| GX1402-25g | Tellurium Pieces, zone refined, 99.9999% | 13494-80-9 | 25g |
| GX1402-100g | Tellurium Pieces, zone refined, 99.9999% | 13494-80-9 | 100g |
| GX8691-100g | Tellurium Powder -200 mesh, 99.8+% | 13494-80-9 | 100g |
| GX3953-25g | Tellurium Powder -30 mesh, 99.99% | 13494-80-9 | 25g |
| GX3953-100g | Tellurium Powder -30 mesh, 99.99% | 13494-80-9 | 100g |
| GX8953-25g | Tellurium Powder max. 250 micron, 99.999% | 13494-80-9 | 25g |
| GX8953-100g | Tellurium Powder max. 250 micron, 99.999% | 13494-80-9 | 100g |
| GP9498-1g | Telmisartan | 144701-48-4 | 1g |
| GP9498-5g | Telmisartan | 144701-48-4 | 5g |
| GC3131-1mg | Telmisartan acyl-b-D-glucuronide | 250780-40-6 | 1mg |
| GC3131-2mg | Telmisartan acyl-b-D-glucuronide | 250780-40-6 | 2mg |
| GC3131-5mg | Telmisartan acyl-b-D-glucuronide | 250780-40-6 | 5mg |
| GC3131-10mg | Telmisartan acyl-b-D-glucuronide | 250780-40-6 | 10mg |
| GP6174-250mg | Temozolomide | 85622-93-1 | 250mg |
| GP6174-1g | Temozolomide | 85622-93-1 | 1g |
| GP6174-5g | Temozolomide | 85622-93-1 | 5g |
| GK6347-5g | TEMPO | 2564-83-2 | 5g |
| GK6347-25g | TEMPO | 2564-83-2 | 25g |
| GK6347-100g | TEMPO | 2564-83-2 | 100g |
| GP2668-10mg | Teniposide | 29767-20-2 | 10mg |
| GP2668-100mg | Teniposide | 29767-20-2 | 100mg |
| GP5400-100mg | Tenofovir | 147127-20-6 | 100mg |
| GP5075-1g | Tenoxicam | 59804-37-4 | 1g |
| GW6294-1mg | TEPP46 [ML-265] | 1221186-53-3 | 1mg |
| GW6294-5mg | TEPP46 [ML-265] | 1221186-53-3 | 5mg |
| GW6294-25mg | TEPP46 [ML-265] | 1221186-53-3 | 25mg |
| GA7211-100mg | Terbinafine hydrochloride | 78628-80-5 | 100mg |
| GA7211-250mg | Terbinafine hydrochloride | 78628-80-5 | 250mg |
| GA7211-1g | Terbinafine hydrochloride | 78628-80-5 | 1g |
| GX2475-5g | Terbium acetate hydrate, 99.9% | 16922-07-9 | 5g |
| GX2475-25g | Terbium acetate hydrate, 99.9% | 16922-07-9 | 25g |
| GX1946-5g | Terbium carbonate hydrate, 99.9% | 6067-34-1 | 5g |
| GX1946-25g | Terbium carbonate hydrate, 99.9% | 6067-34-1 | 25g |
| GX8364-5g | Terbium carbonate hydrate, 99.999% | 6067-34-1 | 5g |
| GX8364-25g | Terbium carbonate hydrate, 99.999% | 6067-34-1 | 25g |
| GX8078-1g | Terbium Chips, 99.9% | 7440-27-9 | 1g |
| GX8078-5g | Terbium Chips, 99.9% | 7440-27-9 | 5g |
| GX6357-2g | Terbium chloride anhydrous, 99.9% | 10042-88-3 | 2g |
| GX3714-10g | Terbium chloride hydrate, 99.9% | 13798-24-8 | 10g |
| GX3714-50g | Terbium chloride hydrate, 99.9% | 13798-24-8 | 50g |
| GX4407-5g | Terbium chloride hydrate, 99.99% | 13798-24-8 | 5g |
| GX4407-25g | Terbium chloride hydrate, 99.99% | 13798-24-8 | 25g |
| GX2628-5g | Terbium chloride hydrate, 99.999% | 13798-24-8 | 5g |
| GX2628-25g | Terbium chloride hydrate, 99.999% | 13798-24-8 | 25g |
| GX1833-5g | Terbium fluoride, 99.9% | 13708-63-9 | 5g |
| GX1833-25g | Terbium fluoride, 99.9% | 13708-63-9 | 25g |
| GX7865-5g | Terbium fluoride, 99.999% | 13708-63-9 | 5g |
| GX7865-25g | Terbium fluoride, 99.999% | 13708-63-9 | 25g |
| GX3388-25x50mm | Terbium Foil 0.25mm, 99.9% | 7440-27-9 | 25x50mm |
| GX3640-10g | Terbium oxide, 99.9% | 12037-01-3 | 10g |
| GX3640-25g | Terbium oxide, 99.9% | 12037-01-3 | 25g |
| GX3640-100g | Terbium oxide, 99.9% | 12037-01-3 | 100g |
| GX1359-5g | Terbium oxide, 99.99% | 12037-01-3 | 5g |
| GX1359-10g | Terbium oxide, 99.99% | 12037-01-3 | 10g |
| GX1359-50g | Terbium oxide, 99.99% | 12037-01-3 | 50g |
| GX2041-1g | Terbium oxide, 99.999% | 12037-01-3 | 1g |
| GX2041-5g | Terbium oxide, 99.999% | 12037-01-3 | 5g |
| GX2041-25g | Terbium oxide, 99.999% | 12037-01-3 | 25g |
| GX5472-10g | Terbium oxide, 99.999%, ampouled, low gas content | 12037-01-3 | 10g |
| GX1231-5g | Terbium Pieces distilled, 99.99% | 7440-27-9 | 5g |
| GX1231-10g | Terbium Pieces distilled, 99.99% | 7440-27-9 | 10g |
| GX6615-2g | Terbium Pieces, 99.9% | 7440-27-9 | 2g |
| GX6615-10g | Terbium Pieces, 99.9% | 7440-27-9 | 10g |
| GX9185-1g | Terbium Powder, 99.9% | 7440-27-9 | 1g |
| GX9185-5g | Terbium Powder, 99.9% | 7440-27-9 | 5g |
| GX9932-10cm | Terbium Wire 1 mm diameter, 99.9% | 7440-27-9 | 10cm |
| GK1414-25g | Terephthalaldehyde | 623-27-8 | 25g |
| GK1161-25g | Terephthalic acid | 100-21-0 | 25g |
| GK4960-25g | Terephthaloyl chloride | 100-20-9 | 25g |
| GP2305-100mg | Terfenadine | 50679-08-8 | 100mg |
| GD5718-1l | Tergitol 15-S-9 | 84133-50-6 | 1l |
| GD5718-5l | Tergitol 15-S-9 | 84133-50-6 | 5l |
| GL9892-250ug | Terpendole C | 156967-65-6 | 250ug |
| GL9892-1mg | Terpendole C | 156967-65-6 | 1mg |
| GL4961-250ug | Terpendole E | 167427-23-8 | 250ug |
| GL4961-1mg | Terpendole E | 167427-23-8 | 1mg |
| GW3941-1g | Terpyridine | 1148-79-4 | 1g |
| GW3941-5g | Terpyridine | 1148-79-4 | 5g |
| GW0390-1mg | Terreic acid | 121-40-4 | 1mg |
| GW0390-5mg | Terreic acid | 121-40-4 | 5mg |
| GA2739-1mg | Terrein | 582-46-7 | 1mg |
| GA2739-5mg | Terrein | 582-46-7 | 5mg |
| GA2739-10mg | Terrein | 582-46-7 | 10mg |
| GL2491-500ug | Territrem B | 70407-20-4 | 500ug |
| GL2491-1mg | Territrem B | 70407-20-4 | 1mg |
| GK8834-100ml | tert-Butyl acetate | 540-88-5 | 100ml |
| GK7414-25g | tert-Butyl bromoacetate | 5292-43-3 | 25g |
| GK7414-100g | tert-Butyl bromoacetate | 5292-43-3 | 100g |
| GK9215-25g | tert-Butyldimethylchlorosilane | 18162-48-6 | 25g |
| GK1425-100g | tert-Butylhydroquinone | 1948-33-0 | 100g |
| GK1425-500g | tert-Butylhydroquinone | 1948-33-0 | 500g |
| GK1425-1kg | tert-Butylhydroquinone | 1948-33-0 | 1kg |
| GK5635-100ml | tert-Butylmethylether | 1634-04-4 | 100ml |
| GB0507-25g | TES | 7365-44-8 | 25g |
| GB0507-100g | TES | 7365-44-8 | 100g |
| GB0507-250g | TES | 7365-44-8 | 250g |
| GB0507-500g | TES | 7365-44-8 | 500g |
| GB0507-1kg | TES | 7365-44-8 | 1kg |
| GB4016-25g | TES sodium salt | 70331-82-7 | 25g |
| GB4016-100g | TES sodium salt | 70331-82-7 | 100g |
| GB4016-250g | TES sodium salt | 70331-82-7 | 250g |
| GB4016-500g | TES sodium salt | 70331-82-7 | 500g |
| GK4143-5g | Tetra-n-butylammonium tetrafluoroborate | 429-42-5 | 5g |
| GK4143-25g | Tetra-n-butylammonium tetrafluoroborate | 429-42-5 | 25g |
| GK4143-100g | Tetra-n-butylammonium tetrafluoroborate | 429-42-5 | 100g |
| GK4143-250g | Tetra-n-butylammonium tetrafluoroborate | 429-42-5 | 250g |
| GK7070-5g | Tetra-n-butylammonium trifluoromethanesulfonate | 35895-70-6 | 5g |
| GK7070-10g | Tetra-n-butylammonium trifluoromethanesulfonate | 35895-70-6 | 10g |
| GX1758-1g | Tetraammine platinum(II) chloride hydrate | 13933-32-9 | 1g |
| GX1758-5g | Tetraammine platinum(II) chloride hydrate | 13933-32-9 | 5g |
| GX9386-5g | Tetraammine platinum(II) chloride solution | 13933-32-9 | 5g |
| GX9386-25g | Tetraammine platinum(II) chloride solution | 13933-32-9 | 25g |
| GX0154-25g | Tetraammine platinum(II) hydroxide solution | 38201-97-7 | 25g |
| GX8736-5g | Tetraamminepalladium(II) chloride solution | 13815-17-3 | 5g |
| GX8736-25g | Tetraamminepalladium(II) chloride solution | 13815-17-3 | 25g |
| GX2028-1g | Tetraamminepalladium(II) chloride, 99.95% (metals basis) | 13815-17-3 | 1g |
| GX2028-5g | Tetraamminepalladium(II) chloride, 99.95% (metals basis) | 13815-17-3 | 5g |
| GX8052-10g | Tetraamminepalladium(II) nitrate solution (up to 6% Pd) | 13601-08-6 | 10g |
| GK6994-25g | Tetrabutylammonium bromide | 1643-19-2 | 25g |
| GK6994-100g | Tetrabutylammonium bromide | 1643-19-2 | 100g |
| GK6994-250g | Tetrabutylammonium bromide | 1643-19-2 | 250g |
| GK6994-500g | Tetrabutylammonium bromide | 1643-19-2 | 500g |
| GK6994-1kg | Tetrabutylammonium bromide | 1643-19-2 | 1kg |
| GK2828-25g | Tetrabutylammonium bromide, 99%, HPLC grade | 1643-19-2 | 25g |
| GX7906-100g | Tetrabutylammonium chloride | 1112-67-0 | 100g |
| GK4271-1g | Tetrabutylammonium dihydrogen phosphate | 5574-97-0 | 1g |
| GK4271-5g | Tetrabutylammonium dihydrogen phosphate | 5574-97-0 | 5g |
| GK4271-10g | Tetrabutylammonium dihydrogen phosphate | 5574-97-0 | 10g |
| GK4271-25g | Tetrabutylammonium dihydrogen phosphate | 5574-97-0 | 25g |
| GX3285-1g | Tetrabutylammonium dihydrogen phosphate, 99% | 5574-97-0 | 1g |
| GX3285-5g | Tetrabutylammonium dihydrogen phosphate, 99% | 5574-97-0 | 5g |
| GX3285-25g | Tetrabutylammonium dihydrogen phosphate, 99% | 5574-97-0 | 25g |
| GK1300-10g | Tetrabutylammonium fluoride trihydrate | 87749-50-6 | 10g |
| GK1300-25g | Tetrabutylammonium fluoride trihydrate | 87749-50-6 | 25g |
| GK1300-50g | Tetrabutylammonium fluoride trihydrate | 87749-50-6 | 50g |
| GK1300-100g | Tetrabutylammonium fluoride trihydrate | 87749-50-6 | 100g |
| GK3008-25g | Tetrabutylammonium hexafluorophosphate | 3109-63-5 | 25g |
| GK3008-100g | Tetrabutylammonium hexafluorophosphate | 3109-63-5 | 100g |
| GK0881-25g | Tetrabutylammonium hydrogen sulfate | 32503-27-8 | 25g |
| GK0881-100g | Tetrabutylammonium hydrogen sulfate | 32503-27-8 | 100g |
| GK0881-250g | Tetrabutylammonium hydrogen sulfate | 32503-27-8 | 250g |
| GK0881-500g | Tetrabutylammonium hydrogen sulfate | 32503-27-8 | 500g |
| GK6528-25ml | Tetrabutylammonium hydroxide 40% solution in water | 2052-49-5 | 25ml |
| GK6528-100ml | Tetrabutylammonium hydroxide 40% solution in water | 2052-49-5 | 100ml |
| GK9010-10g | Tetrabutylammonium iodide | 311-28-4 | 10g |
| GK9010-50g | Tetrabutylammonium iodide | 311-28-4 | 50g |
| GK9010-100g | Tetrabutylammonium iodide | 311-28-4 | 100g |
| GK9010-250g | Tetrabutylammonium iodide | 311-28-4 | 250g |
| GK9010-500g | Tetrabutylammonium iodide | 311-28-4 | 500g |
| GK1156-10g | Tetrabutylammonium perchlorate | 1923-70-2 | 10g |
| GK1156-25g | Tetrabutylammonium perchlorate | 1923-70-2 | 25g |
| GK1156-50g | Tetrabutylammonium perchlorate | 1923-70-2 | 50g |
| GK1156-100g | Tetrabutylammonium perchlorate | 1923-70-2 | 100g |
| GK1156-250g | Tetrabutylammonium perchlorate | 1923-70-2 | 250g |
| GL2126-1g | Tetracaine | 94-24-6 | 1g |
| GL2126-5g | Tetracaine | 94-24-6 | 5g |
| GL2126-25g | Tetracaine | 94-24-6 | 25g |
| GK4286-5g | Tetracaine hydrochloride | 136-47-0 | 5g |
| GK4286-25g | Tetracaine hydrochloride | 136-47-0 | 25g |
| GK7505-25g | Tetrachloro-p-benzoquinone | 118-75-2 | 25g |
| GK7505-100g | Tetrachloro-p-benzoquinone | 118-75-2 | 100g |
| GS7939-100ml | Tetrachloroethylene, GlenDry™, anhydrous | 127-18-4 | 100ml |
| GS7939-500ml | Tetrachloroethylene, GlenDry™, anhydrous | 127-18-4 | 500ml |
| GS7939-1l | Tetrachloroethylene, GlenDry™, anhydrous | 127-18-4 | 1l |
| GS7939-2500ml | Tetrachloroethylene, GlenDry™, anhydrous | 127-18-4 | 2500ml |
| GS6265-500ml | Tetrachloroethylene, GlenPure™, analytical grade | 127-18-4 | 500ml |
| GS6265-1l | Tetrachloroethylene, GlenPure™, analytical grade | 127-18-4 | 1l |
| GS6265-2500ml | Tetrachloroethylene, GlenPure™, analytical grade | 127-18-4 | 2500ml |
| GW8498-100mg | Tetraconazole | 112281-77-3 | 100mg |
| GW8498-500mg | Tetraconazole | 112281-77-3 | 500mg |
| GA9779-10g | Tetracycline base | 60-54-8 | 10g |
| GA9779-25g | Tetracycline base | 60-54-8 | 25g |
| GA9779-100g | Tetracycline base | 60-54-8 | 100g |
| GA4323-25g | Tetracycline hydrochloride | 64-75-5 | 25g |
| GA4323-100g | Tetracycline hydrochloride | 64-75-5 | 100g |
| GA4323-250g | Tetracycline hydrochloride | 64-75-5 | 250g |
| GP3828-1g | Tetracycline hydrochloride, USP grade | 64-75-5 | 1g |
| GP3828-5g | Tetracycline hydrochloride, USP grade | 64-75-5 | 5g |
| GL5733-100ml | Tetradecane | 629-59-4 | 100ml |
| GK9362-100g | Tetradecyltrimethylammonium chloride | 4574-04-3 | 100g |
| GK9362-500g | Tetradecyltrimethylammonium chloride | 4574-04-3 | 500g |
| GK7125-100ml | Tetraethoxysilane | 78-10-4 | 100ml |
| GK7125-250ml | Tetraethoxysilane | 78-10-4 | 250ml |
| GK7125-500ml | Tetraethoxysilane | 78-10-4 | 500ml |
| GK7125-1l | Tetraethoxysilane | 78-10-4 | 1l |
| GK7125-2500ml | Tetraethoxysilane | 78-10-4 | 2500ml |
| GE1456-100g | Tetraethylammonium bromide | 71-91-0 | 100g |
| GE1456-500g | Tetraethylammonium bromide | 71-91-0 | 500g |
| GE1456-1kg | Tetraethylammonium bromide | 71-91-0 | 1kg |
| GL7065-25g | Tetraethylammonium chloride | 56-34-8 | 25g |
| GL7065-100g | Tetraethylammonium chloride | 56-34-8 | 100g |
| GL7065-250g | Tetraethylammonium chloride | 56-34-8 | 250g |
| GK2619-100g | Tetraethylene glycol | 112-60-7 | 100g |
| GK5408-5g | Tetraheptylammonium bromide | 4368-51-8 | 5g |
| GK5408-10g | Tetraheptylammonium bromide | 4368-51-8 | 10g |
| GK5408-25g | Tetraheptylammonium bromide | 4368-51-8 | 25g |
| GK5408-50g | Tetraheptylammonium bromide | 4368-51-8 | 50g |
| GK5408-100g | Tetraheptylammonium bromide | 4368-51-8 | 100g |
| GL8351-1mg | Tetrahydrobostrycin | 1072119-07-3 | 1mg |
| GK1522-500ml | Tetrahydrofuran | 109-99-9 | 500ml |
| GK1522-1l | Tetrahydrofuran | 109-99-9 | 1l |
| GK1522-2500ml | Tetrahydrofuran | 109-99-9 | 2500ml |
| GK0126-1l | Tetrahydrofuran, 99.9%, for analysis, unstabilised | 109-99-9 | 1l |
| GK0126-2500ml | Tetrahydrofuran, 99.9%, for analysis, unstabilised | 109-99-9 | 2500ml |
| GK8887-100ml | Tetrahydrofuran, anhydrous, 99.9%, unstabilised | 109-99-9 | 100ml |
| GK8887-500ml | Tetrahydrofuran, anhydrous, 99.9%, unstabilised | 109-99-9 | 500ml |
| GK8887-1l | Tetrahydrofuran, anhydrous, 99.9%, unstabilised | 109-99-9 | 1l |
| GK8887-2500ml | Tetrahydrofuran, anhydrous, 99.9%, unstabilised | 109-99-9 | 2500ml |
| GS6029-100ml | Tetrahydrofuran, GlenDry™, anhydrous | 109-99-9 | 100ml |
| GS6029-500ml | Tetrahydrofuran, GlenDry™, anhydrous | 109-99-9 | 500ml |
| GS6029-1l | Tetrahydrofuran, GlenDry™, anhydrous | 109-99-9 | 1l |
| GS6029-2500ml | Tetrahydrofuran, GlenDry™, anhydrous | 109-99-9 | 2500ml |
| GS8667-100ml | Tetrahydrofuran, GlenDry™, anhydrous over molecular sieve | 109-99-9 | 100ml |
| GS8667-500ml | Tetrahydrofuran, GlenDry™, anhydrous over molecular sieve | 109-99-9 | 500ml |
| GS8667-1l | Tetrahydrofuran, GlenDry™, anhydrous over molecular sieve | 109-99-9 | 1l |
| GS8667-2500ml | Tetrahydrofuran, GlenDry™, anhydrous over molecular sieve | 109-99-9 | 2500ml |
| GS2203-100ml | Tetrahydrofuran, GlenDry™, anhydrous stabilised with BHT | 109-99-9 | 100ml |
| GS2203-500ml | Tetrahydrofuran, GlenDry™, anhydrous stabilised with BHT | 109-99-9 | 500ml |
| GS2203-1l | Tetrahydrofuran, GlenDry™, anhydrous stabilised with BHT | 109-99-9 | 1l |
| GS2203-2500ml | Tetrahydrofuran, GlenDry™, anhydrous stabilised with BHT | 109-99-9 | 2500ml |
| GS8138-500ml | Tetrahydrofuran, GlenPure™, analytical grade | 109-99-9 | 500ml |
| GS8138-1l | Tetrahydrofuran, GlenPure™, analytical grade | 109-99-9 | 1l |
| GS8138-2500ml | Tetrahydrofuran, GlenPure™, analytical grade | 109-99-9 | 2500ml |
| GS4339-500ml | Tetrahydrofuran, GlenPure™, analytical grade stabilised with BHT | 109-99-9 | 500ml |
| GS4339-1l | Tetrahydrofuran, GlenPure™, analytical grade stabilised with BHT | 109-99-9 | 1l |
| GS4339-2500ml | Tetrahydrofuran, GlenPure™, analytical grade stabilised with BHT | 109-99-9 | 2500ml |
| GS2560-1l | Tetrahydrofuran, GlenUltra™, analytical grade, for LC | 109-99-9 | 1l |
| GS2560-2500ml | Tetrahydrofuran, GlenUltra™, analytical grade, for LC | 109-99-9 | 2500ml |
| GP8987-5g | Tetrahydropalmatine | 483-14-7 | 5g |
| GP2626-1g | Tetrahydrozoline hydrochloride | 522-48-5 | 1g |
| GX8847-25g | Tetraisopropyl methylenediphosphonate | 1660-95-3 | 25g |
| GX8847-100g | Tetraisopropyl methylenediphosphonate | 1660-95-3 | 100g |
| GK4550-10g | Tetrakis(decyl)ammonium bromide | 14937-42-9 | 10g |
| GK4550-25g | Tetrakis(decyl)ammonium bromide | 14937-42-9 | 25g |
| GX5705-100ml | Tetrakis(hydroxymethyl)phosphonium chloride, 80% solution in water | 124-64-1 | 100ml |
| GX5705-250ml | Tetrakis(hydroxymethyl)phosphonium chloride, 80% solution in water | 124-64-1 | 250ml |
| GX5705-500ml | Tetrakis(hydroxymethyl)phosphonium chloride, 80% solution in water | 124-64-1 | 500ml |
| GX3048-1g | Tetrakis(triphenylphosphine)nickel(0) | 15133-82-1 | 1g |
| GK7755-100g | Tetramethylammonium bromide | 64-20-0 | 100g |
| GK7755-250g | Tetramethylammonium bromide | 64-20-0 | 250g |
| GK7755-500g | Tetramethylammonium bromide | 64-20-0 | 500g |
| GK4855-100g | Tetramethylammonium chloride | 75-57-0 | 100g |
| GK4855-250g | Tetramethylammonium chloride | 75-57-0 | 250g |
| GK4855-500g | Tetramethylammonium chloride | 75-57-0 | 500g |
| GK3760-10g | Tetramethylammonium hydrogen sulfate | 80526-82-5 | 10g |
| GK9701-5g | Tetramethylammonium hydroxide pentahydrate | 10424-65-4 | 5g |
| GK9701-25g | Tetramethylammonium hydroxide pentahydrate | 10424-65-4 | 25g |
| GK9701-100g | Tetramethylammonium hydroxide pentahydrate | 10424-65-4 | 100g |
| GK9701-250g | Tetramethylammonium hydroxide pentahydrate | 10424-65-4 | 250g |
| GK9635-25ml | Tetramethylammonium hydroxide, 25% solution | 75-59-2 | 25ml |
| GT4898-10mg | Tetramethylrhodamine isothiocyanate, mixed isomers | 95197-95-8 | 10mg |
| GT4898-50mg | Tetramethylrhodamine isothiocyanate, mixed isomers | 95197-95-8 | 50mg |
| GT4898-250mg | Tetramethylrhodamine isothiocyanate, mixed isomers | 95197-95-8 | 250mg |
| GT6005-5mg | Tetramethylrhodamine-5-isothiocyanate | 80724-19-2 | 5mg |
| GT6005-25mg | Tetramethylrhodamine-5-isothiocyanate | 80724-19-2 | 25mg |
| GW5949-1mg | Tetramethylrhodamine-5-maleimide | 174568-67-3 | 1mg |
| GW5949-5mg | Tetramethylrhodamine-5-maleimide | 174568-67-3 | 5mg |
| GW5949-25mg | Tetramethylrhodamine-5-maleimide | 174568-67-3 | 25mg |
| GW9016-2mg | Tetramethylrhodamine-6-maleimide | 174568-68-4 | 2mg |
| GW9016-25mg | Tetramethylrhodamine-6-maleimide | 174568-68-4 | 25mg |
| GY8641-1mg | Tetramethylscutellarein | 1168-42-9 | 1mg |
| GY8641-5mg | Tetramethylscutellarein | 1168-42-9 | 5mg |
| GL6523-5g | Tetramethylurea | 632-22-4 | 5g |
| GL6523-100g | Tetramethylurea | 632-22-4 | 100g |
| GP2274-250mg | Tetrandrine | 518-34-3 | 250mg |
| GP2274-1g | Tetrandrine | 518-34-3 | 1g |
| GK5496-100mg | Tetranitroblue tetrazolium chloride | 1184-43-6 | 100mg |
| GK5496-1g | Tetranitroblue tetrazolium chloride | 1184-43-6 | 1g |
| GX0411-250g | Tetrasodium iminodisuccinate | 144538-83-0 | 250g |
| GX0411-1kg | Tetrasodium iminodisuccinate | 144538-83-0 | 1kg |
| GT7170-1g | Tetrazolium Blue Chloride | 1871-22-3 | 1g |
| GT7170-5g | Tetrazolium Blue Chloride | 1871-22-3 | 5g |
| GT6818-1g | Tetrazolium Violet | 1719-71-7 | 1g |
| GT6818-5g | Tetrazolium Violet | 1719-71-7 | 5g |
| GT6818-10g | Tetrazolium Violet | 1719-71-7 | 10g |
| GW4440-1g | TFMU | 575-03-1 | 1g |
| GW4440-2500mg | TFMU | 575-03-1 | 2500mg |
| GW7223-1mg | TG-46 | 936091-15-5 | 1mg |
| GW7223-5mg | TG-46 | 936091-15-5 | 5mg |
| GW7223-10mg | TG-46 | 936091-15-5 | 10mg |
| GW3532-1mg | TG-89 | 936091-56-4 | 1mg |
| GW3532-5mg | TG-89 | 936091-56-4 | 5mg |
| GW3532-10mg | TG-89 | 936091-56-4 | 10mg |
| GL3452-1mg | TG003 | 300801-52-9 | 1mg |
| GL3452-5mg | TG003 | 300801-52-9 | 5mg |
| GL3452-25mg | TG003 | 300801-52-9 | 25mg |
| GW4786-5mg | TG007 | 719277-30-2 | 5mg |
| GW4786-25mg | TG007 | 719277-30-2 | 25mg |
| GW5257-1mg | TG100115 | 677297-51-7 | 1mg |
| GW5257-5mg | TG100115 | 677297-51-7 | 5mg |
| GW5257-10mg | TG100115 | 677297-51-7 | 10mg |
| GW9139-1mg | TG101209 | 936091-14-4 | 1mg |
| GW9139-5mg | TG101209 | 936091-14-4 | 5mg |
| GW9139-10mg | TG101209 | 936091-14-4 | 10mg |
| GW6453-1mg | TG101348 | 936091-26-8 | 1mg |
| GW6453-5mg | TG101348 | 936091-26-8 | 5mg |
| GW6453-10mg | TG101348 | 936091-26-8 | 10mg |
| GW0793-1mg | TGX-221 | 663619-89-4 | 1mg |
| GW0793-5mg | TGX-221 | 663619-89-4 | 5mg |
| GW0793-10mg | TGX-221 | 663619-89-4 | 10mg |
| GL7828-1mg | Thailandolide B | 944726-62-9 | 1mg |
| GL7828-5mg | Thailandolide B | 944726-62-9 | 5mg |
| GX4995-150mm | Thallium Rod 12.7 x 150 mm, under water, 99.999% | 7440-28-0 | 150mm |
| GX5759-25g | Thallium(I) bromide, 99.999% | 7789-40-4 | 25g |
| GX8983-50g | Thallium(I) carbonate, 99.9% | 29809-42-5 | 50g |
| GX4588-25g | Thallium(I) carbonate, 99.99% | 29809-42-5 | 25g |
| GX9612-50g | Thallium(I) iodide, 99.99% | 7790-30-9 | 50g |
| GL5516-1mg | Thapsigargin | 67526-95-8 | 1mg |
| GL5516-5mg | Thapsigargin | 67526-95-8 | 5mg |
| GL5516-10mg | Thapsigargin | 67526-95-8 | 10mg |
| GL5484-1mg | Thaxtomin A | 122380-18-1 | 1mg |
| GL5484-5mg | Thaxtomin A | 122380-18-1 | 5mg |
| GA1201-1mg | Thaxtomin C | 140111-05-3 | 1mg |
| GA1201-5mg | Thaxtomin C | 140111-05-3 | 5mg |
| GW8778-100mg | Theacrine | 2309-49-1 | 100mg |
| GW8778-1g | Theacrine | 2309-49-1 | 1g |
| GW8778-5g | Theacrine | 2309-49-1 | 5g |
| GW8778-25g | Theacrine | 2309-49-1 | 25g |
| GY1271-10mg | Theaflavin-3-gallate | 30462-34-1 | 10mg |
| GE3548-25g | Theobromine | 83-67-0 | 25g |
| GE3548-100g | Theobromine | 83-67-0 | 100g |
| GP6302-25g | Theophylline | 58-55-9 | 25g |
| GP6302-100g | Theophylline | 58-55-9 | 100g |
| GP6302-250g | Theophylline | 58-55-9 | 250g |
| GP6302-500g | Theophylline | 58-55-9 | 500g |
| GX0813-1m | Thermocouple Wire Tungsten/Rhenium W/Re 97/3-W/Re 75/25 | 1m | |
| GX6501-1m | Thermocouple Wire Tungsten/Rhenium W/Re 97/3-W/Re 75/25 | 1m | |
| GX3855-1m | Thermocouple Wire Tungsten/Rhenium W/Re 97/3-W/Re 75/25 | 1m | |
| GX6688-1m | Thermocouple Wire Type S Platinum/Platinum-Rhodium 90/10 | 1m | |
| GW5364-1mg | Thermorubin | 37577-75-6 | 1mg |
| GW5364-5mg | Thermorubin | 37577-75-6 | 5mg |
| GW5364-25mg | Thermorubin | 37577-75-6 | 25mg |
| GL9930-25mg | THI | 94944-70-4 | 25mg |
| GL9930-50mg | THI | 94944-70-4 | 50mg |
| GL9930-100mg | THI | 94944-70-4 | 100mg |
| GL9930-250mg | THI | 94944-70-4 | 250mg |
| GL9930-500mg | THI | 94944-70-4 | 500mg |
| GA5810-25g | Thiabendazole | 148-79-8 | 25g |
| GA5810-100g | Thiabendazole | 148-79-8 | 100g |
| GA5810-250g | Thiabendazole | 148-79-8 | 250g |
| GA5810-500g | Thiabendazole | 148-79-8 | 500g |
| GA5810-1kg | Thiabendazole | 148-79-8 | 1kg |
| GW3835-25mg | Thiamethoxam-d3 | 1294048-82-0 | 25mg |
| GP0613-25g | Thiamine hydrochloride, Ph. Eur. grade | 67-03-8 | 25g |
| GP0613-100g | Thiamine hydrochloride, Ph. Eur. grade | 67-03-8 | 100g |
| GP0613-250g | Thiamine hydrochloride, Ph. Eur. grade | 67-03-8 | 250g |
| GP0613-500g | Thiamine hydrochloride, Ph. Eur. grade | 67-03-8 | 500g |
| GP8217-25g | Thiamine hydrochloride, USP grade | 67-03-8 | 25g |
| GP8217-100g | Thiamine hydrochloride, USP grade | 67-03-8 | 100g |
| GP8217-250g | Thiamine hydrochloride, USP grade | 67-03-8 | 250g |
| GV4958-5g | Thiamine nitrate | 532-43-4 | 5g |
| GV4958-25g | Thiamine nitrate | 532-43-4 | 25g |
| GV4958-100g | Thiamine nitrate | 532-43-4 | 100g |
| GV8106-1g | Thiamine pyrophosphate | 154-87-0 | 1g |
| GV8106-5g | Thiamine pyrophosphate | 154-87-0 | 5g |
| GA2455-1g | Thiamphenicol | 15318-45-3 | 1g |
| GA2455-5g | Thiamphenicol | 15318-45-3 | 5g |
| GA2455-25g | Thiamphenicol | 15318-45-3 | 25g |
| GT7767-1g | Thiazole Orange | 107091-89-4 | 1g |
| GT3471-25g | Thiazole Yellow G (C.I. 19540) | 1829-00-1 | 25g |
| GT3471-100g | Thiazole Yellow G (C.I. 19540) | 1829-00-1 | 100g |
| GC4568-1g | Thiazolyl blue tetrazolium bromide | 298-93-1 | 1g |
| GC4568-5g | Thiazolyl blue tetrazolium bromide | 298-93-1 | 5g |
| GC4568-10g | Thiazolyl blue tetrazolium bromide | 298-93-1 | 10g |
| GY0412-500mg | Thidiazuron | 51707-55-2 | 500mg |
| GY0412-1g | Thidiazuron | 51707-55-2 | 1g |
| GY0412-5g | Thidiazuron | 51707-55-2 | 5g |
| GW8386-250mg | Thifluzamide | 130000-40-7 | 250mg |
| GW8386-1g | Thifluzamide | 130000-40-7 | 1g |
| GA6948-10g | Thimerosal | 54-64-8 | 10g |
| GA6948-25g | Thimerosal | 54-64-8 | 25g |
| GA6948-100g | Thimerosal | 54-64-8 | 100g |
| GA8923-25g | Thimerosal, BP, EP, USP grade | 54-64-8 | 25g |
| GA8923-100g | Thimerosal, BP, EP, USP grade | 54-64-8 | 100g |
| GK1732-25g | Thioacetamide | 62-55-5 | 25g |
| GK1732-100g | Thioacetamide | 62-55-5 | 100g |
| GK1732-250g | Thioacetamide | 62-55-5 | 250g |
| GK1732-500g | Thioacetamide | 62-55-5 | 500g |
| GL9350-5mg | Thiocolchicine | 2730-71-4 | 5mg |
| GL9350-25mg | Thiocolchicine | 2730-71-4 | 25mg |
| GK2368-100mg | Thiocolchicoside | 602-41-5 | 100mg |
| GK2368-1g | Thiocolchicoside | 602-41-5 | 1g |
| GW6823-1mg | Thioglycine | 758-10-1 | 1mg |
| GW6823-5mg | Thioglycine | 758-10-1 | 5mg |
| GK6903-250ml | Thioglycolic acid | 68-11-1 | 250ml |
| GK6903-500ml | Thioglycolic acid | 68-11-1 | 500ml |
| GK6903-1l | Thioglycolic acid | 68-11-1 | 1l |
| GK6903-2500ml | Thioglycolic acid | 68-11-1 | 2500ml |
| GA0837-5mg | Thiolutin | 87-11-6 | 5mg |
| GT7720-5g | Thionin acetate salt | 78338-22-4 | 5g |
| GT7720-10g | Thionin acetate salt | 78338-22-4 | 10g |
| GT7720-25g | Thionin acetate salt | 78338-22-4 | 25g |
| GK2382-25g | Thiophene-2-acetic acid | 1918-77-0 | 25g |
| GK9180-25g | Thiophene-2-carboxaldehyde | 98-03-3 | 25g |
| GK2721-25g | Thiosemicarbazide | 79-19-6 | 25g |
| GK2721-100g | Thiosemicarbazide | 79-19-6 | 100g |
| GK2721-500g | Thiosemicarbazide | 79-19-6 | 500g |
| GA3924-250mg | Thiostrepton | 1393-48-2 | 250mg |
| GA3924-1g | Thiostrepton | 1393-48-2 | 1g |
| GE8159-100g | Thiourea | 62-56-6 | 100g |
| GE8159-500g | Thiourea | 62-56-6 | 500g |
| GE8159-1kg | Thiourea | 62-56-6 | 1kg |
| GE8159-5kg | Thiourea | 62-56-6 | 5kg |
| GK5170-25g | Thioxanthen-9-one | 492-22-8 | 25g |
| GK5170-100g | Thioxanthen-9-one | 492-22-8 | 100g |
| GL2255-50mg | Thonzonium bromide | 553-08-2 | 50mg |
| GX0006-2g | Thulium acetate hydrate, 99.9% | 39156-80-4 | 2g |
| GX0006-10g | Thulium acetate hydrate, 99.9% | 39156-80-4 | 10g |
| GX7207-1g | Thulium Chips, 99.9% | 7440-30-4 | 1g |
| GX7207-5g | Thulium Chips, 99.9% | 7440-30-4 | 5g |
| GX6540-1g | Thulium chloride anhydrous, 99.9% | 13537-18-3 | 1g |
| GX6540-5g | Thulium chloride anhydrous, 99.9% | 13537-18-3 | 5g |
| GX6481-1g | Thulium chloride hydrate, 99.9% | 13537-18-3 | 1g |
| GX6481-5g | Thulium chloride hydrate, 99.9% | 13537-18-3 | 5g |
| GX8622-1g | Thulium fluoride, 99.9% | 13760-79-7 | 1g |
| GX8622-5g | Thulium fluoride, 99.9% | 13760-79-7 | 5g |
| GX7320-1g | Thulium hydroxide hydrate, 99.999% | 1311-33-7 | 1g |
| GX7320-5g | Thulium hydroxide hydrate, 99.999% | 1311-33-7 | 5g |
| GX6098-2g | Thulium nitrate hydrate, 99.9% | 36548-87-5 | 2g |
| GX6098-10g | Thulium nitrate hydrate, 99.9% | 36548-87-5 | 10g |
| GX8413-1g | Thulium oxide, 99.9% | 12036-44-1 | 1g |
| GX8413-5g | Thulium oxide, 99.9% | 12036-44-1 | 5g |
| GX8413-25g | Thulium oxide, 99.9% | 12036-44-1 | 25g |
| GX1460-1g | Thulium oxide, 99.99% | 12036-44-1 | 1g |
| GX1460-5g | Thulium oxide, 99.99% | 12036-44-1 | 5g |
| GX1460-25g | Thulium oxide, 99.99% | 12036-44-1 | 25g |
| GX9780-1g | Thulium oxide, 99.999% | 12036-44-1 | 1g |
| GX9780-5g | Thulium oxide, 99.999% | 12036-44-1 | 5g |
| GX9780-25g | Thulium oxide, 99.999% | 12036-44-1 | 25g |
| GX6402-5g | Thulium oxide, 99.9999% | 12036-44-1 | 5g |
| GX5218-5g | Thulium Pieces distilled, 99.99% | 7440-30-4 | 5g |
| GX5218-10g | Thulium Pieces distilled, 99.99% | 7440-30-4 | 10g |
| GX1096-1g | Thulium Pieces, 99.9% | 7440-30-4 | 1g |
| GX1096-5g | Thulium Pieces, 99.9% | 7440-30-4 | 5g |
| GX0105-2g | Thulium sulfate hydrate, 99.9% | 13778-40-0 | 2g |
| GX0105-10g | Thulium sulfate hydrate, 99.9% | 13778-40-0 | 10g |
| GX0279-2g | Thulium sulfate hydrate, 99.999% | 13778-40-0 | 2g |
| GX0279-10g | Thulium sulfate hydrate, 99.999% | 13778-40-0 | 10g |
| GX1273-2g | Thulium sulfide, 99.9% | 12166-30-2 | 2g |
| GX5248-1g | Thulium(III) iodide, 99.9% | 13813-43-9 | 1g |
| GX5248-5g | Thulium(III) iodide, 99.9% | 13813-43-9 | 5g |
| GE6597-1g | Thymidine | 50-89-5 | 1g |
| GE6597-5g | Thymidine | 50-89-5 | 5g |
| GE6597-25g | Thymidine | 50-89-5 | 25g |
| GE6597-100g | Thymidine | 50-89-5 | 100g |
| GE0125-100mg | Thymidine 5''-monophosphate disodium salt hydrate | 33430-62-5 | 100mg |
| GE0125-250mg | Thymidine 5''-monophosphate disodium salt hydrate | 33430-62-5 | 250mg |
| GE0125-1g | Thymidine 5''-monophosphate disodium salt hydrate | 33430-62-5 | 1g |
| GE5340-5g | Thymine | 65-71-4 | 5g |
| GE5340-25g | Thymine | 65-71-4 | 25g |
| GE5340-100g | Thymine | 65-71-4 | 100g |
| GT9699-25g | Thymol | 89-83-8 | 25g |
| GT9699-100g | Thymol | 89-83-8 | 100g |
| GT9699-250g | Thymol | 89-83-8 | 250g |
| GT9699-500g | Thymol | 89-83-8 | 500g |
| GT9755-5g | Thymol Blue | 76-61-9 | 5g |
| GT9755-10g | Thymol Blue | 76-61-9 | 10g |
| GT9755-25g | Thymol Blue | 76-61-9 | 25g |
| GT9755-50g | Thymol Blue | 76-61-9 | 50g |
| GT9755-100g | Thymol Blue | 76-61-9 | 100g |
| GT4225-5g | Thymol blue sodium salt | 62625-21-2 | 5g |
| GT4225-10g | Thymol blue sodium salt | 62625-21-2 | 10g |
| GT4225-25g | Thymol blue sodium salt | 62625-21-2 | 25g |
| GT4225-50g | Thymol blue sodium salt | 62625-21-2 | 50g |
| GT6465-25g | Thymol iodide | 552-22-7 | 25g |
| GT1470-10g | Thymolphthalein | 125-20-2 | 10g |
| GT1470-25g | Thymolphthalein | 125-20-2 | 25g |
| GT1470-50g | Thymolphthalein | 125-20-2 | 50g |
| GT1470-100g | Thymolphthalein | 125-20-2 | 100g |
| GT1470-250g | Thymolphthalein | 125-20-2 | 250g |
| GT9118-5g | Thymolphthalein, 95%, ACS grade | 125-20-2 | 5g |
| GT9118-10g | Thymolphthalein, 95%, ACS grade | 125-20-2 | 10g |
| GT9118-25g | Thymolphthalein, 95%, ACS grade | 125-20-2 | 25g |
| GT9118-100g | Thymolphthalein, 95%, ACS grade | 125-20-2 | 100g |
| GT5953-1g | Thymoquinone | 490-91-5 | 1g |
| GT5953-5g | Thymoquinone | 490-91-5 | 5g |
| GW3846-25mg | Tiadinil | 223580-51-6 | 25mg |
| GW3846-100mg | Tiadinil | 223580-51-6 | 100mg |
| GA3707-100mg | Tiamulin fumarate | 55297-96-6 | 100mg |
| GA3707-250mg | Tiamulin fumarate | 55297-96-6 | 250mg |
| GA3707-1g | Tiamulin fumarate | 55297-96-6 | 1g |
| GA3707-5g | Tiamulin fumarate | 55297-96-6 | 5g |
| GP8667-250mg | Tianeptine sodium salt hydrate | 30123-17-2 | 250mg |
| GP8667-1g | Tianeptine sodium salt hydrate | 30123-17-2 | 1g |
| GP9951-25mg | Tiaprofenic acid | 33005-95-7 | 25mg |
| GP9951-100mg | Tiaprofenic acid | 33005-95-7 | 100mg |
| GA1874-100mg | Ticarcillin disodium salt | 4697-14-7 | 100mg |
| GA1874-500mg | Ticarcillin disodium salt | 4697-14-7 | 500mg |
| GA1874-1g | Ticarcillin disodium salt | 4697-14-7 | 1g |
| GK6202-5mg | Tigecycline hydrate | 1229002-07-6 | 5mg |
| GK6202-25mg | Tigecycline hydrate | 1229002-07-6 | 25mg |
| GK6202-100mg | Tigecycline hydrate | 1229002-07-6 | 100mg |
| GP6895-100mg | Tilmicosin | 108050-54-0 | 100mg |
| GA7223-100mg | Tilmicosin phosphate salt | 137330-13-3 | 100mg |
| GP7307-100mg | Timolol maleate salt | 26921-17-5 | 100mg |
| GP7307-250mg | Timolol maleate salt | 26921-17-5 | 250mg |
| GP7307-1g | Timolol maleate salt | 26921-17-5 | 1g |
| GX5578-50g | Tin Bar, 99.999% | 7440-31-5 | 50g |
| GX5578-250g | Tin Bar, 99.999% | 7440-31-5 | 250g |
| GX2377-100x100mm | Tin Foil 0.125 mm, 99.99+% | 7440-31-5 | 100x100mm |
| GX5573-100x100mm | Tin Foil 0.25 mm, 99.99% | 7440-31-5 | 100x100mm |
| GX5573-100x200mm | Tin Foil 0.25 mm, 99.99% | 7440-31-5 | 100x200mm |
| GX6032-100x100mm | Tin Foil 0.5 mm, 99.8% | 7440-31-5 | 100x100mm |
| GX6032-150x150mm | Tin Foil 0.5 mm, 99.8% | 7440-31-5 | 150x150mm |
| GX3833-100x200mm | Tin Foil 0.5 mm, 99.99% | 7440-31-5 | 100x200mm |
| GX2676-100x200mm | Tin Foil 1.0 mm, 99.99% | 7440-31-5 | 100x200mm |
| GX0036-50g | Tin Granules 2-4 mm, 99.99% | 7440-31-5 | 50g |
| GX0036-250g | Tin Granules 2-4 mm, 99.99% | 7440-31-5 | 250g |
| GX7775-25g | Tin Granules 2-4 mm, 99.999% | 7440-31-5 | 25g |
| GX7775-50g | Tin Granules 2-4 mm, 99.999% | 7440-31-5 | 50g |
| GX7775-250g | Tin Granules 2-4 mm, 99.999% | 7440-31-5 | 250g |
| GX3171-5g | Tin Granules 3 mm, 99.9999% | 7440-31-5 | 5g |
| GX3171-25g | Tin Granules 3 mm, 99.9999% | 7440-31-5 | 25g |
| GX3171-100g | Tin Granules 3 mm, 99.9999% | 7440-31-5 | 100g |
| GX7490-10g | Tin nanopowder, 99.9% [APS LT 100nm] | 7440-31-5 | 10g |
| GX7490-25g | Tin nanopowder, 99.9% [APS LT 100nm] | 7440-31-5 | 25g |
| GX7490-100g | Tin nanopowder, 99.9% [APS LT 100nm] | 7440-31-5 | 100g |
| GX5876-100g | Tin Pellets 10mm max., 99.95% | 7440-31-5 | 100g |
| GX2142-10g | Tin Powder -100 mesh, 99.995% | 7440-31-5 | 10g |
| GX2142-25g | Tin Powder -100 mesh, 99.995% | 7440-31-5 | 25g |
| GX2142-100g | Tin Powder -100 mesh, 99.995% | 7440-31-5 | 100g |
| GX1969-250g | Tin Powder max. 100 micron, 99+% | 7440-31-5 | 250g |
| GX1969-1kg | Tin Powder max. 100 micron, 99+% | 7440-31-5 | 1kg |
| GX7812-20mm | Tin Rod 11 mm diameter, 99.999% | 7440-31-5 | 20mm |
| GX7812-100mm | Tin Rod 11 mm diameter, 99.999% | 7440-31-5 | 100mm |
| GX6451-150mm | Tin Rod 6 mm diameter, 99.999% | 7440-31-5 | 150mm |
| GX3375-250mm | Tin Rod 8 mm diameter, 99.999% | 7440-31-5 | 250mm |
| GX4056-1m | Tin Wire 1.0 mm diameter, 99.9+% | 7440-31-5 | 1m |
| GX4056-5m | Tin Wire 1.0 mm diameter, 99.9+% | 7440-31-5 | 5m |
| GX7531-1m | Tin Wire 1.0 mm diameter, 99.999% | 7440-31-5 | 1m |
| GX7531-5m | Tin Wire 1.0 mm diameter, 99.999% | 7440-31-5 | 5m |
| GX1685-1m | Tin Wire 2.0 mm diameter, 99.9+% | 7440-31-5 | 1m |
| GX1685-5m | Tin Wire 2.0 mm diameter, 99.9+% | 7440-31-5 | 5m |
| GX3444-25cm | Tin Wire 2.0 mm diameter, 99.999% | 7440-31-5 | 25cm |
| GX3444-1m | Tin Wire 2.0 mm diameter, 99.999% | 7440-31-5 | 1m |
| GX5603-500g | Tin(II) 2-ethylhexanoate | 301-10-0 | 500g |
| GX2073-50g | Tin(II) bromide, 99% | 10031-24-0 | 50g |
| GX9341-25g | Tin(II) chloride dihydrate | 10025-69-1 | 25g |
| GX2712-100g | Tin(II) chloride, anhydrous, 97.0% | 7772-99-8 | 100g |
| GX2712-250g | Tin(II) chloride, anhydrous, 97.0% | 7772-99-8 | 250g |
| GX3976-100g | Tin(II) chloride, dihydrate, 98+%, ACS | 10025-69-1 | 100g |
| GX3976-250g | Tin(II) chloride, dihydrate, 98+%, ACS | 10025-69-1 | 250g |
| GX8135-25g | Tin(II) ethoxide, 99% | 14791-99-2 | 25g |
| GX5593-10g | Tin(II) oxide, 99.9% | 21651-19-4 | 10g |
| GX5593-250g | Tin(II) oxide, 99.9% | 21651-19-4 | 250g |
| GX2583-5g | Tin(II) selenide, 99.999% | 1315-06-6 | 5g |
| GX2583-10g | Tin(II) selenide, 99.999% | 1315-06-6 | 10g |
| GX2583-50g | Tin(II) selenide, 99.999% | 1315-06-6 | 50g |
| GX2830-250g | Tin(II) sulfate, 96% | 7488-55-3 | 250g |
| GX9560-10g | Tin(II) telluride, 99.999% | 12040-02-7 | 10g |
| GX9560-50g | Tin(II) telluride, 99.999% | 12040-02-7 | 50g |
| GX1651-25g | Tin(IV) chloride, anhydrous, 99.99% | 7646-78-8 | 25g |
| GX4247-500g | Tin(IV) chloride, pentahydrate, 98% | 10026-06-9 | 500g |
| GX8443-25g | Tin(IV) oxide Nanopowder, 99.5% | 18282-10-5 | 25g |
| GX8443-100g | Tin(IV) oxide Nanopowder, 99.5% | 18282-10-5 | 100g |
| GX4773-50g | Tin(IV) oxide Nanopowder, 99.9 % | 18282-10-5 | 50g |
| GX4773-250g | Tin(IV) oxide Nanopowder, 99.9 % | 18282-10-5 | 250g |
| GX4773-1kg | Tin(IV) oxide Nanopowder, 99.9 % | 18282-10-5 | 1kg |
| GX7439-250g | Tin(IV) oxide, 99.0% | 18282-10-5 | 250g |
| GX7439-1kg | Tin(IV) oxide, 99.0% | 18282-10-5 | 1kg |
| GX8913-5g | Tin(IV) oxide, 99.999% | 18282-10-5 | 5g |
| GX8913-25g | Tin(IV) oxide, 99.999% | 18282-10-5 | 25g |
| GX8128-10g | Tin(IV) t-butoxide, 99.9% | 36809-75-3 | 10g |
| GA9668-25g | Tinidazole | 19387-91-8 | 25g |
| GA0099-1g | Tioconazole | 65899-73-2 | 1g |
| GA0099-10g | Tioconazole | 65899-73-2 | 10g |
| GP5627-10mg | Tiotropium bromide monohydrate | 139404-48-1 | 10mg |
| GP2595-5mg | Tirofiban | 144494-65-5 | 5mg |
| GP2595-25mg | Tirofiban | 144494-65-5 | 25mg |
| GP2595-100mg | Tirofiban | 144494-65-5 | 100mg |
| GP1864-50mg | Tirofiban hydrochloride | 150915-40-5 | 50mg |
| GK6289-25g | Tiron monohydrate | 149-45-1 | 25g |
| GK6289-100g | Tiron monohydrate | 149-45-1 | 100g |
| GK6289-250g | Tiron monohydrate | 149-45-1 | 250g |
| GP2780-5mg | Tirzepatide sodium salt | 2023788-19-2 | 5mg |
| GP2780-25mg | Tirzepatide sodium salt | 2023788-19-2 | 25mg |
| GX2370-500g | Titanium (diisopropoxide) bis (2,4-pentanedionate); 75% in isopropanol | 17927-72-9 | 500g |
| GX2370-2kg | Titanium (diisopropoxide) bis (2,4-pentanedionate); 75% in isopropanol | 17927-72-9 | 2kg |
| GX2412-100g | Titanium Aluminium Vanadium Ti-6Al-4V Powder sperical 75-125 micron | 12743-70-3 | 100g |
| GX0348-100g | Titanium Aluminium Vanadium Ti-6Al-4V Powder spherical 45-75 micron, Grade 5 | 12743-70-3 | 100g |
| GX7735-100g | Titanium boride | 12045-63-5 | 100g |
| GX7735-500g | Titanium boride | 12045-63-5 | 500g |
| GX0703-250g | Titanium dioxide | 13463-67-7 | 250g |
| GX0703-500g | Titanium dioxide | 13463-67-7 | 500g |
| GX0703-1kg | Titanium dioxide | 13463-67-7 | 1kg |
| GX0703-5kg | Titanium dioxide | 13463-67-7 | 5kg |
| GX1193-1kg | Titanium dioxide, 99%, Ph. Eur., BP, USP grade | 13463-67-7 | 1kg |
| GX4446-50x100mm | Titanium Foil 0.05 mm, 99.6% | 7440-32-6 | 50x100mm |
| GX4446-100x100mm | Titanium Foil 0.05 mm, 99.6% | 7440-32-6 | 100x100mm |
| GX4446-150x150mm | Titanium Foil 0.05 mm, 99.6% | 7440-32-6 | 150x150mm |
| GX2622-150x150mm | Titanium Foil 0.1 mm, 99.6% | 7440-32-6 | 150x150mm |
| GX9127-100x100mm | Titanium Foil 0.125 mm, 99.6% | 7440-32-6 | 100x100mm |
| GX9127-150x150mm | Titanium Foil 0.125 mm, 99.6% | 7440-32-6 | 150x150mm |
| GX9127-300x300mm | Titanium Foil 0.125 mm, 99.6% | 7440-32-6 | 300x300mm |
| GX3290-150x150mm | Titanium Foil 0.25 mm, 99.6% | 7440-32-6 | 150x150mm |
| GX1848-100x200mm | Titanium Foil 0.5 mm, 99.6% | 7440-32-6 | 100x200mm |
| GX2025-100g | Titanium Granules ≤ 4 mm, 99.8+% | 7440-32-6 | 100g |
| GX2025-500g | Titanium Granules ≤ 4 mm, 99.8+% | 7440-32-6 | 500g |
| GX7622-100g | Titanium Granules max. 6 mm, 99.8% | 7440-32-6 | 100g |
| GX7622-500g | Titanium Granules max. 6 mm, 99.8% | 7440-32-6 | 500g |
| GX3635-10g | Titanium Nanopowder, 99,9 % | 7440-32-6 | 10g |
| GX3635-25g | Titanium Nanopowder, 99,9 % | 7440-32-6 | 25g |
| GX3635-100g | Titanium Nanopowder, 99,9 % | 7440-32-6 | 100g |
| GX6013-50g | Titanium nitride, 99% | 25583-20-4 | 50g |
| GX6013-250g | Titanium nitride, 99% | 25583-20-4 | 250g |
| GX3990-50g | Titanium oxide Nanopowder, 10 - 30 nm, rutile, 99.5% | 1317-80-2 | 50g |
| GX3990-100g | Titanium oxide Nanopowder, 10 - 30 nm, rutile, 99.5% | 1317-80-2 | 100g |
| GX3990-250g | Titanium oxide Nanopowder, 10 - 30 nm, rutile, 99.5% | 1317-80-2 | 250g |
| GX3990-1kg | Titanium oxide Nanopowder, 10 - 30 nm, rutile, 99.5% | 1317-80-2 | 1kg |
| GX7199-50g | Titanium oxide Nanopowder, anatase, 99,5% | 1317-70-0 | 50g |
| GX7199-100g | Titanium oxide Nanopowder, anatase, 99,5% | 1317-70-0 | 100g |
| GX7199-250g | Titanium oxide Nanopowder, anatase, 99,5% | 1317-70-0 | 250g |
| GX7199-1kg | Titanium oxide Nanopowder, anatase, 99,5% | 1317-70-0 | 1kg |
| GX4909-50g | Titanium oxide Nanopowder, rutile, 99% [APS 200nm, spherical] | 1317-80-2 | 50g |
| GX4909-250g | Titanium oxide Nanopowder, rutile, 99% [APS 200nm, spherical] | 1317-80-2 | 250g |
| GX4909-1kg | Titanium oxide Nanopowder, rutile, 99% [APS 200nm, spherical] | 1317-80-2 | 1kg |
| GX9270-50g | Titanium oxide Nanopowder, rutile, coated with SiO2, 99 % | 1317-80-2 | 50g |
| GX9270-250g | Titanium oxide Nanopowder, rutile, coated with SiO2, 99 % | 1317-80-2 | 250g |
| GX2634-50g | Titanium Pellets 6 x 6 mm, 99.8% | 7440-32-6 | 50g |
| GX6677-50g | Titanium Pellets 6 x 6 mm, 99.99% | 7440-32-6 | 50g |
| GX0119-50g | Titanium Pieces 2-5mm, 99.995% | 7440-32-6 | 50g |
| GX4353-100g | Titanium Powder max. 30 micron, under water, 95+% | 7440-32-6 | 100g |
| GX5904-100g | Titanium Powder spherical 125-250 micron, 99.8% | 7440-32-6 | 100g |
| GX3946-100g | Titanium Powder spherical 125-250 micron, Grade 1 | 7440-32-6 | 100g |
| GX7105-100g | Titanium Powder spherical 45-75 micron, 99.8% | 7440-32-6 | 100g |
| GX9053-100g | Titanium Powder spherical 75-125 micron, 99.8% | 7440-32-6 | 100g |
| GX7318-25cm | Titanium Rod 10.0 mm diameter, 99.7% | 7440-32-6 | 25cm |
| GX4949-25cm | Titanium Rod 15.0 mm diameter, 99.7% | 7440-32-6 | 25cm |
| GX7226-2x1m | Titanium Rod 2 mm diameter, 99.6% | 7440-32-6 | 2x1m |
| GX9536-2x90cm | Titanium Rod 3 mm diameter, 99.7% | 7440-32-6 | 2x90cm |
| GX8130-250mm | Titanium Rod 3 mm diameter, 99.995% | 7440-32-6 | 250mm |
| GX7798-25cm | Titanium Rod 30.0 mm diameter, 99.7% | 7440-32-6 | 25cm |
| GX4343-1m | Titanium Rod 5 mm diameter, 99.6% | 7440-32-6 | 1m |
| GX9869-100mm | Titanium Rod 6.35 mm diameter, 99.99+% | 7440-32-6 | 100mm |
| GX9462-25cm | Titanium Rod 8 mm diameter, 99.6% | 7440-32-6 | 25cm |
| GX8460-50x50mm | Titanium Sheet 1.0mm, 99.6% | 7440-32-6 | 50x50mm |
| GX8460-100x200mm | Titanium Sheet 1.0mm, 99.6% | 7440-32-6 | 100x200mm |
| GX4809-25g | Titanium silicide, 99% | 12039-83-7 | 25g |
| GX2325-50g | Titanium Slugs ~5 x 10-12 mm, 99.6% | 7440-32-6 | 50g |
| GX9535-10m | Titanium Wire 0.125 mm diameter, 99.6% | 7440-32-6 | 10m |
| GX9535-25m | Titanium Wire 0.125 mm diameter, 99.6% | 7440-32-6 | 25m |
| GX4071-5m | Titanium Wire 0.25 mm diameter, 99.6% | 7440-32-6 | 5m |
| GX4071-25m | Titanium Wire 0.25 mm diameter, 99.6% | 7440-32-6 | 25m |
| GX8854-10m | Titanium Wire 0.5 mm diameter, 99.8% | 7440-32-6 | 10m |
| GX8854-50m | Titanium Wire 0.5 mm diameter, 99.8% | 7440-32-6 | 50m |
| GX5183-10m | Titanium Wire 0.8 mm diameter, 99.8% | 7440-32-6 | 10m |
| GX5183-50m | Titanium Wire 0.8 mm diameter, 99.8% | 7440-32-6 | 50m |
| GX1280-10m | Titanium Wire 1.0 mm diameter, 99.8% | 7440-32-6 | 10m |
| GX1280-25m | Titanium Wire 1.0 mm diameter, 99.8% | 7440-32-6 | 25m |
| GX7043-25g | Titanium(II) oxide, 99.5% | 12137-20-1 | 25g |
| GX7043-50g | Titanium(II) oxide, 99.5% | 12137-20-1 | 50g |
| GX7043-250g | Titanium(II) oxide, 99.5% | 12137-20-1 | 250g |
| GX9461-25g | Titanium(II) oxide, 99.9% | 12137-20-1 | 25g |
| GX9461-100g | Titanium(II) oxide, 99.9% | 12137-20-1 | 100g |
| GX6140-10g | Titanium(III,IV) oxide, 99.5+% | 12065-65-5 | 10g |
| GX6140-50g | Titanium(III,IV) oxide, 99.5+% | 12065-65-5 | 50g |
| GX0376-10g | Titanium(III) nitride Nanopowder, 97 % | 25583-20-4 | 10g |
| GX0376-25g | Titanium(III) nitride Nanopowder, 97 % | 25583-20-4 | 25g |
| GX0376-50g | Titanium(III) nitride Nanopowder, 97 % | 25583-20-4 | 50g |
| GX0376-100g | Titanium(III) nitride Nanopowder, 97 % | 25583-20-4 | 100g |
| GX0376-500g | Titanium(III) nitride Nanopowder, 97 % | 25583-20-4 | 500g |
| GX9511-25g | Titanium(III) oxide | 1344-54-3 | 25g |
| GX9511-100g | Titanium(III) oxide | 1344-54-3 | 100g |
| GX5251-50g | Titanium(III) oxide, 99.8% | 1344-54-3 | 50g |
| GX0735-10g | Titanium(IV) carbide Nanopowder, 99 % | 12070-08-5 | 10g |
| GX0735-25g | Titanium(IV) carbide Nanopowder, 99 % | 12070-08-5 | 25g |
| GX0735-50g | Titanium(IV) carbide Nanopowder, 99 % | 12070-08-5 | 50g |
| GX0735-100g | Titanium(IV) carbide Nanopowder, 99 % | 12070-08-5 | 100g |
| GX6027-10g | Titanium(IV) carbide Nanopowder, 99% [APS ~40nm, SSA NLT 50m2/g] | 12070-08-5 | 10g |
| GX6027-25g | Titanium(IV) carbide Nanopowder, 99% [APS ~40nm, SSA NLT 50m2/g] | 12070-08-5 | 25g |
| GX6027-50g | Titanium(IV) carbide Nanopowder, 99% [APS ~40nm, SSA NLT 50m2/g] | 12070-08-5 | 50g |
| GX6027-100g | Titanium(IV) carbide Nanopowder, 99% [APS ~40nm, SSA NLT 50m2/g] | 12070-08-5 | 100g |
| GX6027-500g | Titanium(IV) carbide Nanopowder, 99% [APS ~40nm, SSA NLT 50m2/g] | 12070-08-5 | 500g |
| GX6194-100g | Titanium(IV) carbide, 99% | 12070-08-5 | 100g |
| GX6194-250g | Titanium(IV) carbide, 99% | 12070-08-5 | 250g |
| GX6194-1kg | Titanium(IV) carbide, 99% | 12070-08-5 | 1kg |
| GX0530-10g | Titanium(IV) chloride-2-tetrahydrofuran | 31011-57-1 | 10g |
| GX6644-500g | Titanium(IV) ethoxide | 3087-36-3 | 500g |
| GX6644-1kg | Titanium(IV) ethoxide | 3087-36-3 | 1kg |
| GK5886-1kg | Titanium(IV) isopropoxide | 546-68-9 | 1kg |
| GK5886-2kg | Titanium(IV) isopropoxide | 546-68-9 | 2kg |
| GX0421-25g | Titanium(IV) isopropoxide, 99.99% | 546-68-9 | 25g |
| GX2925-1kg | Titanium(IV) n-butoxide, 99% | 5593-70-4 | 1kg |
| GX9404-500g | Titanium(IV) n-propoxide | 3087-37-4 | 500g |
| GX9404-1kg | Titanium(IV) n-propoxide | 3087-37-4 | 1kg |
| GX3163-250g | Titanium(IV) oxide Powder 220 nm, 95% | 13463-67-7 | 250g |
| GX3163-1kg | Titanium(IV) oxide Powder 220 nm, 95% | 13463-67-7 | 1kg |
| GX6311-25g | Titanium(IV) oxide-Nano Powder (anatase); 99.9% | 13463-67-7 | 25g |
| GX6311-100g | Titanium(IV) oxide-Nano Powder (anatase); 99.9% | 13463-67-7 | 100g |
| GX6844-250g | Titanium(IV) oxide, 99.5% | 13463-67-7 | 250g |
| GX6844-1kg | Titanium(IV) oxide, 99.5% | 13463-67-7 | 1kg |
| GX0305-25g | Titanium(IV) oxide, 99.9% | 13463-67-7 | 25g |
| GX0305-100g | Titanium(IV) oxide, 99.9% | 13463-67-7 | 100g |
| GX9179-10g | Titanium(IV) oxide, 99.998% | 1317-80-2 | 10g |
| GX9179-25g | Titanium(IV) oxide, 99.998% | 1317-80-2 | 25g |
| GX7581-10g | Titanium(IV) oxide, 99.999% | 13463-67-7 | 10g |
| GX7581-25g | Titanium(IV) oxide, 99.999% | 13463-67-7 | 25g |
| GX3109-10g | Titanium(IV) t-butoxide, 99.99% | 132071-58-0 | 10g |
| GP9162-1mg | Tivozanib | 475108-18-0 | 1mg |
| GP9162-5mg | Tivozanib | 475108-18-0 | 5mg |
| GP9162-10mg | Tivozanib | 475108-18-0 | 10mg |
| GP2209-1g | Tizanidine hydrochloride | 64461-82-1 | 1g |
| GN3044-5mg | TNP-ATP triethylammonium salt, 10mM in water | 61368-63-6 | 5mg |
| GA9878-1g | Tobramycin | 32986-56-4 | 1g |
| GA9878-5g | Tobramycin | 32986-56-4 | 5g |
| GA2734-100mg | Tobramycin sulphate | 49842-07-1 | 100mg |
| GA2734-250mg | Tobramycin sulphate | 49842-07-1 | 250mg |
| GA2734-1g | Tobramycin sulphate | 49842-07-1 | 1g |
| GL2205-10mg | Tocainide hydrochloride | 71395-14-7 | 10mg |
| GL2205-25mg | Tocainide hydrochloride | 71395-14-7 | 25mg |
| GL2205-50mg | Tocainide hydrochloride | 71395-14-7 | 50mg |
| GL6289-10mg | TOFA | 54857-86-2 | 10mg |
| GL6289-5mg | TOFA | 54857-86-2 | 5mg |
| GL6289-50mg | TOFA | 54857-86-2 | 50mg |
| GL6289-25mg | TOFA | 54857-86-2 | 25mg |
| GW7684-5mg | Tofacitinib | 477600-75-2 | 5mg |
| GW7684-25mg | Tofacitinib | 477600-75-2 | 25mg |
| GX6522-10mg | Tofacitinib citrate | 540737-29-9 | 10mg |
| GX6522-25mg | Tofacitinib citrate | 540737-29-9 | 25mg |
| GP6227-50mg | Tolazamide | 1156-19-0 | 50mg |
| GC7310-1mg | Tolcapone 3-O-β-D-glucuronide | 204853-33-8 | 1mg |
| GC7310-2mg | Tolcapone 3-O-β-D-glucuronide | 204853-33-8 | 2mg |
| GC7310-5mg | Tolcapone 3-O-β-D-glucuronide | 204853-33-8 | 5mg |
| GC7310-10mg | Tolcapone 3-O-β-D-glucuronide | 204853-33-8 | 10mg |
| GX9655-100mg | Tolfenpyrad | 129558-76-5 | 100mg |
| GC1469-1mg | Tolmetin acyl-β-D-glucuronide | 71595-19-2 | 1mg |
| GC1469-2mg | Tolmetin acyl-β-D-glucuronide | 71595-19-2 | 2mg |
| GC1469-5mg | Tolmetin acyl-β-D-glucuronide | 71595-19-2 | 5mg |
| GC1469-10mg | Tolmetin acyl-β-D-glucuronide | 71595-19-2 | 10mg |
| GA6091-1g | Tolnaftate | 2398-96-1 | 1g |
| GA6091-5g | Tolnaftate | 2398-96-1 | 5g |
| GP4157-1g | Tolperisone hydrochloride | 3644-61-9 | 1g |
| GP3410-25mg | Tolterodine tartrate | 124937-52-6 | 25mg |
| GP3410-100mg | Tolterodine tartrate | 124937-52-6 | 100mg |
| GA3944-100mg | Toltrazuril | 69004-03-1 | 100mg |
| GA3944-1g | Toltrazuril | 69004-03-1 | 1g |
| GK6186-100ml | Toluene | 108-88-3 | 100ml |
| GK6186-500ml | Toluene | 108-88-3 | 500ml |
| GK6186-1l | Toluene | 108-88-3 | 1l |
| GK6186-2500ml | Toluene | 108-88-3 | 2500ml |
| GK9090-100ml | Toluene, anhydrous, 99.9% | 108-88-3 | 100ml |
| GK9090-1l | Toluene, anhydrous, 99.9% | 108-88-3 | 1l |
| GS5970-100ml | Toluene, GlenDry™, anhydrous | 108-88-3 | 100ml |
| GS5970-500ml | Toluene, GlenDry™, anhydrous | 108-88-3 | 500ml |
| GS5970-1l | Toluene, GlenDry™, anhydrous | 108-88-3 | 1l |
| GS5970-2500ml | Toluene, GlenDry™, anhydrous | 108-88-3 | 2500ml |
| GS7641-100ml | Toluene, GlenDry™, anhydrous over molecular sieve | 108-88-3 | 100ml |
| GS7641-500ml | Toluene, GlenDry™, anhydrous over molecular sieve | 108-88-3 | 500ml |
| GS7641-1l | Toluene, GlenDry™, anhydrous over molecular sieve | 108-88-3 | 1l |
| GS7641-2500ml | Toluene, GlenDry™, anhydrous over molecular sieve | 108-88-3 | 2500ml |
| GS4701-500ml | Toluene, GlenPure™, analytical grade | 108-88-3 | 500ml |
| GS4701-1l | Toluene, GlenPure™, analytical grade | 108-88-3 | 1l |
| GS4701-2500ml | Toluene, GlenPure™, analytical grade | 108-88-3 | 2500ml |
| GS8845-2500ml | Toluene, GlenUltra™, analytical grade, for GC | 108-88-3 | 2500ml |
| GT7960-5g | Toluidine Blue (C.I. 50240) | 92-31-9 | 5g |
| GT7960-25g | Toluidine Blue (C.I. 50240) | 92-31-9 | 25g |
| GT7960-100g | Toluidine Blue (C.I. 50240) | 92-31-9 | 100g |
| GT2793-1l | Toluidine Blue (C.I. 50240); 1% aqueous solution | 92-31-9 | 1l |
| GP0580-50mg | Tonabersat | 175013-84-0 | 50mg |
| GC1245-1g | Topiramate | 97240-79-4 | 1g |
| GC1245-5g | Topiramate | 97240-79-4 | 5g |
| GP8771-100mg | Topotecan hydrochloride | 119413-54-6 | 100mg |
| GP8497-100mg | Toremifene citrate | 89778-27-8 | 100mg |
| GP8497-250mg | Toremifene citrate | 89778-27-8 | 250mg |
| GP8497-1g | Toremifene citrate | 89778-27-8 | 1g |
| GA5035-50mg | Torezolid | 856866-72-3 | 50mg |
| GA5035-1g | Torezolid | 856866-72-3 | 1g |
| GA2012-250mg | Tosufloxacin tosylate hydrate | 115964-29-9 | 250mg |
| GA2012-1g | Tosufloxacin tosylate hydrate | 115964-29-9 | 1g |
| GW0305-1mg | Tozasertib | 639089-54-6 | 1mg |
| GW0305-5mg | Tozasertib | 639089-54-6 | 5mg |
| GW0305-10mg | Tozasertib | 639089-54-6 | 10mg |
| GL8927-1mg | TPh A | 21306-65-0 | 1mg |
| GL8927-5mg | TPh A | 21306-65-0 | 5mg |
| GC2746-25g | Tragacanth | 9000-65-1 | 25g |
| GC2746-100g | Tragacanth | 9000-65-1 | 100g |
| GC2746-250g | Tragacanth | 9000-65-1 | 250g |
| GC2746-500g | Tragacanth | 9000-65-1 | 500g |
| GW3071-100mg | Tralomethrin | 66841-25-6 | 100mg |
| GW3071-500mg | Tralomethrin | 66841-25-6 | 500mg |
| GP2302-10mg | Trametinib | 1187431-43-1 | 10mg |
| GP8888-10mg | Trandolapril | 87679-37-6 | 10mg |
| GK5699-5g | Tranexamic acid | 1197-18-8 | 5g |
| GK5699-25g | Tranexamic acid | 1197-18-8 | 25g |
| GK5699-100g | Tranexamic acid | 1197-18-8 | 100g |
| GP8731-10mg | Tranilast | 53902-12-8 | 10mg |
| GT3354-25g | trans-1,2-Diaminocyclohexane-N,N,N'',N''-tetraacetic acid monohydrate | 125572-95-4 | 25g |
| GT3354-100g | trans-1,2-Diaminocyclohexane-N,N,N'',N''-tetraacetic acid monohydrate | 125572-95-4 | 100g |
| GT2391-50g | trans-1,2-Diaminocyclohexane-N,N,N'',N''-tetraacetic acid monohydrate, ACS grade | 125572-95-4 | 50g |
| GW0162-25g | trans-1,3-Diphenyl-2-propen-1-ol | 62668-02-4 | 25g |
| GW0162-100g | trans-1,3-Diphenyl-2-propen-1-ol | 62668-02-4 | 100g |
| GW1492-5mg | trans-11-Methyl-2-dodecenoic acid | 677354-24-4 | 5mg |
| GW1492-25mg | trans-11-Methyl-2-dodecenoic acid | 677354-24-4 | 25mg |
| GW0507-100mg | trans-2-Decenoic acid | 334-49-6 | 100mg |
| GW0507-1g | trans-2-Decenoic acid | 334-49-6 | 1g |
| GK7230-25g | trans-2-Hexenal | 6728-26-3 | 25g |
| GK3750-100g | trans-2,3-Dimethylacrylic acid | 80-59-1 | 100g |
| GK2300-25g | trans-4-Hydroxy-3-methoxycinnamic acid | 537-98-4 | 25g |
| GK2300-100g | trans-4-Hydroxy-3-methoxycinnamic acid | 537-98-4 | 100g |
| GK2300-250g | trans-4-Hydroxy-3-methoxycinnamic acid | 537-98-4 | 250g |
| GK2300-500g | trans-4-Hydroxy-3-methoxycinnamic acid | 537-98-4 | 500g |
| GK2300-1kg | trans-4-Hydroxy-3-methoxycinnamic acid | 537-98-4 | 1kg |
| GM7180-5g | trans-4-Hydroxy-L-proline | 51-35-4 | 5g |
| GM7180-25g | trans-4-Hydroxy-L-proline | 51-35-4 | 25g |
| GM7180-100g | trans-4-Hydroxy-L-proline | 51-35-4 | 100g |
| GM0902-100g | trans-4-Hydroxy-L-proline, GlenCell™, suitable for cell culture | 51-35-4 | 100g |
| GX9122-1g | trans-4,5-Dihydroxy-1,2-dithiane | 14193-38-5 | 1g |
| GX9122-5g | trans-4,5-Dihydroxy-1,2-dithiane | 14193-38-5 | 5g |
| GX9122-100g | trans-4,5-Dihydroxy-1,2-dithiane | 14193-38-5 | 100g |
| GL7895-100g | trans-Anethole | 4180-23-8 | 100g |
| GL7895-500g | trans-Anethole | 4180-23-8 | 500g |
| GK4115-100g | trans-Cinnamic acid | 140-10-3 | 100g |
| GK4115-500g | trans-Cinnamic acid | 140-10-3 | 500g |
| GK4115-1kg | trans-Cinnamic acid | 140-10-3 | 1kg |
| GX1443-1g | trans-Dichlorodiamine platinum(II); 99.95% (metals basis) | 14913-33-8 | 1g |
| GX1443-5g | trans-Dichlorodiamine platinum(II); 99.95% (metals basis) | 14913-33-8 | 5g |
| GK1850-250mg | trans-Indole-3-acrylic acid | 29953-71-7 | 250mg |
| GK1850-1g | trans-Indole-3-acrylic acid | 29953-71-7 | 1g |
| GC7269-1mg | trans-Resveratrol 3-O-β-D-glucuronide | 387372-17-0 | 1mg |
| GC7269-2mg | trans-Resveratrol 3-O-β-D-glucuronide | 387372-17-0 | 2mg |
| GC7269-5mg | trans-Resveratrol 3-O-β-D-glucuronide | 387372-17-0 | 5mg |
| GC7269-10mg | trans-Resveratrol 3-O-β-D-glucuronide | 387372-17-0 | 10mg |
| GC5367-100mg | trans-Resveratrol 3,5-diacetate | 411233-14-2 | 100mg |
| GC5367-250mg | trans-Resveratrol 3,5-diacetate | 411233-14-2 | 250mg |
| GC5367-500mg | trans-Resveratrol 3,5-diacetate | 411233-14-2 | 500mg |
| GC5367-1g | trans-Resveratrol 3,5-diacetate | 411233-14-2 | 1g |
| GC2654-1mg | trans-Resveratrol 4''-O-β-D-glucuronide | 387372-20-5 | 1mg |
| GC2654-2mg | trans-Resveratrol 4''-O-β-D-glucuronide | 387372-20-5 | 2mg |
| GC2654-5mg | trans-Resveratrol 4''-O-β-D-glucuronide | 387372-20-5 | 5mg |
| GC2654-10mg | trans-Resveratrol 4''-O-β-D-glucuronide | 387372-20-5 | 10mg |
| GY6386-100mg | trans-Zeatin | 1637-39-4 | 100mg |
| GY6386-250mg | trans-Zeatin | 1637-39-4 | 250mg |
| GL5267-25mg | trans-Zeatin-riboside | 6025-53-2 | 25mg |
| GL5267-100mg | trans-Zeatin-riboside | 6025-53-2 | 100mg |
| GL5267-250mg | trans-Zeatin-riboside | 6025-53-2 | 250mg |
| GK8553-10g | trans,trans-2,4-Hexadien-1-ol | 17102-64-6 | 10g |
| GK8553-25g | trans,trans-2,4-Hexadien-1-ol | 17102-64-6 | 25g |
| GK8553-100g | trans,trans-2,4-Hexadien-1-ol | 17102-64-6 | 100g |
| GK8553-250g | trans,trans-2,4-Hexadien-1-ol | 17102-64-6 | 250g |
| GK8553-500g | trans,trans-2,4-Hexadien-1-ol | 17102-64-6 | 500g |
| GP1446-25mg | Trapidil | 15421-84-8 | 25mg |
| GP1446-100mg | Trapidil | 15421-84-8 | 100mg |
| GC8339-5g | Tri-O-acetyl-D-glucal | 2873-29-2 | 5g |
| GC8339-25g | Tri-O-acetyl-D-glucal | 2873-29-2 | 25g |
| GC8339-100g | Tri-O-acetyl-D-glucal | 2873-29-2 | 100g |
| GK2569-500g | tri-Potassium citrate monohydrate | 6100-05-6 | 500g |
| GK2569-1kg | tri-Potassium citrate monohydrate | 6100-05-6 | 1kg |
| GK2569-5kg | tri-Potassium citrate monohydrate | 6100-05-6 | 5kg |
| GX3054-1kg | tri-Potassium citrate monohydrate, Ph. Eur. grade | 6100-05-6 | 1kg |
| GX3054-5kg | tri-Potassium citrate monohydrate, Ph. Eur. grade | 6100-05-6 | 5kg |
| GE6940-25ml | Triacetin | 102-76-1 | 25ml |
| GE6940-100ml | Triacetin | 102-76-1 | 100ml |
| GE6940-500ml | Triacetin | 102-76-1 | 500ml |
| GE6940-1l | Triacetin | 102-76-1 | 1l |
| GL6713-10mg | Triacetyl resveratrol | 42206-94-0 | 10mg |
| GL6713-50mg | Triacetyl resveratrol | 42206-94-0 | 50mg |
| GP2518-250mg | Triamcinolone | 124-94-7 | 250mg |
| GP2518-1g | Triamcinolone | 124-94-7 | 1g |
| GP6845-1g | Triamcinolone acetonide | 76-25-5 | 1g |
| GP6845-5g | Triamcinolone acetonide | 76-25-5 | 5g |
| GW4190-100mg | Triazamate | 112143-82-5 | 100mg |
| GW4190-500mg | Triazamate | 112143-82-5 | 500mg |
| GW3625-25mg | Triaziflam | 131475-57-5 | 25mg |
| GW0942-100mg | Tribenuron methylester | 101200-48-0 | 100mg |
| GX4926-100ml | Tributyl phosphate, 99% | 126-73-8 | 100ml |
| GK2312-25ml | Tributylamine | 102-82-9 | 25ml |
| GK2312-100ml | Tributylamine | 102-82-9 | 100ml |
| GX5903-5g | Tributylhexadecylphosphonium bromide | 14937-45-2 | 5g |
| GX5903-25g | Tributylhexadecylphosphonium bromide | 14937-45-2 | 25g |
| GX5903-100g | Tributylhexadecylphosphonium bromide | 14937-45-2 | 100g |
| GX8783-100g | Tributyltin chloride | 1461-22-9 | 100g |
| GE5936-5g | Tricaine methanesulfonate | 886-86-2 | 5g |
| GE5936-10g | Tricaine methanesulfonate | 886-86-2 | 10g |
| GE5936-25g | Tricaine methanesulfonate | 886-86-2 | 25g |
| GE5936-50g | Tricaine methanesulfonate | 886-86-2 | 50g |
| GL0754-100g | Tricaprylylmethylammonium chloride | 63393-96-4 | 100g |
| GL0754-500g | Tricaprylylmethylammonium chloride | 63393-96-4 | 500g |
| GK7416-100g | Trichloroacetic acid | 76-03-9 | 100g |
| GK7416-500g | Trichloroacetic acid | 76-03-9 | 500g |
| GK7416-1kg | Trichloroacetic acid | 76-03-9 | 1kg |
| GP8006-1mg | Trichostatin A | 58880-19-6 | 1mg |
| GP8006-5mg | Trichostatin A | 58880-19-6 | 5mg |
| GT6676-250ml | Trichrome Stain (Aniline Blue) solution | 250ml | |
| GT6676-500ml | Trichrome Stain (Aniline Blue) solution | 500ml | |
| GT4469-250ml | Trichrome Stain (Light Green) solution | 250ml | |
| GT4469-500ml | Trichrome Stain (Light Green) solution | 500ml | |
| GB8987-250g | Tricine | 5704-04-1 | 250g |
| GB8987-1kg | Tricine | 5704-04-1 | 1kg |
| GB5131-10g | Tricine, 99% | 5704-04-1 | 10g |
| GB5131-25g | Tricine, 99% | 5704-04-1 | 25g |
| GB5131-100g | Tricine, 99% | 5704-04-1 | 100g |
| GB5131-250g | Tricine, 99% | 5704-04-1 | 250g |
| GB5131-500g | Tricine, 99% | 5704-04-1 | 500g |
| GB5131-1kg | Tricine, 99% | 5704-04-1 | 1kg |
| GP3360-1g | Triclabendazole | 68786-66-3 | 1g |
| GA5716-5g | Triclosan | 3380-34-5 | 5g |
| GA5716-10g | Triclosan | 3380-34-5 | 10g |
| GA5716-25g | Triclosan | 3380-34-5 | 25g |
| GA5716-100g | Triclosan | 3380-34-5 | 100g |
| GA5716-250g | Triclosan | 3380-34-5 | 250g |
| GA5716-500g | Triclosan | 3380-34-5 | 500g |
| GX7553-5g | Tricyclohexylphosphine | 2622-14-2 | 5g |
| GX7553-25g | Tricyclohexylphosphine | 2622-14-2 | 25g |
| GE0563-100ml | Triethanolamine | 102-71-6 | 100ml |
| GE0563-250ml | Triethanolamine | 102-71-6 | 250ml |
| GE0563-500ml | Triethanolamine | 102-71-6 | 500ml |
| GE0563-1l | Triethanolamine | 102-71-6 | 1l |
| GE0563-5l | Triethanolamine | 102-71-6 | 5l |
| GB3570-100ml | Triethanolamine buffer solution, with EDTA and sodium azide | 100ml | |
| GB3570-500ml | Triethanolamine buffer solution, with EDTA and sodium azide | 500ml | |
| GB3570-1l | Triethanolamine buffer solution, with EDTA and sodium azide | 1l | |
| GX1854-100g | Triethyl citrate | 77-93-0 | 100g |
| GX1854-250g | Triethyl citrate | 77-93-0 | 250g |
| GX1854-1kg | Triethyl citrate | 77-93-0 | 1kg |
| GX1854-5kg | Triethyl citrate | 77-93-0 | 5kg |
| GK5301-25ml | Triethyl orthoformate | 122-51-0 | 25ml |
| GK5301-100ml | Triethyl orthoformate | 122-51-0 | 100ml |
| GK5481-25g | Triethyl phosphonoacetate | 867-13-0 | 25g |
| GK5481-100g | Triethyl phosphonoacetate | 867-13-0 | 100g |
| GK7255-25ml | Triethylamine | 121-44-8 | 25ml |
| GK7255-100ml | Triethylamine | 121-44-8 | 100ml |
| GK7255-500ml | Triethylamine | 121-44-8 | 500ml |
| GK0316-100g | Triethylamine hydrochloride | 554-68-7 | 100g |
| GK0316-1kg | Triethylamine hydrochloride | 554-68-7 | 1kg |
| GS8310-100ml | Triethylamine, GlenDry™, anhydrous | 121-44-8 | 100ml |
| GS8310-500ml | Triethylamine, GlenDry™, anhydrous | 121-44-8 | 500ml |
| GS8310-1l | Triethylamine, GlenDry™, anhydrous | 121-44-8 | 1l |
| GS4732-100ml | Triethylamine, GlenDry™, anhydrous over molecular sieve | 121-44-8 | 100ml |
| GS4732-500ml | Triethylamine, GlenDry™, anhydrous over molecular sieve | 121-44-8 | 500ml |
| GS4732-1l | Triethylamine, GlenDry™, anhydrous over molecular sieve | 121-44-8 | 1l |
| GS2878-100ml | Triethylamine, GlenPure™, analytical grade | 121-44-8 | 100ml |
| GS2878-500ml | Triethylamine, GlenPure™, analytical grade | 121-44-8 | 500ml |
| GB3614-100ml | Triethylammonium acetate buffer, 1M solution in water | 100ml | |
| GB3614-500ml | Triethylammonium acetate buffer, 1M solution in water | 500ml | |
| GB3614-1l | Triethylammonium acetate buffer, 1M solution in water | 1l | |
| GX1189-25ml | Triethylene glycol | 112-27-6 | 25ml |
| GX1189-100ml | Triethylene glycol | 112-27-6 | 100ml |
| GK6592-1g | Triethylene glycol monooctyl ether | 19327-38-9 | 1g |
| GK6592-5g | Triethylene glycol monooctyl ether | 19327-38-9 | 5g |
| GX6817-5g | Triethylsilane | 617-86-7 | 5g |
| GX6817-10g | Triethylsilane | 617-86-7 | 10g |
| GX5753-25g | Triethyltin bromide | 2767-54-6 | 25g |
| GX5707-100mg | Trifloxystrobin | 141517-21-7 | 100mg |
| GL5164-5g | Trifluoperazine dihydrochloride | 440-17-5 | 5g |
| GL5164-10g | Trifluoperazine dihydrochloride | 440-17-5 | 10g |
| GL5164-25g | Trifluoperazine dihydrochloride | 440-17-5 | 25g |
| GK6959-500ml | Trifluoroacetic acid | 76-05-1 | 500ml |
| GK6959-1l | Trifluoroacetic acid | 76-05-1 | 1l |
| GK2000-100ml | Trifluoroacetic acid, Ultrapure for synthesis | 76-05-1 | 100ml |
| GK2000-1l | Trifluoroacetic acid, Ultrapure for synthesis | 76-05-1 | 1l |
| GL9311-1g | Trifluoromethanesulfonamide | 421-85-2 | 1g |
| GL9311-10g | Trifluoromethanesulfonamide | 421-85-2 | 10g |
| GC7093-10g | Trifluoromethanesulfonic acid | 1493-13-6 | 10g |
| GC7093-25g | Trifluoromethanesulfonic acid | 1493-13-6 | 25g |
| GK4778-10g | Trifluoromethanesulfonic anhydride | 358-23-6 | 10g |
| GK4778-25g | Trifluoromethanesulfonic anhydride | 358-23-6 | 25g |
| GE1913-50mg | Trifluridine | 70-00-8 | 50mg |
| GE1913-100mg | Trifluridine | 70-00-8 | 100mg |
| GE1913-250mg | Trifluridine | 70-00-8 | 250mg |
| GK5203-100mg | Trigonelline hydrochloride | 6138-41-6 | 100mg |
| GP8355-10mg | Trilostane | 13647-35-3 | 10mg |
| GP8355-25mg | Trilostane | 13647-35-3 | 25mg |
| GP8355-50mg | Trilostane | 13647-35-3 | 50mg |
| GP8355-100mg | Trilostane | 13647-35-3 | 100mg |
| GP6551-1g | Trimebutine maleate | 34140-59-5 | 1g |
| GP6551-5g | Trimebutine maleate | 34140-59-5 | 5g |
| GA3656-1g | Trimethoprim | 738-70-5 | 1g |
| GA3656-5g | Trimethoprim | 738-70-5 | 5g |
| GA3656-10g | Trimethoprim | 738-70-5 | 10g |
| GA3656-25g | Trimethoprim | 738-70-5 | 25g |
| GA3656-50g | Trimethoprim | 738-70-5 | 50g |
| GA3656-100g | Trimethoprim | 738-70-5 | 100g |
| GA5588-100mg | Trimethoprim lactate salt | 23256-42-0 | 100mg |
| GA5588-250mg | Trimethoprim lactate salt | 23256-42-0 | 250mg |
| GA5588-500mg | Trimethoprim lactate salt | 23256-42-0 | 500mg |
| GA5588-1g | Trimethoprim lactate salt | 23256-42-0 | 1g |
| GW9332-25mg | Trimethoprim sulfate | 56585-33-2 | 25mg |
| GW9332-100mg | Trimethoprim sulfate | 56585-33-2 | 100mg |
| GK1848-500ml | Trimethyl orthoacetate | 1445-45-0 | 500ml |
| GK5763-10g | Trimethylamine-N-oxide dihydrate | 62637-93-8 | 10g |
| GK5763-25g | Trimethylamine-N-oxide dihydrate | 62637-93-8 | 25g |
| GK5763-100g | Trimethylamine-N-oxide dihydrate | 62637-93-8 | 100g |
| GK5763-250g | Trimethylamine-N-oxide dihydrate | 62637-93-8 | 250g |
| GK5763-500g | Trimethylamine-N-oxide dihydrate | 62637-93-8 | 500g |
| GE8419-25g | Trioctylmethylammonium chloride | 5137-55-3 | 25g |
| GX0729-10g | Trioctylphosphine oxide | 78-50-2 | 10g |
| GX0729-25g | Trioctylphosphine oxide | 78-50-2 | 25g |
| GX0729-100g | Trioctylphosphine oxide | 78-50-2 | 100g |
| GX0766-50g | Triphenylantimony, 98% | 603-36-1 | 50g |
| GX2207-25g | Triphenyllead acetate | 1162-06-7 | 25g |
| GX2207-100g | Triphenyllead acetate | 1162-06-7 | 100g |
| GK1326-100g | Triphenylphosphine | 603-35-0 | 100g |
| GK1326-250g | Triphenylphosphine | 603-35-0 | 250g |
| GK1326-500g | Triphenylphosphine | 603-35-0 | 500g |
| GK1326-1kg | Triphenylphosphine | 603-35-0 | 1kg |
| GK1326-5kg | Triphenylphosphine | 603-35-0 | 5kg |
| GX7580-1g | Triphenylphosphine gold (I) chloride, 99.95% (metals basis) | 14243-64-2 | 1g |
| GX7580-2g | Triphenylphosphine gold (I) chloride, 99.95% (metals basis) | 14243-64-2 | 2g |
| GX7580-5g | Triphenylphosphine gold (I) chloride, 99.95% (metals basis) | 14243-64-2 | 5g |
| GK3762-5g | Triphenylphosphine hydrobromide | 6399-81-1 | 5g |
| GK3762-25g | Triphenylphosphine hydrobromide | 6399-81-1 | 25g |
| GK8650-25g | Triphenylphosphine oxide | 791-28-6 | 25g |
| GK8650-100g | Triphenylphosphine oxide | 791-28-6 | 100g |
| GK8650-250g | Triphenylphosphine oxide | 791-28-6 | 250g |
| GL2755-5g | Triphenylsilanol | 791-31-1 | 5g |
| GX6810-100g | Triphenyltin chloride | 639-58-7 | 100g |
| GL7060-1mg | Tripolin A | 1148118-92-6 | 1mg |
| GL7060-5mg | Tripolin A | 1148118-92-6 | 5mg |
| GL9093-1mg | Tripolin B | 372164-71-1 | 1mg |
| GP2934-1mg | Triptolide | 38748-32-2 | 1mg |
| GP2934-5mg | Triptolide | 38748-32-2 | 5mg |
| GP2934-10mg | Triptolide | 38748-32-2 | 10mg |
| GP7166-100g | TRIS | 77-86-1 | 100g |
| GP7166-250g | TRIS | 77-86-1 | 250g |
| GP7166-500g | TRIS | 77-86-1 | 500g |
| GP7166-1kg | TRIS | 77-86-1 | 1kg |
| GP7166-5kg | TRIS | 77-86-1 | 5kg |
| GX7765-1g | Tris (triphenylphosphine)ruthenium(II) chloride, 99.95% (metals basis) | 15529-49-4 | 1g |
| GX7765-5g | Tris (triphenylphosphine)ruthenium(II) chloride, 99.95% (metals basis) | 15529-49-4 | 5g |
| GB8936-25g | TRIS acetate | 6850-28-8 | 25g |
| GB8936-100g | TRIS acetate | 6850-28-8 | 100g |
| GB8936-500g | TRIS acetate | 6850-28-8 | 500g |
| GB8580-250ml | Tris Acetate-EDTA buffer solution | 250ml | |
| GB8580-1l | Tris Acetate-EDTA buffer solution | 1l | |
| GB3555-500ml | TRIS Buffered Saline (TBS); 10X solution | - | 500ml |
| GB3555-1l | TRIS Buffered Saline (TBS); 10X solution | - | 1l |
| GB3555-2500ml | TRIS Buffered Saline (TBS); 10X solution | - | 2500ml |
| GB4431-100g | TRIS hydrochloride | 1185-53-1 | 100g |
| GB4431-250g | TRIS hydrochloride | 1185-53-1 | 250g |
| GB4431-500g | TRIS hydrochloride | 1185-53-1 | 500g |
| GB4431-1kg | TRIS hydrochloride | 1185-53-1 | 1kg |
| GB4431-5kg | TRIS hydrochloride | 1185-53-1 | 5kg |
| GB1923-100g | TRIS Ultrapure, 99.9%, Ph. Eur. grade | 77-86-1 | 100g |
| GB1923-250g | TRIS Ultrapure, 99.9%, Ph. Eur. grade | 77-86-1 | 250g |
| GB1923-500g | TRIS Ultrapure, 99.9%, Ph. Eur. grade | 77-86-1 | 500g |
| GB1923-1kg | TRIS Ultrapure, 99.9%, Ph. Eur. grade | 77-86-1 | 1kg |
| GE1860-1g | Tris-(2-carboxyethyl)phosphine hydrochloride | 51805-45-9 | 1g |
| GE1860-5g | Tris-(2-carboxyethyl)phosphine hydrochloride | 51805-45-9 | 5g |
| GE1860-10g | Tris-(2-carboxyethyl)phosphine hydrochloride | 51805-45-9 | 10g |
| GE1860-25g | Tris-(2-carboxyethyl)phosphine hydrochloride | 51805-45-9 | 25g |
| GX7489-500ml | Tris-EDTA buffer solution (10X, suitable for molecular biology, pH 8.0) | - | 500ml |
| GX7489-1l | Tris-EDTA buffer solution (10X, suitable for molecular biology, pH 8.0) | - | 1l |
| GX7489-2500ml | Tris-EDTA buffer solution (10X, suitable for molecular biology, pH 8.0) | - | 2500ml |
| GX8166-1l | Tris-EDTA buffer solution (1X, pH 8.0) | 1l | |
| GX8166-2500ml | Tris-EDTA buffer solution (1X, pH 8.0) | 2500ml | |
| GB5857-100ml | Tris-EDTA buffer, 100X solution | 100ml | |
| GB5857-250ml | Tris-EDTA buffer, 100X solution | 250ml | |
| GE4461-1l | TRIS-Glycine Buffer 10X | 1l | |
| GE4461-2500ml | TRIS-Glycine Buffer 10X | 2500ml | |
| GE6710-250ml | TRIS-Glycine Buffer 10X, GlenBiol™, suitable for molecular biology | 250ml | |
| GE6710-1l | TRIS-Glycine Buffer 10X, GlenBiol™, suitable for molecular biology | 1l | |
| GE2706-500ml | TRIS-Glycine-SDS Buffer 10X | - | 500ml |
| GE2706-1l | TRIS-Glycine-SDS Buffer 10X | - | 1l |
| GE2706-2500ml | TRIS-Glycine-SDS Buffer 10X | - | 2500ml |
| GE9118-250ml | TRIS-Glycine-SDS Buffer 10X, GlenBiol™, suitable for molecular biology | 250ml | |
| GE9118-1l | TRIS-Glycine-SDS Buffer 10X, GlenBiol™, suitable for molecular biology | 1l | |
| GB0181-500ml | TRIS-Tricine-SDS running buffer, 10X solution | 500ml | |
| GB0181-1l | TRIS-Tricine-SDS running buffer, 10X solution | 1l | |
| GP9311-1kg | Tris(hydroxymethyl)aminomethane | 77-86-1 | 1kg |
| GP9311-5kg | Tris(hydroxymethyl)aminomethane | 77-86-1 | 5kg |
| GX2604-1g | Tris(triphenylphosphine)rhodium(I) chloride, 99.95% (metals basis) | 14694-95-2 | 1g |
| GX2604-5g | Tris(triphenylphosphine)rhodium(I) chloride, 99.95% (metals basis) | 14694-95-2 | 5g |
| GX1218-1g | Tris[(1-benzyl-1H-1,2,3-triazol-4-yl)methyl]amine | 510758-28-8 | 1g |
| GW0051-500mg | Tris[3,5-bis(trifluoromethyl)phenyl]phosphine | 175136-62-6 | 500mg |
| GW0051-2500mg | Tris[3,5-bis(trifluoromethyl)phenyl]phosphine | 175136-62-6 | 2500mg |
| GX8017-100mg | Tris[tris(3,5-bis(trifluoromethyl)phenyl)phosphine]palladium(0) (Superstable Pd(0) catalyst) | 130784-80-3 | 100mg |
| GK8388-5g | Tristearin, 98% | 555-43-1 | 5g |
| GK8388-25g | Tristearin, 98% | 555-43-1 | 25g |
| GP8940-5mg | Troglitazone | 97322-87-7 | 5mg |
| GP8940-25mg | Troglitazone | 97322-87-7 | 25mg |
| GT8713-1g | Tropaeolin 000 No. 1 | 523-44-4 | 1g |
| GT8713-5g | Tropaeolin 000 No. 1 | 523-44-4 | 5g |
| GT7534-10g | Tropaeolin O (C.I. 14270) | 547-57-9 | 10g |
| GT7534-25g | Tropaeolin O (C.I. 14270) | 547-57-9 | 25g |
| GT7534-100g | Tropaeolin O (C.I. 14270) | 547-57-9 | 100g |
| GT4399-5g | Tropaeolin OO | 554-73-4 | 5g |
| GT4399-25g | Tropaeolin OO | 554-73-4 | 25g |
| GT4399-100g | Tropaeolin OO | 554-73-4 | 100g |
| GP3255-1g | Tropicamide | 1508-75-4 | 1g |
| GA4312-1mg | Tropodithietic acid | 750590-18-2 | 1mg |
| GA4312-5mg | Tropodithietic acid | 750590-18-2 | 5mg |
| GE7945-1g | Tropolone | 533-75-5 | 1g |
| GE7945-5g | Tropolone | 533-75-5 | 5g |
| GE7945-25g | Tropolone | 533-75-5 | 25g |
| GL4062-1mg | Trypacidin | 1900-29-4 | 1mg |
| GL4062-5mg | Trypacidin | 1900-29-4 | 5mg |
| GT3970-25g | Trypan Blue (C.I. 23850) | 72-57-1 | 25g |
| GT3970-100g | Trypan Blue (C.I. 23850) | 72-57-1 | 100g |
| GT0822-100ml | Trypan Blue (C.I. 23850); 0.4% solution | 72-57-1 | 100ml |
| GE3976-10g | Trypsin | 9002-07-7 | 10g |
| GE5012-1g | Trypsin, bovine origin | 9002-07-7 | 1g |
| GP9154-10g | Tryptamine | 61-54-1 | 10g |
| GP9154-50g | Tryptamine | 61-54-1 | 50g |
| GE6771-100g | Tryptone (Casein hydrolysate, enzymatic digest) | 91079-40-2 | 100g |
| GE6771-250g | Tryptone (Casein hydrolysate, enzymatic digest) | 91079-40-2 | 250g |
| GE6771-500g | Tryptone (Casein hydrolysate, enzymatic digest) | 91079-40-2 | 500g |
| GW9504-10mg | Tubastatin A | 1252003-15-8 | 10mg |
| GA3247-250mg | Tulathromycin A | 217500-96-4 | 250mg |
| GA3247-1g | Tulathromycin A | 217500-96-4 | 1g |
| GX6015-50g | Tungsten boride, 99.5% | 12007-09-9 | 50g |
| GX2208-50g | Tungsten boride, 99.5% | 12007-10-2 | 50g |
| GX6015-250g | Tungsten boride, 99.5% | 12007-09-9 | 250g |
| GX2208-250g | Tungsten boride, 99.5% | 12007-10-2 | 250g |
| GX2331-25g | Tungsten boride, 99+% | 12007-98-6 | 25g |
| GX2331-50g | Tungsten boride, 99+% | 12007-98-6 | 50g |
| GX2331-250g | Tungsten boride, 99+% | 12007-98-6 | 250g |
| GX5611-100g | Tungsten carbide | 12070-12-1 | 100g |
| GX5611-250g | Tungsten carbide | 12070-12-1 | 250g |
| GX5611-500g | Tungsten carbide | 12070-12-1 | 500g |
| GX3926-45x50mm | Tungsten Foil 0.025 mm, 99.95% | 7440-33-7 | 45x50mm |
| GX3926-50x50mm | Tungsten Foil 0.025 mm, 99.95% | 7440-33-7 | 50x50mm |
| GX3926-50x100mm | Tungsten Foil 0.025 mm, 99.95% | 7440-33-7 | 50x100mm |
| GX3926-100x100mm | Tungsten Foil 0.025 mm, 99.95% | 7440-33-7 | 100x100mm |
| GX0695-25x25mm | Tungsten Foil 0.05 mm, 99.9+% | 7440-33-7 | 25x25mm |
| GX0695-50x50mm | Tungsten Foil 0.05 mm, 99.9+% | 7440-33-7 | 50x50mm |
| GX0695-100x100mm | Tungsten Foil 0.05 mm, 99.9+% | 7440-33-7 | 100x100mm |
| GX7233-100x100mm | Tungsten Foil 0.1 mm, 99.96% | 7440-33-7 | 100x100mm |
| GX7233-100x200mm | Tungsten Foil 0.1 mm, 99.96% | 7440-33-7 | 100x200mm |
| GX3609-100x100mm | Tungsten Foil 0.15 mm, 99.96% | 7440-33-7 | 100x100mm |
| GX3609-100x200mm | Tungsten Foil 0.15 mm, 99.96% | 7440-33-7 | 100x200mm |
| GX6917-100x100mm | Tungsten Foil 0.2 mm, 99.96% | 7440-33-7 | 100x100mm |
| GX6917-100x200mm | Tungsten Foil 0.2 mm, 99.96% | 7440-33-7 | 100x200mm |
| GX9553-50x50mm | Tungsten Foil 0.5 mm, 99.96% | 7440-33-7 | 50x50mm |
| GX9553-100x100mm | Tungsten Foil 0.5 mm, 99.96% | 7440-33-7 | 100x100mm |
| GX9553-100x200mm | Tungsten Foil 0.5 mm, 99.96% | 7440-33-7 | 100x200mm |
| GX0404-100x100mm | Tungsten Foil 0.7 mm, 99.96% | 7440-33-7 | 100x100mm |
| GX0201-50x50mm | Tungsten Foil 1.0 mm, 99.96% | 7440-33-7 | 50x50mm |
| GX0201-100x100mm | Tungsten Foil 1.0 mm, 99.96% | 7440-33-7 | 100x100mm |
| GX0201-100x200mm | Tungsten Foil 1.0 mm, 99.96% | 7440-33-7 | 100x200mm |
| GX1242-50x50mm | Tungsten Foil 2.0 mm, 99.96% | 7440-33-7 | 50x50mm |
| GX1242-100x100mm | Tungsten Foil 2.0 mm, 99.96% | 7440-33-7 | 100x100mm |
| GX2321-250g | Tungsten Granules 0.5-2 mm, 99.7% | 7440-33-7 | 250g |
| GX2321-1kg | Tungsten Granules 0.5-2 mm, 99.7% | 7440-33-7 | 1kg |
| GX8256-10g | Tungsten Nanopowder, 99,9 % | 7440-33-7 | 10g |
| GX8256-25g | Tungsten Nanopowder, 99,9 % | 7440-33-7 | 25g |
| GX8914-5g | Tungsten nanopowder, 99.0% | 7440-33-7 | 5g |
| GX8914-10g | Tungsten nanopowder, 99.0% | 7440-33-7 | 10g |
| GX8914-25g | Tungsten nanopowder, 99.0% | 7440-33-7 | 25g |
| GX8914-100g | Tungsten nanopowder, 99.0% | 7440-33-7 | 100g |
| GX8345-25g | Tungsten Pellets 6.35 x 6.35 mm, 99.97% | 7440-33-7 | 25g |
| GX8345-100g | Tungsten Pellets 6.35 x 6.35 mm, 99.97% | 7440-33-7 | 100g |
| GX8906-250g | Tungsten Powder 2.8 micron, 99.95% | 7440-33-7 | 250g |
| GX8906-500g | Tungsten Powder 2.8 micron, 99.95% | 7440-33-7 | 500g |
| GX3247-5g | Tungsten Powder 5 micron (Mo 1 ppm); 99.999% | 7440-33-7 | 5g |
| GX3247-25g | Tungsten Powder 5 micron (Mo 1 ppm); 99.999% | 7440-33-7 | 25g |
| GX4644-100g | Tungsten Powder max. 10 micron, 99.99% | 7440-33-7 | 100g |
| GX8566-5x330mm | Tungsten Rod 1 mm, 99.95+% | 7440-33-7 | 5x330mm |
| GX0975-5x800mm | Tungsten Rod 1.2 mm, 99.95+% | 7440-33-7 | 5x800mm |
| GX3271-150mm | Tungsten Rod 10 mm diameter, 99.95+% | 7440-33-7 | 150mm |
| GX9070-150mm | Tungsten Rod 12 mm diameter, 99.95+% | 7440-33-7 | 150mm |
| GX8106-100mm | Tungsten Rod 15 mm diameter, 99.95+% | 7440-33-7 | 100mm |
| GX5842-2x200mm | Tungsten Rod 2 mm, 99.95+% | 7440-33-7 | 2x200mm |
| GX1135-2x500mm | Tungsten Rod 2.5 mm, 99.95+% | 7440-33-7 | 2x500mm |
| GX5958-100mm | Tungsten Rod 20 mm diameter, 99.95+% | 7440-33-7 | 100mm |
| GX1465-500mm | Tungsten Rod 3.0 mm diameter, 99.95+% | 7440-33-7 | 500mm |
| GX0030-250mm | Tungsten Rod 4.0 mm diameter, 99.95+% | 7440-33-7 | 250mm |
| GX3169-250mm | Tungsten Rod 5.0 mm diameter, 99.95+% | 7440-33-7 | 250mm |
| GX3278-200mm | Tungsten Rod 8.0 mm diameter, 99.95+% | 7440-33-7 | 200mm |
| GX3278-500mm | Tungsten Rod 8.0 mm diameter, 99.95+% | 7440-33-7 | 500mm |
| GX9862-50g | Tungsten silicide, 99% | 12039-88-2 | 50g |
| GX4566-25g | Tungsten sulfide, 99.8% | 12138-09-9 | 25g |
| GX4566-100g | Tungsten sulfide, 99.8% | 12138-09-9 | 100g |
| GX4566-250g | Tungsten sulfide, 99.8% | 12138-09-9 | 250g |
| GX9233-50m | Tungsten Wire 0.01 mm diameter, 99.9+% | 7440-33-7 | 50m |
| GX4882-25m | Tungsten Wire 0.1 mm diameter, 99.95+% | 7440-33-7 | 25m |
| GX4882-100m | Tungsten Wire 0.1 mm diameter, 99.95+% | 7440-33-7 | 100m |
| GX6303-25m | Tungsten Wire 0.15 mm diameter, 99.9% | 7440-33-7 | 25m |
| GX3564-25m | Tungsten Wire 0.2 mm diameter, 99.95+% | 7440-33-7 | 25m |
| GX3564-100m | Tungsten Wire 0.2 mm diameter, 99.95+% | 7440-33-7 | 100m |
| GX2906-25m | Tungsten Wire 0.25 mm diameter, 99.95+% | 7440-33-7 | 25m |
| GX2248-25m | Tungsten Wire 0.3 mm diameter, 99.95+% | 7440-33-7 | 25m |
| GX2248-100m | Tungsten Wire 0.3 mm diameter, 99.95+% | 7440-33-7 | 100m |
| GX6591-10m | Tungsten Wire 0.4 mm diameter, 99.95+% | 7440-33-7 | 10m |
| GX6591-50m | Tungsten Wire 0.4 mm diameter, 99.95+% | 7440-33-7 | 50m |
| GX6591-100m | Tungsten Wire 0.4 mm diameter, 99.95+% | 7440-33-7 | 100m |
| GX4458-10m | Tungsten Wire 0.5 mm diameter, 99.95+% | 7440-33-7 | 10m |
| GX4458-50m | Tungsten Wire 0.5 mm diameter, 99.95+% | 7440-33-7 | 50m |
| GX2815-5m | Tungsten Wire 0.7 mm diameter, 99.95+% | 7440-33-7 | 5m |
| GX2815-25m | Tungsten Wire 0.7 mm diameter, 99.95+% | 7440-33-7 | 25m |
| GX0753-2m | Tungsten Wire 1.0 mm diameter, 99.95+% | 7440-33-7 | 2m |
| GX0753-10m | Tungsten Wire 1.0 mm diameter, 99.95+% | 7440-33-7 | 10m |
| GX5029-2m | Tungsten Wire 1.4 mm diameter, 99.95+% | 7440-33-7 | 2m |
| GX5029-10m | Tungsten Wire 1.4 mm diameter, 99.95+% | 7440-33-7 | 10m |
| GX0156-1m | Tungsten Wire 2.0 mm diameter, 99.95+% | 7440-33-7 | 1m |
| GX0156-5m | Tungsten Wire 2.0 mm diameter, 99.95+% | 7440-33-7 | 5m |
| GX8863-25g | Tungsten(IV) carbide, 99,95 % | 12070-12-1 | 25g |
| GX8863-100g | Tungsten(IV) carbide, 99,95 % | 12070-12-1 | 100g |
| GX8863-250g | Tungsten(IV) carbide, 99,95 % | 12070-12-1 | 250g |
| GX8863-500g | Tungsten(IV) carbide, 99,95 % | 12070-12-1 | 500g |
| GX7776-25g | Tungsten(IV) disulfide Nanopowder, 99 % | 12138-09-9 | 25g |
| GX9957-5g | Tungsten(IV) oxide, 99.5% | 12036-22-5 | 5g |
| GX9957-25g | Tungsten(IV) oxide, 99.5% | 12036-22-5 | 25g |
| GX9957-100g | Tungsten(IV) oxide, 99.5% | 12036-22-5 | 100g |
| GX7903-25g | Tungsten(VI) oxide-Nano Powder, 99+% | 1314-35-8 | 25g |
| GX7903-100g | Tungsten(VI) oxide-Nano Powder, 99+% | 1314-35-8 | 100g |
| GX1091-100g | Tungsten(VI) oxide, 99.9% | 1314-35-8 | 100g |
| GX1091-500g | Tungsten(VI) oxide, 99.9% | 1314-35-8 | 500g |
| GX6170-25g | Tungsten(VI) oxide, 99.9%, tablets for evaporation | 1314-35-8 | 25g |
| GX6170-100g | Tungsten(VI) oxide, 99.9%, tablets for evaporation | 1314-35-8 | 100g |
| GX9024-100g | Tungsten(VI) oxide, 99.99% | 1314-35-8 | 100g |
| GX9024-250g | Tungsten(VI) oxide, 99.99% | 1314-35-8 | 250g |
| GX6962-10g | Tungsten(VI) oxide, 99.995% | 1314-35-8 | 10g |
| GX6962-25g | Tungsten(VI) oxide, 99.995% | 1314-35-8 | 25g |
| GX0912-100g | Tungsten(VI) oxide, 99+% | 1314-35-8 | 100g |
| GX0912-250g | Tungsten(VI) oxide, 99+% | 1314-35-8 | 250g |
| GX0912-1kg | Tungsten(VI) oxide, 99+% | 1314-35-8 | 1kg |
| GX7349-500g | Tungstic acid, 99+% | 7783-03-1 | 500g |
| GX7349-1kg | Tungstic acid, 99+% | 7783-03-1 | 1kg |
| GD9856-100ml | Tween 20 | 9005-64-5 | 100ml |
| GD9856-250ml | Tween 20 | 9005-64-5 | 250ml |
| GD9856-500ml | Tween 20 | 9005-64-5 | 500ml |
| GD9856-1l | Tween 20 | 9005-64-5 | 1l |
| GD9856-5l | Tween 20 | 9005-64-5 | 5l |
| GE1584-100ml | Tween 20, BP, Ph. Eur., USP/NF grade | 9005-64-5 | 100ml |
| GE1584-500ml | Tween 20, BP, Ph. Eur., USP/NF grade | 9005-64-5 | 500ml |
| GE1584-1l | Tween 20, BP, Ph. Eur., USP/NF grade | 9005-64-5 | 1l |
| GD3405-100ml | Tween 40 | 9005-66-7 | 100ml |
| GD3405-250ml | Tween 40 | 9005-66-7 | 250ml |
| GD3405-500ml | Tween 40 | 9005-66-7 | 500ml |
| GD3405-1l | Tween 40 | 9005-66-7 | 1l |
| GD3405-5l | Tween 40 | 9005-66-7 | 5l |
| GL6809-100ml | Tween 60 | 9005-67-8 | 100ml |
| GL6809-500ml | Tween 60 | 9005-67-8 | 500ml |
| GL6809-1l | Tween 60 | 9005-67-8 | 1l |
| GL3891-100g | Tween 60, BP, Ph. Eur., USP/NF grade | 9005-67-8 | 100g |
| GL3891-250g | Tween 60, BP, Ph. Eur., USP/NF grade | 9005-67-8 | 250g |
| GL3891-500g | Tween 60, BP, Ph. Eur., USP/NF grade | 9005-67-8 | 500g |
| GD5948-100ml | Tween 80 | 9005-65-6 | 100ml |
| GD5948-250ml | Tween 80 | 9005-65-6 | 250ml |
| GD5948-500ml | Tween 80 | 9005-65-6 | 500ml |
| GD5948-1l | Tween 80 | 9005-65-6 | 1l |
| GD5948-5l | Tween 80 | 9005-65-6 | 5l |
| GD6218-100ml | Tween 80, 10% solution in water | 9005-65-6 | 100ml |
| GD6218-1l | Tween 80, 10% solution in water | 9005-65-6 | 1l |
| GD6218-2500ml | Tween 80, 10% solution in water | 9005-65-6 | 2500ml |
| GA0812-250mg | Tylosin | 1401-69-0 | 250mg |
| GA6954-100mg | Tylosin phosphate | 1405-53-4 | 100mg |
| GA2429-1g | Tylosin tartrate | 1405-54-5 | 1g |
| GL3025-1g | Tyloxapol, USP grade | 25301-02-4 | 1g |
| GL3025-5g | Tyloxapol, USP grade | 25301-02-4 | 5g |
| GE1766-5g | Tyramine | 51-67-2 | 5g |
| GE1766-25g | Tyramine | 51-67-2 | 25g |
| GE5178-1g | Tyramine hydrochloride | 60-19-5 | 1g |
| GE5178-5g | Tyramine hydrochloride | 60-19-5 | 5g |
| GE5178-10g | Tyramine hydrochloride | 60-19-5 | 10g |
| GE5178-25g | Tyramine hydrochloride | 60-19-5 | 25g |
| GE5178-100g | Tyramine hydrochloride | 60-19-5 | 100g |
| GZ6771-25KU | Tyrosinase, from mushroom | 9002-10-2 | 25KU |
| GZ6771-100KU | Tyrosinase, from mushroom | 9002-10-2 | 100KU |
| GW6423-1mg | UBS109 | 1258513-40-4 | 1mg |
| GW6423-5mg | UBS109 | 1258513-40-4 | 5mg |
| GW6423-10mg | UBS109 | 1258513-40-4 | 10mg |
| GC8551-5mg | UDP-a-D-galactose disodium salt | 137868-52-1 | 5mg |
| GC8551-25mg | UDP-a-D-galactose disodium salt | 137868-52-1 | 25mg |
| GL9453-250ug | UK-1 | 151271-53-3 | 250ug |
| GL9453-1mg | UK-1 | 151271-53-3 | 1mg |
| GL1279-1mg | UK-5099 | 56396-35-1 | 1mg |
| GL1279-5mg | UK-5099 | 56396-35-1 | 5mg |
| GL1279-10mg | UK-5099 | 56396-35-1 | 10mg |
| GW2505-50mg | Ulipristal acetate | 126784-99-4 | 50mg |
| GW2505-100mg | Ulipristal acetate | 126784-99-4 | 100mg |
| GE8775-10g | Umbelliferone | 93-35-6 | 10g |
| GE8775-25g | Umbelliferone | 93-35-6 | 25g |
| GE8775-100g | Umbelliferone | 93-35-6 | 100g |
| GL5507-10mg | Umbellulone | 546-78-1 | 10mg |
| GW1024-10mg | Umifenovir hydrochloride | 131707-23-8 | 10mg |
| GW1024-50mg | Umifenovir hydrochloride | 131707-23-8 | 50mg |
| GK3588-25ml | Undecane | 1120-21-4 | 25ml |
| GK3588-100ml | Undecane | 1120-21-4 | 100ml |
| GC9189-250mg | Undecyl b-D-glucopyranoside | 70005-86-6 | 250mg |
| GL3897-250ug | Undecylprodigiosin | 52340-48-4 | 250ug |
| GL3897-1mg | Undecylprodigiosin | 52340-48-4 | 1mg |
| GK0306-25g | Uracil | 66-22-8 | 25g |
| GK0306-100g | Uracil | 66-22-8 | 100g |
| GK0306-250g | Uracil | 66-22-8 | 250g |
| GK0306-500g | Uracil | 66-22-8 | 500g |
| GZ6540-500IU | Uracil DNA Glycosylase Modified, from E. coli | 59088-21-0 | 500IU |
| GZ6540-5KIU | Uracil DNA Glycosylase Modified, from E. coli | 59088-21-0 | 5KIU |
| GE5342-1g | Uracil-beta-D-arabinofuranoside | 3083-77-0 | 1g |
| GE5342-5g | Uracil-beta-D-arabinofuranoside | 3083-77-0 | 5g |
| GE5342-25g | Uracil-beta-D-arabinofuranoside | 3083-77-0 | 25g |
| GE9705-25g | Uracil, 99%, Ultrapure | 66-22-8 | 25g |
| GP1109-100mg | Urapidil hydrochloride | 64887-14-5 | 100mg |
| GP1109-500mg | Urapidil hydrochloride | 64887-14-5 | 500mg |
| GP1109-1g | Urapidil hydrochloride | 64887-14-5 | 1g |
| GE3329-250g | Urea | 57-13-6 | 250g |
| GE3329-500g | Urea | 57-13-6 | 500g |
| GE3329-1kg | Urea | 57-13-6 | 1kg |
| GE3329-5kg | Urea | 57-13-6 | 5kg |
| GE2507-100ml | Urea, 8M solution | 57-13-6 | 100ml |
| GE2507-250ml | Urea, 8M solution | 57-13-6 | 250ml |
| GE1210-500g | Urea, suitable for molecular biology | 57-13-6 | 500g |
| GE1210-1kg | Urea, suitable for molecular biology | 57-13-6 | 1kg |
| GZ4552-100mg | Urease, from Jack bean | 9002-13-5 | 100mg |
| GZ4552-250mg | Urease, from Jack bean | 9002-13-5 | 250mg |
| GE8815-250g | Urethane | 51-79-6 | 250g |
| GE8815-1kg | Urethane | 51-79-6 | 1kg |
| GK0117-2mg | Uric acid sodium salt | 1198-77-2 | 2mg |
| GK0117-10mg | Uric acid sodium salt | 1198-77-2 | 10mg |
| GP7250-1g | Uridine | 58-96-8 | 1g |
| GP7250-5g | Uridine | 58-96-8 | 5g |
| GP7250-25g | Uridine | 58-96-8 | 25g |
| GP7250-100g | Uridine | 58-96-8 | 100g |
| GP7250-250g | Uridine | 58-96-8 | 250g |
| GE8880-100mg | Uridine 5'-triphosphate trisodium salt hydrate | 19817-92-6 | 100mg |
| GE8880-250mg | Uridine 5'-triphosphate trisodium salt hydrate | 19817-92-6 | 250mg |
| GE8880-1g | Uridine 5'-triphosphate trisodium salt hydrate | 19817-92-6 | 1g |
| GC9934-25mg | Uridine 5''-diphosphate disodium salt | 21931-53-3 | 25mg |
| GC9934-100mg | Uridine 5''-diphosphate disodium salt | 21931-53-3 | 100mg |
| GC9934-250mg | Uridine 5''-diphosphate disodium salt | 21931-53-3 | 250mg |
| GC9934-500mg | Uridine 5''-diphosphate disodium salt | 21931-53-3 | 500mg |
| GC9934-1g | Uridine 5''-diphosphate disodium salt | 21931-53-3 | 1g |
| GL9970-250mg | Uridine 5''-monophosphate | 58-97-9 | 250mg |
| GL9970-1g | Uridine 5''-monophosphate | 58-97-9 | 1g |
| GE7138-5g | Uridine 5''-monophosphate disodium salt | 3387-36-8 | 5g |
| GE7138-25g | Uridine 5''-monophosphate disodium salt | 3387-36-8 | 25g |
| GE7138-100g | Uridine 5''-monophosphate disodium salt | 3387-36-8 | 100g |
| GW3144-1mg | URMC-099 | 1229582-33-5 | 1mg |
| GW3144-5mg | URMC-099 | 1229582-33-5 | 5mg |
| GW3144-10mg | URMC-099 | 1229582-33-5 | 10mg |
| GP1000-5g | Ursodeoxycholic acid | 128-13-2 | 5g |
| GP1000-10g | Ursodeoxycholic acid | 128-13-2 | 10g |
| GP1000-25g | Ursodeoxycholic acid | 128-13-2 | 25g |
| GE7225-100mg | Ursolic acid | 77-52-1 | 100mg |
| GA5888-5g | Usnic acid | 125-46-2 | 5g |
| GA5888-25g | Usnic acid | 125-46-2 | 25g |
| GP4343-5mg | Vadimezan | 117570-53-3 | 5mg |
| GP1612-50mg | Valaciclovir hydrochloride | 124832-27-5 | 50mg |
| GP1612-250mg | Valaciclovir hydrochloride | 124832-27-5 | 250mg |
| GP1612-1g | Valaciclovir hydrochloride | 124832-27-5 | 1g |
| GP8320-100mg | Valdecoxib | 181695-72-7 | 100mg |
| GP8320-250mg | Valdecoxib | 181695-72-7 | 250mg |
| GP8320-1g | Valdecoxib | 181695-72-7 | 1g |
| GK2938-100ml | Valeric acid | 109-52-4 | 100ml |
| GK6340-25g | Valerophenone | 1009-14-9 | 25g |
| GK6340-100g | Valerophenone | 1009-14-9 | 100g |
| GA4672-100mg | Validamycin A | 37248-47-8 | 100mg |
| GA4672-1g | Validamycin A | 37248-47-8 | 1g |
| GA5799-5mg | Valinomycin | 2001-95-8 | 5mg |
| GA5799-10mg | Valinomycin | 2001-95-8 | 10mg |
| GA5799-25mg | Valinomycin | 2001-95-8 | 25mg |
| GA5799-100mg | Valinomycin | 2001-95-8 | 100mg |
| GC0999-1mg | Valproic acid b-D-glucuronide | 60113-83-9 | 1mg |
| GC0999-2mg | Valproic acid b-D-glucuronide | 60113-83-9 | 2mg |
| GC0999-5mg | Valproic acid b-D-glucuronide | 60113-83-9 | 5mg |
| GC0999-10mg | Valproic acid b-D-glucuronide | 60113-83-9 | 10mg |
| GP7911-1mg | Valrubicin | 56124-62-0 | 1mg |
| GP7911-5mg | Valrubicin | 56124-62-0 | 5mg |
| GP7911-10mg | Valrubicin | 56124-62-0 | 10mg |
| GP7911-25mg | Valrubicin | 56124-62-0 | 25mg |
| GP3294-1g | Valsartan | 137862-53-4 | 1g |
| GP3294-5g | Valsartan | 137862-53-4 | 5g |
| GP8514-100mg | Valsartan, USP grade | 137862-53-4 | 100mg |
| GX3187-50g | Vanadium boride | 12045-27-1 | 50g |
| GX1692-25g | Vanadium boride, 99% | 12007-37-3 | 25g |
| GX1692-100g | Vanadium boride, 99% | 12007-37-3 | 100g |
| GX7849-50g | Vanadium carbide | 12070-10-9 | 50g |
| GX7155-100x100mm | Vanadium Foil 0.05 mm, 99.7% | 7440-62-2 | 100x100mm |
| GX3817-100x100mm | Vanadium Foil 0.1mm, 99.9% | 7440-62-2 | 100x100mm |
| GX7019-100x200mm | Vanadium Foil 0.2mm, 99.9% | 7440-62-2 | 100x200mm |
| GX3211-100x200mm | Vanadium Foil 0.3 mm, 99.9% | 7440-62-2 | 100x200mm |
| GX7305-100x200mm | Vanadium Foil 0.5 mm, 99.9% | 7440-62-2 | 100x200mm |
| GX0644-100x100mm | Vanadium Foil 1.0 mm, 99.9% | 7440-62-2 | 100x100mm |
| GX0644-100x200mm | Vanadium Foil 1.0 mm, 99.9% | 7440-62-2 | 100x200mm |
| GX8141-5g | Vanadium nitride, 99.5% | 24646-85-3 | 5g |
| GX8141-25g | Vanadium nitride, 99.5% | 24646-85-3 | 25g |
| GX9091-50g | Vanadium Pellets 6 x 6.35 mm, 99.9% | 7440-62-2 | 50g |
| GX5702-25g | Vanadium Powder -200 mesh, 99.5+% | 7440-62-2 | 25g |
| GX4789-100mm | Vanadium Rod 10 mm diameter, 99.9% | 7440-62-2 | 100mm |
| GX2688-100mm | Vanadium Rod 12 mm diameter, 99.9% | 7440-62-2 | 100mm |
| GX9210-100mm | Vanadium Rod 5 mm diameter, 99.9% | 7440-62-2 | 100mm |
| GX6444-100mm | Vanadium Rod 6 mm diameter, 99.9% | 7440-62-2 | 100mm |
| GX6500-25g | Vanadium silicide | 12039-87-1 | 25g |
| GX6500-100g | Vanadium silicide | 12039-87-1 | 100g |
| GX8226-25g | Vanadium Turnings, 99.7% | 7440-62-2 | 25g |
| GX8226-100g | Vanadium Turnings, 99.7% | 7440-62-2 | 100g |
| GX8439-1m | Vanadium Wire 1.0 mm diameter, 99.8% annealed | 7440-62-2 | 1m |
| GX8439-5m | Vanadium Wire 1.0 mm diameter, 99.8% annealed | 7440-62-2 | 5m |
| GX1566-25cm | Vanadium Wire 2.0 mm diameter, 99.9% | 7440-62-2 | 25cm |
| GX7607-5g | Vanadium(III) oxide, 99.9% | 1314-34-7 | 5g |
| GX7607-10g | Vanadium(III) oxide, 99.9% | 1314-34-7 | 10g |
| GX7607-50g | Vanadium(III) oxide, 99.9% | 1314-34-7 | 50g |
| GX7946-5g | Vanadium(III) oxide, 99.99+% | 1314-34-7 | 5g |
| GX7946-25g | Vanadium(III) oxide, 99.99+% | 1314-34-7 | 25g |
| GX5007-25g | Vanadium(IV) oxide sulfate hydrate, 99.9% | 123334-20-3 | 25g |
| GX5007-100g | Vanadium(IV) oxide sulfate hydrate, 99.9% | 123334-20-3 | 100g |
| GX5007-250g | Vanadium(IV) oxide sulfate hydrate, 99.9% | 123334-20-3 | 250g |
| GX8438-10g | Vanadium(IV) oxide sulfate hydrate, 99.99+% | 123334-20-3 | 10g |
| GX8438-50g | Vanadium(IV) oxide sulfate hydrate, 99.99+% | 123334-20-3 | 50g |
| GX4523-100g | Vanadium(IV) oxide, 98+% | 12036-21-4 | 100g |
| GX4523-500g | Vanadium(IV) oxide, 98+% | 12036-21-4 | 500g |
| GX1438-10g | Vanadium(IV) oxide, 99.5% | 12036-21-4 | 10g |
| GX1438-25g | Vanadium(IV) oxide, 99.5% | 12036-21-4 | 25g |
| GX1438-100g | Vanadium(IV) oxide, 99.5% | 12036-21-4 | 100g |
| GX4596-100g | Vanadium(IV) sulfate oxide hydrate, 98% | 123334-20-3 | 100g |
| GX7477-25g | Vanadium(V) oxide isopropoxide, 99.9% | 5588-84-1 | 25g |
| GX4031-100g | Vanadium(V) oxide trichloride, 99% | 7727-18-6 | 100g |
| GX1959-500g | Vanadium(V) oxide, 98+% | 1314-62-1 | 500g |
| GX1959-1kg | Vanadium(V) oxide, 98+% | 1314-62-1 | 1kg |
| GX7781-100g | Vanadium(V) oxide, 99.9% | 1314-62-1 | 100g |
| GX7781-500g | Vanadium(V) oxide, 99.9% | 1314-62-1 | 500g |
| GX7627-5g | Vanadium(V) oxide, 99.97% | 1314-62-1 | 5g |
| GX7627-25g | Vanadium(V) oxide, 99.97% | 1314-62-1 | 25g |
| GA6284-250mg | Vancomycin hydrochloride | 1404-93-9 | 250mg |
| GA6284-1g | Vancomycin hydrochloride | 1404-93-9 | 1g |
| GA6284-5g | Vancomycin hydrochloride | 1404-93-9 | 5g |
| GA6284-25g | Vancomycin hydrochloride | 1404-93-9 | 25g |
| GP1439-25mg | Vandetanib | 443913-73-3 | 25mg |
| GP1439-100mg | Vandetanib | 443913-73-3 | 100mg |
| GK9155-100g | Vanillic acid | 121-34-6 | 100g |
| GK9155-250g | Vanillic acid | 121-34-6 | 250g |
| GP6341-25g | Vanillin | 121-33-5 | 25g |
| GP6341-100g | Vanillin | 121-33-5 | 100g |
| GP6341-250g | Vanillin | 121-33-5 | 250g |
| GP6341-500g | Vanillin | 121-33-5 | 500g |
| GP6341-1kg | Vanillin | 121-33-5 | 1kg |
| GC3471-1mg | Varenicline carbamoyl b-D-glucuronide | 535920-98-0 | 1mg |
| GC3471-2mg | Varenicline carbamoyl b-D-glucuronide | 535920-98-0 | 2mg |
| GC3471-5mg | Varenicline carbamoyl b-D-glucuronide | 535920-98-0 | 5mg |
| GC3471-10mg | Varenicline carbamoyl b-D-glucuronide | 535920-98-0 | 10mg |
| GP9070-50mg | Vecuronium bromide | 50700-72-6 | 50mg |
| GP9070-100mg | Vecuronium bromide | 50700-72-6 | 100mg |
| GP9070-250mg | Vecuronium bromide | 50700-72-6 | 250mg |
| GA9355-1mg | Venturicidin A | 33538-71-5 | 1mg |
| GP4575-1g | Verapamil hydrochloride | 152-11-4 | 1g |
| GL4143-10mg | Veratridine | 71-62-5 | 10mg |
| GC8855-10mg | Verbascoside | 61276-17-3 | 10mg |
| GL5203-1mg | Verruculogen | 12771-72-1 | 1mg |
| GL5203-5mg | Verruculogen | 12771-72-1 | 5mg |
| GT0164-5g | Victoria Pure Blue BO (C.I. 42595) | 2390-60-5 | 5g |
| GP8547-50mg | Vigabatrin | 68506-86-5 | 50mg |
| GP8547-100mg | Vigabatrin | 68506-86-5 | 100mg |
| GP4588-100mg | Vildagliptin | 274901-16-5 | 100mg |
| GP4588-250mg | Vildagliptin | 274901-16-5 | 250mg |
| GP4588-1g | Vildagliptin | 274901-16-5 | 1g |
| GC5074-1mg | Vildagliptin O-β-D-glucuronide | 1147403-03-9 | 1mg |
| GC5074-2mg | Vildagliptin O-β-D-glucuronide | 1147403-03-9 | 2mg |
| GC5074-5mg | Vildagliptin O-β-D-glucuronide | 1147403-03-9 | 5mg |
| GC5074-10mg | Vildagliptin O-β-D-glucuronide | 1147403-03-9 | 10mg |
| GA7194-1mg | Vinblastine sulfate | 143-67-9 | 1mg |
| GA7194-5mg | Vinblastine sulfate | 143-67-9 | 5mg |
| GA7194-10mg | Vinblastine sulfate | 143-67-9 | 10mg |
| GA7194-25mg | Vinblastine sulfate | 143-67-9 | 25mg |
| GA7194-50mg | Vinblastine sulfate | 143-67-9 | 50mg |
| GP3407-1g | Vincamine | 1617-90-9 | 1g |
| GP3407-5g | Vincamine | 1617-90-9 | 5g |
| GA1776-1mg | Vincristine sulfate | 2068-78-2 | 1mg |
| GA1776-5mg | Vincristine sulfate | 2068-78-2 | 5mg |
| GA1776-10mg | Vincristine sulfate | 2068-78-2 | 10mg |
| GA1776-25mg | Vincristine sulfate | 2068-78-2 | 25mg |
| GP8222-50mg | Vindoline | 2182-14-1 | 50mg |
| GP8222-250mg | Vindoline | 2182-14-1 | 250mg |
| GP8222-2500mg | Vindoline | 2182-14-1 | 2500mg |
| GP5205-5mg | Vinorelbine ditartrate | 125317-39-7 | 5mg |
| GP5205-10mg | Vinorelbine ditartrate | 125317-39-7 | 10mg |
| GP5205-25mg | Vinorelbine ditartrate | 125317-39-7 | 25mg |
| GP5205-50mg | Vinorelbine ditartrate | 125317-39-7 | 50mg |
| GP3347-20mg | Vinpocetine | 42971-09-5 | 20mg |
| GP3347-100mg | Vinpocetine | 42971-09-5 | 100mg |
| GA3764-5mg | Virginiamycin M | 21411-53-0 | 5mg |
| GA3764-10mg | Virginiamycin M | 21411-53-0 | 10mg |
| GA7111-5mg | Virginiamycin S1 | 23152-29-6 | 5mg |
| GW3857-1mg | Viridicatumtoxin | 39277-41-3 | 1mg |
| GL6994-250ug | Viridiol | 23820-80-6 | 250ug |
| GL6994-1mg | Viridiol | 23820-80-6 | 1mg |
| GA7777-1mg | Virustomycin A | 84777-85-5 | 1mg |
| GA7777-5mg | Virustomycin A | 84777-85-5 | 5mg |
| GV2742-1g | Vitamin A acetate | 127-47-9 | 1g |
| GE2859-1g | Vitamin B12 | 68-19-9 | 1g |
| GE2859-5g | Vitamin B12 | 68-19-9 | 5g |
| GE2859-10g | Vitamin B12 | 68-19-9 | 10g |
| GE2859-25g | Vitamin B12 | 68-19-9 | 25g |
| GV3321-250mg | Vitamin B12, pyrogen free | 68-19-9 | 250mg |
| GV3321-1g | Vitamin B12, pyrogen free | 68-19-9 | 1g |
| GV6132-1g | Vitamin D2 | 50-14-6 | 1g |
| GV6132-5g | Vitamin D2 | 50-14-6 | 5g |
| GV6134-1g | Vitamin D2, USP grade | 50-14-6 | 1g |
| GV6134-5g | Vitamin D2, USP grade | 50-14-6 | 5g |
| GK3575-100g | Vitamin E, liquid | 59-02-9 | 100g |
| GV4612-1g | Vitamin K1 | 84-80-0 | 1g |
| GV6200-1g | Vitamin K2 | 863-61-6 | 1g |
| GV3614-25g | Vitamin K3 | 58-27-5 | 25g |
| GC5761-5mg | Vitexin | 3681-93-4 | 5mg |
| GC5761-25mg | Vitexin | 3681-93-4 | 25mg |
| GA6306-250mg | Voriconazole | 137234-62-9 | 250mg |
| GA6306-1g | Voriconazole | 137234-62-9 | 1g |
| GA6306-5g | Voriconazole | 137234-62-9 | 5g |
| GP5178-5mg | Vorinostat | 149647-78-9 | 5mg |
| GP5178-10mg | Vorinostat | 149647-78-9 | 10mg |
| GW0993-1mg | VR23 [Proteasome Inhibitor] | 1624602-30-7 | 1mg |
| GW0993-5mg | VR23 [Proteasome Inhibitor] | 1624602-30-7 | 5mg |
| GW0993-25mg | VR23 [Proteasome Inhibitor] | 1624602-30-7 | 25mg |
| GW0199-1mg | VTX-27 | 1321924-70-2 | 1mg |
| GW0199-5mg | VTX-27 | 1321924-70-2 | 5mg |
| GW0199-10mg | VTX-27 | 1321924-70-2 | 10mg |
| GW1373-1mg | VX-702 | 745833-23-2 | 1mg |
| GW1373-5mg | VX-702 | 745833-23-2 | 5mg |
| GW1373-10mg | VX-702 | 745833-23-2 | 10mg |
| GW2962-1mg | VX-745 | 209410-46-8 | 1mg |
| GW2962-5mg | VX-745 | 209410-46-8 | 5mg |
| GW2962-10mg | VX-745 | 209410-46-8 | 10mg |
| GW2962-50mg | VX-745 | 209410-46-8 | 50mg |
| GL9804-5mg | W-5 hydrochloride | 61714-25-8 | 5mg |
| GL9804-25mg | W-5 hydrochloride | 61714-25-8 | 25mg |
| GW9714-1mg | W493 B | 99316-98-0 | 1mg |
| GP6872-5g | Warfarin sodium salt | 129-06-6 | 5g |
| GP6872-10g | Warfarin sodium salt | 129-06-6 | 10g |
| GP6872-25g | Warfarin sodium salt | 129-06-6 | 25g |
| GK0904-1l | Water, BP, Ph. Eur. grade, sterile | 7732-18-5 | 1l |
| GB8233-1l | Water, deionised | 7732-18-5 | 1l |
| GB8233-5l | Water, deionised | 7732-18-5 | 5l |
| GK8002-1l | Water, distilled | 7732-18-5 | 1l |
| GK8002-5l | Water, distilled | 7732-18-5 | 5l |
| GK8512-1l | Water, distilled, GlenBiol™, suitable for molecular biology | 7732-18-5 | 1l |
| GK3940-1l | Water, GlenCell™, suitable for cell culture | 7732-18-5 | 1l |
| GS3420-1l | Water, GlenPure™, analytical grade | 7732-18-5 | 1l |
| GS3420-2500ml | Water, GlenPure™, analytical grade | 7732-18-5 | 2500ml |
| GS9307-1l | Water, GlenUltra™, analytical grade, for LC | 7732-18-5 | 1l |
| GS9307-2500ml | Water, GlenUltra™, analytical grade, for LC | 7732-18-5 | 2500ml |
| GL6617-1mg | Wedelolactone | 524-12-9 | 1mg |
| GL6617-5mg | Wedelolactone | 524-12-9 | 5mg |
| GT2669-250ml | Weigert’s iron haematoxylin solution A | 250ml | |
| GT2669-500ml | Weigert’s iron haematoxylin solution A | 500ml | |
| GT5732-250ml | Weigert’s iron haematoxylin solution B | 250ml | |
| GT5732-500ml | Weigert’s iron haematoxylin solution B | 500ml | |
| GL2455-1mg | White Line Inducing Principle | 135096-89-8 | 1mg |
| GY6190-1mg | Withaferin A | 5119-48-2 | 1mg |
| GY6190-5mg | Withaferin A | 5119-48-2 | 5mg |
| GY6190-10mg | Withaferin A | 5119-48-2 | 10mg |
| GP7400-5mg | Wogonin | 632-85-9 | 5mg |
| GP7400-25mg | Wogonin | 632-85-9 | 25mg |
| GE4316-1mg | Wortmannin | 19545-26-7 | 1mg |
| GE4316-5mg | Wortmannin | 19545-26-7 | 5mg |
| GE4316-25mg | Wortmannin | 19545-26-7 | 25mg |
| GT7819-10g | Wright's stain | 68988-92-1 | 10g |
| GT7819-25g | Wright's stain | 68988-92-1 | 25g |
| GT7819-100g | Wright's stain | 68988-92-1 | 100g |
| GT7819-250g | Wright's stain | 68988-92-1 | 250g |
| GW5858-5mg | WSP1 | 1352750-34-5 | 5mg |
| GW5858-25mg | WSP1 | 1352750-34-5 | 25mg |
| GL2940-10mg | WY-14643 | 50892-23-4 | 10mg |
| GL2940-50mg | WY-14643 | 50892-23-4 | 50mg |
| GL2940-250mg | WY-14643 | 50892-23-4 | 250mg |
| GW8255-5mg | WZB117 | 1223397-11-2 | 5mg |
| GW8255-25mg | WZB117 | 1223397-11-2 | 25mg |
| GP1801-1mg | Xamoterol hemifumarate | 73210-73-8 | 1mg |
| GP1801-5mg | Xamoterol hemifumarate | 73210-73-8 | 5mg |
| GP1801-25mg | Xamoterol hemifumarate | 73210-73-8 | 25mg |
| GC4475-25g | Xanthan gum | 11138-66-2 | 25g |
| GC4475-100g | Xanthan gum | 11138-66-2 | 100g |
| GC4475-250g | Xanthan gum | 11138-66-2 | 250g |
| GC4475-500g | Xanthan gum | 11138-66-2 | 500g |
| GK1029-5g | Xanthine | 69-89-6 | 5g |
| GK1029-25g | Xanthine | 69-89-6 | 25g |
| GK1029-100g | Xanthine | 69-89-6 | 100g |
| GK7942-250mg | Xanthine sodium salt | 1196-43-6 | 250mg |
| GK7942-1g | Xanthine sodium salt | 1196-43-6 | 1g |
| GY0767-25mg | Xanthohumol | 6754-58-1 | 25mg |
| GY0767-50mg | Xanthohumol | 6754-58-1 | 50mg |
| GL7316-500ug | Xanthomegnin | 1685-91-2 | 500ug |
| GL7316-1mg | Xanthomegnin | 1685-91-2 | 1mg |
| GK2391-5mg | Xanthophyll | 127-40-2 | 5mg |
| GK2391-10mg | Xanthophyll | 127-40-2 | 10mg |
| GL7340-1mg | Xanthorrhizol | 30199-26-9 | 1mg |
| GN2077-25mg | Xanthosine 5''-monophosphate disodium salt | 25899-70-1 | 25mg |
| GN2077-100mg | Xanthosine 5''-monophosphate disodium salt | 25899-70-1 | 100mg |
| GP5578-1g | Xanthotoxin | 298-81-7 | 1g |
| GP5578-5g | Xanthotoxin | 298-81-7 | 5g |
| GW2238-1mg | XD14 | 1370888-71-3 | 1mg |
| GW2238-5mg | XD14 | 1370888-71-3 | 5mg |
| GW2238-10mg | XD14 | 1370888-71-3 | 10mg |
| GW6307-1mg | XL019 | 945750-13-0 | 1mg |
| GW6307-5mg | XL019 | 945750-13-0 | 5mg |
| GW6307-10mg | XL019 | 945750-13-0 | 10mg |
| GW8661-1mg | XL388 | 1251156-08-7 | 1mg |
| GW8661-5mg | XL388 | 1251156-08-7 | 5mg |
| GW8661-10mg | XL388 | 1251156-08-7 | 10mg |
| GW5078-1mg | XL765 | 1349796-36-6 | 1mg |
| GW5078-5mg | XL765 | 1349796-36-6 | 5mg |
| GW5078-10mg | XL765 | 1349796-36-6 | 10mg |
| GC5281-25mg | XTT sodium salt | 111072-31-2 | 25mg |
| GC5281-50mg | XTT sodium salt | 111072-31-2 | 50mg |
| GC5281-100mg | XTT sodium salt | 111072-31-2 | 100mg |
| GC5281-250mg | XTT sodium salt | 111072-31-2 | 250mg |
| GC4689-100g | Xylan | 9014-63-5 | 100g |
| GC4689-250g | Xylan | 9014-63-5 | 250g |
| GC4689-500g | Xylan | 9014-63-5 | 500g |
| GK8124-1g | Xylazine | 7361-61-7 | 1g |
| GL1298-10g | Xylazine hydrochloride | 23076-35-9 | 10g |
| GL1298-25g | Xylazine hydrochloride | 23076-35-9 | 25g |
| GT4153-10g | Xylene Cyanol FF (C.I. 42135) | 2650-17-1 | 10g |
| GT4153-25g | Xylene Cyanol FF (C.I. 42135) | 2650-17-1 | 25g |
| GT4153-50g | Xylene Cyanol FF (C.I. 42135) | 2650-17-1 | 50g |
| GS2860-100ml | Xylene mixed isomers, GlenDry™, anhydrous | 1330-20-7 | 100ml |
| GS2860-500ml | Xylene mixed isomers, GlenDry™, anhydrous | 1330-20-7 | 500ml |
| GS2860-1l | Xylene mixed isomers, GlenDry™, anhydrous | 1330-20-7 | 1l |
| GS2860-2500ml | Xylene mixed isomers, GlenDry™, anhydrous | 1330-20-7 | 2500ml |
| GS3017-100ml | Xylene mixed isomers, GlenDry™, anhydrous over molecular sieve | 1330-20-7 | 100ml |
| GS3017-500ml | Xylene mixed isomers, GlenDry™, anhydrous over molecular sieve | 1330-20-7 | 500ml |
| GS3017-1l | Xylene mixed isomers, GlenDry™, anhydrous over molecular sieve | 1330-20-7 | 1l |
| GS3017-2500ml | Xylene mixed isomers, GlenDry™, anhydrous over molecular sieve | 1330-20-7 | 2500ml |
| GS4352-500ml | Xylene mixed isomers, GlenPure™, analytical grade | 1330-20-7 | 500ml |
| GS4352-1l | Xylene mixed isomers, GlenPure™, analytical grade | 1330-20-7 | 1l |
| GS4352-2500ml | Xylene mixed isomers, GlenPure™, analytical grade | 1330-20-7 | 2500ml |
| GK8919-500ml | Xylene, mixture of isomers | 1330-20-7 | 500ml |
| GK8919-1l | Xylene, mixture of isomers | 1330-20-7 | 1l |
| GT7988-1g | Xylenol Blue | 125-31-5 | 1g |
| GT7988-5g | Xylenol Blue | 125-31-5 | 5g |
| GT7988-25g | Xylenol Blue | 125-31-5 | 25g |
| GT8065-1g | Xylenol Orange tetrasodium salt | 3618-43-7 | 1g |
| GT8065-5g | Xylenol Orange tetrasodium salt | 3618-43-7 | 5g |
| GT8065-25g | Xylenol Orange tetrasodium salt | 3618-43-7 | 25g |
| GT1513-25g | Xylidine Ponceau 2R (C.l. 16150) | 3761-53-3 | 25g |
| GT1513-50g | Xylidine Ponceau 2R (C.l. 16150) | 3761-53-3 | 50g |
| GT4376-1g | Xylidyl blue I sodium salt | 14936-97-1 | 1g |
| GT4376-5g | Xylidyl blue I sodium salt | 14936-97-1 | 5g |
| GT4376-10g | Xylidyl blue I sodium salt | 14936-97-1 | 10g |
| GC3694-100g | Xylitol | 87-99-0 | 100g |
| GC3694-250g | Xylitol | 87-99-0 | 250g |
| GC3694-500g | Xylitol | 87-99-0 | 500g |
| GC3694-1kg | Xylitol | 87-99-0 | 1kg |
| GC3694-5kg | Xylitol | 87-99-0 | 5kg |
| GK8578-1mg | Y-27632 dihydrochloride | 129830-38-2 | 1mg |
| GK8578-5mg | Y-27632 dihydrochloride | 129830-38-2 | 5mg |
| GK8578-10mg | Y-27632 dihydrochloride | 129830-38-2 | 10mg |
| GK8578-25mg | Y-27632 dihydrochloride | 129830-38-2 | 25mg |
| GK7558-1mg | YC-1 | 170632-47-0 | 1mg |
| GK7558-5mg | YC-1 | 170632-47-0 | 5mg |
| GK7558-25mg | YC-1 | 170632-47-0 | 25mg |
| GE4420-100g | Yeast extract, powder | 8013-01-2 | 100g |
| GE4420-250g | Yeast extract, powder | 8013-01-2 | 250g |
| GE4420-500g | Yeast extract, powder | 8013-01-2 | 500g |
| GE4420-1kg | Yeast extract, powder | 8013-01-2 | 1kg |
| GW7605-1mg | YM201636 hydrochloride | 371942-69-7 | 1mg |
| GW7605-5mg | YM201636 hydrochloride | 371942-69-7 | 5mg |
| GW7605-10mg | YM201636 hydrochloride | 371942-69-7 | 10mg |
| GP3367-1g | Yohimbine hydrochloride | 65-19-0 | 1g |
| GP3367-5g | Yohimbine hydrochloride | 65-19-0 | 5g |
| GP3367-25g | Yohimbine hydrochloride | 65-19-0 | 25g |
| GX6016-25g | Ytterbium acetate hydrate, 99.9% | 15280-58-7 | 25g |
| GX6016-100g | Ytterbium acetate hydrate, 99.9% | 15280-58-7 | 100g |
| GX0496-10g | Ytterbium acetate hydrate, 99.999% | 15280-58-7 | 10g |
| GX0496-25g | Ytterbium acetate hydrate, 99.999% | 15280-58-7 | 25g |
| GX9318-25g | Ytterbium carbonate hydrate, 99.999% | 64360-98-1 | 25g |
| GX9318-100g | Ytterbium carbonate hydrate, 99.999% | 64360-98-1 | 100g |
| GX0566-5g | Ytterbium Chips, 99.9% | 7440-64-4 | 5g |
| GX0566-25g | Ytterbium Chips, 99.9% | 7440-64-4 | 25g |
| GX0939-25g | Ytterbium chloride hydrate, 99.9% | 19423-87-1 | 25g |
| GX0939-50g | Ytterbium chloride hydrate, 99.9% | 19423-87-1 | 50g |
| GX0939-100g | Ytterbium chloride hydrate, 99.9% | 19423-87-1 | 100g |
| GX4544-25g | Ytterbium chloride hydrate, 99.99% | 19423-87-1 | 25g |
| GX4544-50g | Ytterbium chloride hydrate, 99.99% | 19423-87-1 | 50g |
| GX5550-10g | Ytterbium chloride hydrate, 99.999% | 19423-87-1 | 10g |
| GX5550-50g | Ytterbium chloride hydrate, 99.999% | 19423-87-1 | 50g |
| GX0983-5g | Ytterbium chloride, anhydrous, 99.9% | 10361-91-8 | 5g |
| GX0983-25g | Ytterbium chloride, anhydrous, 99.9% | 10361-91-8 | 25g |
| GX0640-1g | Ytterbium D-3-trifluoroacetylcamphorate, 99% | 38054-03-4 | 1g |
| GX0009-10g | Ytterbium fluoride, 99.99% | 13760-80-0 | 10g |
| GX0009-25g | Ytterbium fluoride, 99.99% | 13760-80-0 | 25g |
| GX0009-100g | Ytterbium fluoride, 99.99% | 13760-80-0 | 100g |
| GX3495-10g | Ytterbium fluoride, anhydrous, 99.9% | 13760-80-0 | 10g |
| GX3495-50g | Ytterbium fluoride, anhydrous, 99.9% | 13760-80-0 | 50g |
| GX3495-100g | Ytterbium fluoride, anhydrous, 99.9% | 13760-80-0 | 100g |
| GX0255-10g | Ytterbium fluoride, anhydrous, 99.99% | 13760-80-0 | 10g |
| GX0255-50g | Ytterbium fluoride, anhydrous, 99.99% | 13760-80-0 | 50g |
| GX0552-25x50mm | Ytterbium Foil 0.25mm, 99.9% | 7440-64-4 | 25x50mm |
| GX0032-25x50mm | Ytterbium Foil 0.5mm, 99.9% | 7440-64-4 | 25x50mm |
| GX2918-10g | Ytterbium hydroxide hydrate | 16469-20-8 | 10g |
| GX2918-50g | Ytterbium hydroxide hydrate | 16469-20-8 | 50g |
| GX6920-25g | Ytterbium nitrate hydrate, 99.9% | 35725-34-9 | 25g |
| GX6920-50g | Ytterbium nitrate hydrate, 99.9% | 35725-34-9 | 50g |
| GX6920-100g | Ytterbium nitrate hydrate, 99.9% | 35725-34-9 | 100g |
| GX9000-25g | Ytterbium nitrate hydrate, 99.99% | 35725-34-9 | 25g |
| GX9000-100g | Ytterbium nitrate hydrate, 99.99% | 35725-34-9 | 100g |
| GX6984-10g | Ytterbium nitrate hydrate, 99.999% | 35725-34-9 | 10g |
| GX6984-50g | Ytterbium nitrate hydrate, 99.999% | 35725-34-9 | 50g |
| GX0481-25g | Ytterbium oxide, 99.9% | 1314-37-0 | 25g |
| GX0481-100g | Ytterbium oxide, 99.9% | 1314-37-0 | 100g |
| GX0481-500g | Ytterbium oxide, 99.9% | 1314-37-0 | 500g |
| GX9006-10g | Ytterbium oxide, 99.99% | 1314-37-0 | 10g |
| GX9006-25g | Ytterbium oxide, 99.99% | 1314-37-0 | 25g |
| GX9006-100g | Ytterbium oxide, 99.99% | 1314-37-0 | 100g |
| GX1114-5g | Ytterbium oxide, 99.999% | 1314-37-0 | 5g |
| GX1114-10g | Ytterbium oxide, 99.999% | 1314-37-0 | 10g |
| GX1114-25g | Ytterbium oxide, 99.999% | 1314-37-0 | 25g |
| GX1114-100g | Ytterbium oxide, 99.999% | 1314-37-0 | 100g |
| GX5403-2g | Ytterbium oxide, 99.9999% | 1314-37-0 | 2g |
| GX5403-10g | Ytterbium oxide, 99.9999% | 1314-37-0 | 10g |
| GX5403-25g | Ytterbium oxide, 99.9999% | 1314-37-0 | 25g |
| GX5815-25g | Ytterbium oxide, 99.9999% | 1314-37-0 | 25g |
| GX2266-10g | Ytterbium Pieces distilled, 99.99% | 7440-64-4 | 10g |
| GX2266-25g | Ytterbium Pieces distilled, 99.99% | 7440-64-4 | 25g |
| GX9797-5g | Ytterbium Pieces, 99.9% | 7440-64-4 | 5g |
| GX9797-25g | Ytterbium Pieces, 99.9% | 7440-64-4 | 25g |
| GX5748-5g | Ytterbium Powder, 99.9% | 7440-64-4 | 5g |
| GX5748-25g | Ytterbium Powder, 99.9% | 7440-64-4 | 25g |
| GX9935-10g | Ytterbium sulfate hydrate, 99.9% | 10034-98-7 | 10g |
| GX9935-50g | Ytterbium sulfate hydrate, 99.9% | 10034-98-7 | 50g |
| GX1576-25g | Ytterbium sulfate hydrate, 99.999% | 10034-98-7 | 25g |
| GX1576-50g | Ytterbium sulfate hydrate, 99.999% | 10034-98-7 | 50g |
| GX6211-25cm | Ytterbium Wire 1 mm diameter, 99.9% | 7440-64-4 | 25cm |
| GX6211-50cm | Ytterbium Wire 1 mm diameter, 99.9% | 7440-64-4 | 50cm |
| GK2615-100g | Ytterbium(lll) chloride hexahydrate | 10035-01-5 | 100g |
| GX6589-50g | Yttrium acetate hydrate, 99.9% | 23363-14-6 | 50g |
| GX6589-250g | Yttrium acetate hydrate, 99.9% | 23363-14-6 | 250g |
| GX4609-50g | Yttrium acetate hydrate, 99.999% | 23363-14-6 | 50g |
| GX1971-10g | Yttrium aluminium oxide, 99.9% | 12005-24-9 | 10g |
| GX1971-50g | Yttrium aluminium oxide, 99.9% | 12005-24-9 | 50g |
| GX5260-10g | Yttrium aluminium oxide, 99.99% | 12005-24-9 | 10g |
| GX5260-50g | Yttrium aluminium oxide, 99.99% | 12005-24-9 | 50g |
| GX4857-25g | Yttrium carbonate hydrate, 99.9% | 38245-39-5 | 25g |
| GX4857-100g | Yttrium carbonate hydrate, 99.9% | 38245-39-5 | 100g |
| GX4857-250g | Yttrium carbonate hydrate, 99.9% | 38245-39-5 | 250g |
| GX9109-25g | Yttrium carbonate hydrate, 99.99% | 38245-39-5 | 25g |
| GX9109-100g | Yttrium carbonate hydrate, 99.99% | 38245-39-5 | 100g |
| GX9109-250g | Yttrium carbonate hydrate, 99.99% | 38245-39-5 | 250g |
| GX2433-25g | Yttrium carbonate hydrate, 99.998% | 38245-39-5 | 25g |
| GX2433-100g | Yttrium carbonate hydrate, 99.998% | 38245-39-5 | 100g |
| GX2433-250g | Yttrium carbonate hydrate, 99.998% | 38245-39-5 | 250g |
| GX3456-10g | Yttrium Chips, 99.9% | 7440-65-5 | 10g |
| GX3456-50g | Yttrium Chips, 99.9% | 7440-65-5 | 50g |
| GX8247-50g | Yttrium chloride hexahydrate, 99.9% | 10025-94-2 | 50g |
| GX8247-250g | Yttrium chloride hexahydrate, 99.9% | 10025-94-2 | 250g |
| GX0202-50g | Yttrium chloride hexahydrate, 99.99% | 10025-94-2 | 50g |
| GX0202-250g | Yttrium chloride hexahydrate, 99.99% | 10025-94-2 | 250g |
| GX5098-10g | Yttrium chloride hexahydrate, 99.999% | 10025-94-2 | 10g |
| GX5098-50g | Yttrium chloride hexahydrate, 99.999% | 10025-94-2 | 50g |
| GX6849-25g | Yttrium chloride, anhydrous, 99.9% | 10361-92-9 | 25g |
| GX7829-50g | Yttrium fluoride, anhydrous, 99.9% | 13709-49-4 | 50g |
| GX7829-250g | Yttrium fluoride, anhydrous, 99.9% | 13709-49-4 | 250g |
| GX1508-25g | Yttrium fluoride, anhydrous, 99.99% | 13709-49-4 | 25g |
| GX9715-50g | Yttrium fluoride, anhydrous, 99.99% | 13709-49-4 | 50g |
| GX1508-100g | Yttrium fluoride, anhydrous, 99.99% | 13709-49-4 | 100g |
| GX9715-250g | Yttrium fluoride, anhydrous, 99.99% | 13709-49-4 | 250g |
| GX3907-50g | Yttrium fluoride, anhydrous, 99.999% | 13709-49-4 | 50g |
| GX3907-100g | Yttrium fluoride, anhydrous, 99.999% | 13709-49-4 | 100g |
| GX2774-25x50mm | Yttrium Foil 0.25mm, 99.9% | 7440-65-5 | 25x50mm |
| GX0563-25x50mm | Yttrium Foil 0.5mm, 99.9% | 7440-65-5 | 25x50mm |
| GX5764-25x50mm | Yttrium Foil 1.0mm, 99.9% | 7440-65-5 | 25x50mm |
| GX4069-100g | Yttrium hydroxide hydrate, 99.99% | 16469-22-0 | 100g |
| GX4069-250g | Yttrium hydroxide hydrate, 99.99% | 16469-22-0 | 250g |
| GX1144-1g | Yttrium iodide, anhydrous, 99.9% | 13470-38-7 | 1g |
| GK6505-25g | Yttrium nitrate hexahydrate | 13494-98-9 | 25g |
| GK6505-100g | Yttrium nitrate hexahydrate | 13494-98-9 | 100g |
| GK6505-500g | Yttrium nitrate hexahydrate | 13494-98-9 | 500g |
| GX3740-50g | Yttrium nitrate hydrate, 99.9% | 10361-93-0 | 50g |
| GX3740-250g | Yttrium nitrate hydrate, 99.9% | 10361-93-0 | 250g |
| GX4485-50g | Yttrium nitrate hydrate, 99.99% | 10361-93-0 | 50g |
| GX4485-100g | Yttrium nitrate hydrate, 99.99% | 10361-93-0 | 100g |
| GX7552-25g | Yttrium nitrate hydrate, 99.999% | 10361-93-0 | 25g |
| GX7552-100g | Yttrium nitrate hydrate, 99.999% | 10361-93-0 | 100g |
| GX6018-50g | Yttrium oxalate hydrate, 99.9% | 13266-82-5 | 50g |
| GX6018-250g | Yttrium oxalate hydrate, 99.9% | 13266-82-5 | 250g |
| GX7755-50g | Yttrium oxalate hydrate, 99.99% | 13266-82-5 | 50g |
| GX7755-250g | Yttrium oxalate hydrate, 99.99% | 13266-82-5 | 250g |
| GX6058-10g | Yttrium oxalate hydrate, 99.999% | 13266-82-5 | 10g |
| GX6058-50g | Yttrium oxalate hydrate, 99.999% | 13266-82-5 | 50g |
| GX3179-25g | Yttrium oxide-Nano Powder, 99.9% | 1314-36-9 | 25g |
| GX3179-100g | Yttrium oxide-Nano Powder, 99.9% | 1314-36-9 | 100g |
| GX7139-50g | Yttrium oxide, 99.9% | 1314-36-9 | 50g |
| GX3134-25g | Yttrium oxide, 99.9% | 1314-36-9 | 25g |
| GX7139-250g | Yttrium oxide, 99.9% | 1314-36-9 | 250g |
| GX3134-100g | Yttrium oxide, 99.9% | 1314-36-9 | 100g |
| GX7314-50g | Yttrium oxide, 99.99% | 1314-36-9 | 50g |
| GX7314-250g | Yttrium oxide, 99.99% | 1314-36-9 | 250g |
| GX5044-10g | Yttrium oxide, 99.999% | 1314-36-9 | 10g |
| GX5044-50g | Yttrium oxide, 99.999% | 1314-36-9 | 50g |
| GX5044-250g | Yttrium oxide, 99.999% | 1314-36-9 | 250g |
| GX8334-5g | Yttrium oxide, 99.9999% | 1314-36-9 | 5g |
| GX8334-25g | Yttrium oxide, 99.9999% | 1314-36-9 | 25g |
| GX8334-50g | Yttrium oxide, 99.9999% | 1314-36-9 | 50g |
| GX8334-250g | Yttrium oxide, 99.9999% | 1314-36-9 | 250g |
| GX0115-10g | Yttrium pieces, 99.9% | 7440-65-5 | 10g |
| GX0115-50g | Yttrium pieces, 99.9% | 7440-65-5 | 50g |
| GX3320-5g | Yttrium Powder -200 mesh, 99.9% | 7440-65-5 | 5g |
| GX3320-25g | Yttrium Powder -200 mesh, 99.9% | 7440-65-5 | 25g |
| GX6165-25mm | Yttrium Rod 12.5 mm diameter, 99.9% | 7440-65-5 | 25mm |
| GX6165-50mm | Yttrium Rod 12.5 mm diameter, 99.9% | 7440-65-5 | 50mm |
| GX2029-25mm | Yttrium Rod 6.35 mm diameter, 99.9% | 7440-65-5 | 25mm |
| GX2029-50mm | Yttrium Rod 6.35 mm diameter, 99.9% | 7440-65-5 | 50mm |
| GX7301-50g | Yttrium sulfate hydrate, 99.9% | 7446-33-5 | 50g |
| GX7301-100g | Yttrium sulfate hydrate, 99.9% | 7446-33-5 | 100g |
| GX6907-25g | Yttrium sulfate hydrate, 99.999% | 7446-33-5 | 25g |
| GX0023-25cm | Yttrium Wire 1mm diameter, 99.9% | 7440-65-5 | 25cm |
| GX0023-50cm | Yttrium Wire 1mm diameter, 99.9% | 7440-65-5 | 50cm |
| GX6160-100g | Yttrium-Barium-Copper-Oxide YBCO123 | 107539-20-8 | 100g |
| GX6459-5g | Yttrium-thd, 99.9% | 15632-39-0 | 5g |
| GX8397-50g | Yttrium(III) oxide Nanopowder, 99,95 % | 1314-36-9 | 50g |
| GX8397-100g | Yttrium(III) oxide Nanopowder, 99,95 % | 1314-36-9 | 100g |
| GX8397-250g | Yttrium(III) oxide Nanopowder, 99,95 % | 1314-36-9 | 250g |
| GX8397-1kg | Yttrium(III) oxide Nanopowder, 99,95 % | 1314-36-9 | 1kg |
| GM1130-25g | Z-beta-Ala-OH | 2304-94-1 | 25g |
| GM4955-1g | Z-D-Arg-OH | 6382-93-0 | 1g |
| GM4955-5g | Z-D-Arg-OH | 6382-93-0 | 5g |
| GM2905-5g | Z-D-Glu-OBzl | 65706-99-2 | 5g |
| GL8968-1mg | Z-Leu-Arg-Gly-Gly-AMC | 167698-68-2 | 1mg |
| GL8968-5mg | Z-Leu-Arg-Gly-Gly-AMC | 167698-68-2 | 5mg |
| GL6936-1mg | Z-Leu-Leu-Glu-AMC | 348086-66-8 | 1mg |
| GL6936-5mg | Z-Leu-Leu-Glu-AMC | 348086-66-8 | 5mg |
| GK3641-1mg | Z-Leu-Leu-Leu-al | 133407-82-6 | 1mg |
| GK3641-5mg | Z-Leu-Leu-Leu-al | 133407-82-6 | 5mg |
| GK3641-25mg | Z-Leu-Leu-Leu-al | 133407-82-6 | 25mg |
| GL3117-1mg | Z-Leu-Leu-Leu-AMC | 152015-61-7 | 1mg |
| GL3117-5mg | Z-Leu-Leu-Leu-AMC | 152015-61-7 | 5mg |
| GL0498-200ug | Z-Leu-Leu-Leu-B(OH)2 | 179324-22-2 | 200ug |
| GL0498-1mg | Z-Leu-Leu-Leu-B(OH)2 | 179324-22-2 | 1mg |
| GK6034-1mg | Z-Leu-Leu-Norvalinal | 133407-86-0 | 1mg |
| GK6034-5mg | Z-Leu-Leu-Norvalinal | 133407-86-0 | 5mg |
| GL3344-1mg | Z-Leu-Leu-Phe-CHO | 133429-58-0 | 1mg |
| GL3344-5mg | Z-Leu-Leu-Phe-CHO | 133429-58-0 | 5mg |
| GM1281-1g | Z-Orn-OH | 2640-58-6 | 1g |
| GM1281-5g | Z-Orn-OH | 2640-58-6 | 5g |
| GM1281-10g | Z-Orn-OH | 2640-58-6 | 10g |
| GW1865-5mg | Z-Phe-Arg-AFC | 93753-73-2 | 5mg |
| GW1865-25mg | Z-Phe-Arg-AFC | 93753-73-2 | 25mg |
| GM8963-5g | Z-Pyr-OH | 32159-21-0 | 5g |
| GM8963-25g | Z-Pyr-OH | 32159-21-0 | 25g |
| GM0046-25g | Z-Tyr(tBu)-OH dicyclohexylammonium salt | 16879-90-6 | 25g |
| GL1523-1mg | Z-VAD-FMK, cell permeable | 187389-52-2 | 1mg |
| GL1523-5mg | Z-VAD-FMK, cell permeable | 187389-52-2 | 5mg |
| GW5750-5mg | Z-Val-Leu-Arg-AMC | 5mg | |
| GW5750-25mg | Z-Val-Leu-Arg-AMC | 25mg | |
| GL3755-500ug | Z-VRPR-FMK | 1381885-28-4 | 500ug |
| GL3755-1mg | Z-VRPR-FMK | 1381885-28-4 | 1mg |
| GP6218-50mg | Zafirlukast | 107753-78-6 | 50mg |
| GP6218-100mg | Zafirlukast | 107753-78-6 | 100mg |
| GP6218-250mg | Zafirlukast | 107753-78-6 | 250mg |
| GC5399-250mg | Zanamivir hydrate | 139110-80-8 | 250mg |
| GK8444-5mg | Zearalenone | 17924-92-4 | 5mg |
| GK8444-25mg | Zearalenone | 17924-92-4 | 25mg |
| GN9299-50mg | Zeatin riboside | 28542-78-1 | 50mg |
| GK4898-1g | Zeaxanthin | 144-68-3 | 1g |
| GK4898-5g | Zeaxanthin | 144-68-3 | 5g |
| GX2761-100g | Zein | 9010-66-6 | 100g |
| GX2761-500g | Zein | 9010-66-6 | 500g |
| GX2761-1kg | Zein | 9010-66-6 | 1kg |
| GX2761-5kg | Zein | 9010-66-6 | 5kg |
| GL7669-250ug | Zelkovamycin | 221197-33-7 | 250ug |
| GL7669-1mg | Zelkovamycin | 221197-33-7 | 1mg |
| GL7258-10mg | Zerumbone | 471-05-6 | 10mg |
| GL7258-50mg | Zerumbone | 471-05-6 | 50mg |
| GC2870-5mg | Zidovudine O-β-D-glucuronide | 117675-21-5 | 5mg |
| GC2870-10mg | Zidovudine O-β-D-glucuronide | 117675-21-5 | 10mg |
| GC2870-25mg | Zidovudine O-β-D-glucuronide | 117675-21-5 | 25mg |
| GC2870-50mg | Zidovudine O-β-D-glucuronide | 117675-21-5 | 50mg |
| GT0168-500ml | Ziehl-Neelsen carbol-fuchsin solution (0.3%) | 500ml | |
| GT0168-1l | Ziehl-Neelsen carbol-fuchsin solution (0.3%) | 1l | |
| GP5873-10mg | Zileuton | 111406-87-2 | 10mg |
| GP5873-25mg | Zileuton | 111406-87-2 | 25mg |
| GP5873-50mg | Zileuton | 111406-87-2 | 50mg |
| GX0226-250g | Zinc acetate dihydrate | 5970-45-6 | 250g |
| GX0226-1kg | Zinc acetate dihydrate | 5970-45-6 | 1kg |
| GX0226-5kg | Zinc acetate dihydrate | 5970-45-6 | 5kg |
| GX6789-250g | Zinc acetate dihydrate, 99%, Ph. Eur. grade | 5970-45-6 | 250g |
| GX6789-1kg | Zinc acetate dihydrate, 99%, Ph. Eur. grade | 5970-45-6 | 1kg |
| GX1609-10g | Zinc acetate hydrate, 99.999% | 5970-45-6 | 10g |
| GX1609-25g | Zinc acetate hydrate, 99.999% | 5970-45-6 | 25g |
| GX7384-5g | Zinc arsenide, 99.999% | 12044-55-2 | 5g |
| GX8264-10g | Zinc arsenide, 99.999% | 12006-40-5 | 10g |
| GX0089-100g | Zinc bromide, anhydrous, 98% | 7699-45-8 | 100g |
| GX0089-500g | Zinc bromide, anhydrous, 98% | 7699-45-8 | 500g |
| GX0089-1kg | Zinc bromide, anhydrous, 98% | 7699-45-8 | 1kg |
| GX2118-25g | Zinc bromide, anhydrous, 99.999% | 7699-45-8 | 25g |
| GX9817-1kg | Zinc bromide, anhydrous, 99% | 7699-45-8 | 1kg |
| GK2449-250g | Zinc carbonate basic | 5263-02-5 | 250g |
| GK2449-1kg | Zinc carbonate basic | 5263-02-5 | 1kg |
| GX3170-10g | Zinc chloride-2-Tetrahydrofuran | 10g | |
| GX3170-25g | Zinc chloride-2-Tetrahydrofuran | 25g | |
| GK8554-100g | Zinc chloride, anhydrous | 7646-85-7 | 100g |
| GK8554-250g | Zinc chloride, anhydrous | 7646-85-7 | 250g |
| GK8554-500g | Zinc chloride, anhydrous | 7646-85-7 | 500g |
| GK8554-1kg | Zinc chloride, anhydrous | 7646-85-7 | 1kg |
| GK8554-5kg | Zinc chloride, anhydrous | 7646-85-7 | 5kg |
| GX7890-250g | Zinc chloride, anhydrous, ACS | 7646-85-7 | 250g |
| GX7890-1kg | Zinc chloride, anhydrous, ACS | 7646-85-7 | 1kg |
| GK8880-1kg | Zinc chloride, anhydrous, USP grade | 7646-85-7 | 1kg |
| GE1507-1kg | Zinc citrate dihydrate | 5990-32-9 | 1kg |
| GE2021-100g | Zinc citrate trihydrate | 546-46-3 | 100g |
| GE2021-250g | Zinc citrate trihydrate | 546-46-3 | 250g |
| GE2021-500g | Zinc citrate trihydrate | 546-46-3 | 500g |
| GE2021-1kg | Zinc citrate trihydrate | 546-46-3 | 1kg |
| GX1602-1g | Zinc cyclohexanebutyrate, AAS | 38582-18-2 | 1g |
| GX6838-10g | Zinc fluoride, anhydrous, 99.999% | 7783-49-5 | 10g |
| GX6838-25g | Zinc fluoride, anhydrous, 99.999% | 7783-49-5 | 25g |
| GX1212-100g | Zinc fluoride, anhydrous, 99% | 7783-49-5 | 100g |
| GX4786-25x25mm | Zinc Foil 0.1mm, 99.99+% | 7740-66-6 | 25x25mm |
| GX4786-50x50mm | Zinc Foil 0.1mm, 99.99+% | 7740-66-6 | 50x50mm |
| GX4786-100x100mm | Zinc Foil 0.1mm, 99.99+% | 7740-66-6 | 100x100mm |
| GX4786-100x200mm | Zinc Foil 0.1mm, 99.99+% | 7740-66-6 | 100x200mm |
| GX5686-50x50mm | Zinc Foil 0.25 mm, 99.994% | 7740-66-6 | 50x50mm |
| GX5686-25x100mm | Zinc Foil 0.25 mm, 99.994% | 7740-66-6 | 25x100mm |
| GX5686-100x100mm | Zinc Foil 0.25 mm, 99.994% | 7740-66-6 | 100x100mm |
| GX5686-100x200mm | Zinc Foil 0.25 mm, 99.994% | 7740-66-6 | 100x200mm |
| GX0916-100x100mm | Zinc Foil 0.5mm, 99.99% | 7440-66-6 | 100x100mm |
| GX0916-100x200mm | Zinc Foil 0.5mm, 99.99% | 7440-66-6 | 100x200mm |
| GX7331-100x100mm | Zinc Foil 1.0mm, 99.99% | 7440-66-6 | 100x100mm |
| GX7331-100x200mm | Zinc Foil 1.0mm, 99.99% | 7440-66-6 | 100x200mm |
| GK3576-100g | Zinc formaldehyde sulfoxylate | 24887-06-7 | 100g |
| GE5157-1l | Zinc Formalin Fixative | 1l | |
| GE5157-2500ml | Zinc Formalin Fixative | 2500ml | |
| GE0055-250ml | Zinc Formalin Fixative, 10X solution | 250ml | |
| GE0055-500ml | Zinc Formalin Fixative, 10X solution | 500ml | |
| GX1482-50g | Zinc Granules, 1-5 mm, 99.999% | 7440-66-6 | 50g |
| GX1482-250g | Zinc Granules, 1-5 mm, 99.999% | 7440-66-6 | 250g |
| GX6924-100g | Zinc hexafluorosilicate hydrate, 98% | 18433-42-6 | 100g |
| GX1001-100g | Zinc Ingot, 99.99% | 7440-66-6 | 100g |
| GX1001-500g | Zinc Ingot, 99.99% | 7440-66-6 | 500g |
| GX2955-100g | Zinc iodide, 98% | 10139-47-6 | 100g |
| GX7251-5g | Zinc iodide, 99.999% | 10139-47-6 | 5g |
| GX7251-25g | Zinc iodide, 99.999% | 10139-47-6 | 25g |
| GX0843-100g | Zinc nitrate hexahydrate | 10196-18-6 | 100g |
| GX0843-250g | Zinc nitrate hexahydrate | 10196-18-6 | 250g |
| GX0843-500g | Zinc nitrate hexahydrate | 10196-18-6 | 500g |
| GX0843-1kg | Zinc nitrate hexahydrate | 10196-18-6 | 1kg |
| GX0843-5kg | Zinc nitrate hexahydrate | 10196-18-6 | 5kg |
| GX9610-1kg | Zinc oxide, 99.5%, Ph. Eur., USP grade | 1314-13-2 | 1kg |
| GX2362-250g | Zinc oxide, 99.9% | 1314-13-2 | 250g |
| GX4992-10g | Zinc oxide, 99.999% | 1314-13-2 | 10g |
| GX4992-50g | Zinc oxide, 99.999% | 1314-13-2 | 50g |
| GK2332-1kg | Zinc oxide, 99% | 1314-13-2 | 1kg |
| GK2332-5kg | Zinc oxide, 99% | 1314-13-2 | 5kg |
| GX9146-50g | Zinc oxide, Nanopowder, 99.5% | 1314-13-2 | 50g |
| GX9146-100g | Zinc oxide, Nanopowder, 99.5% | 1314-13-2 | 100g |
| GX9146-250g | Zinc oxide, Nanopowder, 99.5% | 1314-13-2 | 250g |
| GX7801-50g | Zinc oxide, Nanopowder, 99.9% | 1314-13-2 | 50g |
| GX7801-100g | Zinc oxide, Nanopowder, 99.9% | 1314-13-2 | 100g |
| GX2313-100g | Zinc Pellets 6 x 6 mm, 99.95% | 7440-66-6 | 100g |
| GX4774-1kg | Zinc phosphate dihydrate | 7779-90-0 | 1kg |
| GX4774-5kg | Zinc phosphate dihydrate | 7779-90-0 | 5kg |
| GX0790-250g | Zinc Pieces max. 20 mm, 99.995+% | 7440-66-6 | 250g |
| GX0790-1kg | Zinc Pieces max. 20 mm, 99.995+% | 7440-66-6 | 1kg |
| GX4205-1kg | Zinc powder, max. 65 micron, 98% | 7440-66-6 | 1kg |
| GX1328-50mm | Zinc Rod 10 mm, 99.9999% | 7440-66-6 | 50mm |
| GX1328-250mm | Zinc Rod 10 mm, 99.9999% | 7440-66-6 | 250mm |
| GX5998-100mm | Zinc Rod 6 mm, 99.99% | 7440-66-6 | 100mm |
| GX1595-50mm | Zinc Rod 8 mm, 99.999% | 7440-66-6 | 50mm |
| GX1595-250mm | Zinc Rod 8 mm, 99.999% | 7440-66-6 | 250mm |
| GX6361-50mm | Zinc Rod 8 mm, 99.9999% | 7440-66-6 | 50mm |
| GX6361-250mm | Zinc Rod 8 mm, 99.9999% | 7440-66-6 | 250mm |
| GX7885-5g | Zinc selenide, 99.999% | 1315-09-9 | 5g |
| GX7885-25g | Zinc selenide, 99.999% | 1315-09-9 | 25g |
| GX6548-1kg | Zinc stearate | 557-05-1 | 1kg |
| GK7296-100g | Zinc sulfate heptahydrate | 7446-20-0 | 100g |
| GK7296-250g | Zinc sulfate heptahydrate | 7446-20-0 | 250g |
| GK7296-500g | Zinc sulfate heptahydrate | 7446-20-0 | 500g |
| GK7296-1kg | Zinc sulfate heptahydrate | 7446-20-0 | 1kg |
| GK7296-5kg | Zinc sulfate heptahydrate | 7446-20-0 | 5kg |
| GX8355-500g | Zinc sulfate heptahydrate, 99.5+%, ACS | 7446-20-0 | 500g |
| GX5114-25g | Zinc sulfate heptahydrate, 99.999% | 7446-20-0 | 25g |
| GK8729-100g | Zinc sulfate heptahydrate, EP grade | 7446-20-0 | 100g |
| GK8729-250g | Zinc sulfate heptahydrate, EP grade | 7446-20-0 | 250g |
| GK8729-500g | Zinc sulfate heptahydrate, EP grade | 7446-20-0 | 500g |
| GK8729-1kg | Zinc sulfate heptahydrate, EP grade | 7446-20-0 | 1kg |
| GK8729-5kg | Zinc sulfate heptahydrate, EP grade | 7446-20-0 | 5kg |
| GX1311-1kg | Zinc sulfate monohydrate | 7446-19-7 | 1kg |
| GX1311-5kg | Zinc sulfate monohydrate | 7446-19-7 | 5kg |
| GX6888-1kg | Zinc sulfate monohydrate, USP grade | 7446-19-7 | 1kg |
| GX3458-25g | Zinc sulfide, 99.9% | 1314-98-3 | 25g |
| GX3458-100g | Zinc sulfide, 99.9% | 1314-98-3 | 100g |
| GX1917-25g | Zinc sulfide, 99.99% | 1314-98-3 | 25g |
| GX1917-100g | Zinc sulfide, 99.99% | 1314-98-3 | 100g |
| GX6915-50g | Zinc telluride, 99.999% | 1315-11-3 | 50g |
| GX8502-100g | Zinc titanate, 99.9% | 12036-43-0 | 100g |
| GX2338-10g | Zinc tungstate, 99.9% | 13597-56-3 | 10g |
| GX2338-25g | Zinc tungstate, 99.9% | 13597-56-3 | 25g |
| GX2338-50g | Zinc tungstate, 99.9% | 13597-56-3 | 50g |
| GK1973-100g | Zinc undecylenate | 557-08-4 | 100g |
| GK1973-500g | Zinc undecylenate | 557-08-4 | 500g |
| GX7975-50m | Zinc Wire 0.25 mm diameter, 99.9+% | 7440-66-6 | 50m |
| GX8111-50cm | Zinc Wire 1.0 mm diameter, 99.997% | 7440-66-6 | 50cm |
| GX7617-2m | Zinc Wire 2.0 mm diameter, 99.99% | 7440-66-6 | 2m |
| GX7617-10m | Zinc Wire 2.0 mm diameter, 99.99% | 7440-66-6 | 10m |
| GX5581-10g | Zinc-thd, 99.9% | 14363-14-5 | 10g |
| GX0963-100g | Zinc(II) 2,4-pentanedionate | 14024-63-6 | 100g |
| GK0303-1g | Zincon sodium salt | 62625-22-3 | 1g |
| GK0303-5g | Zincon sodium salt | 62625-22-3 | 5g |
| GK0303-10g | Zincon sodium salt | 62625-22-3 | 10g |
| GK0303-25g | Zincon sodium salt | 62625-22-3 | 25g |
| GW9151-20mg | Zinpyr-1 | 288574-78-7 | 20mg |
| GW9151-125mg | Zinpyr-1 | 288574-78-7 | 125mg |
| GK8490-1mg | Zinquin | 151606-29-0 | 1mg |
| GK8490-5mg | Zinquin | 151606-29-0 | 5mg |
| GK8490-25mg | Zinquin | 151606-29-0 | 25mg |
| GW0052-1mg | Zinquin ethyl ester | 181530-09-6 | 1mg |
| GW0052-5mg | Zinquin ethyl ester | 181530-09-6 | 5mg |
| GW0052-50mg | Zinquin ethyl ester | 181530-09-6 | 50mg |
| GP6084-250mg | Ziprasidone hydrochloride monohydrate | 138982-67-9 | 250mg |
| GP6084-1g | Ziprasidone hydrochloride monohydrate | 138982-67-9 | 1g |
| GX7510-100g | Zirconium 2,4-pentanedionate, 98+% | 17501-44-9 | 100g |
| GX0433-100g | Zirconium boride, 99+% | 12045-64-6 | 100g |
| GX2462-100g | Zirconium carbide | 12070-14-3 | 100g |
| GX2462-500g | Zirconium carbide | 12070-14-3 | 500g |
| GX6681-250g | Zirconium chloride, 98% | 10026-11-6 | 250g |
| GX1232-1kg | Zirconium dichloride oxide hydrate, 98% | 13520-92-8 | 1kg |
| GX1232-500g | Zirconium dichloride oxide hydrate, 98% | 13520-92-8 | 500g |
| GX0293-100g | Zirconium dichloride oxide octahydrate, 98+% | 13520-92-8 | 100g |
| GX0293-500g | Zirconium dichloride oxide octahydrate, 98+% | 13520-92-8 | 500g |
| GX4751-100g | Zirconium dinitrate oxide hydrate, 99% | 14985-18-3 | 100g |
| GX4751-500g | Zirconium dinitrate oxide hydrate, 99% | 14985-18-3 | 500g |
| GX6719-50g | Zirconium ethoxide, 99.99% | 18267-08-8 | 50g |
| GX8945-100x100mm | Zirconium Foil 0.025 mm, 99.7% | 7440-67-7 | 100x100mm |
| GX8945-200x200mm | Zirconium Foil 0.025 mm, 99.7% | 7440-67-7 | 200x200mm |
| GX3385-100x100mm | Zirconium Foil 0.25 mm, 99.8% | 7440-67-7 | 100x100mm |
| GX3385-150x150mm | Zirconium Foil 0.25 mm, 99.8% | 7440-67-7 | 150x150mm |
| GX1630-50x50mm | Zirconium Foil 0.5 mm, 99.8% | 7440-67-7 | 50x50mm |
| GX1630-100x100mm | Zirconium Foil 0.5 mm, 99.8% | 7440-67-7 | 100x100mm |
| GX0507-50x50mm | Zirconium Foil 1.0 mm, 99.8% | 7440-67-7 | 50x50mm |
| GX0507-100x100mm | Zirconium Foil 1.0 mm, 99.8% | 7440-67-7 | 100x100mm |
| GX5634-100g | Zirconium hydride, 99.7% | 7704-99-6 | 100g |
| GX1128-250g | Zirconium n-butoxide | 1071-76-7 | 250g |
| GX1128-1kg | Zirconium n-butoxide | 1071-76-7 | 1kg |
| GX6868-25g | Zirconium nitride, 99% | 25658-42-8 | 25g |
| GX5312-1m | Zirconium Rod 2 mm diameter, 97% | 7440-67-7 | 1m |
| GX3706-5cm | Zirconium Rod 6.2 mm diameter, 99.7% | 7440-67-7 | 5cm |
| GX3706-10cm | Zirconium Rod 6.2 mm diameter, 99.7% | 7440-67-7 | 10cm |
| GX8627-50g | Zirconium silicide, 99.5% | 12039-90-6 | 50g |
| GX4921-200g | Zirconium Sponge 3-6 mm, 99.8% | 7440-67-7 | 200g |
| GX1784-25g | Zirconium t-butoxide, 99.99% | 2081-12-1 | 25g |
| GX2203-2m | Zirconium Wire 1.0 mm diameter, 99+% | 7440-67-7 | 2m |
| GX9348-10g | Zirconium(IV) carbide Nanopowder, Hf-content ~3%, 97 % | 12070-14-3 | 10g |
| GX3347-10g | Zirconium(IV) carbide Nanopowder, Hf-content ~3%, 97 % | 12070-14-3 | 10g |
| GX9348-25g | Zirconium(IV) carbide Nanopowder, Hf-content ~3%, 97 % | 12070-14-3 | 25g |
| GX3347-25g | Zirconium(IV) carbide Nanopowder, Hf-content ~3%, 97 % | 12070-14-3 | 25g |
| GX9348-50g | Zirconium(IV) carbide Nanopowder, Hf-content ~3%, 97 % | 12070-14-3 | 50g |
| GX3347-50g | Zirconium(IV) carbide Nanopowder, Hf-content ~3%, 97 % | 12070-14-3 | 50g |
| GX9348-100g | Zirconium(IV) carbide Nanopowder, Hf-content ~3%, 97 % | 12070-14-3 | 100g |
| GX3347-100g | Zirconium(IV) carbide Nanopowder, Hf-content ~3%, 97 % | 12070-14-3 | 100g |
| GX9401-25g | Zirconium(IV) oxide + 3 mol-% Y2O3-Nano Powder, 99.9% | 1314-23-4 | 25g |
| GX9401-100g | Zirconium(IV) oxide + 3 mol-% Y2O3-Nano Powder, 99.9% | 1314-23-4 | 100g |
| GX9401-250g | Zirconium(IV) oxide + 3 mol-% Y2O3-Nano Powder, 99.9% | 1314-23-4 | 250g |
| GX1650-25g | Zirconium(IV) oxide + 8 mol-% Y2O3-Nano Powder, 99.9% | 1314-23-4 | 25g |
| GX1650-100g | Zirconium(IV) oxide + 8 mol-% Y2O3-Nano Powder, 99.9% | 1314-23-4 | 100g |
| GX0728-100g | Zirconium(IV) oxide 5 micron, 99.9% | 1314-23-4 | 100g |
| GX0728-500g | Zirconium(IV) oxide 5 micron, 99.9% | 1314-23-4 | 500g |
| GX0180-500g | Zirconium(IV) oxide 5 micron, 99% | 1314-23-4 | 500g |
| GX2049-100g | Zirconium(IV) oxide, 99.7% | 1314-23-4 | 100g |
| GX9883-25g | Zirconium(IV) oxide, 99.9+% | 1314-23-4 | 25g |
| GX9883-100g | Zirconium(IV) oxide, 99.9+% | 1314-23-4 | 100g |
| GX9587-5g | Zirconium(IV) oxide, 99.995% | 1314-23-4 | 5g |
| GX9587-25g | Zirconium(IV) oxide, 99.995% | 1314-23-4 | 25g |
| GX9587-100g | Zirconium(IV) oxide, 99.995% | 1314-23-4 | 100g |
| GX9411-5g | Zirconium(IV) oxide, nanopowder, 40nm, 99% | 1314-23-4 | 5g |
| GX9411-25g | Zirconium(IV) oxide, nanopowder, 40nm, 99% | 1314-23-4 | 25g |
| GX1780-100g | Zirconium(IV) oxychloride octahydrate | 13520-92-8 | 100g |
| GX1780-250g | Zirconium(IV) oxychloride octahydrate | 13520-92-8 | 250g |
| GX1780-500g | Zirconium(IV) oxychloride octahydrate | 13520-92-8 | 500g |
| GW8864-5mg | ZnAF-1 | 321859-09-0 | 5mg |
| GW8864-125mg | ZnAF-1 | 321859-09-0 | 125mg |
| GW7372-1mg | ZnAF-1 DA | 1mg | |
| GW7372-5mg | ZnAF-1 DA | 5mg | |
| GW7372-25mg | ZnAF-1 DA | 25mg | |
| GW4970-1mg | ZnAF-1 DA Solution | 1mg | |
| GW1582-1mg | ZnAF-1 Solution | 321859-09-0 | 1mg |
| GW6478-1mg | ZnAF-1F | 443302-08-7 | 1mg |
| GW6478-5mg | ZnAF-1F | 443302-08-7 | 5mg |
| GW6478-25mg | ZnAF-1F | 443302-08-7 | 25mg |
| GW0290-1mg | ZnAF-1F DA | 1mg | |
| GW0290-5mg | ZnAF-1F DA | 5mg | |
| GW2587-1mg | ZnAF-1F DA Solution | 1mg | |
| GW8530-1mg | ZnAF-1F Solution | 443302-08-7 | 1mg |
| GW8223-1mg | ZnAF-2 | 321859-11-4 | 1mg |
| GW8223-5mg | ZnAF-2 | 321859-11-4 | 5mg |
| GW8223-25mg | ZnAF-2 | 321859-11-4 | 25mg |
| GW0414-1mg | ZnAF-2 DA | 357339-96-9 | 1mg |
| GW0414-5mg | ZnAF-2 DA | 357339-96-9 | 5mg |
| GW3437-1mg | ZnAF-2 DA Solution | 357339-96-9 | 1mg |
| GW9491-1mg | ZnAF-2 Solution | 321859-11-4 | 1mg |
| GW5940-1mg | ZnAF-2F | 443302-09-8 | 1mg |
| GW5940-5mg | ZnAF-2F | 443302-09-8 | 5mg |
| GW5940-25mg | ZnAF-2F | 443302-09-8 | 25mg |
| GW3623-1mg | ZnAF-2F DA | 443302-10-1 | 1mg |
| GW3623-5mg | ZnAF-2F DA | 443302-10-1 | 5mg |
| GW6359-1mg | ZnAF-2F DA Solution | 443302-10-1 | 1mg |
| GW9813-1mg | ZnAF-2F Solution | 443302-09-8 | 1mg |
| GP9021-25mg | Zofenopril calcium salt | 81938-43-4 | 25mg |
| GP9021-100mg | Zofenopril calcium salt | 81938-43-4 | 100mg |
| GP8685-250mg | Zoledronic acid monohydrate | 165800-06-6 | 250mg |
| GP8685-1g | Zoledronic acid monohydrate | 165800-06-6 | 1g |
| GC7379-1mg | Zomepirac acyl-β-D-glucuronide | 75871-31-7 | 1mg |
| GC7379-2mg | Zomepirac acyl-β-D-glucuronide | 75871-31-7 | 2mg |
| GC7379-5mg | Zomepirac acyl-β-D-glucuronide | 75871-31-7 | 5mg |
| GC7379-10mg | Zomepirac acyl-β-D-glucuronide | 75871-31-7 | 10mg |
| GW7312-100mg | Zoxamide | 156052-68-5 | 100mg |
| GW7312-500mg | Zoxamide | 156052-68-5 | 500mg |
| GW6410-1mg | ZSTK474 | 475110-96-4 | 1mg |
| GW6410-5mg | ZSTK474 | 475110-96-4 | 5mg |
| GW6410-10mg | ZSTK474 | 475110-96-4 | 10mg |
| GC7489-100mg | α-D-Cellobiosyl fluoride heptaacetate | 14227-64-6 | 100mg |
| GC7489-250mg | α-D-Cellobiosyl fluoride heptaacetate | 14227-64-6 | 250mg |
| GC7489-500mg | α-D-Cellobiosyl fluoride heptaacetate | 14227-64-6 | 500mg |
| GC7489-1g | α-D-Cellobiosyl fluoride heptaacetate | 14227-64-6 | 1g |
| GC7628-1g | α-D-Lactosyl fluoride | 7792-96-3 | 1g |
| GC7628-2g | α-D-Lactosyl fluoride | 7792-96-3 | 2g |
| GC7628-5g | α-D-Lactosyl fluoride | 7792-96-3 | 5g |
| GC7628-10g | α-D-Lactosyl fluoride | 7792-96-3 | 10g |
| GC8259-25mg | α-D-Xylopyranosyl azide | 100842-21-5 | 25mg |
| GC8259-50mg | α-D-Xylopyranosyl azide | 100842-21-5 | 50mg |
| GC8259-100mg | α-D-Xylopyranosyl azide | 100842-21-5 | 100mg |
| GC8259-250mg | α-D-Xylopyranosyl azide | 100842-21-5 | 250mg |
| GC7443-250mg | β-D-Cellobiosyl azide | 69194-62-3 | 250mg |
| GC7443-500mg | β-D-Cellobiosyl azide | 69194-62-3 | 500mg |
| GC7443-1g | β-D-Cellobiosyl azide | 69194-62-3 | 1g |
| GC7443-2g | β-D-Cellobiosyl azide | 69194-62-3 | 2g |
| GC3513-1g | β-D-Cellobiosyl azide heptaacetate | 33012-50-9 | 1g |
| GC3513-2g | β-D-Cellobiosyl azide heptaacetate | 33012-50-9 | 2g |
| GC3513-5g | β-D-Cellobiosyl azide heptaacetate | 33012-50-9 | 5g |
| GC3513-10g | β-D-Cellobiosyl azide heptaacetate | 33012-50-9 | 10g |
| GC7217-100mg | β-D-Cellobiosyl fluoride heptaacetate | 440-03-9 | 100mg |
| GC7217-250mg | β-D-Cellobiosyl fluoride heptaacetate | 440-03-9 | 250mg |
| GC7217-500mg | β-D-Cellobiosyl fluoride heptaacetate | 440-03-9 | 500mg |
| GC7217-1g | β-D-Cellobiosyl fluoride heptaacetate | 440-03-9 | 1g |
| GC1608-250mg | β-D-Gal-PEG3-azide tetraacetate | 126765-25-1 | 250mg |
| GC1608-500mg | β-D-Gal-PEG3-azide tetraacetate | 126765-25-1 | 500mg |
| GC1608-1g | β-D-Gal-PEG3-azide tetraacetate | 126765-25-1 | 1g |
| GC1608-2g | β-D-Gal-PEG3-azide tetraacetate | 126765-25-1 | 2g |
| GC7196-50mg | β-D-Gal-PEG4-azide tetraacetate | 153252-44-9 | 50mg |
| GC7196-100mg | β-D-Gal-PEG4-azide tetraacetate | 153252-44-9 | 100mg |
| GC7196-250mg | β-D-Gal-PEG4-azide tetraacetate | 153252-44-9 | 250mg |
| GC7196-500mg | β-D-Gal-PEG4-azide tetraacetate | 153252-44-9 | 500mg |
| GC9062-50mg | β-D-Galactopyranosyl isomaltol | 82756-28-3 | 50mg |
| GC9062-100mg | β-D-Galactopyranosyl isomaltol | 82756-28-3 | 100mg |
| GC9062-250mg | β-D-Galactopyranosyl isomaltol | 82756-28-3 | 250mg |
| GC9062-500mg | β-D-Galactopyranosyl isomaltol | 82756-28-3 | 500mg |
| GC6873-5mg | β-D-GalNAc-PEG4-azide | 879004-92-9 | 5mg |
| GC6873-10mg | β-D-GalNAc-PEG4-azide | 879004-92-9 | 10mg |
| GC6873-25mg | β-D-GalNAc-PEG4-azide | 879004-92-9 | 25mg |
| GC6873-50mg | β-D-GalNAc-PEG4-azide | 879004-92-9 | 50mg |
| GC3658-5mg | β-D-Glucopyranosyl glycolaldehyde | 136670-93-4 | 5mg |
| GC3658-10mg | β-D-Glucopyranosyl glycolaldehyde | 136670-93-4 | 10mg |
| GC3658-25mg | β-D-Glucopyranosyl glycolaldehyde | 136670-93-4 | 25mg |
| GC3658-50mg | β-D-Glucopyranosyl glycolaldehyde | 136670-93-4 | 50mg |
| GC6092-1mg | β-D-Glucopyranosyl-(1→2)-D-erythrofuranose | 99174-81-9 | 1mg |
| GC6092-2mg | β-D-Glucopyranosyl-(1→2)-D-erythrofuranose | 99174-81-9 | 2mg |
| GC6092-5mg | β-D-Glucopyranosyl-(1→2)-D-erythrofuranose | 99174-81-9 | 5mg |
| GC6092-10mg | β-D-Glucopyranosyl-(1→2)-D-erythrofuranose | 99174-81-9 | 10mg |
| GC2653-5g | β-D-Glucosamine Pentaacetate | 7772-79-4 | 5g |
| GC2653-10g | β-D-Glucosamine Pentaacetate | 7772-79-4 | 10g |
| GC2653-25g | β-D-Glucosamine Pentaacetate | 7772-79-4 | 25g |
| GC2653-50g | β-D-Glucosamine Pentaacetate | 7772-79-4 | 50g |
| GC5202-10mg | β-D-Lac-PEG3-azide heptaacetate | 153253-42-0 | 10mg |
| GC5202-25mg | β-D-Lac-PEG3-azide heptaacetate | 153253-42-0 | 25mg |
| GC5202-50mg | β-D-Lac-PEG3-azide heptaacetate | 153253-42-0 | 50mg |
| GC5202-100mg | β-D-Lac-PEG3-azide heptaacetate | 153253-42-0 | 100mg |
| GC5202-250mg | β-D-Lac-PEG3-azide heptaacetate | 153253-42-0 | 250mg |
| GC3625-2mg | β-D-Lactopyranosylphenyl isothiocyanate | 96324-93-5 | 2mg |
| GC3625-5mg | β-D-Lactopyranosylphenyl isothiocyanate | 96324-93-5 | 5mg |
| GC3625-10mg | β-D-Lactopyranosylphenyl isothiocyanate | 96324-93-5 | 10mg |
| GC3625-25mg | β-D-Lactopyranosylphenyl isothiocyanate | 96324-93-5 | 25mg |
| GC3625-50mg | β-D-Lactopyranosylphenyl isothiocyanate | 96324-93-5 | 50mg |
| GC2801-100mg | β-D-Maltosyl azide | 51970-30-0 | 100mg |
| GC2801-250mg | β-D-Maltosyl azide | 51970-30-0 | 250mg |
| GC2801-500mg | β-D-Maltosyl azide | 51970-30-0 | 500mg |
| GC2801-1g | β-D-Maltosyl azide | 51970-30-0 | 1g |
| GC3126-100mg | β-D-Xylopyranosyl azide | 51368-20-8 | 100mg |
| GC3126-250mg | β-D-Xylopyranosyl azide | 51368-20-8 | 250mg |
| GC3126-500mg | β-D-Xylopyranosyl azide | 51368-20-8 | 500mg |
| GC3126-1g | β-D-Xylopyranosyl azide | 51368-20-8 | 1g |
| GC3126-2g | β-D-Xylopyranosyl azide | 51368-20-8 | 2g |
| GK2475-1mg | β-Estradiol 17-(β-D-glucuronide) sodium salt | 15087-02-2 | 1mg |
| GK2475-5mg | β-Estradiol 17-(β-D-glucuronide) sodium salt | 15087-02-2 | 5mg |
| GK2475-10mg | β-Estradiol 17-(β-D-glucuronide) sodium salt | 15087-02-2 | 10mg |
| GK2475-25mg | β-Estradiol 17-(β-D-glucuronide) sodium salt | 15087-02-2 | 25mg |
| GL7868-1g | β-Hydroxyisovaleric acid | 625-08-1 | 1g |
| GC4787-50mg | β-L-Fucopyranosyl azide | 66347-26-0 | 50mg |
| GC4787-100mg | β-L-Fucopyranosyl azide | 66347-26-0 | 100mg |
| GC4787-250mg | β-L-Fucopyranosyl azide | 66347-26-0 | 250mg |
| GC4787-500mg | β-L-Fucopyranosyl azide | 66347-26-0 | 500mg |
| GC4787-1g | β-L-Fucopyranosyl azide | 66347-26-0 | 1g |
ELZ Analytik Vertrieb GmbH
Sirius Business Park
Gartenfelder Str. 29-37
Gebäude: 31, 1. OG
13599 Berlin
Ali Cürük
Geschäftsführer
+49 178 5115132
info@elz-analytik.com